summaryrefslogtreecommitdiff
path: root/board/freescale
diff options
context:
space:
mode:
Diffstat (limited to 'board/freescale')
-rw-r--r--board/freescale/common/Makefile83
-rw-r--r--board/freescale/common/arm_sleep.c130
-rw-r--r--board/freescale/common/cadmus.c79
-rw-r--r--board/freescale/common/cadmus.h37
-rw-r--r--board/freescale/common/cds_pci_ft.c17
-rw-r--r--board/freescale/common/cds_via.c95
-rw-r--r--board/freescale/common/cmd_esbc_validate.c86
-rw-r--r--board/freescale/common/eeprom.h33
-rw-r--r--board/freescale/common/emc2305.c61
-rw-r--r--board/freescale/common/emc2305.h22
-rw-r--r--board/freescale/common/fman.c88
-rw-r--r--board/freescale/common/fman.h14
-rw-r--r--board/freescale/common/fsl_chain_of_trust.c160
-rw-r--r--board/freescale/common/fsl_validate.c975
-rw-r--r--board/freescale/common/i2c_common.c34
-rw-r--r--board/freescale/common/i2c_common.h30
-rw-r--r--board/freescale/common/i2c_mux.c41
-rw-r--r--board/freescale/common/i2c_mux.h15
-rw-r--r--board/freescale/common/ics307_clk.c149
-rw-r--r--board/freescale/common/ics307_clk.h14
-rw-r--r--board/freescale/common/ls102xa_stream_id.c35
-rw-r--r--board/freescale/common/mc34vr500.c94
-rw-r--r--board/freescale/common/mmc.c49
-rw-r--r--board/freescale/common/mpc85xx_sleep.c97
-rw-r--r--board/freescale/common/ngpixis.c247
-rw-r--r--board/freescale/common/ngpixis.h60
-rw-r--r--board/freescale/common/ns_access.c241
-rw-r--r--board/freescale/common/p_corenet/Makefile7
-rw-r--r--board/freescale/common/p_corenet/law.c36
-rw-r--r--board/freescale/common/p_corenet/tlb.c161
-rw-r--r--board/freescale/common/pfuze.c172
-rw-r--r--board/freescale/common/pfuze.h17
-rw-r--r--board/freescale/common/qixis.c388
-rw-r--r--board/freescale/common/qixis.h190
-rw-r--r--board/freescale/common/sdhc_boot.c78
-rw-r--r--board/freescale/common/sgmii_riser.h16
-rw-r--r--board/freescale/common/sleep.h20
-rw-r--r--board/freescale/common/spl.h12
-rw-r--r--board/freescale/common/sys_eeprom.c648
-rw-r--r--board/freescale/common/via.h18
-rw-r--r--board/freescale/common/vid.c797
-rw-r--r--board/freescale/common/vid.h75
-rw-r--r--board/freescale/common/vsc3316_3308.h23
-rw-r--r--board/freescale/imx8mm_evk/Kconfig15
-rw-r--r--board/freescale/imx8mm_evk/MAINTAINERS7
-rw-r--r--board/freescale/imx8mm_evk/Makefile12
-rw-r--r--board/freescale/imx8mm_evk/imx8mm_evk.c68
-rw-r--r--board/freescale/imx8mm_evk/imximage-8mm-lpddr4-fspi.cfg7
-rw-r--r--board/freescale/imx8mm_evk/imximage-8mm-lpddr4.cfg8
-rw-r--r--board/freescale/imx8mm_evk/lpddr4_timing.c1848
-rw-r--r--board/freescale/imx8mm_evk/spl.c143
-rw-r--r--board/freescale/imx8mn_evk/Kconfig18
-rw-r--r--board/freescale/imx8mn_evk/MAINTAINERS7
-rw-r--r--board/freescale/imx8mn_evk/Makefile18
-rw-r--r--board/freescale/imx8mn_evk/ddr4_timing.c1054
-rw-r--r--board/freescale/imx8mn_evk/ddr4_timing_ld.c1056
-rw-r--r--board/freescale/imx8mn_evk/imx8mn_evk.c43
-rw-r--r--board/freescale/imx8mn_evk/imximage-8mn-ddr4.cfg9
-rw-r--r--board/freescale/imx8mn_evk/lpddr4_timing.c1587
-rw-r--r--board/freescale/imx8mn_evk/lpddr4_timing_ld.c1440
-rw-r--r--board/freescale/imx8mn_evk/spl.c139
-rw-r--r--board/freescale/imx8mp_evk/Kconfig15
-rw-r--r--board/freescale/imx8mp_evk/MAINTAINERS7
-rw-r--r--board/freescale/imx8mp_evk/Makefile12
-rw-r--r--board/freescale/imx8mp_evk/imx8mp_evk.c21
-rw-r--r--board/freescale/imx8mp_evk/imximage-8mp-lpddr4.cfg9
-rw-r--r--board/freescale/imx8mp_evk/lpddr4_timing.c2048
-rw-r--r--board/freescale/imx8mp_evk/spl.c145
-rw-r--r--board/freescale/imx8mq_evk/Kconfig15
-rw-r--r--board/freescale/imx8mq_evk/MAINTAINERS7
-rw-r--r--board/freescale/imx8mq_evk/Makefile12
-rw-r--r--board/freescale/imx8mq_evk/imx8mq_evk.c78
-rw-r--r--board/freescale/imx8mq_evk/lpddr4_timing.c1323
-rw-r--r--board/freescale/imx8mq_evk/lpddr4_timing_b0.c1190
-rw-r--r--board/freescale/imx8mq_evk/spl.c256
-rw-r--r--board/freescale/imx8qm_mek/Kconfig15
-rw-r--r--board/freescale/imx8qm_mek/MAINTAINERS6
-rw-r--r--board/freescale/imx8qm_mek/Makefile8
-rw-r--r--board/freescale/imx8qm_mek/README54
-rw-r--r--board/freescale/imx8qm_mek/imx8qm_mek.c137
-rw-r--r--board/freescale/imx8qm_mek/imximage.cfg18
-rw-r--r--board/freescale/imx8qm_mek/spl.c71
-rw-r--r--board/freescale/imx8qm_mek/uboot-container.cfg12
-rw-r--r--board/freescale/imx8qxp_mek/Kconfig15
-rw-r--r--board/freescale/imx8qxp_mek/MAINTAINERS7
-rw-r--r--board/freescale/imx8qxp_mek/Makefile8
-rw-r--r--board/freescale/imx8qxp_mek/imx8qxp_mek.c161
-rw-r--r--board/freescale/imx8qxp_mek/imximage.cfg20
-rw-r--r--board/freescale/imx8qxp_mek/spl.c89
-rw-r--r--board/freescale/imx8qxp_mek/uboot-container.cfg12
-rw-r--r--board/freescale/imx8ulp_evk/Kconfig12
-rw-r--r--board/freescale/imx8ulp_evk/MAINTAINERS6
-rw-r--r--board/freescale/imx8ulp_evk/Makefile12
-rw-r--r--board/freescale/imx8ulp_evk/imx8ulp_evk.c135
-rw-r--r--board/freescale/imx8ulp_evk/lpddr4_timing.c1158
-rw-r--r--board/freescale/imx8ulp_evk/lpddr4_timing_266.c1109
-rw-r--r--board/freescale/imx8ulp_evk/spl.c148
-rw-r--r--board/freescale/imx93_evk/Kconfig19
-rw-r--r--board/freescale/imx93_evk/MAINTAINERS7
-rw-r--r--board/freescale/imx93_evk/Makefile16
-rw-r--r--board/freescale/imx93_evk/imx93_evk.c70
-rw-r--r--board/freescale/imx93_evk/lpddr4x_timing.c1994
-rw-r--r--board/freescale/imx93_evk/lpddr4x_timing_ld.c1496
-rw-r--r--board/freescale/imx93_evk/spl.c146
-rw-r--r--board/freescale/imxrt1020-evk/Kconfig21
-rw-r--r--board/freescale/imxrt1020-evk/MAINTAINERS6
-rw-r--r--board/freescale/imxrt1020-evk/Makefile6
-rw-r--r--board/freescale/imxrt1020-evk/imximage.cfg35
-rw-r--r--board/freescale/imxrt1020-evk/imxrt1020-evk.c79
-rw-r--r--board/freescale/imxrt1050-evk/Kconfig21
-rw-r--r--board/freescale/imxrt1050-evk/MAINTAINERS7
-rw-r--r--board/freescale/imxrt1050-evk/Makefile6
-rw-r--r--board/freescale/imxrt1050-evk/imximage-nor.cfg41
-rw-r--r--board/freescale/imxrt1050-evk/imximage.cfg41
-rw-r--r--board/freescale/imxrt1050-evk/imxrt1050-evk.c84
-rw-r--r--board/freescale/imxrt1170-evk/Kconfig21
-rw-r--r--board/freescale/imxrt1170-evk/MAINTAINERS7
-rw-r--r--board/freescale/imxrt1170-evk/Makefile6
-rw-r--r--board/freescale/imxrt1170-evk/imximage.cfg31
-rw-r--r--board/freescale/imxrt1170-evk/imxrt1170-evk.c79
-rw-r--r--board/freescale/ls1012afrdm/Kconfig80
-rw-r--r--board/freescale/ls1012afrdm/MAINTAINERS17
-rw-r--r--board/freescale/ls1012afrdm/Makefile8
-rw-r--r--board/freescale/ls1012afrdm/README58
-rw-r--r--board/freescale/ls1012afrdm/eth.c124
-rw-r--r--board/freescale/ls1012afrdm/ls1012afrdm.c188
-rw-r--r--board/freescale/ls1012aqds/Kconfig72
-rw-r--r--board/freescale/ls1012aqds/MAINTAINERS8
-rw-r--r--board/freescale/ls1012aqds/Makefile8
-rw-r--r--board/freescale/ls1012aqds/README59
-rw-r--r--board/freescale/ls1012aqds/eth.c309
-rw-r--r--board/freescale/ls1012aqds/ls1012aqds.c287
-rw-r--r--board/freescale/ls1012aqds/ls1012aqds_pfe.h44
-rw-r--r--board/freescale/ls1012aqds/ls1012aqds_qixis.h34
-rw-r--r--board/freescale/ls1012ardb/Kconfig108
-rw-r--r--board/freescale/ls1012ardb/MAINTAINERS17
-rw-r--r--board/freescale/ls1012ardb/Makefile8
-rw-r--r--board/freescale/ls1012ardb/README97
-rw-r--r--board/freescale/ls1012ardb/eth.c171
-rw-r--r--board/freescale/ls1012ardb/ls1012ardb.c412
-rw-r--r--board/freescale/ls1021aiot/Kconfig15
-rw-r--r--board/freescale/ls1021aiot/MAINTAINERS7
-rw-r--r--board/freescale/ls1021aiot/Makefile6
-rw-r--r--board/freescale/ls1021aiot/README58
-rw-r--r--board/freescale/ls1021aiot/ls1021aiot.c203
-rw-r--r--board/freescale/ls1021aiot/ls102xa_pbi.cfg14
-rw-r--r--board/freescale/ls1021aiot/ls102xa_rcw_sd.cfg27
-rw-r--r--board/freescale/ls1021aiot/psci.S27
-rw-r--r--board/freescale/ls1021aqds/Kconfig15
-rw-r--r--board/freescale/ls1021aqds/MAINTAINERS14
-rw-r--r--board/freescale/ls1021aqds/Makefile9
-rw-r--r--board/freescale/ls1021aqds/README117
-rw-r--r--board/freescale/ls1021aqds/ddr.c199
-rw-r--r--board/freescale/ls1021aqds/ddr.h61
-rw-r--r--board/freescale/ls1021aqds/ls1021aqds.c456
-rw-r--r--board/freescale/ls1021aqds/ls1021aqds_qixis.h36
-rw-r--r--board/freescale/ls1021aqds/ls102xa_pbi.cfg12
-rw-r--r--board/freescale/ls1021aqds/ls102xa_rcw_nand.cfg7
-rw-r--r--board/freescale/ls1021aqds/ls102xa_rcw_sd_ifc.cfg14
-rw-r--r--board/freescale/ls1021aqds/ls102xa_rcw_sd_qspi.cfg14
-rw-r--r--board/freescale/ls1021aqds/psci.S32
-rw-r--r--board/freescale/ls1021atsn/Kconfig16
-rw-r--r--board/freescale/ls1021atsn/MAINTAINERS8
-rw-r--r--board/freescale/ls1021atsn/Makefile3
-rw-r--r--board/freescale/ls1021atsn/README.rst97
-rw-r--r--board/freescale/ls1021atsn/ls1021atsn.c263
-rw-r--r--board/freescale/ls1021atsn/ls102xa_pbi.cfg15
-rw-r--r--board/freescale/ls1021atsn/ls102xa_rcw_sd.cfg8
-rw-r--r--board/freescale/ls1021atwr/Kconfig15
-rw-r--r--board/freescale/ls1021atwr/MAINTAINERS12
-rw-r--r--board/freescale/ls1021atwr/Makefile8
-rw-r--r--board/freescale/ls1021atwr/README114
-rw-r--r--board/freescale/ls1021atwr/ls1021atwr.c752
-rw-r--r--board/freescale/ls1021atwr/ls102xa_pbi.cfg12
-rw-r--r--board/freescale/ls1021atwr/ls102xa_rcw_sd_ifc.cfg8
-rw-r--r--board/freescale/ls1021atwr/ls102xa_rcw_sd_qspi.cfg8
-rw-r--r--board/freescale/ls1021atwr/psci.S24
-rw-r--r--board/freescale/ls1028a/Kconfig47
-rw-r--r--board/freescale/ls1028a/MAINTAINERS26
-rw-r--r--board/freescale/ls1028a/Makefile8
-rw-r--r--board/freescale/ls1028a/README164
-rw-r--r--board/freescale/ls1028a/ddr.c20
-rw-r--r--board/freescale/ls1028a/ls1028a.c329
-rw-r--r--board/freescale/ls1043aqds/Kconfig15
-rw-r--r--board/freescale/ls1043aqds/MAINTAINERS14
-rw-r--r--board/freescale/ls1043aqds/Makefile11
-rw-r--r--board/freescale/ls1043aqds/README64
-rw-r--r--board/freescale/ls1043aqds/ddr.c145
-rw-r--r--board/freescale/ls1043aqds/ddr.h61
-rw-r--r--board/freescale/ls1043aqds/eth.c501
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds.c596
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds_pbi.cfg14
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds_qixis.h38
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds_rcw_nand.cfg7
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds_rcw_sd_ifc.cfg8
-rw-r--r--board/freescale/ls1043aqds/ls1043aqds_rcw_sd_qspi.cfg8
-rw-r--r--board/freescale/ls1043ardb/Kconfig16
-rw-r--r--board/freescale/ls1043ardb/MAINTAINERS13
-rw-r--r--board/freescale/ls1043ardb/Makefile10
-rw-r--r--board/freescale/ls1043ardb/README54
-rw-r--r--board/freescale/ls1043ardb/cpld.c177
-rw-r--r--board/freescale/ls1043ardb/cpld.h46
-rw-r--r--board/freescale/ls1043ardb/ddr.c254
-rw-r--r--board/freescale/ls1043ardb/ddr.h116
-rw-r--r--board/freescale/ls1043ardb/eth.c77
-rw-r--r--board/freescale/ls1043ardb/ls1043ardb.c415
-rw-r--r--board/freescale/ls1043ardb/ls1043ardb_pbi.cfg14
-rw-r--r--board/freescale/ls1043ardb/ls1043ardb_rcw_nand.cfg7
-rw-r--r--board/freescale/ls1043ardb/ls1043ardb_rcw_sd.cfg7
-rw-r--r--board/freescale/ls1046afrwy/Kconfig16
-rw-r--r--board/freescale/ls1046afrwy/MAINTAINERS8
-rw-r--r--board/freescale/ls1046afrwy/Makefile7
-rw-r--r--board/freescale/ls1046afrwy/README76
-rw-r--r--board/freescale/ls1046afrwy/ddr.c19
-rw-r--r--board/freescale/ls1046afrwy/eth.c118
-rw-r--r--board/freescale/ls1046afrwy/ls1046afrwy.c218
-rw-r--r--board/freescale/ls1046aqds/Kconfig15
-rw-r--r--board/freescale/ls1046aqds/MAINTAINERS14
-rw-r--r--board/freescale/ls1046aqds/Makefile11
-rw-r--r--board/freescale/ls1046aqds/README70
-rw-r--r--board/freescale/ls1046aqds/ddr.c130
-rw-r--r--board/freescale/ls1046aqds/ddr.h43
-rw-r--r--board/freescale/ls1046aqds/eth.c431
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds.c479
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds_pbi.cfg17
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds_qixis.h38
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds_rcw_nand.cfg7
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds_rcw_sd_ifc.cfg8
-rw-r--r--board/freescale/ls1046aqds/ls1046aqds_rcw_sd_qspi.cfg8
-rw-r--r--board/freescale/ls1046ardb/Kconfig16
-rw-r--r--board/freescale/ls1046ardb/MAINTAINERS16
-rw-r--r--board/freescale/ls1046ardb/Makefile10
-rw-r--r--board/freescale/ls1046ardb/cpld.c166
-rw-r--r--board/freescale/ls1046ardb/cpld.h49
-rw-r--r--board/freescale/ls1046ardb/ddr.c132
-rw-r--r--board/freescale/ls1046ardb/ddr.h62
-rw-r--r--board/freescale/ls1046ardb/eth.c129
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb.c192
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb_pbi.cfg22
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb_qspi_pbi.cfg26
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb_rcw_emmc.cfg7
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb_rcw_qspi.cfg7
-rw-r--r--board/freescale/ls1046ardb/ls1046ardb_rcw_sd.cfg7
-rw-r--r--board/freescale/ls1088a/Kconfig31
-rw-r--r--board/freescale/ls1088a/MAINTAINERS35
-rw-r--r--board/freescale/ls1088a/Makefile10
-rw-r--r--board/freescale/ls1088a/README145
-rw-r--r--board/freescale/ls1088a/ddr.c135
-rw-r--r--board/freescale/ls1088a/ddr.h48
-rw-r--r--board/freescale/ls1088a/eth_ls1088aqds.c105
-rw-r--r--board/freescale/ls1088a/eth_ls1088ardb.c13
-rw-r--r--board/freescale/ls1088a/ls1088a.c1034
-rw-r--r--board/freescale/ls1088a/ls1088a_qixis.h55
-rw-r--r--board/freescale/ls2080aqds/Kconfig16
-rw-r--r--board/freescale/ls2080aqds/MAINTAINERS13
-rw-r--r--board/freescale/ls2080aqds/Makefile7
-rw-r--r--board/freescale/ls2080aqds/README215
-rw-r--r--board/freescale/ls2080aqds/ddr.c182
-rw-r--r--board/freescale/ls2080aqds/ddr.h91
-rw-r--r--board/freescale/ls2080aqds/eth.c117
-rw-r--r--board/freescale/ls2080aqds/ls2080aqds.c349
-rw-r--r--board/freescale/ls2080aqds/ls2080aqds_qixis.h29
-rw-r--r--board/freescale/ls2080ardb/Kconfig15
-rw-r--r--board/freescale/ls2080ardb/MAINTAINERS32
-rw-r--r--board/freescale/ls2080ardb/Makefile6
-rw-r--r--board/freescale/ls2080ardb/README134
-rw-r--r--board/freescale/ls2080ardb/ddr.c187
-rw-r--r--board/freescale/ls2080ardb/ddr.h76
-rw-r--r--board/freescale/ls2080ardb/eth_ls2080rdb.c36
-rw-r--r--board/freescale/ls2080ardb/ls2080ardb.c571
-rw-r--r--board/freescale/ls2080ardb/ls2080ardb_qixis.h19
-rw-r--r--board/freescale/lx2160a/Kconfig47
-rw-r--r--board/freescale/lx2160a/MAINTAINERS55
-rw-r--r--board/freescale/lx2160a/Makefile11
-rw-r--r--board/freescale/lx2160a/README329
-rw-r--r--board/freescale/lx2160a/ddr.c20
-rw-r--r--board/freescale/lx2160a/eth_lx2160aqds.c148
-rw-r--r--board/freescale/lx2160a/eth_lx2160ardb.c144
-rw-r--r--board/freescale/lx2160a/eth_lx2162aqds.c143
-rw-r--r--board/freescale/lx2160a/lx2160a.c864
-rw-r--r--board/freescale/lx2160a/lx2160a.h76
-rw-r--r--board/freescale/m5208evbe/Kconfig15
-rw-r--r--board/freescale/m5208evbe/MAINTAINERS6
-rw-r--r--board/freescale/m5208evbe/Makefile6
-rw-r--r--board/freescale/m5208evbe/m5208evbe.c83
-rw-r--r--board/freescale/m5235evb/Kconfig18
-rw-r--r--board/freescale/m5235evb/MAINTAINERS7
-rw-r--r--board/freescale/m5235evb/Makefile6
-rw-r--r--board/freescale/m5235evb/m5235evb.c111
-rw-r--r--board/freescale/m5249evb/Kconfig15
-rw-r--r--board/freescale/m5249evb/MAINTAINERS6
-rw-r--r--board/freescale/m5249evb/Makefile6
-rw-r--r--board/freescale/m5249evb/m5249evb.c101
-rw-r--r--board/freescale/m5253demo/Kconfig19
-rw-r--r--board/freescale/m5253demo/MAINTAINERS6
-rw-r--r--board/freescale/m5253demo/Makefile6
-rw-r--r--board/freescale/m5253demo/flash.c440
-rw-r--r--board/freescale/m5253demo/m5253demo.c142
-rw-r--r--board/freescale/m5272c3/Kconfig15
-rw-r--r--board/freescale/m5272c3/MAINTAINERS6
-rw-r--r--board/freescale/m5272c3/Makefile6
-rw-r--r--board/freescale/m5272c3/m5272c3.c44
-rw-r--r--board/freescale/m5275evb/Kconfig15
-rw-r--r--board/freescale/m5275evb/MAINTAINERS6
-rw-r--r--board/freescale/m5275evb/Makefile6
-rw-r--r--board/freescale/m5275evb/m5275evb.c105
-rw-r--r--board/freescale/m5282evb/Kconfig15
-rw-r--r--board/freescale/m5282evb/MAINTAINERS6
-rw-r--r--board/freescale/m5282evb/Makefile6
-rw-r--r--board/freescale/m5282evb/m5282evb.c87
-rw-r--r--board/freescale/m53017evb/Kconfig15
-rw-r--r--board/freescale/m53017evb/MAINTAINERS6
-rw-r--r--board/freescale/m53017evb/Makefile6
-rw-r--r--board/freescale/m53017evb/README178
-rw-r--r--board/freescale/m53017evb/m53017evb.c83
-rw-r--r--board/freescale/m5329evb/Kconfig15
-rw-r--r--board/freescale/m5329evb/MAINTAINERS7
-rw-r--r--board/freescale/m5329evb/Makefile6
-rw-r--r--board/freescale/m5329evb/m5329evb.c77
-rw-r--r--board/freescale/m5329evb/nand.c70
-rw-r--r--board/freescale/m5373evb/Kconfig15
-rw-r--r--board/freescale/m5373evb/MAINTAINERS6
-rw-r--r--board/freescale/m5373evb/Makefile6
-rw-r--r--board/freescale/m5373evb/README324
-rw-r--r--board/freescale/m5373evb/m5373evb.c77
-rw-r--r--board/freescale/m5373evb/nand.c74
-rw-r--r--board/freescale/mpc837xerdb/Kconfig15
-rw-r--r--board/freescale/mpc837xerdb/MAINTAINERS7
-rw-r--r--board/freescale/mpc837xerdb/Makefile6
-rw-r--r--board/freescale/mpc837xerdb/README97
-rw-r--r--board/freescale/mpc837xerdb/mpc837xerdb.c242
-rw-r--r--board/freescale/mpc8548cds/Kconfig24
-rw-r--r--board/freescale/mpc8548cds/MAINTAINERS8
-rw-r--r--board/freescale/mpc8548cds/Makefile10
-rw-r--r--board/freescale/mpc8548cds/ddr.c52
-rw-r--r--board/freescale/mpc8548cds/law.c18
-rw-r--r--board/freescale/mpc8548cds/mpc8548cds.c170
-rw-r--r--board/freescale/mpc8548cds/tlb.c87
-rw-r--r--board/freescale/mx23evk/Kconfig15
-rw-r--r--board/freescale/mx23evk/MAINTAINERS8
-rw-r--r--board/freescale/mx23evk/Makefile10
-rw-r--r--board/freescale/mx23evk/mx23evk.c55
-rw-r--r--board/freescale/mx23evk/spl_boot.c133
-rw-r--r--board/freescale/mx28evk/Kconfig15
-rw-r--r--board/freescale/mx28evk/MAINTAINERS7
-rw-r--r--board/freescale/mx28evk/Makefile10
-rw-r--r--board/freescale/mx28evk/README62
-rw-r--r--board/freescale/mx28evk/iomux.c204
-rw-r--r--board/freescale/mx28evk/mx28evk.c73
-rw-r--r--board/freescale/mx51evk/Kconfig18
-rw-r--r--board/freescale/mx51evk/MAINTAINERS7
-rw-r--r--board/freescale/mx51evk/Makefile7
-rw-r--r--board/freescale/mx51evk/imximage.cfg108
-rw-r--r--board/freescale/mx51evk/mx51evk.c220
-rw-r--r--board/freescale/mx53loco/Kconfig21
-rw-r--r--board/freescale/mx53loco/MAINTAINERS7
-rw-r--r--board/freescale/mx53loco/Makefile6
-rw-r--r--board/freescale/mx53loco/imximage.cfg83
-rw-r--r--board/freescale/mx53loco/mx53loco.c246
-rw-r--r--board/freescale/mx6memcal/Kconfig230
-rw-r--r--board/freescale/mx6memcal/MAINTAINERS7
-rw-r--r--board/freescale/mx6memcal/Makefile11
-rw-r--r--board/freescale/mx6memcal/README49
-rw-r--r--board/freescale/mx6memcal/mx6memcal.c31
-rw-r--r--board/freescale/mx6memcal/spl.c457
-rw-r--r--board/freescale/mx6sabreauto/Kconfig12
-rw-r--r--board/freescale/mx6sabreauto/MAINTAINERS7
-rw-r--r--board/freescale/mx6sabreauto/Makefile7
-rw-r--r--board/freescale/mx6sabreauto/mx6sabreauto.c934
-rw-r--r--board/freescale/mx6sabresd/Kconfig12
-rw-r--r--board/freescale/mx6sabresd/MAINTAINERS6
-rw-r--r--board/freescale/mx6sabresd/Makefile7
-rw-r--r--board/freescale/mx6sabresd/mx6sabresd.c868
-rw-r--r--board/freescale/mx6slevk/Kconfig15
-rw-r--r--board/freescale/mx6slevk/MAINTAINERS9
-rw-r--r--board/freescale/mx6slevk/Makefile4
-rw-r--r--board/freescale/mx6slevk/imximage.cfg122
-rw-r--r--board/freescale/mx6slevk/mx6slevk.c390
-rw-r--r--board/freescale/mx6sllevk/Kconfig15
-rw-r--r--board/freescale/mx6sllevk/MAINTAINERS7
-rw-r--r--board/freescale/mx6sllevk/Makefile4
-rw-r--r--board/freescale/mx6sllevk/imximage.cfg125
-rw-r--r--board/freescale/mx6sllevk/mx6sllevk.c115
-rw-r--r--board/freescale/mx6sllevk/plugin.S154
-rw-r--r--board/freescale/mx6sxsabreauto/Kconfig15
-rw-r--r--board/freescale/mx6sxsabreauto/MAINTAINERS6
-rw-r--r--board/freescale/mx6sxsabreauto/Makefile4
-rw-r--r--board/freescale/mx6sxsabreauto/imximage.cfg134
-rw-r--r--board/freescale/mx6sxsabreauto/mx6sxsabreauto.c325
-rw-r--r--board/freescale/mx6sxsabresd/Kconfig15
-rw-r--r--board/freescale/mx6sxsabresd/MAINTAINERS6
-rw-r--r--board/freescale/mx6sxsabresd/Makefile4
-rw-r--r--board/freescale/mx6sxsabresd/imximage.cfg137
-rw-r--r--board/freescale/mx6sxsabresd/mx6sxsabresd.c328
-rw-r--r--board/freescale/mx6ul_14x14_evk/Kconfig12
-rw-r--r--board/freescale/mx6ul_14x14_evk/MAINTAINERS7
-rw-r--r--board/freescale/mx6ul_14x14_evk/Makefile4
-rw-r--r--board/freescale/mx6ul_14x14_evk/mx6ul_14x14_evk.c524
-rw-r--r--board/freescale/mx6ullevk/Kconfig15
-rw-r--r--board/freescale/mx6ullevk/MAINTAINERS8
-rw-r--r--board/freescale/mx6ullevk/Makefile4
-rw-r--r--board/freescale/mx6ullevk/imximage.cfg114
-rw-r--r--board/freescale/mx6ullevk/mx6ullevk.c138
-rw-r--r--board/freescale/mx6ullevk/plugin.S138
-rw-r--r--board/freescale/mx7dsabresd/Kconfig15
-rw-r--r--board/freescale/mx7dsabresd/MAINTAINERS8
-rw-r--r--board/freescale/mx7dsabresd/Makefile4
-rw-r--r--board/freescale/mx7dsabresd/imximage.cfg99
-rw-r--r--board/freescale/mx7dsabresd/mx7dsabresd.c326
-rw-r--r--board/freescale/mx7ulp_evk/Kconfig15
-rw-r--r--board/freescale/mx7ulp_evk/MAINTAINERS7
-rw-r--r--board/freescale/mx7ulp_evk/Makefile4
-rw-r--r--board/freescale/mx7ulp_evk/imximage.cfg130
-rw-r--r--board/freescale/mx7ulp_evk/mx7ulp_evk.c95
-rw-r--r--board/freescale/mx7ulp_evk/plugin.S216
-rw-r--r--board/freescale/p1010rdb/Kconfig12
-rw-r--r--board/freescale/p1010rdb/MAINTAINERS21
-rw-r--r--board/freescale/p1010rdb/Makefile26
-rw-r--r--board/freescale/p1010rdb/README.P1010RDB-PA207
-rw-r--r--board/freescale/p1010rdb/README.P1010RDB-PB187
-rw-r--r--board/freescale/p1010rdb/ddr.c97
-rw-r--r--board/freescale/p1010rdb/law.c16
-rw-r--r--board/freescale/p1010rdb/p1010rdb.c680
-rw-r--r--board/freescale/p1010rdb/spl.c113
-rw-r--r--board/freescale/p1010rdb/spl_minimal.c66
-rw-r--r--board/freescale/p1010rdb/tlb.c90
-rw-r--r--board/freescale/p1_p2_rdb_pc/Kconfig14
-rw-r--r--board/freescale/p1_p2_rdb_pc/MAINTAINERS25
-rw-r--r--board/freescale/p1_p2_rdb_pc/Makefile26
-rw-r--r--board/freescale/p1_p2_rdb_pc/README64
-rw-r--r--board/freescale/p1_p2_rdb_pc/ddr.c290
-rw-r--r--board/freescale/p1_p2_rdb_pc/law.c21
-rw-r--r--board/freescale/p1_p2_rdb_pc/p1_p2_rdb_pc.c470
-rw-r--r--board/freescale/p1_p2_rdb_pc/spl.c132
-rw-r--r--board/freescale/p1_p2_rdb_pc/spl_minimal.c64
-rw-r--r--board/freescale/p1_p2_rdb_pc/tlb.c107
-rw-r--r--board/freescale/p2041rdb/Kconfig12
-rw-r--r--board/freescale/p2041rdb/MAINTAINERS11
-rw-r--r--board/freescale/p2041rdb/Makefile10
-rw-r--r--board/freescale/p2041rdb/README138
-rw-r--r--board/freescale/p2041rdb/cpld.c156
-rw-r--r--board/freescale/p2041rdb/cpld.h54
-rw-r--r--board/freescale/p2041rdb/ddr.c143
-rw-r--r--board/freescale/p2041rdb/eth.c210
-rw-r--r--board/freescale/p2041rdb/p2041rdb.c248
-rw-r--r--board/freescale/p2041rdb/pbi.cfg33
-rw-r--r--board/freescale/p2041rdb/rcw_p2041rdb.cfg11
-rw-r--r--board/freescale/t102xrdb/Kconfig12
-rw-r--r--board/freescale/t102xrdb/MAINTAINERS9
-rw-r--r--board/freescale/t102xrdb/Makefile16
-rw-r--r--board/freescale/t102xrdb/README340
-rw-r--r--board/freescale/t102xrdb/cpld.c102
-rw-r--r--board/freescale/t102xrdb/cpld.h48
-rw-r--r--board/freescale/t102xrdb/ddr.c258
-rw-r--r--board/freescale/t102xrdb/eth_t102xrdb.c149
-rw-r--r--board/freescale/t102xrdb/law.c31
-rw-r--r--board/freescale/t102xrdb/spl.c132
-rw-r--r--board/freescale/t102xrdb/t1023_nand_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t1023_sd_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t1023_spi_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t1024_nand_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t1024_pbi.cfg26
-rw-r--r--board/freescale/t102xrdb/t1024_sd_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t1024_spi_rcw.cfg8
-rw-r--r--board/freescale/t102xrdb/t102xrdb.c397
-rw-r--r--board/freescale/t102xrdb/t102xrdb.h15
-rw-r--r--board/freescale/t102xrdb/tlb.c117
-rw-r--r--board/freescale/t104xrdb/Kconfig12
-rw-r--r--board/freescale/t104xrdb/MAINTAINERS26
-rw-r--r--board/freescale/t104xrdb/Makefile14
-rw-r--r--board/freescale/t104xrdb/README386
-rw-r--r--board/freescale/t104xrdb/cpld.c115
-rw-r--r--board/freescale/t104xrdb/cpld.h45
-rw-r--r--board/freescale/t104xrdb/ddr.c148
-rw-r--r--board/freescale/t104xrdb/ddr.h56
-rw-r--r--board/freescale/t104xrdb/eth.c92
-rw-r--r--board/freescale/t104xrdb/law.c31
-rw-r--r--board/freescale/t104xrdb/spl.c131
-rw-r--r--board/freescale/t104xrdb/t1040_nand_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1040_sd_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1040_spi_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1040d4_nand_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1040d4_sd_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1040d4_spi_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_nand_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_pi_nand_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_pi_sd_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_pi_spi_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_sd_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042_spi_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042d4_nand_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042d4_sd_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t1042d4_spi_rcw.cfg7
-rw-r--r--board/freescale/t104xrdb/t104x_pbi.cfg36
-rw-r--r--board/freescale/t104xrdb/t104x_pbi_sb.cfg38
-rw-r--r--board/freescale/t104xrdb/t104xrdb.c159
-rw-r--r--board/freescale/t104xrdb/t104xrdb.h12
-rw-r--r--board/freescale/t104xrdb/tlb.c132
-rw-r--r--board/freescale/t208xqds/Kconfig15
-rw-r--r--board/freescale/t208xqds/MAINTAINERS20
-rw-r--r--board/freescale/t208xqds/Makefile15
-rwxr-xr-xboard/freescale/t208xqds/README292
-rw-r--r--board/freescale/t208xqds/ddr.c125
-rw-r--r--board/freescale/t208xqds/ddr.h70
-rw-r--r--board/freescale/t208xqds/eth_t208xqds.c723
-rw-r--r--board/freescale/t208xqds/law.c33
-rw-r--r--board/freescale/t208xqds/spl.c141
-rw-r--r--board/freescale/t208xqds/t2080_nand_rcw.cfg16
-rw-r--r--board/freescale/t208xqds/t2080_sd_rcw.cfg16
-rw-r--r--board/freescale/t208xqds/t2080_spi_rcw.cfg16
-rw-r--r--board/freescale/t208xqds/t2081_nand_rcw.cfg8
-rw-r--r--board/freescale/t208xqds/t2081_sd_rcw.cfg8
-rw-r--r--board/freescale/t208xqds/t2081_spi_rcw.cfg8
-rw-r--r--board/freescale/t208xqds/t208x_pbi.cfg40
-rw-r--r--board/freescale/t208xqds/t208xqds.c426
-rw-r--r--board/freescale/t208xqds/t208xqds.h12
-rw-r--r--board/freescale/t208xqds/t208xqds_qixis.h48
-rw-r--r--board/freescale/t208xqds/tlb.c153
-rw-r--r--board/freescale/t208xrdb/Kconfig15
-rw-r--r--board/freescale/t208xrdb/MAINTAINERS14
-rw-r--r--board/freescale/t208xrdb/Makefile15
-rw-r--r--board/freescale/t208xrdb/README288
-rw-r--r--board/freescale/t208xrdb/cpld.c71
-rw-r--r--board/freescale/t208xrdb/cpld.h48
-rw-r--r--board/freescale/t208xrdb/ddr.c118
-rw-r--r--board/freescale/t208xrdb/ddr.h46
-rw-r--r--board/freescale/t208xrdb/eth_t208xrdb.c100
-rw-r--r--board/freescale/t208xrdb/law.c33
-rw-r--r--board/freescale/t208xrdb/spl.c101
-rw-r--r--board/freescale/t208xrdb/t2080_nand_rcw.cfg19
-rw-r--r--board/freescale/t208xrdb/t2080_pbi.cfg40
-rw-r--r--board/freescale/t208xrdb/t2080_sd_rcw.cfg19
-rw-r--r--board/freescale/t208xrdb/t2080_spi_rcw.cfg19
-rw-r--r--board/freescale/t208xrdb/t208xrdb.c188
-rw-r--r--board/freescale/t208xrdb/t208xrdb.h18
-rw-r--r--board/freescale/t208xrdb/tlb.c153
-rw-r--r--board/freescale/t4rdb/Kconfig12
-rw-r--r--board/freescale/t4rdb/MAINTAINERS7
-rw-r--r--board/freescale/t4rdb/Makefile17
-rw-r--r--board/freescale/t4rdb/cpld.c129
-rw-r--r--board/freescale/t4rdb/cpld.h47
-rw-r--r--board/freescale/t4rdb/ddr.c127
-rw-r--r--board/freescale/t4rdb/ddr.h77
-rw-r--r--board/freescale/t4rdb/eth.c152
-rw-r--r--board/freescale/t4rdb/law.c30
-rw-r--r--board/freescale/t4rdb/spl.c88
-rw-r--r--board/freescale/t4rdb/t4240rdb.c183
-rw-r--r--board/freescale/t4rdb/t4_pbi.cfg27
-rw-r--r--board/freescale/t4rdb/t4_sd_rcw.cfg7
-rw-r--r--board/freescale/t4rdb/t4rdb.h20
-rw-r--r--board/freescale/t4rdb/tlb.c124
-rw-r--r--board/freescale/vf610twr/Kconfig15
-rw-r--r--board/freescale/vf610twr/MAINTAINERS7
-rw-r--r--board/freescale/vf610twr/Makefile5
-rw-r--r--board/freescale/vf610twr/imximage.cfg16
-rw-r--r--board/freescale/vf610twr/vf610twr.c387
556 files changed, 64667 insertions, 0 deletions
diff --git a/board/freescale/common/Makefile b/board/freescale/common/Makefile
new file mode 100644
index 00000000000..b4faf6f9e0a
--- /dev/null
+++ b/board/freescale/common/Makefile
@@ -0,0 +1,83 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+MINIMAL=
+
+ifdef CONFIG_SPL_BUILD
+ifndef CONFIG_TPL_BUILD
+ifdef CONFIG_SPL_INIT_MINIMAL
+MINIMAL=y
+endif
+endif
+endif
+
+ifdef MINIMAL
+# necessary to create built-in.o
+obj- := __dummy__.o
+else
+# include i2c_common.o once if either VID or FSL_USE_PCA9547_MUX
+I2C_COMMON=
+ifdef CONFIG_VID
+I2C_COMMON=y
+endif
+ifdef CONFIG_FSL_USE_PCA9547_MUX
+I2C_COMMON=y
+endif
+
+obj-$(CONFIG_FSL_CADMUS) += cadmus.o
+obj-$(CONFIG_FSL_VIA) += cds_via.o
+obj-$(CONFIG_FMAN_ENET) += fman.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_FSL_NGPIXIS) += ngpixis.o
+endif
+obj-$(I2C_COMMON) += i2c_common.o
+obj-$(CONFIG_FSL_USE_PCA9547_MUX) += i2c_mux.o
+obj-$(CONFIG_$(SPL_)VID) += vid.o
+obj-$(CONFIG_FSL_QIXIS) += qixis.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_ID_EEPROM) += sys_eeprom.o
+endif
+ifndef CONFIG_RAMBOOT_PBL
+obj-$(CONFIG_FSL_FIXED_MMC_LOCATION) += sdhc_boot.o
+endif
+
+ifdef CONFIG_ARM
+obj-$(CONFIG_DEEP_SLEEP) += arm_sleep.o
+else
+obj-$(CONFIG_DEEP_SLEEP) += mpc85xx_sleep.o
+endif
+
+obj-$(CONFIG_TARGET_MPC8548CDS) += cds_pci_ft.o
+
+obj-$(CONFIG_TARGET_P3041DS) += ics307_clk.o
+obj-$(CONFIG_TARGET_P4080DS) += ics307_clk.o
+obj-$(CONFIG_TARGET_P5040DS) += ics307_clk.o
+ifeq ($(CONFIG_$(SPL_)POWER_LEGACY),y)
+obj-$(CONFIG_POWER_PFUZE100) += pfuze.o
+endif
+obj-$(CONFIG_DM_PMIC_PFUZE100) += pfuze.o
+obj-$(CONFIG_POWER_MC34VR500) += mc34vr500.o
+ifneq (,$(filter $(SOC), imx8ulp imx9))
+obj-y += mmc.o
+endif
+
+obj-$(CONFIG_LS102XA_STREAM_ID) += ls102xa_stream_id.o
+
+obj-$(CONFIG_EMC2305) += emc2305.o
+
+# deal with common files for P-series corenet based devices
+obj-$(CONFIG_TARGET_P2041RDB) += p_corenet/
+obj-$(CONFIG_TARGET_P3041DS) += p_corenet/
+obj-$(CONFIG_TARGET_P4080DS) += p_corenet/
+obj-$(CONFIG_TARGET_P5040DS) += p_corenet/
+
+obj-$(CONFIG_LAYERSCAPE_NS_ACCESS) += ns_access.o
+
+ifdef CONFIG_NXP_ESBC
+obj-$(CONFIG_CMD_ESBC_VALIDATE) += fsl_validate.o cmd_esbc_validate.o
+endif
+obj-$(CONFIG_CHAIN_OF_TRUST) += fsl_chain_of_trust.o
+
+endif
diff --git a/board/freescale/common/arm_sleep.c b/board/freescale/common/arm_sleep.c
new file mode 100644
index 00000000000..228f07502f7
--- /dev/null
+++ b/board/freescale/common/arm_sleep.c
@@ -0,0 +1,130 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#ifndef CONFIG_ARMV7_NONSEC
+#error " Deep sleep needs non-secure mode support. "
+#else
+#include <asm/secure.h>
+#endif
+#include <asm/armv7.h>
+
+#if defined(CONFIG_ARCH_LS1021A)
+#include <asm/arch/immap_ls102xa.h>
+#endif
+
+#include "sleep.h"
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void __weak board_mem_sleep_setup(void)
+{
+}
+
+void __weak board_sleep_prepare(void)
+{
+}
+
+bool is_warm_boot(void)
+{
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+
+ if (in_be32(&gur->crstsr) & DCFG_CCSR_CRSTSR_WDRFR)
+ return 1;
+
+ return 0;
+}
+
+void fsl_dp_disable_console(void)
+{
+ gd->flags |= GD_FLG_SILENT | GD_FLG_DISABLE_CONSOLE;
+}
+
+/*
+ * When wakeup from deep sleep, the first 128 bytes space
+ * will be used to do DDR training which corrupts the data
+ * in there. This function will restore them.
+ */
+static void dp_ddr_restore(void)
+{
+ u64 *src, *dst;
+ int i;
+ struct ccsr_scfg __iomem *scfg = (void *)CFG_SYS_FSL_SCFG_ADDR;
+
+ /* get the address of ddr date from SPARECR3 */
+ src = (u64 *)in_le32(&scfg->sparecr[2]);
+ dst = (u64 *)CFG_SYS_SDRAM_BASE;
+
+ for (i = 0; i < DDR_BUFF_LEN / 8; i++)
+ *dst++ = *src++;
+}
+
+#if defined(CONFIG_ARMV7_PSCI) && defined(CONFIG_ARCH_LS1021A)
+void ls1_psci_resume_fixup(void)
+{
+ u32 tmp;
+ struct ccsr_scfg __iomem *scfg = (void *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef QIXIS_BASE
+ void *qixis_base = (void *)QIXIS_BASE;
+
+ /* Pull on PCIe RST# */
+ out_8(qixis_base + QIXIS_RST_FORCE_3, 0);
+
+ /* disable deep sleep signals in FPGA */
+ tmp = in_8(qixis_base + QIXIS_PWR_CTL2);
+ tmp &= ~QIXIS_PWR_CTL2_PCTL;
+ out_8(qixis_base + QIXIS_PWR_CTL2, tmp);
+#endif
+
+ /* Disable wakeup interrupt during deep sleep */
+ out_be32(&scfg->pmcintecr, 0);
+ /* Clear PMC interrupt status */
+ out_be32(&scfg->pmcintsr, 0xffffffff);
+
+ /* Disable Warm Device Reset */
+ tmp = in_be32(&scfg->dpslpcr);
+ tmp &= ~SCFG_DPSLPCR_WDRR_EN;
+ out_be32(&scfg->dpslpcr, tmp);
+}
+#endif
+
+static void dp_resume_prepare(void)
+{
+ dp_ddr_restore();
+ board_sleep_prepare();
+ armv7_init_nonsec();
+#ifdef CONFIG_U_QE
+ u_qe_resume();
+#endif
+#if defined(CONFIG_ARMV7_PSCI) && defined(CONFIG_ARCH_LS1021A)
+ ls1_psci_resume_fixup();
+#endif
+}
+
+int fsl_dp_resume(void)
+{
+ u32 start_addr;
+ void (*kernel_resume)(void);
+ struct ccsr_scfg __iomem *scfg = (void *)CFG_SYS_FSL_SCFG_ADDR;
+
+ if (!is_warm_boot())
+ return 0;
+
+ dp_resume_prepare();
+
+ /* Get the entry address and jump to kernel */
+ start_addr = in_le32(&scfg->sparecr[3]);
+ debug("Entry address is 0x%08x\n", start_addr);
+ kernel_resume = (void (*)(void))start_addr;
+ secure_ram_addr(_do_nonsec_entry)(kernel_resume, 0, 0, 0);
+
+ return 0;
+}
diff --git a/board/freescale/common/cadmus.c b/board/freescale/common/cadmus.c
new file mode 100644
index 00000000000..6f66ed6851d
--- /dev/null
+++ b/board/freescale/common/cadmus.c
@@ -0,0 +1,79 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2004, 2011 Freescale Semiconductor.
+ */
+
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <linux/types.h>
+
+/*
+ * CADMUS Board System Registers
+ */
+#ifndef CFG_SYS_CADMUS_BASE_REG
+#define CFG_SYS_CADMUS_BASE_REG (CADMUS_BASE_ADDR + 0x4000)
+#endif
+
+typedef struct cadmus_reg {
+ u_char cm_ver; /* Board version */
+ u_char cm_csr; /* General control/status */
+ u_char cm_rst; /* Reset control */
+ u_char cm_hsclk; /* High speed clock */
+ u_char cm_hsxclk; /* High speed clock extended */
+ u_char cm_led; /* LED data */
+ u_char cm_pci; /* PCI control/status */
+ u_char cm_dma; /* DMA control */
+ u_char cm_reserved[248]; /* Total 256 bytes */
+} cadmus_reg_t;
+
+
+unsigned int
+get_board_version(void)
+{
+ volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_SYS_CADMUS_BASE_REG;
+
+ return cadmus->cm_ver;
+}
+
+
+unsigned long
+get_board_sys_clk(void)
+{
+ volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_SYS_CADMUS_BASE_REG;
+
+ uint pci1_speed = (cadmus->cm_pci >> 2) & 0x3; /* PSPEED in [4:5] */
+
+ if (pci1_speed == 0) {
+ return 33333333;
+ } else if (pci1_speed == 1) {
+ return 66666666;
+ } else {
+ /* Really, unknown. Be safe? */
+ return 33333333;
+ }
+}
+
+
+unsigned int
+get_pci_slot(void)
+{
+ volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_SYS_CADMUS_BASE_REG;
+
+ /*
+ * PCI slot in USER bits CSR[6:7] by convention.
+ */
+ return ((cadmus->cm_csr >> 6) & 0x3) + 1;
+}
+
+
+unsigned int
+get_pci_dual(void)
+{
+ volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_SYS_CADMUS_BASE_REG;
+
+ /*
+ * PCI DUAL in CM_PCI[3]
+ */
+ return cadmus->cm_pci & 0x10;
+}
diff --git a/board/freescale/common/cadmus.h b/board/freescale/common/cadmus.h
new file mode 100644
index 00000000000..fb74e8f6db5
--- /dev/null
+++ b/board/freescale/common/cadmus.h
@@ -0,0 +1,37 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ */
+
+#ifndef __CADMUS_H_
+#define __CADMUS_H_
+
+
+/*
+ * CADMUS Board System Register interface.
+ */
+
+/*
+ * Returns board version register.
+ */
+extern unsigned int get_board_version(void);
+
+/*
+ * Returns either 33000000 or 66000000 as the SYS_CLK_FREQ.
+ */
+extern unsigned long get_board_sys_clk(void);
+
+
+/*
+ * Returns 1 - 4, as found in the USER CSR[6:7] bits.
+ */
+extern unsigned int get_pci_slot(void);
+
+
+/*
+ * Returns PCI DUAL as found in CM_PCI[3].
+ */
+extern unsigned int get_pci_dual(void);
+
+
+#endif /* __CADMUS_H_ */
diff --git a/board/freescale/common/cds_pci_ft.c b/board/freescale/common/cds_pci_ft.c
new file mode 100644
index 00000000000..56b01e3f51f
--- /dev/null
+++ b/board/freescale/common/cds_pci_ft.c
@@ -0,0 +1,17 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ */
+
+#include <linux/libfdt.h>
+#include <fdt_support.h>
+#include "cadmus.h"
+
+#if defined(CONFIG_OF_BOARD_SETUP)
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ ft_cpu_setup(blob, bd);
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/common/cds_via.c b/board/freescale/common/cds_via.c
new file mode 100644
index 00000000000..6fc3a21780f
--- /dev/null
+++ b/board/freescale/common/cds_via.c
@@ -0,0 +1,95 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2006 Freescale Semiconductor.
+ */
+
+#include <pci.h>
+
+/* Config the VIA chip */
+void mpc85xx_config_via(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pci_dev_t bridge;
+ unsigned int cmdstat;
+
+ /* Enable USB and IDE functions */
+ pci_hose_write_config_byte(hose, dev, 0x48, 0x08);
+
+ pci_hose_read_config_dword(hose, dev, PCI_COMMAND, &cmdstat);
+ cmdstat |= PCI_COMMAND_IO | PCI_COMMAND_MEMORY| PCI_COMMAND_MASTER;
+ pci_hose_write_config_dword(hose, dev, PCI_COMMAND, cmdstat);
+ pci_hose_write_config_byte(hose, dev, PCI_CACHE_LINE_SIZE, 0x08);
+ pci_hose_write_config_byte(hose, dev, PCI_LATENCY_TIMER, 0x80);
+
+ /*
+ * Force the backplane P2P bridge to have a window
+ * open from 0x00000000-0x00001fff in PCI I/O space.
+ * This allows legacy I/O (i8259, etc) on the VIA
+ * southbridge to be accessed.
+ */
+#ifdef CONFIG_TARGET_MPC8548CDS_LEGACY
+ bridge = PCI_BDF(0, 17, 0);
+#else
+ bridge = PCI_BDF(0, 28, 0);
+#endif
+ pci_hose_write_config_byte(hose, bridge, PCI_IO_BASE, 0);
+ pci_hose_write_config_word(hose, bridge, PCI_IO_BASE_UPPER16, 0);
+ pci_hose_write_config_byte(hose, bridge, PCI_IO_LIMIT, 0x10);
+ pci_hose_write_config_word(hose, bridge, PCI_IO_LIMIT_UPPER16, 0);
+}
+
+/* Function 1, IDE */
+void mpc85xx_config_via_usbide(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pciauto_config_device(hose, dev);
+ /*
+ * Since the P2P window was forced to cover the fixed
+ * legacy I/O addresses, it is necessary to manually
+ * place the base addresses for the IDE and USB functions
+ * within this window.
+ */
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_0, 0x1ff8);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_1, 0x1ff4);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_2, 0x1fe8);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_3, 0x1fe4);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_4, 0x1fd0);
+}
+
+/* Function 2, USB ports 0-1 */
+void mpc85xx_config_via_usb(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pciauto_config_device(hose, dev);
+
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_4, 0x1fa0);
+}
+
+/* Function 3, USB ports 2-3 */
+void mpc85xx_config_via_usb2(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pciauto_config_device(hose, dev);
+
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_4, 0x1f80);
+}
+
+/* Function 5, Power Management */
+void mpc85xx_config_via_power(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pciauto_config_device(hose, dev);
+
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_0, 0x1e00);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_1, 0x1dfc);
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_2, 0x1df8);
+}
+
+/* Function 6, AC97 Interface */
+void mpc85xx_config_via_ac97(struct pci_controller *hose,
+ pci_dev_t dev, struct pci_config_table *tab)
+{
+ pciauto_config_device(hose, dev);
+
+ pci_hose_write_config_dword(hose, dev, PCI_BASE_ADDRESS_0, 0x1c00);
+}
diff --git a/board/freescale/common/cmd_esbc_validate.c b/board/freescale/common/cmd_esbc_validate.c
new file mode 100644
index 00000000000..d4192e5ab52
--- /dev/null
+++ b/board/freescale/common/cmd_esbc_validate.c
@@ -0,0 +1,86 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <command.h>
+#include <env.h>
+#include <fsl_validate.h>
+#include <vsprintf.h>
+
+int do_esbc_halt(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (fsl_check_boot_mode_secure() == 0) {
+ printf("Boot Mode is Non-Secure. Not entering spin loop.\n");
+ return 0;
+ }
+
+ printf("Core is entering spin loop.\n");
+loop:
+ goto loop;
+
+ return 0;
+}
+
+#ifndef CONFIG_SPL_BUILD
+static int do_esbc_validate(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ char *hash_str = NULL;
+ uintptr_t haddr;
+ int ret;
+ uintptr_t img_addr = 0;
+ char buf[20];
+
+ if (argc < 2)
+ return cmd_usage(cmdtp);
+ else if (argc > 2)
+ /* Second arg - Optional - Hash Str*/
+ hash_str = argv[2];
+
+ /* First argument - header address -32/64bit */
+ haddr = (uintptr_t)hextoul(argv[1], NULL);
+
+ /* With esbc_validate command, Image address must be
+ * part of header. So, the function is called
+ * by passing this argument as 0.
+ */
+ ret = fsl_secboot_validate(haddr, hash_str, &img_addr);
+
+ /* Need to set "img_addr" even if validation failure.
+ * Required when SB_EN in RCW set and non-fatal error
+ * to continue U-Boot
+ */
+ sprintf(buf, "%lx", img_addr);
+ env_set("img_addr", buf);
+
+ if (ret)
+ return 1;
+
+ printf("esbc_validate command successful\n");
+ return 0;
+}
+
+/***************************************************/
+static char esbc_validate_help_text[] =
+ "esbc_validate hdr_addr <hash_val> - Validates signature using\n"
+ " RSA verification\n"
+ " $hdr_addr Address of header of the image\n"
+ " to be validated.\n"
+ " $hash_val -Optional\n"
+ " It provides Hash of public/srk key to be\n"
+ " used to verify signature.\n";
+
+U_BOOT_CMD(
+ esbc_validate, 3, 0, do_esbc_validate,
+ "Validates signature on a given image using RSA verification",
+ esbc_validate_help_text
+);
+
+U_BOOT_CMD(
+ esbc_halt, 1, 0, do_esbc_halt,
+ "Put the core in spin loop (Secure Boot Only)",
+ ""
+);
+#endif
diff --git a/board/freescale/common/eeprom.h b/board/freescale/common/eeprom.h
new file mode 100644
index 00000000000..328fd3974b1
--- /dev/null
+++ b/board/freescale/common/eeprom.h
@@ -0,0 +1,33 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ */
+
+#ifndef __EEPROM_H_
+#define __EEPROM_H_
+
+
+/*
+ * EEPROM Board System Register interface.
+ */
+
+
+/*
+ * CPU Board Revision
+ */
+#define MPC85XX_CPU_BOARD_REV(maj, min) ((((maj)&0xff) << 8) | ((min) & 0xff))
+#define MPC85XX_CPU_BOARD_MAJOR(rev) (((rev) >> 8) & 0xff)
+#define MPC85XX_CPU_BOARD_MINOR(rev) ((rev) & 0xff)
+
+#define MPC85XX_CPU_BOARD_REV_UNKNOWN MPC85XX_CPU_BOARD_REV(0,0)
+#define MPC85XX_CPU_BOARD_REV_1_0 MPC85XX_CPU_BOARD_REV(1,0)
+#define MPC85XX_CPU_BOARD_REV_1_1 MPC85XX_CPU_BOARD_REV(1,1)
+
+/*
+ * Returns CPU board revision register as a 16-bit value with
+ * the Major in the high byte, and Minor in the low byte.
+ */
+extern unsigned int get_cpu_board_revision(void);
+
+
+#endif /* __CADMUS_H_ */
diff --git a/board/freescale/common/emc2305.c b/board/freescale/common/emc2305.c
new file mode 100644
index 00000000000..50252bb5007
--- /dev/null
+++ b/board/freescale/common/emc2305.c
@@ -0,0 +1,61 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018-2020 NXP.
+ *
+ */
+
+#include <command.h>
+#include <i2c.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+
+#include "emc2305.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void set_fan_speed(u8 data, int chip_addr)
+{
+ u8 index;
+ u8 Fan[NUM_OF_FANS] = {I2C_EMC2305_FAN1,
+ I2C_EMC2305_FAN2,
+ I2C_EMC2305_FAN3,
+ I2C_EMC2305_FAN4,
+ I2C_EMC2305_FAN5};
+
+ for (index = 0; index < NUM_OF_FANS; index++) {
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ if (i2c_write(chip_addr, Fan[index], 1, &data, 1) != 0) {
+ printf("Error: failed to change fan speed @%x\n",
+ Fan[index]);
+ }
+#else
+ struct udevice *dev;
+
+ if (i2c_get_chip_for_busnum(0, chip_addr, 1, &dev))
+ continue;
+
+ if (dm_i2c_write(dev, Fan[index], &data, 1) != 0) {
+ printf("Error: failed to change fan speed @%x\n",
+ Fan[index]);
+ }
+#endif
+ }
+}
+
+void emc2305_init(int chip_addr)
+{
+ u8 data;
+
+ data = I2C_EMC2305_CMD;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ if (i2c_write(chip_addr, I2C_EMC2305_CONF, 1, &data, 1) != 0)
+ printf("Error: failed to configure EMC2305\n");
+#else
+ struct udevice *dev;
+
+ if (!i2c_get_chip_for_busnum(0, chip_addr, 1, &dev))
+ if (dm_i2c_write(dev, I2C_EMC2305_CONF, &data, 1))
+ printf("Error: failed to configure EMC2305\n");
+#endif
+
+}
diff --git a/board/freescale/common/emc2305.h b/board/freescale/common/emc2305.h
new file mode 100644
index 00000000000..24c5410d120
--- /dev/null
+++ b/board/freescale/common/emc2305.h
@@ -0,0 +1,22 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2018-2020 NXP
+ *
+ */
+
+#ifndef __EMC2305_H_
+#define __EMC2305_H_
+
+#define I2C_EMC2305_CONF 0x20
+#define I2C_EMC2305_FAN1 0x30
+#define I2C_EMC2305_FAN2 0x40
+#define I2C_EMC2305_FAN3 0x50
+#define I2C_EMC2305_FAN4 0x60
+#define I2C_EMC2305_FAN5 0x70
+
+#define NUM_OF_FANS 5
+
+void emc2305_init(int chip_addr);
+void set_fan_speed(u8 data, int chip_addr);
+
+#endif /* __EMC2305_H_ */
diff --git a/board/freescale/common/fman.c b/board/freescale/common/fman.c
new file mode 100644
index 00000000000..650ecc7b440
--- /dev/null
+++ b/board/freescale/common/fman.c
@@ -0,0 +1,88 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011-2015 Freescale Semiconductor, Inc.
+ */
+
+#include <linux/libfdt.h>
+#include <linux/libfdt_env.h>
+#include <fdt_support.h>
+
+#include <fm_eth.h>
+#ifdef CONFIG_FSL_LAYERSCAPE
+#include <asm/arch/fsl_serdes.h>
+#else
+#include <asm/fsl_serdes.h>
+#endif
+
+/*
+ * Given the following ...
+ *
+ * 1) A pointer to an Fman Ethernet node (as identified by the 'compat'
+ * compatible string and 'addr' physical address)
+ *
+ * 2) The name of an alias that points to the ethernet-phy node (usually inside
+ * a virtual MDIO node)
+ *
+ * ... update that Ethernet node's phy-handle property to point to the
+ * ethernet-phy node. This is how we link an Ethernet node to its PHY, so each
+ * PHY in a virtual MDIO node must have an alias.
+ *
+ * Returns 0 on success, or a negative FDT error code on error.
+ */
+int fdt_set_phy_handle(void *fdt, char *compat, phys_addr_t addr,
+ const char *alias)
+{
+ int offset;
+ unsigned int ph;
+ const char *path;
+
+ /* Get a path to the node that 'alias' points to */
+ path = fdt_get_alias(fdt, alias);
+ if (!path)
+ return -FDT_ERR_BADPATH;
+
+ /* Get the offset of that node */
+ offset = fdt_path_offset(fdt, path);
+ if (offset < 0)
+ return offset;
+
+ ph = fdt_create_phandle(fdt, offset);
+ if (!ph)
+ return -FDT_ERR_BADPHANDLE;
+
+ ph = cpu_to_fdt32(ph);
+
+ offset = fdt_node_offset_by_compat_reg(fdt, compat, addr);
+ if (offset < 0)
+ return offset;
+
+ return fdt_setprop(fdt, offset, "phy-handle", &ph, sizeof(ph));
+}
+
+/*
+ * Return the SerDes device enum for a given Fman port
+ *
+ * This function just maps the fm_port namespace to the srds_prtcl namespace.
+ */
+enum srds_prtcl serdes_device_from_fm_port(enum fm_port port)
+{
+ static const enum srds_prtcl srds_table[] = {
+ [FM1_DTSEC1] = SGMII_FM1_DTSEC1,
+ [FM1_DTSEC2] = SGMII_FM1_DTSEC2,
+ [FM1_DTSEC3] = SGMII_FM1_DTSEC3,
+ [FM1_DTSEC4] = SGMII_FM1_DTSEC4,
+ [FM1_DTSEC5] = SGMII_FM1_DTSEC5,
+ [FM1_10GEC1] = XAUI_FM1,
+ [FM2_DTSEC1] = SGMII_FM2_DTSEC1,
+ [FM2_DTSEC2] = SGMII_FM2_DTSEC2,
+ [FM2_DTSEC3] = SGMII_FM2_DTSEC3,
+ [FM2_DTSEC4] = SGMII_FM2_DTSEC4,
+ [FM2_DTSEC5] = SGMII_FM2_DTSEC5,
+ [FM2_10GEC1] = XAUI_FM2,
+ };
+
+ if ((port < FM1_DTSEC1) || (port > FM2_10GEC1))
+ return NONE;
+ else
+ return srds_table[port];
+}
diff --git a/board/freescale/common/fman.h b/board/freescale/common/fman.h
new file mode 100644
index 00000000000..16afc34b03e
--- /dev/null
+++ b/board/freescale/common/fman.h
@@ -0,0 +1,14 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __FMAN_BOARD_HELPER__
+#define __FMAN_BOARD_HELPER__
+
+int fdt_set_phy_handle(void *fdt, char *compat, phys_addr_t addr,
+ const char *alias);
+
+enum srds_prtcl serdes_device_from_fm_port(enum fm_port port);
+
+#endif
diff --git a/board/freescale/common/fsl_chain_of_trust.c b/board/freescale/common/fsl_chain_of_trust.c
new file mode 100644
index 00000000000..27a33924c84
--- /dev/null
+++ b/board/freescale/common/fsl_chain_of_trust.c
@@ -0,0 +1,160 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2022 NXP
+ */
+
+#include <config.h>
+#include <dm.h>
+#include <env.h>
+#include <init.h>
+#include <fsl_validate.h>
+#include <fsl_secboot_err.h>
+#include <fsl_sfp.h>
+#include <log.h>
+#include <dm/root.h>
+#include <asm/fsl_secure_boot.h>
+
+#if defined(CONFIG_SPL_BUILD) && defined(CONFIG_SPL_FRAMEWORK)
+#include <spl.h>
+#endif
+
+#ifdef CONFIG_FSL_CORENET
+#include <asm/fsl_pamu.h>
+#endif
+
+#ifdef CONFIG_ARCH_LS1021A
+#include <asm/arch/immap_ls102xa.h>
+#endif
+
+#if defined(CONFIG_MPC85xx)
+#define CFG_DCFG_ADDR CFG_SYS_MPC85xx_GUTS_ADDR
+#else
+#define CFG_DCFG_ADDR CFG_SYS_FSL_GUTS_ADDR
+#endif
+
+#ifdef CONFIG_SYS_FSL_CCSR_GUR_LE
+#define gur_in32(a) in_le32(a)
+#else
+#define gur_in32(a) in_be32(a)
+#endif
+
+/* Check the Boot Mode. If Secure, return 1 else return 0 */
+int fsl_check_boot_mode_secure(void)
+{
+ uint32_t val;
+ struct ccsr_sfp_regs *sfp_regs = (void *)(CFG_SYS_SFP_ADDR);
+ struct ccsr_gur __iomem *gur = (void *)(CFG_DCFG_ADDR);
+
+ val = sfp_in32(&sfp_regs->ospr) & ITS_MASK;
+ if (val == ITS_MASK)
+ return 1;
+
+#if defined(CONFIG_FSL_CORENET) || !defined(CONFIG_MPC85xx)
+ /* For PBL based platforms check the SB_EN bit in RCWSR */
+ val = gur_in32(&gur->rcwsr[RCW_SB_EN_REG_INDEX - 1]) & RCW_SB_EN_MASK;
+ if (val == RCW_SB_EN_MASK)
+ return 1;
+#endif
+
+#if defined(CONFIG_MPC85xx) && !defined(CONFIG_FSL_CORENET)
+ /* For Non-PBL Platforms, check the Device Status register 2*/
+ val = gur_in32(&gur->pordevsr2) & MPC85xx_PORDEVSR2_SBC_MASK;
+ if (val != MPC85xx_PORDEVSR2_SBC_MASK)
+ return 1;
+
+#endif
+ return 0;
+}
+
+#ifndef CONFIG_SPL_BUILD
+int fsl_setenv_chain_of_trust(void)
+{
+ /* Check Boot Mode
+ * If Boot Mode is Non-Secure, no changes are required
+ */
+ if (fsl_check_boot_mode_secure() == 0)
+ return 0;
+
+ /* If Boot mode is Secure, set the environment variables
+ * bootdelay = 0 (To disable Boot Prompt)
+ * bootcmd = CHAIN_BOOT_CMD (Validate and execute Boot script)
+ */
+ env_set("bootdelay", "-2");
+
+#ifdef CONFIG_ARM
+ env_set("secureboot", "y");
+#else
+ env_set("bootcmd", CHAIN_BOOT_CMD);
+#endif
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SPL_BUILD
+void spl_validate_uboot(uint32_t hdr_addr, uintptr_t img_addr)
+{
+ int res;
+
+ /*
+ * Check Boot Mode
+ * If Boot Mode is Non-Secure, skip validation
+ */
+ if (fsl_check_boot_mode_secure() == 0)
+ return;
+
+ printf("SPL: Validating U-Boot image\n");
+
+#ifdef CONFIG_ADDR_MAP
+ init_addr_map();
+#endif
+
+#ifdef CONFIG_FSL_CORENET
+ if (pamu_init() < 0)
+ fsl_secboot_handle_error(ERROR_ESBC_PAMU_INIT);
+#endif
+
+/*
+ * dm_init_and_scan() is called as part of common SPL framework, so no
+ * need to call it again but in case of powerpc platforms which currently
+ * do not use common SPL framework, so need to call this function here.
+ */
+#if defined(CONFIG_SPL_DM) && (!defined(CONFIG_SPL_FRAMEWORK))
+ dm_init_and_scan(true);
+#endif
+ res = fsl_secboot_validate(hdr_addr, CONFIG_SPL_UBOOT_KEY_HASH,
+ &img_addr);
+
+ if (res == 0)
+ printf("SPL: Validation of U-Boot successful\n");
+}
+
+#ifdef CONFIG_SPL_FRAMEWORK
+/* Override weak funtion defined in SPL framework to enable validation
+ * of main u-boot image before jumping to u-boot image.
+ */
+void __noreturn jump_to_image_no_args(struct spl_image_info *spl_image)
+{
+ typedef void __noreturn (*image_entry_noargs_t)(void);
+ uint32_t hdr_addr;
+
+ image_entry_noargs_t image_entry =
+ (image_entry_noargs_t)(unsigned long)spl_image->entry_point;
+
+ hdr_addr = (spl_image->entry_point + spl_image->size -
+ FSL_U_BOOT_HDR_SIZE);
+ spl_validate_uboot(hdr_addr, (uintptr_t)spl_image->entry_point);
+ /*
+ * In case of failure in validation, spl_validate_uboot would
+ * not return back in case of Production environment with ITS=1.
+ * Thus U-Boot will not start.
+ * In Development environment (ITS=0 and SB_EN=1), the function
+ * may return back in case of non-fatal failures.
+ */
+
+ debug("image entry point: 0x%lX\n", spl_image->entry_point);
+ image_entry();
+}
+#endif /* ifdef CONFIG_SPL_FRAMEWORK */
+#endif /* ifdef CONFIG_SPL_BUILD */
diff --git a/board/freescale/common/fsl_validate.c b/board/freescale/common/fsl_validate.c
new file mode 100644
index 00000000000..e03434dcdfe
--- /dev/null
+++ b/board/freescale/common/fsl_validate.c
@@ -0,0 +1,975 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2021-2022 NXP
+ */
+
+#include <config.h>
+#include <dm.h>
+#include <fsl_validate.h>
+#include <fsl_secboot_err.h>
+#include <fsl_sfp.h>
+#include <fsl_sec.h>
+#include <command.h>
+#include <log.h>
+#include <malloc.h>
+#include <u-boot/rsa-mod-exp.h>
+#include <hash.h>
+#include <fsl_secboot_err.h>
+#ifdef CONFIG_ARCH_LS1021A
+#include <asm/arch/immap_ls102xa.h>
+#endif
+#include <dm/lists.h>
+
+#define SHA256_BITS 256
+#define SHA256_BYTES (256/8)
+#define SHA256_NIBBLES (256/4)
+#define NUM_HEX_CHARS (sizeof(ulong) * 2)
+
+#define CHECK_KEY_LEN(key_len) (((key_len) == 2 * KEY_SIZE_BYTES / 4) || \
+ ((key_len) == 2 * KEY_SIZE_BYTES / 2) || \
+ ((key_len) == 2 * KEY_SIZE_BYTES))
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+/* Global data structure */
+static struct fsl_secboot_glb glb;
+#endif
+
+/* This array contains DER value for SHA-256 */
+static const u8 hash_identifier[] = { 0x30, 0x31, 0x30, 0x0d, 0x06, 0x09, 0x60,
+ 0x86, 0x48, 0x01, 0x65, 0x03, 0x04, 0x02, 0x01, 0x05, 0x00,
+ 0x04, 0x20
+ };
+
+static u8 hash_val[SHA256_BYTES];
+
+#ifdef CONFIG_ESBC_HDR_LS
+/* New Barker Code for LS ESBC Header */
+static const u8 barker_code[ESBC_BARKER_LEN] = { 0x12, 0x19, 0x20, 0x01 };
+#else
+static const u8 barker_code[ESBC_BARKER_LEN] = { 0x68, 0x39, 0x27, 0x81 };
+#endif
+
+void branch_to_self(void) __attribute__ ((noreturn));
+
+/*
+ * This function will put core in infinite loop.
+ * This will be called when the ESBC can not proceed further due
+ * to some unknown errors.
+ */
+void branch_to_self(void)
+{
+ printf("Core is in infinite loop due to errors.\n");
+self:
+ goto self;
+}
+
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+static u32 check_ie(struct fsl_secboot_img_priv *img)
+{
+ if (img->hdr.ie_flag & IE_FLAG_MASK)
+ return 1;
+
+ return 0;
+}
+
+/* This function returns the CSF Header Address of uboot
+ * For MPC85xx based platforms, the LAW mapping for NOR
+ * flash changes in uboot code. Hence the offset needs
+ * to be calculated and added to the new NOR flash base
+ * address
+ */
+#if defined(CONFIG_MPC85xx)
+#include <flash.h>
+
+int get_csf_base_addr(u32 *csf_addr, u32 *flash_base_addr)
+{
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 csf_hdr_addr = in_be32(&gur->scratchrw[0]);
+ u32 csf_flash_offset = csf_hdr_addr & ~(CFG_SYS_PBI_FLASH_BASE);
+ u32 flash_addr, addr;
+ int found = 0;
+ int i = 0;
+
+ for (i = 0; i < CONFIG_SYS_MAX_FLASH_BANKS; i++) {
+ flash_addr = flash_info[i].start[0];
+ addr = flash_info[i].start[0] + csf_flash_offset;
+ if (memcmp((u8 *)addr, barker_code, ESBC_BARKER_LEN) == 0) {
+ debug("Barker found on addr %x\n", addr);
+ found = 1;
+ break;
+ }
+ }
+
+ if (!found)
+ return -1;
+
+ *csf_addr = addr;
+ *flash_base_addr = flash_addr;
+
+ return 0;
+}
+#else
+/* For platforms like LS1020, correct flash address is present in
+ * the header. So the function reqturns flash base address as 0
+ */
+int get_csf_base_addr(u32 *csf_addr, u32 *flash_base_addr)
+{
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 csf_hdr_addr = in_be32(&gur->scratchrw[0]);
+
+ if (memcmp((u8 *)(uintptr_t)csf_hdr_addr,
+ barker_code, ESBC_BARKER_LEN))
+ return -1;
+
+ *csf_addr = csf_hdr_addr;
+ *flash_base_addr = 0;
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_ESBC_HDR_LS)
+static int get_ie_info_addr(uintptr_t *ie_addr)
+{
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ /* For LS-CH3, the address of IE Table is
+ * stated in Scratch13 and scratch14 of DCFG.
+ * Bootrom validates this table while validating uboot.
+ * DCFG is LE*/
+ *ie_addr = in_le32(&gur->scratchrw[SCRATCH_IE_HIGH_ADR - 1]);
+ *ie_addr = *ie_addr << 32;
+ *ie_addr |= in_le32(&gur->scratchrw[SCRATCH_IE_LOW_ADR - 1]);
+ return 0;
+}
+#else /* CONFIG_ESBC_HDR_LS */
+static int get_ie_info_addr(uintptr_t *ie_addr)
+{
+ struct fsl_secboot_img_hdr *hdr;
+ struct fsl_secboot_sg_table *sg_tbl;
+ u32 flash_base_addr, csf_addr;
+
+ if (get_csf_base_addr(&csf_addr, &flash_base_addr))
+ return -1;
+
+ hdr = (struct fsl_secboot_img_hdr *)(uintptr_t)csf_addr;
+
+ /* For SoC's with Trust Architecture v1 with corenet bus
+ * the sg table field in CSF header has absolute address
+ * for sg table in memory. In other Trust Architecture,
+ * this field specifies the offset of sg table from the
+ * base address of CSF Header
+ */
+#if defined(CONFIG_FSL_TRUST_ARCH_v1) && defined(CONFIG_FSL_CORENET)
+ sg_tbl = (struct fsl_secboot_sg_table *)
+ (((u32)hdr->psgtable & ~(CFG_SYS_PBI_FLASH_BASE)) +
+ flash_base_addr);
+#else
+ sg_tbl = (struct fsl_secboot_sg_table *)(uintptr_t)(csf_addr +
+ (u32)hdr->psgtable);
+#endif
+
+ /* IE Key Table is the first entry in the SG Table */
+#if defined(CONFIG_MPC85xx)
+ *ie_addr = (uintptr_t)((sg_tbl->src_addr &
+ ~(CFG_SYS_PBI_FLASH_BASE)) +
+ flash_base_addr);
+#else
+ *ie_addr = (uintptr_t)sg_tbl->src_addr;
+#endif
+
+ debug("IE Table address is %lx\n", *ie_addr);
+ return 0;
+}
+#endif /* CONFIG_ESBC_HDR_LS */
+#endif
+
+#ifdef CONFIG_KEY_REVOCATION
+/* This function checks srk_table_flag in header and set/reset srk_flag.*/
+static u32 check_srk(struct fsl_secboot_img_priv *img)
+{
+#ifdef CONFIG_ESBC_HDR_LS
+ /* In LS, No SRK Flag as SRK is always present if IE not present*/
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ return !check_ie(img);
+#endif
+ return 1;
+#else
+ if (img->hdr.len_kr.srk_table_flag & SRK_FLAG)
+ return 1;
+
+ return 0;
+#endif
+}
+
+/* This function returns ospr's key_revoc values.*/
+static u32 get_key_revoc(void)
+{
+ struct ccsr_sfp_regs *sfp_regs = (void *)(CFG_SYS_SFP_ADDR);
+ return (sfp_in32(&sfp_regs->ospr) & OSPR_KEY_REVOC_MASK) >>
+ OSPR_KEY_REVOC_SHIFT;
+}
+
+/* This function checks if selected key is revoked or not.*/
+static u32 is_key_revoked(u32 keynum, u32 rev_flag)
+{
+ if (keynum == UNREVOCABLE_KEY)
+ return 0;
+
+ if ((u32)(1 << (ALIGN_REVOC_KEY - keynum)) & rev_flag)
+ return 1;
+
+ return 0;
+}
+
+/* It read validates srk_table key lengths.*/
+static u32 read_validate_srk_tbl(struct fsl_secboot_img_priv *img)
+{
+ int i = 0;
+ u32 ret, key_num, key_revoc_flag, size;
+ struct fsl_secboot_img_hdr *hdr = &img->hdr;
+ void *esbc = (u8 *)(uintptr_t)img->ehdrloc;
+
+ if ((hdr->len_kr.num_srk == 0) ||
+ (hdr->len_kr.num_srk > MAX_KEY_ENTRIES))
+ return ERROR_ESBC_CLIENT_HEADER_INVALID_SRK_NUM_ENTRY;
+
+ key_num = hdr->len_kr.srk_sel;
+ if (key_num == 0 || key_num > hdr->len_kr.num_srk)
+ return ERROR_ESBC_CLIENT_HEADER_INVALID_KEY_NUM;
+
+ /* Get revoc key from sfp */
+ key_revoc_flag = get_key_revoc();
+ ret = is_key_revoked(key_num, key_revoc_flag);
+ if (ret)
+ return ERROR_ESBC_CLIENT_HEADER_KEY_REVOKED;
+
+ size = hdr->len_kr.num_srk * sizeof(struct srk_table);
+
+ memcpy(&img->srk_tbl, esbc + hdr->srk_tbl_off, size);
+
+ for (i = 0; i < hdr->len_kr.num_srk; i++) {
+ if (!CHECK_KEY_LEN(img->srk_tbl[i].key_len))
+ return ERROR_ESBC_CLIENT_HEADER_INV_SRK_ENTRY_KEYLEN;
+ }
+
+ img->key_len = img->srk_tbl[key_num - 1].key_len;
+
+ memcpy(&img->img_key, &(img->srk_tbl[key_num - 1].pkey),
+ img->key_len);
+
+ return 0;
+}
+#endif
+
+#ifndef CONFIG_ESBC_HDR_LS
+static u32 read_validate_single_key(struct fsl_secboot_img_priv *img)
+{
+ struct fsl_secboot_img_hdr *hdr = &img->hdr;
+ void *esbc = (u8 *)(uintptr_t)img->ehdrloc;
+
+ /* check key length */
+ if (!CHECK_KEY_LEN(hdr->key_len))
+ return ERROR_ESBC_CLIENT_HEADER_KEY_LEN;
+
+ memcpy(&img->img_key, esbc + hdr->pkey, hdr->key_len);
+
+ img->key_len = hdr->key_len;
+
+ return 0;
+}
+#endif /* CONFIG_ESBC_HDR_LS */
+
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+
+static void install_ie_tbl(uintptr_t ie_tbl_addr,
+ struct fsl_secboot_img_priv *img)
+{
+ /* Copy IE tbl to Global Data */
+ memcpy(&glb.ie_tbl, (u8 *)ie_tbl_addr, sizeof(struct ie_key_info));
+ img->ie_addr = (uintptr_t)&glb.ie_tbl;
+ glb.ie_addr = img->ie_addr;
+}
+
+static u32 read_validate_ie_tbl(struct fsl_secboot_img_priv *img)
+{
+ struct fsl_secboot_img_hdr *hdr = &img->hdr;
+ u32 ie_key_len, ie_revoc_flag, ie_num;
+ struct ie_key_info *ie_info;
+
+ if (!img->ie_addr) {
+ if (get_ie_info_addr(&img->ie_addr))
+ return ERROR_IE_TABLE_NOT_FOUND;
+ else
+ install_ie_tbl(img->ie_addr, img);
+ }
+
+ ie_info = (struct ie_key_info *)(uintptr_t)img->ie_addr;
+ if (ie_info->num_keys == 0 || ie_info->num_keys > 32)
+ return ERROR_ESBC_CLIENT_HEADER_INVALID_IE_NUM_ENTRY;
+
+ ie_num = hdr->ie_key_sel;
+ if (ie_num == 0 || ie_num > ie_info->num_keys)
+ return ERROR_ESBC_CLIENT_HEADER_INVALID_IE_KEY_NUM;
+
+ ie_revoc_flag = ie_info->key_revok;
+ if ((u32)(1 << (ie_num - 1)) & ie_revoc_flag)
+ return ERROR_ESBC_CLIENT_HEADER_IE_KEY_REVOKED;
+
+ ie_key_len = ie_info->ie_key_tbl[ie_num - 1].key_len;
+
+ if (!CHECK_KEY_LEN(ie_key_len))
+ return ERROR_ESBC_CLIENT_HEADER_INV_IE_ENTRY_KEYLEN;
+
+ memcpy(&img->img_key, &(ie_info->ie_key_tbl[ie_num - 1].pkey),
+ ie_key_len);
+
+ img->key_len = ie_key_len;
+ return 0;
+}
+#endif
+
+
+/* This function return length of public key.*/
+static inline u32 get_key_len(struct fsl_secboot_img_priv *img)
+{
+ return img->key_len;
+}
+
+/*
+ * Handles the ESBC uboot client header verification failure.
+ * This function handles all the errors which might occur in the
+ * parsing and checking of ESBC uboot client header. It will also
+ * set the error bits in the SEC_MON.
+ */
+static void fsl_secboot_header_verification_failure(void)
+{
+ struct ccsr_sfp_regs *sfp_regs = (void *)(CFG_SYS_SFP_ADDR);
+
+ /* 29th bit of OSPR is ITS */
+ u32 its = sfp_in32(&sfp_regs->ospr) >> 2;
+
+ if (its == 1)
+ set_sec_mon_state(HPSR_SSM_ST_SOFT_FAIL);
+ else
+ set_sec_mon_state(HPSR_SSM_ST_NON_SECURE);
+
+ printf("Generating reset request\n");
+ do_reset(NULL, 0, 0, NULL);
+ /* If reset doesn't coocur, halt execution */
+ do_esbc_halt(NULL, 0, 0, NULL);
+}
+
+/*
+ * Handles the ESBC uboot client image verification failure.
+ * This function handles all the errors which might occur in the
+ * public key hash comparison and signature verification of
+ * ESBC uboot client image. It will also
+ * set the error bits in the SEC_MON.
+ */
+static void fsl_secboot_image_verification_failure(void)
+{
+ struct ccsr_sfp_regs *sfp_regs = (void *)(CFG_SYS_SFP_ADDR);
+
+ u32 its = (sfp_in32(&sfp_regs->ospr) & ITS_MASK) >> ITS_BIT;
+
+ if (its == 1) {
+ set_sec_mon_state(HPSR_SSM_ST_SOFT_FAIL);
+
+ printf("Generating reset request\n");
+ do_reset(NULL, 0, 0, NULL);
+ /* If reset doesn't coocur, halt execution */
+ do_esbc_halt(NULL, 0, 0, NULL);
+
+ } else {
+ set_sec_mon_state(HPSR_SSM_ST_NON_SECURE);
+ }
+}
+
+static void fsl_secboot_bootscript_parse_failure(void)
+{
+ fsl_secboot_header_verification_failure();
+}
+
+/*
+ * Handles the errors in esbc boot.
+ * This function handles all the errors which might occur in the
+ * esbc boot phase. It will call the appropriate api to log the
+ * errors and set the error bits in the SEC_MON.
+ */
+void fsl_secboot_handle_error(int error)
+{
+#ifndef CONFIG_SPL_BUILD
+ const struct fsl_secboot_errcode *e;
+
+ for (e = fsl_secboot_errcodes; e->errcode != ERROR_ESBC_CLIENT_MAX;
+ e++) {
+ if (e->errcode == error)
+ printf("ERROR :: %x :: %s\n", error, e->name);
+ }
+#else
+ printf("ERROR :: %x\n", error);
+#endif
+
+ /* If Boot Mode is secure, transition the SNVS state and issue
+ * reset based on type of failure and ITS setting.
+ * If Boot mode is non-secure, return from this function.
+ */
+ if (fsl_check_boot_mode_secure() == 0)
+ return;
+
+ switch (error) {
+ case ERROR_ESBC_CLIENT_HEADER_BARKER:
+ case ERROR_ESBC_CLIENT_HEADER_IMG_SIZE:
+ case ERROR_ESBC_CLIENT_HEADER_KEY_LEN:
+ case ERROR_ESBC_CLIENT_HEADER_SIG_LEN:
+ case ERROR_ESBC_CLIENT_HEADER_KEY_LEN_NOT_TWICE_SIG_LEN:
+ case ERROR_ESBC_CLIENT_HEADER_KEY_MOD_1:
+ case ERROR_ESBC_CLIENT_HEADER_KEY_MOD_2:
+ case ERROR_ESBC_CLIENT_HEADER_SIG_KEY_MOD:
+ case ERROR_ESBC_CLIENT_HEADER_SG_ESBC_EP:
+ case ERROR_ESBC_CLIENT_HEADER_SG_ENTIRES_BAD:
+ case ERROR_KEY_TABLE_NOT_FOUND:
+#ifdef CONFIG_KEY_REVOCATION
+ case ERROR_ESBC_CLIENT_HEADER_KEY_REVOKED:
+ case ERROR_ESBC_CLIENT_HEADER_INVALID_SRK_NUM_ENTRY:
+ case ERROR_ESBC_CLIENT_HEADER_INVALID_KEY_NUM:
+ case ERROR_ESBC_CLIENT_HEADER_INV_SRK_ENTRY_KEYLEN:
+#endif
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ /*@fallthrough@*/
+ case ERROR_ESBC_CLIENT_HEADER_IE_KEY_REVOKED:
+ case ERROR_ESBC_CLIENT_HEADER_INVALID_IE_NUM_ENTRY:
+ case ERROR_ESBC_CLIENT_HEADER_INVALID_IE_KEY_NUM:
+ case ERROR_ESBC_CLIENT_HEADER_INV_IE_ENTRY_KEYLEN:
+ case ERROR_IE_TABLE_NOT_FOUND:
+#endif
+ fsl_secboot_header_verification_failure();
+ break;
+ case ERROR_ESBC_SEC_RESET:
+ case ERROR_ESBC_SEC_DEQ:
+ case ERROR_ESBC_SEC_ENQ:
+ case ERROR_ESBC_SEC_DEQ_TO:
+ case ERROR_ESBC_SEC_JOBQ_STATUS:
+ case ERROR_ESBC_CLIENT_HASH_COMPARE_KEY:
+ case ERROR_ESBC_CLIENT_HASH_COMPARE_EM:
+ fsl_secboot_image_verification_failure();
+ break;
+ case ERROR_ESBC_MISSING_BOOTM:
+ fsl_secboot_bootscript_parse_failure();
+ break;
+ case ERROR_ESBC_WRONG_CMD:
+ default:
+ branch_to_self();
+ break;
+ }
+}
+
+static void fsl_secblk_handle_error(int error)
+{
+ switch (error) {
+ case ERROR_ESBC_SEC_ENQ:
+ fsl_secboot_handle_error(ERROR_ESBC_SEC_ENQ);
+ break;
+ case ERROR_ESBC_SEC_DEQ:
+ fsl_secboot_handle_error(ERROR_ESBC_SEC_DEQ);
+ break;
+ case ERROR_ESBC_SEC_DEQ_TO:
+ fsl_secboot_handle_error(ERROR_ESBC_SEC_DEQ_TO);
+ break;
+ default:
+ printf("Job Queue Output status %x\n", error);
+ fsl_secboot_handle_error(ERROR_ESBC_SEC_JOBQ_STATUS);
+ break;
+ }
+}
+
+/*
+ * Calculate hash of key obtained via offset present in ESBC uboot
+ * client hdr. This function calculates the hash of key which is obtained
+ * through offset present in ESBC uboot client header.
+ */
+static int calc_img_key_hash(struct fsl_secboot_img_priv *img)
+{
+ struct hash_algo *algo;
+ void *ctx;
+ int i, srk = 0;
+ int ret = 0;
+ const char *algo_name = "sha256";
+
+ /* Calculate hash of the esbc key */
+ ret = hash_progressive_lookup_algo(algo_name, &algo);
+ if (ret)
+ return ret;
+
+ ret = algo->hash_init(algo, &ctx);
+ if (ret)
+ return ret;
+ /* Update hash for ESBC key */
+#ifdef CONFIG_KEY_REVOCATION
+ if (check_srk(img)) {
+ ret = algo->hash_update(algo, ctx,
+ (u8 *)(uintptr_t)(img->ehdrloc + img->hdr.srk_tbl_off),
+ img->hdr.len_kr.num_srk * sizeof(struct srk_table), 1);
+ srk = 1;
+ }
+#endif
+ if (!srk)
+ ret = algo->hash_update(algo, ctx,
+ img->img_key, img->key_len, 1);
+ if (ret)
+ return ret;
+ /* Copy hash at destination buffer */
+ ret = algo->hash_finish(algo, ctx, hash_val, algo->digest_size);
+ if (ret) {
+ free(ctx);
+ return ret;
+ }
+ for (i = 0; i < SHA256_BYTES; i++)
+ img->img_key_hash[i] = hash_val[i];
+
+ return 0;
+}
+
+/*
+ * Calculate hash of ESBC hdr and ESBC. This function calculates the
+ * single hash of ESBC header and ESBC image. If SG flag is on, all
+ * SG entries are also hashed alongwith the complete SG table.
+ */
+static int calc_esbchdr_esbc_hash(struct fsl_secboot_img_priv *img)
+{
+ struct hash_algo *algo;
+ void *ctx;
+ int ret = 0;
+ int key_hash = 0;
+ const char *algo_name = "sha256";
+
+ /* Calculate the hash of the ESBC */
+ ret = hash_progressive_lookup_algo(algo_name, &algo);
+ if (ret)
+ return ret;
+
+ ret = algo->hash_init(algo, &ctx);
+ /* Copy hash at destination buffer */
+ if (ret)
+ return ret;
+
+ /* Update hash for CSF Header */
+ ret = algo->hash_update(algo, ctx,
+ (u8 *)&img->hdr, sizeof(struct fsl_secboot_img_hdr), 0);
+ if (ret)
+ return ret;
+
+ /* Update the hash with that of srk table if srk flag is 1
+ * If IE Table is selected, key is not added in the hash
+ * If neither srk table nor IE key table available, add key
+ * from header in the hash calculation
+ */
+#ifdef CONFIG_KEY_REVOCATION
+ if (check_srk(img)) {
+ ret = algo->hash_update(algo, ctx,
+ (u8 *)(uintptr_t)(img->ehdrloc + img->hdr.srk_tbl_off),
+ img->hdr.len_kr.num_srk * sizeof(struct srk_table), 0);
+ key_hash = 1;
+ }
+#endif
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ if (!key_hash && check_ie(img))
+ key_hash = 1;
+#endif
+#ifndef CONFIG_ESBC_HDR_LS
+/* No single key support in LS ESBC header */
+ if (!key_hash) {
+ ret = algo->hash_update(algo, ctx,
+ img->img_key, img->hdr.key_len, 0);
+ key_hash = 1;
+ }
+#endif
+ if (ret)
+ return ret;
+ if (!key_hash) {
+ free(ctx);
+ return ERROR_KEY_TABLE_NOT_FOUND;
+ }
+ /* Update hash for actual Image */
+ ret = algo->hash_update(algo, ctx,
+ (u8 *)(*(img->img_addr_ptr)), img->img_size, 1);
+ if (ret)
+ return ret;
+
+ /* Copy hash at destination buffer */
+ ret = algo->hash_finish(algo, ctx, hash_val, algo->digest_size);
+ if (ret) {
+ free(ctx);
+ return ret;
+ }
+ return 0;
+}
+
+/*
+ * Construct encoded hash EM' wrt PKCSv1.5. This function calculates the
+ * pointers for padding, DER value and hash. And finally, constructs EM'
+ * which includes hash of complete CSF header and ESBC image. If SG flag
+ * is on, hash of SG table and entries is also included.
+ */
+static void construct_img_encoded_hash_second(struct fsl_secboot_img_priv *img)
+{
+ /*
+ * RSA PKCSv1.5 encoding format for encoded message is below
+ * EM = 0x0 || 0x1 || PS || 0x0 || DER || Hash
+ * PS is Padding String
+ * DER is DER value for SHA-256
+ * Hash is SHA-256 hash
+ * *********************************************************
+ * representative points to first byte of EM initially and is
+ * filled with 0x0
+ * representative is incremented by 1 and second byte is filled
+ * with 0x1
+ * padding points to third byte of EM
+ * digest points to full length of EM - 32 bytes
+ * hash_id (DER value) points to 19 bytes before pDigest
+ * separator is one byte which separates padding and DER
+ */
+
+ size_t len;
+ u8 *representative;
+ u8 *padding, *digest;
+ u8 *hash_id, *separator;
+ int i;
+
+ len = (get_key_len(img) / 2) - 1;
+ representative = img->img_encoded_hash_second;
+ representative[0] = 0;
+ representative[1] = 1; /* block type 1 */
+
+ padding = &representative[2];
+ digest = &representative[1] + len - 32;
+ hash_id = digest - sizeof(hash_identifier);
+ separator = hash_id - 1;
+
+ /* fill padding area pointed by padding with 0xff */
+ memset(padding, 0xff, separator - padding);
+
+ /* fill byte pointed by separator */
+ *separator = 0;
+
+ /* fill SHA-256 DER value pointed by HashId */
+ memcpy(hash_id, hash_identifier, sizeof(hash_identifier));
+
+ /* fill hash pointed by Digest */
+ for (i = 0; i < SHA256_BYTES; i++)
+ digest[i] = hash_val[i];
+}
+
+/*
+ * Reads and validates the ESBC client header.
+ * This function reads key and signature from the ESBC client header.
+ * If Scatter/Gather flag is on, lengths and offsets of images
+ * present as SG entries are also read. This function also checks
+ * whether the header is valid or not.
+ */
+static int read_validate_esbc_client_header(struct fsl_secboot_img_priv *img)
+{
+ struct fsl_secboot_img_hdr *hdr = &img->hdr;
+ void *esbc = (u8 *)(uintptr_t)img->ehdrloc;
+ u8 *k, *s;
+ u32 ret = 0;
+
+ int key_found = 0;
+
+ /* check barker code */
+ if (memcmp(hdr->barker, barker_code, ESBC_BARKER_LEN))
+ return ERROR_ESBC_CLIENT_HEADER_BARKER;
+
+ /* If Image Address is not passed as argument to function,
+ * then Address and Size must be read from the Header.
+ */
+ if (*(img->img_addr_ptr) == 0) {
+ #ifdef CONFIG_ESBC_ADDR_64BIT
+ *(img->img_addr_ptr) = hdr->pimg64;
+ #else
+ *(img->img_addr_ptr) = hdr->pimg;
+ #endif
+ }
+
+ if (!hdr->img_size)
+ return ERROR_ESBC_CLIENT_HEADER_IMG_SIZE;
+
+ img->img_size = hdr->img_size;
+
+ /* Key checking*/
+#ifdef CONFIG_KEY_REVOCATION
+ if (check_srk(img)) {
+ ret = read_validate_srk_tbl(img);
+ if (ret != 0)
+ return ret;
+ key_found = 1;
+ }
+#endif
+
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ if (!key_found && check_ie(img)) {
+ ret = read_validate_ie_tbl(img);
+ if (ret != 0)
+ return ret;
+ key_found = 1;
+ }
+#endif
+#ifndef CONFIG_ESBC_HDR_LS
+/* Single Key Feature not available in LS ESBC Header */
+ if (key_found == 0) {
+ ret = read_validate_single_key(img);
+ if (ret != 0)
+ return ret;
+ key_found = 1;
+ }
+#endif
+ if (!key_found)
+ return ERROR_KEY_TABLE_NOT_FOUND;
+
+ /* check signaure */
+ if (get_key_len(img) == 2 * hdr->sign_len) {
+ /* check signature length */
+ if (!((hdr->sign_len == KEY_SIZE_BYTES / 4) ||
+ (hdr->sign_len == KEY_SIZE_BYTES / 2) ||
+ (hdr->sign_len == KEY_SIZE_BYTES)))
+ return ERROR_ESBC_CLIENT_HEADER_SIG_LEN;
+ } else {
+ return ERROR_ESBC_CLIENT_HEADER_KEY_LEN_NOT_TWICE_SIG_LEN;
+ }
+
+ memcpy(&img->img_sign, esbc + hdr->psign, hdr->sign_len);
+/* No SG support in LS-CH3 */
+#ifndef CONFIG_ESBC_HDR_LS
+ /* No SG support */
+ if (hdr->sg_flag)
+ return ERROR_ESBC_CLIENT_HEADER_SG;
+#endif
+
+ /* modulus most significant bit should be set */
+ k = (u8 *)&img->img_key;
+
+ if ((k[0] & 0x80) == 0)
+ return ERROR_ESBC_CLIENT_HEADER_KEY_MOD_1;
+
+ /* modulus value should be odd */
+ if ((k[get_key_len(img) / 2 - 1] & 0x1) == 0)
+ return ERROR_ESBC_CLIENT_HEADER_KEY_MOD_2;
+
+ /* Check signature value < modulus value */
+ s = (u8 *)&img->img_sign;
+
+ if (!(memcmp(s, k, hdr->sign_len) < 0))
+ return ERROR_ESBC_CLIENT_HEADER_SIG_KEY_MOD;
+
+ return ESBC_VALID_HDR;
+}
+
+static inline int str2longbe(const char *p, ulong *num)
+{
+ char *endptr;
+ ulong tmp;
+
+ if (!p) {
+ return 0;
+ } else {
+ tmp = hextoul(p, &endptr);
+ if (sizeof(ulong) == 4)
+ *num = cpu_to_be32(tmp);
+ else
+ *num = cpu_to_be64(tmp);
+ }
+
+ return *p != '\0' && *endptr == '\0';
+}
+/* Function to calculate the ESBC Image Hash
+ * and hash from Digital signature.
+ * The Two hash's are compared to yield the
+ * result of signature validation.
+ */
+static int calculate_cmp_img_sig(struct fsl_secboot_img_priv *img)
+{
+ int ret;
+ uint32_t key_len;
+ struct key_prop prop;
+#if !defined(USE_HOSTCC)
+ struct udevice *mod_exp_dev;
+#endif
+ ret = calc_esbchdr_esbc_hash(img);
+ if (ret)
+ return ret;
+
+ /* Construct encoded hash EM' wrt PKCSv1.5 */
+ construct_img_encoded_hash_second(img);
+
+ /* Fill prop structure for public key */
+ memset(&prop, 0, sizeof(struct key_prop));
+ key_len = get_key_len(img) / 2;
+ prop.modulus = img->img_key;
+ prop.public_exponent = img->img_key + key_len;
+ prop.num_bits = key_len * 8;
+ prop.exp_len = key_len;
+
+#if defined(CONFIG_SPL_BUILD)
+ ret = device_bind_driver(NULL, "fsl_rsa_mod_exp", "fsl_rsa_mod_exp", NULL);
+ if (ret) {
+ printf("Couldn't bind fsl_rsa_mod_exp driver (%d)\n", ret);
+ return -EINVAL;
+ }
+#endif
+ ret = uclass_get_device(UCLASS_MOD_EXP, 0, &mod_exp_dev);
+ if (ret) {
+ printf("RSA: Can't find Modular Exp implementation\n");
+ return -EINVAL;
+ }
+
+ ret = rsa_mod_exp(mod_exp_dev, img->img_sign, img->hdr.sign_len,
+ &prop, img->img_encoded_hash);
+ if (ret)
+ return ret;
+
+ /*
+ * compare the encoded messages EM' and EM wrt RSA PKCSv1.5
+ * memcmp returns zero on success
+ * memcmp returns non-zero on failure
+ */
+ ret = memcmp(&img->img_encoded_hash_second, &img->img_encoded_hash,
+ img->hdr.sign_len);
+
+ if (ret)
+ return ERROR_ESBC_CLIENT_HASH_COMPARE_EM;
+
+ return 0;
+}
+/* Function to initialize img priv and global data structure
+ */
+static int secboot_init(struct fsl_secboot_img_priv **img_ptr)
+{
+ *img_ptr = malloc(sizeof(struct fsl_secboot_img_priv));
+
+ struct fsl_secboot_img_priv *img = *img_ptr;
+
+ if (!img)
+ return -ENOMEM;
+ memset(img, 0, sizeof(struct fsl_secboot_img_priv));
+
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ if (glb.ie_addr)
+ img->ie_addr = glb.ie_addr;
+#endif
+ return 0;
+}
+
+
+/* haddr - Address of the header of image to be validated.
+ * arg_hash_str - Option hash string. If provided, this
+ * overrides the key hash in the SFP fuses.
+ * img_addr_ptr - Optional pointer to address of image to be validated.
+ * If non zero addr, this overrides the addr of image in header,
+ * otherwise updated to image addr in header.
+ * Acts as both input and output of function.
+ * This pointer shouldn't be NULL.
+ */
+int fsl_secboot_validate(uintptr_t haddr, char *arg_hash_str,
+ uintptr_t *img_addr_ptr)
+{
+ struct ccsr_sfp_regs *sfp_regs = (void *)(CFG_SYS_SFP_ADDR);
+ ulong hash[SHA256_BYTES/sizeof(ulong)];
+ char hash_str[NUM_HEX_CHARS + 1];
+ struct fsl_secboot_img_priv *img;
+ struct fsl_secboot_img_hdr *hdr;
+ void *esbc;
+ int ret, i, hash_cmd = 0;
+ u32 srk_hash[8];
+
+ if (strlen(arg_hash_str) != 0) {
+ const char *cp = arg_hash_str;
+ int i = 0;
+
+ if (*cp == '0' && *(cp + 1) == 'x')
+ cp += 2;
+
+ /* The input string expected is in hex, where
+ * each 4 bits would be represented by a hex
+ * sha256 hash is 256 bits long, which would mean
+ * num of characters = 256 / 4
+ */
+ if (strlen(cp) != SHA256_NIBBLES) {
+ printf("%s is not a 256 bits hex string as expected\n",
+ arg_hash_str);
+ return -1;
+ }
+
+ for (i = 0; i < sizeof(hash)/sizeof(ulong); i++) {
+ strncpy(hash_str, cp + (i * NUM_HEX_CHARS),
+ NUM_HEX_CHARS);
+ hash_str[NUM_HEX_CHARS] = '\0';
+ if (!str2longbe(hash_str, &hash[i])) {
+ printf("%s is not a 256 bits hex string ",
+ arg_hash_str);
+ return -1;
+ }
+ }
+
+ hash_cmd = 1;
+ }
+
+ ret = secboot_init(&img);
+ if (ret)
+ goto exit;
+
+ /* Update the information in Private Struct */
+ hdr = &img->hdr;
+ img->ehdrloc = haddr;
+ img->img_addr_ptr = img_addr_ptr;
+ esbc = (u8 *)img->ehdrloc;
+
+ memcpy(hdr, esbc, sizeof(struct fsl_secboot_img_hdr));
+
+ /* read and validate esbc header */
+ ret = read_validate_esbc_client_header(img);
+
+ if (ret != ESBC_VALID_HDR) {
+ fsl_secboot_handle_error(ret);
+ goto exit;
+ }
+
+ /* SRKH present in SFP */
+ for (i = 0; i < NUM_SRKH_REGS; i++)
+ srk_hash[i] = srk_in32(&sfp_regs->srk_hash[i]);
+
+ /*
+ * Calculate hash of key obtained via offset present in
+ * ESBC uboot client hdr
+ */
+ ret = calc_img_key_hash(img);
+ if (ret) {
+ fsl_secblk_handle_error(ret);
+ goto exit;
+ }
+
+ /* Compare hash obtained above with SRK hash present in SFP */
+ if (hash_cmd)
+ ret = memcmp(&hash, &img->img_key_hash, SHA256_BYTES);
+ else
+ ret = memcmp(srk_hash, img->img_key_hash, SHA256_BYTES);
+
+#if CONFIG_IS_ENABLED(FSL_ISBC_KEY_EXT)
+ if (!hash_cmd && check_ie(img))
+ ret = 0;
+#endif
+
+ if (ret != 0) {
+ fsl_secboot_handle_error(ERROR_ESBC_CLIENT_HASH_COMPARE_KEY);
+ goto exit;
+ }
+
+ ret = calculate_cmp_img_sig(img);
+ if (ret) {
+ fsl_secboot_handle_error(ret);
+ goto exit;
+ }
+
+exit:
+ /* Free Img as it was malloc'ed*/
+ free(img);
+ return ret;
+}
diff --git a/board/freescale/common/i2c_common.c b/board/freescale/common/i2c_common.c
new file mode 100644
index 00000000000..20705ecc8e4
--- /dev/null
+++ b/board/freescale/common/i2c_common.c
@@ -0,0 +1,34 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-21 NXP
+ * Copyright 2021 Microsoft Corporation
+ */
+
+#include <stdio.h>
+#include <i2c.h>
+#include "i2c_common.h"
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+
+/* If DM is in use, retrieve the chip for the specified bus number */
+int fsl_i2c_get_device(int address, int bus, DEVICE_HANDLE_T *dev)
+{
+ int ret = i2c_get_chip_for_busnum(bus, address, 1, dev);
+
+ if (ret)
+ printf("I2C: Bus %d has no device with address 0x%02X\n",
+ bus, address);
+ return ret;
+}
+
+#else
+
+/* Handle is passed directly */
+int fsl_i2c_get_device(int address, int bus, DEVICE_HANDLE_T *dev)
+{
+ *dev = address;
+ return 0;
+}
+
+#endif
diff --git a/board/freescale/common/i2c_common.h b/board/freescale/common/i2c_common.h
new file mode 100644
index 00000000000..77a7b6aedd7
--- /dev/null
+++ b/board/freescale/common/i2c_common.h
@@ -0,0 +1,30 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-21 NXP
+ * Copyright 2021 Microsoft Corporation
+ */
+
+#ifndef __NXP_I2C_COMMON_H__
+#define __NXP_I2C_COMMON_H__
+
+/* Common functionality shared by the I2C drivers for VID and the mux. */
+#if CONFIG_IS_ENABLED(DM_I2C)
+#define DEVICE_HANDLE_T struct udevice *
+
+#define I2C_READ(dev, register, data, length) \
+ dm_i2c_read(dev, register, data, length)
+#define I2C_WRITE(dev, register, data, length) \
+ dm_i2c_write(dev, register, data, length)
+#else
+#define DEVICE_HANDLE_T int
+
+#define I2C_READ(dev, register, data, length) \
+ i2c_read(dev, register, 1, data, length)
+#define I2C_WRITE(dev, register, data, length) \
+ i2c_write(dev, register, 1, data, length)
+#endif
+
+int fsl_i2c_get_device(int address, int bus, DEVICE_HANDLE_T *dev);
+
+#endif
diff --git a/board/freescale/common/i2c_mux.c b/board/freescale/common/i2c_mux.c
new file mode 100644
index 00000000000..89151ccaf06
--- /dev/null
+++ b/board/freescale/common/i2c_mux.c
@@ -0,0 +1,41 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-21 NXP
+ * Copyright 2021 Microsoft Corporation
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <stdio.h>
+#include "i2c_common.h"
+#include "i2c_mux.h"
+
+/*
+ * A new Kconfig option for something that used to always be built should be
+ * "default y".
+ */
+#ifdef CONFIG_FSL_USE_PCA9547_MUX
+
+int select_i2c_ch_pca9547(u8 ch, int bus)
+{
+ int ret;
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(I2C_MUX_PCA_ADDR_PRI, bus, &dev);
+ if (ret) {
+ printf("PCA: No PCA9547 device found\n");
+ return ret;
+ }
+
+ ret = I2C_WRITE(dev, 0, &ch, sizeof(ch));
+ if (ret) {
+ printf("PCA: Unable to select channel %d (%d)\n", (int)ch, ret);
+ return ret;
+ }
+
+ return 0;
+}
+
+#endif
diff --git a/board/freescale/common/i2c_mux.h b/board/freescale/common/i2c_mux.h
new file mode 100644
index 00000000000..0870c1918e6
--- /dev/null
+++ b/board/freescale/common/i2c_mux.h
@@ -0,0 +1,15 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-21 NXP
+ * Copyright 2021 Microsoft Corporation
+ */
+
+#ifndef __NXP_I2C_MUX_H__
+#define __NXP_I2C_MUX_H__
+
+#ifdef CONFIG_FSL_USE_PCA9547_MUX
+int select_i2c_ch_pca9547(u8 ch, int bus);
+#endif
+
+#endif
diff --git a/board/freescale/common/ics307_clk.c b/board/freescale/common/ics307_clk.c
new file mode 100644
index 00000000000..af30faa0c5f
--- /dev/null
+++ b/board/freescale/common/ics307_clk.c
@@ -0,0 +1,149 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <log.h>
+#include <asm/io.h>
+
+#include "ics307_clk.h"
+
+#if defined(CONFIG_FSL_NGPIXIS)
+#include "ngpixis.h"
+#define fpga_reg pixis
+#elif defined(CONFIG_FSL_QIXIS)
+#include "qixis.h"
+#define fpga_reg ((struct qixis *)QIXIS_BASE)
+#else
+#include "pixis.h"
+#define fpga_reg pixis
+#endif
+
+/* define for SYS CLK or CLK1Frequency */
+#define TTL 1
+#define CLK2 0
+#define CRYSTAL 0
+#define MAX_VDW (511 + 8)
+#define MAX_RDW (127 + 2)
+#define MIN_VDW (4 + 8)
+#define MIN_RDW (1 + 2)
+#define NUM_OD_SETTING 8
+/*
+ * These defines cover the industrial temperature range part,
+ * for commercial, change below to 400000 and 55000, respectively
+ */
+#define MAX_VCO 360000
+#define MIN_VCO 60000
+
+/* decode S[0-2] to Output Divider (OD) */
+static u8 ics307_s_to_od[] = {
+ 10, 2, 8, 4, 5, 7, 3, 6
+};
+
+/*
+ * Find one solution to generate required frequency for SYSCLK
+ * out_freq: KHz, required frequency to the SYSCLK
+ * the result will be retuned with component RDW, VDW, OD, TTL,
+ * CLK2 and crystal
+ */
+unsigned long ics307_sysclk_calculator(unsigned long out_freq)
+{
+ const unsigned long input_freq = CFG_ICS307_REFCLK_HZ;
+ unsigned long vdw, rdw, odp, s_vdw = 0, s_rdw = 0, s_odp = 0, od;
+ unsigned long tmp_out, diff, result = 0;
+ int found = 0;
+
+ for (odp = 0; odp < NUM_OD_SETTING; odp++) {
+ od = ics307_s_to_od[odp];
+ if (od * out_freq < MIN_VCO || od * out_freq > MAX_VCO)
+ continue;
+ for (rdw = MIN_RDW; rdw <= MAX_RDW; rdw++) {
+ /* Calculate the VDW */
+ vdw = out_freq * 1000 * od * rdw / (input_freq * 2);
+ if (vdw > MAX_VDW)
+ vdw = MAX_VDW;
+ if (vdw < MIN_VDW)
+ continue;
+ /* Calculate the temp out frequency */
+ tmp_out = input_freq * 2 * vdw / (rdw * od * 1000);
+ diff = max(out_freq, tmp_out) - min(out_freq, tmp_out);
+ /*
+ * calculate the percent, the precision is 1/1000
+ * If greater than 1/1000, continue
+ * otherwise, we think the solution is we required
+ */
+ if (diff * 1000 / out_freq > 1)
+ continue;
+ else {
+ s_vdw = vdw;
+ s_rdw = rdw;
+ s_odp = odp;
+ found = 1;
+ break;
+ }
+ }
+ }
+
+ if (found)
+ result = (s_rdw - 2) | (s_vdw - 8) << 7 | s_odp << 16 |
+ CLK2 << 19 | TTL << 21 | CRYSTAL << 22;
+
+ debug("ICS307-02: RDW: %ld, VDW: %ld, OD: %d\n", s_rdw - 2, s_vdw - 8,
+ ics307_s_to_od[s_odp]);
+ return result;
+}
+
+/*
+ * Calculate frequency being generated by ICS307-02 clock chip based upon
+ * the control bytes being programmed into it.
+ */
+static unsigned long ics307_clk_freq(u8 cw0, u8 cw1, u8 cw2)
+{
+ const unsigned long input_freq = CFG_ICS307_REFCLK_HZ;
+ unsigned long vdw = ((cw1 << 1) & 0x1FE) + ((cw2 >> 7) & 1);
+ unsigned long rdw = cw2 & 0x7F;
+ unsigned long od = ics307_s_to_od[cw0 & 0x7];
+ unsigned long freq;
+
+ /*
+ * CLK1 Freq = Input Frequency * 2 * (VDW + 8) / ((RDW + 2) * OD)
+ *
+ * cw0: C1 C0 TTL F1 F0 S2 S1 S0
+ * cw1: V8 V7 V6 V5 V4 V3 V2 V1
+ * cw2: V0 R6 R5 R4 R3 R2 R1 R0
+ *
+ * R6:R0 = Reference Divider Word (RDW)
+ * V8:V0 = VCO Divider Word (VDW)
+ * S2:S0 = Output Divider Select (OD)
+ * F1:F0 = Function of CLK2 Output
+ * TTL = duty cycle
+ * C1:C0 = internal load capacitance for cyrstal
+ *
+ */
+
+ freq = input_freq * 2 * (vdw + 8) / ((rdw + 2) * od);
+
+ debug("ICS307: CW[0-2]: %02X %02X %02X => %lu Hz\n", cw0, cw1, cw2,
+ freq);
+ return freq;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ return ics307_clk_freq(
+ in_8(&fpga_reg->sclk[0]),
+ in_8(&fpga_reg->sclk[1]),
+ in_8(&fpga_reg->sclk[2]));
+}
+
+#ifdef CONFIG_DYNAMIC_DDR_CLK_FREQ
+unsigned long get_board_ddr_clk(void)
+{
+ return ics307_clk_freq(
+ in_8(&fpga_reg->dclk[0]),
+ in_8(&fpga_reg->dclk[1]),
+ in_8(&fpga_reg->dclk[2]));
+}
+#endif
diff --git a/board/freescale/common/ics307_clk.h b/board/freescale/common/ics307_clk.h
new file mode 100644
index 00000000000..163496930c8
--- /dev/null
+++ b/board/freescale/common/ics307_clk.h
@@ -0,0 +1,14 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+#ifndef __ICS_CLK_H_
+#define __ICS_CLK_H_ 1
+
+#ifndef __ASSEMBLY__
+
+extern unsigned long get_board_sys_clk(void);
+extern unsigned long ics307_sysclk_calculator(unsigned long out_freq);
+#endif
+
+#endif /* __ICS_CLK_H_ */
diff --git a/board/freescale/common/ls102xa_stream_id.c b/board/freescale/common/ls102xa_stream_id.c
new file mode 100644
index 00000000000..bf76274c43c
--- /dev/null
+++ b/board/freescale/common/ls102xa_stream_id.c
@@ -0,0 +1,35 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor
+ */
+
+#include <config.h>
+#include <asm/io.h>
+#include <asm/arch/ls102xa_stream_id.h>
+
+void ls102xa_config_smmu_stream_id(struct smmu_stream_id *id, uint32_t num)
+{
+ void *scfg = (void *)CFG_SYS_FSL_SCFG_ADDR;
+ int i;
+ u32 icid;
+
+ for (i = 0; i < num; i++) {
+ icid = (id[i].stream_id & 0xff) << 24;
+ out_be32((u32 *)(scfg + id[i].offset), icid);
+ }
+}
+
+void ls1021x_config_caam_stream_id(struct liodn_id_table *tbl, int size)
+{
+ int i;
+ u32 liodn;
+
+ for (i = 0; i < size; i++) {
+ if (tbl[i].num_ids == 2)
+ liodn = (tbl[i].id[0] << 16) | tbl[i].id[1];
+ else
+ liodn = tbl[i].id[0];
+
+ out_le32((u32 *)(tbl[i].reg_offset), liodn);
+ }
+}
diff --git a/board/freescale/common/mc34vr500.c b/board/freescale/common/mc34vr500.c
new file mode 100644
index 00000000000..cf14b29a3ec
--- /dev/null
+++ b/board/freescale/common/mc34vr500.c
@@ -0,0 +1,94 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Hou Zhiqiang <Zhiqiang.Hou@freescale.com>
+ */
+
+#include <errno.h>
+#include <i2c.h>
+#include <log.h>
+#include <power/pmic.h>
+#include <power/mc34vr500_pmic.h>
+
+static uint8_t swxvolt_addr[4] = { MC34VR500_SW1VOLT,
+ MC34VR500_SW2VOLT,
+ MC34VR500_SW3VOLT,
+ MC34VR500_SW4VOLT };
+
+static uint8_t swx_set_point_base[4] = { 13, 9, 9, 9 };
+
+int mc34vr500_get_sw_volt(uint8_t sw)
+{
+ struct pmic *p;
+ u32 swxvolt;
+ uint8_t spb;
+ int sw_volt;
+ int ret;
+
+ debug("%s: Get SW%u volt from swxvolt_addr = 0x%x\n",
+ __func__, sw + 1, swxvolt_addr[sw]);
+ if (sw > SW4) {
+ printf("%s: Unsupported SW(sw%d)\n", __func__, sw + 1);
+ return -EINVAL;
+ }
+
+ p = pmic_get("MC34VR500");
+ if (!p) {
+ printf("%s: Did NOT find PMIC MC34VR500\n", __func__);
+ return -ENODEV;
+ }
+
+ ret = pmic_probe(p);
+ if (ret)
+ return ret;
+
+ ret = pmic_reg_read(p, swxvolt_addr[sw], &swxvolt);
+ if (ret) {
+ printf("%s: Failed to get SW%u volt\n", __func__, sw + 1);
+ return ret;
+ }
+
+ debug("%s: SW%d step point swxvolt = %u\n", __func__, sw + 1, swxvolt);
+ spb = swx_set_point_base[sw];
+ /* The base of SW volt is 625mV and increase by step 25mV */
+ sw_volt = 625 + (swxvolt - spb) * 25;
+
+ debug("%s: SW%u volt = %dmV\n", __func__, sw + 1, sw_volt);
+ return sw_volt;
+}
+
+int mc34vr500_set_sw_volt(uint8_t sw, int sw_volt)
+{
+ struct pmic *p;
+ u32 swxvolt;
+ uint8_t spb;
+ int ret;
+
+ debug("%s: Set SW%u volt to %dmV\n", __func__, sw + 1, sw_volt);
+ /* The least SW volt is 625mV, and only 4 SW outputs */
+ if (sw > SW4 || sw_volt < 625)
+ return -EINVAL;
+
+ p = pmic_get("MC34VR500");
+ if (!p) {
+ printf("%s: Did NOT find PMIC MC34VR500\n", __func__);
+ return -ENODEV;
+ }
+
+ ret = pmic_probe(p);
+ if (ret)
+ return ret;
+
+ spb = swx_set_point_base[sw];
+ /* The base of SW volt is 625mV and increase by step 25mV */
+ swxvolt = (sw_volt - 625) / 25 + spb;
+ debug("%s: SW%d step point swxvolt = %u\n", __func__, sw + 1, swxvolt);
+ if (swxvolt > 63)
+ return -EINVAL;
+
+ ret = pmic_reg_write(p, swxvolt_addr[sw], swxvolt);
+ if (ret)
+ return ret;
+
+ return 0;
+}
diff --git a/board/freescale/common/mmc.c b/board/freescale/common/mmc.c
new file mode 100644
index 00000000000..00e4f3675fe
--- /dev/null
+++ b/board/freescale/common/mmc.c
@@ -0,0 +1,49 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2018-2022 NXP
+ */
+
+#include <command.h>
+#include <vsprintf.h>
+#include <asm/arch/sys_proto.h>
+#include <linux/errno.h>
+#include <asm/io.h>
+#include <stdbool.h>
+#include <mmc.h>
+#include <env.h>
+
+static int check_mmc_autodetect(void)
+{
+ char *autodetect_str = env_get("mmcautodetect");
+
+ if (autodetect_str && !strcmp(autodetect_str, "yes"))
+ return 1;
+
+ return 0;
+}
+
+/* This should be defined for each board */
+__weak int mmc_map_to_kernel_blk(int dev_no)
+{
+ return dev_no;
+}
+
+void board_late_mmc_env_init(void)
+{
+ char cmd[32];
+ char mmcblk[32];
+ u32 dev_no = mmc_get_env_dev();
+
+ if (!check_mmc_autodetect())
+ return;
+
+ env_set_ulong("mmcdev", dev_no);
+
+ /* Set mmcblk env */
+ sprintf(mmcblk, "/dev/mmcblk%dp2 rootwait rw", mmc_map_to_kernel_blk(dev_no));
+ env_set("mmcroot", mmcblk);
+
+ sprintf(cmd, "mmc dev %d", dev_no);
+ run_command(cmd, 0);
+}
diff --git a/board/freescale/common/mpc85xx_sleep.c b/board/freescale/common/mpc85xx_sleep.c
new file mode 100644
index 00000000000..d4ca278e883
--- /dev/null
+++ b/board/freescale/common/mpc85xx_sleep.c
@@ -0,0 +1,97 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <log.h>
+#include <asm/cache.h>
+#include <asm/global_data.h>
+#include <asm/immap_85xx.h>
+#include "sleep.h"
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void __weak board_mem_sleep_setup(void)
+{
+}
+
+void __weak board_sleep_prepare(void)
+{
+}
+
+bool is_warm_boot(void)
+{
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ if (in_be32(&gur->scrtsr[0]) & DCFG_CCSR_CRSTSR_WDRFR)
+ return 1;
+
+ return 0;
+}
+
+void fsl_dp_disable_console(void)
+{
+ gd->flags |= GD_FLG_SILENT | GD_FLG_DISABLE_CONSOLE;
+}
+
+/*
+ * When wakeup from deep sleep, the first 128 bytes space
+ * will be used to do DDR training which corrupts the data
+ * in there. This function will restore them.
+ */
+static void dp_ddr_restore(void)
+{
+ u64 *src, *dst;
+ int i;
+ struct ccsr_scfg __iomem *scfg = (void *)CFG_SYS_MPC85xx_SCFG;
+
+ /* get the address of ddr date from SPARECR3 */
+ src = (u64 *)(in_be32(&scfg->sparecr[2]) + DDR_BUFF_LEN - 8);
+ dst = (u64 *)(CFG_SYS_SDRAM_BASE + DDR_BUFF_LEN - 8);
+
+ for (i = 0; i < DDR_BUFF_LEN / 8; i++)
+ *dst-- = *src--;
+
+ flush_dcache();
+}
+
+static void dp_resume_prepare(void)
+{
+ dp_ddr_restore();
+
+ board_sleep_prepare();
+
+ l2cache_init();
+#if defined(CONFIG_RAMBOOT_PBL)
+ disable_cpc_sram();
+#endif
+ enable_cpc();
+
+#ifdef CONFIG_U_QE
+ u_qe_resume();
+#endif
+
+}
+
+int fsl_dp_resume(void)
+{
+ u32 start_addr;
+ void (*kernel_resume)(void);
+ struct ccsr_scfg __iomem *scfg = (void *)CFG_SYS_MPC85xx_SCFG;
+
+ if (!is_warm_boot())
+ return 0;
+
+ dp_resume_prepare();
+
+ /* Get the entry address and jump to kernel */
+ start_addr = in_be32(&scfg->sparecr[1]);
+ debug("Entry address is 0x%08x\n", start_addr);
+ kernel_resume = (void (*)(void))start_addr;
+ kernel_resume();
+
+ return 0;
+}
diff --git a/board/freescale/common/ngpixis.c b/board/freescale/common/ngpixis.c
new file mode 100644
index 00000000000..74c345807e6
--- /dev/null
+++ b/board/freescale/common/ngpixis.c
@@ -0,0 +1,247 @@
+// SPDX-License-Identifier: GPL-2.0+
+/**
+ * Copyright 2010-2011 Freescale Semiconductor
+ * Author: Timur Tabi <timur@freescale.com>
+ *
+ * This file provides support for the ngPIXIS, a board-specific FPGA used on
+ * some Freescale reference boards.
+ *
+ * A "switch" is black rectangular block on the motherboard. It contains
+ * eight "bits". The ngPIXIS has a set of memory-mapped registers (SWx) that
+ * shadow the actual physical switches. There is also another set of
+ * registers (ENx) that tell the ngPIXIS which bits of SWx should actually be
+ * used to override the values of the bits in the physical switches.
+ *
+ * The following macros need to be defined:
+ *
+ * PIXIS_BASE - The virtual address of the base of the PIXIS register map
+ *
+ * PIXIS_LBMAP_SWITCH - The switch number (i.e. the "x" in "SWx"). This value
+ * is used in the PIXIS_SW() macro to determine which offset in
+ * the PIXIS register map corresponds to the physical switch that controls
+ * the boot bank.
+ *
+ * PIXIS_LBMAP_MASK - A bit mask the defines which bits in SWx to use.
+ *
+ * PIXIS_LBMAP_SHIFT - The shift value that corresponds to PIXIS_LBMAP_MASK.
+ *
+ * PIXIS_LBMAP_ALTBANK - The value to program into SWx to tell the ngPIXIS to
+ * boot from the alternate bank.
+ */
+
+#include <command.h>
+#include <asm/io.h>
+
+#include "ngpixis.h"
+
+static u8 __pixis_read(unsigned int reg)
+{
+ void *p = (void *)PIXIS_BASE;
+
+ return in_8(p + reg);
+}
+u8 pixis_read(unsigned int reg) __attribute__((weak, alias("__pixis_read")));
+
+static void __pixis_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)PIXIS_BASE;
+
+ out_8(p + reg, value);
+}
+void pixis_write(unsigned int reg, u8 value)
+ __attribute__((weak, alias("__pixis_write")));
+
+/*
+ * Reset the board. This ignores the ENx registers.
+ */
+void __pixis_reset(void)
+{
+ PIXIS_WRITE(rst, 0);
+
+ while (1);
+}
+void pixis_reset(void) __attribute__((weak, alias("__pixis_reset")));
+
+/*
+ * Reset the board. Like pixis_reset(), but it honors the ENx registers.
+ */
+void __pixis_bank_reset(void)
+{
+ PIXIS_WRITE(vctl, 0);
+ PIXIS_WRITE(vctl, 1);
+
+ while (1);
+}
+void pixis_bank_reset(void) __attribute__((weak, alias("__pixis_bank_reset")));
+
+/**
+ * Set the boot bank to the power-on default bank
+ */
+void __clear_altbank(void)
+{
+ u8 reg;
+
+ /* Tell the ngPIXIS to use this the bits in the physical switch for the
+ * boot bank value, instead of the SWx register. We need to be careful
+ * only to set the bits in SWx that correspond to the boot bank.
+ */
+ reg = PIXIS_READ(s[PIXIS_LBMAP_SWITCH - 1].en);
+ reg &= ~PIXIS_LBMAP_MASK;
+ PIXIS_WRITE(s[PIXIS_LBMAP_SWITCH - 1].en, reg);
+}
+void clear_altbank(void) __attribute__((weak, alias("__clear_altbank")));
+
+/**
+ * Set the boot bank to the alternate bank
+ */
+void __set_altbank(void)
+{
+ u8 reg;
+
+ /* Program the alternate bank number into the SWx register.
+ */
+ reg = PIXIS_READ(s[PIXIS_LBMAP_SWITCH - 1].sw);
+ reg = (reg & ~PIXIS_LBMAP_MASK) | PIXIS_LBMAP_ALTBANK;
+ PIXIS_WRITE(s[PIXIS_LBMAP_SWITCH - 1].sw, reg);
+
+ /* Tell the ngPIXIS to use this the bits in the SWx register for the
+ * boot bank value, instead of the physical switch. We need to be
+ * careful only to set the bits in SWx that correspond to the boot bank.
+ */
+ reg = PIXIS_READ(s[PIXIS_LBMAP_SWITCH - 1].en);
+ reg |= PIXIS_LBMAP_MASK;
+ PIXIS_WRITE(s[PIXIS_LBMAP_SWITCH - 1].en, reg);
+}
+void set_altbank(void) __attribute__((weak, alias("__set_altbank")));
+
+#ifdef DEBUG
+static void pixis_dump_regs(void)
+{
+ unsigned int i;
+
+ printf("id=%02x\n", PIXIS_READ(id));
+ printf("arch=%02x\n", PIXIS_READ(arch));
+ printf("scver=%02x\n", PIXIS_READ(scver));
+ printf("csr=%02x\n", PIXIS_READ(csr));
+ printf("rst=%02x\n", PIXIS_READ(rst));
+ printf("aux=%02x\n", PIXIS_READ(aux));
+ printf("spd=%02x\n", PIXIS_READ(spd));
+ printf("brdcfg0=%02x\n", PIXIS_READ(brdcfg0));
+ printf("brdcfg1=%02x\n", PIXIS_READ(brdcfg1));
+ printf("addr=%02x\n", PIXIS_READ(addr));
+ printf("data=%02x\n", PIXIS_READ(data));
+ printf("led=%02x\n", PIXIS_READ(led));
+ printf("vctl=%02x\n", PIXIS_READ(vctl));
+ printf("vstat=%02x\n", PIXIS_READ(vstat));
+ printf("vcfgen0=%02x\n", PIXIS_READ(vcfgen0));
+ printf("ocmcsr=%02x\n", PIXIS_READ(ocmcsr));
+ printf("ocmmsg=%02x\n", PIXIS_READ(ocmmsg));
+ printf("gmdbg=%02x\n", PIXIS_READ(gmdbg));
+ printf("sclk=%02x%02x%02x\n",
+ PIXIS_READ(sclk[0]), PIXIS_READ(sclk[1]), PIXIS_READ(sclk[2]));
+ printf("dclk=%02x%02x%02x\n",
+ PIXIS_READ(dclk[0]), PIXIS_READ(dclk[1]), PIXIS_READ(dclk[2]));
+ printf("watch=%02x\n", PIXIS_READ(watch));
+
+ for (i = 0; i < 8; i++) {
+ printf("SW%u=%02x/%02x ", i + 1,
+ PIXIS_READ(s[i].sw), PIXIS_READ(s[i].en));
+ }
+ putc('\n');
+}
+#endif
+
+void pixis_sysclk_set(unsigned long sysclk)
+{
+ unsigned long freq_word;
+ u8 sclk0, sclk1, sclk2;
+
+ freq_word = ics307_sysclk_calculator(sysclk);
+ sclk2 = freq_word & 0xff;
+ sclk1 = (freq_word >> 8) & 0xff;
+ sclk0 = (freq_word >> 16) & 0xff;
+
+ /* set SYSCLK enable bit */
+ PIXIS_WRITE(vcfgen0, 0x01);
+
+ /* SYSCLK to required frequency */
+ PIXIS_WRITE(sclk[0], sclk0);
+ PIXIS_WRITE(sclk[1], sclk1);
+ PIXIS_WRITE(sclk[2], sclk2);
+}
+
+int pixis_reset_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ unsigned int i;
+ unsigned long sysclk;
+ char *p_altbank = NULL;
+#ifdef DEBUG
+ char *p_dump = NULL;
+#endif
+ char *unknown_param = NULL;
+
+ /* No args is a simple reset request.
+ */
+ if (argc <= 1)
+ pixis_reset();
+
+ for (i = 1; i < argc; i++) {
+ if (strcmp(argv[i], "altbank") == 0) {
+ p_altbank = argv[i];
+ continue;
+ }
+
+#ifdef DEBUG
+ if (strcmp(argv[i], "dump") == 0) {
+ p_dump = argv[i];
+ continue;
+ }
+#endif
+ if (strcmp(argv[i], "sysclk") == 0) {
+ sysclk = simple_strtoul(argv[i + 1], NULL, 0);
+ i += 1;
+ pixis_sysclk_set(sysclk);
+ continue;
+ }
+
+ unknown_param = argv[i];
+ }
+
+ if (unknown_param) {
+ printf("Invalid option: %s\n", unknown_param);
+ return 1;
+ }
+
+#ifdef DEBUG
+ if (p_dump) {
+ pixis_dump_regs();
+
+ /* 'dump' ignores other commands */
+ return 0;
+ }
+#endif
+
+ if (p_altbank)
+ set_altbank();
+ else
+ clear_altbank();
+
+ pixis_bank_reset();
+
+ /* Shouldn't be reached. */
+ return 0;
+}
+
+U_BOOT_LONGHELP(pixis,
+ "- hard reset to default bank\n"
+ "pixis_reset altbank - reset to alternate bank\n"
+#ifdef DEBUG
+ "pixis_reset dump - display the PIXIS registers\n"
+#endif
+ "pixis_reset sysclk <SYSCLK_freq> - reset with SYSCLK frequency(KHz)\n");
+
+U_BOOT_CMD(
+ pixis_reset, CONFIG_SYS_MAXARGS, 1, pixis_reset_cmd,
+ "Reset the board using the FPGA sequencer", pixis_help_text
+ );
diff --git a/board/freescale/common/ngpixis.h b/board/freescale/common/ngpixis.h
new file mode 100644
index 00000000000..7a20ee015fa
--- /dev/null
+++ b/board/freescale/common/ngpixis.h
@@ -0,0 +1,60 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/**
+ * Copyright 2010-2011 Freescale Semiconductor
+ * Author: Timur Tabi <timur@freescale.com>
+ *
+ * This file provides support for the ngPIXIS, a board-specific FPGA used on
+ * some Freescale reference boards.
+ */
+
+/* ngPIXIS register set. Hopefully, this won't change too much over time.
+ * Feel free to add board-specific #ifdefs where necessary.
+ */
+typedef struct ngpixis {
+ u8 id;
+ u8 arch;
+ u8 scver;
+ u8 csr;
+ u8 rst;
+ u8 serclk;
+ u8 aux;
+ u8 spd;
+ u8 brdcfg0;
+ u8 brdcfg1; /* On some boards, this register is called 'dma' */
+ u8 addr;
+ u8 brdcfg2;
+ u8 gpiodir;
+ u8 data;
+ u8 led;
+ u8 tag;
+ u8 vctl;
+ u8 vstat;
+ u8 vcfgen0;
+ u8 res4;
+ u8 ocmcsr;
+ u8 ocmmsg;
+ u8 gmdbg;
+ u8 res5[2];
+ u8 sclk[3];
+ u8 dclk[3];
+ u8 watch;
+ struct {
+ u8 sw;
+ u8 en;
+ } s[9]; /* s[0]..s[7] is SW1..SW8, and s[8] is SW11 */
+} __attribute__ ((packed)) ngpixis_t;
+
+/* Pointer to the PIXIS register set */
+#define pixis ((ngpixis_t *)PIXIS_BASE)
+
+/* The PIXIS SW register that corresponds to board switch X, where x >= 1 */
+#define PIXIS_SW(x) (pixis->s[(x) - 1].sw)
+
+/* The PIXIS EN register that corresponds to board switch X, where x >= 1 */
+#define PIXIS_EN(x) (pixis->s[(x) - 1].en)
+
+u8 pixis_read(unsigned int reg);
+void pixis_write(unsigned int reg, u8 value);
+
+#define PIXIS_READ(reg) pixis_read(offsetof(ngpixis_t, reg))
+#define PIXIS_WRITE(reg, value) pixis_write(offsetof(ngpixis_t, reg), value)
diff --git a/board/freescale/common/ns_access.c b/board/freescale/common/ns_access.c
new file mode 100644
index 00000000000..c46e87f4cce
--- /dev/null
+++ b/board/freescale/common/ns_access.c
@@ -0,0 +1,241 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor
+ */
+
+#include <config.h>
+#include <log.h>
+#include <asm/cache.h>
+#include <asm/io.h>
+#include <fsl_csu.h>
+#include <asm/arch/ns_access.h>
+#include <asm/arch/fsl_serdes.h>
+
+#ifdef CONFIG_ARCH_LS1021A
+static struct csu_ns_dev ns_dev[] = {
+ { CSU_CSLX_PCIE2_IO, CSU_ALL_RW },
+ { CSU_CSLX_PCIE1_IO, CSU_ALL_RW },
+ { CSU_CSLX_MG2TPR_IP, CSU_ALL_RW },
+ { CSU_CSLX_IFC_MEM, CSU_ALL_RW },
+ { CSU_CSLX_OCRAM, CSU_ALL_RW },
+ { CSU_CSLX_GIC, CSU_ALL_RW },
+ { CSU_CSLX_PCIE1, CSU_ALL_RW },
+ { CSU_CSLX_OCRAM2, CSU_ALL_RW },
+ { CSU_CSLX_QSPI_MEM, CSU_ALL_RW },
+ { CSU_CSLX_PCIE2, CSU_ALL_RW },
+ { CSU_CSLX_SATA, CSU_ALL_RW },
+ { CSU_CSLX_USB3, CSU_ALL_RW },
+ { CSU_CSLX_SERDES, CSU_ALL_RW },
+ { CSU_CSLX_QDMA, CSU_ALL_RW },
+ { CSU_CSLX_LPUART2, CSU_ALL_RW },
+ { CSU_CSLX_LPUART1, CSU_ALL_RW },
+ { CSU_CSLX_LPUART4, CSU_ALL_RW },
+ { CSU_CSLX_LPUART3, CSU_ALL_RW },
+ { CSU_CSLX_LPUART6, CSU_ALL_RW },
+ { CSU_CSLX_LPUART5, CSU_ALL_RW },
+ { CSU_CSLX_DSPI2, CSU_ALL_RW },
+ { CSU_CSLX_DSPI1, CSU_ALL_RW },
+ { CSU_CSLX_QSPI, CSU_ALL_RW },
+ { CSU_CSLX_ESDHC, CSU_ALL_RW },
+ { CSU_CSLX_2D_ACE, CSU_ALL_RW },
+ { CSU_CSLX_IFC, CSU_ALL_RW },
+ { CSU_CSLX_I2C1, CSU_ALL_RW },
+ { CSU_CSLX_USB2, CSU_ALL_RW },
+ { CSU_CSLX_I2C3, CSU_ALL_RW },
+ { CSU_CSLX_I2C2, CSU_ALL_RW },
+ { CSU_CSLX_DUART2, CSU_ALL_RW },
+ { CSU_CSLX_DUART1, CSU_ALL_RW },
+ { CSU_CSLX_WDT2, CSU_ALL_RW },
+ { CSU_CSLX_WDT1, CSU_ALL_RW },
+ { CSU_CSLX_EDMA, CSU_ALL_RW },
+ { CSU_CSLX_SYS_CNT, CSU_ALL_RW },
+ { CSU_CSLX_DMA_MUX2, CSU_ALL_RW },
+ { CSU_CSLX_DMA_MUX1, CSU_ALL_RW },
+ { CSU_CSLX_DDR, CSU_ALL_RW },
+ { CSU_CSLX_QUICC, CSU_ALL_RW },
+ { CSU_CSLX_DCFG_CCU_RCPM, CSU_ALL_RW },
+ { CSU_CSLX_SECURE_BOOTROM, CSU_ALL_RW },
+ { CSU_CSLX_SFP, CSU_ALL_RW },
+ { CSU_CSLX_TMU, CSU_ALL_RW },
+ { CSU_CSLX_SECURE_MONITOR, CSU_ALL_RW },
+ { CSU_CSLX_RESERVED0, CSU_ALL_RW },
+ { CSU_CSLX_ETSEC1, CSU_ALL_RW },
+ { CSU_CSLX_SEC5_5, CSU_ALL_RW },
+ { CSU_CSLX_ETSEC3, CSU_ALL_RW },
+ { CSU_CSLX_ETSEC2, CSU_ALL_RW },
+ { CSU_CSLX_GPIO2, CSU_ALL_RW },
+ { CSU_CSLX_GPIO1, CSU_ALL_RW },
+ { CSU_CSLX_GPIO4, CSU_ALL_RW },
+ { CSU_CSLX_GPIO3, CSU_ALL_RW },
+ { CSU_CSLX_PLATFORM_CONT, CSU_ALL_RW },
+ { CSU_CSLX_CSU, CSU_ALL_RW },
+ { CSU_CSLX_ASRC, CSU_ALL_RW },
+ { CSU_CSLX_SPDIF, CSU_ALL_RW },
+ { CSU_CSLX_FLEXCAN2, CSU_ALL_RW },
+ { CSU_CSLX_FLEXCAN1, CSU_ALL_RW },
+ { CSU_CSLX_FLEXCAN4, CSU_ALL_RW },
+ { CSU_CSLX_FLEXCAN3, CSU_ALL_RW },
+ { CSU_CSLX_SAI2, CSU_ALL_RW },
+ { CSU_CSLX_SAI1, CSU_ALL_RW },
+ { CSU_CSLX_SAI4, CSU_ALL_RW },
+ { CSU_CSLX_SAI3, CSU_ALL_RW },
+ { CSU_CSLX_FTM2, CSU_ALL_RW },
+ { CSU_CSLX_FTM1, CSU_ALL_RW },
+ { CSU_CSLX_FTM4, CSU_ALL_RW },
+ { CSU_CSLX_FTM3, CSU_ALL_RW },
+ { CSU_CSLX_FTM6, CSU_ALL_RW },
+ { CSU_CSLX_FTM5, CSU_ALL_RW },
+ { CSU_CSLX_FTM8, CSU_ALL_RW },
+ { CSU_CSLX_FTM7, CSU_ALL_RW },
+ { CSU_CSLX_COP_DCSR, CSU_ALL_RW },
+ { CSU_CSLX_EPU, CSU_ALL_RW },
+ { CSU_CSLX_GDI, CSU_ALL_RW },
+ { CSU_CSLX_DDI, CSU_ALL_RW },
+ { CSU_CSLX_RESERVED1, CSU_ALL_RW },
+ { CSU_CSLX_USB3_PHY, CSU_ALL_RW },
+ { CSU_CSLX_RESERVED2, CSU_ALL_RW },
+};
+
+#else
+static struct csu_ns_dev ns_dev[] = {
+ {CSU_CSLX_PCIE2_IO, CSU_ALL_RW},
+ {CSU_CSLX_PCIE1_IO, CSU_ALL_RW},
+ {CSU_CSLX_MG2TPR_IP, CSU_ALL_RW},
+ {CSU_CSLX_IFC_MEM, CSU_ALL_RW},
+ {CSU_CSLX_OCRAM, CSU_ALL_RW},
+ {CSU_CSLX_GIC, CSU_ALL_RW},
+ {CSU_CSLX_PCIE1, CSU_ALL_RW},
+ {CSU_CSLX_OCRAM2, CSU_ALL_RW},
+ {CSU_CSLX_QSPI_MEM, CSU_ALL_RW},
+ {CSU_CSLX_PCIE2, CSU_ALL_RW},
+ {CSU_CSLX_SATA, CSU_ALL_RW},
+ {CSU_CSLX_USB1, CSU_ALL_RW},
+ {CSU_CSLX_QM_BM_SWPORTAL, CSU_ALL_RW},
+ {CSU_CSLX_PCIE3, CSU_ALL_RW},
+ {CSU_CSLX_PCIE3_IO, CSU_ALL_RW},
+ {CSU_CSLX_USB3, CSU_ALL_RW},
+ {CSU_CSLX_USB2, CSU_ALL_RW},
+ {CSU_CSLX_PFE, CSU_ALL_RW},
+ {CSU_CSLX_SERDES, CSU_ALL_RW},
+ {CSU_CSLX_QDMA, CSU_ALL_RW},
+ {CSU_CSLX_LPUART2, CSU_ALL_RW},
+ {CSU_CSLX_LPUART1, CSU_ALL_RW},
+ {CSU_CSLX_LPUART4, CSU_ALL_RW},
+ {CSU_CSLX_LPUART3, CSU_ALL_RW},
+ {CSU_CSLX_LPUART6, CSU_ALL_RW},
+ {CSU_CSLX_LPUART5, CSU_ALL_RW},
+ {CSU_CSLX_DSPI1, CSU_ALL_RW},
+ {CSU_CSLX_QSPI, CSU_ALL_RW},
+ {CSU_CSLX_ESDHC, CSU_ALL_RW},
+ {CSU_CSLX_IFC, CSU_ALL_RW},
+ {CSU_CSLX_I2C1, CSU_ALL_RW},
+ {CSU_CSLX_I2C3, CSU_ALL_RW},
+ {CSU_CSLX_I2C2, CSU_ALL_RW},
+ {CSU_CSLX_DUART2, CSU_ALL_RW},
+ {CSU_CSLX_DUART1, CSU_ALL_RW},
+ {CSU_CSLX_WDT2, CSU_ALL_RW},
+ {CSU_CSLX_WDT1, CSU_ALL_RW},
+ {CSU_CSLX_EDMA, CSU_ALL_RW},
+ {CSU_CSLX_SYS_CNT, CSU_ALL_RW},
+ {CSU_CSLX_DMA_MUX2, CSU_ALL_RW},
+ {CSU_CSLX_DMA_MUX1, CSU_ALL_RW},
+ {CSU_CSLX_DDR, CSU_ALL_RW},
+ {CSU_CSLX_QUICC, CSU_ALL_RW},
+ {CSU_CSLX_DCFG_CCU_RCPM, CSU_ALL_RW},
+ {CSU_CSLX_SECURE_BOOTROM, CSU_ALL_RW},
+ {CSU_CSLX_SFP, CSU_ALL_RW},
+ {CSU_CSLX_TMU, CSU_ALL_RW},
+ {CSU_CSLX_SECURE_MONITOR, CSU_ALL_RW},
+ {CSU_CSLX_SCFG, CSU_ALL_RW},
+ {CSU_CSLX_FM, CSU_ALL_RW},
+ {CSU_CSLX_SEC5_5, CSU_ALL_RW},
+ {CSU_CSLX_BM, CSU_ALL_RW},
+ {CSU_CSLX_QM, CSU_ALL_RW},
+ {CSU_CSLX_GPIO2, CSU_ALL_RW},
+ {CSU_CSLX_GPIO1, CSU_ALL_RW},
+ {CSU_CSLX_GPIO4, CSU_ALL_RW},
+ {CSU_CSLX_GPIO3, CSU_ALL_RW},
+ {CSU_CSLX_PLATFORM_CONT, CSU_ALL_RW},
+ {CSU_CSLX_CSU, CSU_ALL_RW},
+ {CSU_CSLX_IIC4, CSU_ALL_RW},
+ {CSU_CSLX_WDT4, CSU_ALL_RW},
+ {CSU_CSLX_WDT3, CSU_ALL_RW},
+ {CSU_CSLX_ESDHC2, CSU_ALL_RW},
+ {CSU_CSLX_WDT5, CSU_ALL_RW},
+ {CSU_CSLX_SAI2, CSU_ALL_RW},
+ {CSU_CSLX_SAI1, CSU_ALL_RW},
+ {CSU_CSLX_SAI4, CSU_ALL_RW},
+ {CSU_CSLX_SAI3, CSU_ALL_RW},
+ {CSU_CSLX_FTM2, CSU_ALL_RW},
+ {CSU_CSLX_FTM1, CSU_ALL_RW},
+ {CSU_CSLX_FTM4, CSU_ALL_RW},
+ {CSU_CSLX_FTM3, CSU_ALL_RW},
+ {CSU_CSLX_FTM6, CSU_ALL_RW},
+ {CSU_CSLX_FTM5, CSU_ALL_RW},
+ {CSU_CSLX_FTM8, CSU_ALL_RW},
+ {CSU_CSLX_FTM7, CSU_ALL_RW},
+ {CSU_CSLX_DSCR, CSU_ALL_RW},
+};
+#endif
+
+void set_devices_ns_access(unsigned long index, u16 val)
+{
+ u32 *base = (u32 *)CFG_SYS_FSL_CSU_ADDR;
+ u32 *reg;
+ uint32_t tmp;
+
+ reg = base + index / 2;
+ tmp = in_be32(reg);
+ if (index % 2 == 0) {
+ tmp &= 0x0000ffff;
+ tmp |= val << 16;
+ } else {
+ tmp &= 0xffff0000;
+ tmp |= val;
+ }
+
+ out_be32(reg, tmp);
+}
+
+static void enable_devices_ns_access(struct csu_ns_dev *ns_dev, uint32_t num)
+{
+ int i;
+
+ for (i = 0; i < num; i++)
+ set_devices_ns_access(ns_dev[i].ind, ns_dev[i].val);
+}
+
+void enable_layerscape_ns_access(void)
+{
+#ifdef CONFIG_ARM64
+ if (current_el() == 3)
+#endif
+ enable_devices_ns_access(ns_dev, ARRAY_SIZE(ns_dev));
+}
+
+void set_pcie_ns_access(int pcie, u16 val)
+{
+ switch (pcie) {
+#ifdef CONFIG_PCIE1
+ case PCIE1:
+ set_devices_ns_access(CSU_CSLX_PCIE1, val);
+ set_devices_ns_access(CSU_CSLX_PCIE1_IO, val);
+ return;
+#endif
+#ifdef CONFIG_PCIE2
+ case PCIE2:
+ set_devices_ns_access(CSU_CSLX_PCIE2, val);
+ set_devices_ns_access(CSU_CSLX_PCIE2_IO, val);
+ return;
+#endif
+#ifdef CONFIG_PCIE3
+ case PCIE3:
+ set_devices_ns_access(CSU_CSLX_PCIE3, val);
+ set_devices_ns_access(CSU_CSLX_PCIE3_IO, val);
+ return;
+#endif
+ default:
+ debug("The PCIE%d doesn't exist!\n", pcie);
+ return;
+ }
+}
diff --git a/board/freescale/common/p_corenet/Makefile b/board/freescale/common/p_corenet/Makefile
new file mode 100644
index 00000000000..ce156018a06
--- /dev/null
+++ b/board/freescale/common/p_corenet/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2002-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/common/p_corenet/law.c b/board/freescale/common/p_corenet/law.c
new file mode 100644
index 00000000000..83818d6d847
--- /dev/null
+++ b/board/freescale/common/p_corenet/law.c
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2011 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_LBC),
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_2M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_2M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef PIXIS_BASE_PHYS
+ SET_LAW(PIXIS_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_LBC),
+#endif
+#ifdef CPLD_BASE_PHYS
+ SET_LAW(CPLD_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_LBC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ /* Limit DCSR to 32M to access NPC Trace Buffer */
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_LBC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/common/p_corenet/tlb.c b/board/freescale/common/p_corenet/tlb.c
new file mode 100644
index 00000000000..cebdedfa4a7
--- /dev/null
+++ b/board/freescale/common/p_corenet/tlb.c
@@ -0,0 +1,161 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2011 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+#ifdef CPLD_BASE
+ SET_TLB_ENTRY(0, CPLD_BASE, CPLD_BASE_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+#endif
+
+#ifdef PIXIS_BASE
+ SET_TLB_ENTRY(0, PIXIS_BASE, PIXIS_BASE_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+#endif
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR)
+
+#if !defined(CONFIG_NXP_ESBC)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 1M SRAM, the address of the
+ * SRAM is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#else
+ /*
+ * *I*G - L3SRAM. When L3 is used as 1M SRAM, in case of Secure Boot
+ * the physical address of the SRAM is at CFG_SYS_INIT_L3_ADDR,
+ * and virtual address is CONFIG_SYS_MONITOR_BASE
+ */
+
+ SET_TLB_ENTRY(1, CONFIG_SYS_MONITOR_BASE & 0xfff00000,
+ CFG_SYS_INIT_L3_ADDR & 0xfff00000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#endif
+
+#elif defined(CONFIG_SRIO_PCIE_BOOT_SLAVE)
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. When slave boot, the address of the
+ * space is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT + 0x40000000,
+ CFG_SYS_PCIE1_MEM_PHYS + 0x40000000,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256M, 1),
+
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT + 0x50000000,
+ CFG_SYS_PCIE1_MEM_PHYS + 0x50000000,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 9, BOOKE_PAGESZ_1M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x00100000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x00100000,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_1M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SW|MAS3_SR, 0,
+ 0, 11, BOOKE_PAGESZ_1M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x00100000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x00100000,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 12, BOOKE_PAGESZ_1M, 1),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 13, BOOKE_PAGESZ_4M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ /*
+ * *I*G - NAND
+ * entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so we use entry 16 for nand.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 16, BOOKE_PAGESZ_1M, 1),
+#endif
+#ifdef CONFIG_SRIO_PCIE_BOOT_SLAVE
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. 1M space from 0xffe00000 for
+ * fetching ucode and ENV from master
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 17, BOOKE_PAGESZ_1M, 1),
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/common/pfuze.c b/board/freescale/common/pfuze.c
new file mode 100644
index 00000000000..0d7a94fd232
--- /dev/null
+++ b/board/freescale/common/pfuze.c
@@ -0,0 +1,172 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <errno.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+
+#ifndef CONFIG_DM_PMIC_PFUZE100
+int pfuze_mode_init(struct pmic *p, u32 mode)
+{
+ unsigned char offset, i, switch_num;
+ u32 id;
+ int ret;
+
+ pmic_reg_read(p, PFUZE100_DEVICEID, &id);
+ id = id & 0xf;
+
+ if (id == 0) {
+ switch_num = 6;
+ offset = PFUZE100_SW1CMODE;
+ } else if (id == 1) {
+ switch_num = 4;
+ offset = PFUZE100_SW2MODE;
+ } else {
+ printf("Not supported, id=%d\n", id);
+ return -EINVAL;
+ }
+
+ ret = pmic_reg_write(p, PFUZE100_SW1ABMODE, mode);
+ if (ret < 0) {
+ printf("Set SW1AB mode error!\n");
+ return ret;
+ }
+
+ for (i = 0; i < switch_num - 1; i++) {
+ ret = pmic_reg_write(p, offset + i * SWITCH_SIZE, mode);
+ if (ret < 0) {
+ printf("Set switch 0x%x mode error!\n",
+ offset + i * SWITCH_SIZE);
+ return ret;
+ }
+ }
+
+ return ret;
+}
+
+struct pmic *pfuze_common_init(unsigned char i2cbus)
+{
+ struct pmic *p;
+ int ret;
+ unsigned int reg;
+
+ ret = power_pfuze100_init(i2cbus);
+ if (ret)
+ return NULL;
+
+ p = pmic_get("PFUZE100");
+ ret = pmic_probe(p);
+ if (ret)
+ return NULL;
+
+ pmic_reg_read(p, PFUZE100_DEVICEID, &reg);
+ printf("PMIC: PFUZE100 ID=0x%02x\n", reg);
+
+ /* Set SW1AB stanby volage to 0.975V */
+ pmic_reg_read(p, PFUZE100_SW1ABSTBY, &reg);
+ reg &= ~SW1x_STBY_MASK;
+ reg |= SW1x_0_975V;
+ pmic_reg_write(p, PFUZE100_SW1ABSTBY, reg);
+
+ /* Set SW1AB/VDDARM step ramp up time from 16us to 4us/25mV */
+ pmic_reg_read(p, PFUZE100_SW1ABCONF, &reg);
+ reg &= ~SW1xCONF_DVSSPEED_MASK;
+ reg |= SW1xCONF_DVSSPEED_4US;
+ pmic_reg_write(p, PFUZE100_SW1ABCONF, reg);
+
+ /* Set SW1C standby voltage to 0.975V */
+ pmic_reg_read(p, PFUZE100_SW1CSTBY, &reg);
+ reg &= ~SW1x_STBY_MASK;
+ reg |= SW1x_0_975V;
+ pmic_reg_write(p, PFUZE100_SW1CSTBY, reg);
+
+ /* Set SW1C/VDDSOC step ramp up time from 16us to 4us/25mV */
+ pmic_reg_read(p, PFUZE100_SW1CCONF, &reg);
+ reg &= ~SW1xCONF_DVSSPEED_MASK;
+ reg |= SW1xCONF_DVSSPEED_4US;
+ pmic_reg_write(p, PFUZE100_SW1CCONF, reg);
+
+ return p;
+}
+#elif defined(CONFIG_DM_PMIC)
+int pfuze_mode_init(struct udevice *dev, u32 mode)
+{
+ unsigned char offset, i, switch_num;
+ u32 id;
+ int ret;
+
+ id = pmic_reg_read(dev, PFUZE100_DEVICEID);
+ id = id & 0xf;
+
+ if (id == 0) {
+ switch_num = 6;
+ offset = PFUZE100_SW1CMODE;
+ } else if (id == 1) {
+ switch_num = 4;
+ offset = PFUZE100_SW2MODE;
+ } else {
+ printf("Not supported, id=%d\n", id);
+ return -EINVAL;
+ }
+
+ ret = pmic_reg_write(dev, PFUZE100_SW1ABMODE, mode);
+ if (ret < 0) {
+ printf("Set SW1AB mode error!\n");
+ return ret;
+ }
+
+ for (i = 0; i < switch_num - 1; i++) {
+ ret = pmic_reg_write(dev, offset + i * SWITCH_SIZE, mode);
+ if (ret < 0) {
+ printf("Set switch 0x%x mode error!\n",
+ offset + i * SWITCH_SIZE);
+ return ret;
+ }
+ }
+
+ return ret;
+}
+
+struct udevice *pfuze_common_init(void)
+{
+ struct udevice *dev;
+ int ret;
+ unsigned int reg, dev_id, rev_id;
+
+ ret = pmic_get("pfuze100@8", &dev);
+ if (ret == -ENODEV)
+ return NULL;
+
+ dev_id = pmic_reg_read(dev, PFUZE100_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE100_REVID);
+ printf("PMIC: PFUZE100! DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+ /* Set SW1AB stanby volage to 0.975V */
+ reg = pmic_reg_read(dev, PFUZE100_SW1ABSTBY);
+ reg &= ~SW1x_STBY_MASK;
+ reg |= SW1x_0_975V;
+ pmic_reg_write(dev, PFUZE100_SW1ABSTBY, reg);
+
+ /* Set SW1AB/VDDARM step ramp up time from 16us to 4us/25mV */
+ reg = pmic_reg_read(dev, PFUZE100_SW1ABCONF);
+ reg &= ~SW1xCONF_DVSSPEED_MASK;
+ reg |= SW1xCONF_DVSSPEED_4US;
+ pmic_reg_write(dev, PFUZE100_SW1ABCONF, reg);
+
+ /* Set SW1C standby voltage to 0.975V */
+ reg = pmic_reg_read(dev, PFUZE100_SW1CSTBY);
+ reg &= ~SW1x_STBY_MASK;
+ reg |= SW1x_0_975V;
+ pmic_reg_write(dev, PFUZE100_SW1CSTBY, reg);
+
+ /* Set SW1C/VDDSOC step ramp up time from 16us to 4us/25mV */
+ reg = pmic_reg_read(dev, PFUZE100_SW1CCONF);
+ reg &= ~SW1xCONF_DVSSPEED_MASK;
+ reg |= SW1xCONF_DVSSPEED_4US;
+ pmic_reg_write(dev, PFUZE100_SW1CCONF, reg);
+
+ return dev;
+}
+#endif
diff --git a/board/freescale/common/pfuze.h b/board/freescale/common/pfuze.h
new file mode 100644
index 00000000000..45b49afaeb7
--- /dev/null
+++ b/board/freescale/common/pfuze.h
@@ -0,0 +1,17 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __PFUZE_BOARD_HELPER__
+#define __PFUZE_BOARD_HELPER__
+
+#ifdef CONFIG_DM_PMIC_PFUZE100
+struct udevice *pfuze_common_init(void);
+int pfuze_mode_init(struct udevice *dev, u32 mode);
+#else
+struct pmic *pfuze_common_init(unsigned char i2cbus);
+int pfuze_mode_init(struct pmic *p, u32 mode);
+#endif
+
+#endif
diff --git a/board/freescale/common/qixis.c b/board/freescale/common/qixis.c
new file mode 100644
index 00000000000..6400ac05245
--- /dev/null
+++ b/board/freescale/common/qixis.c
@@ -0,0 +1,388 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011 Freescale Semiconductor
+ * Copyright 2020 NXP
+ * Author: Shengzhou Liu <Shengzhou.Liu@freescale.com>
+ *
+ * This file provides support for the QIXIS of some Freescale reference boards.
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+#include <linux/compiler.h>
+#include <linux/time.h>
+#include <i2c.h>
+#include "qixis.h"
+
+#ifndef QIXIS_LBMAP_BRDCFG_REG
+/*
+ * For consistency with existing platforms
+ */
+#define QIXIS_LBMAP_BRDCFG_REG 0x00
+#endif
+
+#ifndef QIXIS_RCFG_CTL_RECONFIG_IDLE
+#define QIXIS_RCFG_CTL_RECONFIG_IDLE 0x20
+#endif
+#ifndef QIXIS_RCFG_CTL_RECONFIG_START
+#define QIXIS_RCFG_CTL_RECONFIG_START 0x21
+#endif
+
+#ifdef CFG_SYS_I2C_FPGA_ADDR
+u8 qixis_read_i2c(unsigned int reg)
+{
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ return i2c_reg_read(CFG_SYS_I2C_FPGA_ADDR, reg);
+#else
+ struct udevice *dev;
+
+ if (i2c_get_chip_for_busnum(0, CFG_SYS_I2C_FPGA_ADDR, 1, &dev))
+ return 0xff;
+
+ return dm_i2c_reg_read(dev, reg);
+#endif
+}
+
+void qixis_write_i2c(unsigned int reg, u8 value)
+{
+ u8 val = value;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_reg_write(CFG_SYS_I2C_FPGA_ADDR, reg, val);
+#else
+ struct udevice *dev;
+
+ if (!i2c_get_chip_for_busnum(0, CFG_SYS_I2C_FPGA_ADDR, 1, &dev))
+ dm_i2c_reg_write(dev, reg, val);
+#endif
+
+}
+#endif
+
+#ifdef QIXIS_BASE
+u8 qixis_read(unsigned int reg)
+{
+ void *p = (void *)QIXIS_BASE;
+
+ return in_8(p + reg);
+}
+
+void qixis_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)QIXIS_BASE;
+
+ out_8(p + reg, value);
+}
+#endif
+
+u16 qixis_read_minor(void)
+{
+ u16 minor;
+
+ /* this data is in little endian */
+ QIXIS_WRITE(tagdata, 5);
+ minor = QIXIS_READ(tagdata);
+ QIXIS_WRITE(tagdata, 6);
+ minor += QIXIS_READ(tagdata) << 8;
+
+ return minor;
+}
+
+char *qixis_read_time(char *result)
+{
+ time_t time = 0;
+ int i;
+
+ /* timestamp is in 32-bit big endian */
+ for (i = 8; i <= 11; i++) {
+ QIXIS_WRITE(tagdata, i);
+ time = (time << 8) + QIXIS_READ(tagdata);
+ }
+
+ return ctime_r(&time, result);
+}
+
+char *qixis_read_tag(char *buf)
+{
+ int i;
+ char tag, *ptr = buf;
+
+ for (i = 16; i <= 63; i++) {
+ QIXIS_WRITE(tagdata, i);
+ tag = QIXIS_READ(tagdata);
+ *(ptr++) = tag;
+ if (!tag)
+ break;
+ }
+ if (i > 63)
+ *ptr = '\0';
+
+ return buf;
+}
+
+/*
+ * return the string of binary of u8 in the format of
+ * 1010 10_0. The masked bit is filled as underscore.
+ */
+const char *byte_to_binary_mask(u8 val, u8 mask, char *buf)
+{
+ char *ptr;
+ int i;
+
+ ptr = buf;
+ for (i = 0x80; i > 0x08 ; i >>= 1, ptr++)
+ *ptr = (val & i) ? '1' : ((mask & i) ? '_' : '0');
+ *(ptr++) = ' ';
+ for (i = 0x08; i > 0 ; i >>= 1, ptr++)
+ *ptr = (val & i) ? '1' : ((mask & i) ? '_' : '0');
+
+ *ptr = '\0';
+
+ return buf;
+}
+
+#ifdef QIXIS_RST_FORCE_MEM
+void board_assert_mem_reset(void)
+{
+ u8 rst;
+
+ rst = QIXIS_READ(rst_frc[0]);
+ if (!(rst & QIXIS_RST_FORCE_MEM))
+ QIXIS_WRITE(rst_frc[0], rst | QIXIS_RST_FORCE_MEM);
+}
+
+void board_deassert_mem_reset(void)
+{
+ u8 rst;
+
+ rst = QIXIS_READ(rst_frc[0]);
+ if (rst & QIXIS_RST_FORCE_MEM)
+ QIXIS_WRITE(rst_frc[0], rst & ~QIXIS_RST_FORCE_MEM);
+}
+#endif
+
+#ifndef CONFIG_SPL_BUILD
+static void qixis_reset(void)
+{
+ QIXIS_WRITE(rst_ctl, QIXIS_RST_CTL_RESET);
+}
+
+#ifdef QIXIS_LBMAP_ALTBANK
+static void qixis_bank_reset(void)
+{
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_START);
+}
+#endif
+
+static void __maybe_unused set_lbmap(int lbmap)
+{
+ u8 reg;
+
+ reg = QIXIS_READ(brdcfg[QIXIS_LBMAP_BRDCFG_REG]);
+ reg = (reg & ~QIXIS_LBMAP_MASK) | lbmap;
+ QIXIS_WRITE(brdcfg[QIXIS_LBMAP_BRDCFG_REG], reg);
+}
+
+static void __maybe_unused set_rcw_src(int rcw_src)
+{
+#ifdef CONFIG_NXP_LSCH3_2
+ QIXIS_WRITE(dutcfg[0], (rcw_src & 0xff));
+#else
+ u8 reg;
+
+ reg = QIXIS_READ(dutcfg[1]);
+ reg = (reg & ~1) | (rcw_src & 1);
+ QIXIS_WRITE(dutcfg[1], reg);
+ QIXIS_WRITE(dutcfg[0], (rcw_src >> 1) & 0xff);
+#endif
+}
+
+static void qixis_dump_regs(void)
+{
+ int i;
+
+ printf("id = %02x\n", QIXIS_READ(id));
+ printf("arch = %02x\n", QIXIS_READ(arch));
+ printf("scver = %02x\n", QIXIS_READ(scver));
+ printf("model = %02x\n", QIXIS_READ(model));
+ printf("rst_ctl = %02x\n", QIXIS_READ(rst_ctl));
+ printf("aux = %02x\n", QIXIS_READ(aux));
+ for (i = 0; i < 16; i++)
+ printf("brdcfg%02d = %02x\n", i, QIXIS_READ(brdcfg[i]));
+ for (i = 0; i < 16; i++)
+ printf("dutcfg%02d = %02x\n", i, QIXIS_READ(dutcfg[i]));
+ printf("sclk = %02x%02x%02x\n", QIXIS_READ(sclk[0]),
+ QIXIS_READ(sclk[1]), QIXIS_READ(sclk[2]));
+ printf("dclk = %02x%02x%02x\n", QIXIS_READ(dclk[0]),
+ QIXIS_READ(dclk[1]), QIXIS_READ(dclk[2]));
+ printf("aux = %02x\n", QIXIS_READ(aux));
+ printf("watch = %02x\n", QIXIS_READ(watch));
+ printf("ctl_sys = %02x\n", QIXIS_READ(ctl_sys));
+ printf("rcw_ctl = %02x\n", QIXIS_READ(rcw_ctl));
+ printf("present = %02x\n", QIXIS_READ(present));
+ printf("present2 = %02x\n", QIXIS_READ(present2));
+ printf("clk_spd = %02x\n", QIXIS_READ(clk_spd));
+ printf("stat_dut = %02x\n", QIXIS_READ(stat_dut));
+ printf("stat_sys = %02x\n", QIXIS_READ(stat_sys));
+ printf("stat_alrm = %02x\n", QIXIS_READ(stat_alrm));
+}
+
+void __weak qixis_dump_switch(void)
+{
+ puts("Reverse engineering switch is not implemented for this board\n");
+}
+
+static int qixis_reset_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ int i;
+
+ if (argc <= 1) {
+ set_lbmap(QIXIS_LBMAP_DFLTBANK);
+ qixis_reset();
+ } else if (strcmp(argv[1], "altbank") == 0) {
+#ifdef QIXIS_LBMAP_ALTBANK
+ set_lbmap(QIXIS_LBMAP_ALTBANK);
+ qixis_bank_reset();
+#else
+ printf("No Altbank!\n");
+#endif
+ } else if (strcmp(argv[1], "nand") == 0) {
+#ifdef QIXIS_LBMAP_NAND
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+ set_lbmap(QIXIS_LBMAP_NAND);
+ set_rcw_src(QIXIS_RCW_SRC_NAND);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "sd") == 0) {
+#ifdef QIXIS_LBMAP_SD
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+#ifdef NON_EXTENDED_DUTCFG
+ QIXIS_WRITE(dutcfg[0], QIXIS_RCW_SRC_SD);
+#else
+ set_lbmap(QIXIS_LBMAP_SD);
+ set_rcw_src(QIXIS_RCW_SRC_SD);
+#endif
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "ifc") == 0) {
+#ifdef QIXIS_LBMAP_IFC
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+ set_lbmap(QIXIS_LBMAP_IFC);
+ set_rcw_src(QIXIS_RCW_SRC_IFC);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "emmc") == 0) {
+#ifdef QIXIS_LBMAP_EMMC
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+#ifndef NON_EXTENDED_DUTCFG
+ set_lbmap(QIXIS_LBMAP_EMMC);
+#endif
+ set_rcw_src(QIXIS_RCW_SRC_EMMC);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ QIXIS_WRITE(rcfg_ctl, QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "sd_qspi") == 0) {
+#ifdef QIXIS_LBMAP_SD_QSPI
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+ set_lbmap(QIXIS_LBMAP_SD_QSPI);
+ set_rcw_src(QIXIS_RCW_SRC_SD);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "qspi") == 0) {
+#ifdef QIXIS_LBMAP_QSPI
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+ set_lbmap(QIXIS_LBMAP_QSPI);
+ set_rcw_src(QIXIS_RCW_SRC_QSPI);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "xspi") == 0) {
+#ifdef QIXIS_LBMAP_XSPI
+ QIXIS_WRITE(rst_ctl, 0x30);
+ QIXIS_WRITE(rcfg_ctl, 0);
+ set_lbmap(QIXIS_LBMAP_XSPI);
+ set_rcw_src(QIXIS_RCW_SRC_XSPI);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_IDLE);
+ qixis_write_i2c(offsetof(struct qixis, rcfg_ctl),
+ QIXIS_RCFG_CTL_RECONFIG_START);
+#else
+ printf("Not implemented\n");
+#endif
+ } else if (strcmp(argv[1], "watchdog") == 0) {
+ static char *period[9] = {"2s", "4s", "8s", "16s", "32s",
+ "1min", "2min", "4min", "8min"};
+ u8 rcfg = QIXIS_READ(rcfg_ctl);
+
+ if (argv[2] == NULL) {
+ printf("qixis watchdog <watchdog_period>\n");
+ return 0;
+ }
+ for (i = 0; i < ARRAY_SIZE(period); i++) {
+ if (strcmp(argv[2], period[i]) == 0) {
+ /* disable watchdog */
+ QIXIS_WRITE(rcfg_ctl,
+ rcfg & ~QIXIS_RCFG_CTL_WATCHDOG_ENBLE);
+ QIXIS_WRITE(watch, ((i<<2) - 1));
+ QIXIS_WRITE(rcfg_ctl, rcfg);
+ return 0;
+ }
+ }
+ } else if (strcmp(argv[1], "dump") == 0) {
+ qixis_dump_regs();
+ return 0;
+ } else if (strcmp(argv[1], "switch") == 0) {
+ qixis_dump_switch();
+ return 0;
+ } else {
+ printf("Invalid option: %s\n", argv[1]);
+ return 1;
+ }
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ qixis_reset, CONFIG_SYS_MAXARGS, 1, qixis_reset_cmd,
+ "Reset the board using the FPGA sequencer",
+ "- hard reset to default bank\n"
+ "qixis_reset altbank - reset to alternate bank\n"
+ "qixis_reset nand - reset to nand\n"
+ "qixis_reset sd - reset to sd\n"
+ "qixis_reset sd_qspi - reset to sd with qspi support\n"
+ "qixis_reset qspi - reset to qspi\n"
+ "qixis watchdog <watchdog_period> - set the watchdog period\n"
+ " period: 1s 2s 4s 8s 16s 32s 1min 2min 4min 8min\n"
+ "qixis_reset dump - display the QIXIS registers\n"
+ "qixis_reset emmc - reset to emmc\n"
+ "qixis_reset switch - display switch\n"
+ );
+#endif
diff --git a/board/freescale/common/qixis.h b/board/freescale/common/qixis.h
new file mode 100644
index 00000000000..784046ac4e0
--- /dev/null
+++ b/board/freescale/common/qixis.h
@@ -0,0 +1,190 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2011 Freescale Semiconductor
+ * Copyright 2020 NXP
+ * Author: Shengzhou Liu <Shengzhou.Liu@freescale.com>
+ *
+ * This file provides support for the QIXIS of some Freescale reference boards.
+ */
+
+#ifndef __QIXIS_H_
+#define __QIXIS_H_
+
+struct qixis {
+ u8 id; /* ID value uniquely identifying each QDS board type */
+ u8 arch; /* Board version information */
+ u8 scver; /* QIXIS Version Register */
+ u8 model; /* Information of software programming model version */
+ u8 tagdata;
+ u8 ctl_sys;
+ u8 aux; /* Auxiliary Register,0x06 */
+ u8 clk_spd;
+ u8 stat_dut;
+ u8 stat_sys;
+ u8 stat_alrm;
+ u8 present;
+ u8 present2; /* Presence Status Register 2,0x0c */
+ u8 rcw_ctl;
+ u8 ctl_led;
+ u8 i2cblk;
+ u8 rcfg_ctl; /* Reconfig Control Register,0x10 */
+ u8 rcfg_st;
+ u8 dcm_ad;
+ u8 dcm_da;
+ u8 dcmd;
+ u8 dmsg;
+ u8 gdc;
+ u8 gdd; /* DCM Debug Data Register,0x17 */
+ u8 dmack;
+ u8 res1;
+ u8 sdhc1;
+ u8 sdhc2;
+ u8 stat_pres3;
+ u8 los_stat;
+ u8 usb_ctl;
+ u8 watch; /* Watchdog Register,0x1F */
+ u8 pwr_ctl[2]; /* Power Control Register,0x20 */
+ u8 res2[2];
+ u8 pwr_stat[4]; /* Power Status Register,0x24 */
+ u8 res3[8];
+ u8 clk_spd2[2]; /* SYSCLK clock Speed Register,0x30 */
+ u8 res4[2];
+ u8 sclk[3]; /* Clock Configuration Registers,0x34 */
+ u8 res5;
+ u8 dclk[3];
+ u8 res6;
+ u8 clk_dspd[3];
+ u8 res7;
+ u8 rst_ctl; /* Reset Control Register,0x40 */
+ u8 rst_stat; /* Reset Status Register */
+ u8 rst_rsn; /* Reset Reason Register */
+ u8 rst_frc[2]; /* Reset Force Registers,0x43 */
+ u8 res8[11];
+ u8 brdcfg[16]; /* Board Configuration Register,0x50 */
+ u8 dutcfg[16];
+ u8 rcw_ad[2]; /* RCW SRAM Address Registers,0x70 */
+ u8 rcw_data;
+ u8 res9[5];
+ u8 post_ctl;
+ u8 post_stat;
+ u8 post_dat[2];
+ u8 pi_d[4];
+ u8 gpio_io[4];
+ u8 gpio_dir[4];
+ u8 res10[20];
+ u8 rjtag_ctl;
+ u8 rjtag_dat;
+ u8 res11[2];
+ u8 trig_src[4];
+ u8 trig_dst[4];
+ u8 trig_stat;
+ u8 res12[3];
+ u8 trig_ctr[4];
+ u8 res13[16];
+ u8 clk_freq[6]; /* Clock Measurement Registers */
+ u8 res_c6[8];
+ u8 clk_base[2]; /* Clock Frequency Base Reg */
+ u8 res_d0[8];
+ u8 cms[2]; /* Core Management Space Address Register, 0xD8 */
+ u8 res_c0[6];
+ u8 aux2[4]; /* Auxiliary Registers,0xE0 */
+ u8 res14[10];
+ u8 aux_ad;
+ u8 aux_da;
+ u8 res15[16];
+};
+
+u8 qixis_read(unsigned int reg);
+void qixis_write(unsigned int reg, u8 value);
+u16 qixis_read_minor(void);
+char *qixis_read_time(char *result);
+char *qixis_read_tag(char *buf);
+const char *byte_to_binary_mask(u8 val, u8 mask, char *buf);
+#ifdef CFG_SYS_I2C_FPGA_ADDR
+u8 qixis_read_i2c(unsigned int reg);
+void qixis_write_i2c(unsigned int reg, u8 value);
+#endif
+
+#if defined(CONFIG_QIXIS_I2C_ACCESS) && defined(CFG_SYS_I2C_FPGA_ADDR)
+#define QIXIS_READ(reg) qixis_read_i2c(offsetof(struct qixis, reg))
+#define QIXIS_WRITE(reg, value) \
+ qixis_write_i2c(offsetof(struct qixis, reg), value)
+#else
+#define QIXIS_READ(reg) qixis_read(offsetof(struct qixis, reg))
+#define QIXIS_WRITE(reg, value) qixis_write(offsetof(struct qixis, reg), value)
+#endif
+
+#ifdef CFG_SYS_I2C_FPGA_ADDR
+#define QIXIS_READ_I2C(reg) qixis_read_i2c(offsetof(struct qixis, reg))
+#define QIXIS_WRITE_I2C(reg, value) \
+ qixis_write_i2c(offsetof(struct qixis, reg), value)
+#endif
+
+/* Use for SDHC adapter card type identification and operation */
+#define QIXIS_SDID_MASK 0x07
+
+#define QIXIS_ESDHC_ADAPTER_TYPE_EMMC45 0x1 /* eMMC Card Rev4.5 */
+#define QIXIS_ESDHC_ADAPTER_TYPE_SDMMC_LEGACY 0x2 /* SD/MMC Legacy Card */
+#define QIXIS_ESDHC_ADAPTER_TYPE_EMMC44 0x3 /* eMMC Card Rev4.4 */
+#define QIXIS_ESDHC_ADAPTER_TYPE_RSV 0x4 /* Reserved */
+#define QIXIS_ESDHC_ADAPTER_TYPE_MMC 0x5 /* MMC Card */
+#define QIXIS_ESDHC_ADAPTER_TYPE_SD 0x6 /* SD Card Rev2.0 3.0 */
+#define QIXIS_ESDHC_NO_ADAPTER 0x7 /* No Card is Present*/
+
+#define QIXIS_SDHC1_S1V3 0x80 /* SDHC1: SDHC1 3.3V power control */
+#define QIXIS_SDHC1_VS 0x30 /* BRDCFG11: route to SDHC1_VS */
+
+#define QIXIS_SDCLKIN 0x08
+#define QIXIS_SDCLKOUT 0x02
+#define QIXIS_DAT5_6_7 0X02
+#define QIXIS_DAT4 0X01
+
+#define QIXIS_EVDD_BY_SDHC_VS 0x0c
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS) || \
+defined(CONFIG_TARGET_LX2160ARDB)
+#define QIXIS_XMAP_MASK 0x07
+#define QIXIS_RST_CTL_RESET_EN 0x30
+#define QIXIS_LBMAP_DFLTBANK 0x00
+#define QIXIS_LBMAP_ALTBANK 0x20
+#define QIXIS_LBMAP_QSPI 0x00
+#define QIXIS_RCW_SRC_QSPI 0xff
+#define QIXIS_RST_CTL_RESET 0x31
+#define QIXIS_RCFG_CTL_RECONFIG_IDLE 0x20
+#define QIXIS_RCFG_CTL_RECONFIG_START 0x21
+#define QIXIS_RCFG_CTL_WATCHDOG_ENBLE 0x08
+#define QIXIS_LBMAP_MASK 0x0f
+#define QIXIS_LBMAP_SD
+#define QIXIS_LBMAP_EMMC
+#define QIXIS_RCW_SRC_SD 0x08
+#define QIXIS_RCW_SRC_EMMC 0x09
+#define NON_EXTENDED_DUTCFG
+#endif
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+#define QIXIS_SDID_MASK 0x07
+#define QIXIS_ESDHC_NO_ADAPTER 0x7
+#endif
+
+/*
+ * implementation of CONFIG_ESDHC_DETECT_QUIRK Macro.
+ */
+static inline u8 qixis_esdhc_detect_quirk(void)
+{
+ /*
+ * SDHC1 Card ID:
+ * Specifies the type of card installed in the SDHC1 adapter slot.
+ * 000= (reserved)
+ * 001= eMMC V4.5 adapter is installed.
+ * 010= SD/MMC 3.3V adapter is installed.
+ * 011= eMMC V4.4 adapter is installed.
+ * 100= eMMC V5.0 adapter is installed.
+ * 101= MMC card/Legacy (3.3V) adapter is installed.
+ * 110= SDCard V2/V3 adapter installed.
+ * 111= no adapter is installed.
+ */
+ return ((QIXIS_READ(sdhc1) & QIXIS_SDID_MASK) !=
+ QIXIS_ESDHC_NO_ADAPTER);
+}
+
+#endif
diff --git a/board/freescale/common/sdhc_boot.c b/board/freescale/common/sdhc_boot.c
new file mode 100644
index 00000000000..5ee730cefd0
--- /dev/null
+++ b/board/freescale/common/sdhc_boot.c
@@ -0,0 +1,78 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ */
+
+#include <mmc.h>
+#include <malloc.h>
+
+/*
+ * The environment variables are written to just after the u-boot image
+ * on SDCard, so we must read the MBR to get the start address and code
+ * length of the u-boot image, then calculate the address of the env.
+ */
+#define ESDHC_BOOT_IMAGE_SIZE 0x48
+#define ESDHC_BOOT_IMAGE_ADDR 0x50
+
+#define ESDHC_DEFAULT_ENVADDR 0x400
+
+int mmc_get_env_addr(struct mmc *mmc, int copy, u32 *env_addr)
+{
+ u8 *tmp_buf;
+ u32 blklen, code_offset, code_len, n;
+
+ blklen = mmc->read_bl_len;
+ tmp_buf = malloc(blklen);
+ if (!tmp_buf)
+ return 1;
+
+ /* read out the first block, get the config data information */
+#ifdef CONFIG_BLK
+ n = blk_dread(mmc_get_blk_desc(mmc), 0, 1, tmp_buf);
+#else
+ n = mmc->block_dev.block_read(&mmc->block_dev, 0, 1, tmp_buf);
+#endif
+ if (!n) {
+ free(tmp_buf);
+ return 1;
+ }
+
+ /* Get the Source Address, from offset 0x50 */
+ code_offset = *(u32 *)(tmp_buf + ESDHC_BOOT_IMAGE_ADDR);
+
+ /* Get the code size from offset 0x48 */
+ code_len = *(u32 *)(tmp_buf + ESDHC_BOOT_IMAGE_SIZE);
+
+#ifdef CONFIG_ESDHC_HC_BLK_ADDR
+ /*
+ * On soc BSC9131, BSC9132:
+ * In High Capacity SD Cards (> 2 GBytes), the 32-bit source address and
+ * code length of these soc specify the memory address in block address
+ * format. Block length is fixed to 512 bytes as per the SD High
+ * Capacity specification.
+ */
+ u64 tmp;
+
+ if (mmc->high_capacity) {
+ tmp = (u64)code_offset * blklen;
+ tmp += code_len * blklen;
+ } else
+ tmp = code_offset + code_len;
+
+ if ((tmp + CONFIG_ENV_SIZE > mmc->capacity) ||
+ (tmp > 0xFFFFFFFFU))
+ *env_addr = ESDHC_DEFAULT_ENVADDR;
+ else
+ *env_addr = tmp;
+
+ free(tmp_buf);
+
+ return 0;
+#endif
+
+ *env_addr = code_offset + code_len;
+
+ free(tmp_buf);
+
+ return 0;
+}
diff --git a/board/freescale/common/sgmii_riser.h b/board/freescale/common/sgmii_riser.h
new file mode 100644
index 00000000000..e1fcc858f3f
--- /dev/null
+++ b/board/freescale/common/sgmii_riser.h
@@ -0,0 +1,16 @@
+/*
+ * Freescale SGMII Riser Card
+ *
+ * This driver supports the SGMII Riser card found on the
+ * "DS" style of development board from Freescale.
+ *
+ * This software may be used and distributed according to the
+ * terms of the GNU Public License, Version 2, incorporated
+ * herein by reference.
+ *
+ * Copyright 2008 Freescale Semiconductor, Inc.
+ *
+ */
+
+void fsl_sgmii_riser_init(struct tsec_info_struct *tsec_info, int num);
+void fsl_sgmii_riser_fdt_fixup(void *fdt);
diff --git a/board/freescale/common/sleep.h b/board/freescale/common/sleep.h
new file mode 100644
index 00000000000..1450baa0725
--- /dev/null
+++ b/board/freescale/common/sleep.h
@@ -0,0 +1,20 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __SLEEP_H
+#define __SLEEP_H
+
+#define DCFG_CCSR_CRSTSR_WDRFR (1 << 3)
+#define DDR_BUFF_LEN 128
+
+/* determine if it is a wakeup from deep sleep */
+bool is_warm_boot(void);
+
+/* disable console output */
+void fsl_dp_disable_console(void);
+
+/* clean up everything and jump to kernel */
+int fsl_dp_resume(void);
+#endif
diff --git a/board/freescale/common/spl.h b/board/freescale/common/spl.h
new file mode 100644
index 00000000000..d4689d3d726
--- /dev/null
+++ b/board/freescale/common/spl.h
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Google, Inc
+ */
+
+#ifndef __FREESCALE_BOARD_SPL_H
+#define __FREESCALE_BOARD_SPL_H
+
+void fsl_spi_spl_load_image(uint32_t offs, unsigned int size, void *vdst);
+void fsl_spi_boot(void) __noreturn;
+
+#endif
diff --git a/board/freescale/common/sys_eeprom.c b/board/freescale/common/sys_eeprom.c
new file mode 100644
index 00000000000..ec3c9e37222
--- /dev/null
+++ b/board/freescale/common/sys_eeprom.c
@@ -0,0 +1,648 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2006, 2008-2009, 2011 Freescale Semiconductor
+ * York Sun (yorksun@freescale.com)
+ * Haiying Wang (haiying.wang@freescale.com)
+ * Timur Tabi (timur@freescale.com)
+ */
+
+#include <command.h>
+#include <env.h>
+#include <i2c.h>
+#include <init.h>
+#include <linux/ctype.h>
+#include <linux/delay.h>
+#include <u-boot/crc.h>
+
+#ifdef CONFIG_SYS_I2C_EEPROM_CCID
+#include "../common/eeprom.h"
+#define MAX_NUM_PORTS 8
+#endif
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+/* some boards with non-256-bytes EEPROM have special define */
+/* for MAX_NUM_PORTS in board-specific file */
+#ifndef MAX_NUM_PORTS
+#define MAX_NUM_PORTS 16
+#endif
+#define NXID_VERSION 1
+#endif
+
+/**
+ * static eeprom: EEPROM layout for CCID or NXID formats
+ *
+ * See application note AN3638 for details.
+ */
+static struct __attribute__ ((__packed__)) eeprom {
+#ifdef CONFIG_SYS_I2C_EEPROM_CCID
+ u8 id[4]; /* 0x00 - 0x03 EEPROM Tag 'CCID' */
+ u8 major; /* 0x04 Board revision, major */
+ u8 minor; /* 0x05 Board revision, minor */
+ u8 sn[10]; /* 0x06 - 0x0F Serial Number*/
+ u8 errata[2]; /* 0x10 - 0x11 Errata Level */
+ u8 date[6]; /* 0x12 - 0x17 Build Date */
+ u8 res_0[40]; /* 0x18 - 0x3f Reserved */
+ u8 mac_count; /* 0x40 Number of MAC addresses */
+ u8 mac_flag; /* 0x41 MAC table flags */
+ u8 mac[MAX_NUM_PORTS][6]; /* 0x42 - 0x71 MAC addresses */
+ u32 crc; /* 0x72 CRC32 checksum */
+#endif
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ u8 id[4]; /* 0x00 - 0x03 EEPROM Tag 'NXID' */
+ u8 sn[12]; /* 0x04 - 0x0F Serial Number */
+ u8 errata[5]; /* 0x10 - 0x14 Errata Level */
+ u8 date[6]; /* 0x15 - 0x1a Build Date */
+ u8 res_0; /* 0x1b Reserved */
+ u32 version; /* 0x1c - 0x1f NXID Version */
+ u8 tempcal[8]; /* 0x20 - 0x27 Temperature Calibration Factors */
+ u8 tempcalsys[2]; /* 0x28 - 0x29 System Temperature Calibration Factors */
+ u8 tempcalflags; /* 0x2a Temperature Calibration Flags */
+ u8 res_1[21]; /* 0x2b - 0x3f Reserved */
+ u8 mac_count; /* 0x40 Number of MAC addresses */
+ u8 mac_flag; /* 0x41 MAC table flags */
+ u8 mac[MAX_NUM_PORTS][6]; /* 0x42 - 0xa1 MAC addresses */
+ u8 res_2[90]; /* 0xa2 - 0xfb Reserved */
+ u32 crc; /* 0xfc - 0xff CRC32 checksum */
+#endif
+} e;
+
+/* Set to 1 if we've read EEPROM into memory */
+static int has_been_read = 0;
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+/* Is this a valid NXID EEPROM? */
+#define is_valid ((e.id[0] == 'N') || (e.id[1] == 'X') || \
+ (e.id[2] == 'I') || (e.id[3] == 'D'))
+#endif
+
+#ifdef CONFIG_SYS_I2C_EEPROM_CCID
+/* Is this a valid CCID EEPROM? */
+#define is_valid ((e.id[0] == 'C') || (e.id[1] == 'C') || \
+ (e.id[2] == 'I') || (e.id[3] == 'D'))
+#endif
+
+/**
+ * show_eeprom - display the contents of the EEPROM
+ */
+static void show_eeprom(void)
+{
+ int i;
+ unsigned int crc;
+
+ /* EEPROM tag ID, either CCID or NXID */
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ printf("ID: %c%c%c%c v%u\n", e.id[0], e.id[1], e.id[2], e.id[3],
+ be32_to_cpu(e.version));
+#else
+ printf("ID: %c%c%c%c\n", e.id[0], e.id[1], e.id[2], e.id[3]);
+#endif
+
+ /* Serial number */
+ printf("SN: %s\n", e.sn);
+
+ /* Errata level. */
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ printf("Errata: %s\n", e.errata);
+#else
+ printf("Errata: %c%c\n",
+ e.errata[0] ? e.errata[0] : '.',
+ e.errata[1] ? e.errata[1] : '.');
+#endif
+
+ /* Build date, BCD date values, as YYMMDDhhmmss */
+ printf("Build date: 20%02x/%02x/%02x %02x:%02x:%02x %s\n",
+ e.date[0], e.date[1], e.date[2],
+ e.date[3] & 0x7F, e.date[4], e.date[5],
+ e.date[3] & 0x80 ? "PM" : "");
+
+ /* Show MAC addresses */
+ for (i = 0; i < min(e.mac_count, (u8)MAX_NUM_PORTS); i++) {
+
+ u8 *p = e.mac[i];
+
+ printf("Eth%u: %02x:%02x:%02x:%02x:%02x:%02x\n", i,
+ p[0], p[1], p[2], p[3], p[4], p[5]);
+ }
+
+ crc = crc32(0, (void *)&e, sizeof(e) - 4);
+
+ if (crc == be32_to_cpu(e.crc))
+ printf("CRC: %08x\n", be32_to_cpu(e.crc));
+ else
+ printf("CRC: %08x (should be %08x)\n",
+ be32_to_cpu(e.crc), crc);
+
+#ifdef DEBUG
+ printf("EEPROM dump: (0x%x bytes)\n", sizeof(e));
+ for (i = 0; i < sizeof(e); i++) {
+ if ((i % 16) == 0)
+ printf("%02X: ", i);
+ printf("%02X ", ((u8 *)&e)[i]);
+ if (((i % 16) == 15) || (i == sizeof(e) - 1))
+ printf("\n");
+ }
+#endif
+}
+
+/**
+ * read_eeprom - read the EEPROM into memory
+ */
+static int read_eeprom(void)
+{
+ int ret;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ unsigned int bus;
+#endif
+#endif
+
+ if (has_been_read)
+ return 0;
+
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ bus = i2c_get_bus_num();
+ i2c_set_bus_num(CONFIG_SYS_EEPROM_BUS_NUM);
+#endif
+#endif
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_read(CONFIG_SYS_I2C_EEPROM_ADDR, 0,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ (void *)&e, sizeof(e));
+#else
+ struct udevice *dev;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ ret = i2c_get_chip_for_busnum(CONFIG_SYS_EEPROM_BUS_NUM,
+ CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN, &dev);
+#else
+ ret = i2c_get_chip_for_busnum(0, CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN, &dev);
+#endif
+ if (!ret)
+ ret = dm_i2c_read(dev, 0, (void *)&e, sizeof(e));
+#endif
+
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_set_bus_num(bus);
+#endif
+#endif
+
+#ifdef DEBUG
+ show_eeprom();
+#endif
+
+ has_been_read = (ret == 0) ? 1 : 0;
+
+ return ret;
+}
+
+/**
+ * update_crc - update the CRC
+ *
+ * This function should be called after each update to the EEPROM structure,
+ * to make sure the CRC is always correct.
+ */
+static void update_crc(void)
+{
+ u32 crc;
+
+ crc = crc32(0, (void *)&e, sizeof(e) - 4);
+ e.crc = cpu_to_be32(crc);
+}
+
+/**
+ * prog_eeprom - write the EEPROM from memory
+ */
+static int prog_eeprom(void)
+{
+ int ret = 0;
+ int i;
+ void *p;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ unsigned int bus;
+#endif
+#endif
+
+ /* Set the reserved values to 0xFF */
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ e.res_0 = 0xFF;
+ memset(e.res_1, 0xFF, sizeof(e.res_1));
+#else
+ memset(e.res_0, 0xFF, sizeof(e.res_0));
+#endif
+ update_crc();
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ bus = i2c_get_bus_num();
+ i2c_set_bus_num(CONFIG_SYS_EEPROM_BUS_NUM);
+#endif
+#endif
+
+ /*
+ * The AT24C02 datasheet says that data can only be written in page
+ * mode, which means 8 bytes at a time, and it takes up to 5ms to
+ * complete a given write.
+ */
+ for (i = 0, p = &e; i < sizeof(e); i += 8, p += 8) {
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_write(CONFIG_SYS_I2C_EEPROM_ADDR, i,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ p, min((int)(sizeof(e) - i), 8));
+#else
+ struct udevice *dev;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ ret = i2c_get_chip_for_busnum(CONFIG_SYS_EEPROM_BUS_NUM,
+ CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#else
+ ret = i2c_get_chip_for_busnum(0, CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#endif
+ if (!ret)
+ ret = dm_i2c_write(dev, i, p, min((int)(sizeof(e) - i),
+ 8));
+#endif
+ if (ret)
+ break;
+ udelay(5000); /* 5ms write cycle timing */
+ }
+
+ if (!ret) {
+ /* Verify the write by reading back the EEPROM and comparing */
+ struct eeprom e2;
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_read(CONFIG_SYS_I2C_EEPROM_ADDR, 0,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ (void *)&e2, sizeof(e2));
+#else
+ struct udevice *dev;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ ret = i2c_get_chip_for_busnum(CONFIG_SYS_EEPROM_BUS_NUM,
+ CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#else
+ ret = i2c_get_chip_for_busnum(0, CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#endif
+ if (!ret)
+ ret = dm_i2c_read(dev, 0, (void *)&e2, sizeof(e2));
+#endif
+ if (!ret && memcmp(&e, &e2, sizeof(e)))
+ ret = -1;
+ }
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ i2c_set_bus_num(bus);
+#endif
+#endif
+
+ if (ret) {
+ printf("Programming failed.\n");
+ has_been_read = 0;
+ return -1;
+ }
+
+ printf("Programming passed.\n");
+ return 0;
+}
+
+/**
+ * h2i - converts hex character into a number
+ *
+ * This function takes a hexadecimal character (e.g. '7' or 'C') and returns
+ * the integer equivalent.
+ */
+static inline u8 h2i(char p)
+{
+ if ((p >= '0') && (p <= '9'))
+ return p - '0';
+
+ if ((p >= 'A') && (p <= 'F'))
+ return (p - 'A') + 10;
+
+ if ((p >= 'a') && (p <= 'f'))
+ return (p - 'a') + 10;
+
+ return 0;
+}
+
+/**
+ * set_date - stores the build date into the EEPROM
+ *
+ * This function takes a pointer to a string in the format "YYMMDDhhmmss"
+ * (2-digit year, 2-digit month, etc), converts it to a 6-byte BCD string,
+ * and stores it in the build date field of the EEPROM local copy.
+ */
+static void set_date(const char *string)
+{
+ unsigned int i;
+
+ if (strlen(string) != 12) {
+ printf("Usage: mac date YYMMDDhhmmss\n");
+ return;
+ }
+
+ for (i = 0; i < 6; i++)
+ e.date[i] = h2i(string[2 * i]) << 4 | h2i(string[2 * i + 1]);
+
+ update_crc();
+}
+
+/**
+ * set_mac_address - stores a MAC address into the EEPROM
+ *
+ * This function takes a pointer to MAC address string
+ * (i.e."XX:XX:XX:XX:XX:XX", where "XX" is a two-digit hex number) and
+ * stores it in one of the MAC address fields of the EEPROM local copy.
+ */
+static void set_mac_address(unsigned int index, const char *string)
+{
+ char *p = (char *) string;
+ unsigned int i;
+
+ if ((index >= MAX_NUM_PORTS) || !string) {
+ printf("Usage: mac <n> XX:XX:XX:XX:XX:XX\n");
+ return;
+ }
+
+ for (i = 0; *p && (i < 6); i++) {
+ e.mac[index][i] = hextoul(p, &p);
+ if (*p == ':')
+ p++;
+ }
+
+ update_crc();
+}
+
+int do_mac(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ char cmd;
+
+ if (argc == 1) {
+ show_eeprom();
+ return 0;
+ }
+
+ cmd = argv[1][0];
+
+ if (cmd == 'r') {
+ read_eeprom();
+ return 0;
+ }
+
+ if (cmd == 'i') {
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ memcpy(e.id, "NXID", sizeof(e.id));
+ e.version = cpu_to_be32(NXID_VERSION);
+#else
+ memcpy(e.id, "CCID", sizeof(e.id));
+#endif
+ update_crc();
+ return 0;
+ }
+
+ if (!is_valid) {
+ printf("Please read the EEPROM ('r') and/or set the ID ('i') first.\n");
+ return 0;
+ }
+
+ if (argc == 2) {
+ switch (cmd) {
+ case 's': /* save */
+ prog_eeprom();
+ break;
+ default:
+ return CMD_RET_USAGE;
+ }
+
+ return 0;
+ }
+
+ /* We know we have at least one parameter */
+
+ switch (cmd) {
+ case 'n': /* serial number */
+ memset(e.sn, 0, sizeof(e.sn));
+ strncpy((char *)e.sn, argv[2], sizeof(e.sn) - 1);
+ update_crc();
+ break;
+ case 'e': /* errata */
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ memset(e.errata, 0, 5);
+ strncpy((char *)e.errata, argv[2], 4);
+#else
+ e.errata[0] = argv[2][0];
+ e.errata[1] = argv[2][1];
+#endif
+ update_crc();
+ break;
+ case 'd': /* date BCD format YYMMDDhhmmss */
+ set_date(argv[2]);
+ break;
+ case 'p': /* MAC table size */
+ e.mac_count = hextoul(argv[2], NULL);
+ update_crc();
+ break;
+ case '0' ... '9': /* "mac 0" through "mac 22" */
+ set_mac_address(dectoul(argv[1], NULL), argv[2]);
+ break;
+ case 'h': /* help */
+ default:
+ return cmd_usage(cmdtp);
+ }
+
+ return 0;
+}
+
+/**
+ * mac_read_from_eeprom - read the MAC addresses from EEPROM
+ *
+ * This function reads the MAC addresses from EEPROM and sets the
+ * appropriate environment variables for each one read.
+ *
+ * The environment variables are only set if they haven't been set already.
+ * This ensures that any user-saved variables are never overwritten.
+ *
+ * This function must be called after relocation.
+ *
+ * For NXID v1 EEPROMs, we support loading and up-converting the older NXID v0
+ * format. In a v0 EEPROM, there are only eight MAC addresses and the CRC is
+ * located at a different offset.
+ */
+int mac_read_from_eeprom(void)
+{
+ unsigned int i;
+ u32 crc, crc_offset = offsetof(struct eeprom, crc);
+ u32 *crcp; /* Pointer to the CRC in the data read from the EEPROM */
+
+ puts("EEPROM: ");
+
+ if (read_eeprom()) {
+ printf("Read failed.\n");
+ return 0;
+ }
+
+ if (!is_valid) {
+ printf("Invalid ID (%02x %02x %02x %02x)\n",
+ e.id[0], e.id[1], e.id[2], e.id[3]);
+ return 0;
+ }
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ /*
+ * If we've read an NXID v0 EEPROM, then we need to set the CRC offset
+ * to where it is in v0.
+ */
+ if (e.version == 0)
+ crc_offset = 0x72;
+#endif
+
+ crc = crc32(0, (void *)&e, crc_offset);
+ crcp = (void *)&e + crc_offset;
+ if (crc != be32_to_cpu(*crcp)) {
+ printf("CRC mismatch (%08x != %08x)\n", crc, be32_to_cpu(e.crc));
+ return 0;
+ }
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ /*
+ * MAC address #9 in v1 occupies the same position as the CRC in v0.
+ * Erase it so that it's not mistaken for a MAC address. We'll
+ * update the CRC later.
+ */
+ if (e.version == 0)
+ memset(e.mac[8], 0xff, 6);
+#endif
+
+ for (i = 0; i < min(e.mac_count, (u8)MAX_NUM_PORTS); i++) {
+ if (memcmp(&e.mac[i], "\0\0\0\0\0\0", 6) &&
+ memcmp(&e.mac[i], "\xFF\xFF\xFF\xFF\xFF\xFF", 6)) {
+ char ethaddr[18];
+ char enetvar[9];
+
+ sprintf(ethaddr, "%02X:%02X:%02X:%02X:%02X:%02X",
+ e.mac[i][0],
+ e.mac[i][1],
+ e.mac[i][2],
+ e.mac[i][3],
+ e.mac[i][4],
+ e.mac[i][5]);
+ sprintf(enetvar, i ? "eth%daddr" : "ethaddr", i);
+ /* Only initialize environment variables that are blank
+ * (i.e. have not yet been set)
+ */
+ if (!env_get(enetvar))
+ env_set(enetvar, ethaddr);
+ }
+ }
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ printf("%c%c%c%c v%u\n", e.id[0], e.id[1], e.id[2], e.id[3],
+ be32_to_cpu(e.version));
+#else
+ printf("%c%c%c%c\n", e.id[0], e.id[1], e.id[2], e.id[3]);
+#endif
+
+#ifdef CONFIG_SYS_I2C_EEPROM_NXID
+ /*
+ * Now we need to upconvert the data into v1 format. We do this last so
+ * that at boot time, U-Boot will still say "NXID v0".
+ */
+ if (e.version == 0) {
+ e.version = cpu_to_be32(NXID_VERSION);
+ update_crc();
+ }
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_SYS_I2C_EEPROM_CCID
+
+/**
+ * get_cpu_board_revision - get the CPU board revision on 85xx boards
+ *
+ * Read the EEPROM to determine the board revision.
+ *
+ * This function is called before relocation, so we need to read a private
+ * copy of the EEPROM into a local variable on the stack.
+ *
+ * Also, we assume that CONFIG_SYS_EEPROM_BUS_NUM == CONFIG_SYS_SPD_BUS_NUM. The global
+ * variable i2c_bus_num must be compile-time initialized to CONFIG_SYS_SPD_BUS_NUM,
+ * so that the SPD code will work. This means that all pre-relocation I2C
+ * operations can only occur on the CONFIG_SYS_SPD_BUS_NUM bus. So if
+ * CONFIG_SYS_EEPROM_BUS_NUM != CONFIG_SYS_SPD_BUS_NUM, then we can't read the EEPROM when
+ * this function is called. Oh well.
+ */
+unsigned int get_cpu_board_revision(void)
+{
+ struct board_eeprom {
+ u32 id; /* 0x00 - 0x03 EEPROM Tag 'CCID' */
+ u8 major; /* 0x04 Board revision, major */
+ u8 minor; /* 0x05 Board revision, minor */
+ } be;
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(CONFIG_SYS_I2C_EEPROM_ADDR, 0, CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ (void *)&be, sizeof(be));
+#else
+ struct udevice *dev;
+ int ret;
+#ifdef CONFIG_SYS_EEPROM_BUS_NUM
+ ret = i2c_get_chip_for_busnum(CONFIG_SYS_EEPROM_BUS_NUM,
+ CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#else
+ ret = i2c_get_chip_for_busnum(0, CONFIG_SYS_I2C_EEPROM_ADDR,
+ CONFIG_SYS_I2C_EEPROM_ADDR_LEN,
+ &dev);
+#endif
+ if (!ret)
+ dm_i2c_read(dev, 0, (void *)&be, sizeof(be));
+#endif
+
+ if (be.id != (('C' << 24) | ('C' << 16) | ('I' << 8) | 'D'))
+ return MPC85XX_CPU_BOARD_REV(0, 0);
+
+ if ((be.major == 0xff) && (be.minor == 0xff))
+ return MPC85XX_CPU_BOARD_REV(0, 0);
+
+ return MPC85XX_CPU_BOARD_REV(be.major, be.minor);
+}
+#endif
+
+U_BOOT_LONGHELP(mac,
+ "[read|save|id|num|errata|date|ports|port_number]\n"
+ "mac read\n"
+ " - read EEPROM content into memory data structure\n"
+ "mac save\n"
+ " - save memory data structure to the EEPROM\n"
+ "mac id\n"
+ " - program system id per hard coded value\n"
+ "mac num string\n"
+ " - program system serial number to value string\n"
+ "mac errata string\n"
+ " - program errata data to value string\n"
+ "mac date YYMMDDhhmmss\n"
+ " - program date to string value YYMMDDhhmmss\n"
+ "mac ports N\n"
+ " - program the number of network ports to integer N\n"
+ "mac X string\n"
+ " - program MAC addr for port X [X=0,1..] to colon separated string");
+
+U_BOOT_CMD(
+ mac, 3, 1, do_mac,
+ "display and program the system ID and MAC addresses in EEPROM",
+ mac_help_text);
diff --git a/board/freescale/common/via.h b/board/freescale/common/via.h
new file mode 100644
index 00000000000..77cfacc5261
--- /dev/null
+++ b/board/freescale/common/via.h
@@ -0,0 +1,18 @@
+#ifndef _MPC85xx_VIA_H
+void mpc85xx_config_via(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+
+/* Function 1, IDE */
+void mpc85xx_config_via_usbide(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+
+/* Function 2, USB ports 0-1 */
+void mpc85xx_config_via_usb(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+
+/* Function 3, USB ports 2-3 */
+void mpc85xx_config_via_usb2(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+
+/* Function 5, Power Management */
+void mpc85xx_config_via_power(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+
+/* Function 6, AC97 Interface */
+void mpc85xx_config_via_ac97(struct pci_controller* hose, pci_dev_t dev, struct pci_config_table *tab);
+#endif /* _MPC85xx_VIA_H */
diff --git a/board/freescale/common/vid.c b/board/freescale/common/vid.c
new file mode 100644
index 00000000000..84cb43fad56
--- /dev/null
+++ b/board/freescale/common/vid.c
@@ -0,0 +1,797 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-21 NXP
+ * Copyright 2020 Stephen Carlson <stcarlso@linux.microsoft.com>
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <i2c.h>
+#include <irq_func.h>
+#include <log.h>
+#include <vsprintf.h>
+#include <asm/io.h>
+#ifdef CONFIG_FSL_LSCH2
+#include <asm/arch/immap_lsch2.h>
+#elif defined(CONFIG_FSL_LSCH3)
+#include <asm/arch/immap_lsch3.h>
+#else
+#include <asm/immap_85xx.h>
+#endif
+#include <linux/delay.h>
+#include "i2c_common.h"
+#include "vid.h"
+
+#ifndef I2C_VOL_MONITOR_BUS
+#define I2C_VOL_MONITOR_BUS 0
+#endif
+
+/* Voltages are generally handled in mV to keep them as integers */
+#define MV_PER_V 1000
+
+/*
+ * Select the channel on the I2C mux (on some NXP boards) that contains
+ * the voltage regulator to use for VID. Return 0 for success or nonzero
+ * for failure.
+ */
+int __weak i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return 0;
+}
+
+/*
+ * Compensate for a board specific voltage drop between regulator and SoC.
+ * Returns the voltage offset in mV.
+ */
+int __weak board_vdd_drop_compensation(void)
+{
+ return 0;
+}
+
+/*
+ * Performs any board specific adjustments after the VID voltage has been
+ * set. Return 0 for success or nonzero for failure.
+ */
+int __weak board_adjust_vdd(int vdd)
+{
+ return 0;
+}
+
+/*
+ * Processor specific method of converting the fuse value read from VID
+ * registers into the core voltage to supply. Return the voltage in mV.
+ */
+u16 __weak soc_get_fuse_vid(int vid_index)
+{
+ /* Default VDD for Layerscape Chassis 1 devices */
+ static const u16 vdd[32] = {
+ 0, /* unused */
+ 9875, /* 0.9875V */
+ 9750,
+ 9625,
+ 9500,
+ 9375,
+ 9250,
+ 9125,
+ 9000,
+ 8875,
+ 8750,
+ 8625,
+ 8500,
+ 8375,
+ 8250,
+ 8125,
+ 10000, /* 1.0000V */
+ 10125,
+ 10250,
+ 10375,
+ 10500,
+ 10625,
+ 10750,
+ 10875,
+ 11000,
+ 0, /* reserved */
+ };
+ return vdd[vid_index];
+}
+
+#ifndef I2C_VOL_MONITOR_ADDR
+#define I2C_VOL_MONITOR_ADDR 0
+#endif
+
+#if defined(CONFIG_VOL_MONITOR_IR36021_SET) || \
+ defined(CONFIG_VOL_MONITOR_IR36021_READ)
+/*
+ * Get the i2c address configuration for the IR regulator chip
+ *
+ * There are some variance in the RDB HW regarding the I2C address configuration
+ * for the IR regulator chip, which is likely a problem of external resistor
+ * accuracy. So we just check each address in a hopefully non-intrusive mode
+ * and use the first one that seems to work
+ *
+ * The IR chip can show up under the following addresses:
+ * 0x08 (Verified on T1040RDB-PA,T4240RDB-PB,X-T4240RDB-16GPA)
+ * 0x09 (Verified on T1040RDB-PA)
+ * 0x38 (Verified on T2080QDS, T2081QDS, T4240RDB)
+ */
+static int find_ir_chip_on_i2c(void)
+{
+ int i2caddress, ret, i;
+ u8 mfrID;
+ const int ir_i2c_addr[] = {0x38, 0x08, 0x09};
+ DEVICE_HANDLE_T dev;
+
+ /* Check all the address */
+ for (i = 0; i < (sizeof(ir_i2c_addr)/sizeof(ir_i2c_addr[0])); i++) {
+ i2caddress = ir_i2c_addr[i];
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (!ret) {
+ ret = I2C_READ(dev, IR36021_MFR_ID_OFFSET,
+ (void *)&mfrID, sizeof(mfrID));
+ /* If manufacturer ID matches the IR36021 */
+ if (!ret && mfrID == IR36021_MFR_ID)
+ return i2caddress;
+ }
+ }
+ return -1;
+}
+#endif
+
+/* Maximum loop count waiting for new voltage to take effect */
+#define MAX_LOOP_WAIT_NEW_VOL 100
+/* Maximum loop count waiting for the voltage to be stable */
+#define MAX_LOOP_WAIT_VOL_STABLE 100
+/*
+ * read_voltage from sensor on I2C bus
+ * We use average of 4 readings, waiting for WAIT_FOR_ADC before
+ * another reading
+ */
+#define NUM_READINGS 4 /* prefer to be power of 2 for efficiency */
+
+/* If an INA220 chip is available, we can use it to read back the voltage
+ * as it may have a higher accuracy than the IR chip for the same purpose
+ */
+#ifdef CONFIG_VOL_MONITOR_INA220
+#define WAIT_FOR_ADC 532 /* wait for 532 microseconds for ADC */
+#define ADC_MIN_ACCURACY 4
+#else
+#define WAIT_FOR_ADC 138 /* wait for 138 microseconds for ADC */
+#define ADC_MIN_ACCURACY 4
+#endif
+
+#ifdef CONFIG_VOL_MONITOR_INA220
+static int read_voltage_from_INA220(int i2caddress)
+{
+ int i, ret, voltage_read = 0;
+ u16 vol_mon;
+ u8 buf[2];
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ for (i = 0; i < NUM_READINGS; i++) {
+ ret = I2C_READ(dev, I2C_VOL_MONITOR_BUS_V_OFFSET,
+ (void *)&buf[0], sizeof(buf));
+ if (ret) {
+ printf("VID: failed to read core voltage\n");
+ return ret;
+ }
+
+ vol_mon = (buf[0] << 8) | buf[1];
+ if (vol_mon & I2C_VOL_MONITOR_BUS_V_OVF) {
+ printf("VID: Core voltage sensor error\n");
+ return -1;
+ }
+
+ debug("VID: bus voltage reads 0x%04x\n", vol_mon);
+ /* LSB = 4mv */
+ voltage_read += (vol_mon >> I2C_VOL_MONITOR_BUS_V_SHIFT) * 4;
+ udelay(WAIT_FOR_ADC);
+ }
+
+ /* calculate the average */
+ voltage_read /= NUM_READINGS;
+
+ return voltage_read;
+}
+#endif
+
+#ifdef CONFIG_VOL_MONITOR_IR36021_READ
+/* read voltage from IR */
+static int read_voltage_from_IR(int i2caddress)
+{
+ int i, ret, voltage_read = 0;
+ u16 vol_mon;
+ u8 buf;
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ for (i = 0; i < NUM_READINGS; i++) {
+ ret = I2C_READ(dev, IR36021_LOOP1_VOUT_OFFSET, (void *)&buf,
+ sizeof(buf));
+ if (ret) {
+ printf("VID: failed to read core voltage\n");
+ return ret;
+ }
+ vol_mon = buf;
+ if (!vol_mon) {
+ printf("VID: Core voltage sensor error\n");
+ return -1;
+ }
+ debug("VID: bus voltage reads 0x%02x\n", vol_mon);
+ /* Resolution is 1/128V. We scale up here to get 1/128mV
+ * and divide at the end
+ */
+ voltage_read += vol_mon * MV_PER_V;
+ udelay(WAIT_FOR_ADC);
+ }
+ /* Scale down to the real mV as IR resolution is 1/128V, rounding up */
+ voltage_read = DIV_ROUND_UP(voltage_read, 128);
+
+ /* calculate the average */
+ voltage_read /= NUM_READINGS;
+
+ /* Compensate for a board specific voltage drop between regulator and
+ * SoC before converting into an IR VID value
+ */
+ voltage_read -= board_vdd_drop_compensation();
+
+ return voltage_read;
+}
+#endif
+
+#if defined(CONFIG_VOL_MONITOR_ISL68233_READ) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_READ) || \
+ defined(CONFIG_VOL_MONITOR_ISL68233_SET) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_SET)
+
+/*
+ * The message displayed if the VOUT exponent causes a resolution
+ * worse than 1.0 V (if exponent is >= 0).
+ */
+#define VOUT_WARNING "VID: VOUT_MODE exponent has resolution worse than 1 V!\n"
+
+/* Checks the PMBus voltage monitor for the format used for voltage values */
+static int get_pmbus_multiplier(DEVICE_HANDLE_T dev)
+{
+ u8 mode;
+ int exponent, multiplier, ret;
+
+ ret = I2C_READ(dev, PMBUS_CMD_VOUT_MODE, &mode, sizeof(mode));
+ if (ret) {
+ printf("VID: unable to determine voltage multiplier\n");
+ return 1;
+ }
+
+ /* Upper 3 bits is mode, lower 5 bits is exponent */
+ exponent = (int)mode & 0x1F;
+ mode >>= 5;
+ switch (mode) {
+ case 0:
+ /* Linear, 5 bit twos component exponent */
+ if (exponent & 0x10) {
+ multiplier = 1 << (16 - (exponent & 0xF));
+ } else {
+ /* If exponent is >= 0, then resolution is 1 V! */
+ printf(VOUT_WARNING);
+ multiplier = 1;
+ }
+ break;
+ case 1:
+ /* VID code identifier */
+ printf("VID: custom VID codes are not supported\n");
+ multiplier = MV_PER_V;
+ break;
+ default:
+ /* Direct, in mV */
+ multiplier = MV_PER_V;
+ break;
+ }
+
+ debug("VID: calculated multiplier is %d\n", multiplier);
+ return multiplier;
+}
+#endif
+
+#if defined(CONFIG_VOL_MONITOR_ISL68233_READ) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_READ)
+static int read_voltage_from_pmbus(int i2caddress)
+{
+ int ret, multiplier, vout;
+ u8 channel = PWM_CHANNEL0;
+ u16 vcode;
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ /* Select the right page */
+ ret = I2C_WRITE(dev, PMBUS_CMD_PAGE, &channel, sizeof(channel));
+ if (ret) {
+ printf("VID: failed to select VDD page %d\n", channel);
+ return ret;
+ }
+
+ /* VOUT is little endian */
+ ret = I2C_READ(dev, PMBUS_CMD_READ_VOUT, (void *)&vcode, sizeof(vcode));
+ if (ret) {
+ printf("VID: failed to read core voltage\n");
+ return ret;
+ }
+
+ /* Scale down to the real mV */
+ multiplier = get_pmbus_multiplier(dev);
+ vout = (int)vcode;
+ /* Multiplier 1000 (direct mode) requires no change to convert */
+ if (multiplier != MV_PER_V)
+ vout = DIV_ROUND_UP(vout * MV_PER_V, multiplier);
+ return vout - board_vdd_drop_compensation();
+}
+#endif
+
+static int read_voltage(int i2caddress)
+{
+ int voltage_read;
+#ifdef CONFIG_VOL_MONITOR_INA220
+ voltage_read = read_voltage_from_INA220(I2C_VOL_MONITOR_ADDR);
+#elif defined CONFIG_VOL_MONITOR_IR36021_READ
+ voltage_read = read_voltage_from_IR(i2caddress);
+#elif defined(CONFIG_VOL_MONITOR_ISL68233_READ) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_READ)
+ voltage_read = read_voltage_from_pmbus(i2caddress);
+#else
+ voltage_read = -1;
+#endif
+ return voltage_read;
+}
+
+#ifdef CONFIG_VOL_MONITOR_IR36021_SET
+/*
+ * We need to calculate how long before the voltage stops to drop
+ * or increase. It returns with the loop count. Each loop takes
+ * several readings (WAIT_FOR_ADC)
+ */
+static int wait_for_new_voltage(int vdd, int i2caddress)
+{
+ int timeout, vdd_current;
+
+ vdd_current = read_voltage(i2caddress);
+ /* wait until voltage starts to reach the target. Voltage slew
+ * rates by typical regulators will always lead to stable readings
+ * within each fairly long ADC interval in comparison to the
+ * intended voltage delta change until the target voltage is
+ * reached. The fairly small voltage delta change to any target
+ * VID voltage also means that this function will always complete
+ * within few iterations. If the timeout was ever reached, it would
+ * point to a serious failure in the regulator system.
+ */
+ for (timeout = 0;
+ abs(vdd - vdd_current) > (IR_VDD_STEP_UP + IR_VDD_STEP_DOWN) &&
+ timeout < MAX_LOOP_WAIT_NEW_VOL; timeout++) {
+ vdd_current = read_voltage(i2caddress);
+ }
+ if (timeout >= MAX_LOOP_WAIT_NEW_VOL) {
+ printf("VID: Voltage adjustment timeout\n");
+ return -1;
+ }
+ return timeout;
+}
+
+/*
+ * Blocks and reads the VID voltage until it stabilizes, or the
+ * timeout expires
+ */
+static int wait_for_voltage_stable(int i2caddress)
+{
+ int timeout, vdd_current, vdd;
+
+ vdd = read_voltage(i2caddress);
+ udelay(NUM_READINGS * WAIT_FOR_ADC);
+
+ vdd_current = read_voltage(i2caddress);
+ /*
+ * The maximum timeout is
+ * MAX_LOOP_WAIT_VOL_STABLE * NUM_READINGS * WAIT_FOR_ADC
+ */
+ for (timeout = MAX_LOOP_WAIT_VOL_STABLE;
+ abs(vdd - vdd_current) > ADC_MIN_ACCURACY &&
+ timeout > 0; timeout--) {
+ vdd = vdd_current;
+ udelay(NUM_READINGS * WAIT_FOR_ADC);
+ vdd_current = read_voltage(i2caddress);
+ }
+ if (timeout == 0)
+ return -1;
+ return vdd_current;
+}
+
+/* Sets the VID voltage using the IR36021 */
+static int set_voltage_to_IR(int i2caddress, int vdd)
+{
+ int wait, vdd_last;
+ int ret;
+ u8 vid;
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ /* Compensate for a board specific voltage drop between regulator and
+ * SoC before converting into an IR VID value
+ */
+ vdd += board_vdd_drop_compensation();
+#ifdef CONFIG_FSL_LSCH2
+ vid = DIV_ROUND_UP(vdd - 265, 5);
+#else
+ vid = DIV_ROUND_UP(vdd - 245, 5);
+#endif
+
+ ret = I2C_WRITE(dev, IR36021_LOOP1_MANUAL_ID_OFFSET, (void *)&vid,
+ sizeof(vid));
+ if (ret) {
+ printf("VID: failed to write new voltage\n");
+ return -1;
+ }
+ wait = wait_for_new_voltage(vdd, i2caddress);
+ if (wait < 0)
+ return -1;
+ debug("VID: Waited %d us\n", wait * NUM_READINGS * WAIT_FOR_ADC);
+
+ vdd_last = wait_for_voltage_stable(i2caddress);
+ if (vdd_last < 0)
+ return -1;
+ debug("VID: Current voltage is %d mV\n", vdd_last);
+ return vdd_last;
+}
+#endif
+
+#if defined(CONFIG_VOL_MONITOR_ISL68233_SET) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_SET)
+static int set_voltage_to_pmbus(int i2caddress, int vdd)
+{
+ int ret, vdd_last, vdd_target = vdd;
+ int count = MAX_LOOP_WAIT_NEW_VOL, temp = 0, multiplier;
+ unsigned char value;
+
+ /* The data to be sent with the PMBus command PAGE_PLUS_WRITE */
+ u8 buffer[5] = { 0x04, PWM_CHANNEL0, PMBUS_CMD_VOUT_COMMAND, 0, 0 };
+ DEVICE_HANDLE_T dev;
+
+ /* Open device handle */
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ /* Scale up to the proper value for the VOUT command, little endian */
+ multiplier = get_pmbus_multiplier(dev);
+ vdd += board_vdd_drop_compensation();
+ if (multiplier != MV_PER_V)
+ vdd = DIV_ROUND_UP(vdd * multiplier, MV_PER_V);
+ buffer[3] = vdd & 0xFF;
+ buffer[4] = (vdd & 0xFF00) >> 8;
+
+ /* Check write protect state */
+ ret = I2C_READ(dev, PMBUS_CMD_WRITE_PROTECT, (void *)&value,
+ sizeof(value));
+ if (ret)
+ goto exit;
+
+ if (value != EN_WRITE_ALL_CMD) {
+ value = EN_WRITE_ALL_CMD;
+ ret = I2C_WRITE(dev, PMBUS_CMD_WRITE_PROTECT,
+ (void *)&value, sizeof(value));
+ if (ret)
+ goto exit;
+ }
+
+ /* Write the desired voltage code to the regulator */
+ ret = I2C_WRITE(dev, PMBUS_CMD_PAGE_PLUS_WRITE, (void *)&buffer[0],
+ sizeof(buffer));
+ if (ret) {
+ printf("VID: I2C failed to write to the voltage regulator\n");
+ return -1;
+ }
+
+exit:
+ /* Wait for the voltage to get to the desired value */
+ do {
+ vdd_last = read_voltage_from_pmbus(i2caddress);
+ if (vdd_last < 0) {
+ printf("VID: Couldn't read sensor abort VID adjust\n");
+ return -1;
+ }
+ count--;
+ temp = vdd_last - vdd_target;
+ } while ((abs(temp) > 2) && (count > 0));
+
+ return vdd_last;
+}
+#endif
+
+static int set_voltage(int i2caddress, int vdd)
+{
+ int vdd_last = -1;
+
+#ifdef CONFIG_VOL_MONITOR_IR36021_SET
+ vdd_last = set_voltage_to_IR(i2caddress, vdd);
+#elif defined(CONFIG_VOL_MONITOR_ISL68233_SET) || \
+ defined(CONFIG_VOL_MONITOR_LTC3882_SET)
+ vdd_last = set_voltage_to_pmbus(i2caddress, vdd);
+#else
+ #error Specific voltage monitor must be defined
+#endif
+ return vdd_last;
+}
+
+int adjust_vdd(ulong vdd_override)
+{
+ int re_enable = disable_interrupts();
+#if defined(CONFIG_FSL_LSCH2) || defined(CONFIG_FSL_LSCH3)
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+#else
+ ccsr_gur_t __iomem *gur =
+ (void __iomem *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+#endif
+ u8 vid;
+ u32 fusesr;
+ int vdd_current, vdd_last, vdd_target;
+ int ret, i2caddress = I2C_VOL_MONITOR_ADDR;
+ unsigned long vdd_string_override;
+ char *vdd_string;
+
+#if defined(CONFIG_VOL_MONITOR_IR36021_SET) || \
+ defined(CONFIG_VOL_MONITOR_IR36021_READ)
+ u8 buf;
+ DEVICE_HANDLE_T dev;
+#endif
+
+ /*
+ * VID is used according to the table below
+ * ---------------------------------------
+ * | DA_V |
+ * |-------------------------------------|
+ * | 5b00000 | 5b00001-5b11110 | 5b11111 |
+ * ---------------+---------+-----------------+---------|
+ * | D | 5b00000 | NO VID | VID = DA_V | NO VID |
+ * | A |----------+---------+-----------------+---------|
+ * | _ | 5b00001 |VID = | VID = |VID = |
+ * | V | ~ | DA_V_ALT| DA_V_ALT | DA_A_VLT|
+ * | _ | 5b11110 | | | |
+ * | A |----------+---------+-----------------+---------|
+ * | L | 5b11111 | No VID | VID = DA_V | NO VID |
+ * | T | | | | |
+ * ------------------------------------------------------
+ */
+#if defined(CONFIG_FSL_LSCH3)
+ fusesr = in_le32(&gur->dcfg_fusesr);
+ vid = (fusesr >> FSL_CHASSIS3_DCFG_FUSESR_ALTVID_SHIFT) &
+ FSL_CHASSIS3_DCFG_FUSESR_ALTVID_MASK;
+ if (vid == 0 || vid == FSL_CHASSIS3_DCFG_FUSESR_ALTVID_MASK) {
+ vid = (fusesr >> FSL_CHASSIS3_DCFG_FUSESR_VID_SHIFT) &
+ FSL_CHASSIS3_DCFG_FUSESR_VID_MASK;
+ }
+#elif defined(CONFIG_FSL_LSCH2)
+ fusesr = in_be32(&gur->dcfg_fusesr);
+ vid = (fusesr >> FSL_CHASSIS2_DCFG_FUSESR_ALTVID_SHIFT) &
+ FSL_CHASSIS2_DCFG_FUSESR_ALTVID_MASK;
+ if (vid == 0 || vid == FSL_CHASSIS2_DCFG_FUSESR_ALTVID_MASK) {
+ vid = (fusesr >> FSL_CHASSIS2_DCFG_FUSESR_VID_SHIFT) &
+ FSL_CHASSIS2_DCFG_FUSESR_VID_MASK;
+ }
+#else
+ fusesr = in_be32(&gur->dcfg_fusesr);
+ vid = (fusesr >> FSL_CORENET_DCFG_FUSESR_ALTVID_SHIFT) &
+ FSL_CORENET_DCFG_FUSESR_ALTVID_MASK;
+ if (vid == 0 || vid == FSL_CORENET_DCFG_FUSESR_ALTVID_MASK) {
+ vid = (fusesr >> FSL_CORENET_DCFG_FUSESR_VID_SHIFT) &
+ FSL_CORENET_DCFG_FUSESR_VID_MASK;
+ }
+#endif
+ vdd_target = soc_get_fuse_vid((int)vid);
+
+ ret = i2c_multiplexer_select_vid_channel(I2C_MUX_CH_VOL_MONITOR);
+ if (ret) {
+ debug("VID: I2C failed to switch channel\n");
+ ret = -1;
+ goto exit;
+ }
+
+#if defined(CONFIG_VOL_MONITOR_IR36021_SET) || \
+ defined(CONFIG_VOL_MONITOR_IR36021_READ)
+ ret = find_ir_chip_on_i2c();
+ if (ret < 0) {
+ printf("VID: Could not find voltage regulator on I2C.\n");
+ ret = -1;
+ goto exit;
+ } else {
+ i2caddress = ret;
+ debug("VID: IR Chip found on I2C address 0x%02x\n", i2caddress);
+ }
+
+ ret = fsl_i2c_get_device(i2caddress, I2C_VOL_MONITOR_BUS, &dev);
+ if (ret)
+ return ret;
+
+ /* check IR chip work on Intel mode */
+ ret = I2C_READ(dev, IR36021_INTEL_MODE_OFFSET, (void *)&buf,
+ sizeof(buf));
+ if (ret) {
+ printf("VID: failed to read IR chip mode.\n");
+ ret = -1;
+ goto exit;
+ }
+ if ((buf & IR36021_MODE_MASK) != IR36021_INTEL_MODE) {
+ printf("VID: IR Chip is not used in Intel mode.\n");
+ ret = -1;
+ goto exit;
+ }
+#endif
+
+ /* check override variable for overriding VDD */
+ vdd_string = env_get(CONFIG_VID_FLS_ENV);
+ debug("VID: Initial VDD value is %d mV\n",
+ DIV_ROUND_UP(vdd_target, 10));
+ if (vdd_override == 0 && vdd_string &&
+ !strict_strtoul(vdd_string, 10, &vdd_string_override))
+ vdd_override = vdd_string_override;
+ if (vdd_override >= VDD_MV_MIN && vdd_override <= VDD_MV_MAX) {
+ vdd_target = vdd_override * 10; /* convert to 1/10 mV */
+ debug("VID: VDD override is %lu\n", vdd_override);
+ } else if (vdd_override != 0) {
+ printf("VID: Invalid VDD value.\n");
+ }
+ if (vdd_target == 0) {
+ debug("VID: VID not used\n");
+ ret = 0;
+ goto exit;
+ } else {
+ /* divide and round up by 10 to get a value in mV */
+ vdd_target = DIV_ROUND_UP(vdd_target, 10);
+ debug("VID: vid = %d mV\n", vdd_target);
+ }
+
+ /*
+ * Read voltage monitor to check real voltage.
+ */
+ vdd_last = read_voltage(i2caddress);
+ if (vdd_last < 0) {
+ printf("VID: Couldn't read sensor abort VID adjustment\n");
+ ret = -1;
+ goto exit;
+ }
+ vdd_current = vdd_last;
+ debug("VID: Core voltage is currently at %d mV\n", vdd_last);
+
+#if defined(CONFIG_VOL_MONITOR_LTC3882_SET) || \
+ defined(CONFIG_VOL_MONITOR_ISL68233_SET)
+ /* Set the target voltage */
+ vdd_current = set_voltage(i2caddress, vdd_target);
+ vdd_last = vdd_current;
+#else
+ /*
+ * Adjust voltage to at or one step above target.
+ * As measurements are less precise than setting the values
+ * we may run through dummy steps that cancel each other
+ * when stepping up and then down.
+ */
+ while (vdd_last > 0 &&
+ vdd_last < vdd_target) {
+ vdd_current += IR_VDD_STEP_UP;
+ vdd_last = set_voltage(i2caddress, vdd_current);
+ }
+ while (vdd_last > 0 &&
+ vdd_last > vdd_target + (IR_VDD_STEP_DOWN - 1)) {
+ vdd_current -= IR_VDD_STEP_DOWN;
+ vdd_last = set_voltage(i2caddress, vdd_current);
+ }
+#endif
+
+ /* Board specific adjustments */
+ if (board_adjust_vdd(vdd_target) < 0) {
+ ret = -1;
+ goto exit;
+ }
+
+ if (vdd_last > 0)
+ printf("VID: Core voltage after adjustment is at %d mV\n",
+ vdd_last);
+ else
+ ret = -1;
+exit:
+ if (re_enable)
+ enable_interrupts();
+
+ i2c_multiplexer_select_vid_channel(I2C_MUX_CH_DEFAULT);
+
+ return ret;
+}
+
+static int print_vdd(void)
+{
+ int vdd_last, ret, i2caddress = I2C_VOL_MONITOR_ADDR;
+
+ ret = i2c_multiplexer_select_vid_channel(I2C_MUX_CH_VOL_MONITOR);
+ if (ret) {
+ debug("VID : I2c failed to switch channel\n");
+ return -1;
+ }
+#if defined(CONFIG_VOL_MONITOR_IR36021_SET) || \
+ defined(CONFIG_VOL_MONITOR_IR36021_READ)
+ ret = find_ir_chip_on_i2c();
+ if (ret < 0) {
+ printf("VID: Could not find voltage regulator on I2C.\n");
+ goto exit;
+ } else {
+ i2caddress = ret;
+ debug("VID: IR Chip found on I2C address 0x%02x\n", i2caddress);
+ }
+#endif
+
+ /*
+ * Read voltage monitor to check real voltage.
+ */
+ vdd_last = read_voltage(i2caddress);
+ if (vdd_last < 0) {
+ printf("VID: Couldn't read sensor abort VID adjustment\n");
+ goto exit;
+ }
+ printf("VID: Core voltage is at %d mV\n", vdd_last);
+exit:
+ i2c_multiplexer_select_vid_channel(I2C_MUX_CH_DEFAULT);
+
+ return ret < 0 ? -1 : 0;
+}
+
+static int do_vdd_override(struct cmd_tbl *cmdtp,
+ int flag, int argc,
+ char *const argv[])
+{
+ ulong override;
+ int ret = 0;
+
+ if (argc < 2)
+ return CMD_RET_USAGE;
+
+ if (!strict_strtoul(argv[1], 10, &override)) {
+ ret = adjust_vdd(override);
+ if (ret < 0)
+ return CMD_RET_FAILURE;
+ } else
+ return CMD_RET_USAGE;
+ return 0;
+}
+
+static int do_vdd_read(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc < 1)
+ return CMD_RET_USAGE;
+ print_vdd();
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ vdd_override, 2, 0, do_vdd_override,
+ "override VDD",
+ " - override with the voltage specified in mV, eg. 1050"
+);
+
+U_BOOT_CMD(
+ vdd_read, 1, 0, do_vdd_read,
+ "read VDD",
+ " - Read the voltage specified in mV"
+);
diff --git a/board/freescale/common/vid.h b/board/freescale/common/vid.h
new file mode 100644
index 00000000000..b34c080b4ba
--- /dev/null
+++ b/board/freescale/common/vid.h
@@ -0,0 +1,75 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020 NXP
+ */
+
+#ifndef __VID_H_
+#define __VID_H_
+
+/* IR36021 command codes */
+#define IR36021_LOOP1_MANUAL_ID_OFFSET 0x6A
+#define IR36021_LOOP1_VOUT_OFFSET 0x9A
+#define IR36021_MFR_ID_OFFSET 0x92
+#define IR36021_MFR_ID 0x43
+#define IR36021_INTEL_MODE_OFFSET 0x14
+#define IR36021_MODE_MASK 0x20
+#define IR36021_INTEL_MODE 0x00
+#define IR36021_AMD_MODE 0x20
+
+/* Step the IR regulator in 5mV increments */
+#define IR_VDD_STEP_DOWN 5
+#define IR_VDD_STEP_UP 5
+
+/* LTC3882 */
+#define PMBUS_CMD_WRITE_PROTECT 0x10
+/*
+ * WRITE_PROTECT command supported values
+ * 0x80: Disable all writes except WRITE_PROTECT, PAGE,
+ * STORE_USER_ALL and MFR_EE_UNLOCK commands.
+ * 0x40: Disable all writes except WRITE_PROTECT, PAGE, STORE_USER_ALL,
+ * MFR_EE_UNLOCK, OPERATION, CLEAR_PEAKS and CLEAR_FAULTS commands.
+ * Individual faults can also be cleared by writing a 1 to the
+ * respective status bit.
+ * 0x20: Disable all writes except WRITE_PROTECT, PAGE, STORE_USER_ ALL,
+ * MFR_EE_UNLOCK, OPERATION, CLEAR_PEAKS, CLEAR_FAULTS, ON_OFF_CONFIG
+ * and VOUT_COMMAND commands. Individual faults can be cleared by
+ * writing a 1 to the respective status bit.
+ * 0x00: Enables write to all commands
+ */
+#define EN_WRITE_ALL_CMD (0)
+
+#ifdef CONFIG_TARGET_LX2160ARDB
+/* The lowest and highest voltage allowed*/
+#define VDD_MV_MIN 775
+#define VDD_MV_MAX 855
+#endif
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+/* The lowest and highest voltage allowed*/
+#define VDD_MV_MIN 775
+#define VDD_MV_MAX 925
+#endif
+
+/* PM Bus commands code for LTC3882*/
+#define PWM_CHANNEL0 0x0
+#define PMBUS_CMD_PAGE 0x0
+#define PMBUS_CMD_READ_VOUT 0x8B
+#define PMBUS_CMD_VOUT_MODE 0x20
+#define PMBUS_CMD_VOUT_COMMAND 0x21
+#define PMBUS_CMD_PAGE_PLUS_WRITE 0x05
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS) || \
+defined(CONFIG_TARGET_LX2160ARDB)
+/* Voltage monitor on channel 2*/
+#define I2C_VOL_MONITOR_BUS_V_OFFSET 0x2
+#define I2C_VOL_MONITOR_BUS_V_OVF 0x1
+#define I2C_VOL_MONITOR_BUS_V_SHIFT 3
+#define I2C_VOL_MONITOR_ADDR 0x63
+#define I2C_MUX_CH_VOL_MONITOR 0xA
+#endif
+
+int adjust_vdd(ulong vdd_override);
+u16 soc_get_fuse_vid(int vid_index);
+
+#endif /* __VID_H_ */
diff --git a/board/freescale/common/vsc3316_3308.h b/board/freescale/common/vsc3316_3308.h
new file mode 100644
index 00000000000..9725d6d9e39
--- /dev/null
+++ b/board/freescale/common/vsc3316_3308.h
@@ -0,0 +1,23 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2012 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __VSC_CROSSBAR_H_
+#define __VSC_CROSSBAR_H_
+
+#include <i2c.h>
+#include <errno.h>
+
+int vsc_if_enable(unsigned int vsc_addr);
+int vsc3316_config(unsigned int vsc_addr, int8_t con_arr[][2],
+ unsigned int num_con);
+#ifdef CONFIG_SYS_FSL_B4860QDS_XFI_ERR
+int vsc3308_config_adjust(unsigned int vsc_addr, const int8_t con_arr[][2],
+ unsigned int num_con);
+#endif
+int vsc3308_config(unsigned int vsc_addr, const int8_t con_arr[][2],
+ unsigned int num_con);
+void vsc_wp_config(unsigned int vsc_addr);
+
+#endif /* __VSC_CROSSBAR_H_ */
diff --git a/board/freescale/imx8mm_evk/Kconfig b/board/freescale/imx8mm_evk/Kconfig
new file mode 100644
index 00000000000..24cc526b0ab
--- /dev/null
+++ b/board/freescale/imx8mm_evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_IMX8MM_EVK
+
+config SYS_BOARD
+ default "imx8mm_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8mm_evk"
+
+config IMX_CONFIG
+ default "board/freescale/imx8mm_evk/imximage-8mm-lpddr4.cfg"
+
+endif
diff --git a/board/freescale/imx8mm_evk/MAINTAINERS b/board/freescale/imx8mm_evk/MAINTAINERS
new file mode 100644
index 00000000000..875adf58ee2
--- /dev/null
+++ b/board/freescale/imx8mm_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX8MM EVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx8mm_evk/
+F: include/configs/imx8mm_evk.h
+F: configs/imx8mm_evk_defconfig
+F: configs/imx8mm_evk_fspi_defconfig
diff --git a/board/freescale/imx8mm_evk/Makefile b/board/freescale/imx8mm_evk/Makefile
new file mode 100644
index 00000000000..1db7b62cafc
--- /dev/null
+++ b/board/freescale/imx8mm_evk/Makefile
@@ -0,0 +1,12 @@
+#
+# Copyright 2018 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8mm_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+obj-$(CONFIG_IMX8M_LPDDR4) += lpddr4_timing.o
+endif
diff --git a/board/freescale/imx8mm_evk/imx8mm_evk.c b/board/freescale/imx8mm_evk/imx8mm_evk.c
new file mode 100644
index 00000000000..4c4436af3b1
--- /dev/null
+++ b/board/freescale/imx8mm_evk/imx8mm_evk.c
@@ -0,0 +1,68 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <env.h>
+#include <init.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+
+#include <asm/arch/clock.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/io.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if IS_ENABLED(CONFIG_FEC_MXC)
+static int setup_fec(void)
+{
+ struct iomuxc_gpr_base_regs *gpr =
+ (struct iomuxc_gpr_base_regs *)IOMUXC_GPR_BASE_ADDR;
+
+ /* Use 125M anatop REF_CLK1 for ENET1, not from external */
+ clrsetbits_le32(&gpr->gpr[1], 0x2000, 0);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ /* enable rgmii rxc skew and phy mode select to RGMII copper */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x1f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x8);
+
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x00);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x82ee);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x05);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x100);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ if (IS_ENABLED(CONFIG_FEC_MXC))
+ setup_fec();
+
+ return 0;
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int board_late_init(void)
+{
+ if (IS_ENABLED(CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG)) {
+ env_set("board_name", "EVK");
+ env_set("board_rev", "iMX8MM");
+ }
+
+ return 0;
+}
diff --git a/board/freescale/imx8mm_evk/imximage-8mm-lpddr4-fspi.cfg b/board/freescale/imx8mm_evk/imximage-8mm-lpddr4-fspi.cfg
new file mode 100644
index 00000000000..fcace8a93a0
--- /dev/null
+++ b/board/freescale/imx8mm_evk/imximage-8mm-lpddr4-fspi.cfg
@@ -0,0 +1,7 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2021 NXP
+ */
+
+BOOT_FROM fspi
+LOADER u-boot-spl-ddr.bin 0x7E2000
diff --git a/board/freescale/imx8mm_evk/imximage-8mm-lpddr4.cfg b/board/freescale/imx8mm_evk/imximage-8mm-lpddr4.cfg
new file mode 100644
index 00000000000..20061521f22
--- /dev/null
+++ b/board/freescale/imx8mm_evk/imximage-8mm-lpddr4.cfg
@@ -0,0 +1,8 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2021 NXP
+ */
+
+
+BOOT_FROM sd
+LOADER u-boot-spl-ddr.bin 0x7E1000
diff --git a/board/freescale/imx8mm_evk/lpddr4_timing.c b/board/freescale/imx8mm_evk/lpddr4_timing.c
new file mode 100644
index 00000000000..4373ca624e4
--- /dev/null
+++ b/board/freescale/imx8mm_evk/lpddr4_timing.c
@@ -0,0 +1,1848 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018-2019 NXP
+ *
+ * Generated code from MX8M_DDR_tool
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /* Initialize DDRC registers */
+ { 0x3d400304, 0x1 },
+ { 0x3d400030, 0x1 },
+ { 0x3d400000, 0xa1080020 },
+ { 0x3d400020, 0x223 },
+ { 0x3d400024, 0x16e3600 },
+ { 0x3d400064, 0x5b00d2 },
+ { 0x3d4000d0, 0xc00305ba },
+ { 0x3d4000d4, 0x940000 },
+ { 0x3d4000dc, 0xd4002d },
+ { 0x3d4000e0, 0x310000 },
+ { 0x3d4000e8, 0x66004d },
+ { 0x3d4000ec, 0x16004d },
+ { 0x3d400100, 0x191e1920 },
+ { 0x3d400104, 0x60630 },
+ { 0x3d40010c, 0xb0b000 },
+ { 0x3d400110, 0xe04080e },
+ { 0x3d400114, 0x2040c0c },
+ { 0x3d400118, 0x1010007 },
+ { 0x3d40011c, 0x401 },
+ { 0x3d400130, 0x20600 },
+ { 0x3d400134, 0xc100002 },
+ { 0x3d400138, 0xd8 },
+ { 0x3d400144, 0x96004b },
+ { 0x3d400180, 0x2ee0017 },
+ { 0x3d400184, 0x2605b8e },
+ { 0x3d400188, 0x0 },
+ { 0x3d400190, 0x497820a },
+ { 0x3d400194, 0x80303 },
+ { 0x3d4001b4, 0x170a },
+ { 0x3d4001a0, 0xe0400018 },
+ { 0x3d4001a4, 0xdf00e4 },
+ { 0x3d4001a8, 0x80000000 },
+ { 0x3d4001b0, 0x11 },
+ { 0x3d4001c0, 0x1 },
+ { 0x3d4001c4, 0x0 },
+ { 0x3d4000f4, 0xc99 },
+ { 0x3d400108, 0x70e1617 },
+ { 0x3d400200, 0x1f },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400204, 0x80808 },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x7070707 },
+
+ /* performance setting */
+ { 0x3d400250, 0x29001701 },
+ { 0x3d400254, 0x2c },
+ { 0x3d40025c, 0x4000030 },
+ { 0x3d400264, 0x900093e7 },
+ { 0x3d40026c, 0x2005574 },
+ { 0x3d400400, 0x111 },
+ { 0x3d400408, 0x72ff },
+ { 0x3d400494, 0x2100e07 },
+ { 0x3d400498, 0x620096 },
+ { 0x3d40049c, 0x1100e07 },
+ { 0x3d4004a0, 0xc8012c },
+
+ /* P1: 400mts */
+ { 0x3d402020, 0x21 },
+ { 0x3d402024, 0x30d400 },
+ { 0x3d402050, 0x20d040 },
+ { 0x3d402064, 0xc001c },
+ { 0x3d4020dc, 0x840000 },
+ { 0x3d4020e0, 0x310000 },
+ { 0x3d4020e8, 0x66004d },
+ { 0x3d4020ec, 0x16004d },
+ { 0x3d402100, 0xa040305 },
+ { 0x3d402104, 0x30407 },
+ { 0x3d402108, 0x203060b },
+ { 0x3d40210c, 0x505000 },
+ { 0x3d402110, 0x2040202 },
+ { 0x3d402114, 0x2030202 },
+ { 0x3d402118, 0x1010004 },
+ { 0x3d40211c, 0x301 },
+ { 0x3d402130, 0x20300 },
+ { 0x3d402134, 0xa100002 },
+ { 0x3d402138, 0x1d },
+ { 0x3d402144, 0x14000a },
+ { 0x3d402180, 0x640004 },
+ { 0x3d402190, 0x3818200 },
+ { 0x3d402194, 0x80303 },
+ { 0x3d4021b4, 0x100 },
+
+ /* p2: 100mts */
+ { 0x3d403020, 0x21 },
+ { 0x3d403024, 0xc3500 },
+ { 0x3d403050, 0x20d040 },
+ { 0x3d403064, 0x30007 },
+ { 0x3d4030dc, 0x840000 },
+ { 0x3d4030e0, 0x310000 },
+ { 0x3d4030e8, 0x66004d },
+ { 0x3d4030ec, 0x16004d },
+ { 0x3d403100, 0xa010102 },
+ { 0x3d403104, 0x30404 },
+ { 0x3d403108, 0x203060b },
+ { 0x3d40310c, 0x505000 },
+ { 0x3d403110, 0x2040202 },
+ { 0x3d403114, 0x2030202 },
+ { 0x3d403118, 0x1010004 },
+ { 0x3d40311c, 0x301 },
+ { 0x3d403130, 0x20300 },
+ { 0x3d403134, 0xa100002 },
+ { 0x3d403138, 0x8 },
+ { 0x3d403144, 0x50003 },
+ { 0x3d403180, 0x190004 },
+ { 0x3d403190, 0x3818200 },
+ { 0x3d403194, 0x80303 },
+ { 0x3d4031b4, 0x100 },
+
+ /* default boot point */
+ { 0x3d400028, 0x0 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x1 },
+ { 0x100a2, 0x2 },
+ { 0x100a3, 0x3 },
+ { 0x100a4, 0x4 },
+ { 0x100a5, 0x5 },
+ { 0x100a6, 0x6 },
+ { 0x100a7, 0x7 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x1 },
+ { 0x110a2, 0x3 },
+ { 0x110a3, 0x4 },
+ { 0x110a4, 0x5 },
+ { 0x110a5, 0x2 },
+ { 0x110a6, 0x7 },
+ { 0x110a7, 0x6 },
+ { 0x120a0, 0x0 },
+ { 0x120a1, 0x1 },
+ { 0x120a2, 0x3 },
+ { 0x120a3, 0x2 },
+ { 0x120a4, 0x5 },
+ { 0x120a5, 0x4 },
+ { 0x120a6, 0x7 },
+ { 0x120a7, 0x6 },
+ { 0x130a0, 0x0 },
+ { 0x130a1, 0x1 },
+ { 0x130a2, 0x2 },
+ { 0x130a3, 0x3 },
+ { 0x130a4, 0x4 },
+ { 0x130a5, 0x5 },
+ { 0x130a6, 0x6 },
+ { 0x130a7, 0x7 },
+ { 0x1005f, 0x1ff },
+ { 0x1015f, 0x1ff },
+ { 0x1105f, 0x1ff },
+ { 0x1115f, 0x1ff },
+ { 0x1205f, 0x1ff },
+ { 0x1215f, 0x1ff },
+ { 0x1305f, 0x1ff },
+ { 0x1315f, 0x1ff },
+ { 0x11005f, 0x1ff },
+ { 0x11015f, 0x1ff },
+ { 0x11105f, 0x1ff },
+ { 0x11115f, 0x1ff },
+ { 0x11205f, 0x1ff },
+ { 0x11215f, 0x1ff },
+ { 0x11305f, 0x1ff },
+ { 0x11315f, 0x1ff },
+ { 0x21005f, 0x1ff },
+ { 0x21015f, 0x1ff },
+ { 0x21105f, 0x1ff },
+ { 0x21115f, 0x1ff },
+ { 0x21205f, 0x1ff },
+ { 0x21215f, 0x1ff },
+ { 0x21305f, 0x1ff },
+ { 0x21315f, 0x1ff },
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x3055, 0x1ff },
+ { 0x4055, 0x1ff },
+ { 0x5055, 0x1ff },
+ { 0x6055, 0x1ff },
+ { 0x7055, 0x1ff },
+ { 0x8055, 0x1ff },
+ { 0x9055, 0x1ff },
+ { 0x200c5, 0x19 },
+ { 0x1200c5, 0x7 },
+ { 0x2200c5, 0x7 },
+ { 0x2002e, 0x2 },
+ { 0x12002e, 0x2 },
+ { 0x22002e, 0x2 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x20024, 0x1ab },
+ { 0x2003a, 0x0 },
+ { 0x120024, 0x1ab },
+ { 0x2003a, 0x0 },
+ { 0x220024, 0x1ab },
+ { 0x2003a, 0x0 },
+ { 0x20056, 0x3 },
+ { 0x120056, 0xa },
+ { 0x220056, 0xa },
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x1204d, 0xe00 },
+ { 0x1214d, 0xe00 },
+ { 0x1304d, 0xe00 },
+ { 0x1314d, 0xe00 },
+ { 0x11004d, 0xe00 },
+ { 0x11014d, 0xe00 },
+ { 0x11104d, 0xe00 },
+ { 0x11114d, 0xe00 },
+ { 0x11204d, 0xe00 },
+ { 0x11214d, 0xe00 },
+ { 0x11304d, 0xe00 },
+ { 0x11314d, 0xe00 },
+ { 0x21004d, 0xe00 },
+ { 0x21014d, 0xe00 },
+ { 0x21104d, 0xe00 },
+ { 0x21114d, 0xe00 },
+ { 0x21204d, 0xe00 },
+ { 0x21214d, 0xe00 },
+ { 0x21304d, 0xe00 },
+ { 0x21314d, 0xe00 },
+ { 0x10049, 0xeba },
+ { 0x10149, 0xeba },
+ { 0x11049, 0xeba },
+ { 0x11149, 0xeba },
+ { 0x12049, 0xeba },
+ { 0x12149, 0xeba },
+ { 0x13049, 0xeba },
+ { 0x13149, 0xeba },
+ { 0x110049, 0xeba },
+ { 0x110149, 0xeba },
+ { 0x111049, 0xeba },
+ { 0x111149, 0xeba },
+ { 0x112049, 0xeba },
+ { 0x112149, 0xeba },
+ { 0x113049, 0xeba },
+ { 0x113149, 0xeba },
+ { 0x210049, 0xeba },
+ { 0x210149, 0xeba },
+ { 0x211049, 0xeba },
+ { 0x211149, 0xeba },
+ { 0x212049, 0xeba },
+ { 0x212149, 0xeba },
+ { 0x213049, 0xeba },
+ { 0x213149, 0xeba },
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+ { 0x20018, 0x3 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x2ee },
+ { 0x120008, 0x64 },
+ { 0x220008, 0x19 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0xdc },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x12043, 0x5a1 },
+ { 0x12143, 0x5a1 },
+ { 0x13043, 0x5a1 },
+ { 0x13143, 0x5a1 },
+ { 0x1200b2, 0xdc },
+ { 0x110043, 0x5a1 },
+ { 0x110143, 0x5a1 },
+ { 0x111043, 0x5a1 },
+ { 0x111143, 0x5a1 },
+ { 0x112043, 0x5a1 },
+ { 0x112143, 0x5a1 },
+ { 0x113043, 0x5a1 },
+ { 0x113143, 0x5a1 },
+ { 0x2200b2, 0xdc },
+ { 0x210043, 0x5a1 },
+ { 0x210143, 0x5a1 },
+ { 0x211043, 0x5a1 },
+ { 0x211143, 0x5a1 },
+ { 0x212043, 0x5a1 },
+ { 0x212143, 0x5a1 },
+ { 0x213043, 0x5a1 },
+ { 0x213143, 0x5a1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x2200fa, 0x1 },
+ { 0x20019, 0x1 },
+ { 0x120019, 0x1 },
+ { 0x220019, 0x1 },
+ { 0x200f0, 0x660 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5665 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x22002d, 0x0 },
+ { 0x200c7, 0x21 },
+ { 0x1200c7, 0x21 },
+ { 0x2200c7, 0x21 },
+ { 0x200ca, 0x24 },
+ { 0x1200ca, 0x24 },
+ { 0x2200ca, 0x24 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ { 0x200b2, 0x0 },
+ { 0x1200b2, 0x0 },
+ { 0x2200b2, 0x0 },
+ { 0x200cb, 0x0 },
+ { 0x10043, 0x0 },
+ { 0x110043, 0x0 },
+ { 0x210043, 0x0 },
+ { 0x10143, 0x0 },
+ { 0x110143, 0x0 },
+ { 0x210143, 0x0 },
+ { 0x11043, 0x0 },
+ { 0x111043, 0x0 },
+ { 0x211043, 0x0 },
+ { 0x11143, 0x0 },
+ { 0x111143, 0x0 },
+ { 0x211143, 0x0 },
+ { 0x12043, 0x0 },
+ { 0x112043, 0x0 },
+ { 0x212043, 0x0 },
+ { 0x12143, 0x0 },
+ { 0x112143, 0x0 },
+ { 0x212143, 0x0 },
+ { 0x13043, 0x0 },
+ { 0x113043, 0x0 },
+ { 0x213043, 0x0 },
+ { 0x13143, 0x0 },
+ { 0x113143, 0x0 },
+ { 0x213143, 0x0 },
+ { 0x80, 0x0 },
+ { 0x100080, 0x0 },
+ { 0x200080, 0x0 },
+ { 0x1080, 0x0 },
+ { 0x101080, 0x0 },
+ { 0x201080, 0x0 },
+ { 0x2080, 0x0 },
+ { 0x102080, 0x0 },
+ { 0x202080, 0x0 },
+ { 0x3080, 0x0 },
+ { 0x103080, 0x0 },
+ { 0x203080, 0x0 },
+ { 0x4080, 0x0 },
+ { 0x104080, 0x0 },
+ { 0x204080, 0x0 },
+ { 0x5080, 0x0 },
+ { 0x105080, 0x0 },
+ { 0x205080, 0x0 },
+ { 0x6080, 0x0 },
+ { 0x106080, 0x0 },
+ { 0x206080, 0x0 },
+ { 0x7080, 0x0 },
+ { 0x107080, 0x0 },
+ { 0x207080, 0x0 },
+ { 0x8080, 0x0 },
+ { 0x108080, 0x0 },
+ { 0x208080, 0x0 },
+ { 0x9080, 0x0 },
+ { 0x109080, 0x0 },
+ { 0x209080, 0x0 },
+ { 0x10080, 0x0 },
+ { 0x110080, 0x0 },
+ { 0x210080, 0x0 },
+ { 0x10180, 0x0 },
+ { 0x110180, 0x0 },
+ { 0x210180, 0x0 },
+ { 0x11080, 0x0 },
+ { 0x111080, 0x0 },
+ { 0x211080, 0x0 },
+ { 0x11180, 0x0 },
+ { 0x111180, 0x0 },
+ { 0x211180, 0x0 },
+ { 0x12080, 0x0 },
+ { 0x112080, 0x0 },
+ { 0x212080, 0x0 },
+ { 0x12180, 0x0 },
+ { 0x112180, 0x0 },
+ { 0x212180, 0x0 },
+ { 0x13080, 0x0 },
+ { 0x113080, 0x0 },
+ { 0x213080, 0x0 },
+ { 0x13180, 0x0 },
+ { 0x113180, 0x0 },
+ { 0x213180, 0x0 },
+ { 0x10081, 0x0 },
+ { 0x110081, 0x0 },
+ { 0x210081, 0x0 },
+ { 0x10181, 0x0 },
+ { 0x110181, 0x0 },
+ { 0x210181, 0x0 },
+ { 0x11081, 0x0 },
+ { 0x111081, 0x0 },
+ { 0x211081, 0x0 },
+ { 0x11181, 0x0 },
+ { 0x111181, 0x0 },
+ { 0x211181, 0x0 },
+ { 0x12081, 0x0 },
+ { 0x112081, 0x0 },
+ { 0x212081, 0x0 },
+ { 0x12181, 0x0 },
+ { 0x112181, 0x0 },
+ { 0x212181, 0x0 },
+ { 0x13081, 0x0 },
+ { 0x113081, 0x0 },
+ { 0x213081, 0x0 },
+ { 0x13181, 0x0 },
+ { 0x113181, 0x0 },
+ { 0x213181, 0x0 },
+ { 0x100d0, 0x0 },
+ { 0x1100d0, 0x0 },
+ { 0x2100d0, 0x0 },
+ { 0x101d0, 0x0 },
+ { 0x1101d0, 0x0 },
+ { 0x2101d0, 0x0 },
+ { 0x110d0, 0x0 },
+ { 0x1110d0, 0x0 },
+ { 0x2110d0, 0x0 },
+ { 0x111d0, 0x0 },
+ { 0x1111d0, 0x0 },
+ { 0x2111d0, 0x0 },
+ { 0x120d0, 0x0 },
+ { 0x1120d0, 0x0 },
+ { 0x2120d0, 0x0 },
+ { 0x121d0, 0x0 },
+ { 0x1121d0, 0x0 },
+ { 0x2121d0, 0x0 },
+ { 0x130d0, 0x0 },
+ { 0x1130d0, 0x0 },
+ { 0x2130d0, 0x0 },
+ { 0x131d0, 0x0 },
+ { 0x1131d0, 0x0 },
+ { 0x2131d0, 0x0 },
+ { 0x100d1, 0x0 },
+ { 0x1100d1, 0x0 },
+ { 0x2100d1, 0x0 },
+ { 0x101d1, 0x0 },
+ { 0x1101d1, 0x0 },
+ { 0x2101d1, 0x0 },
+ { 0x110d1, 0x0 },
+ { 0x1110d1, 0x0 },
+ { 0x2110d1, 0x0 },
+ { 0x111d1, 0x0 },
+ { 0x1111d1, 0x0 },
+ { 0x2111d1, 0x0 },
+ { 0x120d1, 0x0 },
+ { 0x1120d1, 0x0 },
+ { 0x2120d1, 0x0 },
+ { 0x121d1, 0x0 },
+ { 0x1121d1, 0x0 },
+ { 0x2121d1, 0x0 },
+ { 0x130d1, 0x0 },
+ { 0x1130d1, 0x0 },
+ { 0x2130d1, 0x0 },
+ { 0x131d1, 0x0 },
+ { 0x1131d1, 0x0 },
+ { 0x2131d1, 0x0 },
+ { 0x10068, 0x0 },
+ { 0x10168, 0x0 },
+ { 0x10268, 0x0 },
+ { 0x10368, 0x0 },
+ { 0x10468, 0x0 },
+ { 0x10568, 0x0 },
+ { 0x10668, 0x0 },
+ { 0x10768, 0x0 },
+ { 0x10868, 0x0 },
+ { 0x11068, 0x0 },
+ { 0x11168, 0x0 },
+ { 0x11268, 0x0 },
+ { 0x11368, 0x0 },
+ { 0x11468, 0x0 },
+ { 0x11568, 0x0 },
+ { 0x11668, 0x0 },
+ { 0x11768, 0x0 },
+ { 0x11868, 0x0 },
+ { 0x12068, 0x0 },
+ { 0x12168, 0x0 },
+ { 0x12268, 0x0 },
+ { 0x12368, 0x0 },
+ { 0x12468, 0x0 },
+ { 0x12568, 0x0 },
+ { 0x12668, 0x0 },
+ { 0x12768, 0x0 },
+ { 0x12868, 0x0 },
+ { 0x13068, 0x0 },
+ { 0x13168, 0x0 },
+ { 0x13268, 0x0 },
+ { 0x13368, 0x0 },
+ { 0x13468, 0x0 },
+ { 0x13568, 0x0 },
+ { 0x13668, 0x0 },
+ { 0x13768, 0x0 },
+ { 0x13868, 0x0 },
+ { 0x10069, 0x0 },
+ { 0x10169, 0x0 },
+ { 0x10269, 0x0 },
+ { 0x10369, 0x0 },
+ { 0x10469, 0x0 },
+ { 0x10569, 0x0 },
+ { 0x10669, 0x0 },
+ { 0x10769, 0x0 },
+ { 0x10869, 0x0 },
+ { 0x11069, 0x0 },
+ { 0x11169, 0x0 },
+ { 0x11269, 0x0 },
+ { 0x11369, 0x0 },
+ { 0x11469, 0x0 },
+ { 0x11569, 0x0 },
+ { 0x11669, 0x0 },
+ { 0x11769, 0x0 },
+ { 0x11869, 0x0 },
+ { 0x12069, 0x0 },
+ { 0x12169, 0x0 },
+ { 0x12269, 0x0 },
+ { 0x12369, 0x0 },
+ { 0x12469, 0x0 },
+ { 0x12569, 0x0 },
+ { 0x12669, 0x0 },
+ { 0x12769, 0x0 },
+ { 0x12869, 0x0 },
+ { 0x13069, 0x0 },
+ { 0x13169, 0x0 },
+ { 0x13269, 0x0 },
+ { 0x13369, 0x0 },
+ { 0x13469, 0x0 },
+ { 0x13569, 0x0 },
+ { 0x13669, 0x0 },
+ { 0x13769, 0x0 },
+ { 0x13869, 0x0 },
+ { 0x1008c, 0x0 },
+ { 0x11008c, 0x0 },
+ { 0x21008c, 0x0 },
+ { 0x1018c, 0x0 },
+ { 0x11018c, 0x0 },
+ { 0x21018c, 0x0 },
+ { 0x1108c, 0x0 },
+ { 0x11108c, 0x0 },
+ { 0x21108c, 0x0 },
+ { 0x1118c, 0x0 },
+ { 0x11118c, 0x0 },
+ { 0x21118c, 0x0 },
+ { 0x1208c, 0x0 },
+ { 0x11208c, 0x0 },
+ { 0x21208c, 0x0 },
+ { 0x1218c, 0x0 },
+ { 0x11218c, 0x0 },
+ { 0x21218c, 0x0 },
+ { 0x1308c, 0x0 },
+ { 0x11308c, 0x0 },
+ { 0x21308c, 0x0 },
+ { 0x1318c, 0x0 },
+ { 0x11318c, 0x0 },
+ { 0x21318c, 0x0 },
+ { 0x1008d, 0x0 },
+ { 0x11008d, 0x0 },
+ { 0x21008d, 0x0 },
+ { 0x1018d, 0x0 },
+ { 0x11018d, 0x0 },
+ { 0x21018d, 0x0 },
+ { 0x1108d, 0x0 },
+ { 0x11108d, 0x0 },
+ { 0x21108d, 0x0 },
+ { 0x1118d, 0x0 },
+ { 0x11118d, 0x0 },
+ { 0x21118d, 0x0 },
+ { 0x1208d, 0x0 },
+ { 0x11208d, 0x0 },
+ { 0x21208d, 0x0 },
+ { 0x1218d, 0x0 },
+ { 0x11218d, 0x0 },
+ { 0x21218d, 0x0 },
+ { 0x1308d, 0x0 },
+ { 0x11308d, 0x0 },
+ { 0x21308d, 0x0 },
+ { 0x1318d, 0x0 },
+ { 0x11318d, 0x0 },
+ { 0x21318d, 0x0 },
+ { 0x100c0, 0x0 },
+ { 0x1100c0, 0x0 },
+ { 0x2100c0, 0x0 },
+ { 0x101c0, 0x0 },
+ { 0x1101c0, 0x0 },
+ { 0x2101c0, 0x0 },
+ { 0x102c0, 0x0 },
+ { 0x1102c0, 0x0 },
+ { 0x2102c0, 0x0 },
+ { 0x103c0, 0x0 },
+ { 0x1103c0, 0x0 },
+ { 0x2103c0, 0x0 },
+ { 0x104c0, 0x0 },
+ { 0x1104c0, 0x0 },
+ { 0x2104c0, 0x0 },
+ { 0x105c0, 0x0 },
+ { 0x1105c0, 0x0 },
+ { 0x2105c0, 0x0 },
+ { 0x106c0, 0x0 },
+ { 0x1106c0, 0x0 },
+ { 0x2106c0, 0x0 },
+ { 0x107c0, 0x0 },
+ { 0x1107c0, 0x0 },
+ { 0x2107c0, 0x0 },
+ { 0x108c0, 0x0 },
+ { 0x1108c0, 0x0 },
+ { 0x2108c0, 0x0 },
+ { 0x110c0, 0x0 },
+ { 0x1110c0, 0x0 },
+ { 0x2110c0, 0x0 },
+ { 0x111c0, 0x0 },
+ { 0x1111c0, 0x0 },
+ { 0x2111c0, 0x0 },
+ { 0x112c0, 0x0 },
+ { 0x1112c0, 0x0 },
+ { 0x2112c0, 0x0 },
+ { 0x113c0, 0x0 },
+ { 0x1113c0, 0x0 },
+ { 0x2113c0, 0x0 },
+ { 0x114c0, 0x0 },
+ { 0x1114c0, 0x0 },
+ { 0x2114c0, 0x0 },
+ { 0x115c0, 0x0 },
+ { 0x1115c0, 0x0 },
+ { 0x2115c0, 0x0 },
+ { 0x116c0, 0x0 },
+ { 0x1116c0, 0x0 },
+ { 0x2116c0, 0x0 },
+ { 0x117c0, 0x0 },
+ { 0x1117c0, 0x0 },
+ { 0x2117c0, 0x0 },
+ { 0x118c0, 0x0 },
+ { 0x1118c0, 0x0 },
+ { 0x2118c0, 0x0 },
+ { 0x120c0, 0x0 },
+ { 0x1120c0, 0x0 },
+ { 0x2120c0, 0x0 },
+ { 0x121c0, 0x0 },
+ { 0x1121c0, 0x0 },
+ { 0x2121c0, 0x0 },
+ { 0x122c0, 0x0 },
+ { 0x1122c0, 0x0 },
+ { 0x2122c0, 0x0 },
+ { 0x123c0, 0x0 },
+ { 0x1123c0, 0x0 },
+ { 0x2123c0, 0x0 },
+ { 0x124c0, 0x0 },
+ { 0x1124c0, 0x0 },
+ { 0x2124c0, 0x0 },
+ { 0x125c0, 0x0 },
+ { 0x1125c0, 0x0 },
+ { 0x2125c0, 0x0 },
+ { 0x126c0, 0x0 },
+ { 0x1126c0, 0x0 },
+ { 0x2126c0, 0x0 },
+ { 0x127c0, 0x0 },
+ { 0x1127c0, 0x0 },
+ { 0x2127c0, 0x0 },
+ { 0x128c0, 0x0 },
+ { 0x1128c0, 0x0 },
+ { 0x2128c0, 0x0 },
+ { 0x130c0, 0x0 },
+ { 0x1130c0, 0x0 },
+ { 0x2130c0, 0x0 },
+ { 0x131c0, 0x0 },
+ { 0x1131c0, 0x0 },
+ { 0x2131c0, 0x0 },
+ { 0x132c0, 0x0 },
+ { 0x1132c0, 0x0 },
+ { 0x2132c0, 0x0 },
+ { 0x133c0, 0x0 },
+ { 0x1133c0, 0x0 },
+ { 0x2133c0, 0x0 },
+ { 0x134c0, 0x0 },
+ { 0x1134c0, 0x0 },
+ { 0x2134c0, 0x0 },
+ { 0x135c0, 0x0 },
+ { 0x1135c0, 0x0 },
+ { 0x2135c0, 0x0 },
+ { 0x136c0, 0x0 },
+ { 0x1136c0, 0x0 },
+ { 0x2136c0, 0x0 },
+ { 0x137c0, 0x0 },
+ { 0x1137c0, 0x0 },
+ { 0x2137c0, 0x0 },
+ { 0x138c0, 0x0 },
+ { 0x1138c0, 0x0 },
+ { 0x2138c0, 0x0 },
+ { 0x100c1, 0x0 },
+ { 0x1100c1, 0x0 },
+ { 0x2100c1, 0x0 },
+ { 0x101c1, 0x0 },
+ { 0x1101c1, 0x0 },
+ { 0x2101c1, 0x0 },
+ { 0x102c1, 0x0 },
+ { 0x1102c1, 0x0 },
+ { 0x2102c1, 0x0 },
+ { 0x103c1, 0x0 },
+ { 0x1103c1, 0x0 },
+ { 0x2103c1, 0x0 },
+ { 0x104c1, 0x0 },
+ { 0x1104c1, 0x0 },
+ { 0x2104c1, 0x0 },
+ { 0x105c1, 0x0 },
+ { 0x1105c1, 0x0 },
+ { 0x2105c1, 0x0 },
+ { 0x106c1, 0x0 },
+ { 0x1106c1, 0x0 },
+ { 0x2106c1, 0x0 },
+ { 0x107c1, 0x0 },
+ { 0x1107c1, 0x0 },
+ { 0x2107c1, 0x0 },
+ { 0x108c1, 0x0 },
+ { 0x1108c1, 0x0 },
+ { 0x2108c1, 0x0 },
+ { 0x110c1, 0x0 },
+ { 0x1110c1, 0x0 },
+ { 0x2110c1, 0x0 },
+ { 0x111c1, 0x0 },
+ { 0x1111c1, 0x0 },
+ { 0x2111c1, 0x0 },
+ { 0x112c1, 0x0 },
+ { 0x1112c1, 0x0 },
+ { 0x2112c1, 0x0 },
+ { 0x113c1, 0x0 },
+ { 0x1113c1, 0x0 },
+ { 0x2113c1, 0x0 },
+ { 0x114c1, 0x0 },
+ { 0x1114c1, 0x0 },
+ { 0x2114c1, 0x0 },
+ { 0x115c1, 0x0 },
+ { 0x1115c1, 0x0 },
+ { 0x2115c1, 0x0 },
+ { 0x116c1, 0x0 },
+ { 0x1116c1, 0x0 },
+ { 0x2116c1, 0x0 },
+ { 0x117c1, 0x0 },
+ { 0x1117c1, 0x0 },
+ { 0x2117c1, 0x0 },
+ { 0x118c1, 0x0 },
+ { 0x1118c1, 0x0 },
+ { 0x2118c1, 0x0 },
+ { 0x120c1, 0x0 },
+ { 0x1120c1, 0x0 },
+ { 0x2120c1, 0x0 },
+ { 0x121c1, 0x0 },
+ { 0x1121c1, 0x0 },
+ { 0x2121c1, 0x0 },
+ { 0x122c1, 0x0 },
+ { 0x1122c1, 0x0 },
+ { 0x2122c1, 0x0 },
+ { 0x123c1, 0x0 },
+ { 0x1123c1, 0x0 },
+ { 0x2123c1, 0x0 },
+ { 0x124c1, 0x0 },
+ { 0x1124c1, 0x0 },
+ { 0x2124c1, 0x0 },
+ { 0x125c1, 0x0 },
+ { 0x1125c1, 0x0 },
+ { 0x2125c1, 0x0 },
+ { 0x126c1, 0x0 },
+ { 0x1126c1, 0x0 },
+ { 0x2126c1, 0x0 },
+ { 0x127c1, 0x0 },
+ { 0x1127c1, 0x0 },
+ { 0x2127c1, 0x0 },
+ { 0x128c1, 0x0 },
+ { 0x1128c1, 0x0 },
+ { 0x2128c1, 0x0 },
+ { 0x130c1, 0x0 },
+ { 0x1130c1, 0x0 },
+ { 0x2130c1, 0x0 },
+ { 0x131c1, 0x0 },
+ { 0x1131c1, 0x0 },
+ { 0x2131c1, 0x0 },
+ { 0x132c1, 0x0 },
+ { 0x1132c1, 0x0 },
+ { 0x2132c1, 0x0 },
+ { 0x133c1, 0x0 },
+ { 0x1133c1, 0x0 },
+ { 0x2133c1, 0x0 },
+ { 0x134c1, 0x0 },
+ { 0x1134c1, 0x0 },
+ { 0x2134c1, 0x0 },
+ { 0x135c1, 0x0 },
+ { 0x1135c1, 0x0 },
+ { 0x2135c1, 0x0 },
+ { 0x136c1, 0x0 },
+ { 0x1136c1, 0x0 },
+ { 0x2136c1, 0x0 },
+ { 0x137c1, 0x0 },
+ { 0x1137c1, 0x0 },
+ { 0x2137c1, 0x0 },
+ { 0x138c1, 0x0 },
+ { 0x1138c1, 0x0 },
+ { 0x2138c1, 0x0 },
+ { 0x10020, 0x0 },
+ { 0x110020, 0x0 },
+ { 0x210020, 0x0 },
+ { 0x11020, 0x0 },
+ { 0x111020, 0x0 },
+ { 0x211020, 0x0 },
+ { 0x12020, 0x0 },
+ { 0x112020, 0x0 },
+ { 0x212020, 0x0 },
+ { 0x13020, 0x0 },
+ { 0x113020, 0x0 },
+ { 0x213020, 0x0 },
+ { 0x20072, 0x0 },
+ { 0x20073, 0x0 },
+ { 0x20074, 0x0 },
+ { 0x100aa, 0x0 },
+ { 0x110aa, 0x0 },
+ { 0x120aa, 0x0 },
+ { 0x130aa, 0x0 },
+ { 0x20010, 0x0 },
+ { 0x120010, 0x0 },
+ { 0x220010, 0x0 },
+ { 0x20011, 0x0 },
+ { 0x120011, 0x0 },
+ { 0x220011, 0x0 },
+ { 0x100ae, 0x0 },
+ { 0x1100ae, 0x0 },
+ { 0x2100ae, 0x0 },
+ { 0x100af, 0x0 },
+ { 0x1100af, 0x0 },
+ { 0x2100af, 0x0 },
+ { 0x110ae, 0x0 },
+ { 0x1110ae, 0x0 },
+ { 0x2110ae, 0x0 },
+ { 0x110af, 0x0 },
+ { 0x1110af, 0x0 },
+ { 0x2110af, 0x0 },
+ { 0x120ae, 0x0 },
+ { 0x1120ae, 0x0 },
+ { 0x2120ae, 0x0 },
+ { 0x120af, 0x0 },
+ { 0x1120af, 0x0 },
+ { 0x2120af, 0x0 },
+ { 0x130ae, 0x0 },
+ { 0x1130ae, 0x0 },
+ { 0x2130ae, 0x0 },
+ { 0x130af, 0x0 },
+ { 0x1130af, 0x0 },
+ { 0x2130af, 0x0 },
+ { 0x20020, 0x0 },
+ { 0x120020, 0x0 },
+ { 0x220020, 0x0 },
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x0 },
+ { 0x100a2, 0x0 },
+ { 0x100a3, 0x0 },
+ { 0x100a4, 0x0 },
+ { 0x100a5, 0x0 },
+ { 0x100a6, 0x0 },
+ { 0x100a7, 0x0 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x0 },
+ { 0x110a2, 0x0 },
+ { 0x110a3, 0x0 },
+ { 0x110a4, 0x0 },
+ { 0x110a5, 0x0 },
+ { 0x110a6, 0x0 },
+ { 0x110a7, 0x0 },
+ { 0x120a0, 0x0 },
+ { 0x120a1, 0x0 },
+ { 0x120a2, 0x0 },
+ { 0x120a3, 0x0 },
+ { 0x120a4, 0x0 },
+ { 0x120a5, 0x0 },
+ { 0x120a6, 0x0 },
+ { 0x120a7, 0x0 },
+ { 0x130a0, 0x0 },
+ { 0x130a1, 0x0 },
+ { 0x130a2, 0x0 },
+ { 0x130a3, 0x0 },
+ { 0x130a4, 0x0 },
+ { 0x130a5, 0x0 },
+ { 0x130a6, 0x0 },
+ { 0x130a7, 0x0 },
+ { 0x2007c, 0x0 },
+ { 0x12007c, 0x0 },
+ { 0x22007c, 0x0 },
+ { 0x2007d, 0x0 },
+ { 0x12007d, 0x0 },
+ { 0x22007d, 0x0 },
+ { 0x400fd, 0x0 },
+ { 0x400c0, 0x0 },
+ { 0x90201, 0x0 },
+ { 0x190201, 0x0 },
+ { 0x290201, 0x0 },
+ { 0x90202, 0x0 },
+ { 0x190202, 0x0 },
+ { 0x290202, 0x0 },
+ { 0x90203, 0x0 },
+ { 0x190203, 0x0 },
+ { 0x290203, 0x0 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x90205, 0x0 },
+ { 0x190205, 0x0 },
+ { 0x290205, 0x0 },
+ { 0x90206, 0x0 },
+ { 0x190206, 0x0 },
+ { 0x290206, 0x0 },
+ { 0x90207, 0x0 },
+ { 0x190207, 0x0 },
+ { 0x290207, 0x0 },
+ { 0x90208, 0x0 },
+ { 0x190208, 0x0 },
+ { 0x290208, 0x0 },
+ { 0x10062, 0x0 },
+ { 0x10162, 0x0 },
+ { 0x10262, 0x0 },
+ { 0x10362, 0x0 },
+ { 0x10462, 0x0 },
+ { 0x10562, 0x0 },
+ { 0x10662, 0x0 },
+ { 0x10762, 0x0 },
+ { 0x10862, 0x0 },
+ { 0x11062, 0x0 },
+ { 0x11162, 0x0 },
+ { 0x11262, 0x0 },
+ { 0x11362, 0x0 },
+ { 0x11462, 0x0 },
+ { 0x11562, 0x0 },
+ { 0x11662, 0x0 },
+ { 0x11762, 0x0 },
+ { 0x11862, 0x0 },
+ { 0x12062, 0x0 },
+ { 0x12162, 0x0 },
+ { 0x12262, 0x0 },
+ { 0x12362, 0x0 },
+ { 0x12462, 0x0 },
+ { 0x12562, 0x0 },
+ { 0x12662, 0x0 },
+ { 0x12762, 0x0 },
+ { 0x12862, 0x0 },
+ { 0x13062, 0x0 },
+ { 0x13162, 0x0 },
+ { 0x13262, 0x0 },
+ { 0x13362, 0x0 },
+ { 0x13462, 0x0 },
+ { 0x13562, 0x0 },
+ { 0x13662, 0x0 },
+ { 0x13762, 0x0 },
+ { 0x13862, 0x0 },
+ { 0x20077, 0x0 },
+ { 0x10001, 0x0 },
+ { 0x11001, 0x0 },
+ { 0x12001, 0x0 },
+ { 0x13001, 0x0 },
+ { 0x10040, 0x0 },
+ { 0x10140, 0x0 },
+ { 0x10240, 0x0 },
+ { 0x10340, 0x0 },
+ { 0x10440, 0x0 },
+ { 0x10540, 0x0 },
+ { 0x10640, 0x0 },
+ { 0x10740, 0x0 },
+ { 0x10840, 0x0 },
+ { 0x10030, 0x0 },
+ { 0x10130, 0x0 },
+ { 0x10230, 0x0 },
+ { 0x10330, 0x0 },
+ { 0x10430, 0x0 },
+ { 0x10530, 0x0 },
+ { 0x10630, 0x0 },
+ { 0x10730, 0x0 },
+ { 0x10830, 0x0 },
+ { 0x11040, 0x0 },
+ { 0x11140, 0x0 },
+ { 0x11240, 0x0 },
+ { 0x11340, 0x0 },
+ { 0x11440, 0x0 },
+ { 0x11540, 0x0 },
+ { 0x11640, 0x0 },
+ { 0x11740, 0x0 },
+ { 0x11840, 0x0 },
+ { 0x11030, 0x0 },
+ { 0x11130, 0x0 },
+ { 0x11230, 0x0 },
+ { 0x11330, 0x0 },
+ { 0x11430, 0x0 },
+ { 0x11530, 0x0 },
+ { 0x11630, 0x0 },
+ { 0x11730, 0x0 },
+ { 0x11830, 0x0 },
+ { 0x12040, 0x0 },
+ { 0x12140, 0x0 },
+ { 0x12240, 0x0 },
+ { 0x12340, 0x0 },
+ { 0x12440, 0x0 },
+ { 0x12540, 0x0 },
+ { 0x12640, 0x0 },
+ { 0x12740, 0x0 },
+ { 0x12840, 0x0 },
+ { 0x12030, 0x0 },
+ { 0x12130, 0x0 },
+ { 0x12230, 0x0 },
+ { 0x12330, 0x0 },
+ { 0x12430, 0x0 },
+ { 0x12530, 0x0 },
+ { 0x12630, 0x0 },
+ { 0x12730, 0x0 },
+ { 0x12830, 0x0 },
+ { 0x13040, 0x0 },
+ { 0x13140, 0x0 },
+ { 0x13240, 0x0 },
+ { 0x13340, 0x0 },
+ { 0x13440, 0x0 },
+ { 0x13540, 0x0 },
+ { 0x13640, 0x0 },
+ { 0x13740, 0x0 },
+ { 0x13840, 0x0 },
+ { 0x13030, 0x0 },
+ { 0x13130, 0x0 },
+ { 0x13230, 0x0 },
+ { 0x13330, 0x0 },
+ { 0x13430, 0x0 },
+ { 0x13530, 0x0 },
+ { 0x13630, 0x0 },
+ { 0x13730, 0x0 },
+ { 0x13830, 0x0 },
+};
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0xbb8 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x131f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x2dd4 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x2dd4 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x1 },
+ { 0x54032, 0xd400 },
+ { 0x54033, 0x312d },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xd400 },
+ { 0x54039, 0x312d },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x101 },
+ { 0x54003, 0x190 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x1 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3100 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3100 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P2 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp2_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x102 },
+ { 0x54003, 0x64 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x1 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3100 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3100 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0xbb8 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x61 },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54010, 0x1f7f },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x2dd4 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x2dd4 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x1 },
+ { 0x54032, 0xd400 },
+ { 0x54033, 0x312d },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xd400 },
+ { 0x54039, 0x312d },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xf },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x630 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x630 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x630 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x45a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x448 },
+ { 0x90055, 0x109 },
+ { 0x90056, 0x40 },
+ { 0x90057, 0x630 },
+ { 0x90058, 0x179 },
+ { 0x90059, 0x1 },
+ { 0x9005a, 0x618 },
+ { 0x9005b, 0x109 },
+ { 0x9005c, 0x40c0 },
+ { 0x9005d, 0x630 },
+ { 0x9005e, 0x149 },
+ { 0x9005f, 0x8 },
+ { 0x90060, 0x4 },
+ { 0x90061, 0x48 },
+ { 0x90062, 0x4040 },
+ { 0x90063, 0x630 },
+ { 0x90064, 0x149 },
+ { 0x90065, 0x0 },
+ { 0x90066, 0x4 },
+ { 0x90067, 0x48 },
+ { 0x90068, 0x40 },
+ { 0x90069, 0x630 },
+ { 0x9006a, 0x149 },
+ { 0x9006b, 0x10 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x18 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x4 },
+ { 0x90070, 0x78 },
+ { 0x90071, 0x549 },
+ { 0x90072, 0x630 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0xd49 },
+ { 0x90075, 0x630 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x94a },
+ { 0x90078, 0x630 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0x441 },
+ { 0x9007b, 0x630 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x42 },
+ { 0x9007e, 0x630 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x1 },
+ { 0x90081, 0x630 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x0 },
+ { 0x90084, 0xe0 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0xa },
+ { 0x90087, 0x10 },
+ { 0x90088, 0x109 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x149 },
+ { 0x9008c, 0x9 },
+ { 0x9008d, 0x3c0 },
+ { 0x9008e, 0x159 },
+ { 0x9008f, 0x18 },
+ { 0x90090, 0x10 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x0 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x109 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x48 },
+ { 0x90098, 0x18 },
+ { 0x90099, 0x4 },
+ { 0x9009a, 0x58 },
+ { 0x9009b, 0xa },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x2 },
+ { 0x9009f, 0x10 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x5 },
+ { 0x900a2, 0x7c0 },
+ { 0x900a3, 0x109 },
+ { 0x900a4, 0x10 },
+ { 0x900a5, 0x10 },
+ { 0x900a6, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x623 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x623 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900a7, 0x0 },
+ { 0x900a8, 0x790 },
+ { 0x900a9, 0x11a },
+ { 0x900aa, 0x8 },
+ { 0x900ab, 0x7aa },
+ { 0x900ac, 0x2a },
+ { 0x900ad, 0x10 },
+ { 0x900ae, 0x7b2 },
+ { 0x900af, 0x2a },
+ { 0x900b0, 0x0 },
+ { 0x900b1, 0x7c8 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x10 },
+ { 0x900b4, 0x2a8 },
+ { 0x900b5, 0x129 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0x370 },
+ { 0x900b8, 0x129 },
+ { 0x900b9, 0xa },
+ { 0x900ba, 0x3c8 },
+ { 0x900bb, 0x1a9 },
+ { 0x900bc, 0xc },
+ { 0x900bd, 0x408 },
+ { 0x900be, 0x199 },
+ { 0x900bf, 0x14 },
+ { 0x900c0, 0x790 },
+ { 0x900c1, 0x11a },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x18 },
+ { 0x900c5, 0xe },
+ { 0x900c6, 0x408 },
+ { 0x900c7, 0x199 },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x8568 },
+ { 0x900ca, 0x108 },
+ { 0x900cb, 0x18 },
+ { 0x900cc, 0x790 },
+ { 0x900cd, 0x16a },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x1d8 },
+ { 0x900d0, 0x169 },
+ { 0x900d1, 0x10 },
+ { 0x900d2, 0x8558 },
+ { 0x900d3, 0x168 },
+ { 0x900d4, 0x70 },
+ { 0x900d5, 0x788 },
+ { 0x900d6, 0x16a },
+ { 0x900d7, 0x1ff8 },
+ { 0x900d8, 0x85a8 },
+ { 0x900d9, 0x1e8 },
+ { 0x900da, 0x50 },
+ { 0x900db, 0x798 },
+ { 0x900dc, 0x16a },
+ { 0x900dd, 0x60 },
+ { 0x900de, 0x7a0 },
+ { 0x900df, 0x16a },
+ { 0x900e0, 0x8 },
+ { 0x900e1, 0x8310 },
+ { 0x900e2, 0x168 },
+ { 0x900e3, 0x8 },
+ { 0x900e4, 0xa310 },
+ { 0x900e5, 0x168 },
+ { 0x900e6, 0xa },
+ { 0x900e7, 0x408 },
+ { 0x900e8, 0x169 },
+ { 0x900e9, 0x6e },
+ { 0x900ea, 0x0 },
+ { 0x900eb, 0x68 },
+ { 0x900ec, 0x0 },
+ { 0x900ed, 0x408 },
+ { 0x900ee, 0x169 },
+ { 0x900ef, 0x0 },
+ { 0x900f0, 0x8310 },
+ { 0x900f1, 0x168 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0xa310 },
+ { 0x900f4, 0x168 },
+ { 0x900f5, 0x1ff8 },
+ { 0x900f6, 0x85a8 },
+ { 0x900f7, 0x1e8 },
+ { 0x900f8, 0x68 },
+ { 0x900f9, 0x798 },
+ { 0x900fa, 0x16a },
+ { 0x900fb, 0x78 },
+ { 0x900fc, 0x7a0 },
+ { 0x900fd, 0x16a },
+ { 0x900fe, 0x68 },
+ { 0x900ff, 0x790 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x8 },
+ { 0x90102, 0x8b10 },
+ { 0x90103, 0x168 },
+ { 0x90104, 0x8 },
+ { 0x90105, 0xab10 },
+ { 0x90106, 0x168 },
+ { 0x90107, 0xa },
+ { 0x90108, 0x408 },
+ { 0x90109, 0x169 },
+ { 0x9010a, 0x58 },
+ { 0x9010b, 0x0 },
+ { 0x9010c, 0x68 },
+ { 0x9010d, 0x0 },
+ { 0x9010e, 0x408 },
+ { 0x9010f, 0x169 },
+ { 0x90110, 0x0 },
+ { 0x90111, 0x8b10 },
+ { 0x90112, 0x168 },
+ { 0x90113, 0x0 },
+ { 0x90114, 0xab10 },
+ { 0x90115, 0x168 },
+ { 0x90116, 0x0 },
+ { 0x90117, 0x1d8 },
+ { 0x90118, 0x169 },
+ { 0x90119, 0x80 },
+ { 0x9011a, 0x790 },
+ { 0x9011b, 0x16a },
+ { 0x9011c, 0x18 },
+ { 0x9011d, 0x7aa },
+ { 0x9011e, 0x6a },
+ { 0x9011f, 0xa },
+ { 0x90120, 0x0 },
+ { 0x90121, 0x1e9 },
+ { 0x90122, 0x8 },
+ { 0x90123, 0x8080 },
+ { 0x90124, 0x108 },
+ { 0x90125, 0xf },
+ { 0x90126, 0x408 },
+ { 0x90127, 0x169 },
+ { 0x90128, 0xc },
+ { 0x90129, 0x0 },
+ { 0x9012a, 0x68 },
+ { 0x9012b, 0x9 },
+ { 0x9012c, 0x0 },
+ { 0x9012d, 0x1a9 },
+ { 0x9012e, 0x0 },
+ { 0x9012f, 0x408 },
+ { 0x90130, 0x169 },
+ { 0x90131, 0x0 },
+ { 0x90132, 0x8080 },
+ { 0x90133, 0x108 },
+ { 0x90134, 0x8 },
+ { 0x90135, 0x7aa },
+ { 0x90136, 0x6a },
+ { 0x90137, 0x0 },
+ { 0x90138, 0x8568 },
+ { 0x90139, 0x108 },
+ { 0x9013a, 0xb7 },
+ { 0x9013b, 0x790 },
+ { 0x9013c, 0x16a },
+ { 0x9013d, 0x1f },
+ { 0x9013e, 0x0 },
+ { 0x9013f, 0x68 },
+ { 0x90140, 0x8 },
+ { 0x90141, 0x8558 },
+ { 0x90142, 0x168 },
+ { 0x90143, 0xf },
+ { 0x90144, 0x408 },
+ { 0x90145, 0x169 },
+ { 0x90146, 0xc },
+ { 0x90147, 0x0 },
+ { 0x90148, 0x68 },
+ { 0x90149, 0x0 },
+ { 0x9014a, 0x408 },
+ { 0x9014b, 0x169 },
+ { 0x9014c, 0x0 },
+ { 0x9014d, 0x8558 },
+ { 0x9014e, 0x168 },
+ { 0x9014f, 0x8 },
+ { 0x90150, 0x3c8 },
+ { 0x90151, 0x1a9 },
+ { 0x90152, 0x3 },
+ { 0x90153, 0x370 },
+ { 0x90154, 0x129 },
+ { 0x90155, 0x20 },
+ { 0x90156, 0x2aa },
+ { 0x90157, 0x9 },
+ { 0x90158, 0x0 },
+ { 0x90159, 0x400 },
+ { 0x9015a, 0x10e },
+ { 0x9015b, 0x8 },
+ { 0x9015c, 0xe8 },
+ { 0x9015d, 0x109 },
+ { 0x9015e, 0x0 },
+ { 0x9015f, 0x8140 },
+ { 0x90160, 0x10c },
+ { 0x90161, 0x10 },
+ { 0x90162, 0x8138 },
+ { 0x90163, 0x10c },
+ { 0x90164, 0x8 },
+ { 0x90165, 0x7c8 },
+ { 0x90166, 0x101 },
+ { 0x90167, 0x8 },
+ { 0x90168, 0x0 },
+ { 0x90169, 0x8 },
+ { 0x9016a, 0x8 },
+ { 0x9016b, 0x448 },
+ { 0x9016c, 0x109 },
+ { 0x9016d, 0xf },
+ { 0x9016e, 0x7c0 },
+ { 0x9016f, 0x109 },
+ { 0x90170, 0x0 },
+ { 0x90171, 0xe8 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0x47 },
+ { 0x90174, 0x630 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x8 },
+ { 0x90177, 0x618 },
+ { 0x90178, 0x109 },
+ { 0x90179, 0x8 },
+ { 0x9017a, 0xe0 },
+ { 0x9017b, 0x109 },
+ { 0x9017c, 0x0 },
+ { 0x9017d, 0x7c8 },
+ { 0x9017e, 0x109 },
+ { 0x9017f, 0x8 },
+ { 0x90180, 0x8140 },
+ { 0x90181, 0x10c },
+ { 0x90182, 0x0 },
+ { 0x90183, 0x1 },
+ { 0x90184, 0x8 },
+ { 0x90185, 0x8 },
+ { 0x90186, 0x4 },
+ { 0x90187, 0x8 },
+ { 0x90188, 0x8 },
+ { 0x90189, 0x7c8 },
+ { 0x9018a, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x2a },
+ { 0x90026, 0x6a },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+ { 0x2000b, 0x5d },
+ { 0x2000c, 0xbb },
+ { 0x2000d, 0x753 },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0xc },
+ { 0x12000c, 0x19 },
+ { 0x12000d, 0xfa },
+ { 0x12000e, 0x10 },
+ { 0x22000b, 0x3 },
+ { 0x22000c, 0x6 },
+ { 0x22000d, 0x3e },
+ { 0x22000e, 0x10 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x60 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+ { 0x120010, 0x5a },
+ { 0x120011, 0x3 },
+ { 0x220010, 0x5a },
+ { 0x220011, 0x3 },
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x140080, 0xe0 },
+ { 0x140081, 0x12 },
+ { 0x140082, 0xe0 },
+ { 0x140083, 0x12 },
+ { 0x140084, 0xe0 },
+ { 0x140085, 0x12 },
+ { 0x240080, 0xe0 },
+ { 0x240081, 0x12 },
+ { 0x240082, 0xe0 },
+ { 0x240083, 0x12 },
+ { 0x240084, 0xe0 },
+ { 0x240085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x12011, 0x1 },
+ { 0x12012, 0x1 },
+ { 0x12013, 0x180 },
+ { 0x12018, 0x1 },
+ { 0x12002, 0x6209 },
+ { 0x120b2, 0x1 },
+ { 0x121b4, 0x1 },
+ { 0x122b4, 0x1 },
+ { 0x123b4, 0x1 },
+ { 0x124b4, 0x1 },
+ { 0x125b4, 0x1 },
+ { 0x126b4, 0x1 },
+ { 0x127b4, 0x1 },
+ { 0x128b4, 0x1 },
+ { 0x13011, 0x1 },
+ { 0x13012, 0x1 },
+ { 0x13013, 0x180 },
+ { 0x13018, 0x1 },
+ { 0x13002, 0x6209 },
+ { 0x130b2, 0x1 },
+ { 0x131b4, 0x1 },
+ { 0x132b4, 0x1 },
+ { 0x133b4, 0x1 },
+ { 0x134b4, 0x1 },
+ { 0x135b4, 0x1 },
+ { 0x136b4, 0x1 },
+ { 0x137b4, 0x1 },
+ { 0x138b4, 0x1 },
+ { 0x2003a, 0x2 },
+ { 0xc0080, 0x2 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 3000mts 1D */
+ .drate = 3000,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 400mts 1D */
+ .drate = 400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P2 100mts 1D */
+ .drate = 100,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp2_cfg),
+ },
+ {
+ /* P0 3000mts 2D */
+ .drate = 3000,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 3000, 400, 100, },
+};
diff --git a/board/freescale/imx8mm_evk/spl.c b/board/freescale/imx8mm_evk/spl.c
new file mode 100644
index 00000000000..cd251d274ff
--- /dev/null
+++ b/board/freescale/imx8mm_evk/spl.c
@@ -0,0 +1,143 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019, 2021 NXP
+ */
+
+#include <command.h>
+#include <cpu_func.h>
+#include <hang.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx8mm_pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/arch/ddr.h>
+#include <asm/sections.h>
+
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+
+#include <power/pmic.h>
+#include <power/pca9450.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int spl_board_boot_device(enum boot_device boot_dev_spl)
+{
+ switch (boot_dev_spl) {
+ case USB_BOOT:
+ return BOOT_DEVICE_BOARD;
+ case SD2_BOOT:
+ case MMC2_BOOT:
+ return BOOT_DEVICE_MMC1;
+ case SD3_BOOT:
+ case MMC3_BOOT:
+ return BOOT_DEVICE_MMC2;
+ case QSPI_BOOT:
+ return BOOT_DEVICE_NOR;
+ default:
+ return BOOT_DEVICE_NONE;
+ }
+}
+
+static void spl_dram_init(void)
+{
+ ddr_init(&dram_timing);
+}
+
+void spl_board_init(void)
+{
+ arch_misc_init();
+}
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+static int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+
+ ret = pmic_get("pca9450@25", &dev);
+ if (ret == -ENODEV) {
+ puts("No pmic\n");
+ return 0;
+ }
+ if (ret != 0)
+ return ret;
+
+ /* BUCKxOUT_DVS0/1 control BUCK123 output */
+ pmic_reg_write(dev, PCA9450_BUCK123_DVS, 0x29);
+
+ /* Buck 1 DVS control through PMIC_STBY_REQ */
+ pmic_reg_write(dev, PCA9450_BUCK1CTRL, 0x59);
+
+ /* Set DVS1 to 0.8v for suspend */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS1, 0x10);
+
+ /* increase VDD_DRAM to 0.95v for 3Ghz DDR */
+ pmic_reg_write(dev, PCA9450_BUCK3OUT_DVS0, 0x1C);
+
+ /* VDD_DRAM needs off in suspend, set B1_ENMODE=10 (ON by PMIC_ON_REQ = H && PMIC_STBY_REQ = L) */
+ pmic_reg_write(dev, PCA9450_BUCK3CTRL, 0x4a);
+
+ /* set VDD_SNVS_0V8 from default 0.85V */
+ pmic_reg_write(dev, PCA9450_LDO2CTRL, 0xC0);
+
+ return 0;
+}
+
+void board_init_f(ulong dummy)
+{
+ struct udevice *dev;
+ int ret;
+
+ arch_cpu_init();
+
+ init_uart_clk(1);
+
+ timer_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ ret = spl_early_init();
+ if (ret) {
+ debug("spl_early_init() failed: %d\n", ret);
+ hang();
+ }
+
+ ret = uclass_get_device_by_name(UCLASS_CLK,
+ "clock-controller@30380000",
+ &dev);
+ if (ret < 0) {
+ printf("Failed to find clock node. Check device tree\n");
+ hang();
+ }
+
+ preloader_console_init();
+
+ enable_tzc380();
+
+ power_init_board();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx8mn_evk/Kconfig b/board/freescale/imx8mn_evk/Kconfig
new file mode 100644
index 00000000000..a148a9b998c
--- /dev/null
+++ b/board/freescale/imx8mn_evk/Kconfig
@@ -0,0 +1,18 @@
+if TARGET_IMX8MN_EVK || TARGET_IMX8MN_DDR4_EVK
+
+config SYS_BOARD
+ default "imx8mn_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8mn_evk"
+
+config IMX8MN_LOW_DRIVE_MODE
+ bool "Enable the low drive mode of iMX8MN on EVK board"
+
+config IMX_CONFIG
+ default "board/freescale/imx8mn_evk/imximage-8mn-ddr4.cfg"
+
+endif
diff --git a/board/freescale/imx8mn_evk/MAINTAINERS b/board/freescale/imx8mn_evk/MAINTAINERS
new file mode 100644
index 00000000000..6d110ccf22b
--- /dev/null
+++ b/board/freescale/imx8mn_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX8MN EVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx8mn_evk/
+F: include/configs/imx8mn_evk.h
+F: configs/imx8mn_ddr4_evk_defconfig
+F: configs/imx8mn_evk_defconfig
diff --git a/board/freescale/imx8mn_evk/Makefile b/board/freescale/imx8mn_evk/Makefile
new file mode 100644
index 00000000000..42d1179724d
--- /dev/null
+++ b/board/freescale/imx8mn_evk/Makefile
@@ -0,0 +1,18 @@
+#
+# Copyright 2018 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8mn_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+ifdef CONFIG_IMX8MN_LOW_DRIVE_MODE
+obj-$(CONFIG_IMX8M_LPDDR4) += lpddr4_timing_ld.o
+obj-$(CONFIG_IMX8M_DDR4) += ddr4_timing_ld.o
+else
+obj-$(CONFIG_IMX8M_LPDDR4) += lpddr4_timing.o
+obj-$(CONFIG_IMX8M_DDR4) += ddr4_timing.o
+endif
+endif
diff --git a/board/freescale/imx8mn_evk/ddr4_timing.c b/board/freescale/imx8mn_evk/ddr4_timing.c
new file mode 100644
index 00000000000..77611ea0260
--- /dev/null
+++ b/board/freescale/imx8mn_evk/ddr4_timing.c
@@ -0,0 +1,1054 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ *
+ * Generated code from MX8M_DDR_tool
+ * Align with uboot version:
+ * imx_v2018.03_4.14.78_1.0.0_ga ~ imx_v2018.04_4.19.35_1.0.0_ga
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ { 0x3d400000, 0x81040010 },
+ { 0x3d400030, 0x20 },
+ { 0x3d400034, 0x221306 },
+ { 0x3d400050, 0x210070 },
+ { 0x3d400054, 0x10008 },
+ { 0x3d400060, 0x0 },
+ { 0x3d400064, 0x92014a },
+ { 0x3d4000c0, 0x0 },
+ { 0x3d4000c4, 0x1000 },
+ { 0x3d4000d0, 0xc0030126 },
+ { 0x3d4000d4, 0x770000 },
+ { 0x3d4000dc, 0x8340105 },
+ { 0x3d4000e0, 0x180200 },
+ { 0x3d4000e4, 0x110000 },
+ { 0x3d4000e8, 0x2000600 },
+ { 0x3d4000ec, 0x810 },
+ { 0x3d4000f0, 0x20 },
+ { 0x3d4000f4, 0xec7 },
+ { 0x3d400100, 0x11122914 },
+ { 0x3d400104, 0x4051c },
+ { 0x3d400108, 0x608050d },
+ { 0x3d40010c, 0x400c },
+ { 0x3d400110, 0x8030409 },
+ { 0x3d400114, 0x6060403 },
+ { 0x3d40011c, 0x606 },
+ { 0x3d400120, 0x7070d0c },
+ { 0x3d400124, 0x2040a },
+ { 0x3d40012c, 0x1809010e },
+ { 0x3d400130, 0x8 },
+ { 0x3d40013c, 0x0 },
+ { 0x3d400180, 0x1000040 },
+ { 0x3d400184, 0x493e },
+ { 0x3d400190, 0x38b8207 },
+ { 0x3d400194, 0x2020303 },
+ { 0x3d400198, 0x7f04011 },
+ { 0x3d40019c, 0xb0 },
+ { 0x3d4001a0, 0xe0400018 },
+ { 0x3d4001a4, 0x48005a },
+ { 0x3d4001a8, 0x80000000 },
+ { 0x3d4001b0, 0x1 },
+ { 0x3d4001b4, 0xb07 },
+ { 0x3d4001b8, 0x4 },
+ { 0x3d4001c0, 0x1 },
+ { 0x3d4001c4, 0x0 },
+ { 0x3d400200, 0x3f1f },
+ { 0x3d400204, 0x3f0909 },
+ { 0x3d400208, 0x700 },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x7070707 },
+ { 0x3d40021c, 0xf07 },
+ { 0x3d400220, 0x3f01 },
+ { 0x3d400240, 0x6000610 },
+ { 0x3d400244, 0x1323 },
+ { 0x3d400400, 0x100 },
+
+ /* performance setting */
+ { 0x3d400250, 0x00001f05 },
+ { 0x3d400254, 0x1f },
+ { 0x3d400264, 0x900003ff },
+ { 0x3d40026c, 0x200003ff },
+ { 0x3d400494, 0x01000e00 },
+ { 0x3d400498, 0x03ff0000 },
+ { 0x3d40049c, 0x01000e00 },
+ { 0x3d4004a0, 0x03ff0000 },
+
+ { 0x3d402050, 0x210070 },
+ { 0x3d402064, 0x400093 },
+ { 0x3d4020dc, 0x105 },
+ { 0x3d4020e0, 0x0 },
+ { 0x3d4020e8, 0x2000600 },
+ { 0x3d4020ec, 0x10 },
+ { 0x3d402100, 0xb081209 },
+ { 0x3d402104, 0x2020d },
+ { 0x3d402108, 0x5050309 },
+ { 0x3d40210c, 0x400c },
+ { 0x3d402110, 0x5030206 },
+ { 0x3d402114, 0x3030202 },
+ { 0x3d40211c, 0x303 },
+ { 0x3d402120, 0x4040d06 },
+ { 0x3d402124, 0x20208 },
+ { 0x3d40212c, 0x1205010e },
+ { 0x3d402130, 0x8 },
+ { 0x3d40213c, 0x0 },
+ { 0x3d402180, 0x1000040 },
+ { 0x3d402190, 0x3848204 },
+ { 0x3d402194, 0x2020303 },
+ { 0x3d4021b4, 0x404 },
+ { 0x3d4021b8, 0x4 },
+ { 0x3d402240, 0x6000600 },
+ { 0x3d4020f4, 0xec7 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x1005f, 0x2fd },
+ { 0x1015f, 0x2fd },
+ { 0x1105f, 0x2fd },
+ { 0x1115f, 0x2fd },
+ { 0x11005f, 0x2fd },
+ { 0x11015f, 0x2fd },
+ { 0x11105f, 0x2fd },
+ { 0x11115f, 0x2fd },
+ { 0x55, 0x355 },
+ { 0x1055, 0x355 },
+ { 0x2055, 0x355 },
+ { 0x3055, 0x355 },
+ { 0x4055, 0x55 },
+ { 0x5055, 0x55 },
+ { 0x6055, 0x355 },
+ { 0x7055, 0x355 },
+ { 0x8055, 0x355 },
+ { 0x9055, 0x355 },
+ { 0x200c5, 0xa },
+ { 0x1200c5, 0x6 },
+ { 0x2002e, 0x2 },
+ { 0x12002e, 0x1 },
+ { 0x20024, 0x8 },
+ { 0x2003a, 0x2 },
+ { 0x120024, 0x8 },
+ { 0x2003a, 0x2 },
+ { 0x20056, 0x6 },
+ { 0x120056, 0xa },
+ { 0x1004d, 0x1a },
+ { 0x1014d, 0x1a },
+ { 0x1104d, 0x1a },
+ { 0x1114d, 0x1a },
+ { 0x11004d, 0x1a },
+ { 0x11014d, 0x1a },
+ { 0x11104d, 0x1a },
+ { 0x11114d, 0x1a },
+ { 0x10049, 0xe38 },
+ { 0x10149, 0xe38 },
+ { 0x11049, 0xe38 },
+ { 0x11149, 0xe38 },
+ { 0x110049, 0xe38 },
+ { 0x110149, 0xe38 },
+ { 0x111049, 0xe38 },
+ { 0x111149, 0xe38 },
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+ { 0x20018, 0x1 },
+ { 0x20075, 0x2 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x258 },
+ { 0x120008, 0x10a },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x268 },
+ { 0x10043, 0x5b1 },
+ { 0x10143, 0x5b1 },
+ { 0x11043, 0x5b1 },
+ { 0x11143, 0x5b1 },
+ { 0x1200b2, 0x268 },
+ { 0x110043, 0x5b1 },
+ { 0x110143, 0x5b1 },
+ { 0x111043, 0x5b1 },
+ { 0x111143, 0x5b1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x20019, 0x5 },
+ { 0x120019, 0x5 },
+ { 0x200f0, 0x5555 },
+ { 0x200f1, 0x5555 },
+ { 0x200f2, 0x5555 },
+ { 0x200f3, 0x5555 },
+ { 0x200f4, 0x5555 },
+ { 0x200f5, 0x5555 },
+ { 0x200f6, 0x5555 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x2005b, 0x7529 },
+ { 0x2005c, 0x0 },
+ { 0x200c7, 0x21 },
+ { 0x200ca, 0x24 },
+ { 0x200cc, 0x1f7 },
+ { 0x1200c7, 0x21 },
+ { 0x1200ca, 0x24 },
+ { 0x1200cc, 0x1f7 },
+ { 0x2007d, 0x212 },
+ { 0x12007d, 0x212 },
+ { 0x2007c, 0x61 },
+ { 0x12007c, 0x61 },
+ { 0x1004a, 0x500 },
+ { 0x1104a, 0x500 },
+ { 0x2002c, 0x0 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ {0x0200b2, 0x0},
+ {0x1200b2, 0x0},
+ {0x2200b2, 0x0},
+ {0x0200cb, 0x0},
+ {0x010043, 0x0},
+ {0x110043, 0x0},
+ {0x210043, 0x0},
+ {0x010143, 0x0},
+ {0x110143, 0x0},
+ {0x210143, 0x0},
+ {0x011043, 0x0},
+ {0x111043, 0x0},
+ {0x211043, 0x0},
+ {0x011143, 0x0},
+ {0x111143, 0x0},
+ {0x211143, 0x0},
+ {0x000080, 0x0},
+ {0x100080, 0x0},
+ {0x200080, 0x0},
+ {0x001080, 0x0},
+ {0x101080, 0x0},
+ {0x201080, 0x0},
+ {0x002080, 0x0},
+ {0x102080, 0x0},
+ {0x202080, 0x0},
+ {0x003080, 0x0},
+ {0x103080, 0x0},
+ {0x203080, 0x0},
+ {0x004080, 0x0},
+ {0x104080, 0x0},
+ {0x204080, 0x0},
+ {0x005080, 0x0},
+ {0x105080, 0x0},
+ {0x205080, 0x0},
+ {0x006080, 0x0},
+ {0x106080, 0x0},
+ {0x206080, 0x0},
+ {0x007080, 0x0},
+ {0x107080, 0x0},
+ {0x207080, 0x0},
+ {0x008080, 0x0},
+ {0x108080, 0x0},
+ {0x208080, 0x0},
+ {0x009080, 0x0},
+ {0x109080, 0x0},
+ {0x209080, 0x0},
+ {0x010080, 0x0},
+ {0x110080, 0x0},
+ {0x210080, 0x0},
+ {0x010180, 0x0},
+ {0x110180, 0x0},
+ {0x210180, 0x0},
+ {0x010081, 0x0},
+ {0x110081, 0x0},
+ {0x210081, 0x0},
+ {0x010181, 0x0},
+ {0x110181, 0x0},
+ {0x210181, 0x0},
+ {0x010082, 0x0},
+ {0x110082, 0x0},
+ {0x210082, 0x0},
+ {0x010182, 0x0},
+ {0x110182, 0x0},
+ {0x210182, 0x0},
+ {0x010083, 0x0},
+ {0x110083, 0x0},
+ {0x210083, 0x0},
+ {0x010183, 0x0},
+ {0x110183, 0x0},
+ {0x210183, 0x0},
+ {0x011080, 0x0},
+ {0x111080, 0x0},
+ {0x211080, 0x0},
+ {0x011180, 0x0},
+ {0x111180, 0x0},
+ {0x211180, 0x0},
+ {0x011081, 0x0},
+ {0x111081, 0x0},
+ {0x211081, 0x0},
+ {0x011181, 0x0},
+ {0x111181, 0x0},
+ {0x211181, 0x0},
+ {0x011082, 0x0},
+ {0x111082, 0x0},
+ {0x211082, 0x0},
+ {0x011182, 0x0},
+ {0x111182, 0x0},
+ {0x211182, 0x0},
+ {0x011083, 0x0},
+ {0x111083, 0x0},
+ {0x211083, 0x0},
+ {0x011183, 0x0},
+ {0x111183, 0x0},
+ {0x211183, 0x0},
+ {0x0100d0, 0x0},
+ {0x1100d0, 0x0},
+ {0x2100d0, 0x0},
+ {0x0101d0, 0x0},
+ {0x1101d0, 0x0},
+ {0x2101d0, 0x0},
+ {0x0100d1, 0x0},
+ {0x1100d1, 0x0},
+ {0x2100d1, 0x0},
+ {0x0101d1, 0x0},
+ {0x1101d1, 0x0},
+ {0x2101d1, 0x0},
+ {0x0100d2, 0x0},
+ {0x1100d2, 0x0},
+ {0x2100d2, 0x0},
+ {0x0101d2, 0x0},
+ {0x1101d2, 0x0},
+ {0x2101d2, 0x0},
+ {0x0100d3, 0x0},
+ {0x1100d3, 0x0},
+ {0x2100d3, 0x0},
+ {0x0101d3, 0x0},
+ {0x1101d3, 0x0},
+ {0x2101d3, 0x0},
+ {0x0110d0, 0x0},
+ {0x1110d0, 0x0},
+ {0x2110d0, 0x0},
+ {0x0111d0, 0x0},
+ {0x1111d0, 0x0},
+ {0x2111d0, 0x0},
+ {0x0110d1, 0x0},
+ {0x1110d1, 0x0},
+ {0x2110d1, 0x0},
+ {0x0111d1, 0x0},
+ {0x1111d1, 0x0},
+ {0x2111d1, 0x0},
+ {0x0110d2, 0x0},
+ {0x1110d2, 0x0},
+ {0x2110d2, 0x0},
+ {0x0111d2, 0x0},
+ {0x1111d2, 0x0},
+ {0x2111d2, 0x0},
+ {0x0110d3, 0x0},
+ {0x1110d3, 0x0},
+ {0x2110d3, 0x0},
+ {0x0111d3, 0x0},
+ {0x1111d3, 0x0},
+ {0x2111d3, 0x0},
+ {0x010068, 0x0},
+ {0x010168, 0x0},
+ {0x010268, 0x0},
+ {0x010368, 0x0},
+ {0x010468, 0x0},
+ {0x010568, 0x0},
+ {0x010668, 0x0},
+ {0x010768, 0x0},
+ {0x010868, 0x0},
+ {0x010069, 0x0},
+ {0x010169, 0x0},
+ {0x010269, 0x0},
+ {0x010369, 0x0},
+ {0x010469, 0x0},
+ {0x010569, 0x0},
+ {0x010669, 0x0},
+ {0x010769, 0x0},
+ {0x010869, 0x0},
+ {0x01006a, 0x0},
+ {0x01016a, 0x0},
+ {0x01026a, 0x0},
+ {0x01036a, 0x0},
+ {0x01046a, 0x0},
+ {0x01056a, 0x0},
+ {0x01066a, 0x0},
+ {0x01076a, 0x0},
+ {0x01086a, 0x0},
+ {0x01006b, 0x0},
+ {0x01016b, 0x0},
+ {0x01026b, 0x0},
+ {0x01036b, 0x0},
+ {0x01046b, 0x0},
+ {0x01056b, 0x0},
+ {0x01066b, 0x0},
+ {0x01076b, 0x0},
+ {0x01086b, 0x0},
+ {0x011068, 0x0},
+ {0x011168, 0x0},
+ {0x011268, 0x0},
+ {0x011368, 0x0},
+ {0x011468, 0x0},
+ {0x011568, 0x0},
+ {0x011668, 0x0},
+ {0x011768, 0x0},
+ {0x011868, 0x0},
+ {0x011069, 0x0},
+ {0x011169, 0x0},
+ {0x011269, 0x0},
+ {0x011369, 0x0},
+ {0x011469, 0x0},
+ {0x011569, 0x0},
+ {0x011669, 0x0},
+ {0x011769, 0x0},
+ {0x011869, 0x0},
+ {0x01106a, 0x0},
+ {0x01116a, 0x0},
+ {0x01126a, 0x0},
+ {0x01136a, 0x0},
+ {0x01146a, 0x0},
+ {0x01156a, 0x0},
+ {0x01166a, 0x0},
+ {0x01176a, 0x0},
+ {0x01186a, 0x0},
+ {0x01106b, 0x0},
+ {0x01116b, 0x0},
+ {0x01126b, 0x0},
+ {0x01136b, 0x0},
+ {0x01146b, 0x0},
+ {0x01156b, 0x0},
+ {0x01166b, 0x0},
+ {0x01176b, 0x0},
+ {0x01186b, 0x0},
+ {0x01008c, 0x0},
+ {0x11008c, 0x0},
+ {0x21008c, 0x0},
+ {0x01018c, 0x0},
+ {0x11018c, 0x0},
+ {0x21018c, 0x0},
+ {0x01008d, 0x0},
+ {0x11008d, 0x0},
+ {0x21008d, 0x0},
+ {0x01018d, 0x0},
+ {0x11018d, 0x0},
+ {0x21018d, 0x0},
+ {0x01008e, 0x0},
+ {0x11008e, 0x0},
+ {0x21008e, 0x0},
+ {0x01018e, 0x0},
+ {0x11018e, 0x0},
+ {0x21018e, 0x0},
+ {0x01008f, 0x0},
+ {0x11008f, 0x0},
+ {0x21008f, 0x0},
+ {0x01018f, 0x0},
+ {0x11018f, 0x0},
+ {0x21018f, 0x0},
+ {0x01108c, 0x0},
+ {0x11108c, 0x0},
+ {0x21108c, 0x0},
+ {0x01118c, 0x0},
+ {0x11118c, 0x0},
+ {0x21118c, 0x0},
+ {0x01108d, 0x0},
+ {0x11108d, 0x0},
+ {0x21108d, 0x0},
+ {0x01118d, 0x0},
+ {0x11118d, 0x0},
+ {0x21118d, 0x0},
+ {0x01108e, 0x0},
+ {0x11108e, 0x0},
+ {0x21108e, 0x0},
+ {0x01118e, 0x0},
+ {0x11118e, 0x0},
+ {0x21118e, 0x0},
+ {0x01108f, 0x0},
+ {0x11108f, 0x0},
+ {0x21108f, 0x0},
+ {0x01118f, 0x0},
+ {0x11118f, 0x0},
+ {0x21118f, 0x0},
+ {0x0100c0, 0x0},
+ {0x1100c0, 0x0},
+ {0x2100c0, 0x0},
+ {0x0101c0, 0x0},
+ {0x1101c0, 0x0},
+ {0x2101c0, 0x0},
+ {0x0102c0, 0x0},
+ {0x1102c0, 0x0},
+ {0x2102c0, 0x0},
+ {0x0103c0, 0x0},
+ {0x1103c0, 0x0},
+ {0x2103c0, 0x0},
+ {0x0104c0, 0x0},
+ {0x1104c0, 0x0},
+ {0x2104c0, 0x0},
+ {0x0105c0, 0x0},
+ {0x1105c0, 0x0},
+ {0x2105c0, 0x0},
+ {0x0106c0, 0x0},
+ {0x1106c0, 0x0},
+ {0x2106c0, 0x0},
+ {0x0107c0, 0x0},
+ {0x1107c0, 0x0},
+ {0x2107c0, 0x0},
+ {0x0108c0, 0x0},
+ {0x1108c0, 0x0},
+ {0x2108c0, 0x0},
+ {0x0100c1, 0x0},
+ {0x1100c1, 0x0},
+ {0x2100c1, 0x0},
+ {0x0101c1, 0x0},
+ {0x1101c1, 0x0},
+ {0x2101c1, 0x0},
+ {0x0102c1, 0x0},
+ {0x1102c1, 0x0},
+ {0x2102c1, 0x0},
+ {0x0103c1, 0x0},
+ {0x1103c1, 0x0},
+ {0x2103c1, 0x0},
+ {0x0104c1, 0x0},
+ {0x1104c1, 0x0},
+ {0x2104c1, 0x0},
+ {0x0105c1, 0x0},
+ {0x1105c1, 0x0},
+ {0x2105c1, 0x0},
+ {0x0106c1, 0x0},
+ {0x1106c1, 0x0},
+ {0x2106c1, 0x0},
+ {0x0107c1, 0x0},
+ {0x1107c1, 0x0},
+ {0x2107c1, 0x0},
+ {0x0108c1, 0x0},
+ {0x1108c1, 0x0},
+ {0x2108c1, 0x0},
+ {0x0100c2, 0x0},
+ {0x1100c2, 0x0},
+ {0x2100c2, 0x0},
+ {0x0101c2, 0x0},
+ {0x1101c2, 0x0},
+ {0x2101c2, 0x0},
+ {0x0102c2, 0x0},
+ {0x1102c2, 0x0},
+ {0x2102c2, 0x0},
+ {0x0103c2, 0x0},
+ {0x1103c2, 0x0},
+ {0x2103c2, 0x0},
+ {0x0104c2, 0x0},
+ {0x1104c2, 0x0},
+ {0x2104c2, 0x0},
+ {0x0105c2, 0x0},
+ {0x1105c2, 0x0},
+ {0x2105c2, 0x0},
+ {0x0106c2, 0x0},
+ {0x1106c2, 0x0},
+ {0x2106c2, 0x0},
+ {0x0107c2, 0x0},
+ {0x1107c2, 0x0},
+ {0x2107c2, 0x0},
+ {0x0108c2, 0x0},
+ {0x1108c2, 0x0},
+ {0x2108c2, 0x0},
+ {0x0100c3, 0x0},
+ {0x1100c3, 0x0},
+ {0x2100c3, 0x0},
+ {0x0101c3, 0x0},
+ {0x1101c3, 0x0},
+ {0x2101c3, 0x0},
+ {0x0102c3, 0x0},
+ {0x1102c3, 0x0},
+ {0x2102c3, 0x0},
+ {0x0103c3, 0x0},
+ {0x1103c3, 0x0},
+ {0x2103c3, 0x0},
+ {0x0104c3, 0x0},
+ {0x1104c3, 0x0},
+ {0x2104c3, 0x0},
+ {0x0105c3, 0x0},
+ {0x1105c3, 0x0},
+ {0x2105c3, 0x0},
+ {0x0106c3, 0x0},
+ {0x1106c3, 0x0},
+ {0x2106c3, 0x0},
+ {0x0107c3, 0x0},
+ {0x1107c3, 0x0},
+ {0x2107c3, 0x0},
+ {0x0108c3, 0x0},
+ {0x1108c3, 0x0},
+ {0x2108c3, 0x0},
+ {0x0110c0, 0x0},
+ {0x1110c0, 0x0},
+ {0x2110c0, 0x0},
+ {0x0111c0, 0x0},
+ {0x1111c0, 0x0},
+ {0x2111c0, 0x0},
+ {0x0112c0, 0x0},
+ {0x1112c0, 0x0},
+ {0x2112c0, 0x0},
+ {0x0113c0, 0x0},
+ {0x1113c0, 0x0},
+ {0x2113c0, 0x0},
+ {0x0114c0, 0x0},
+ {0x1114c0, 0x0},
+ {0x2114c0, 0x0},
+ {0x0115c0, 0x0},
+ {0x1115c0, 0x0},
+ {0x2115c0, 0x0},
+ {0x0116c0, 0x0},
+ {0x1116c0, 0x0},
+ {0x2116c0, 0x0},
+ {0x0117c0, 0x0},
+ {0x1117c0, 0x0},
+ {0x2117c0, 0x0},
+ {0x0118c0, 0x0},
+ {0x1118c0, 0x0},
+ {0x2118c0, 0x0},
+ {0x0110c1, 0x0},
+ {0x1110c1, 0x0},
+ {0x2110c1, 0x0},
+ {0x0111c1, 0x0},
+ {0x1111c1, 0x0},
+ {0x2111c1, 0x0},
+ {0x0112c1, 0x0},
+ {0x1112c1, 0x0},
+ {0x2112c1, 0x0},
+ {0x0113c1, 0x0},
+ {0x1113c1, 0x0},
+ {0x2113c1, 0x0},
+ {0x0114c1, 0x0},
+ {0x1114c1, 0x0},
+ {0x2114c1, 0x0},
+ {0x0115c1, 0x0},
+ {0x1115c1, 0x0},
+ {0x2115c1, 0x0},
+ {0x0116c1, 0x0},
+ {0x1116c1, 0x0},
+ {0x2116c1, 0x0},
+ {0x0117c1, 0x0},
+ {0x1117c1, 0x0},
+ {0x2117c1, 0x0},
+ {0x0118c1, 0x0},
+ {0x1118c1, 0x0},
+ {0x2118c1, 0x0},
+ {0x0110c2, 0x0},
+ {0x1110c2, 0x0},
+ {0x2110c2, 0x0},
+ {0x0111c2, 0x0},
+ {0x1111c2, 0x0},
+ {0x2111c2, 0x0},
+ {0x0112c2, 0x0},
+ {0x1112c2, 0x0},
+ {0x2112c2, 0x0},
+ {0x0113c2, 0x0},
+ {0x1113c2, 0x0},
+ {0x2113c2, 0x0},
+ {0x0114c2, 0x0},
+ {0x1114c2, 0x0},
+ {0x2114c2, 0x0},
+ {0x0115c2, 0x0},
+ {0x1115c2, 0x0},
+ {0x2115c2, 0x0},
+ {0x0116c2, 0x0},
+ {0x1116c2, 0x0},
+ {0x2116c2, 0x0},
+ {0x0117c2, 0x0},
+ {0x1117c2, 0x0},
+ {0x2117c2, 0x0},
+ {0x0118c2, 0x0},
+ {0x1118c2, 0x0},
+ {0x2118c2, 0x0},
+ {0x0110c3, 0x0},
+ {0x1110c3, 0x0},
+ {0x2110c3, 0x0},
+ {0x0111c3, 0x0},
+ {0x1111c3, 0x0},
+ {0x2111c3, 0x0},
+ {0x0112c3, 0x0},
+ {0x1112c3, 0x0},
+ {0x2112c3, 0x0},
+ {0x0113c3, 0x0},
+ {0x1113c3, 0x0},
+ {0x2113c3, 0x0},
+ {0x0114c3, 0x0},
+ {0x1114c3, 0x0},
+ {0x2114c3, 0x0},
+ {0x0115c3, 0x0},
+ {0x1115c3, 0x0},
+ {0x2115c3, 0x0},
+ {0x0116c3, 0x0},
+ {0x1116c3, 0x0},
+ {0x2116c3, 0x0},
+ {0x0117c3, 0x0},
+ {0x1117c3, 0x0},
+ {0x2117c3, 0x0},
+ {0x0118c3, 0x0},
+ {0x1118c3, 0x0},
+ {0x2118c3, 0x0},
+ {0x010020, 0x0},
+ {0x110020, 0x0},
+ {0x210020, 0x0},
+ {0x011020, 0x0},
+ {0x111020, 0x0},
+ {0x211020, 0x0},
+ {0x02007d, 0x0},
+ {0x12007d, 0x0},
+ {0x22007d, 0x0},
+ {0x010040, 0x0},
+ {0x010140, 0x0},
+ {0x010240, 0x0},
+ {0x010340, 0x0},
+ {0x010440, 0x0},
+ {0x010540, 0x0},
+ {0x010640, 0x0},
+ {0x010740, 0x0},
+ {0x010840, 0x0},
+ {0x010030, 0x0},
+ {0x010130, 0x0},
+ {0x010230, 0x0},
+ {0x010330, 0x0},
+ {0x010430, 0x0},
+ {0x010530, 0x0},
+ {0x010630, 0x0},
+ {0x010730, 0x0},
+ {0x010830, 0x0},
+ {0x011040, 0x0},
+ {0x011140, 0x0},
+ {0x011240, 0x0},
+ {0x011340, 0x0},
+ {0x011440, 0x0},
+ {0x011540, 0x0},
+ {0x011640, 0x0},
+ {0x011740, 0x0},
+ {0x011840, 0x0},
+ {0x011030, 0x0},
+ {0x011130, 0x0},
+ {0x011230, 0x0},
+ {0x011330, 0x0},
+ {0x011430, 0x0},
+ {0x011530, 0x0},
+ {0x011630, 0x0},
+ {0x011730, 0x0},
+ {0x011830, 0x0},
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x960 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x31f },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x54012, 0x1 },
+ { 0x5402f, 0x834 },
+ { 0x54030, 0x105 },
+ { 0x54031, 0x18 },
+ { 0x54032, 0x200 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x810 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x1 },
+ { 0x54003, 0x42a },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x21f },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x54012, 0x1 },
+ { 0x54030, 0x105 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x10 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x960 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x61 },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x5400e, 0x1f7f },
+ { 0x54012, 0x1 },
+ { 0x5402f, 0x834 },
+ { 0x54030, 0x105 },
+ { 0x54031, 0x18 },
+ { 0x54032, 0x200 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x810 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x2 },
+ { 0x90033, 0x10 },
+ { 0x90034, 0x139 },
+ { 0x90035, 0xb },
+ { 0x90036, 0x7c0 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0x44 },
+ { 0x90039, 0x633 },
+ { 0x9003a, 0x159 },
+ { 0x9003b, 0x14f },
+ { 0x9003c, 0x630 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x47 },
+ { 0x9003f, 0x633 },
+ { 0x90040, 0x149 },
+ { 0x90041, 0x4f },
+ { 0x90042, 0x633 },
+ { 0x90043, 0x179 },
+ { 0x90044, 0x8 },
+ { 0x90045, 0xe0 },
+ { 0x90046, 0x109 },
+ { 0x90047, 0x0 },
+ { 0x90048, 0x7c8 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x1 },
+ { 0x9004c, 0x8 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x45a },
+ { 0x9004f, 0x9 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x448 },
+ { 0x90052, 0x109 },
+ { 0x90053, 0x40 },
+ { 0x90054, 0x633 },
+ { 0x90055, 0x179 },
+ { 0x90056, 0x1 },
+ { 0x90057, 0x618 },
+ { 0x90058, 0x109 },
+ { 0x90059, 0x40c0 },
+ { 0x9005a, 0x633 },
+ { 0x9005b, 0x149 },
+ { 0x9005c, 0x8 },
+ { 0x9005d, 0x4 },
+ { 0x9005e, 0x48 },
+ { 0x9005f, 0x4040 },
+ { 0x90060, 0x633 },
+ { 0x90061, 0x149 },
+ { 0x90062, 0x0 },
+ { 0x90063, 0x4 },
+ { 0x90064, 0x48 },
+ { 0x90065, 0x40 },
+ { 0x90066, 0x633 },
+ { 0x90067, 0x149 },
+ { 0x90068, 0x10 },
+ { 0x90069, 0x4 },
+ { 0x9006a, 0x18 },
+ { 0x9006b, 0x0 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x78 },
+ { 0x9006e, 0x549 },
+ { 0x9006f, 0x633 },
+ { 0x90070, 0x159 },
+ { 0x90071, 0xd49 },
+ { 0x90072, 0x633 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0x94a },
+ { 0x90075, 0x633 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x441 },
+ { 0x90078, 0x633 },
+ { 0x90079, 0x149 },
+ { 0x9007a, 0x42 },
+ { 0x9007b, 0x633 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x1 },
+ { 0x9007e, 0x633 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x0 },
+ { 0x90081, 0xe0 },
+ { 0x90082, 0x109 },
+ { 0x90083, 0xa },
+ { 0x90084, 0x10 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0x9 },
+ { 0x90087, 0x3c0 },
+ { 0x90088, 0x149 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x159 },
+ { 0x9008c, 0x18 },
+ { 0x9008d, 0x10 },
+ { 0x9008e, 0x109 },
+ { 0x9008f, 0x0 },
+ { 0x90090, 0x3c0 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x18 },
+ { 0x90093, 0x4 },
+ { 0x90094, 0x48 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x58 },
+ { 0x90098, 0xb },
+ { 0x90099, 0x10 },
+ { 0x9009a, 0x109 },
+ { 0x9009b, 0x1 },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x5 },
+ { 0x9009f, 0x7c0 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x0 },
+ { 0x900a2, 0x8140 },
+ { 0x900a3, 0x10c },
+ { 0x900a4, 0x10 },
+ { 0x900a5, 0x8138 },
+ { 0x900a6, 0x10c },
+ { 0x900a7, 0x8 },
+ { 0x900a8, 0x7c8 },
+ { 0x900a9, 0x101 },
+ { 0x900aa, 0x8 },
+ { 0x900ab, 0x448 },
+ { 0x900ac, 0x109 },
+ { 0x900ad, 0xf },
+ { 0x900ae, 0x7c0 },
+ { 0x900af, 0x109 },
+ { 0x900b0, 0x47 },
+ { 0x900b1, 0x630 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x8 },
+ { 0x900b4, 0x618 },
+ { 0x900b5, 0x109 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0xe0 },
+ { 0x900b8, 0x109 },
+ { 0x900b9, 0x0 },
+ { 0x900ba, 0x7c8 },
+ { 0x900bb, 0x109 },
+ { 0x900bc, 0x8 },
+ { 0x900bd, 0x8140 },
+ { 0x900be, 0x10c },
+ { 0x900bf, 0x0 },
+ { 0x900c0, 0x1 },
+ { 0x900c1, 0x8 },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x8 },
+ { 0x900c5, 0x8 },
+ { 0x900c6, 0x7c8 },
+ { 0x900c7, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x90026, 0x2b },
+ { 0x2000b, 0x4b },
+ { 0x2000c, 0x96 },
+ { 0x2000d, 0x5dc },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0x21 },
+ { 0x12000c, 0x42 },
+ { 0x12000d, 0x29a },
+ { 0x12000e, 0x21 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0xffff },
+ { 0x90013, 0x6152 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x0 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 2400mts 1D */
+ .drate = 2400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 1066mts 1D */
+ .drate = 1066,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P0 2400mts 2D */
+ .drate = 2400,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 2400, 1066, },
+};
diff --git a/board/freescale/imx8mn_evk/ddr4_timing_ld.c b/board/freescale/imx8mn_evk/ddr4_timing_ld.c
new file mode 100644
index 00000000000..a3577efd0b2
--- /dev/null
+++ b/board/freescale/imx8mn_evk/ddr4_timing_ld.c
@@ -0,0 +1,1056 @@
+/*
+ * Copyright 2019 NXP
+ *
+ * SPDX-License-Identifier: GPL-2.0+
+ *
+ * Generated code from MX8M_DDR_tool
+ * Align with uboot version:
+ * imx_v2018.03_4.14.78_1.0.0_ga ~ imx_v2018.04_4.19.35_1.1.0_ga
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ { 0x3d400000, 0x81040010 },
+ { 0x3d400030, 0x20 },
+ { 0x3d400034, 0x221306 },
+ { 0x3d400050, 0x210070 },
+ { 0x3d400054, 0x10008 },
+ { 0x3d400060, 0x0 },
+ { 0x3d400064, 0x6100dc },
+ { 0x3d4000c0, 0x0 },
+ { 0x3d4000c4, 0x1000 },
+ { 0x3d4000d0, 0xc00200c5 },
+ { 0x3d4000d4, 0x500000 },
+ { 0x3d4000dc, 0x2340105 },
+ { 0x3d4000e0, 0x0 },
+ { 0x3d4000e4, 0x110000 },
+ { 0x3d4000e8, 0x2000600 },
+ { 0x3d4000ec, 0x410 },
+ { 0x3d4000f0, 0x20 },
+ { 0x3d4000f4, 0xec7 },
+ { 0x3d400100, 0xd0c1b0d },
+ { 0x3d400104, 0x30313 },
+ { 0x3d400108, 0x508060a },
+ { 0x3d40010c, 0x400c },
+ { 0x3d400110, 0x6030306 },
+ { 0x3d400114, 0x4040302 },
+ { 0x3d40011c, 0x404 },
+ { 0x3d400120, 0x5050d08 },
+ { 0x3d400124, 0x20308 },
+ { 0x3d40012c, 0x1406010e },
+ { 0x3d400130, 0x8 },
+ { 0x3d40013c, 0x0 },
+ { 0x3d400180, 0x1000040 },
+ { 0x3d400184, 0x30d4 },
+ { 0x3d400190, 0x38b8204 },
+ { 0x3d400194, 0x2020303 },
+ { 0x3d400198, 0x7f04011 },
+ { 0x3d40019c, 0xb0 },
+ { 0x3d4001a0, 0xe0400018 },
+ { 0x3d4001a4, 0x48005a },
+ { 0x3d4001a8, 0x80000000 },
+ { 0x3d4001b0, 0x1 },
+ { 0x3d4001b4, 0xb04 },
+ { 0x3d4001b8, 0x4 },
+ { 0x3d4001c0, 0x1 },
+ { 0x3d4001c4, 0x0 },
+ { 0x3d400200, 0x3f1f },
+ { 0x3d400204, 0x3f0909 },
+ { 0x3d400208, 0x700 },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x7070707 },
+ { 0x3d40021c, 0xf07 },
+ { 0x3d400220, 0x3f01 },
+ { 0x3d400240, 0x600061c },
+ { 0x3d400244, 0x1323 },
+ { 0x3d400400, 0x100 },
+ { 0x3d400250, 0x317d1a07 },
+ { 0x3d400254, 0xf },
+ { 0x3d40025c, 0x2a001b76 },
+ { 0x3d400264, 0x7300b473 },
+ { 0x3d40026c, 0x30000e06 },
+ { 0x3d400300, 0x14 },
+ { 0x3d40036c, 0x10 },
+ { 0x3d400404, 0x13193 },
+ { 0x3d400408, 0x6096 },
+ { 0x3d400490, 0x1 },
+ { 0x3d400494, 0x2000c00 },
+ { 0x3d400498, 0x3c00db },
+ { 0x3d40049c, 0x100009 },
+ { 0x3d4004a0, 0x2 },
+ { 0x3d402050, 0x210070 },
+ { 0x3d402064, 0x400093 },
+ { 0x3d4020dc, 0x40105 },
+ { 0x3d4020e0, 0x0 },
+ { 0x3d4020e8, 0x2000600 },
+ { 0x3d4020ec, 0x10 },
+ { 0x3d402100, 0xb081209 },
+ { 0x3d402104, 0x2020d },
+ { 0x3d402108, 0x5050309 },
+ { 0x3d40210c, 0x400c },
+ { 0x3d402110, 0x5030206 },
+ { 0x3d402114, 0x3030202 },
+ { 0x3d40211c, 0x303 },
+ { 0x3d402120, 0x4040d06 },
+ { 0x3d402124, 0x20208 },
+ { 0x3d40212c, 0x1205010e },
+ { 0x3d402130, 0x8 },
+ { 0x3d40213c, 0x0 },
+ { 0x3d402180, 0x1000040 },
+ { 0x3d402190, 0x3858204 },
+ { 0x3d402194, 0x2020303 },
+ { 0x3d4021b4, 0x504 },
+ { 0x3d4021b8, 0x4 },
+ { 0x3d402240, 0x6000604 },
+ { 0x3d4020f4, 0xec7 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x1005f, 0x2fd },
+ { 0x1015f, 0x2fd },
+ { 0x1105f, 0x2fd },
+ { 0x1115f, 0x2fd },
+ { 0x11005f, 0x2fd },
+ { 0x11015f, 0x2fd },
+ { 0x11105f, 0x2fd },
+ { 0x11115f, 0x2fd },
+ { 0x55, 0x355 },
+ { 0x1055, 0x355 },
+ { 0x2055, 0x355 },
+ { 0x3055, 0x355 },
+ { 0x4055, 0x55 },
+ { 0x5055, 0x55 },
+ { 0x6055, 0x355 },
+ { 0x7055, 0x355 },
+ { 0x8055, 0x355 },
+ { 0x9055, 0x355 },
+ { 0x200c5, 0xb },
+ { 0x1200c5, 0x6 },
+ { 0x2002e, 0x1 },
+ { 0x12002e, 0x1 },
+ { 0x20024, 0x8 },
+ { 0x2003a, 0x2 },
+ { 0x120024, 0x8 },
+ { 0x2003a, 0x2 },
+ { 0x20056, 0xa },
+ { 0x120056, 0xa },
+ { 0x1004d, 0x1a },
+ { 0x1014d, 0x1a },
+ { 0x1104d, 0x1a },
+ { 0x1114d, 0x1a },
+ { 0x11004d, 0x1a },
+ { 0x11014d, 0x1a },
+ { 0x11104d, 0x1a },
+ { 0x11114d, 0x1a },
+ { 0x10049, 0xe38 },
+ { 0x10149, 0xe38 },
+ { 0x11049, 0xe38 },
+ { 0x11149, 0xe38 },
+ { 0x110049, 0xe38 },
+ { 0x110149, 0xe38 },
+ { 0x111049, 0xe38 },
+ { 0x111149, 0xe38 },
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+ { 0x20018, 0x1 },
+ { 0x20075, 0x2 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x190 },
+ { 0x120008, 0x10a },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x268 },
+ { 0x10043, 0x5b1 },
+ { 0x10143, 0x5b1 },
+ { 0x11043, 0x5b1 },
+ { 0x11143, 0x5b1 },
+ { 0x1200b2, 0x268 },
+ { 0x110043, 0x5b1 },
+ { 0x110143, 0x5b1 },
+ { 0x111043, 0x5b1 },
+ { 0x111143, 0x5b1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x20019, 0x5 },
+ { 0x120019, 0x5 },
+ { 0x200f0, 0x5555 },
+ { 0x200f1, 0x5555 },
+ { 0x200f2, 0x5555 },
+ { 0x200f3, 0x5555 },
+ { 0x200f4, 0x5555 },
+ { 0x200f5, 0x5555 },
+ { 0x200f6, 0x5555 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x2005b, 0x7529 },
+ { 0x2005c, 0x0 },
+ { 0x200c7, 0x21 },
+ { 0x200ca, 0x24 },
+ { 0x200cc, 0x1f7 },
+ { 0x1200c7, 0x21 },
+ { 0x1200ca, 0x24 },
+ { 0x1200cc, 0x1f7 },
+ { 0x2007d, 0x212 },
+ { 0x12007d, 0x212 },
+ { 0x2007c, 0x61 },
+ { 0x12007c, 0x61 },
+ { 0x1004a, 0x500 },
+ { 0x1104a, 0x500 },
+ { 0x2002c, 0x0 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ {0x0200b2, 0x0},
+ {0x1200b2, 0x0},
+ {0x2200b2, 0x0},
+ {0x0200cb, 0x0},
+ {0x010043, 0x0},
+ {0x110043, 0x0},
+ {0x210043, 0x0},
+ {0x010143, 0x0},
+ {0x110143, 0x0},
+ {0x210143, 0x0},
+ {0x011043, 0x0},
+ {0x111043, 0x0},
+ {0x211043, 0x0},
+ {0x011143, 0x0},
+ {0x111143, 0x0},
+ {0x211143, 0x0},
+ {0x000080, 0x0},
+ {0x100080, 0x0},
+ {0x200080, 0x0},
+ {0x001080, 0x0},
+ {0x101080, 0x0},
+ {0x201080, 0x0},
+ {0x002080, 0x0},
+ {0x102080, 0x0},
+ {0x202080, 0x0},
+ {0x003080, 0x0},
+ {0x103080, 0x0},
+ {0x203080, 0x0},
+ {0x004080, 0x0},
+ {0x104080, 0x0},
+ {0x204080, 0x0},
+ {0x005080, 0x0},
+ {0x105080, 0x0},
+ {0x205080, 0x0},
+ {0x006080, 0x0},
+ {0x106080, 0x0},
+ {0x206080, 0x0},
+ {0x007080, 0x0},
+ {0x107080, 0x0},
+ {0x207080, 0x0},
+ {0x008080, 0x0},
+ {0x108080, 0x0},
+ {0x208080, 0x0},
+ {0x009080, 0x0},
+ {0x109080, 0x0},
+ {0x209080, 0x0},
+ {0x010080, 0x0},
+ {0x110080, 0x0},
+ {0x210080, 0x0},
+ {0x010180, 0x0},
+ {0x110180, 0x0},
+ {0x210180, 0x0},
+ {0x010081, 0x0},
+ {0x110081, 0x0},
+ {0x210081, 0x0},
+ {0x010181, 0x0},
+ {0x110181, 0x0},
+ {0x210181, 0x0},
+ {0x010082, 0x0},
+ {0x110082, 0x0},
+ {0x210082, 0x0},
+ {0x010182, 0x0},
+ {0x110182, 0x0},
+ {0x210182, 0x0},
+ {0x010083, 0x0},
+ {0x110083, 0x0},
+ {0x210083, 0x0},
+ {0x010183, 0x0},
+ {0x110183, 0x0},
+ {0x210183, 0x0},
+ {0x011080, 0x0},
+ {0x111080, 0x0},
+ {0x211080, 0x0},
+ {0x011180, 0x0},
+ {0x111180, 0x0},
+ {0x211180, 0x0},
+ {0x011081, 0x0},
+ {0x111081, 0x0},
+ {0x211081, 0x0},
+ {0x011181, 0x0},
+ {0x111181, 0x0},
+ {0x211181, 0x0},
+ {0x011082, 0x0},
+ {0x111082, 0x0},
+ {0x211082, 0x0},
+ {0x011182, 0x0},
+ {0x111182, 0x0},
+ {0x211182, 0x0},
+ {0x011083, 0x0},
+ {0x111083, 0x0},
+ {0x211083, 0x0},
+ {0x011183, 0x0},
+ {0x111183, 0x0},
+ {0x211183, 0x0},
+ {0x0100d0, 0x0},
+ {0x1100d0, 0x0},
+ {0x2100d0, 0x0},
+ {0x0101d0, 0x0},
+ {0x1101d0, 0x0},
+ {0x2101d0, 0x0},
+ {0x0100d1, 0x0},
+ {0x1100d1, 0x0},
+ {0x2100d1, 0x0},
+ {0x0101d1, 0x0},
+ {0x1101d1, 0x0},
+ {0x2101d1, 0x0},
+ {0x0100d2, 0x0},
+ {0x1100d2, 0x0},
+ {0x2100d2, 0x0},
+ {0x0101d2, 0x0},
+ {0x1101d2, 0x0},
+ {0x2101d2, 0x0},
+ {0x0100d3, 0x0},
+ {0x1100d3, 0x0},
+ {0x2100d3, 0x0},
+ {0x0101d3, 0x0},
+ {0x1101d3, 0x0},
+ {0x2101d3, 0x0},
+ {0x0110d0, 0x0},
+ {0x1110d0, 0x0},
+ {0x2110d0, 0x0},
+ {0x0111d0, 0x0},
+ {0x1111d0, 0x0},
+ {0x2111d0, 0x0},
+ {0x0110d1, 0x0},
+ {0x1110d1, 0x0},
+ {0x2110d1, 0x0},
+ {0x0111d1, 0x0},
+ {0x1111d1, 0x0},
+ {0x2111d1, 0x0},
+ {0x0110d2, 0x0},
+ {0x1110d2, 0x0},
+ {0x2110d2, 0x0},
+ {0x0111d2, 0x0},
+ {0x1111d2, 0x0},
+ {0x2111d2, 0x0},
+ {0x0110d3, 0x0},
+ {0x1110d3, 0x0},
+ {0x2110d3, 0x0},
+ {0x0111d3, 0x0},
+ {0x1111d3, 0x0},
+ {0x2111d3, 0x0},
+ {0x010068, 0x0},
+ {0x010168, 0x0},
+ {0x010268, 0x0},
+ {0x010368, 0x0},
+ {0x010468, 0x0},
+ {0x010568, 0x0},
+ {0x010668, 0x0},
+ {0x010768, 0x0},
+ {0x010868, 0x0},
+ {0x010069, 0x0},
+ {0x010169, 0x0},
+ {0x010269, 0x0},
+ {0x010369, 0x0},
+ {0x010469, 0x0},
+ {0x010569, 0x0},
+ {0x010669, 0x0},
+ {0x010769, 0x0},
+ {0x010869, 0x0},
+ {0x01006a, 0x0},
+ {0x01016a, 0x0},
+ {0x01026a, 0x0},
+ {0x01036a, 0x0},
+ {0x01046a, 0x0},
+ {0x01056a, 0x0},
+ {0x01066a, 0x0},
+ {0x01076a, 0x0},
+ {0x01086a, 0x0},
+ {0x01006b, 0x0},
+ {0x01016b, 0x0},
+ {0x01026b, 0x0},
+ {0x01036b, 0x0},
+ {0x01046b, 0x0},
+ {0x01056b, 0x0},
+ {0x01066b, 0x0},
+ {0x01076b, 0x0},
+ {0x01086b, 0x0},
+ {0x011068, 0x0},
+ {0x011168, 0x0},
+ {0x011268, 0x0},
+ {0x011368, 0x0},
+ {0x011468, 0x0},
+ {0x011568, 0x0},
+ {0x011668, 0x0},
+ {0x011768, 0x0},
+ {0x011868, 0x0},
+ {0x011069, 0x0},
+ {0x011169, 0x0},
+ {0x011269, 0x0},
+ {0x011369, 0x0},
+ {0x011469, 0x0},
+ {0x011569, 0x0},
+ {0x011669, 0x0},
+ {0x011769, 0x0},
+ {0x011869, 0x0},
+ {0x01106a, 0x0},
+ {0x01116a, 0x0},
+ {0x01126a, 0x0},
+ {0x01136a, 0x0},
+ {0x01146a, 0x0},
+ {0x01156a, 0x0},
+ {0x01166a, 0x0},
+ {0x01176a, 0x0},
+ {0x01186a, 0x0},
+ {0x01106b, 0x0},
+ {0x01116b, 0x0},
+ {0x01126b, 0x0},
+ {0x01136b, 0x0},
+ {0x01146b, 0x0},
+ {0x01156b, 0x0},
+ {0x01166b, 0x0},
+ {0x01176b, 0x0},
+ {0x01186b, 0x0},
+ {0x01008c, 0x0},
+ {0x11008c, 0x0},
+ {0x21008c, 0x0},
+ {0x01018c, 0x0},
+ {0x11018c, 0x0},
+ {0x21018c, 0x0},
+ {0x01008d, 0x0},
+ {0x11008d, 0x0},
+ {0x21008d, 0x0},
+ {0x01018d, 0x0},
+ {0x11018d, 0x0},
+ {0x21018d, 0x0},
+ {0x01008e, 0x0},
+ {0x11008e, 0x0},
+ {0x21008e, 0x0},
+ {0x01018e, 0x0},
+ {0x11018e, 0x0},
+ {0x21018e, 0x0},
+ {0x01008f, 0x0},
+ {0x11008f, 0x0},
+ {0x21008f, 0x0},
+ {0x01018f, 0x0},
+ {0x11018f, 0x0},
+ {0x21018f, 0x0},
+ {0x01108c, 0x0},
+ {0x11108c, 0x0},
+ {0x21108c, 0x0},
+ {0x01118c, 0x0},
+ {0x11118c, 0x0},
+ {0x21118c, 0x0},
+ {0x01108d, 0x0},
+ {0x11108d, 0x0},
+ {0x21108d, 0x0},
+ {0x01118d, 0x0},
+ {0x11118d, 0x0},
+ {0x21118d, 0x0},
+ {0x01108e, 0x0},
+ {0x11108e, 0x0},
+ {0x21108e, 0x0},
+ {0x01118e, 0x0},
+ {0x11118e, 0x0},
+ {0x21118e, 0x0},
+ {0x01108f, 0x0},
+ {0x11108f, 0x0},
+ {0x21108f, 0x0},
+ {0x01118f, 0x0},
+ {0x11118f, 0x0},
+ {0x21118f, 0x0},
+ {0x0100c0, 0x0},
+ {0x1100c0, 0x0},
+ {0x2100c0, 0x0},
+ {0x0101c0, 0x0},
+ {0x1101c0, 0x0},
+ {0x2101c0, 0x0},
+ {0x0102c0, 0x0},
+ {0x1102c0, 0x0},
+ {0x2102c0, 0x0},
+ {0x0103c0, 0x0},
+ {0x1103c0, 0x0},
+ {0x2103c0, 0x0},
+ {0x0104c0, 0x0},
+ {0x1104c0, 0x0},
+ {0x2104c0, 0x0},
+ {0x0105c0, 0x0},
+ {0x1105c0, 0x0},
+ {0x2105c0, 0x0},
+ {0x0106c0, 0x0},
+ {0x1106c0, 0x0},
+ {0x2106c0, 0x0},
+ {0x0107c0, 0x0},
+ {0x1107c0, 0x0},
+ {0x2107c0, 0x0},
+ {0x0108c0, 0x0},
+ {0x1108c0, 0x0},
+ {0x2108c0, 0x0},
+ {0x0100c1, 0x0},
+ {0x1100c1, 0x0},
+ {0x2100c1, 0x0},
+ {0x0101c1, 0x0},
+ {0x1101c1, 0x0},
+ {0x2101c1, 0x0},
+ {0x0102c1, 0x0},
+ {0x1102c1, 0x0},
+ {0x2102c1, 0x0},
+ {0x0103c1, 0x0},
+ {0x1103c1, 0x0},
+ {0x2103c1, 0x0},
+ {0x0104c1, 0x0},
+ {0x1104c1, 0x0},
+ {0x2104c1, 0x0},
+ {0x0105c1, 0x0},
+ {0x1105c1, 0x0},
+ {0x2105c1, 0x0},
+ {0x0106c1, 0x0},
+ {0x1106c1, 0x0},
+ {0x2106c1, 0x0},
+ {0x0107c1, 0x0},
+ {0x1107c1, 0x0},
+ {0x2107c1, 0x0},
+ {0x0108c1, 0x0},
+ {0x1108c1, 0x0},
+ {0x2108c1, 0x0},
+ {0x0100c2, 0x0},
+ {0x1100c2, 0x0},
+ {0x2100c2, 0x0},
+ {0x0101c2, 0x0},
+ {0x1101c2, 0x0},
+ {0x2101c2, 0x0},
+ {0x0102c2, 0x0},
+ {0x1102c2, 0x0},
+ {0x2102c2, 0x0},
+ {0x0103c2, 0x0},
+ {0x1103c2, 0x0},
+ {0x2103c2, 0x0},
+ {0x0104c2, 0x0},
+ {0x1104c2, 0x0},
+ {0x2104c2, 0x0},
+ {0x0105c2, 0x0},
+ {0x1105c2, 0x0},
+ {0x2105c2, 0x0},
+ {0x0106c2, 0x0},
+ {0x1106c2, 0x0},
+ {0x2106c2, 0x0},
+ {0x0107c2, 0x0},
+ {0x1107c2, 0x0},
+ {0x2107c2, 0x0},
+ {0x0108c2, 0x0},
+ {0x1108c2, 0x0},
+ {0x2108c2, 0x0},
+ {0x0100c3, 0x0},
+ {0x1100c3, 0x0},
+ {0x2100c3, 0x0},
+ {0x0101c3, 0x0},
+ {0x1101c3, 0x0},
+ {0x2101c3, 0x0},
+ {0x0102c3, 0x0},
+ {0x1102c3, 0x0},
+ {0x2102c3, 0x0},
+ {0x0103c3, 0x0},
+ {0x1103c3, 0x0},
+ {0x2103c3, 0x0},
+ {0x0104c3, 0x0},
+ {0x1104c3, 0x0},
+ {0x2104c3, 0x0},
+ {0x0105c3, 0x0},
+ {0x1105c3, 0x0},
+ {0x2105c3, 0x0},
+ {0x0106c3, 0x0},
+ {0x1106c3, 0x0},
+ {0x2106c3, 0x0},
+ {0x0107c3, 0x0},
+ {0x1107c3, 0x0},
+ {0x2107c3, 0x0},
+ {0x0108c3, 0x0},
+ {0x1108c3, 0x0},
+ {0x2108c3, 0x0},
+ {0x0110c0, 0x0},
+ {0x1110c0, 0x0},
+ {0x2110c0, 0x0},
+ {0x0111c0, 0x0},
+ {0x1111c0, 0x0},
+ {0x2111c0, 0x0},
+ {0x0112c0, 0x0},
+ {0x1112c0, 0x0},
+ {0x2112c0, 0x0},
+ {0x0113c0, 0x0},
+ {0x1113c0, 0x0},
+ {0x2113c0, 0x0},
+ {0x0114c0, 0x0},
+ {0x1114c0, 0x0},
+ {0x2114c0, 0x0},
+ {0x0115c0, 0x0},
+ {0x1115c0, 0x0},
+ {0x2115c0, 0x0},
+ {0x0116c0, 0x0},
+ {0x1116c0, 0x0},
+ {0x2116c0, 0x0},
+ {0x0117c0, 0x0},
+ {0x1117c0, 0x0},
+ {0x2117c0, 0x0},
+ {0x0118c0, 0x0},
+ {0x1118c0, 0x0},
+ {0x2118c0, 0x0},
+ {0x0110c1, 0x0},
+ {0x1110c1, 0x0},
+ {0x2110c1, 0x0},
+ {0x0111c1, 0x0},
+ {0x1111c1, 0x0},
+ {0x2111c1, 0x0},
+ {0x0112c1, 0x0},
+ {0x1112c1, 0x0},
+ {0x2112c1, 0x0},
+ {0x0113c1, 0x0},
+ {0x1113c1, 0x0},
+ {0x2113c1, 0x0},
+ {0x0114c1, 0x0},
+ {0x1114c1, 0x0},
+ {0x2114c1, 0x0},
+ {0x0115c1, 0x0},
+ {0x1115c1, 0x0},
+ {0x2115c1, 0x0},
+ {0x0116c1, 0x0},
+ {0x1116c1, 0x0},
+ {0x2116c1, 0x0},
+ {0x0117c1, 0x0},
+ {0x1117c1, 0x0},
+ {0x2117c1, 0x0},
+ {0x0118c1, 0x0},
+ {0x1118c1, 0x0},
+ {0x2118c1, 0x0},
+ {0x0110c2, 0x0},
+ {0x1110c2, 0x0},
+ {0x2110c2, 0x0},
+ {0x0111c2, 0x0},
+ {0x1111c2, 0x0},
+ {0x2111c2, 0x0},
+ {0x0112c2, 0x0},
+ {0x1112c2, 0x0},
+ {0x2112c2, 0x0},
+ {0x0113c2, 0x0},
+ {0x1113c2, 0x0},
+ {0x2113c2, 0x0},
+ {0x0114c2, 0x0},
+ {0x1114c2, 0x0},
+ {0x2114c2, 0x0},
+ {0x0115c2, 0x0},
+ {0x1115c2, 0x0},
+ {0x2115c2, 0x0},
+ {0x0116c2, 0x0},
+ {0x1116c2, 0x0},
+ {0x2116c2, 0x0},
+ {0x0117c2, 0x0},
+ {0x1117c2, 0x0},
+ {0x2117c2, 0x0},
+ {0x0118c2, 0x0},
+ {0x1118c2, 0x0},
+ {0x2118c2, 0x0},
+ {0x0110c3, 0x0},
+ {0x1110c3, 0x0},
+ {0x2110c3, 0x0},
+ {0x0111c3, 0x0},
+ {0x1111c3, 0x0},
+ {0x2111c3, 0x0},
+ {0x0112c3, 0x0},
+ {0x1112c3, 0x0},
+ {0x2112c3, 0x0},
+ {0x0113c3, 0x0},
+ {0x1113c3, 0x0},
+ {0x2113c3, 0x0},
+ {0x0114c3, 0x0},
+ {0x1114c3, 0x0},
+ {0x2114c3, 0x0},
+ {0x0115c3, 0x0},
+ {0x1115c3, 0x0},
+ {0x2115c3, 0x0},
+ {0x0116c3, 0x0},
+ {0x1116c3, 0x0},
+ {0x2116c3, 0x0},
+ {0x0117c3, 0x0},
+ {0x1117c3, 0x0},
+ {0x2117c3, 0x0},
+ {0x0118c3, 0x0},
+ {0x1118c3, 0x0},
+ {0x2118c3, 0x0},
+ {0x010020, 0x0},
+ {0x110020, 0x0},
+ {0x210020, 0x0},
+ {0x011020, 0x0},
+ {0x111020, 0x0},
+ {0x211020, 0x0},
+ {0x02007d, 0x0},
+ {0x12007d, 0x0},
+ {0x22007d, 0x0},
+ {0x010040, 0x0},
+ {0x010140, 0x0},
+ {0x010240, 0x0},
+ {0x010340, 0x0},
+ {0x010440, 0x0},
+ {0x010540, 0x0},
+ {0x010640, 0x0},
+ {0x010740, 0x0},
+ {0x010840, 0x0},
+ {0x010030, 0x0},
+ {0x010130, 0x0},
+ {0x010230, 0x0},
+ {0x010330, 0x0},
+ {0x010430, 0x0},
+ {0x010530, 0x0},
+ {0x010630, 0x0},
+ {0x010730, 0x0},
+ {0x010830, 0x0},
+ {0x011040, 0x0},
+ {0x011140, 0x0},
+ {0x011240, 0x0},
+ {0x011340, 0x0},
+ {0x011440, 0x0},
+ {0x011540, 0x0},
+ {0x011640, 0x0},
+ {0x011740, 0x0},
+ {0x011840, 0x0},
+ {0x011030, 0x0},
+ {0x011130, 0x0},
+ {0x011230, 0x0},
+ {0x011330, 0x0},
+ {0x011430, 0x0},
+ {0x011530, 0x0},
+ {0x011630, 0x0},
+ {0x011730, 0x0},
+ {0x011830, 0x0},
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x640 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x31f },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x54012, 0x1 },
+ { 0x5402f, 0x234 },
+ { 0x54030, 0x105 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x410 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x1 },
+ { 0x54003, 0x42a },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x21f },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x54012, 0x1 },
+ { 0x5402f, 0x4 },
+ { 0x54030, 0x105 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x10 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x640 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2830 },
+ { 0x54006, 0x25e },
+ { 0x54007, 0x1000 },
+ { 0x54008, 0x101 },
+ { 0x5400b, 0x61 },
+ { 0x5400c, 0xc8 },
+ { 0x5400d, 0x100 },
+ { 0x5400e, 0x1f7f },
+ { 0x54012, 0x1 },
+ { 0x5402f, 0x234 },
+ { 0x54030, 0x105 },
+ { 0x54033, 0x200 },
+ { 0x54034, 0x600 },
+ { 0x54035, 0x410 },
+ { 0x54036, 0x101 },
+ { 0x5403f, 0x1221 },
+ { 0x541fc, 0x100 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x2 },
+ { 0x90033, 0x10 },
+ { 0x90034, 0x139 },
+ { 0x90035, 0xb },
+ { 0x90036, 0x7c0 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0x44 },
+ { 0x90039, 0x633 },
+ { 0x9003a, 0x159 },
+ { 0x9003b, 0x14f },
+ { 0x9003c, 0x630 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x47 },
+ { 0x9003f, 0x633 },
+ { 0x90040, 0x149 },
+ { 0x90041, 0x4f },
+ { 0x90042, 0x633 },
+ { 0x90043, 0x179 },
+ { 0x90044, 0x8 },
+ { 0x90045, 0xe0 },
+ { 0x90046, 0x109 },
+ { 0x90047, 0x0 },
+ { 0x90048, 0x7c8 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x1 },
+ { 0x9004c, 0x8 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x45a },
+ { 0x9004f, 0x9 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x448 },
+ { 0x90052, 0x109 },
+ { 0x90053, 0x40 },
+ { 0x90054, 0x633 },
+ { 0x90055, 0x179 },
+ { 0x90056, 0x1 },
+ { 0x90057, 0x618 },
+ { 0x90058, 0x109 },
+ { 0x90059, 0x40c0 },
+ { 0x9005a, 0x633 },
+ { 0x9005b, 0x149 },
+ { 0x9005c, 0x8 },
+ { 0x9005d, 0x4 },
+ { 0x9005e, 0x48 },
+ { 0x9005f, 0x4040 },
+ { 0x90060, 0x633 },
+ { 0x90061, 0x149 },
+ { 0x90062, 0x0 },
+ { 0x90063, 0x4 },
+ { 0x90064, 0x48 },
+ { 0x90065, 0x40 },
+ { 0x90066, 0x633 },
+ { 0x90067, 0x149 },
+ { 0x90068, 0x10 },
+ { 0x90069, 0x4 },
+ { 0x9006a, 0x18 },
+ { 0x9006b, 0x0 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x78 },
+ { 0x9006e, 0x549 },
+ { 0x9006f, 0x633 },
+ { 0x90070, 0x159 },
+ { 0x90071, 0xd49 },
+ { 0x90072, 0x633 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0x94a },
+ { 0x90075, 0x633 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x441 },
+ { 0x90078, 0x633 },
+ { 0x90079, 0x149 },
+ { 0x9007a, 0x42 },
+ { 0x9007b, 0x633 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x1 },
+ { 0x9007e, 0x633 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x0 },
+ { 0x90081, 0xe0 },
+ { 0x90082, 0x109 },
+ { 0x90083, 0xa },
+ { 0x90084, 0x10 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0x9 },
+ { 0x90087, 0x3c0 },
+ { 0x90088, 0x149 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x159 },
+ { 0x9008c, 0x18 },
+ { 0x9008d, 0x10 },
+ { 0x9008e, 0x109 },
+ { 0x9008f, 0x0 },
+ { 0x90090, 0x3c0 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x18 },
+ { 0x90093, 0x4 },
+ { 0x90094, 0x48 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x58 },
+ { 0x90098, 0xb },
+ { 0x90099, 0x10 },
+ { 0x9009a, 0x109 },
+ { 0x9009b, 0x1 },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x5 },
+ { 0x9009f, 0x7c0 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x0 },
+ { 0x900a2, 0x8140 },
+ { 0x900a3, 0x10c },
+ { 0x900a4, 0x10 },
+ { 0x900a5, 0x8138 },
+ { 0x900a6, 0x10c },
+ { 0x900a7, 0x8 },
+ { 0x900a8, 0x7c8 },
+ { 0x900a9, 0x101 },
+ { 0x900aa, 0x8 },
+ { 0x900ab, 0x448 },
+ { 0x900ac, 0x109 },
+ { 0x900ad, 0xf },
+ { 0x900ae, 0x7c0 },
+ { 0x900af, 0x109 },
+ { 0x900b0, 0x47 },
+ { 0x900b1, 0x630 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x8 },
+ { 0x900b4, 0x618 },
+ { 0x900b5, 0x109 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0xe0 },
+ { 0x900b8, 0x109 },
+ { 0x900b9, 0x0 },
+ { 0x900ba, 0x7c8 },
+ { 0x900bb, 0x109 },
+ { 0x900bc, 0x8 },
+ { 0x900bd, 0x8140 },
+ { 0x900be, 0x10c },
+ { 0x900bf, 0x0 },
+ { 0x900c0, 0x1 },
+ { 0x900c1, 0x8 },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x8 },
+ { 0x900c5, 0x8 },
+ { 0x900c6, 0x7c8 },
+ { 0x900c7, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x90026, 0x2b },
+ { 0x2000b, 0x32 },
+ { 0x2000c, 0x64 },
+ { 0x2000d, 0x3e8 },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0x21 },
+ { 0x12000c, 0x42 },
+ { 0x12000d, 0x29a },
+ { 0x12000e, 0x21 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0xffff },
+ { 0x90013, 0x6152 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x0 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 1600mts 1D */
+ .drate = 1600,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 1066mts 1D */
+ .drate = 1066,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P0 1600mts 2D */
+ .drate = 1600,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 1600, 1066, },
+};
diff --git a/board/freescale/imx8mn_evk/imx8mn_evk.c b/board/freescale/imx8mn_evk/imx8mn_evk.c
new file mode 100644
index 00000000000..6b6fb0a7dd2
--- /dev/null
+++ b/board/freescale/imx8mn_evk/imx8mn_evk.c
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+
+#include <env.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/io.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+static void setup_fec(void)
+{
+ struct iomuxc_gpr_base_regs *gpr =
+ (struct iomuxc_gpr_base_regs *)IOMUXC_GPR_BASE_ADDR;
+
+ /* Use 125M anatop REF_CLK1 for ENET1, not from external */
+ clrsetbits_le32(&gpr->gpr[1], 0x2000, 0);
+}
+
+int board_init(void)
+{
+ setup_fec();
+
+ return 0;
+}
+
+int board_late_init(void)
+{
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "DDR4 EVK");
+ env_set("board_rev", "iMX8MN");
+#endif
+ return 0;
+}
diff --git a/board/freescale/imx8mn_evk/imximage-8mn-ddr4.cfg b/board/freescale/imx8mn_evk/imximage-8mn-ddr4.cfg
new file mode 100644
index 00000000000..0edda9c5e06
--- /dev/null
+++ b/board/freescale/imx8mn_evk/imximage-8mn-ddr4.cfg
@@ -0,0 +1,9 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2021 NXP
+ */
+
+
+ROM_VERSION v2
+BOOT_FROM sd
+LOADER u-boot-spl-ddr.bin 0x912000
diff --git a/board/freescale/imx8mn_evk/lpddr4_timing.c b/board/freescale/imx8mn_evk/lpddr4_timing.c
new file mode 100644
index 00000000000..671e924132a
--- /dev/null
+++ b/board/freescale/imx8mn_evk/lpddr4_timing.c
@@ -0,0 +1,1587 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ *
+ * Generated code from MX8M_DDR_tool
+ * Align with uboot-imx_v2018.03_4.14.78_1.0.0_ga
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ {0x3d400020, 0x00000213},
+ {0x3d400024, 0x0003e800},
+ {0x3d400030, 0x00000120},
+ {0x3d400000, 0xa3080020},
+ {0x3d400064, 0x006100e0},
+ {0x3d4000d0, 0xc003061c},
+ {0x3d4000d4, 0x009e0000},
+ {0x3d4000dc, 0x00d4002d},
+ {0x3d4000e0, 0x00310000},
+ {0x3d4000e8, 0x0066004d},
+ {0x3d4000ec, 0x0016004a},
+ {0x3d400100, 0x1a201b22},
+ {0x3d400104, 0x00060633},
+ {0x3d40010c, 0x00c0c000},
+ {0x3d400110, 0x0f04080f},
+ {0x3d400114, 0x02040c0c},
+ {0x3d400118, 0x01010007},
+ {0x3d40011c, 0x00000401},
+ {0x3d400130, 0x00020600},
+ {0x3d400134, 0x0c100002},
+ {0x3d400138, 0x000000e6},
+ {0x3d400144, 0x00a00050},
+ {0x3d400180, 0x03200018},
+ {0x3d400184, 0x028061a8},
+ {0x3d400188, 0x00000000},
+ {0x3d400190, 0x0497820a},
+ {0x3d4001b4, 0x0000170a},
+ {0x3d400108, 0x070e1617},
+ {0x3d4001c0, 0x00000001},
+ {0x3d400194, 0x00080303},
+ {0x3d4001a0, 0xe0400018},
+ {0x3d4001a4, 0x00df00e4},
+ {0x3d4001a8, 0x80000000},
+ {0x3d4001b0, 0x00000011},
+ {0x3d4001c4, 0x00000001},
+ {0x3d4000f4, 0x00000c99},
+ {0x3d400200, 0x00000017},
+ {0x3d400204, 0x00080808},
+ {0x3d400208, 0x00000000},
+ {0x3d40020c, 0x00000000},
+ {0x3d400210, 0x00001f1f},
+ {0x3d400214, 0x07070707},
+ {0x3d400218, 0x07070707},
+ {0x3d40021c, 0x00000f0f},
+ {0x3d400250, 0x29001701},
+ {0x3d400254, 0x0000002c},
+ {0x3d40025c, 0x04000030},
+ {0x3d400264, 0x900093e7},
+ {0x3d40026c, 0x20005574},
+ {0x3d400400, 0x00000111},
+ {0x3d400408, 0x000072ff},
+ {0x3d400494, 0x02100e07},
+ {0x3d400498, 0x00620096},
+ {0x3d40049c, 0x01100e07},
+ {0x3d4004a0, 0x00c8012c},
+ {0x3d402020, 0x00000011},
+ {0x3d402024, 0x00007d00},
+ {0x3d402050, 0x0020d040},
+ {0x3d402064, 0x000c001d},
+ {0x3d4020f4, 0x00000c99},
+ {0x3d402100, 0x0a040305},
+ {0x3d402104, 0x00030407},
+ {0x3d402108, 0x0203060b},
+ {0x3d40210c, 0x00505000},
+ {0x3d402110, 0x02040202},
+ {0x3d402114, 0x02030202},
+ {0x3d402118, 0x01010004},
+ {0x3d40211c, 0x00000301},
+ {0x3d402130, 0x00020300},
+ {0x3d402134, 0x0a100002},
+ {0x3d402138, 0x0000001d},
+ {0x3d402144, 0x0014000a},
+ {0x3d402180, 0x00650004},
+ {0x3d402190, 0x03818200},
+ {0x3d402194, 0x00080303},
+ {0x3d4021b4, 0x00000100},
+ {0x3d4020dc, 0x00840000},
+ {0x3d4020e0, 0x00310000},
+ {0x3d4020e8, 0x0066004d},
+ {0x3d4020ec, 0x0016004a},
+ {0x3d403020, 0x00000011},
+ {0x3d403024, 0x00001f40},
+ {0x3d403050, 0x0020d040},
+ {0x3d403064, 0x00030007},
+ {0x3d4030f4, 0x00000c99},
+ {0x3d403100, 0x0a010102},
+ {0x3d403104, 0x00030404},
+ {0x3d403108, 0x0203060b},
+ {0x3d40310c, 0x00505000},
+ {0x3d403110, 0x02040202},
+ {0x3d403114, 0x02030202},
+ {0x3d403118, 0x01010004},
+ {0x3d40311c, 0x00000301},
+ {0x3d403130, 0x00020300},
+ {0x3d403134, 0x0a100002},
+ {0x3d403138, 0x00000008},
+ {0x3d403144, 0x00050003},
+ {0x3d403180, 0x00190004},
+ {0x3d403190, 0x03818200},
+ {0x3d403194, 0x00080303},
+ {0x3d4031b4, 0x00000100},
+ {0x3d4030dc, 0x00840000},
+ {0x3d4030e0, 0x00310000},
+ {0x3d4030e8, 0x0066004d},
+ {0x3d4030ec, 0x0016004a},
+
+ /* default boot point */
+ { 0x3d400028, 0x0 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ {0x000d0000, 0x00000000},
+ {0x000100a0, 0x00000000},
+ {0x000100a1, 0x00000001},
+ {0x000100a2, 0x00000002},
+ {0x000100a3, 0x00000003},
+ {0x000100a4, 0x00000004},
+ {0x000100a5, 0x00000005},
+ {0x000100a6, 0x00000006},
+ {0x000100a7, 0x00000007},
+ {0x000110a0, 0x00000000},
+ {0x000110a1, 0x00000001},
+ {0x000110a2, 0x00000003},
+ {0x000110a3, 0x00000004},
+ {0x000110a4, 0x00000005},
+ {0x000110a5, 0x00000002},
+ {0x000110a6, 0x00000007},
+ {0x000110a7, 0x00000006},
+ {0x0001005f, 0x0000015f},
+ {0x0001015f, 0x0000015f},
+ {0x0001105f, 0x0000015f},
+ {0x0001115f, 0x0000015f},
+ {0x0011005f, 0x0000015f},
+ {0x0011015f, 0x0000015f},
+ {0x0011105f, 0x0000015f},
+ {0x0011115f, 0x0000015f},
+ {0x0021005f, 0x0000015f},
+ {0x0021015f, 0x0000015f},
+ {0x0021105f, 0x0000015f},
+ {0x0021115f, 0x0000015f},
+ {0x00000055, 0x0000016f},
+ {0x00001055, 0x0000016f},
+ {0x00002055, 0x0000016f},
+ {0x00003055, 0x0000016f},
+ {0x00004055, 0x0000016f},
+ {0x00005055, 0x0000016f},
+ {0x00006055, 0x0000016f},
+ {0x00007055, 0x0000016f},
+ {0x00008055, 0x0000016f},
+ {0x00009055, 0x0000016f},
+ {0x000200c5, 0x00000019},
+ {0x001200c5, 0x00000007},
+ {0x002200c5, 0x00000007},
+ {0x0002002e, 0x00000002},
+ {0x0012002e, 0x00000002},
+ {0x0022002e, 0x00000002},
+ {0x00090204, 0x00000000},
+ {0x00190204, 0x00000000},
+ {0x00290204, 0x00000000},
+ {0x00020024, 0x000001a3},
+ {0x0002003a, 0x00000002},
+ {0x0002007d, 0x00000212},
+ {0x0002007c, 0x00000061},
+ {0x00120024, 0x000001a3},
+ {0x0002003a, 0x00000002},
+ {0x0012007d, 0x00000212},
+ {0x0012007c, 0x00000061},
+ {0x00220024, 0x000001a3},
+ {0x0002003a, 0x00000002},
+ {0x0022007d, 0x00000212},
+ {0x0022007c, 0x00000061},
+ {0x00020056, 0x00000003},
+ {0x00120056, 0x00000003},
+ {0x00220056, 0x00000003},
+ {0x0001004d, 0x00000f80},
+ {0x0001014d, 0x00000f80},
+ {0x0001104d, 0x00000f80},
+ {0x0001114d, 0x00000f80},
+ {0x0011004d, 0x00000f80},
+ {0x0011014d, 0x00000f80},
+ {0x0011104d, 0x00000f80},
+ {0x0011114d, 0x00000f80},
+ {0x0021004d, 0x00000f80},
+ {0x0021014d, 0x00000f80},
+ {0x0021104d, 0x00000f80},
+ {0x0021114d, 0x00000f80},
+ {0x00010049, 0x00000fbe},
+ {0x00010149, 0x00000fbe},
+ {0x00011049, 0x00000fbe},
+ {0x00011149, 0x00000fbe},
+ {0x00110049, 0x00000fbe},
+ {0x00110149, 0x00000fbe},
+ {0x00111049, 0x00000fbe},
+ {0x00111149, 0x00000fbe},
+ {0x00210049, 0x00000fbe},
+ {0x00210149, 0x00000fbe},
+ {0x00211049, 0x00000fbe},
+ {0x00211149, 0x00000fbe},
+ {0x00000043, 0x00000063},
+ {0x00001043, 0x00000063},
+ {0x00002043, 0x00000063},
+ {0x00003043, 0x00000063},
+ {0x00004043, 0x00000063},
+ {0x00005043, 0x00000063},
+ {0x00006043, 0x00000063},
+ {0x00007043, 0x00000063},
+ {0x00008043, 0x00000063},
+ {0x00009043, 0x00000063},
+ {0x00020018, 0x00000001},
+ {0x00020075, 0x00000004},
+ {0x00020050, 0x00000000},
+ {0x00020008, 0x00000320},
+ {0x00120008, 0x00000064},
+ {0x00220008, 0x00000019},
+ {0x00020088, 0x00000009},
+ {0x000200b2, 0x000000dc},
+ {0x00010043, 0x000005a1},
+ {0x00010143, 0x000005a1},
+ {0x00011043, 0x000005a1},
+ {0x00011143, 0x000005a1},
+ {0x001200b2, 0x000000dc},
+ {0x00110043, 0x000005a1},
+ {0x00110143, 0x000005a1},
+ {0x00111043, 0x000005a1},
+ {0x00111143, 0x000005a1},
+ {0x002200b2, 0x000000dc},
+ {0x00210043, 0x000005a1},
+ {0x00210143, 0x000005a1},
+ {0x00211043, 0x000005a1},
+ {0x00211143, 0x000005a1},
+ {0x000200fa, 0x00000001},
+ {0x001200fa, 0x00000001},
+ {0x002200fa, 0x00000001},
+ {0x00020019, 0x00000001},
+ {0x00120019, 0x00000001},
+ {0x00220019, 0x00000001},
+ {0x000200f0, 0x00000660},
+ {0x000200f1, 0x00000000},
+ {0x000200f2, 0x00004444},
+ {0x000200f3, 0x00008888},
+ {0x000200f4, 0x00005665},
+ {0x000200f5, 0x00000000},
+ {0x000200f6, 0x00000000},
+ {0x000200f7, 0x0000f000},
+ {0x0001004a, 0x00000500},
+ {0x0001104a, 0x00000500},
+ {0x00020025, 0x00000000},
+ {0x0002002d, 0x00000000},
+ {0x0012002d, 0x00000000},
+ {0x0022002d, 0x00000000},
+ {0x0002002c, 0x00000000},
+ {0x000200c7, 0x00000021},
+ {0x000200ca, 0x00000024},
+ {0x000200cc, 0x000001f7},
+ {0x001200c7, 0x00000021},
+ {0x001200ca, 0x00000024},
+ {0x001200cc, 0x000001f7},
+ {0x002200c7, 0x00000021},
+ {0x002200ca, 0x00000024},
+ {0x002200cc, 0x000001f7},
+ {0x00020060, 0x00000002},
+ {0x000d0000, 0x00000001},
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ {0x0200b2, 0x0},
+ {0x1200b2, 0x0},
+ {0x2200b2, 0x0},
+ {0x0200cb, 0x0},
+ {0x010043, 0x0},
+ {0x110043, 0x0},
+ {0x210043, 0x0},
+ {0x010143, 0x0},
+ {0x110143, 0x0},
+ {0x210143, 0x0},
+ {0x011043, 0x0},
+ {0x111043, 0x0},
+ {0x211043, 0x0},
+ {0x011143, 0x0},
+ {0x111143, 0x0},
+ {0x211143, 0x0},
+ {0x000080, 0x0},
+ {0x100080, 0x0},
+ {0x200080, 0x0},
+ {0x001080, 0x0},
+ {0x101080, 0x0},
+ {0x201080, 0x0},
+ {0x002080, 0x0},
+ {0x102080, 0x0},
+ {0x202080, 0x0},
+ {0x003080, 0x0},
+ {0x103080, 0x0},
+ {0x203080, 0x0},
+ {0x004080, 0x0},
+ {0x104080, 0x0},
+ {0x204080, 0x0},
+ {0x005080, 0x0},
+ {0x105080, 0x0},
+ {0x205080, 0x0},
+ {0x006080, 0x0},
+ {0x106080, 0x0},
+ {0x206080, 0x0},
+ {0x007080, 0x0},
+ {0x107080, 0x0},
+ {0x207080, 0x0},
+ {0x008080, 0x0},
+ {0x108080, 0x0},
+ {0x208080, 0x0},
+ {0x009080, 0x0},
+ {0x109080, 0x0},
+ {0x209080, 0x0},
+ {0x010080, 0x0},
+ {0x110080, 0x0},
+ {0x210080, 0x0},
+ {0x010180, 0x0},
+ {0x110180, 0x0},
+ {0x210180, 0x0},
+ {0x011080, 0x0},
+ {0x111080, 0x0},
+ {0x211080, 0x0},
+ {0x011180, 0x0},
+ {0x111180, 0x0},
+ {0x211180, 0x0},
+ {0x010081, 0x0},
+ {0x110081, 0x0},
+ {0x210081, 0x0},
+ {0x010181, 0x0},
+ {0x110181, 0x0},
+ {0x210181, 0x0},
+ {0x011081, 0x0},
+ {0x111081, 0x0},
+ {0x211081, 0x0},
+ {0x011181, 0x0},
+ {0x111181, 0x0},
+ {0x211181, 0x0},
+ {0x0100d0, 0x0},
+ {0x1100d0, 0x0},
+ {0x2100d0, 0x0},
+ {0x0101d0, 0x0},
+ {0x1101d0, 0x0},
+ {0x2101d0, 0x0},
+ {0x0110d0, 0x0},
+ {0x1110d0, 0x0},
+ {0x2110d0, 0x0},
+ {0x0111d0, 0x0},
+ {0x1111d0, 0x0},
+ {0x2111d0, 0x0},
+ {0x0100d1, 0x0},
+ {0x1100d1, 0x0},
+ {0x2100d1, 0x0},
+ {0x0101d1, 0x0},
+ {0x1101d1, 0x0},
+ {0x2101d1, 0x0},
+ {0x0110d1, 0x0},
+ {0x1110d1, 0x0},
+ {0x2110d1, 0x0},
+ {0x0111d1, 0x0},
+ {0x1111d1, 0x0},
+ {0x2111d1, 0x0},
+ {0x010068, 0x0},
+ {0x010168, 0x0},
+ {0x010268, 0x0},
+ {0x010368, 0x0},
+ {0x010468, 0x0},
+ {0x010568, 0x0},
+ {0x010668, 0x0},
+ {0x010768, 0x0},
+ {0x010868, 0x0},
+ {0x011068, 0x0},
+ {0x011168, 0x0},
+ {0x011268, 0x0},
+ {0x011368, 0x0},
+ {0x011468, 0x0},
+ {0x011568, 0x0},
+ {0x011668, 0x0},
+ {0x011768, 0x0},
+ {0x011868, 0x0},
+ {0x010069, 0x0},
+ {0x010169, 0x0},
+ {0x010269, 0x0},
+ {0x010369, 0x0},
+ {0x010469, 0x0},
+ {0x010569, 0x0},
+ {0x010669, 0x0},
+ {0x010769, 0x0},
+ {0x010869, 0x0},
+ {0x011069, 0x0},
+ {0x011169, 0x0},
+ {0x011269, 0x0},
+ {0x011369, 0x0},
+ {0x011469, 0x0},
+ {0x011569, 0x0},
+ {0x011669, 0x0},
+ {0x011769, 0x0},
+ {0x011869, 0x0},
+ {0x01008c, 0x0},
+ {0x11008c, 0x0},
+ {0x21008c, 0x0},
+ {0x01018c, 0x0},
+ {0x11018c, 0x0},
+ {0x21018c, 0x0},
+ {0x01108c, 0x0},
+ {0x11108c, 0x0},
+ {0x21108c, 0x0},
+ {0x01118c, 0x0},
+ {0x11118c, 0x0},
+ {0x21118c, 0x0},
+ {0x01008d, 0x0},
+ {0x11008d, 0x0},
+ {0x21008d, 0x0},
+ {0x01018d, 0x0},
+ {0x11018d, 0x0},
+ {0x21018d, 0x0},
+ {0x01108d, 0x0},
+ {0x11108d, 0x0},
+ {0x21108d, 0x0},
+ {0x01118d, 0x0},
+ {0x11118d, 0x0},
+ {0x21118d, 0x0},
+ {0x0100c0, 0x0},
+ {0x1100c0, 0x0},
+ {0x2100c0, 0x0},
+ {0x0101c0, 0x0},
+ {0x1101c0, 0x0},
+ {0x2101c0, 0x0},
+ {0x0102c0, 0x0},
+ {0x1102c0, 0x0},
+ {0x2102c0, 0x0},
+ {0x0103c0, 0x0},
+ {0x1103c0, 0x0},
+ {0x2103c0, 0x0},
+ {0x0104c0, 0x0},
+ {0x1104c0, 0x0},
+ {0x2104c0, 0x0},
+ {0x0105c0, 0x0},
+ {0x1105c0, 0x0},
+ {0x2105c0, 0x0},
+ {0x0106c0, 0x0},
+ {0x1106c0, 0x0},
+ {0x2106c0, 0x0},
+ {0x0107c0, 0x0},
+ {0x1107c0, 0x0},
+ {0x2107c0, 0x0},
+ {0x0108c0, 0x0},
+ {0x1108c0, 0x0},
+ {0x2108c0, 0x0},
+ {0x0110c0, 0x0},
+ {0x1110c0, 0x0},
+ {0x2110c0, 0x0},
+ {0x0111c0, 0x0},
+ {0x1111c0, 0x0},
+ {0x2111c0, 0x0},
+ {0x0112c0, 0x0},
+ {0x1112c0, 0x0},
+ {0x2112c0, 0x0},
+ {0x0113c0, 0x0},
+ {0x1113c0, 0x0},
+ {0x2113c0, 0x0},
+ {0x0114c0, 0x0},
+ {0x1114c0, 0x0},
+ {0x2114c0, 0x0},
+ {0x0115c0, 0x0},
+ {0x1115c0, 0x0},
+ {0x2115c0, 0x0},
+ {0x0116c0, 0x0},
+ {0x1116c0, 0x0},
+ {0x2116c0, 0x0},
+ {0x0117c0, 0x0},
+ {0x1117c0, 0x0},
+ {0x2117c0, 0x0},
+ {0x0118c0, 0x0},
+ {0x1118c0, 0x0},
+ {0x2118c0, 0x0},
+ {0x0100c1, 0x0},
+ {0x1100c1, 0x0},
+ {0x2100c1, 0x0},
+ {0x0101c1, 0x0},
+ {0x1101c1, 0x0},
+ {0x2101c1, 0x0},
+ {0x0102c1, 0x0},
+ {0x1102c1, 0x0},
+ {0x2102c1, 0x0},
+ {0x0103c1, 0x0},
+ {0x1103c1, 0x0},
+ {0x2103c1, 0x0},
+ {0x0104c1, 0x0},
+ {0x1104c1, 0x0},
+ {0x2104c1, 0x0},
+ {0x0105c1, 0x0},
+ {0x1105c1, 0x0},
+ {0x2105c1, 0x0},
+ {0x0106c1, 0x0},
+ {0x1106c1, 0x0},
+ {0x2106c1, 0x0},
+ {0x0107c1, 0x0},
+ {0x1107c1, 0x0},
+ {0x2107c1, 0x0},
+ {0x0108c1, 0x0},
+ {0x1108c1, 0x0},
+ {0x2108c1, 0x0},
+ {0x0110c1, 0x0},
+ {0x1110c1, 0x0},
+ {0x2110c1, 0x0},
+ {0x0111c1, 0x0},
+ {0x1111c1, 0x0},
+ {0x2111c1, 0x0},
+ {0x0112c1, 0x0},
+ {0x1112c1, 0x0},
+ {0x2112c1, 0x0},
+ {0x0113c1, 0x0},
+ {0x1113c1, 0x0},
+ {0x2113c1, 0x0},
+ {0x0114c1, 0x0},
+ {0x1114c1, 0x0},
+ {0x2114c1, 0x0},
+ {0x0115c1, 0x0},
+ {0x1115c1, 0x0},
+ {0x2115c1, 0x0},
+ {0x0116c1, 0x0},
+ {0x1116c1, 0x0},
+ {0x2116c1, 0x0},
+ {0x0117c1, 0x0},
+ {0x1117c1, 0x0},
+ {0x2117c1, 0x0},
+ {0x0118c1, 0x0},
+ {0x1118c1, 0x0},
+ {0x2118c1, 0x0},
+ {0x010020, 0x0},
+ {0x110020, 0x0},
+ {0x210020, 0x0},
+ {0x011020, 0x0},
+ {0x111020, 0x0},
+ {0x211020, 0x0},
+ {0x020072, 0x0},
+ {0x020073, 0x0},
+ {0x020074, 0x0},
+ {0x0100aa, 0x0},
+ {0x0110aa, 0x0},
+ {0x020010, 0x0},
+ {0x120010, 0x0},
+ {0x220010, 0x0},
+ {0x020011, 0x0},
+ {0x120011, 0x0},
+ {0x220011, 0x0},
+ {0x0100ae, 0x0},
+ {0x1100ae, 0x0},
+ {0x2100ae, 0x0},
+ {0x0100af, 0x0},
+ {0x1100af, 0x0},
+ {0x2100af, 0x0},
+ {0x0110ae, 0x0},
+ {0x1110ae, 0x0},
+ {0x2110ae, 0x0},
+ {0x0110af, 0x0},
+ {0x1110af, 0x0},
+ {0x2110af, 0x0},
+ {0x020020, 0x0},
+ {0x120020, 0x0},
+ {0x220020, 0x0},
+ {0x0100a0, 0x0},
+ {0x0100a1, 0x0},
+ {0x0100a2, 0x0},
+ {0x0100a3, 0x0},
+ {0x0100a4, 0x0},
+ {0x0100a5, 0x0},
+ {0x0100a6, 0x0},
+ {0x0100a7, 0x0},
+ {0x0110a0, 0x0},
+ {0x0110a1, 0x0},
+ {0x0110a2, 0x0},
+ {0x0110a3, 0x0},
+ {0x0110a4, 0x0},
+ {0x0110a5, 0x0},
+ {0x0110a6, 0x0},
+ {0x0110a7, 0x0},
+ {0x02007c, 0x0},
+ {0x12007c, 0x0},
+ {0x22007c, 0x0},
+ {0x02007d, 0x0},
+ {0x12007d, 0x0},
+ {0x22007d, 0x0},
+ {0x0400fd, 0x0},
+ {0x0400c0, 0x0},
+ {0x090201, 0x0},
+ {0x190201, 0x0},
+ {0x290201, 0x0},
+ {0x090202, 0x0},
+ {0x190202, 0x0},
+ {0x290202, 0x0},
+ {0x090203, 0x0},
+ {0x190203, 0x0},
+ {0x290203, 0x0},
+ {0x090204, 0x0},
+ {0x190204, 0x0},
+ {0x290204, 0x0},
+ {0x090205, 0x0},
+ {0x190205, 0x0},
+ {0x290205, 0x0},
+ {0x090206, 0x0},
+ {0x190206, 0x0},
+ {0x290206, 0x0},
+ {0x090207, 0x0},
+ {0x190207, 0x0},
+ {0x290207, 0x0},
+ {0x090208, 0x0},
+ {0x190208, 0x0},
+ {0x290208, 0x0},
+ {0x010062, 0x0},
+ {0x010162, 0x0},
+ {0x010262, 0x0},
+ {0x010362, 0x0},
+ {0x010462, 0x0},
+ {0x010562, 0x0},
+ {0x010662, 0x0},
+ {0x010762, 0x0},
+ {0x010862, 0x0},
+ {0x011062, 0x0},
+ {0x011162, 0x0},
+ {0x011262, 0x0},
+ {0x011362, 0x0},
+ {0x011462, 0x0},
+ {0x011562, 0x0},
+ {0x011662, 0x0},
+ {0x011762, 0x0},
+ {0x011862, 0x0},
+ {0x020077, 0x0},
+ {0x010001, 0x0},
+ {0x011001, 0x0},
+ {0x010040, 0x0},
+ {0x010140, 0x0},
+ {0x010240, 0x0},
+ {0x010340, 0x0},
+ {0x010440, 0x0},
+ {0x010540, 0x0},
+ {0x010640, 0x0},
+ {0x010740, 0x0},
+ {0x010840, 0x0},
+ {0x010030, 0x0},
+ {0x010130, 0x0},
+ {0x010230, 0x0},
+ {0x010330, 0x0},
+ {0x010430, 0x0},
+ {0x010530, 0x0},
+ {0x010630, 0x0},
+ {0x010730, 0x0},
+ {0x010830, 0x0},
+ {0x011040, 0x0},
+ {0x011140, 0x0},
+ {0x011240, 0x0},
+ {0x011340, 0x0},
+ {0x011440, 0x0},
+ {0x011540, 0x0},
+ {0x011640, 0x0},
+ {0x011740, 0x0},
+ {0x011840, 0x0},
+ {0x011030, 0x0},
+ {0x011130, 0x0},
+ {0x011230, 0x0},
+ {0x011330, 0x0},
+ {0x011430, 0x0},
+ {0x011530, 0x0},
+ {0x011630, 0x0},
+ {0x011730, 0x0},
+ {0x011830, 0x0},
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ {0x000d0000, 0x00000000},
+ {0x00054000, 0x00000000},
+ {0x00054001, 0x00000000},
+ {0x00054002, 0x00000000},
+ {0x00054003, 0x00000c80},
+ {0x00054004, 0x00000002},
+ {0x00054005, 0x00000000},
+ {0x00054006, 0x00000011},
+ {0x00054007, 0x00000000},
+ {0x00054008, 0x0000131f},
+ {0x00054009, 0x000000c8},
+ {0x0005400a, 0x00000000},
+ {0x0005400b, 0x00000002},
+ {0x0005400c, 0x00000000},
+ {0x0005400d, 0x00000000},
+ {0x0005400e, 0x00000000},
+ {0x0005400f, 0x00000100},
+ {0x00054010, 0x00000000},
+ {0x00054011, 0x00000000},
+ {0x00054012, 0x00000310},
+ {0x00054013, 0x00000000},
+ {0x00054014, 0x00000000},
+ {0x00054015, 0x00000000},
+ {0x00054016, 0x00000000},
+ {0x00054017, 0x00000000},
+ {0x00054018, 0x00000000},
+ {0x00054019, 0x00002dd4},
+ {0x0005401a, 0x00000031},
+ {0x0005401b, 0x00004d66},
+ {0x0005401c, 0x00004a00},
+ {0x0005401d, 0x00000000},
+ {0x0005401e, 0x00000016},
+ {0x0005401f, 0x00002dd4},
+ {0x00054020, 0x00000031},
+ {0x00054021, 0x00004d66},
+ {0x00054022, 0x00004a00},
+ {0x00054023, 0x00000000},
+ {0x00054024, 0x0000002e},
+ {0x00054025, 0x00000000},
+ {0x00054026, 0x00000000},
+ {0x00054027, 0x00000000},
+ {0x00054028, 0x00000000},
+ {0x00054029, 0x00000000},
+ {0x0005402a, 0x00000000},
+ {0x0005402b, 0x00000000},
+ {0x0005402c, 0x00000000},
+ {0x0005402d, 0x00000000},
+ {0x0005402e, 0x00000000},
+ {0x0005402f, 0x00000000},
+ {0x00054030, 0x00000000},
+ {0x00054031, 0x00000000},
+ {0x00054032, 0x0000d400},
+ {0x00054033, 0x0000312d},
+ {0x00054034, 0x00006600},
+ {0x00054035, 0x0000004d},
+ {0x00054036, 0x0000004a},
+ {0x00054037, 0x00001600},
+ {0x00054038, 0x0000d400},
+ {0x00054039, 0x0000312d},
+ {0x0005403a, 0x00006600},
+ {0x0005403b, 0x0000004d},
+ {0x0005403c, 0x0000004a},
+ {0x0005403d, 0x00002e00},
+ {0x0005403e, 0x00000000},
+ {0x0005403f, 0x00000000},
+ {0x00054040, 0x00000000},
+ {0x00054041, 0x00000000},
+ {0x00054042, 0x00000000},
+ {0x00054043, 0x00000000},
+ {0x00054044, 0x00000000},
+ {0x000d0000, 0x00000001},
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ {0x000d0000, 0x00000000},
+ {0x00054000, 0x00000000},
+ {0x00054001, 0x00000000},
+ {0x00054002, 0x00000101},
+ {0x00054003, 0x00000190},
+ {0x00054004, 0x00000002},
+ {0x00054005, 0x00000000},
+ {0x00054006, 0x00000011},
+ {0x00054007, 0x00000000},
+ {0x00054008, 0x0000121f},
+ {0x00054009, 0x000000c8},
+ {0x0005400a, 0x00000000},
+ {0x0005400b, 0x00000002},
+ {0x0005400c, 0x00000000},
+ {0x0005400d, 0x00000000},
+ {0x0005400e, 0x00000000},
+ {0x0005400f, 0x00000100},
+ {0x00054010, 0x00000000},
+ {0x00054011, 0x00000000},
+ {0x00054012, 0x00000310},
+ {0x00054013, 0x00000000},
+ {0x00054014, 0x00000000},
+ {0x00054015, 0x00000000},
+ {0x00054016, 0x00000000},
+ {0x00054017, 0x00000000},
+ {0x00054018, 0x00000000},
+ {0x00054019, 0x00000084},
+ {0x0005401a, 0x00000031},
+ {0x0005401b, 0x00004d66},
+ {0x0005401c, 0x00004a00},
+ {0x0005401d, 0x00000000},
+ {0x0005401e, 0x00000016},
+ {0x0005401f, 0x00000084},
+ {0x00054020, 0x00000031},
+ {0x00054021, 0x00004d66},
+ {0x00054022, 0x00004a00},
+ {0x00054023, 0x00000000},
+ {0x00054024, 0x0000002e},
+ {0x00054025, 0x00000000},
+ {0x00054026, 0x00000000},
+ {0x00054027, 0x00000000},
+ {0x00054028, 0x00000000},
+ {0x00054029, 0x00000000},
+ {0x0005402a, 0x00000000},
+ {0x0005402b, 0x00000000},
+ {0x0005402c, 0x00000000},
+ {0x0005402d, 0x00000000},
+ {0x0005402e, 0x00000000},
+ {0x0005402f, 0x00000000},
+ {0x00054030, 0x00000000},
+ {0x00054031, 0x00000000},
+ {0x00054032, 0x00008400},
+ {0x00054033, 0x00003100},
+ {0x00054034, 0x00006600},
+ {0x00054035, 0x0000004d},
+ {0x00054036, 0x0000004a},
+ {0x00054037, 0x00001600},
+ {0x00054038, 0x00008400},
+ {0x00054039, 0x00003100},
+ {0x0005403a, 0x00006600},
+ {0x0005403b, 0x0000004d},
+ {0x0005403c, 0x0000004a},
+ {0x0005403d, 0x00002e00},
+ {0x0005403e, 0x00000000},
+ {0x0005403f, 0x00000000},
+ {0x00054040, 0x00000000},
+ {0x00054041, 0x00000000},
+ {0x00054042, 0x00000000},
+ {0x00054043, 0x00000000},
+ {0x00054044, 0x00000000},
+ {0x000d0000, 0x00000001},
+};
+
+/* P2 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp2_cfg[] = {
+ {0x000d0000, 0x00000000},
+ {0x00054000, 0x00000000},
+ {0x00054001, 0x00000000},
+ {0x00054002, 0x00000102},
+ {0x00054003, 0x00000064},
+ {0x00054004, 0x00000002},
+ {0x00054005, 0x00000000},
+ {0x00054006, 0x00000011},
+ {0x00054007, 0x00000000},
+ {0x00054008, 0x0000121f},
+ {0x00054009, 0x000000c8},
+ {0x0005400a, 0x00000000},
+ {0x0005400b, 0x00000002},
+ {0x0005400c, 0x00000000},
+ {0x0005400d, 0x00000000},
+ {0x0005400e, 0x00000000},
+ {0x0005400f, 0x00000100},
+ {0x00054010, 0x00000000},
+ {0x00054011, 0x00000000},
+ {0x00054012, 0x00000310},
+ {0x00054013, 0x00000000},
+ {0x00054014, 0x00000000},
+ {0x00054015, 0x00000000},
+ {0x00054016, 0x00000000},
+ {0x00054017, 0x00000000},
+ {0x00054018, 0x00000000},
+ {0x00054019, 0x00000084},
+ {0x0005401a, 0x00000031},
+ {0x0005401b, 0x00004d66},
+ {0x0005401c, 0x00004a00},
+ {0x0005401d, 0x00000000},
+ {0x0005401e, 0x00000016},
+ {0x0005401f, 0x00000084},
+ {0x00054020, 0x00000031},
+ {0x00054021, 0x00004d66},
+ {0x00054022, 0x00004a00},
+ {0x00054023, 0x00000000},
+ {0x00054024, 0x0000002e},
+ {0x00054025, 0x00000000},
+ {0x00054026, 0x00000000},
+ {0x00054027, 0x00000000},
+ {0x00054028, 0x00000000},
+ {0x00054029, 0x00000000},
+ {0x0005402a, 0x00000000},
+ {0x0005402b, 0x00000000},
+ {0x0005402c, 0x00000000},
+ {0x0005402d, 0x00000000},
+ {0x0005402e, 0x00000000},
+ {0x0005402f, 0x00000000},
+ {0x00054030, 0x00000000},
+ {0x00054031, 0x00000000},
+ {0x00054032, 0x00008400},
+ {0x00054033, 0x00003100},
+ {0x00054034, 0x00006600},
+ {0x00054035, 0x0000004d},
+ {0x00054036, 0x0000004a},
+ {0x00054037, 0x00001600},
+ {0x00054038, 0x00008400},
+ {0x00054039, 0x00003100},
+ {0x0005403a, 0x00006600},
+ {0x0005403b, 0x0000004d},
+ {0x0005403c, 0x0000004a},
+ {0x0005403d, 0x00002e00},
+ {0x0005403e, 0x00000000},
+ {0x0005403f, 0x00000000},
+ {0x00054040, 0x00000000},
+ {0x00054041, 0x00000000},
+ {0x00054042, 0x00000000},
+ {0x00054043, 0x00000000},
+ {0x00054044, 0x00000000},
+ {0x000d0000, 0x00000001},
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ {0x000d0000, 0x00000000},
+ {0x00054000, 0x00000000},
+ {0x00054001, 0x00000000},
+ {0x00054002, 0x00000000},
+ {0x00054003, 0x00000c80},
+ {0x00054004, 0x00000002},
+ {0x00054005, 0x00000000},
+ {0x00054006, 0x00000011},
+ {0x00054007, 0x00000000},
+ {0x00054008, 0x00000061},
+ {0x00054009, 0x000000c8},
+ {0x0005400a, 0x00000000},
+ {0x0005400b, 0x00000002},
+ {0x0005400c, 0x00000000},
+ {0x0005400d, 0x00000000},
+ {0x0005400e, 0x00000000},
+ {0x0005400f, 0x00000100},
+ {0x00054010, 0x00001f7f},
+ {0x00054011, 0x00000000},
+ {0x00054012, 0x00000310},
+ {0x00054013, 0x00000000},
+ {0x00054014, 0x00000000},
+ {0x00054015, 0x00000000},
+ {0x00054016, 0x00000000},
+ {0x00054017, 0x00000000},
+ {0x00054018, 0x00000000},
+ {0x00054019, 0x00002dd4},
+ {0x0005401a, 0x00000031},
+ {0x0005401b, 0x00004d66},
+ {0x0005401c, 0x00004a00},
+ {0x0005401d, 0x00000000},
+ {0x0005401e, 0x00000016},
+ {0x0005401f, 0x00002dd4},
+ {0x00054020, 0x00000031},
+ {0x00054021, 0x00004d66},
+ {0x00054022, 0x00004a00},
+ {0x00054023, 0x00000000},
+ {0x00054024, 0x0000002e},
+ {0x00054025, 0x00000000},
+ {0x00054026, 0x00000000},
+ {0x00054027, 0x00000000},
+ {0x00054028, 0x00000000},
+ {0x00054029, 0x00000000},
+ {0x0005402a, 0x00000000},
+ {0x0005402b, 0x00000000},
+ {0x0005402c, 0x00000000},
+ {0x0005402d, 0x00000000},
+ {0x0005402e, 0x00000000},
+ {0x0005402f, 0x00000000},
+ {0x00054030, 0x00000000},
+ {0x00054031, 0x00000000},
+ {0x00054032, 0x0000d400},
+ {0x00054033, 0x0000312d},
+ {0x00054034, 0x00006600},
+ {0x00054035, 0x0000004d},
+ {0x00054036, 0x0000004a},
+ {0x00054037, 0x00001600},
+ {0x00054038, 0x0000d400},
+ {0x00054039, 0x0000312d},
+ {0x0005403a, 0x00006600},
+ {0x0005403b, 0x0000004d},
+ {0x0005403c, 0x0000004a},
+ {0x0005403d, 0x00002e00},
+ {0x0005403e, 0x00000000},
+ {0x0005403f, 0x00000000},
+ {0x00054040, 0x00000000},
+ {0x00054041, 0x00000000},
+ {0x00054042, 0x00000000},
+ {0x00054043, 0x00000000},
+ {0x00054044, 0x00000000},
+ {0x000d0000, 0x00000001},
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ {0xd0000, 0x0},
+ {0x90000, 0x10},
+ {0x90001, 0x400},
+ {0x90002, 0x10e},
+ {0x90003, 0x0},
+ {0x90004, 0x0},
+ {0x90005, 0x8},
+ {0x90029, 0xb},
+ {0x9002a, 0x480},
+ {0x9002b, 0x109},
+ {0x9002c, 0x8},
+ {0x9002d, 0x448},
+ {0x9002e, 0x139},
+ {0x9002f, 0x8},
+ {0x90030, 0x478},
+ {0x90031, 0x109},
+ {0x90032, 0x0},
+ {0x90033, 0xe8},
+ {0x90034, 0x109},
+ {0x90035, 0x2},
+ {0x90036, 0x10},
+ {0x90037, 0x139},
+ {0x90038, 0xb},
+ {0x90039, 0x7c0},
+ {0x9003a, 0x139},
+ {0x9003b, 0x44},
+ {0x9003c, 0x633},
+ {0x9003d, 0x159},
+ {0x9003e, 0x14f},
+ {0x9003f, 0x630},
+ {0x90040, 0x159},
+ {0x90041, 0x47},
+ {0x90042, 0x633},
+ {0x90043, 0x149},
+ {0x90044, 0x4f},
+ {0x90045, 0x633},
+ {0x90046, 0x179},
+ {0x90047, 0x8},
+ {0x90048, 0xe0},
+ {0x90049, 0x109},
+ {0x9004a, 0x0},
+ {0x9004b, 0x7c8},
+ {0x9004c, 0x109},
+ {0x9004d, 0x0},
+ {0x9004e, 0x1},
+ {0x9004f, 0x8},
+ {0x90050, 0x0},
+ {0x90051, 0x45a},
+ {0x90052, 0x9},
+ {0x90053, 0x0},
+ {0x90054, 0x448},
+ {0x90055, 0x109},
+ {0x90056, 0x40},
+ {0x90057, 0x633},
+ {0x90058, 0x179},
+ {0x90059, 0x1},
+ {0x9005a, 0x618},
+ {0x9005b, 0x109},
+ {0x9005c, 0x40c0},
+ {0x9005d, 0x633},
+ {0x9005e, 0x149},
+ {0x9005f, 0x8},
+ {0x90060, 0x4},
+ {0x90061, 0x48},
+ {0x90062, 0x4040},
+ {0x90063, 0x633},
+ {0x90064, 0x149},
+ {0x90065, 0x0},
+ {0x90066, 0x4},
+ {0x90067, 0x48},
+ {0x90068, 0x40},
+ {0x90069, 0x633},
+ {0x9006a, 0x149},
+ {0x9006b, 0x10},
+ {0x9006c, 0x4},
+ {0x9006d, 0x18},
+ {0x9006e, 0x0},
+ {0x9006f, 0x4},
+ {0x90070, 0x78},
+ {0x90071, 0x549},
+ {0x90072, 0x633},
+ {0x90073, 0x159},
+ {0x90074, 0xd49},
+ {0x90075, 0x633},
+ {0x90076, 0x159},
+ {0x90077, 0x94a},
+ {0x90078, 0x633},
+ {0x90079, 0x159},
+ {0x9007a, 0x441},
+ {0x9007b, 0x633},
+ {0x9007c, 0x149},
+ {0x9007d, 0x42},
+ {0x9007e, 0x633},
+ {0x9007f, 0x149},
+ {0x90080, 0x1},
+ {0x90081, 0x633},
+ {0x90082, 0x149},
+ {0x90083, 0x0},
+ {0x90084, 0xe0},
+ {0x90085, 0x109},
+ {0x90086, 0xa},
+ {0x90087, 0x10},
+ {0x90088, 0x109},
+ {0x90089, 0x9},
+ {0x9008a, 0x3c0},
+ {0x9008b, 0x149},
+ {0x9008c, 0x9},
+ {0x9008d, 0x3c0},
+ {0x9008e, 0x159},
+ {0x9008f, 0x18},
+ {0x90090, 0x10},
+ {0x90091, 0x109},
+ {0x90092, 0x0},
+ {0x90093, 0x3c0},
+ {0x90094, 0x109},
+ {0x90095, 0x18},
+ {0x90096, 0x4},
+ {0x90097, 0x48},
+ {0x90098, 0x18},
+ {0x90099, 0x4},
+ {0x9009a, 0x58},
+ {0x9009b, 0xb},
+ {0x9009c, 0x10},
+ {0x9009d, 0x109},
+ {0x9009e, 0x1},
+ {0x9009f, 0x10},
+ {0x900a0, 0x109},
+ {0x900a1, 0x5},
+ {0x900a2, 0x7c0},
+ {0x900a3, 0x109},
+ {0x40000, 0x811},
+ {0x40020, 0x880},
+ {0x40040, 0x0},
+ {0x40060, 0x0},
+ {0x40001, 0x4008},
+ {0x40021, 0x83},
+ {0x40041, 0x4f},
+ {0x40061, 0x0},
+ {0x40002, 0x4040},
+ {0x40022, 0x83},
+ {0x40042, 0x51},
+ {0x40062, 0x0},
+ {0x40003, 0x811},
+ {0x40023, 0x880},
+ {0x40043, 0x0},
+ {0x40063, 0x0},
+ {0x40004, 0x720},
+ {0x40024, 0xf},
+ {0x40044, 0x1740},
+ {0x40064, 0x0},
+ {0x40005, 0x16},
+ {0x40025, 0x83},
+ {0x40045, 0x4b},
+ {0x40065, 0x0},
+ {0x40006, 0x716},
+ {0x40026, 0xf},
+ {0x40046, 0x2001},
+ {0x40066, 0x0},
+ {0x40007, 0x716},
+ {0x40027, 0xf},
+ {0x40047, 0x2800},
+ {0x40067, 0x0},
+ {0x40008, 0x716},
+ {0x40028, 0xf},
+ {0x40048, 0xf00},
+ {0x40068, 0x0},
+ {0x40009, 0x720},
+ {0x40029, 0xf},
+ {0x40049, 0x1400},
+ {0x40069, 0x0},
+ {0x4000a, 0xe08},
+ {0x4002a, 0xc15},
+ {0x4004a, 0x0},
+ {0x4006a, 0x0},
+ {0x4000b, 0x625},
+ {0x4002b, 0x15},
+ {0x4004b, 0x0},
+ {0x4006b, 0x0},
+ {0x4000c, 0x4028},
+ {0x4002c, 0x80},
+ {0x4004c, 0x0},
+ {0x4006c, 0x0},
+ {0x4000d, 0xe08},
+ {0x4002d, 0xc1a},
+ {0x4004d, 0x0},
+ {0x4006d, 0x0},
+ {0x4000e, 0x625},
+ {0x4002e, 0x1a},
+ {0x4004e, 0x0},
+ {0x4006e, 0x0},
+ {0x4000f, 0x4040},
+ {0x4002f, 0x80},
+ {0x4004f, 0x0},
+ {0x4006f, 0x0},
+ {0x40010, 0x2604},
+ {0x40030, 0x15},
+ {0x40050, 0x0},
+ {0x40070, 0x0},
+ {0x40011, 0x708},
+ {0x40031, 0x5},
+ {0x40051, 0x0},
+ {0x40071, 0x2002},
+ {0x40012, 0x8},
+ {0x40032, 0x80},
+ {0x40052, 0x0},
+ {0x40072, 0x0},
+ {0x40013, 0x2604},
+ {0x40033, 0x1a},
+ {0x40053, 0x0},
+ {0x40073, 0x0},
+ {0x40014, 0x708},
+ {0x40034, 0xa},
+ {0x40054, 0x0},
+ {0x40074, 0x2002},
+ {0x40015, 0x4040},
+ {0x40035, 0x80},
+ {0x40055, 0x0},
+ {0x40075, 0x0},
+ {0x40016, 0x60a},
+ {0x40036, 0x15},
+ {0x40056, 0x1200},
+ {0x40076, 0x0},
+ {0x40017, 0x61a},
+ {0x40037, 0x15},
+ {0x40057, 0x1300},
+ {0x40077, 0x0},
+ {0x40018, 0x60a},
+ {0x40038, 0x1a},
+ {0x40058, 0x1200},
+ {0x40078, 0x0},
+ {0x40019, 0x642},
+ {0x40039, 0x1a},
+ {0x40059, 0x1300},
+ {0x40079, 0x0},
+ {0x4001a, 0x4808},
+ {0x4003a, 0x880},
+ {0x4005a, 0x0},
+ {0x4007a, 0x0},
+ {0x900a4, 0x0},
+ {0x900a5, 0x790},
+ {0x900a6, 0x11a},
+ {0x900a7, 0x8},
+ {0x900a8, 0x7aa},
+ {0x900a9, 0x2a},
+ {0x900aa, 0x10},
+ {0x900ab, 0x7b2},
+ {0x900ac, 0x2a},
+ {0x900ad, 0x0},
+ {0x900ae, 0x7c8},
+ {0x900af, 0x109},
+ {0x900b0, 0x10},
+ {0x900b1, 0x10},
+ {0x900b2, 0x109},
+ {0x900b3, 0x10},
+ {0x900b4, 0x2a8},
+ {0x900b5, 0x129},
+ {0x900b6, 0x8},
+ {0x900b7, 0x370},
+ {0x900b8, 0x129},
+ {0x900b9, 0xa},
+ {0x900ba, 0x3c8},
+ {0x900bb, 0x1a9},
+ {0x900bc, 0xc},
+ {0x900bd, 0x408},
+ {0x900be, 0x199},
+ {0x900bf, 0x14},
+ {0x900c0, 0x790},
+ {0x900c1, 0x11a},
+ {0x900c2, 0x8},
+ {0x900c3, 0x4},
+ {0x900c4, 0x18},
+ {0x900c5, 0xe},
+ {0x900c6, 0x408},
+ {0x900c7, 0x199},
+ {0x900c8, 0x8},
+ {0x900c9, 0x8568},
+ {0x900ca, 0x108},
+ {0x900cb, 0x18},
+ {0x900cc, 0x790},
+ {0x900cd, 0x16a},
+ {0x900ce, 0x8},
+ {0x900cf, 0x1d8},
+ {0x900d0, 0x169},
+ {0x900d1, 0x10},
+ {0x900d2, 0x8558},
+ {0x900d3, 0x168},
+ {0x900d4, 0x70},
+ {0x900d5, 0x788},
+ {0x900d6, 0x16a},
+ {0x900d7, 0x1ff8},
+ {0x900d8, 0x85a8},
+ {0x900d9, 0x1e8},
+ {0x900da, 0x50},
+ {0x900db, 0x798},
+ {0x900dc, 0x16a},
+ {0x900dd, 0x60},
+ {0x900de, 0x7a0},
+ {0x900df, 0x16a},
+ {0x900e0, 0x8},
+ {0x900e1, 0x8310},
+ {0x900e2, 0x168},
+ {0x900e3, 0x8},
+ {0x900e4, 0xa310},
+ {0x900e5, 0x168},
+ {0x900e6, 0xa},
+ {0x900e7, 0x408},
+ {0x900e8, 0x169},
+ {0x900e9, 0x6e},
+ {0x900ea, 0x0},
+ {0x900eb, 0x68},
+ {0x900ec, 0x0},
+ {0x900ed, 0x408},
+ {0x900ee, 0x169},
+ {0x900ef, 0x0},
+ {0x900f0, 0x8310},
+ {0x900f1, 0x168},
+ {0x900f2, 0x0},
+ {0x900f3, 0xa310},
+ {0x900f4, 0x168},
+ {0x900f5, 0x1ff8},
+ {0x900f6, 0x85a8},
+ {0x900f7, 0x1e8},
+ {0x900f8, 0x68},
+ {0x900f9, 0x798},
+ {0x900fa, 0x16a},
+ {0x900fb, 0x78},
+ {0x900fc, 0x7a0},
+ {0x900fd, 0x16a},
+ {0x900fe, 0x68},
+ {0x900ff, 0x790},
+ {0x90100, 0x16a},
+ {0x90101, 0x8},
+ {0x90102, 0x8b10},
+ {0x90103, 0x168},
+ {0x90104, 0x8},
+ {0x90105, 0xab10},
+ {0x90106, 0x168},
+ {0x90107, 0xa},
+ {0x90108, 0x408},
+ {0x90109, 0x169},
+ {0x9010a, 0x58},
+ {0x9010b, 0x0},
+ {0x9010c, 0x68},
+ {0x9010d, 0x0},
+ {0x9010e, 0x408},
+ {0x9010f, 0x169},
+ {0x90110, 0x0},
+ {0x90111, 0x8b10},
+ {0x90112, 0x168},
+ {0x90113, 0x1},
+ {0x90114, 0xab10},
+ {0x90115, 0x168},
+ {0x90116, 0x0},
+ {0x90117, 0x1d8},
+ {0x90118, 0x169},
+ {0x90119, 0x80},
+ {0x9011a, 0x790},
+ {0x9011b, 0x16a},
+ {0x9011c, 0x18},
+ {0x9011d, 0x7aa},
+ {0x9011e, 0x6a},
+ {0x9011f, 0xa},
+ {0x90120, 0x0},
+ {0x90121, 0x1e9},
+ {0x90122, 0x8},
+ {0x90123, 0x8080},
+ {0x90124, 0x108},
+ {0x90125, 0xf},
+ {0x90126, 0x408},
+ {0x90127, 0x169},
+ {0x90128, 0xc},
+ {0x90129, 0x0},
+ {0x9012a, 0x68},
+ {0x9012b, 0x9},
+ {0x9012c, 0x0},
+ {0x9012d, 0x1a9},
+ {0x9012e, 0x0},
+ {0x9012f, 0x408},
+ {0x90130, 0x169},
+ {0x90131, 0x0},
+ {0x90132, 0x8080},
+ {0x90133, 0x108},
+ {0x90134, 0x8},
+ {0x90135, 0x7aa},
+ {0x90136, 0x6a},
+ {0x90137, 0x0},
+ {0x90138, 0x8568},
+ {0x90139, 0x108},
+ {0x9013a, 0xb7},
+ {0x9013b, 0x790},
+ {0x9013c, 0x16a},
+ {0x9013d, 0x1f},
+ {0x9013e, 0x0},
+ {0x9013f, 0x68},
+ {0x90140, 0x8},
+ {0x90141, 0x8558},
+ {0x90142, 0x168},
+ {0x90143, 0xf},
+ {0x90144, 0x408},
+ {0x90145, 0x169},
+ {0x90146, 0xd},
+ {0x90147, 0x0},
+ {0x90148, 0x68},
+ {0x90149, 0x0},
+ {0x9014a, 0x408},
+ {0x9014b, 0x169},
+ {0x9014c, 0x0},
+ {0x9014d, 0x8558},
+ {0x9014e, 0x168},
+ {0x9014f, 0x8},
+ {0x90150, 0x3c8},
+ {0x90151, 0x1a9},
+ {0x90152, 0x3},
+ {0x90153, 0x370},
+ {0x90154, 0x129},
+ {0x90155, 0x20},
+ {0x90156, 0x2aa},
+ {0x90157, 0x9},
+ {0x90158, 0x0},
+ {0x90159, 0x400},
+ {0x9015a, 0x10e},
+ {0x9015b, 0x8},
+ {0x9015c, 0xe8},
+ {0x9015d, 0x109},
+ {0x9015e, 0x0},
+ {0x9015f, 0x8140},
+ {0x90160, 0x10c},
+ {0x90161, 0x10},
+ {0x90162, 0x8138},
+ {0x90163, 0x10c},
+ {0x90164, 0x8},
+ {0x90165, 0x7c8},
+ {0x90166, 0x101},
+ {0x90167, 0x8},
+ {0x90168, 0x448},
+ {0x90169, 0x109},
+ {0x9016a, 0xf},
+ {0x9016b, 0x7c0},
+ {0x9016c, 0x109},
+ {0x9016d, 0x0},
+ {0x9016e, 0xe8},
+ {0x9016f, 0x109},
+ {0x90170, 0x47},
+ {0x90171, 0x630},
+ {0x90172, 0x109},
+ {0x90173, 0x8},
+ {0x90174, 0x618},
+ {0x90175, 0x109},
+ {0x90176, 0x8},
+ {0x90177, 0xe0},
+ {0x90178, 0x109},
+ {0x90179, 0x0},
+ {0x9017a, 0x7c8},
+ {0x9017b, 0x109},
+ {0x9017c, 0x8},
+ {0x9017d, 0x8140},
+ {0x9017e, 0x10c},
+ {0x9017f, 0x0},
+ {0x90180, 0x1},
+ {0x90181, 0x8},
+ {0x90182, 0x8},
+ {0x90183, 0x4},
+ {0x90184, 0x8},
+ {0x90185, 0x8},
+ {0x90186, 0x7c8},
+ {0x90187, 0x101},
+ {0x90006, 0x0},
+ {0x90007, 0x0},
+ {0x90008, 0x8},
+ {0x90009, 0x0},
+ {0x9000a, 0x0},
+ {0x9000b, 0x0},
+ {0xd00e7, 0x400},
+ {0x90017, 0x0},
+ {0x9001f, 0x29},
+ {0x90026, 0x6a},
+ {0x400d0, 0x0},
+ {0x400d1, 0x101},
+ {0x400d2, 0x105},
+ {0x400d3, 0x107},
+ {0x400d4, 0x10f},
+ {0x400d5, 0x202},
+ {0x400d6, 0x20a},
+ {0x400d7, 0x20b},
+ {0x2003a, 0x2},
+ {0x2000b, 0x64},
+ {0x2000c, 0xc8},
+ {0x2000d, 0x7d0},
+ {0x2000e, 0x2c},
+ {0x12000b, 0xc},
+ {0x12000c, 0x19},
+ {0x12000d, 0xfa},
+ {0x12000e, 0x10},
+ {0x22000b, 0x3},
+ {0x22000c, 0x6},
+ {0x22000d, 0x3e},
+ {0x22000e, 0x10},
+ {0x9000c, 0x0},
+ {0x9000d, 0x173},
+ {0x9000e, 0x60},
+ {0x9000f, 0x6110},
+ {0x90010, 0x2152},
+ {0x90011, 0xdfbd},
+ {0x90012, 0x2060},
+ {0x90013, 0x6152},
+ {0x20010, 0x5a},
+ {0x20011, 0x3},
+ {0x40080, 0xe0},
+ {0x40081, 0x12},
+ {0x40082, 0xe0},
+ {0x40083, 0x12},
+ {0x40084, 0xe0},
+ {0x40085, 0x12},
+ {0x140080, 0xe0},
+ {0x140081, 0x12},
+ {0x140082, 0xe0},
+ {0x140083, 0x12},
+ {0x140084, 0xe0},
+ {0x140085, 0x12},
+ {0x240080, 0xe0},
+ {0x240081, 0x12},
+ {0x240082, 0xe0},
+ {0x240083, 0x12},
+ {0x240084, 0xe0},
+ {0x240085, 0x12},
+ {0x400fd, 0xf},
+ {0x10011, 0x1},
+ {0x10012, 0x1},
+ {0x10013, 0x180},
+ {0x10018, 0x1},
+ {0x10002, 0x6209},
+ {0x100b2, 0x1},
+ {0x101b4, 0x1},
+ {0x102b4, 0x1},
+ {0x103b4, 0x1},
+ {0x104b4, 0x1},
+ {0x105b4, 0x1},
+ {0x106b4, 0x1},
+ {0x107b4, 0x1},
+ {0x108b4, 0x1},
+ {0x11011, 0x1},
+ {0x11012, 0x1},
+ {0x11013, 0x180},
+ {0x11018, 0x1},
+ {0x11002, 0x6209},
+ {0x110b2, 0x1},
+ {0x111b4, 0x1},
+ {0x112b4, 0x1},
+ {0x113b4, 0x1},
+ {0x114b4, 0x1},
+ {0x115b4, 0x1},
+ {0x116b4, 0x1},
+ {0x117b4, 0x1},
+ {0x118b4, 0x1},
+ {0x20089, 0x1},
+ {0x20088, 0x19},
+ {0xc0080, 0x2},
+ {0xd0000, 0x1},
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 3200mts 1D */
+ .drate = 3200,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 400mts 1D */
+ .drate = 400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P2 100mts 1D */
+ .drate = 100,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp2_cfg),
+ },
+ {
+ /* P0 3200mts 2D */
+ .drate = 3200,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 3200, 400, 100, },
+};
diff --git a/board/freescale/imx8mn_evk/lpddr4_timing_ld.c b/board/freescale/imx8mn_evk/lpddr4_timing_ld.c
new file mode 100644
index 00000000000..aa23c350945
--- /dev/null
+++ b/board/freescale/imx8mn_evk/lpddr4_timing_ld.c
@@ -0,0 +1,1440 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ *
+ * Generated code from MX8M_DDR_tool
+ * Align with uboot version:
+ * imx_v2018.03_4.14.78_1.0.0_ga ~ imx_v2018.04_4.19.35_1.1.0_ga
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ { 0x3d400304, 0x1 },
+ { 0x3d400030, 0x1 },
+ { 0x3d400000, 0xa3080020 },
+ { 0x3d400020, 0x111 },
+ { 0x3d400024, 0x1f400 },
+ { 0x3d400064, 0x300070 },
+ { 0x3d4000d0, 0xc002030f },
+ { 0x3d4000d4, 0x500000 },
+ { 0x3d4000dc, 0xa40012 },
+ { 0x3d4000e0, 0x310000 },
+ { 0x3d4000e8, 0x66004d },
+ { 0x3d4000ec, 0x16004d },
+ { 0x3d400100, 0x10100d11 },
+ { 0x3d400104, 0x3041a },
+ { 0x3d40010c, 0x606000 },
+ { 0x3d400110, 0x8040408 },
+ { 0x3d400114, 0x2030606 },
+ { 0x3d400118, 0x1010004 },
+ { 0x3d40011c, 0x301 },
+ { 0x3d400130, 0x20300 },
+ { 0x3d400134, 0xa100002 },
+ { 0x3d400138, 0x73 },
+ { 0x3d400144, 0x500028 },
+ { 0x3d400180, 0x190000c },
+ { 0x3d400184, 0x14030d4 },
+ { 0x3d400188, 0x0 },
+ { 0x3d400190, 0x4898204 },
+ { 0x3d400194, 0x80303 },
+ { 0x3d4001b4, 0x904 },
+ { 0x3d4001a0, 0xe0400018 },
+ { 0x3d4001a4, 0xdf00e4 },
+ { 0x3d4001a8, 0x80000000 },
+ { 0x3d4001b0, 0x11 },
+ { 0x3d4001c0, 0x1 },
+ { 0x3d4001c4, 0x1 },
+ { 0x3d4000f4, 0xc99 },
+ { 0x3d400108, 0x4070f0f },
+ { 0x3d400200, 0x17 },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400204, 0x80808 },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x7070707 },
+ { 0x3d400250, 0x29001701 },
+ { 0x3d400254, 0x2c },
+ { 0x3d40025c, 0x4000030 },
+ { 0x3d400264, 0x900093e7 },
+ { 0x3d40026c, 0x2005574 },
+ { 0x3d400400, 0x111 },
+ { 0x3d400408, 0x72ff },
+ { 0x3d400494, 0x2100e07 },
+ { 0x3d400498, 0x620096 },
+ { 0x3d40049c, 0x1100e07 },
+ { 0x3d4004a0, 0xc8012c },
+ { 0x3d402020, 0x11 },
+ { 0x3d402024, 0x7d00 },
+ { 0x3d402050, 0x20d040 },
+ { 0x3d402064, 0xc001c },
+ { 0x3d4020dc, 0x840000 },
+ { 0x3d4020e0, 0x310000 },
+ { 0x3d4020e8, 0x66004d },
+ { 0x3d4020ec, 0x16004d },
+ { 0x3d402100, 0xa040305 },
+ { 0x3d402104, 0x30407 },
+ { 0x3d402108, 0x203060b },
+ { 0x3d40210c, 0x505000 },
+ { 0x3d402110, 0x2040202 },
+ { 0x3d402114, 0x2030202 },
+ { 0x3d402118, 0x1010004 },
+ { 0x3d40211c, 0x301 },
+ { 0x3d402130, 0x20300 },
+ { 0x3d402134, 0xa100002 },
+ { 0x3d402138, 0x1d },
+ { 0x3d402144, 0x14000a },
+ { 0x3d402180, 0x640004 },
+ { 0x3d402190, 0x3818200 },
+ { 0x3d402194, 0x80303 },
+ { 0x3d4021b4, 0x100 },
+ { 0x3d4020f4, 0xc99 },
+ { 0x3d403020, 0x11 },
+ { 0x3d403024, 0x1f40 },
+ { 0x3d403050, 0x20d040 },
+ { 0x3d403064, 0x30007 },
+ { 0x3d4030dc, 0x840000 },
+ { 0x3d4030e0, 0x310000 },
+ { 0x3d4030e8, 0x66004d },
+ { 0x3d4030ec, 0x16004d },
+ { 0x3d403100, 0xa010102 },
+ { 0x3d403104, 0x30404 },
+ { 0x3d403108, 0x203060b },
+ { 0x3d40310c, 0x505000 },
+ { 0x3d403110, 0x2040202 },
+ { 0x3d403114, 0x2030202 },
+ { 0x3d403118, 0x1010004 },
+ { 0x3d40311c, 0x301 },
+ { 0x3d403130, 0x20300 },
+ { 0x3d403134, 0xa100002 },
+ { 0x3d403138, 0x8 },
+ { 0x3d403144, 0x50003 },
+ { 0x3d403180, 0x190004 },
+ { 0x3d403190, 0x3818200 },
+ { 0x3d403194, 0x80303 },
+ { 0x3d4031b4, 0x100 },
+ { 0x3d4030f4, 0xc99 },
+ { 0x3d400028, 0x0 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x1 },
+ { 0x100a2, 0x2 },
+ { 0x100a3, 0x3 },
+ { 0x100a4, 0x4 },
+ { 0x100a5, 0x5 },
+ { 0x100a6, 0x6 },
+ { 0x100a7, 0x7 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x1 },
+ { 0x110a2, 0x3 },
+ { 0x110a3, 0x4 },
+ { 0x110a4, 0x5 },
+ { 0x110a5, 0x2 },
+ { 0x110a6, 0x7 },
+ { 0x110a7, 0x6 },
+ { 0x1005f, 0x1ff },
+ { 0x1015f, 0x1ff },
+ { 0x1105f, 0x1ff },
+ { 0x1115f, 0x1ff },
+ { 0x11005f, 0x1ff },
+ { 0x11015f, 0x1ff },
+ { 0x11105f, 0x1ff },
+ { 0x11115f, 0x1ff },
+ { 0x21005f, 0x1ff },
+ { 0x21015f, 0x1ff },
+ { 0x21105f, 0x1ff },
+ { 0x21115f, 0x1ff },
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x3055, 0x1ff },
+ { 0x4055, 0x1ff },
+ { 0x5055, 0x1ff },
+ { 0x6055, 0x1ff },
+ { 0x7055, 0x1ff },
+ { 0x8055, 0x1ff },
+ { 0x9055, 0x1ff },
+ { 0x200c5, 0xb },
+ { 0x1200c5, 0x7 },
+ { 0x2200c5, 0x7 },
+ { 0x2002e, 0x1 },
+ { 0x12002e, 0x2 },
+ { 0x22002e, 0x2 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x20024, 0x1a3 },
+ { 0x2003a, 0x2 },
+ { 0x120024, 0x1a3 },
+ { 0x2003a, 0x2 },
+ { 0x220024, 0x1a3 },
+ { 0x2003a, 0x2 },
+ { 0x20056, 0x3 },
+ { 0x120056, 0x3 },
+ { 0x220056, 0x3 },
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x11004d, 0xe00 },
+ { 0x11014d, 0xe00 },
+ { 0x11104d, 0xe00 },
+ { 0x11114d, 0xe00 },
+ { 0x21004d, 0xe00 },
+ { 0x21014d, 0xe00 },
+ { 0x21104d, 0xe00 },
+ { 0x21114d, 0xe00 },
+ { 0x10049, 0xeba },
+ { 0x10149, 0xeba },
+ { 0x11049, 0xeba },
+ { 0x11149, 0xeba },
+ { 0x110049, 0xeba },
+ { 0x110149, 0xeba },
+ { 0x111049, 0xeba },
+ { 0x111149, 0xeba },
+ { 0x210049, 0xeba },
+ { 0x210149, 0xeba },
+ { 0x211049, 0xeba },
+ { 0x211149, 0xeba },
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+ { 0x20018, 0x1 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x190 },
+ { 0x120008, 0x64 },
+ { 0x220008, 0x19 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0xdc },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x1200b2, 0xdc },
+ { 0x110043, 0x5a1 },
+ { 0x110143, 0x5a1 },
+ { 0x111043, 0x5a1 },
+ { 0x111143, 0x5a1 },
+ { 0x2200b2, 0xdc },
+ { 0x210043, 0x5a1 },
+ { 0x210143, 0x5a1 },
+ { 0x211043, 0x5a1 },
+ { 0x211143, 0x5a1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x2200fa, 0x1 },
+ { 0x20019, 0x1 },
+ { 0x120019, 0x1 },
+ { 0x220019, 0x1 },
+ { 0x200f0, 0x660 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5665 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x22002d, 0x0 },
+ { 0x2005b, 0x7529 },
+ { 0x2005c, 0x0 },
+ { 0x200c7, 0x21 },
+ { 0x200ca, 0x24 },
+ { 0x200cc, 0x1f7 },
+ { 0x1200c7, 0x21 },
+ { 0x1200ca, 0x24 },
+ { 0x1200cc, 0x1f7 },
+ { 0x2200c7, 0x21 },
+ { 0x2200ca, 0x24 },
+ { 0x2200cc, 0x1f7 },
+ { 0x2007d, 0x212 },
+ { 0x12007d, 0x212 },
+ { 0x22007d, 0x212 },
+ { 0x2007c, 0x61 },
+ { 0x12007c, 0x61 },
+ { 0x22007c, 0x61 },
+ { 0x1004a, 0x500 },
+ { 0x1104a, 0x500 },
+ { 0x2002c, 0x0 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ {0x0200b2, 0x0},
+ {0x1200b2, 0x0},
+ {0x2200b2, 0x0},
+ {0x0200cb, 0x0},
+ {0x010043, 0x0},
+ {0x110043, 0x0},
+ {0x210043, 0x0},
+ {0x010143, 0x0},
+ {0x110143, 0x0},
+ {0x210143, 0x0},
+ {0x011043, 0x0},
+ {0x111043, 0x0},
+ {0x211043, 0x0},
+ {0x011143, 0x0},
+ {0x111143, 0x0},
+ {0x211143, 0x0},
+ {0x000080, 0x0},
+ {0x100080, 0x0},
+ {0x200080, 0x0},
+ {0x001080, 0x0},
+ {0x101080, 0x0},
+ {0x201080, 0x0},
+ {0x002080, 0x0},
+ {0x102080, 0x0},
+ {0x202080, 0x0},
+ {0x003080, 0x0},
+ {0x103080, 0x0},
+ {0x203080, 0x0},
+ {0x004080, 0x0},
+ {0x104080, 0x0},
+ {0x204080, 0x0},
+ {0x005080, 0x0},
+ {0x105080, 0x0},
+ {0x205080, 0x0},
+ {0x006080, 0x0},
+ {0x106080, 0x0},
+ {0x206080, 0x0},
+ {0x007080, 0x0},
+ {0x107080, 0x0},
+ {0x207080, 0x0},
+ {0x008080, 0x0},
+ {0x108080, 0x0},
+ {0x208080, 0x0},
+ {0x009080, 0x0},
+ {0x109080, 0x0},
+ {0x209080, 0x0},
+ {0x010080, 0x0},
+ {0x110080, 0x0},
+ {0x210080, 0x0},
+ {0x010180, 0x0},
+ {0x110180, 0x0},
+ {0x210180, 0x0},
+ {0x011080, 0x0},
+ {0x111080, 0x0},
+ {0x211080, 0x0},
+ {0x011180, 0x0},
+ {0x111180, 0x0},
+ {0x211180, 0x0},
+ {0x010081, 0x0},
+ {0x110081, 0x0},
+ {0x210081, 0x0},
+ {0x010181, 0x0},
+ {0x110181, 0x0},
+ {0x210181, 0x0},
+ {0x011081, 0x0},
+ {0x111081, 0x0},
+ {0x211081, 0x0},
+ {0x011181, 0x0},
+ {0x111181, 0x0},
+ {0x211181, 0x0},
+ {0x0100d0, 0x0},
+ {0x1100d0, 0x0},
+ {0x2100d0, 0x0},
+ {0x0101d0, 0x0},
+ {0x1101d0, 0x0},
+ {0x2101d0, 0x0},
+ {0x0110d0, 0x0},
+ {0x1110d0, 0x0},
+ {0x2110d0, 0x0},
+ {0x0111d0, 0x0},
+ {0x1111d0, 0x0},
+ {0x2111d0, 0x0},
+ {0x0100d1, 0x0},
+ {0x1100d1, 0x0},
+ {0x2100d1, 0x0},
+ {0x0101d1, 0x0},
+ {0x1101d1, 0x0},
+ {0x2101d1, 0x0},
+ {0x0110d1, 0x0},
+ {0x1110d1, 0x0},
+ {0x2110d1, 0x0},
+ {0x0111d1, 0x0},
+ {0x1111d1, 0x0},
+ {0x2111d1, 0x0},
+ {0x010068, 0x0},
+ {0x010168, 0x0},
+ {0x010268, 0x0},
+ {0x010368, 0x0},
+ {0x010468, 0x0},
+ {0x010568, 0x0},
+ {0x010668, 0x0},
+ {0x010768, 0x0},
+ {0x010868, 0x0},
+ {0x011068, 0x0},
+ {0x011168, 0x0},
+ {0x011268, 0x0},
+ {0x011368, 0x0},
+ {0x011468, 0x0},
+ {0x011568, 0x0},
+ {0x011668, 0x0},
+ {0x011768, 0x0},
+ {0x011868, 0x0},
+ {0x010069, 0x0},
+ {0x010169, 0x0},
+ {0x010269, 0x0},
+ {0x010369, 0x0},
+ {0x010469, 0x0},
+ {0x010569, 0x0},
+ {0x010669, 0x0},
+ {0x010769, 0x0},
+ {0x010869, 0x0},
+ {0x011069, 0x0},
+ {0x011169, 0x0},
+ {0x011269, 0x0},
+ {0x011369, 0x0},
+ {0x011469, 0x0},
+ {0x011569, 0x0},
+ {0x011669, 0x0},
+ {0x011769, 0x0},
+ {0x011869, 0x0},
+ {0x01008c, 0x0},
+ {0x11008c, 0x0},
+ {0x21008c, 0x0},
+ {0x01018c, 0x0},
+ {0x11018c, 0x0},
+ {0x21018c, 0x0},
+ {0x01108c, 0x0},
+ {0x11108c, 0x0},
+ {0x21108c, 0x0},
+ {0x01118c, 0x0},
+ {0x11118c, 0x0},
+ {0x21118c, 0x0},
+ {0x01008d, 0x0},
+ {0x11008d, 0x0},
+ {0x21008d, 0x0},
+ {0x01018d, 0x0},
+ {0x11018d, 0x0},
+ {0x21018d, 0x0},
+ {0x01108d, 0x0},
+ {0x11108d, 0x0},
+ {0x21108d, 0x0},
+ {0x01118d, 0x0},
+ {0x11118d, 0x0},
+ {0x21118d, 0x0},
+ {0x0100c0, 0x0},
+ {0x1100c0, 0x0},
+ {0x2100c0, 0x0},
+ {0x0101c0, 0x0},
+ {0x1101c0, 0x0},
+ {0x2101c0, 0x0},
+ {0x0102c0, 0x0},
+ {0x1102c0, 0x0},
+ {0x2102c0, 0x0},
+ {0x0103c0, 0x0},
+ {0x1103c0, 0x0},
+ {0x2103c0, 0x0},
+ {0x0104c0, 0x0},
+ {0x1104c0, 0x0},
+ {0x2104c0, 0x0},
+ {0x0105c0, 0x0},
+ {0x1105c0, 0x0},
+ {0x2105c0, 0x0},
+ {0x0106c0, 0x0},
+ {0x1106c0, 0x0},
+ {0x2106c0, 0x0},
+ {0x0107c0, 0x0},
+ {0x1107c0, 0x0},
+ {0x2107c0, 0x0},
+ {0x0108c0, 0x0},
+ {0x1108c0, 0x0},
+ {0x2108c0, 0x0},
+ {0x0110c0, 0x0},
+ {0x1110c0, 0x0},
+ {0x2110c0, 0x0},
+ {0x0111c0, 0x0},
+ {0x1111c0, 0x0},
+ {0x2111c0, 0x0},
+ {0x0112c0, 0x0},
+ {0x1112c0, 0x0},
+ {0x2112c0, 0x0},
+ {0x0113c0, 0x0},
+ {0x1113c0, 0x0},
+ {0x2113c0, 0x0},
+ {0x0114c0, 0x0},
+ {0x1114c0, 0x0},
+ {0x2114c0, 0x0},
+ {0x0115c0, 0x0},
+ {0x1115c0, 0x0},
+ {0x2115c0, 0x0},
+ {0x0116c0, 0x0},
+ {0x1116c0, 0x0},
+ {0x2116c0, 0x0},
+ {0x0117c0, 0x0},
+ {0x1117c0, 0x0},
+ {0x2117c0, 0x0},
+ {0x0118c0, 0x0},
+ {0x1118c0, 0x0},
+ {0x2118c0, 0x0},
+ {0x0100c1, 0x0},
+ {0x1100c1, 0x0},
+ {0x2100c1, 0x0},
+ {0x0101c1, 0x0},
+ {0x1101c1, 0x0},
+ {0x2101c1, 0x0},
+ {0x0102c1, 0x0},
+ {0x1102c1, 0x0},
+ {0x2102c1, 0x0},
+ {0x0103c1, 0x0},
+ {0x1103c1, 0x0},
+ {0x2103c1, 0x0},
+ {0x0104c1, 0x0},
+ {0x1104c1, 0x0},
+ {0x2104c1, 0x0},
+ {0x0105c1, 0x0},
+ {0x1105c1, 0x0},
+ {0x2105c1, 0x0},
+ {0x0106c1, 0x0},
+ {0x1106c1, 0x0},
+ {0x2106c1, 0x0},
+ {0x0107c1, 0x0},
+ {0x1107c1, 0x0},
+ {0x2107c1, 0x0},
+ {0x0108c1, 0x0},
+ {0x1108c1, 0x0},
+ {0x2108c1, 0x0},
+ {0x0110c1, 0x0},
+ {0x1110c1, 0x0},
+ {0x2110c1, 0x0},
+ {0x0111c1, 0x0},
+ {0x1111c1, 0x0},
+ {0x2111c1, 0x0},
+ {0x0112c1, 0x0},
+ {0x1112c1, 0x0},
+ {0x2112c1, 0x0},
+ {0x0113c1, 0x0},
+ {0x1113c1, 0x0},
+ {0x2113c1, 0x0},
+ {0x0114c1, 0x0},
+ {0x1114c1, 0x0},
+ {0x2114c1, 0x0},
+ {0x0115c1, 0x0},
+ {0x1115c1, 0x0},
+ {0x2115c1, 0x0},
+ {0x0116c1, 0x0},
+ {0x1116c1, 0x0},
+ {0x2116c1, 0x0},
+ {0x0117c1, 0x0},
+ {0x1117c1, 0x0},
+ {0x2117c1, 0x0},
+ {0x0118c1, 0x0},
+ {0x1118c1, 0x0},
+ {0x2118c1, 0x0},
+ {0x010020, 0x0},
+ {0x110020, 0x0},
+ {0x210020, 0x0},
+ {0x011020, 0x0},
+ {0x111020, 0x0},
+ {0x211020, 0x0},
+ {0x020072, 0x0},
+ {0x020073, 0x0},
+ {0x020074, 0x0},
+ {0x0100aa, 0x0},
+ {0x0110aa, 0x0},
+ {0x020010, 0x0},
+ {0x120010, 0x0},
+ {0x220010, 0x0},
+ {0x020011, 0x0},
+ {0x120011, 0x0},
+ {0x220011, 0x0},
+ {0x0100ae, 0x0},
+ {0x1100ae, 0x0},
+ {0x2100ae, 0x0},
+ {0x0100af, 0x0},
+ {0x1100af, 0x0},
+ {0x2100af, 0x0},
+ {0x0110ae, 0x0},
+ {0x1110ae, 0x0},
+ {0x2110ae, 0x0},
+ {0x0110af, 0x0},
+ {0x1110af, 0x0},
+ {0x2110af, 0x0},
+ {0x020020, 0x0},
+ {0x120020, 0x0},
+ {0x220020, 0x0},
+ {0x0100a0, 0x0},
+ {0x0100a1, 0x0},
+ {0x0100a2, 0x0},
+ {0x0100a3, 0x0},
+ {0x0100a4, 0x0},
+ {0x0100a5, 0x0},
+ {0x0100a6, 0x0},
+ {0x0100a7, 0x0},
+ {0x0110a0, 0x0},
+ {0x0110a1, 0x0},
+ {0x0110a2, 0x0},
+ {0x0110a3, 0x0},
+ {0x0110a4, 0x0},
+ {0x0110a5, 0x0},
+ {0x0110a6, 0x0},
+ {0x0110a7, 0x0},
+ {0x02007c, 0x0},
+ {0x12007c, 0x0},
+ {0x22007c, 0x0},
+ {0x02007d, 0x0},
+ {0x12007d, 0x0},
+ {0x22007d, 0x0},
+ {0x0400fd, 0x0},
+ {0x0400c0, 0x0},
+ {0x090201, 0x0},
+ {0x190201, 0x0},
+ {0x290201, 0x0},
+ {0x090202, 0x0},
+ {0x190202, 0x0},
+ {0x290202, 0x0},
+ {0x090203, 0x0},
+ {0x190203, 0x0},
+ {0x290203, 0x0},
+ {0x090204, 0x0},
+ {0x190204, 0x0},
+ {0x290204, 0x0},
+ {0x090205, 0x0},
+ {0x190205, 0x0},
+ {0x290205, 0x0},
+ {0x090206, 0x0},
+ {0x190206, 0x0},
+ {0x290206, 0x0},
+ {0x090207, 0x0},
+ {0x190207, 0x0},
+ {0x290207, 0x0},
+ {0x090208, 0x0},
+ {0x190208, 0x0},
+ {0x290208, 0x0},
+ {0x010062, 0x0},
+ {0x010162, 0x0},
+ {0x010262, 0x0},
+ {0x010362, 0x0},
+ {0x010462, 0x0},
+ {0x010562, 0x0},
+ {0x010662, 0x0},
+ {0x010762, 0x0},
+ {0x010862, 0x0},
+ {0x011062, 0x0},
+ {0x011162, 0x0},
+ {0x011262, 0x0},
+ {0x011362, 0x0},
+ {0x011462, 0x0},
+ {0x011562, 0x0},
+ {0x011662, 0x0},
+ {0x011762, 0x0},
+ {0x011862, 0x0},
+ {0x020077, 0x0},
+ {0x010001, 0x0},
+ {0x011001, 0x0},
+ {0x010040, 0x0},
+ {0x010140, 0x0},
+ {0x010240, 0x0},
+ {0x010340, 0x0},
+ {0x010440, 0x0},
+ {0x010540, 0x0},
+ {0x010640, 0x0},
+ {0x010740, 0x0},
+ {0x010840, 0x0},
+ {0x010030, 0x0},
+ {0x010130, 0x0},
+ {0x010230, 0x0},
+ {0x010330, 0x0},
+ {0x010430, 0x0},
+ {0x010530, 0x0},
+ {0x010630, 0x0},
+ {0x010730, 0x0},
+ {0x010830, 0x0},
+ {0x011040, 0x0},
+ {0x011140, 0x0},
+ {0x011240, 0x0},
+ {0x011340, 0x0},
+ {0x011440, 0x0},
+ {0x011540, 0x0},
+ {0x011640, 0x0},
+ {0x011740, 0x0},
+ {0x011840, 0x0},
+ {0x011030, 0x0},
+ {0x011130, 0x0},
+ {0x011230, 0x0},
+ {0x011330, 0x0},
+ {0x011430, 0x0},
+ {0x011530, 0x0},
+ {0x011630, 0x0},
+ {0x011730, 0x0},
+ {0x011830, 0x0},
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x640 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x131f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x12a4 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x12a4 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x54032, 0xa400 },
+ { 0x54033, 0x3112 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xa400 },
+ { 0x54039, 0x3112 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x101 },
+ { 0x54003, 0x190 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3100 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3100 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P2 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp2_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x102 },
+ { 0x54003, 0x64 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3100 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3100 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x640 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x11 },
+ { 0x54008, 0x61 },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54010, 0x1f7f },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x12a4 },
+ { 0x5401a, 0x31 },
+ { 0x5401b, 0x4d66 },
+ { 0x5401c, 0x4d00 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x12a4 },
+ { 0x54020, 0x31 },
+ { 0x54021, 0x4d66 },
+ { 0x54022, 0x4d00 },
+ { 0x54024, 0x16 },
+ { 0x54032, 0xa400 },
+ { 0x54033, 0x3112 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x4d },
+ { 0x54036, 0x4d },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xa400 },
+ { 0x54039, 0x3112 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x4d },
+ { 0x5403c, 0x4d },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xb },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x633 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x633 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x633 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x45a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x448 },
+ { 0x90055, 0x109 },
+ { 0x90056, 0x40 },
+ { 0x90057, 0x633 },
+ { 0x90058, 0x179 },
+ { 0x90059, 0x1 },
+ { 0x9005a, 0x618 },
+ { 0x9005b, 0x109 },
+ { 0x9005c, 0x40c0 },
+ { 0x9005d, 0x633 },
+ { 0x9005e, 0x149 },
+ { 0x9005f, 0x8 },
+ { 0x90060, 0x4 },
+ { 0x90061, 0x48 },
+ { 0x90062, 0x4040 },
+ { 0x90063, 0x633 },
+ { 0x90064, 0x149 },
+ { 0x90065, 0x0 },
+ { 0x90066, 0x4 },
+ { 0x90067, 0x48 },
+ { 0x90068, 0x40 },
+ { 0x90069, 0x633 },
+ { 0x9006a, 0x149 },
+ { 0x9006b, 0x10 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x18 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x4 },
+ { 0x90070, 0x78 },
+ { 0x90071, 0x549 },
+ { 0x90072, 0x633 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0xd49 },
+ { 0x90075, 0x633 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x94a },
+ { 0x90078, 0x633 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0x441 },
+ { 0x9007b, 0x633 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x42 },
+ { 0x9007e, 0x633 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x1 },
+ { 0x90081, 0x633 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x0 },
+ { 0x90084, 0xe0 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0xa },
+ { 0x90087, 0x10 },
+ { 0x90088, 0x109 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x149 },
+ { 0x9008c, 0x9 },
+ { 0x9008d, 0x3c0 },
+ { 0x9008e, 0x159 },
+ { 0x9008f, 0x18 },
+ { 0x90090, 0x10 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x0 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x109 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x48 },
+ { 0x90098, 0x18 },
+ { 0x90099, 0x4 },
+ { 0x9009a, 0x58 },
+ { 0x9009b, 0xb },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x1 },
+ { 0x9009f, 0x10 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x5 },
+ { 0x900a2, 0x7c0 },
+ { 0x900a3, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x625 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x625 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900a4, 0x0 },
+ { 0x900a5, 0x790 },
+ { 0x900a6, 0x11a },
+ { 0x900a7, 0x8 },
+ { 0x900a8, 0x7aa },
+ { 0x900a9, 0x2a },
+ { 0x900aa, 0x10 },
+ { 0x900ab, 0x7b2 },
+ { 0x900ac, 0x2a },
+ { 0x900ad, 0x0 },
+ { 0x900ae, 0x7c8 },
+ { 0x900af, 0x109 },
+ { 0x900b0, 0x10 },
+ { 0x900b1, 0x10 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x10 },
+ { 0x900b4, 0x2a8 },
+ { 0x900b5, 0x129 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0x370 },
+ { 0x900b8, 0x129 },
+ { 0x900b9, 0xa },
+ { 0x900ba, 0x3c8 },
+ { 0x900bb, 0x1a9 },
+ { 0x900bc, 0xc },
+ { 0x900bd, 0x408 },
+ { 0x900be, 0x199 },
+ { 0x900bf, 0x14 },
+ { 0x900c0, 0x790 },
+ { 0x900c1, 0x11a },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x18 },
+ { 0x900c5, 0xe },
+ { 0x900c6, 0x408 },
+ { 0x900c7, 0x199 },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x8568 },
+ { 0x900ca, 0x108 },
+ { 0x900cb, 0x18 },
+ { 0x900cc, 0x790 },
+ { 0x900cd, 0x16a },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x1d8 },
+ { 0x900d0, 0x169 },
+ { 0x900d1, 0x10 },
+ { 0x900d2, 0x8558 },
+ { 0x900d3, 0x168 },
+ { 0x900d4, 0x70 },
+ { 0x900d5, 0x788 },
+ { 0x900d6, 0x16a },
+ { 0x900d7, 0x1ff8 },
+ { 0x900d8, 0x85a8 },
+ { 0x900d9, 0x1e8 },
+ { 0x900da, 0x50 },
+ { 0x900db, 0x798 },
+ { 0x900dc, 0x16a },
+ { 0x900dd, 0x60 },
+ { 0x900de, 0x7a0 },
+ { 0x900df, 0x16a },
+ { 0x900e0, 0x8 },
+ { 0x900e1, 0x8310 },
+ { 0x900e2, 0x168 },
+ { 0x900e3, 0x8 },
+ { 0x900e4, 0xa310 },
+ { 0x900e5, 0x168 },
+ { 0x900e6, 0xa },
+ { 0x900e7, 0x408 },
+ { 0x900e8, 0x169 },
+ { 0x900e9, 0x6e },
+ { 0x900ea, 0x0 },
+ { 0x900eb, 0x68 },
+ { 0x900ec, 0x0 },
+ { 0x900ed, 0x408 },
+ { 0x900ee, 0x169 },
+ { 0x900ef, 0x0 },
+ { 0x900f0, 0x8310 },
+ { 0x900f1, 0x168 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0xa310 },
+ { 0x900f4, 0x168 },
+ { 0x900f5, 0x1ff8 },
+ { 0x900f6, 0x85a8 },
+ { 0x900f7, 0x1e8 },
+ { 0x900f8, 0x68 },
+ { 0x900f9, 0x798 },
+ { 0x900fa, 0x16a },
+ { 0x900fb, 0x78 },
+ { 0x900fc, 0x7a0 },
+ { 0x900fd, 0x16a },
+ { 0x900fe, 0x68 },
+ { 0x900ff, 0x790 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x8 },
+ { 0x90102, 0x8b10 },
+ { 0x90103, 0x168 },
+ { 0x90104, 0x8 },
+ { 0x90105, 0xab10 },
+ { 0x90106, 0x168 },
+ { 0x90107, 0xa },
+ { 0x90108, 0x408 },
+ { 0x90109, 0x169 },
+ { 0x9010a, 0x58 },
+ { 0x9010b, 0x0 },
+ { 0x9010c, 0x68 },
+ { 0x9010d, 0x0 },
+ { 0x9010e, 0x408 },
+ { 0x9010f, 0x169 },
+ { 0x90110, 0x0 },
+ { 0x90111, 0x8b10 },
+ { 0x90112, 0x168 },
+ { 0x90113, 0x0 },
+ { 0x90114, 0xab10 },
+ { 0x90115, 0x168 },
+ { 0x90116, 0x0 },
+ { 0x90117, 0x1d8 },
+ { 0x90118, 0x169 },
+ { 0x90119, 0x80 },
+ { 0x9011a, 0x790 },
+ { 0x9011b, 0x16a },
+ { 0x9011c, 0x18 },
+ { 0x9011d, 0x7aa },
+ { 0x9011e, 0x6a },
+ { 0x9011f, 0xa },
+ { 0x90120, 0x0 },
+ { 0x90121, 0x1e9 },
+ { 0x90122, 0x8 },
+ { 0x90123, 0x8080 },
+ { 0x90124, 0x108 },
+ { 0x90125, 0xf },
+ { 0x90126, 0x408 },
+ { 0x90127, 0x169 },
+ { 0x90128, 0xc },
+ { 0x90129, 0x0 },
+ { 0x9012a, 0x68 },
+ { 0x9012b, 0x9 },
+ { 0x9012c, 0x0 },
+ { 0x9012d, 0x1a9 },
+ { 0x9012e, 0x0 },
+ { 0x9012f, 0x408 },
+ { 0x90130, 0x169 },
+ { 0x90131, 0x0 },
+ { 0x90132, 0x8080 },
+ { 0x90133, 0x108 },
+ { 0x90134, 0x8 },
+ { 0x90135, 0x7aa },
+ { 0x90136, 0x6a },
+ { 0x90137, 0x0 },
+ { 0x90138, 0x8568 },
+ { 0x90139, 0x108 },
+ { 0x9013a, 0xb7 },
+ { 0x9013b, 0x790 },
+ { 0x9013c, 0x16a },
+ { 0x9013d, 0x1f },
+ { 0x9013e, 0x0 },
+ { 0x9013f, 0x68 },
+ { 0x90140, 0x8 },
+ { 0x90141, 0x8558 },
+ { 0x90142, 0x168 },
+ { 0x90143, 0xf },
+ { 0x90144, 0x408 },
+ { 0x90145, 0x169 },
+ { 0x90146, 0xd },
+ { 0x90147, 0x0 },
+ { 0x90148, 0x68 },
+ { 0x90149, 0x0 },
+ { 0x9014a, 0x408 },
+ { 0x9014b, 0x169 },
+ { 0x9014c, 0x0 },
+ { 0x9014d, 0x8558 },
+ { 0x9014e, 0x168 },
+ { 0x9014f, 0x8 },
+ { 0x90150, 0x3c8 },
+ { 0x90151, 0x1a9 },
+ { 0x90152, 0x3 },
+ { 0x90153, 0x370 },
+ { 0x90154, 0x129 },
+ { 0x90155, 0x20 },
+ { 0x90156, 0x2aa },
+ { 0x90157, 0x9 },
+ { 0x90158, 0x0 },
+ { 0x90159, 0x400 },
+ { 0x9015a, 0x10e },
+ { 0x9015b, 0x8 },
+ { 0x9015c, 0xe8 },
+ { 0x9015d, 0x109 },
+ { 0x9015e, 0x0 },
+ { 0x9015f, 0x8140 },
+ { 0x90160, 0x10c },
+ { 0x90161, 0x10 },
+ { 0x90162, 0x8138 },
+ { 0x90163, 0x10c },
+ { 0x90164, 0x8 },
+ { 0x90165, 0x7c8 },
+ { 0x90166, 0x101 },
+ { 0x90167, 0x8 },
+ { 0x90168, 0x448 },
+ { 0x90169, 0x109 },
+ { 0x9016a, 0xf },
+ { 0x9016b, 0x7c0 },
+ { 0x9016c, 0x109 },
+ { 0x9016d, 0x0 },
+ { 0x9016e, 0xe8 },
+ { 0x9016f, 0x109 },
+ { 0x90170, 0x47 },
+ { 0x90171, 0x630 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0x8 },
+ { 0x90174, 0x618 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x8 },
+ { 0x90177, 0xe0 },
+ { 0x90178, 0x109 },
+ { 0x90179, 0x0 },
+ { 0x9017a, 0x7c8 },
+ { 0x9017b, 0x109 },
+ { 0x9017c, 0x8 },
+ { 0x9017d, 0x8140 },
+ { 0x9017e, 0x10c },
+ { 0x9017f, 0x0 },
+ { 0x90180, 0x1 },
+ { 0x90181, 0x8 },
+ { 0x90182, 0x8 },
+ { 0x90183, 0x4 },
+ { 0x90184, 0x8 },
+ { 0x90185, 0x8 },
+ { 0x90186, 0x7c8 },
+ { 0x90187, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x29 },
+ { 0x90026, 0x6a },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+ { 0x2000b, 0x32 },
+ { 0x2000c, 0x64 },
+ { 0x2000d, 0x3e8 },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0xc },
+ { 0x12000c, 0x19 },
+ { 0x12000d, 0xfa },
+ { 0x12000e, 0x10 },
+ { 0x22000b, 0x3 },
+ { 0x22000c, 0x6 },
+ { 0x22000d, 0x3e },
+ { 0x22000e, 0x10 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x2060 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+ { 0x120010, 0x5a },
+ { 0x120011, 0x3 },
+ { 0x220010, 0x5a },
+ { 0x220011, 0x3 },
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x140080, 0xe0 },
+ { 0x140081, 0x12 },
+ { 0x140082, 0xe0 },
+ { 0x140083, 0x12 },
+ { 0x140084, 0xe0 },
+ { 0x140085, 0x12 },
+ { 0x240080, 0xe0 },
+ { 0x240081, 0x12 },
+ { 0x240082, 0xe0 },
+ { 0x240083, 0x12 },
+ { 0x240084, 0xe0 },
+ { 0x240085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x2 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 1600mts 1D */
+ .drate = 1600,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 400mts 1D */
+ .drate = 400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P2 100mts 1D */
+ .drate = 100,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp2_cfg),
+ },
+ {
+ /* P0 1600mts 2D */
+ .drate = 1600,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 1600, 400, 100, },
+};
diff --git a/board/freescale/imx8mn_evk/spl.c b/board/freescale/imx8mn_evk/spl.c
new file mode 100644
index 00000000000..231b9289eea
--- /dev/null
+++ b/board/freescale/imx8mn_evk/spl.c
@@ -0,0 +1,139 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+/*
+ * Copyright 2018-2019, 2021 NXP
+ *
+ */
+
+#include <command.h>
+#include <cpu_func.h>
+#include <hang.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx8mn_pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/arch/ddr.h>
+#include <asm/sections.h>
+
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+#include <power/pmic.h>
+#include <power/pca9450.h>
+#include <asm/mach-imx/gpio.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <fsl_esdhc_imx.h>
+#include <mmc.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int spl_board_boot_device(enum boot_device boot_dev_spl)
+{
+ return BOOT_DEVICE_BOOTROM;
+}
+
+void spl_dram_init(void)
+{
+ ddr_init(&dram_timing);
+}
+
+void spl_board_init(void)
+{
+ struct udevice *dev;
+ int ret;
+
+ arch_misc_init();
+
+ puts("Normal Boot\n");
+
+ ret = uclass_get_device_by_name(UCLASS_CLK,
+ "clock-controller@30380000",
+ &dev);
+ if (ret < 0)
+ printf("Failed to find clock node. Check device tree\n");
+}
+
+#if CONFIG_IS_ENABLED(DM_PMIC_PCA9450)
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+
+ ret = pmic_get("pmic@25", &dev);
+ if (ret == -ENODEV) {
+ puts("No pca9450@25\n");
+ return 0;
+ }
+ if (ret != 0)
+ return ret;
+
+ /* BUCKxOUT_DVS0/1 control BUCK123 output */
+ pmic_reg_write(dev, PCA9450_BUCK123_DVS, 0x29);
+
+#ifdef CONFIG_IMX8MN_LOW_DRIVE_MODE
+ /* Set VDD_SOC/VDD_DRAM to 0.8v for low drive mode */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x10);
+#else
+ /* increase VDD_SOC/VDD_DRAM to typical value 0.95V before first DRAM access */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x1C);
+#endif
+ /* Set DVS1 to 0.85v for suspend */
+ /* Enable DVS control through PMIC_STBY_REQ and set B1_ENMODE=1 (ON by PMIC_ON_REQ=H) */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS1, 0x14);
+ pmic_reg_write(dev, PCA9450_BUCK1CTRL, 0x59);
+
+ /* set VDD_SNVS_0V8 from default 0.85V */
+ pmic_reg_write(dev, PCA9450_LDO2CTRL, 0xC0);
+
+ /* enable LDO4 to 1.2v */
+ pmic_reg_write(dev, PCA9450_LDO4CTRL, 0x44);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+void board_init_f(ulong dummy)
+{
+ int ret;
+
+ arch_cpu_init();
+
+ init_uart_clk(1);
+
+ timer_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ ret = spl_init();
+ if (ret) {
+ debug("spl_init() failed: %d\n", ret);
+ hang();
+ }
+
+ preloader_console_init();
+
+ enable_tzc380();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx8mp_evk/Kconfig b/board/freescale/imx8mp_evk/Kconfig
new file mode 100644
index 00000000000..cafa6329a40
--- /dev/null
+++ b/board/freescale/imx8mp_evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_IMX8MP_EVK
+
+config SYS_BOARD
+ default "imx8mp_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8mp_evk"
+
+config IMX_CONFIG
+ default "board/freescale/imx8mp_evk/imximage-8mp-lpddr4.cfg"
+
+endif
diff --git a/board/freescale/imx8mp_evk/MAINTAINERS b/board/freescale/imx8mp_evk/MAINTAINERS
new file mode 100644
index 00000000000..c2c7c830b5d
--- /dev/null
+++ b/board/freescale/imx8mp_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX8MP EVK BOARD
+M: Fabio Estevm <festevam@gmail.com>
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx8mp_evk/
+F: include/configs/imx8mp_evk.h
+F: configs/imx8mp_evk_defconfig
diff --git a/board/freescale/imx8mp_evk/Makefile b/board/freescale/imx8mp_evk/Makefile
new file mode 100644
index 00000000000..106bf9a1edf
--- /dev/null
+++ b/board/freescale/imx8mp_evk/Makefile
@@ -0,0 +1,12 @@
+#
+# Copyright 2019 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8mp_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+obj-$(CONFIG_IMX8M_LPDDR4) += lpddr4_timing.o
+endif
diff --git a/board/freescale/imx8mp_evk/imx8mp_evk.c b/board/freescale/imx8mp_evk/imx8mp_evk.c
new file mode 100644
index 00000000000..024b46ef8bc
--- /dev/null
+++ b/board/freescale/imx8mp_evk/imx8mp_evk.c
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+
+#include <env.h>
+
+int board_init(void)
+{
+ return 0;
+}
+
+int board_late_init(void)
+{
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "EVK");
+ env_set("board_rev", "iMX8MP");
+#endif
+
+ return 0;
+}
diff --git a/board/freescale/imx8mp_evk/imximage-8mp-lpddr4.cfg b/board/freescale/imx8mp_evk/imximage-8mp-lpddr4.cfg
new file mode 100644
index 00000000000..6dedf1724ab
--- /dev/null
+++ b/board/freescale/imx8mp_evk/imximage-8mp-lpddr4.cfg
@@ -0,0 +1,9 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2021 NXP
+ */
+
+
+ROM_VERSION v2
+BOOT_FROM sd
+LOADER u-boot-spl-ddr.bin 0x920000
diff --git a/board/freescale/imx8mp_evk/lpddr4_timing.c b/board/freescale/imx8mp_evk/lpddr4_timing.c
new file mode 100644
index 00000000000..8c5306d5d20
--- /dev/null
+++ b/board/freescale/imx8mp_evk/lpddr4_timing.c
@@ -0,0 +1,2048 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ { 0x3d400304, 0x1 },
+ { 0x3d400030, 0x1 },
+ { 0x3d400000, 0xa3080020 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x3d400020, 0x223 },
+ { 0x3d400024, 0x124f800 },
+ { 0x3d400064, 0x4900a8 },
+ { 0x3d400070, 0x1027f90 },
+ { 0x3d400074, 0x790 },
+ { 0x3d4000d0, 0xc0030495 },
+ { 0x3d4000d4, 0x770000 },
+ { 0x3d4000dc, 0xc40024 },
+#else
+ { 0x3d400020, 0x1323 },
+ { 0x3d400024, 0x1e84800 },
+ { 0x3d400064, 0x7a017c },
+#ifdef CONFIG_IMX8M_DRAM_INLINE_ECC
+ { 0x3d400070, 0x1027f54 },
+#else
+ { 0x3d400070, 0x1027f10 },
+#endif
+ { 0x3d400074, 0x7b0 },
+ { 0x3d4000d0, 0xc00307a3 },
+ { 0x3d4000d4, 0xc50000 },
+ { 0x3d4000dc, 0xf4003f },
+#endif
+ { 0x3d4000e0, 0x330000 },
+ { 0x3d4000e8, 0x660048 },
+ { 0x3d4000ec, 0x160048 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x3d400100, 0x1618141a },
+ { 0x3d400104, 0x504a6 },
+ { 0x3d40010c, 0x909000 },
+ { 0x3d400110, 0xb04060b },
+ { 0x3d400114, 0x2030909 },
+ { 0x3d400118, 0x1010006 },
+ { 0x3d40011c, 0x301 },
+ { 0x3d400130, 0x20500 },
+ { 0x3d400134, 0xb100002 },
+ { 0x3d400138, 0xad },
+ { 0x3d400144, 0x78003c },
+ { 0x3d400180, 0x2580012 },
+ { 0x3d400184, 0x1e0493e },
+ { 0x3d400188, 0x0 },
+ { 0x3d400190, 0x4938208 },
+ { 0x3d400194, 0x80303 },
+ { 0x3d4001b4, 0x1308 },
+#else
+ { 0x3d400100, 0x2028222a },
+ { 0x3d400104, 0x807bf },
+ { 0x3d40010c, 0xe0e000 },
+ { 0x3d400110, 0x12040a12 },
+ { 0x3d400114, 0x2050f0f },
+ { 0x3d400118, 0x1010009 },
+ { 0x3d40011c, 0x501 },
+ { 0x3d400130, 0x20800 },
+ { 0x3d400134, 0xe100002 },
+ { 0x3d400138, 0x184 },
+ { 0x3d400144, 0xc80064 },
+ { 0x3d400180, 0x3e8001e },
+ { 0x3d400184, 0x3207a12 },
+ { 0x3d400188, 0x0 },
+ { 0x3d400190, 0x49f820e },
+ { 0x3d400194, 0x80303 },
+ { 0x3d4001b4, 0x1f0e },
+#endif
+ { 0x3d4001a0, 0xe0400018 },
+ { 0x3d4001a4, 0xdf00e4 },
+ { 0x3d4001a8, 0x80000000 },
+ { 0x3d4001b0, 0x11 },
+ { 0x3d4001c0, 0x1 },
+ { 0x3d4001c4, 0x1 },
+ { 0x3d4000f4, 0xc99 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x3d400108, 0x60c1514 },
+ { 0x3d400200, 0x16 },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400204, 0x80808 },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x68070707 },
+ { 0x3d40021c, 0xf08 },
+ { 0x3d400250, 0x1f05 },
+ { 0x3d400254, 0x1f },
+ { 0x3d400264, 0x90003ff },
+ { 0x3d40026c, 0x20003ff },
+ { 0x3d400400, 0x111 },
+ { 0x3d400408, 0x72ff },
+ { 0x3d400494, 0x1000e00 },
+ { 0x3d400498, 0x3ff0000 },
+ { 0x3d40049c, 0x1000e00 },
+ { 0x3d4004a0, 0x3ff0000 },
+ { 0x3d402020, 0x21 },
+ { 0x3d402024, 0x30d400 },
+ { 0x3d402050, 0x20d000 },
+ { 0x3d402064, 0xc001c },
+#else
+ { 0x3d400108, 0x9121c1c },
+#ifdef CONFIG_IMX8M_DRAM_INLINE_ECC
+ { 0x3d400200, 0x13 },
+ { 0x3d40020c, 0x13131300 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400204, 0x50505 },
+ { 0x3d400214, 0x4040404 },
+ { 0x3d400218, 0x68040404 },
+#else
+ { 0x3d400200, 0x16 },
+ { 0x3d40020c, 0x0 },
+ { 0x3d400210, 0x1f1f },
+ { 0x3d400204, 0x80808 },
+ { 0x3d400214, 0x7070707 },
+ { 0x3d400218, 0x68070707 },
+#endif
+ { 0x3d40021c, 0xf08 },
+ { 0x3d400250, 0x1705 },
+ { 0x3d400254, 0x2c },
+ { 0x3d40025c, 0x4000030 },
+ { 0x3d400264, 0x900093e7 },
+ { 0x3d40026c, 0x2005574 },
+ { 0x3d400400, 0x111 },
+ { 0x3d400404, 0x72ff },
+ { 0x3d400408, 0x72ff },
+ { 0x3d400494, 0x2100e07 },
+ { 0x3d400498, 0x620096 },
+ { 0x3d40049c, 0x1100e07 },
+ { 0x3d4004a0, 0xc8012c },
+ { 0x3d402020, 0x1021 },
+ { 0x3d402024, 0x30d400 },
+ { 0x3d402050, 0x20d000 },
+ { 0x3d402064, 0xc0026 },
+#endif
+ { 0x3d4020dc, 0x840000 },
+ { 0x3d4020e0, 0x330000 },
+ { 0x3d4020e8, 0x660048 },
+ { 0x3d4020ec, 0x160048 },
+ { 0x3d402100, 0xa040305 },
+ { 0x3d402104, 0x30407 },
+ { 0x3d402108, 0x203060b },
+ { 0x3d40210c, 0x505000 },
+ { 0x3d402110, 0x2040202 },
+ { 0x3d402114, 0x2030202 },
+ { 0x3d402118, 0x1010004 },
+ { 0x3d40211c, 0x301 },
+ { 0x3d402130, 0x20300 },
+ { 0x3d402134, 0xa100002 },
+ { 0x3d402138, 0x27 },
+ { 0x3d402144, 0x14000a },
+ { 0x3d402180, 0x640004 },
+ { 0x3d402190, 0x3818200 },
+ { 0x3d402194, 0x80303 },
+ { 0x3d4021b4, 0x100 },
+ { 0x3d4020f4, 0xc99 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x3d403020, 0x21 },
+ { 0x3d403024, 0xc3500 },
+ { 0x3d403050, 0x20d000 },
+ { 0x3d403064, 0x30007 },
+#else
+ { 0x3d403020, 0x1021 },
+ { 0x3d403024, 0xc3500 },
+ { 0x3d403050, 0x20d000 },
+ { 0x3d403064, 0x3000a },
+#endif
+ { 0x3d4030dc, 0x840000 },
+ { 0x3d4030e0, 0x330000 },
+ { 0x3d4030e8, 0x660048 },
+ { 0x3d4030ec, 0x160048 },
+ { 0x3d403100, 0xa010102 },
+ { 0x3d403104, 0x30404 },
+ { 0x3d403108, 0x203060b },
+ { 0x3d40310c, 0x505000 },
+ { 0x3d403110, 0x2040202 },
+ { 0x3d403114, 0x2030202 },
+ { 0x3d403118, 0x1010004 },
+ { 0x3d40311c, 0x301 },
+ { 0x3d403130, 0x20300 },
+ { 0x3d403134, 0xa100002 },
+ { 0x3d403138, 0xa },
+ { 0x3d403144, 0x50003 },
+ { 0x3d403180, 0x190004 },
+ { 0x3d403190, 0x3818200 },
+ { 0x3d403194, 0x80303 },
+ { 0x3d4031b4, 0x100 },
+ { 0x3d4030f4, 0xc99 },
+ { 0x3d400028, 0x0 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x1 },
+ { 0x100a2, 0x2 },
+ { 0x100a3, 0x3 },
+ { 0x100a4, 0x4 },
+ { 0x100a5, 0x5 },
+ { 0x100a6, 0x6 },
+ { 0x100a7, 0x7 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x1 },
+ { 0x110a2, 0x3 },
+ { 0x110a3, 0x4 },
+ { 0x110a4, 0x5 },
+ { 0x110a5, 0x2 },
+ { 0x110a6, 0x7 },
+ { 0x110a7, 0x6 },
+ { 0x120a0, 0x0 },
+ { 0x120a1, 0x1 },
+ { 0x120a2, 0x3 },
+ { 0x120a3, 0x2 },
+ { 0x120a4, 0x5 },
+ { 0x120a5, 0x4 },
+ { 0x120a6, 0x7 },
+ { 0x120a7, 0x6 },
+ { 0x130a0, 0x0 },
+ { 0x130a1, 0x1 },
+ { 0x130a2, 0x2 },
+ { 0x130a3, 0x3 },
+ { 0x130a4, 0x4 },
+ { 0x130a5, 0x5 },
+ { 0x130a6, 0x6 },
+ { 0x130a7, 0x7 },
+ { 0x1005f, 0x1ff },
+ { 0x1015f, 0x1ff },
+ { 0x1105f, 0x1ff },
+ { 0x1115f, 0x1ff },
+ { 0x1205f, 0x1ff },
+ { 0x1215f, 0x1ff },
+ { 0x1305f, 0x1ff },
+ { 0x1315f, 0x1ff },
+ { 0x11005f, 0x1ff },
+ { 0x11015f, 0x1ff },
+ { 0x11105f, 0x1ff },
+ { 0x11115f, 0x1ff },
+ { 0x11205f, 0x1ff },
+ { 0x11215f, 0x1ff },
+ { 0x11305f, 0x1ff },
+ { 0x11315f, 0x1ff },
+ { 0x21005f, 0x1ff },
+ { 0x21015f, 0x1ff },
+ { 0x21105f, 0x1ff },
+ { 0x21115f, 0x1ff },
+ { 0x21205f, 0x1ff },
+ { 0x21215f, 0x1ff },
+ { 0x21305f, 0x1ff },
+ { 0x21315f, 0x1ff },
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x3055, 0x1ff },
+ { 0x4055, 0x1ff },
+ { 0x5055, 0x1ff },
+ { 0x6055, 0x1ff },
+ { 0x7055, 0x1ff },
+ { 0x8055, 0x1ff },
+ { 0x9055, 0x1ff },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x200c5, 0xa },
+#else
+ { 0x200c5, 0x18 },
+#endif
+ { 0x1200c5, 0x7 },
+ { 0x2200c5, 0x7 },
+ { 0x2002e, 0x2 },
+ { 0x12002e, 0x2 },
+ { 0x22002e, 0x2 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x20024, 0x1e3 },
+ { 0x2003a, 0x2 },
+ { 0x120024, 0x1e3 },
+ { 0x2003a, 0x2 },
+ { 0x220024, 0x1e3 },
+ { 0x2003a, 0x2 },
+ { 0x20056, 0x3 },
+ { 0x120056, 0x3 },
+ { 0x220056, 0x3 },
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x1204d, 0xe00 },
+ { 0x1214d, 0xe00 },
+ { 0x1304d, 0xe00 },
+ { 0x1314d, 0xe00 },
+ { 0x11004d, 0xe00 },
+ { 0x11014d, 0xe00 },
+ { 0x11104d, 0xe00 },
+ { 0x11114d, 0xe00 },
+ { 0x11204d, 0xe00 },
+ { 0x11214d, 0xe00 },
+ { 0x11304d, 0xe00 },
+ { 0x11314d, 0xe00 },
+ { 0x21004d, 0xe00 },
+ { 0x21014d, 0xe00 },
+ { 0x21104d, 0xe00 },
+ { 0x21114d, 0xe00 },
+ { 0x21204d, 0xe00 },
+ { 0x21214d, 0xe00 },
+ { 0x21304d, 0xe00 },
+ { 0x21314d, 0xe00 },
+ { 0x10049, 0xeba },
+ { 0x10149, 0xeba },
+ { 0x11049, 0xeba },
+ { 0x11149, 0xeba },
+ { 0x12049, 0xeba },
+ { 0x12149, 0xeba },
+ { 0x13049, 0xeba },
+ { 0x13149, 0xeba },
+ { 0x110049, 0xeba },
+ { 0x110149, 0xeba },
+ { 0x111049, 0xeba },
+ { 0x111149, 0xeba },
+ { 0x112049, 0xeba },
+ { 0x112149, 0xeba },
+ { 0x113049, 0xeba },
+ { 0x113149, 0xeba },
+ { 0x210049, 0xeba },
+ { 0x210149, 0xeba },
+ { 0x211049, 0xeba },
+ { 0x211149, 0xeba },
+ { 0x212049, 0xeba },
+ { 0x212149, 0xeba },
+ { 0x213049, 0xeba },
+ { 0x213149, 0xeba },
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+ { 0x20018, 0x3 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x20008, 0x258 },
+#else
+ { 0x20008, 0x3e8 },
+#endif
+ { 0x120008, 0x64 },
+ { 0x220008, 0x19 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x104 },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x12043, 0x5a1 },
+ { 0x12143, 0x5a1 },
+ { 0x13043, 0x5a1 },
+ { 0x13143, 0x5a1 },
+ { 0x1200b2, 0x104 },
+ { 0x110043, 0x5a1 },
+ { 0x110143, 0x5a1 },
+ { 0x111043, 0x5a1 },
+ { 0x111143, 0x5a1 },
+ { 0x112043, 0x5a1 },
+ { 0x112143, 0x5a1 },
+ { 0x113043, 0x5a1 },
+ { 0x113143, 0x5a1 },
+ { 0x2200b2, 0x104 },
+ { 0x210043, 0x5a1 },
+ { 0x210143, 0x5a1 },
+ { 0x211043, 0x5a1 },
+ { 0x211143, 0x5a1 },
+ { 0x212043, 0x5a1 },
+ { 0x212143, 0x5a1 },
+ { 0x213043, 0x5a1 },
+ { 0x213143, 0x5a1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x2200fa, 0x1 },
+ { 0x20019, 0x1 },
+ { 0x120019, 0x1 },
+ { 0x220019, 0x1 },
+ { 0x200f0, 0x660 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5665 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x22002d, 0x0 },
+ { 0x2007d, 0x212 },
+ { 0x12007d, 0x212 },
+ { 0x22007d, 0x212 },
+ { 0x2007c, 0x61 },
+ { 0x12007c, 0x61 },
+ { 0x22007c, 0x61 },
+ { 0x1004a, 0x500 },
+ { 0x1104a, 0x500 },
+ { 0x1204a, 0x500 },
+ { 0x1304a, 0x500 },
+ { 0x2002c, 0x0 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ { 0x200b2, 0x0 },
+ { 0x1200b2, 0x0 },
+ { 0x2200b2, 0x0 },
+ { 0x200cb, 0x0 },
+ { 0x10043, 0x0 },
+ { 0x110043, 0x0 },
+ { 0x210043, 0x0 },
+ { 0x10143, 0x0 },
+ { 0x110143, 0x0 },
+ { 0x210143, 0x0 },
+ { 0x11043, 0x0 },
+ { 0x111043, 0x0 },
+ { 0x211043, 0x0 },
+ { 0x11143, 0x0 },
+ { 0x111143, 0x0 },
+ { 0x211143, 0x0 },
+ { 0x12043, 0x0 },
+ { 0x112043, 0x0 },
+ { 0x212043, 0x0 },
+ { 0x12143, 0x0 },
+ { 0x112143, 0x0 },
+ { 0x212143, 0x0 },
+ { 0x13043, 0x0 },
+ { 0x113043, 0x0 },
+ { 0x213043, 0x0 },
+ { 0x13143, 0x0 },
+ { 0x113143, 0x0 },
+ { 0x213143, 0x0 },
+ { 0x80, 0x0 },
+ { 0x100080, 0x0 },
+ { 0x200080, 0x0 },
+ { 0x1080, 0x0 },
+ { 0x101080, 0x0 },
+ { 0x201080, 0x0 },
+ { 0x2080, 0x0 },
+ { 0x102080, 0x0 },
+ { 0x202080, 0x0 },
+ { 0x3080, 0x0 },
+ { 0x103080, 0x0 },
+ { 0x203080, 0x0 },
+ { 0x4080, 0x0 },
+ { 0x104080, 0x0 },
+ { 0x204080, 0x0 },
+ { 0x5080, 0x0 },
+ { 0x105080, 0x0 },
+ { 0x205080, 0x0 },
+ { 0x6080, 0x0 },
+ { 0x106080, 0x0 },
+ { 0x206080, 0x0 },
+ { 0x7080, 0x0 },
+ { 0x107080, 0x0 },
+ { 0x207080, 0x0 },
+ { 0x8080, 0x0 },
+ { 0x108080, 0x0 },
+ { 0x208080, 0x0 },
+ { 0x9080, 0x0 },
+ { 0x109080, 0x0 },
+ { 0x209080, 0x0 },
+ { 0x10080, 0x0 },
+ { 0x110080, 0x0 },
+ { 0x210080, 0x0 },
+ { 0x10180, 0x0 },
+ { 0x110180, 0x0 },
+ { 0x210180, 0x0 },
+ { 0x11080, 0x0 },
+ { 0x111080, 0x0 },
+ { 0x211080, 0x0 },
+ { 0x11180, 0x0 },
+ { 0x111180, 0x0 },
+ { 0x211180, 0x0 },
+ { 0x12080, 0x0 },
+ { 0x112080, 0x0 },
+ { 0x212080, 0x0 },
+ { 0x12180, 0x0 },
+ { 0x112180, 0x0 },
+ { 0x212180, 0x0 },
+ { 0x13080, 0x0 },
+ { 0x113080, 0x0 },
+ { 0x213080, 0x0 },
+ { 0x13180, 0x0 },
+ { 0x113180, 0x0 },
+ { 0x213180, 0x0 },
+ { 0x10081, 0x0 },
+ { 0x110081, 0x0 },
+ { 0x210081, 0x0 },
+ { 0x10181, 0x0 },
+ { 0x110181, 0x0 },
+ { 0x210181, 0x0 },
+ { 0x11081, 0x0 },
+ { 0x111081, 0x0 },
+ { 0x211081, 0x0 },
+ { 0x11181, 0x0 },
+ { 0x111181, 0x0 },
+ { 0x211181, 0x0 },
+ { 0x12081, 0x0 },
+ { 0x112081, 0x0 },
+ { 0x212081, 0x0 },
+ { 0x12181, 0x0 },
+ { 0x112181, 0x0 },
+ { 0x212181, 0x0 },
+ { 0x13081, 0x0 },
+ { 0x113081, 0x0 },
+ { 0x213081, 0x0 },
+ { 0x13181, 0x0 },
+ { 0x113181, 0x0 },
+ { 0x213181, 0x0 },
+ { 0x100d0, 0x0 },
+ { 0x1100d0, 0x0 },
+ { 0x2100d0, 0x0 },
+ { 0x101d0, 0x0 },
+ { 0x1101d0, 0x0 },
+ { 0x2101d0, 0x0 },
+ { 0x110d0, 0x0 },
+ { 0x1110d0, 0x0 },
+ { 0x2110d0, 0x0 },
+ { 0x111d0, 0x0 },
+ { 0x1111d0, 0x0 },
+ { 0x2111d0, 0x0 },
+ { 0x120d0, 0x0 },
+ { 0x1120d0, 0x0 },
+ { 0x2120d0, 0x0 },
+ { 0x121d0, 0x0 },
+ { 0x1121d0, 0x0 },
+ { 0x2121d0, 0x0 },
+ { 0x130d0, 0x0 },
+ { 0x1130d0, 0x0 },
+ { 0x2130d0, 0x0 },
+ { 0x131d0, 0x0 },
+ { 0x1131d0, 0x0 },
+ { 0x2131d0, 0x0 },
+ { 0x100d1, 0x0 },
+ { 0x1100d1, 0x0 },
+ { 0x2100d1, 0x0 },
+ { 0x101d1, 0x0 },
+ { 0x1101d1, 0x0 },
+ { 0x2101d1, 0x0 },
+ { 0x110d1, 0x0 },
+ { 0x1110d1, 0x0 },
+ { 0x2110d1, 0x0 },
+ { 0x111d1, 0x0 },
+ { 0x1111d1, 0x0 },
+ { 0x2111d1, 0x0 },
+ { 0x120d1, 0x0 },
+ { 0x1120d1, 0x0 },
+ { 0x2120d1, 0x0 },
+ { 0x121d1, 0x0 },
+ { 0x1121d1, 0x0 },
+ { 0x2121d1, 0x0 },
+ { 0x130d1, 0x0 },
+ { 0x1130d1, 0x0 },
+ { 0x2130d1, 0x0 },
+ { 0x131d1, 0x0 },
+ { 0x1131d1, 0x0 },
+ { 0x2131d1, 0x0 },
+ { 0x10068, 0x0 },
+ { 0x10168, 0x0 },
+ { 0x10268, 0x0 },
+ { 0x10368, 0x0 },
+ { 0x10468, 0x0 },
+ { 0x10568, 0x0 },
+ { 0x10668, 0x0 },
+ { 0x10768, 0x0 },
+ { 0x10868, 0x0 },
+ { 0x11068, 0x0 },
+ { 0x11168, 0x0 },
+ { 0x11268, 0x0 },
+ { 0x11368, 0x0 },
+ { 0x11468, 0x0 },
+ { 0x11568, 0x0 },
+ { 0x11668, 0x0 },
+ { 0x11768, 0x0 },
+ { 0x11868, 0x0 },
+ { 0x12068, 0x0 },
+ { 0x12168, 0x0 },
+ { 0x12268, 0x0 },
+ { 0x12368, 0x0 },
+ { 0x12468, 0x0 },
+ { 0x12568, 0x0 },
+ { 0x12668, 0x0 },
+ { 0x12768, 0x0 },
+ { 0x12868, 0x0 },
+ { 0x13068, 0x0 },
+ { 0x13168, 0x0 },
+ { 0x13268, 0x0 },
+ { 0x13368, 0x0 },
+ { 0x13468, 0x0 },
+ { 0x13568, 0x0 },
+ { 0x13668, 0x0 },
+ { 0x13768, 0x0 },
+ { 0x13868, 0x0 },
+ { 0x10069, 0x0 },
+ { 0x10169, 0x0 },
+ { 0x10269, 0x0 },
+ { 0x10369, 0x0 },
+ { 0x10469, 0x0 },
+ { 0x10569, 0x0 },
+ { 0x10669, 0x0 },
+ { 0x10769, 0x0 },
+ { 0x10869, 0x0 },
+ { 0x11069, 0x0 },
+ { 0x11169, 0x0 },
+ { 0x11269, 0x0 },
+ { 0x11369, 0x0 },
+ { 0x11469, 0x0 },
+ { 0x11569, 0x0 },
+ { 0x11669, 0x0 },
+ { 0x11769, 0x0 },
+ { 0x11869, 0x0 },
+ { 0x12069, 0x0 },
+ { 0x12169, 0x0 },
+ { 0x12269, 0x0 },
+ { 0x12369, 0x0 },
+ { 0x12469, 0x0 },
+ { 0x12569, 0x0 },
+ { 0x12669, 0x0 },
+ { 0x12769, 0x0 },
+ { 0x12869, 0x0 },
+ { 0x13069, 0x0 },
+ { 0x13169, 0x0 },
+ { 0x13269, 0x0 },
+ { 0x13369, 0x0 },
+ { 0x13469, 0x0 },
+ { 0x13569, 0x0 },
+ { 0x13669, 0x0 },
+ { 0x13769, 0x0 },
+ { 0x13869, 0x0 },
+ { 0x1008c, 0x0 },
+ { 0x11008c, 0x0 },
+ { 0x21008c, 0x0 },
+ { 0x1018c, 0x0 },
+ { 0x11018c, 0x0 },
+ { 0x21018c, 0x0 },
+ { 0x1108c, 0x0 },
+ { 0x11108c, 0x0 },
+ { 0x21108c, 0x0 },
+ { 0x1118c, 0x0 },
+ { 0x11118c, 0x0 },
+ { 0x21118c, 0x0 },
+ { 0x1208c, 0x0 },
+ { 0x11208c, 0x0 },
+ { 0x21208c, 0x0 },
+ { 0x1218c, 0x0 },
+ { 0x11218c, 0x0 },
+ { 0x21218c, 0x0 },
+ { 0x1308c, 0x0 },
+ { 0x11308c, 0x0 },
+ { 0x21308c, 0x0 },
+ { 0x1318c, 0x0 },
+ { 0x11318c, 0x0 },
+ { 0x21318c, 0x0 },
+ { 0x1008d, 0x0 },
+ { 0x11008d, 0x0 },
+ { 0x21008d, 0x0 },
+ { 0x1018d, 0x0 },
+ { 0x11018d, 0x0 },
+ { 0x21018d, 0x0 },
+ { 0x1108d, 0x0 },
+ { 0x11108d, 0x0 },
+ { 0x21108d, 0x0 },
+ { 0x1118d, 0x0 },
+ { 0x11118d, 0x0 },
+ { 0x21118d, 0x0 },
+ { 0x1208d, 0x0 },
+ { 0x11208d, 0x0 },
+ { 0x21208d, 0x0 },
+ { 0x1218d, 0x0 },
+ { 0x11218d, 0x0 },
+ { 0x21218d, 0x0 },
+ { 0x1308d, 0x0 },
+ { 0x11308d, 0x0 },
+ { 0x21308d, 0x0 },
+ { 0x1318d, 0x0 },
+ { 0x11318d, 0x0 },
+ { 0x21318d, 0x0 },
+ { 0x100c0, 0x0 },
+ { 0x1100c0, 0x0 },
+ { 0x2100c0, 0x0 },
+ { 0x101c0, 0x0 },
+ { 0x1101c0, 0x0 },
+ { 0x2101c0, 0x0 },
+ { 0x102c0, 0x0 },
+ { 0x1102c0, 0x0 },
+ { 0x2102c0, 0x0 },
+ { 0x103c0, 0x0 },
+ { 0x1103c0, 0x0 },
+ { 0x2103c0, 0x0 },
+ { 0x104c0, 0x0 },
+ { 0x1104c0, 0x0 },
+ { 0x2104c0, 0x0 },
+ { 0x105c0, 0x0 },
+ { 0x1105c0, 0x0 },
+ { 0x2105c0, 0x0 },
+ { 0x106c0, 0x0 },
+ { 0x1106c0, 0x0 },
+ { 0x2106c0, 0x0 },
+ { 0x107c0, 0x0 },
+ { 0x1107c0, 0x0 },
+ { 0x2107c0, 0x0 },
+ { 0x108c0, 0x0 },
+ { 0x1108c0, 0x0 },
+ { 0x2108c0, 0x0 },
+ { 0x110c0, 0x0 },
+ { 0x1110c0, 0x0 },
+ { 0x2110c0, 0x0 },
+ { 0x111c0, 0x0 },
+ { 0x1111c0, 0x0 },
+ { 0x2111c0, 0x0 },
+ { 0x112c0, 0x0 },
+ { 0x1112c0, 0x0 },
+ { 0x2112c0, 0x0 },
+ { 0x113c0, 0x0 },
+ { 0x1113c0, 0x0 },
+ { 0x2113c0, 0x0 },
+ { 0x114c0, 0x0 },
+ { 0x1114c0, 0x0 },
+ { 0x2114c0, 0x0 },
+ { 0x115c0, 0x0 },
+ { 0x1115c0, 0x0 },
+ { 0x2115c0, 0x0 },
+ { 0x116c0, 0x0 },
+ { 0x1116c0, 0x0 },
+ { 0x2116c0, 0x0 },
+ { 0x117c0, 0x0 },
+ { 0x1117c0, 0x0 },
+ { 0x2117c0, 0x0 },
+ { 0x118c0, 0x0 },
+ { 0x1118c0, 0x0 },
+ { 0x2118c0, 0x0 },
+ { 0x120c0, 0x0 },
+ { 0x1120c0, 0x0 },
+ { 0x2120c0, 0x0 },
+ { 0x121c0, 0x0 },
+ { 0x1121c0, 0x0 },
+ { 0x2121c0, 0x0 },
+ { 0x122c0, 0x0 },
+ { 0x1122c0, 0x0 },
+ { 0x2122c0, 0x0 },
+ { 0x123c0, 0x0 },
+ { 0x1123c0, 0x0 },
+ { 0x2123c0, 0x0 },
+ { 0x124c0, 0x0 },
+ { 0x1124c0, 0x0 },
+ { 0x2124c0, 0x0 },
+ { 0x125c0, 0x0 },
+ { 0x1125c0, 0x0 },
+ { 0x2125c0, 0x0 },
+ { 0x126c0, 0x0 },
+ { 0x1126c0, 0x0 },
+ { 0x2126c0, 0x0 },
+ { 0x127c0, 0x0 },
+ { 0x1127c0, 0x0 },
+ { 0x2127c0, 0x0 },
+ { 0x128c0, 0x0 },
+ { 0x1128c0, 0x0 },
+ { 0x2128c0, 0x0 },
+ { 0x130c0, 0x0 },
+ { 0x1130c0, 0x0 },
+ { 0x2130c0, 0x0 },
+ { 0x131c0, 0x0 },
+ { 0x1131c0, 0x0 },
+ { 0x2131c0, 0x0 },
+ { 0x132c0, 0x0 },
+ { 0x1132c0, 0x0 },
+ { 0x2132c0, 0x0 },
+ { 0x133c0, 0x0 },
+ { 0x1133c0, 0x0 },
+ { 0x2133c0, 0x0 },
+ { 0x134c0, 0x0 },
+ { 0x1134c0, 0x0 },
+ { 0x2134c0, 0x0 },
+ { 0x135c0, 0x0 },
+ { 0x1135c0, 0x0 },
+ { 0x2135c0, 0x0 },
+ { 0x136c0, 0x0 },
+ { 0x1136c0, 0x0 },
+ { 0x2136c0, 0x0 },
+ { 0x137c0, 0x0 },
+ { 0x1137c0, 0x0 },
+ { 0x2137c0, 0x0 },
+ { 0x138c0, 0x0 },
+ { 0x1138c0, 0x0 },
+ { 0x2138c0, 0x0 },
+ { 0x100c1, 0x0 },
+ { 0x1100c1, 0x0 },
+ { 0x2100c1, 0x0 },
+ { 0x101c1, 0x0 },
+ { 0x1101c1, 0x0 },
+ { 0x2101c1, 0x0 },
+ { 0x102c1, 0x0 },
+ { 0x1102c1, 0x0 },
+ { 0x2102c1, 0x0 },
+ { 0x103c1, 0x0 },
+ { 0x1103c1, 0x0 },
+ { 0x2103c1, 0x0 },
+ { 0x104c1, 0x0 },
+ { 0x1104c1, 0x0 },
+ { 0x2104c1, 0x0 },
+ { 0x105c1, 0x0 },
+ { 0x1105c1, 0x0 },
+ { 0x2105c1, 0x0 },
+ { 0x106c1, 0x0 },
+ { 0x1106c1, 0x0 },
+ { 0x2106c1, 0x0 },
+ { 0x107c1, 0x0 },
+ { 0x1107c1, 0x0 },
+ { 0x2107c1, 0x0 },
+ { 0x108c1, 0x0 },
+ { 0x1108c1, 0x0 },
+ { 0x2108c1, 0x0 },
+ { 0x110c1, 0x0 },
+ { 0x1110c1, 0x0 },
+ { 0x2110c1, 0x0 },
+ { 0x111c1, 0x0 },
+ { 0x1111c1, 0x0 },
+ { 0x2111c1, 0x0 },
+ { 0x112c1, 0x0 },
+ { 0x1112c1, 0x0 },
+ { 0x2112c1, 0x0 },
+ { 0x113c1, 0x0 },
+ { 0x1113c1, 0x0 },
+ { 0x2113c1, 0x0 },
+ { 0x114c1, 0x0 },
+ { 0x1114c1, 0x0 },
+ { 0x2114c1, 0x0 },
+ { 0x115c1, 0x0 },
+ { 0x1115c1, 0x0 },
+ { 0x2115c1, 0x0 },
+ { 0x116c1, 0x0 },
+ { 0x1116c1, 0x0 },
+ { 0x2116c1, 0x0 },
+ { 0x117c1, 0x0 },
+ { 0x1117c1, 0x0 },
+ { 0x2117c1, 0x0 },
+ { 0x118c1, 0x0 },
+ { 0x1118c1, 0x0 },
+ { 0x2118c1, 0x0 },
+ { 0x120c1, 0x0 },
+ { 0x1120c1, 0x0 },
+ { 0x2120c1, 0x0 },
+ { 0x121c1, 0x0 },
+ { 0x1121c1, 0x0 },
+ { 0x2121c1, 0x0 },
+ { 0x122c1, 0x0 },
+ { 0x1122c1, 0x0 },
+ { 0x2122c1, 0x0 },
+ { 0x123c1, 0x0 },
+ { 0x1123c1, 0x0 },
+ { 0x2123c1, 0x0 },
+ { 0x124c1, 0x0 },
+ { 0x1124c1, 0x0 },
+ { 0x2124c1, 0x0 },
+ { 0x125c1, 0x0 },
+ { 0x1125c1, 0x0 },
+ { 0x2125c1, 0x0 },
+ { 0x126c1, 0x0 },
+ { 0x1126c1, 0x0 },
+ { 0x2126c1, 0x0 },
+ { 0x127c1, 0x0 },
+ { 0x1127c1, 0x0 },
+ { 0x2127c1, 0x0 },
+ { 0x128c1, 0x0 },
+ { 0x1128c1, 0x0 },
+ { 0x2128c1, 0x0 },
+ { 0x130c1, 0x0 },
+ { 0x1130c1, 0x0 },
+ { 0x2130c1, 0x0 },
+ { 0x131c1, 0x0 },
+ { 0x1131c1, 0x0 },
+ { 0x2131c1, 0x0 },
+ { 0x132c1, 0x0 },
+ { 0x1132c1, 0x0 },
+ { 0x2132c1, 0x0 },
+ { 0x133c1, 0x0 },
+ { 0x1133c1, 0x0 },
+ { 0x2133c1, 0x0 },
+ { 0x134c1, 0x0 },
+ { 0x1134c1, 0x0 },
+ { 0x2134c1, 0x0 },
+ { 0x135c1, 0x0 },
+ { 0x1135c1, 0x0 },
+ { 0x2135c1, 0x0 },
+ { 0x136c1, 0x0 },
+ { 0x1136c1, 0x0 },
+ { 0x2136c1, 0x0 },
+ { 0x137c1, 0x0 },
+ { 0x1137c1, 0x0 },
+ { 0x2137c1, 0x0 },
+ { 0x138c1, 0x0 },
+ { 0x1138c1, 0x0 },
+ { 0x2138c1, 0x0 },
+ { 0x10020, 0x0 },
+ { 0x110020, 0x0 },
+ { 0x210020, 0x0 },
+ { 0x11020, 0x0 },
+ { 0x111020, 0x0 },
+ { 0x211020, 0x0 },
+ { 0x12020, 0x0 },
+ { 0x112020, 0x0 },
+ { 0x212020, 0x0 },
+ { 0x13020, 0x0 },
+ { 0x113020, 0x0 },
+ { 0x213020, 0x0 },
+ { 0x20072, 0x0 },
+ { 0x20073, 0x0 },
+ { 0x20074, 0x0 },
+ { 0x100aa, 0x0 },
+ { 0x110aa, 0x0 },
+ { 0x120aa, 0x0 },
+ { 0x130aa, 0x0 },
+ { 0x20010, 0x0 },
+ { 0x120010, 0x0 },
+ { 0x220010, 0x0 },
+ { 0x20011, 0x0 },
+ { 0x120011, 0x0 },
+ { 0x220011, 0x0 },
+ { 0x100ae, 0x0 },
+ { 0x1100ae, 0x0 },
+ { 0x2100ae, 0x0 },
+ { 0x100af, 0x0 },
+ { 0x1100af, 0x0 },
+ { 0x2100af, 0x0 },
+ { 0x110ae, 0x0 },
+ { 0x1110ae, 0x0 },
+ { 0x2110ae, 0x0 },
+ { 0x110af, 0x0 },
+ { 0x1110af, 0x0 },
+ { 0x2110af, 0x0 },
+ { 0x120ae, 0x0 },
+ { 0x1120ae, 0x0 },
+ { 0x2120ae, 0x0 },
+ { 0x120af, 0x0 },
+ { 0x1120af, 0x0 },
+ { 0x2120af, 0x0 },
+ { 0x130ae, 0x0 },
+ { 0x1130ae, 0x0 },
+ { 0x2130ae, 0x0 },
+ { 0x130af, 0x0 },
+ { 0x1130af, 0x0 },
+ { 0x2130af, 0x0 },
+ { 0x20020, 0x0 },
+ { 0x120020, 0x0 },
+ { 0x220020, 0x0 },
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x0 },
+ { 0x100a2, 0x0 },
+ { 0x100a3, 0x0 },
+ { 0x100a4, 0x0 },
+ { 0x100a5, 0x0 },
+ { 0x100a6, 0x0 },
+ { 0x100a7, 0x0 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x0 },
+ { 0x110a2, 0x0 },
+ { 0x110a3, 0x0 },
+ { 0x110a4, 0x0 },
+ { 0x110a5, 0x0 },
+ { 0x110a6, 0x0 },
+ { 0x110a7, 0x0 },
+ { 0x120a0, 0x0 },
+ { 0x120a1, 0x0 },
+ { 0x120a2, 0x0 },
+ { 0x120a3, 0x0 },
+ { 0x120a4, 0x0 },
+ { 0x120a5, 0x0 },
+ { 0x120a6, 0x0 },
+ { 0x120a7, 0x0 },
+ { 0x130a0, 0x0 },
+ { 0x130a1, 0x0 },
+ { 0x130a2, 0x0 },
+ { 0x130a3, 0x0 },
+ { 0x130a4, 0x0 },
+ { 0x130a5, 0x0 },
+ { 0x130a6, 0x0 },
+ { 0x130a7, 0x0 },
+ { 0x2007c, 0x0 },
+ { 0x12007c, 0x0 },
+ { 0x22007c, 0x0 },
+ { 0x2007d, 0x0 },
+ { 0x12007d, 0x0 },
+ { 0x22007d, 0x0 },
+ { 0x400fd, 0x0 },
+ { 0x400c0, 0x0 },
+ { 0x90201, 0x0 },
+ { 0x190201, 0x0 },
+ { 0x290201, 0x0 },
+ { 0x90202, 0x0 },
+ { 0x190202, 0x0 },
+ { 0x290202, 0x0 },
+ { 0x90203, 0x0 },
+ { 0x190203, 0x0 },
+ { 0x290203, 0x0 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x90205, 0x0 },
+ { 0x190205, 0x0 },
+ { 0x290205, 0x0 },
+ { 0x90206, 0x0 },
+ { 0x190206, 0x0 },
+ { 0x290206, 0x0 },
+ { 0x90207, 0x0 },
+ { 0x190207, 0x0 },
+ { 0x290207, 0x0 },
+ { 0x90208, 0x0 },
+ { 0x190208, 0x0 },
+ { 0x290208, 0x0 },
+ { 0x10062, 0x0 },
+ { 0x10162, 0x0 },
+ { 0x10262, 0x0 },
+ { 0x10362, 0x0 },
+ { 0x10462, 0x0 },
+ { 0x10562, 0x0 },
+ { 0x10662, 0x0 },
+ { 0x10762, 0x0 },
+ { 0x10862, 0x0 },
+ { 0x11062, 0x0 },
+ { 0x11162, 0x0 },
+ { 0x11262, 0x0 },
+ { 0x11362, 0x0 },
+ { 0x11462, 0x0 },
+ { 0x11562, 0x0 },
+ { 0x11662, 0x0 },
+ { 0x11762, 0x0 },
+ { 0x11862, 0x0 },
+ { 0x12062, 0x0 },
+ { 0x12162, 0x0 },
+ { 0x12262, 0x0 },
+ { 0x12362, 0x0 },
+ { 0x12462, 0x0 },
+ { 0x12562, 0x0 },
+ { 0x12662, 0x0 },
+ { 0x12762, 0x0 },
+ { 0x12862, 0x0 },
+ { 0x13062, 0x0 },
+ { 0x13162, 0x0 },
+ { 0x13262, 0x0 },
+ { 0x13362, 0x0 },
+ { 0x13462, 0x0 },
+ { 0x13562, 0x0 },
+ { 0x13662, 0x0 },
+ { 0x13762, 0x0 },
+ { 0x13862, 0x0 },
+ { 0x20077, 0x0 },
+ { 0x10001, 0x0 },
+ { 0x11001, 0x0 },
+ { 0x12001, 0x0 },
+ { 0x13001, 0x0 },
+ { 0x10040, 0x0 },
+ { 0x10140, 0x0 },
+ { 0x10240, 0x0 },
+ { 0x10340, 0x0 },
+ { 0x10440, 0x0 },
+ { 0x10540, 0x0 },
+ { 0x10640, 0x0 },
+ { 0x10740, 0x0 },
+ { 0x10840, 0x0 },
+ { 0x10030, 0x0 },
+ { 0x10130, 0x0 },
+ { 0x10230, 0x0 },
+ { 0x10330, 0x0 },
+ { 0x10430, 0x0 },
+ { 0x10530, 0x0 },
+ { 0x10630, 0x0 },
+ { 0x10730, 0x0 },
+ { 0x10830, 0x0 },
+ { 0x11040, 0x0 },
+ { 0x11140, 0x0 },
+ { 0x11240, 0x0 },
+ { 0x11340, 0x0 },
+ { 0x11440, 0x0 },
+ { 0x11540, 0x0 },
+ { 0x11640, 0x0 },
+ { 0x11740, 0x0 },
+ { 0x11840, 0x0 },
+ { 0x11030, 0x0 },
+ { 0x11130, 0x0 },
+ { 0x11230, 0x0 },
+ { 0x11330, 0x0 },
+ { 0x11430, 0x0 },
+ { 0x11530, 0x0 },
+ { 0x11630, 0x0 },
+ { 0x11730, 0x0 },
+ { 0x11830, 0x0 },
+ { 0x12040, 0x0 },
+ { 0x12140, 0x0 },
+ { 0x12240, 0x0 },
+ { 0x12340, 0x0 },
+ { 0x12440, 0x0 },
+ { 0x12540, 0x0 },
+ { 0x12640, 0x0 },
+ { 0x12740, 0x0 },
+ { 0x12840, 0x0 },
+ { 0x12030, 0x0 },
+ { 0x12130, 0x0 },
+ { 0x12230, 0x0 },
+ { 0x12330, 0x0 },
+ { 0x12430, 0x0 },
+ { 0x12530, 0x0 },
+ { 0x12630, 0x0 },
+ { 0x12730, 0x0 },
+ { 0x12830, 0x0 },
+ { 0x13040, 0x0 },
+ { 0x13140, 0x0 },
+ { 0x13240, 0x0 },
+ { 0x13340, 0x0 },
+ { 0x13440, 0x0 },
+ { 0x13540, 0x0 },
+ { 0x13640, 0x0 },
+ { 0x13740, 0x0 },
+ { 0x13840, 0x0 },
+ { 0x13030, 0x0 },
+ { 0x13130, 0x0 },
+ { 0x13230, 0x0 },
+ { 0x13330, 0x0 },
+ { 0x13430, 0x0 },
+ { 0x13530, 0x0 },
+ { 0x13630, 0x0 },
+ { 0x13730, 0x0 },
+ { 0x13830, 0x0 },
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x960 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x131f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x24c4 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x24c4 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0xc400 },
+ { 0x54033, 0x3324 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xc400 },
+ { 0x54039, 0x3324 },
+#else
+ { 0xd0000, 0x0 },
+ { 0x54003, 0xfa0 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x131f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x3ff4 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x3ff4 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0xf400 },
+ { 0x54033, 0x333f },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xf400 },
+ { 0x54039, 0x333f },
+#endif
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x48 },
+ { 0x5403c, 0x48 },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x101 },
+ { 0x54003, 0x190 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3300 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3300 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x48 },
+ { 0x5403c, 0x48 },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P2 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp2_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54002, 0x102 },
+ { 0x54003, 0x64 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x84 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x84 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0x8400 },
+ { 0x54033, 0x3300 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0x8400 },
+ { 0x54039, 0x3300 },
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x48 },
+ { 0x5403c, 0x48 },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x54003, 0x960 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x61 },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54010, 0x1f7f },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x24c4 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x24c4 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0xc400 },
+ { 0x54033, 0x3324 },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xc400 },
+ { 0x54039, 0x3324 },
+#else
+ { 0x54003, 0xfa0 },
+ { 0x54004, 0x2 },
+ { 0x54005, 0x2228 },
+ { 0x54006, 0x14 },
+ { 0x54008, 0x61 },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x2 },
+ { 0x5400f, 0x100 },
+ { 0x54010, 0x1f7f },
+ { 0x54012, 0x310 },
+ { 0x54019, 0x3ff4 },
+ { 0x5401a, 0x33 },
+ { 0x5401b, 0x4866 },
+ { 0x5401c, 0x4800 },
+ { 0x5401e, 0x16 },
+ { 0x5401f, 0x3ff4 },
+ { 0x54020, 0x33 },
+ { 0x54021, 0x4866 },
+ { 0x54022, 0x4800 },
+ { 0x54024, 0x16 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x54032, 0xf400 },
+ { 0x54033, 0x333f },
+ { 0x54034, 0x6600 },
+ { 0x54035, 0x48 },
+ { 0x54036, 0x48 },
+ { 0x54037, 0x1600 },
+ { 0x54038, 0xf400 },
+ { 0x54039, 0x333f },
+#endif
+ { 0x5403a, 0x6600 },
+ { 0x5403b, 0x48 },
+ { 0x5403c, 0x48 },
+ { 0x5403d, 0x1600 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xb },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x633 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x633 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x633 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x45a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x448 },
+ { 0x90055, 0x109 },
+ { 0x90056, 0x40 },
+ { 0x90057, 0x633 },
+ { 0x90058, 0x179 },
+ { 0x90059, 0x1 },
+ { 0x9005a, 0x618 },
+ { 0x9005b, 0x109 },
+ { 0x9005c, 0x40c0 },
+ { 0x9005d, 0x633 },
+ { 0x9005e, 0x149 },
+ { 0x9005f, 0x8 },
+ { 0x90060, 0x4 },
+ { 0x90061, 0x48 },
+ { 0x90062, 0x4040 },
+ { 0x90063, 0x633 },
+ { 0x90064, 0x149 },
+ { 0x90065, 0x0 },
+ { 0x90066, 0x4 },
+ { 0x90067, 0x48 },
+ { 0x90068, 0x40 },
+ { 0x90069, 0x633 },
+ { 0x9006a, 0x149 },
+ { 0x9006b, 0x10 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x18 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x4 },
+ { 0x90070, 0x78 },
+ { 0x90071, 0x549 },
+ { 0x90072, 0x633 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0xd49 },
+ { 0x90075, 0x633 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x94a },
+ { 0x90078, 0x633 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0x441 },
+ { 0x9007b, 0x633 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x42 },
+ { 0x9007e, 0x633 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x1 },
+ { 0x90081, 0x633 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x0 },
+ { 0x90084, 0xe0 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0xa },
+ { 0x90087, 0x10 },
+ { 0x90088, 0x109 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x149 },
+ { 0x9008c, 0x9 },
+ { 0x9008d, 0x3c0 },
+ { 0x9008e, 0x159 },
+ { 0x9008f, 0x18 },
+ { 0x90090, 0x10 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x0 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x109 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x48 },
+ { 0x90098, 0x18 },
+ { 0x90099, 0x4 },
+ { 0x9009a, 0x58 },
+ { 0x9009b, 0xb },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x1 },
+ { 0x9009f, 0x10 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x5 },
+ { 0x900a2, 0x7c0 },
+ { 0x900a3, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x625 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x625 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900a4, 0x0 },
+ { 0x900a5, 0x790 },
+ { 0x900a6, 0x11a },
+ { 0x900a7, 0x8 },
+ { 0x900a8, 0x7aa },
+ { 0x900a9, 0x2a },
+ { 0x900aa, 0x10 },
+ { 0x900ab, 0x7b2 },
+ { 0x900ac, 0x2a },
+ { 0x900ad, 0x0 },
+ { 0x900ae, 0x7c8 },
+ { 0x900af, 0x109 },
+ { 0x900b0, 0x10 },
+ { 0x900b1, 0x10 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x10 },
+ { 0x900b4, 0x2a8 },
+ { 0x900b5, 0x129 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0x370 },
+ { 0x900b8, 0x129 },
+ { 0x900b9, 0xa },
+ { 0x900ba, 0x3c8 },
+ { 0x900bb, 0x1a9 },
+ { 0x900bc, 0xc },
+ { 0x900bd, 0x408 },
+ { 0x900be, 0x199 },
+ { 0x900bf, 0x14 },
+ { 0x900c0, 0x790 },
+ { 0x900c1, 0x11a },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x18 },
+ { 0x900c5, 0xe },
+ { 0x900c6, 0x408 },
+ { 0x900c7, 0x199 },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x8568 },
+ { 0x900ca, 0x108 },
+ { 0x900cb, 0x18 },
+ { 0x900cc, 0x790 },
+ { 0x900cd, 0x16a },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x1d8 },
+ { 0x900d0, 0x169 },
+ { 0x900d1, 0x10 },
+ { 0x900d2, 0x8558 },
+ { 0x900d3, 0x168 },
+ { 0x900d4, 0x70 },
+ { 0x900d5, 0x788 },
+ { 0x900d6, 0x16a },
+ { 0x900d7, 0x1ff8 },
+ { 0x900d8, 0x85a8 },
+ { 0x900d9, 0x1e8 },
+ { 0x900da, 0x50 },
+ { 0x900db, 0x798 },
+ { 0x900dc, 0x16a },
+ { 0x900dd, 0x60 },
+ { 0x900de, 0x7a0 },
+ { 0x900df, 0x16a },
+ { 0x900e0, 0x8 },
+ { 0x900e1, 0x8310 },
+ { 0x900e2, 0x168 },
+ { 0x900e3, 0x8 },
+ { 0x900e4, 0xa310 },
+ { 0x900e5, 0x168 },
+ { 0x900e6, 0xa },
+ { 0x900e7, 0x408 },
+ { 0x900e8, 0x169 },
+ { 0x900e9, 0x6e },
+ { 0x900ea, 0x0 },
+ { 0x900eb, 0x68 },
+ { 0x900ec, 0x0 },
+ { 0x900ed, 0x408 },
+ { 0x900ee, 0x169 },
+ { 0x900ef, 0x0 },
+ { 0x900f0, 0x8310 },
+ { 0x900f1, 0x168 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0xa310 },
+ { 0x900f4, 0x168 },
+ { 0x900f5, 0x1ff8 },
+ { 0x900f6, 0x85a8 },
+ { 0x900f7, 0x1e8 },
+ { 0x900f8, 0x68 },
+ { 0x900f9, 0x798 },
+ { 0x900fa, 0x16a },
+ { 0x900fb, 0x78 },
+ { 0x900fc, 0x7a0 },
+ { 0x900fd, 0x16a },
+ { 0x900fe, 0x68 },
+ { 0x900ff, 0x790 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x8 },
+ { 0x90102, 0x8b10 },
+ { 0x90103, 0x168 },
+ { 0x90104, 0x8 },
+ { 0x90105, 0xab10 },
+ { 0x90106, 0x168 },
+ { 0x90107, 0xa },
+ { 0x90108, 0x408 },
+ { 0x90109, 0x169 },
+ { 0x9010a, 0x58 },
+ { 0x9010b, 0x0 },
+ { 0x9010c, 0x68 },
+ { 0x9010d, 0x0 },
+ { 0x9010e, 0x408 },
+ { 0x9010f, 0x169 },
+ { 0x90110, 0x0 },
+ { 0x90111, 0x8b10 },
+ { 0x90112, 0x168 },
+ { 0x90113, 0x1 },
+ { 0x90114, 0xab10 },
+ { 0x90115, 0x168 },
+ { 0x90116, 0x0 },
+ { 0x90117, 0x1d8 },
+ { 0x90118, 0x169 },
+ { 0x90119, 0x80 },
+ { 0x9011a, 0x790 },
+ { 0x9011b, 0x16a },
+ { 0x9011c, 0x18 },
+ { 0x9011d, 0x7aa },
+ { 0x9011e, 0x6a },
+ { 0x9011f, 0xa },
+ { 0x90120, 0x0 },
+ { 0x90121, 0x1e9 },
+ { 0x90122, 0x8 },
+ { 0x90123, 0x8080 },
+ { 0x90124, 0x108 },
+ { 0x90125, 0xf },
+ { 0x90126, 0x408 },
+ { 0x90127, 0x169 },
+ { 0x90128, 0xc },
+ { 0x90129, 0x0 },
+ { 0x9012a, 0x68 },
+ { 0x9012b, 0x9 },
+ { 0x9012c, 0x0 },
+ { 0x9012d, 0x1a9 },
+ { 0x9012e, 0x0 },
+ { 0x9012f, 0x408 },
+ { 0x90130, 0x169 },
+ { 0x90131, 0x0 },
+ { 0x90132, 0x8080 },
+ { 0x90133, 0x108 },
+ { 0x90134, 0x8 },
+ { 0x90135, 0x7aa },
+ { 0x90136, 0x6a },
+ { 0x90137, 0x0 },
+ { 0x90138, 0x8568 },
+ { 0x90139, 0x108 },
+ { 0x9013a, 0xb7 },
+ { 0x9013b, 0x790 },
+ { 0x9013c, 0x16a },
+ { 0x9013d, 0x1f },
+ { 0x9013e, 0x0 },
+ { 0x9013f, 0x68 },
+ { 0x90140, 0x8 },
+ { 0x90141, 0x8558 },
+ { 0x90142, 0x168 },
+ { 0x90143, 0xf },
+ { 0x90144, 0x408 },
+ { 0x90145, 0x169 },
+ { 0x90146, 0xd },
+ { 0x90147, 0x0 },
+ { 0x90148, 0x68 },
+ { 0x90149, 0x0 },
+ { 0x9014a, 0x408 },
+ { 0x9014b, 0x169 },
+ { 0x9014c, 0x0 },
+ { 0x9014d, 0x8558 },
+ { 0x9014e, 0x168 },
+ { 0x9014f, 0x8 },
+ { 0x90150, 0x3c8 },
+ { 0x90151, 0x1a9 },
+ { 0x90152, 0x3 },
+ { 0x90153, 0x370 },
+ { 0x90154, 0x129 },
+ { 0x90155, 0x20 },
+ { 0x90156, 0x2aa },
+ { 0x90157, 0x9 },
+ { 0x90158, 0x8 },
+ { 0x90159, 0xe8 },
+ { 0x9015a, 0x109 },
+ { 0x9015b, 0x0 },
+ { 0x9015c, 0x8140 },
+ { 0x9015d, 0x10c },
+ { 0x9015e, 0x10 },
+ { 0x9015f, 0x8138 },
+ { 0x90160, 0x104 },
+ { 0x90161, 0x8 },
+ { 0x90162, 0x448 },
+ { 0x90163, 0x109 },
+ { 0x90164, 0xf },
+ { 0x90165, 0x7c0 },
+ { 0x90166, 0x109 },
+ { 0x90167, 0x0 },
+ { 0x90168, 0xe8 },
+ { 0x90169, 0x109 },
+ { 0x9016a, 0x47 },
+ { 0x9016b, 0x630 },
+ { 0x9016c, 0x109 },
+ { 0x9016d, 0x8 },
+ { 0x9016e, 0x618 },
+ { 0x9016f, 0x109 },
+ { 0x90170, 0x8 },
+ { 0x90171, 0xe0 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0x0 },
+ { 0x90174, 0x7c8 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x8 },
+ { 0x90177, 0x8140 },
+ { 0x90178, 0x10c },
+ { 0x90179, 0x0 },
+ { 0x9017a, 0x478 },
+ { 0x9017b, 0x109 },
+ { 0x9017c, 0x0 },
+ { 0x9017d, 0x1 },
+ { 0x9017e, 0x8 },
+ { 0x9017f, 0x8 },
+ { 0x90180, 0x4 },
+ { 0x90181, 0x0 },
+ { 0x90006, 0x8 },
+ { 0x90007, 0x7c8 },
+ { 0x90008, 0x109 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x400 },
+ { 0x9000b, 0x106 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x29 },
+ { 0x90026, 0x68 },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x2000b, 0x4b },
+ { 0x2000c, 0x96 },
+ { 0x2000d, 0x5dc },
+#else
+ { 0x200be, 0x3 },
+ { 0x2000b, 0x7d },
+ { 0x2000c, 0xfa },
+ { 0x2000d, 0x9c4 },
+#endif
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0xc },
+ { 0x12000c, 0x19 },
+ { 0x12000d, 0xfa },
+ { 0x12000e, 0x10 },
+ { 0x22000b, 0x3 },
+ { 0x22000c, 0x6 },
+ { 0x22000d, 0x3e },
+ { 0x22000e, 0x10 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x2060 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ { 0x120010, 0x5a },
+ { 0x120011, 0x3 },
+ { 0x220010, 0x5a },
+ { 0x220011, 0x3 },
+#endif
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x140080, 0xe0 },
+ { 0x140081, 0x12 },
+ { 0x140082, 0xe0 },
+ { 0x140083, 0x12 },
+ { 0x140084, 0xe0 },
+ { 0x140085, 0x12 },
+ { 0x240080, 0xe0 },
+ { 0x240081, 0x12 },
+ { 0x240082, 0xe0 },
+ { 0x240083, 0x12 },
+ { 0x240084, 0xe0 },
+ { 0x240085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x12011, 0x1 },
+ { 0x12012, 0x1 },
+ { 0x12013, 0x180 },
+ { 0x12018, 0x1 },
+ { 0x12002, 0x6209 },
+ { 0x120b2, 0x1 },
+ { 0x121b4, 0x1 },
+ { 0x122b4, 0x1 },
+ { 0x123b4, 0x1 },
+ { 0x124b4, 0x1 },
+ { 0x125b4, 0x1 },
+ { 0x126b4, 0x1 },
+ { 0x127b4, 0x1 },
+ { 0x128b4, 0x1 },
+ { 0x13011, 0x1 },
+ { 0x13012, 0x1 },
+ { 0x13013, 0x180 },
+ { 0x13018, 0x1 },
+ { 0x13002, 0x6209 },
+ { 0x130b2, 0x1 },
+ { 0x131b4, 0x1 },
+ { 0x132b4, 0x1 },
+ { 0x133b4, 0x1 },
+ { 0x134b4, 0x1 },
+ { 0x135b4, 0x1 },
+ { 0x136b4, 0x1 },
+ { 0x137b4, 0x1 },
+ { 0x138b4, 0x1 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x2 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ /* P0 2400mts 1D */
+ .drate = 2400,
+#else
+ /* P0 4000mts 1D */
+ .drate = 4000,
+#endif
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 400mts 1D */
+ .drate = 400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P2 100mts 1D */
+ .drate = 100,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp2_cfg),
+ },
+ {
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ /* P0 2400mts 2D */
+ .drate = 2400,
+#else
+ /* P0 4000mts 2D */
+ .drate = 4000,
+#endif
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+#ifdef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+ .fsp_table = { 2400, 400, 100, },
+#else
+ .fsp_table = { 4000, 400, 100, },
+#endif
+};
+
+#ifndef CONFIG_IMX8M_LPDDR4_FREQ0_2400MTS
+#ifdef CONFIG_IMX8M_DRAM_INLINE_ECC
+void board_dram_ecc_scrub(void)
+{
+ ddrc_inline_ecc_scrub(0x0, 0x3ffffff);
+ ddrc_inline_ecc_scrub(0x20000000, 0x23ffffff);
+ ddrc_inline_ecc_scrub(0x40000000, 0x43ffffff);
+ ddrc_inline_ecc_scrub(0x4000000, 0x7ffffff);
+ ddrc_inline_ecc_scrub(0x24000000, 0x27ffffff);
+ ddrc_inline_ecc_scrub(0x44000000, 0x47ffffff);
+ ddrc_inline_ecc_scrub(0x8000000, 0xbffffff);
+ ddrc_inline_ecc_scrub(0x28000000, 0x2bffffff);
+ ddrc_inline_ecc_scrub(0x48000000, 0x4bffffff);
+ ddrc_inline_ecc_scrub(0xc000000, 0xfffffff);
+ ddrc_inline_ecc_scrub(0x2c000000, 0x2fffffff);
+ ddrc_inline_ecc_scrub(0x4c000000, 0x4fffffff);
+ ddrc_inline_ecc_scrub(0x10000000, 0x13ffffff);
+ ddrc_inline_ecc_scrub(0x30000000, 0x33ffffff);
+ ddrc_inline_ecc_scrub(0x50000000, 0x53ffffff);
+ ddrc_inline_ecc_scrub(0x14000000, 0x17ffffff);
+ ddrc_inline_ecc_scrub(0x34000000, 0x37ffffff);
+ ddrc_inline_ecc_scrub(0x54000000, 0x57ffffff);
+ ddrc_inline_ecc_scrub(0x18000000, 0x1bffffff);
+ ddrc_inline_ecc_scrub(0x38000000, 0x3bffffff);
+ ddrc_inline_ecc_scrub(0x58000000, 0x5bffffff);
+ ddrc_inline_ecc_scrub_end(0x0, 0x5fffffff);
+}
+#endif
+#endif
diff --git a/board/freescale/imx8mp_evk/spl.c b/board/freescale/imx8mp_evk/spl.c
new file mode 100644
index 00000000000..12da1b2abfb
--- /dev/null
+++ b/board/freescale/imx8mp_evk/spl.c
@@ -0,0 +1,145 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+/*
+ * Copyright 2018-2019, 2021 NXP
+ *
+ */
+
+#include <hang.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx8mp_pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/mach-imx/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/arch/ddr.h>
+#include <power/pmic.h>
+#include <power/pca9450.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int spl_board_boot_device(enum boot_device boot_dev_spl)
+{
+ return BOOT_DEVICE_BOOTROM;
+}
+
+void spl_dram_init(void)
+{
+ ddr_init(&dram_timing);
+}
+
+void spl_board_init(void)
+{
+ arch_misc_init();
+
+ /*
+ * Set GIC clock to 500Mhz for OD VDD_SOC. Kernel driver does
+ * not allow to change it. Should set the clock after PMIC
+ * setting done. Default is 400Mhz (system_pll1_800m with div = 2)
+ * set by ROM for ND VDD_SOC
+ */
+ clock_enable(CCGR_GIC, 0);
+ clock_set_target_val(GIC_CLK_ROOT, CLK_ROOT_ON | CLK_ROOT_SOURCE_SEL(5));
+ clock_enable(CCGR_GIC, 1);
+
+ puts("Normal Boot\n");
+}
+
+#define I2C_PAD_CTRL (PAD_CTL_DSE6 | PAD_CTL_HYS | PAD_CTL_PUE | PAD_CTL_PE)
+#define PC MUX_PAD_CTRL(I2C_PAD_CTRL)
+struct i2c_pads_info i2c_pad_info1 = {
+ .scl = {
+ .i2c_mode = MX8MP_PAD_I2C1_SCL__I2C1_SCL | PC,
+ .gpio_mode = MX8MP_PAD_I2C1_SCL__GPIO5_IO14 | PC,
+ .gp = IMX_GPIO_NR(5, 14),
+ },
+ .sda = {
+ .i2c_mode = MX8MP_PAD_I2C1_SDA__I2C1_SDA | PC,
+ .gpio_mode = MX8MP_PAD_I2C1_SDA__GPIO5_IO15 | PC,
+ .gp = IMX_GPIO_NR(5, 15),
+ },
+};
+
+#if CONFIG_IS_ENABLED(DM_PMIC_PCA9450)
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+
+ ret = pmic_get("pmic@25", &dev);
+ if (ret == -ENODEV) {
+ puts("No pmic@25\n");
+ return 0;
+ }
+ if (ret < 0)
+ return ret;
+
+ /* BUCKxOUT_DVS0/1 control BUCK123 output */
+ pmic_reg_write(dev, PCA9450_BUCK123_DVS, 0x29);
+
+ /*
+ * Increase VDD_SOC to typical value 0.95V before first
+ * DRAM access, set DVS1 to 0.85V for suspend.
+ * Enable DVS control through PMIC_STBY_REQ and
+ * set B1_ENMODE=1 (ON by PMIC_ON_REQ=H)
+ */
+ if (CONFIG_IS_ENABLED(IMX8M_VDD_SOC_850MV))
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x14);
+ else
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x1C);
+
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS1, 0x14);
+ pmic_reg_write(dev, PCA9450_BUCK1CTRL, 0x59);
+
+ /*
+ * Kernel uses OD/OD freq for SOC.
+ * To avoid timing risk from SOC to ARM,increase VDD_ARM to OD
+ * voltage 0.95V.
+ */
+
+ pmic_reg_write(dev, PCA9450_BUCK2OUT_DVS0, 0x1C);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+/* Do not use BSS area in this phase */
+void board_init_f(ulong dummy)
+{
+ int ret;
+
+ arch_cpu_init();
+
+ init_uart_clk(1);
+
+ ret = spl_early_init();
+ if (ret) {
+ debug("spl_init() failed: %d\n", ret);
+ hang();
+ }
+
+ preloader_console_init();
+
+ enable_tzc380();
+
+ power_init_board();
+
+ /* DDR initialization */
+ spl_dram_init();
+}
diff --git a/board/freescale/imx8mq_evk/Kconfig b/board/freescale/imx8mq_evk/Kconfig
new file mode 100644
index 00000000000..c4d20ad7c7d
--- /dev/null
+++ b/board/freescale/imx8mq_evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_IMX8MQ_EVK
+
+config SYS_BOARD
+ default "imx8mq_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8mq_evk"
+
+config IMX_CONFIG
+ default "arch/arm/mach-imx/imx8m/imximage.cfg"
+
+endif
diff --git a/board/freescale/imx8mq_evk/MAINTAINERS b/board/freescale/imx8mq_evk/MAINTAINERS
new file mode 100644
index 00000000000..a00bb4ef786
--- /dev/null
+++ b/board/freescale/imx8mq_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX8MQ EVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/imx8mq_evk/
+F: include/configs/imx8mq_evk.h
+F: configs/imx8mq_evk_defconfig
diff --git a/board/freescale/imx8mq_evk/Makefile b/board/freescale/imx8mq_evk/Makefile
new file mode 100644
index 00000000000..cf046963d25
--- /dev/null
+++ b/board/freescale/imx8mq_evk/Makefile
@@ -0,0 +1,12 @@
+#
+# Copyright 2017 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8mq_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+obj-$(CONFIG_IMX8M_LPDDR4) += lpddr4_timing.o lpddr4_timing_b0.o
+endif
diff --git a/board/freescale/imx8mq_evk/imx8mq_evk.c b/board/freescale/imx8mq_evk/imx8mq_evk.c
new file mode 100644
index 00000000000..ab920a4539c
--- /dev/null
+++ b/board/freescale/imx8mq_evk/imx8mq_evk.c
@@ -0,0 +1,78 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <env.h>
+#include <init.h>
+#include <malloc.h>
+#include <errno.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm-generic/gpio.h>
+#include <fsl_esdhc_imx.h>
+#include <mmc.h>
+#include <asm/arch/imx8mq_pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/mach-imx/gpio.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/arch/clock.h>
+#include <spl.h>
+#include <linux/bitops.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_DSE6 | PAD_CTL_FSEL1)
+
+#define WDOG_PAD_CTRL (PAD_CTL_DSE6 | PAD_CTL_HYS | PAD_CTL_PUE)
+
+static iomux_v3_cfg_t const wdog_pads[] = {
+ IMX8MQ_PAD_GPIO1_IO02__WDOG1_WDOG_B | MUX_PAD_CTRL(WDOG_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const uart_pads[] = {
+ IMX8MQ_PAD_UART1_RXD__UART1_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ IMX8MQ_PAD_UART1_TXD__UART1_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+int board_early_init_f(void)
+{
+ struct wdog_regs *wdog = (struct wdog_regs *)WDOG1_BASE_ADDR;
+
+ imx_iomux_v3_setup_multiple_pads(wdog_pads, ARRAY_SIZE(wdog_pads));
+ set_wdog_reset(wdog);
+
+ imx_iomux_v3_setup_multiple_pads(uart_pads, ARRAY_SIZE(uart_pads));
+
+ return 0;
+}
+
+int board_init(void)
+{
+#if defined(CONFIG_USB_DWC3) || defined(CONFIG_USB_XHCI_DWC3)
+ init_usb_clk();
+#endif
+
+ return 0;
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int board_late_init(void)
+{
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "EVK");
+ env_set("board_rev", "iMX8MQ");
+#endif
+
+ return 0;
+}
diff --git a/board/freescale/imx8mq_evk/lpddr4_timing.c b/board/freescale/imx8mq_evk/lpddr4_timing.c
new file mode 100644
index 00000000000..e9559e3d843
--- /dev/null
+++ b/board/freescale/imx8mq_evk/lpddr4_timing.c
@@ -0,0 +1,1323 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+#include <asm/arch/lpddr4_define.h>
+
+#define WR_POST_EXT_3200 /* recommened to define */
+
+struct dram_cfg_param lpddr4_ddrc_cfg[] = {
+ /* Start to config, default 3200mbps */
+ { DDRC_DBG1(0), 0x00000001 },
+ { DDRC_PWRCTL(0), 0x00000001 },
+ { DDRC_MSTR(0), 0xa3080020 },
+ { DDRC_MSTR2(0), 0x00000000 },
+ { DDRC_RFSHTMG(0), 0x006100E0 },
+ { DDRC_INIT0(0), 0xC003061B },
+ { DDRC_INIT1(0), 0x009D0000 },
+ { DDRC_INIT3(0), 0x00D4002D },
+#ifdef WR_POST_EXT_3200
+ { DDRC_INIT4(0), 0x00330008 },
+#else
+ { DDRC_INIT4(0), 0x00310008 },
+#endif
+ { DDRC_INIT6(0), 0x0066004a },
+ { DDRC_INIT7(0), 0x0006004a },
+
+ { DDRC_DRAMTMG0(0), 0x1A201B22 },
+ { DDRC_DRAMTMG1(0), 0x00060633 },
+ { DDRC_DRAMTMG3(0), 0x00C0C000 },
+ { DDRC_DRAMTMG4(0), 0x0F04080F },
+ { DDRC_DRAMTMG5(0), 0x02040C0C },
+ { DDRC_DRAMTMG6(0), 0x01010007 },
+ { DDRC_DRAMTMG7(0), 0x00000401 },
+ { DDRC_DRAMTMG12(0), 0x00020600 },
+ { DDRC_DRAMTMG13(0), 0x0C100002 },
+ { DDRC_DRAMTMG14(0), 0x000000E6 },
+ { DDRC_DRAMTMG17(0), 0x00A00050 },
+
+ { DDRC_ZQCTL0(0), 0x03200018 },
+ { DDRC_ZQCTL1(0), 0x028061A8 },
+ { DDRC_ZQCTL2(0), 0x00000000 },
+
+ { DDRC_DFITMG0(0), 0x0497820A },
+ { DDRC_DFITMG1(0), 0x00080303 },
+ { DDRC_DFIUPD0(0), 0xE0400018 },
+ { DDRC_DFIUPD1(0), 0x00DF00E4 },
+ { DDRC_DFIUPD2(0), 0x80000000 },
+ { DDRC_DFIMISC(0), 0x00000011 },
+ { DDRC_DFITMG2(0), 0x0000170A },
+
+ { DDRC_DBICTL(0), 0x00000001 },
+ { DDRC_DFIPHYMSTR(0), 0x00000001 },
+ { DDRC_RANKCTL(0), 0x00000c99 },
+ { DDRC_DRAMTMG2(0), 0x070E171a },
+
+ /* address mapping */
+ { DDRC_ADDRMAP0(0), 0x00000015 },
+ { DDRC_ADDRMAP3(0), 0x00000000 },
+ { DDRC_ADDRMAP4(0), 0x00001F1F },
+ /* bank interleave */
+ { DDRC_ADDRMAP1(0), 0x00080808 },
+ { DDRC_ADDRMAP5(0), 0x07070707 },
+ { DDRC_ADDRMAP6(0), 0x08080707 },
+
+ /* performance setting */
+ { DDRC_ODTCFG(0), 0x0b060908 },
+ { DDRC_ODTMAP(0), 0x00000000 },
+ { DDRC_SCHED(0), 0x29511505 },
+ { DDRC_SCHED1(0), 0x0000002c },
+ { DDRC_PERFHPR1(0), 0x5900575b },
+ /* 150T starve and 0x90 max tran len */
+ { DDRC_PERFLPR1(0), 0x90000096 },
+ /* 300T starve and 0x10 max tran len */
+ { DDRC_PERFWR1(0), 0x1000012c },
+ { DDRC_DBG0(0), 0x00000016 },
+ { DDRC_DBG1(0), 0x00000000 },
+ { DDRC_DBGCMD(0), 0x00000000 },
+ { DDRC_SWCTL(0), 0x00000001 },
+ { DDRC_POISONCFG(0), 0x00000011 },
+ { DDRC_PCCFG(0), 0x00000111 },
+ { DDRC_PCFGR_0(0), 0x000010f3 },
+ { DDRC_PCFGW_0(0), 0x000072ff },
+ { DDRC_PCTRL_0(0), 0x00000001 },
+ /* disable Read Qos*/
+ { DDRC_PCFGQOS0_0(0), 0x00000e00 },
+ { DDRC_PCFGQOS1_0(0), 0x0062ffff },
+ /* disable Write Qos*/
+ { DDRC_PCFGWQOS0_0(0), 0x00000e00 },
+ { DDRC_PCFGWQOS1_0(0), 0x0000ffff },
+
+ /* Frequency 1: 400mbps */
+ { DDRC_FREQ1_DRAMTMG0(0), 0x0d0b010c },
+ { DDRC_FREQ1_DRAMTMG1(0), 0x00030410 },
+ { DDRC_FREQ1_DRAMTMG2(0), 0x0305090c },
+ { DDRC_FREQ1_DRAMTMG3(0), 0x00505006 },
+ { DDRC_FREQ1_DRAMTMG4(0), 0x05040305 },
+ { DDRC_FREQ1_DRAMTMG5(0), 0x0d0e0504 },
+ { DDRC_FREQ1_DRAMTMG6(0), 0x0a060004 },
+ { DDRC_FREQ1_DRAMTMG7(0), 0x0000090e },
+ { DDRC_FREQ1_DRAMTMG14(0), 0x00000032 },
+ { DDRC_FREQ1_DRAMTMG15(0), 0x00000000 },
+ { DDRC_FREQ1_DRAMTMG17(0), 0x0036001b },
+ { DDRC_FREQ1_DERATEINT(0), 0x7e9fbeb1 },
+ { DDRC_FREQ1_DFITMG0(0), 0x03818200 },
+ { DDRC_FREQ1_DFITMG2(0), 0x00000000 },
+ { DDRC_FREQ1_RFSHTMG(0), 0x000C001c },
+ { DDRC_FREQ1_INIT3(0), 0x00840000 },
+ { DDRC_FREQ1_INIT4(0), 0x00310008 },
+ { DDRC_FREQ1_INIT6(0), 0x0066004a },
+ { DDRC_FREQ1_INIT7(0), 0x0006004a },
+
+ /* Frequency 2: 100mbps */
+ { DDRC_FREQ2_DRAMTMG0(0), 0x0d0b010c },
+ { DDRC_FREQ2_DRAMTMG1(0), 0x00030410 },
+ { DDRC_FREQ2_DRAMTMG2(0), 0x0305090c },
+ { DDRC_FREQ2_DRAMTMG3(0), 0x00505006 },
+ { DDRC_FREQ2_DRAMTMG4(0), 0x05040305 },
+ { DDRC_FREQ2_DRAMTMG5(0), 0x0d0e0504 },
+ { DDRC_FREQ2_DRAMTMG6(0), 0x0a060004 },
+ { DDRC_FREQ2_DRAMTMG7(0), 0x0000090e },
+ { DDRC_FREQ2_DRAMTMG14(0), 0x00000032 },
+ { DDRC_FREQ2_DRAMTMG17(0), 0x0036001b },
+ { DDRC_FREQ2_DERATEINT(0), 0x7e9fbeb1 },
+ { DDRC_FREQ2_DFITMG0(0), 0x03818200 },
+ { DDRC_FREQ2_DFITMG2(0), 0x00000000 },
+ { DDRC_FREQ2_RFSHTMG(0), 0x00030007 },
+ { DDRC_FREQ2_INIT3(0), 0x00840000 },
+ { DDRC_FREQ2_INIT4(0), 0x00310008 },
+ { DDRC_FREQ2_INIT6(0), 0x0066004a },
+ { DDRC_FREQ2_INIT7(0), 0x0006004a },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param lpddr4_ddrphy_cfg[] = {
+ { 0x20110, 0x02 },
+ { 0x20111, 0x03 },
+ { 0x20112, 0x04 },
+ { 0x20113, 0x05 },
+ { 0x20114, 0x00 },
+ { 0x20115, 0x01 },
+
+ { 0x1005f, 0x1ff },
+ { 0x1015f, 0x1ff },
+ { 0x1105f, 0x1ff },
+ { 0x1115f, 0x1ff },
+ { 0x1205f, 0x1ff },
+ { 0x1215f, 0x1ff },
+ { 0x1305f, 0x1ff },
+ { 0x1315f, 0x1ff },
+
+ { 0x11005f, 0x1ff },
+ { 0x11015f, 0x1ff },
+ { 0x11105f, 0x1ff },
+ { 0x11115f, 0x1ff },
+ { 0x11205f, 0x1ff },
+ { 0x11215f, 0x1ff },
+ { 0x11305f, 0x1ff },
+ { 0x11315f, 0x1ff },
+
+ { 0x21005f, 0x1ff },
+ { 0x21015f, 0x1ff },
+ { 0x21105f, 0x1ff },
+ { 0x21115f, 0x1ff },
+ { 0x21205f, 0x1ff },
+ { 0x21215f, 0x1ff },
+ { 0x21305f, 0x1ff },
+ { 0x21315f, 0x1ff },
+
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x3055, 0x1ff },
+ { 0x4055, 0x1ff },
+ { 0x5055, 0x1ff },
+ { 0x6055, 0x1ff },
+ { 0x7055, 0x1ff },
+ { 0x8055, 0x1ff },
+ { 0x9055, 0x1ff },
+
+ { 0x200c5, 0x19 },
+ { 0x1200c5, 0x7 },
+ { 0x2200c5, 0x7 },
+
+ { 0x2002e, 0x2 },
+ { 0x12002e, 0x2 },
+ { 0x22002e, 0x2 },
+
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+
+#ifdef WR_POST_EXT_3200
+ { 0x20024, 0xeb },
+#else
+ { 0x20024, 0xab },
+#endif
+ { 0x2003a, 0x0 },
+ { 0x120024, 0xab },
+ { 0x2003a, 0x0 },
+ { 0x220024, 0xab },
+ { 0x2003a, 0x0 },
+ { 0x20056, 0x3 },
+ { 0x120056, 0xa },
+ { 0x220056, 0xa },
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x1204d, 0xe00 },
+ { 0x1214d, 0xe00 },
+ { 0x1304d, 0xe00 },
+ { 0x1314d, 0xe00 },
+ { 0x11004d, 0xe00 },
+ { 0x11014d, 0xe00 },
+ { 0x11104d, 0xe00 },
+ { 0x11114d, 0xe00 },
+ { 0x11204d, 0xe00 },
+ { 0x11214d, 0xe00 },
+ { 0x11304d, 0xe00 },
+ { 0x11314d, 0xe00 },
+ { 0x21004d, 0xe00 },
+ { 0x21014d, 0xe00 },
+ { 0x21104d, 0xe00 },
+ { 0x21114d, 0xe00 },
+ { 0x21204d, 0xe00 },
+ { 0x21214d, 0xe00 },
+ { 0x21304d, 0xe00 },
+ { 0x21314d, 0xe00 },
+
+ { 0x10049, 0xfbe },
+ { 0x10149, 0xfbe },
+ { 0x11049, 0xfbe },
+ { 0x11149, 0xfbe },
+ { 0x12049, 0xfbe },
+ { 0x12149, 0xfbe },
+ { 0x13049, 0xfbe },
+ { 0x13149, 0xfbe },
+ { 0x110049, 0xfbe },
+ { 0x110149, 0xfbe },
+ { 0x111049, 0xfbe },
+ { 0x111149, 0xfbe },
+ { 0x112049, 0xfbe },
+ { 0x112149, 0xfbe },
+ { 0x113049, 0xfbe },
+ { 0x113149, 0xfbe },
+ { 0x210049, 0xfbe },
+ { 0x210149, 0xfbe },
+ { 0x211049, 0xfbe },
+ { 0x211149, 0xfbe },
+ { 0x212049, 0xfbe },
+ { 0x212149, 0xfbe },
+ { 0x213049, 0xfbe },
+ { 0x213149, 0xfbe },
+
+ { 0x43, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x1043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x2043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x3043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x4043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x5043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x6043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x7043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x8043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+ { 0x9043, ((LPDDR4_PHY_ADDR_RON << 5) | LPDDR4_PHY_ADDR_RON) },
+
+ { 0x20018, 0x3 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x320 },
+ { 0x120008, 0x64 },
+ { 0x220008, 0x19 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x104 },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x12043, 0x5a1 },
+ { 0x12143, 0x5a1 },
+ { 0x13043, 0x5a1 },
+ { 0x13143, 0x5a1 },
+ { 0x1200b2, 0x104 },
+ { 0x110043, 0x5a1 },
+ { 0x110143, 0x5a1 },
+ { 0x111043, 0x5a1 },
+ { 0x111143, 0x5a1 },
+ { 0x112043, 0x5a1 },
+ { 0x112143, 0x5a1 },
+ { 0x113043, 0x5a1 },
+ { 0x113143, 0x5a1 },
+ { 0x2200b2, 0x104 },
+ { 0x210043, 0x5a1 },
+ { 0x210143, 0x5a1 },
+ { 0x211043, 0x5a1 },
+ { 0x211143, 0x5a1 },
+ { 0x212043, 0x5a1 },
+ { 0x212143, 0x5a1 },
+ { 0x213043, 0x5a1 },
+ { 0x213143, 0x5a1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x2200fa, 0x1 },
+ { 0x20019, 0x1 },
+ { 0x120019, 0x1 },
+ { 0x220019, 0x1 },
+ { 0x200f0, 0x660 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5665 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x22002d, 0x0 },
+
+ { 0x200c7, 0x80 },
+ { 0x1200c7, 0x80 },
+ { 0x2200c7, 0x80 },
+ { 0x200ca, 0x106 },
+ { 0x1200ca, 0x106 },
+ { 0x2200ca, 0x106 },
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param lpddr4_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x0 },
+ { 0x54003, 0xc80 },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) }, /* PHY Ron/Rtt */
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, 0x131f },
+ { 0x54009, LPDDR4_HDT_CTL_3200_1D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_3200_1d << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, 0x0 },
+ { 0x54010, 0x0 },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+
+ { 0x54019, 0x2dd4 },
+#ifdef WR_POST_EXT_3200
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x3) },
+#else
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x1) },
+#endif
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0 },
+ { 0x5401f, 0x2dd4 },
+#ifdef WR_POST_EXT_3200
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x3) },
+#else
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x1) },
+#endif
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0xd400 },
+ /* MR3/MR2 */
+#ifdef WR_POST_EXT_3200
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d /*0x312d*/ },
+#else
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x2d/*0x312d*/ },
+#endif
+ /* MR11/MR4 */
+ { 0x54034, (((LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) << 8) },
+ /* self:0x284d//MR13/MR12 */
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA)/*0x084d*/ },
+ /* MR16/MR14*/
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0/*0x4d*/ },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8)/*0x500*/ },
+ /* MR1 */
+ { 0x54038, 0xd400 },
+ /* MR3/MR2 */
+#ifdef WR_POST_EXT_3200
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d/*0x312d*/ },
+#else
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x2d/*0x312d*/ },
+#endif
+ /* MR11/MR4 */
+ { 0x5403a, (((LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) << 8) },
+ /* self:0x284d//MR13/MR12 */
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA)/*0x084d*/ },
+ /* MR16/MR14 */
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1/*0x4d*/ },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8)/*0x500*/ },
+ /* { 0x5403d, 0x500 } */
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8)/*0x500*/ },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+struct dram_cfg_param lpddr4_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x101 },
+ { 0x54003, 0x190 },
+ { 0x54004, 0x2 },
+ /* PHY Ron/Rtt */
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT)/*0x2828*/ },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, LPDDR4_TRAIN_SEQ_400 },
+ { 0x54009, LPDDR4_HDT_CTL_400_1D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_400 << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, 0x0 },
+ { 0x54010, 0x0 },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54019, 0x84 },
+ /* MR4/MR3 */
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x1)/*0x31*/ },
+ /* MR12/MR11 */
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) | (LPDDR4_RTT_CA << 4) |
+ LPDDR4_RTT_DQ)/*0x4d46*/ },
+ /* self:0x4d28//MR14/MR13 */
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08)/*0x4d08*/ },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0/*0x5*/ },
+ { 0x5401f, 0x84 },
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x1)/*0x31*/ }, /* MR4/MR3 */
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) | (LPDDR4_RTT_CA << 4) |
+ LPDDR4_RTT_DQ)/*0x4d46*/ },/* MR12/MR11 */
+ /* self:0x4d28//MR14/MR13 */
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08)/*0x4d08*/ },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0x8400 },
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x00 },
+ { 0x54034, (((LPDDR4_RTT_CA << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8) },
+ { 0x54038, 0x8400 },
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x00 },
+ { 0x5403a, (((LPDDR4_RTT_CA << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+};
+
+/* P2 message block paremeter for training firmware */
+struct dram_cfg_param lpddr4_fsp2_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x102 },
+ { 0x54003, 0x64 },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, LPDDR4_TRAIN_SEQ_100 },
+ { 0x54009, LPDDR4_HDT_CTL_100_1D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_100 << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, 0x0 },
+ { 0x54010, 0x0 },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54019, 0x84 },
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x1) },
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) | (LPDDR4_RTT_CA << 4) |
+ LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0 },
+ { 0x5401f, 0x84 },
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x1) },
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) | (LPDDR4_RTT_CA << 4) |
+ LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0x8400 },
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x00 },
+ { 0x54034, (((LPDDR4_RTT_CA << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8) },
+ { 0x54038, 0x8400 },
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x00 },
+ { 0x5403a, (((LPDDR4_RTT_CA << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param lpddr4_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x0 },
+ { 0x54003, 0xc80 },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, 0x61 },
+ { 0x54009, LPDDR4_HDT_CTL_2D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_3200_2d << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, (LPDDR4_2D_SHARE << 8) | 0x00 },
+ { 0x54010, LPDDR4_2D_WEIGHT },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54019, 0x2dd4 },
+#ifdef WR_POST_EXT_3200
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x3) },
+#else
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x1) },
+#endif
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0 },
+ { 0x5401f, 0x2dd4 },
+#ifdef WR_POST_EXT_3200
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x3) },
+#else
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x1) },
+#endif
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+
+ { 0x54032, 0xd400 },
+#ifdef WR_POST_EXT_3200
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+#else
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x2d },
+#endif
+ { 0x54034, (((LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8) },
+ { 0x54038, 0xd400 },
+#ifdef WR_POST_EXT_3200
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+#else
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x2d },
+#endif
+ { 0x5403a, (((LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param lpddr4_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xf },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x630 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x630 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x630 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x45a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x448 },
+ { 0x90055, 0x109 },
+ { 0x90056, 0x40 },
+ { 0x90057, 0x630 },
+ { 0x90058, 0x179 },
+ { 0x90059, 0x1 },
+ { 0x9005a, 0x618 },
+ { 0x9005b, 0x109 },
+ { 0x9005c, 0x40c0 },
+ { 0x9005d, 0x630 },
+ { 0x9005e, 0x149 },
+ { 0x9005f, 0x8 },
+ { 0x90060, 0x4 },
+ { 0x90061, 0x48 },
+ { 0x90062, 0x4040 },
+ { 0x90063, 0x630 },
+ { 0x90064, 0x149 },
+ { 0x90065, 0x0 },
+ { 0x90066, 0x4 },
+ { 0x90067, 0x48 },
+ { 0x90068, 0x40 },
+ { 0x90069, 0x630 },
+ { 0x9006a, 0x149 },
+ { 0x9006b, 0x10 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x18 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x4 },
+ { 0x90070, 0x78 },
+ { 0x90071, 0x549 },
+ { 0x90072, 0x630 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0xd49 },
+ { 0x90075, 0x630 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x94a },
+ { 0x90078, 0x630 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0x441 },
+ { 0x9007b, 0x630 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x42 },
+ { 0x9007e, 0x630 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x1 },
+ { 0x90081, 0x630 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x0 },
+ { 0x90084, 0xe0 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0xa },
+ { 0x90087, 0x10 },
+ { 0x90088, 0x109 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x149 },
+ { 0x9008c, 0x9 },
+ { 0x9008d, 0x3c0 },
+ { 0x9008e, 0x159 },
+ { 0x9008f, 0x18 },
+ { 0x90090, 0x10 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x0 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x109 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x48 },
+ { 0x90098, 0x18 },
+ { 0x90099, 0x4 },
+ { 0x9009a, 0x58 },
+ { 0x9009b, 0xa },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x2 },
+ { 0x9009f, 0x10 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x5 },
+ { 0x900a2, 0x7c0 },
+ { 0x900a3, 0x109 },
+ { 0x900a4, 0x10 },
+ { 0x900a5, 0x10 },
+ { 0x900a6, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x623 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x623 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900a7, 0x0 },
+ { 0x900a8, 0x790 },
+ { 0x900a9, 0x11a },
+ { 0x900aa, 0x8 },
+ { 0x900ab, 0x7aa },
+ { 0x900ac, 0x2a },
+ { 0x900ad, 0x10 },
+ { 0x900ae, 0x7b2 },
+ { 0x900af, 0x2a },
+ { 0x900b0, 0x0 },
+ { 0x900b1, 0x7c8 },
+ { 0x900b2, 0x109 },
+ { 0x900b3, 0x10 },
+ { 0x900b4, 0x2a8 },
+ { 0x900b5, 0x129 },
+ { 0x900b6, 0x8 },
+ { 0x900b7, 0x370 },
+ { 0x900b8, 0x129 },
+ { 0x900b9, 0xa },
+ { 0x900ba, 0x3c8 },
+ { 0x900bb, 0x1a9 },
+ { 0x900bc, 0xc },
+ { 0x900bd, 0x408 },
+ { 0x900be, 0x199 },
+ { 0x900bf, 0x14 },
+ { 0x900c0, 0x790 },
+ { 0x900c1, 0x11a },
+ { 0x900c2, 0x8 },
+ { 0x900c3, 0x4 },
+ { 0x900c4, 0x18 },
+ { 0x900c5, 0xe },
+ { 0x900c6, 0x408 },
+ { 0x900c7, 0x199 },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x8568 },
+ { 0x900ca, 0x108 },
+ { 0x900cb, 0x18 },
+ { 0x900cc, 0x790 },
+ { 0x900cd, 0x16a },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x1d8 },
+ { 0x900d0, 0x169 },
+ { 0x900d1, 0x10 },
+ { 0x900d2, 0x8558 },
+ { 0x900d3, 0x168 },
+ { 0x900d4, 0x70 },
+ { 0x900d5, 0x788 },
+ { 0x900d6, 0x16a },
+ { 0x900d7, 0x1ff8 },
+ { 0x900d8, 0x85a8 },
+ { 0x900d9, 0x1e8 },
+ { 0x900da, 0x50 },
+ { 0x900db, 0x798 },
+ { 0x900dc, 0x16a },
+ { 0x900dd, 0x60 },
+ { 0x900de, 0x7a0 },
+ { 0x900df, 0x16a },
+ { 0x900e0, 0x8 },
+ { 0x900e1, 0x8310 },
+ { 0x900e2, 0x168 },
+ { 0x900e3, 0x8 },
+ { 0x900e4, 0xa310 },
+ { 0x900e5, 0x168 },
+ { 0x900e6, 0xa },
+ { 0x900e7, 0x408 },
+ { 0x900e8, 0x169 },
+ { 0x900e9, 0x6e },
+ { 0x900ea, 0x0 },
+ { 0x900eb, 0x68 },
+ { 0x900ec, 0x0 },
+ { 0x900ed, 0x408 },
+ { 0x900ee, 0x169 },
+ { 0x900ef, 0x0 },
+ { 0x900f0, 0x8310 },
+ { 0x900f1, 0x168 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0xa310 },
+ { 0x900f4, 0x168 },
+ { 0x900f5, 0x1ff8 },
+ { 0x900f6, 0x85a8 },
+ { 0x900f7, 0x1e8 },
+ { 0x900f8, 0x68 },
+ { 0x900f9, 0x798 },
+ { 0x900fa, 0x16a },
+ { 0x900fb, 0x78 },
+ { 0x900fc, 0x7a0 },
+ { 0x900fd, 0x16a },
+ { 0x900fe, 0x68 },
+ { 0x900ff, 0x790 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x8 },
+ { 0x90102, 0x8b10 },
+ { 0x90103, 0x168 },
+ { 0x90104, 0x8 },
+ { 0x90105, 0xab10 },
+ { 0x90106, 0x168 },
+ { 0x90107, 0xa },
+ { 0x90108, 0x408 },
+ { 0x90109, 0x169 },
+ { 0x9010a, 0x58 },
+ { 0x9010b, 0x0 },
+ { 0x9010c, 0x68 },
+ { 0x9010d, 0x0 },
+ { 0x9010e, 0x408 },
+ { 0x9010f, 0x169 },
+ { 0x90110, 0x0 },
+ { 0x90111, 0x8b10 },
+ { 0x90112, 0x168 },
+ { 0x90113, 0x0 },
+ { 0x90114, 0xab10 },
+ { 0x90115, 0x168 },
+ { 0x90116, 0x0 },
+ { 0x90117, 0x1d8 },
+ { 0x90118, 0x169 },
+ { 0x90119, 0x80 },
+ { 0x9011a, 0x790 },
+ { 0x9011b, 0x16a },
+ { 0x9011c, 0x18 },
+ { 0x9011d, 0x7aa },
+ { 0x9011e, 0x6a },
+ { 0x9011f, 0xa },
+ { 0x90120, 0x0 },
+ { 0x90121, 0x1e9 },
+ { 0x90122, 0x8 },
+ { 0x90123, 0x8080 },
+ { 0x90124, 0x108 },
+ { 0x90125, 0xf },
+ { 0x90126, 0x408 },
+ { 0x90127, 0x169 },
+ { 0x90128, 0xc },
+ { 0x90129, 0x0 },
+ { 0x9012a, 0x68 },
+ { 0x9012b, 0x9 },
+ { 0x9012c, 0x0 },
+ { 0x9012d, 0x1a9 },
+ { 0x9012e, 0x0 },
+ { 0x9012f, 0x408 },
+ { 0x90130, 0x169 },
+ { 0x90131, 0x0 },
+ { 0x90132, 0x8080 },
+ { 0x90133, 0x108 },
+ { 0x90134, 0x8 },
+ { 0x90135, 0x7aa },
+ { 0x90136, 0x6a },
+ { 0x90137, 0x0 },
+ { 0x90138, 0x8568 },
+ { 0x90139, 0x108 },
+ { 0x9013a, 0xb7 },
+ { 0x9013b, 0x790 },
+ { 0x9013c, 0x16a },
+ { 0x9013d, 0x1f },
+ { 0x9013e, 0x0 },
+ { 0x9013f, 0x68 },
+ { 0x90140, 0x8 },
+ { 0x90141, 0x8558 },
+ { 0x90142, 0x168 },
+ { 0x90143, 0xf },
+ { 0x90144, 0x408 },
+ { 0x90145, 0x169 },
+ { 0x90146, 0xc },
+ { 0x90147, 0x0 },
+ { 0x90148, 0x68 },
+ { 0x90149, 0x0 },
+ { 0x9014a, 0x408 },
+ { 0x9014b, 0x169 },
+ { 0x9014c, 0x0 },
+ { 0x9014d, 0x8558 },
+ { 0x9014e, 0x168 },
+ { 0x9014f, 0x8 },
+ { 0x90150, 0x3c8 },
+ { 0x90151, 0x1a9 },
+ { 0x90152, 0x3 },
+ { 0x90153, 0x370 },
+ { 0x90154, 0x129 },
+ { 0x90155, 0x20 },
+ { 0x90156, 0x2aa },
+ { 0x90157, 0x9 },
+ { 0x90158, 0x0 },
+ { 0x90159, 0x400 },
+ { 0x9015a, 0x10e },
+ { 0x9015b, 0x8 },
+ { 0x9015c, 0xe8 },
+ { 0x9015d, 0x109 },
+ { 0x9015e, 0x0 },
+ { 0x9015f, 0x8140 },
+ { 0x90160, 0x10c },
+ { 0x90161, 0x10 },
+ { 0x90162, 0x8138 },
+ { 0x90163, 0x10c },
+ { 0x90164, 0x8 },
+ { 0x90165, 0x7c8 },
+ { 0x90166, 0x101 },
+ { 0x90167, 0x8 },
+ { 0x90168, 0x0 },
+ { 0x90169, 0x8 },
+ { 0x9016a, 0x8 },
+ { 0x9016b, 0x448 },
+ { 0x9016c, 0x109 },
+ { 0x9016d, 0xf },
+ { 0x9016e, 0x7c0 },
+ { 0x9016f, 0x109 },
+ { 0x90170, 0x0 },
+ { 0x90171, 0xe8 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0x47 },
+ { 0x90174, 0x630 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x8 },
+ { 0x90177, 0x618 },
+ { 0x90178, 0x109 },
+ { 0x90179, 0x8 },
+ { 0x9017a, 0xe0 },
+ { 0x9017b, 0x109 },
+ { 0x9017c, 0x0 },
+ { 0x9017d, 0x7c8 },
+ { 0x9017e, 0x109 },
+ { 0x9017f, 0x8 },
+ { 0x90180, 0x8140 },
+ { 0x90181, 0x10c },
+ { 0x90182, 0x0 },
+ { 0x90183, 0x1 },
+ { 0x90184, 0x8 },
+ { 0x90185, 0x8 },
+ { 0x90186, 0x4 },
+ { 0x90187, 0x8 },
+ { 0x90188, 0x8 },
+ { 0x90189, 0x7c8 },
+ { 0x9018a, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x2a },
+ { 0x90026, 0x6a },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+ { 0x2000b, 0x64 },
+ { 0x2000c, 0xc8 },
+ { 0x2000d, 0x7d0 },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0xc },
+ { 0x12000c, 0x19 },
+ { 0x12000d, 0xfa },
+ { 0x12000e, 0x10 },
+ { 0x22000b, 0x3 },
+ { 0x22000c, 0x6 },
+ { 0x22000d, 0x3e },
+ { 0x22000e, 0x10 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x60 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x140080, 0xe0 },
+ { 0x140081, 0x12 },
+ { 0x140082, 0xe0 },
+ { 0x140083, 0x12 },
+ { 0x140084, 0xe0 },
+ { 0x140085, 0x12 },
+ { 0x240080, 0xe0 },
+ { 0x240081, 0x12 },
+ { 0x240082, 0xe0 },
+ { 0x240083, 0x12 },
+ { 0x240084, 0xe0 },
+ { 0x240085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x12011, 0x1 },
+ { 0x12012, 0x1 },
+ { 0x12013, 0x180 },
+ { 0x12018, 0x1 },
+ { 0x12002, 0x6209 },
+ { 0x120b2, 0x1 },
+ { 0x121b4, 0x1 },
+ { 0x122b4, 0x1 },
+ { 0x123b4, 0x1 },
+ { 0x124b4, 0x1 },
+ { 0x125b4, 0x1 },
+ { 0x126b4, 0x1 },
+ { 0x127b4, 0x1 },
+ { 0x128b4, 0x1 },
+ { 0x13011, 0x1 },
+ { 0x13012, 0x1 },
+ { 0x13013, 0x180 },
+ { 0x13018, 0x1 },
+ { 0x13002, 0x6209 },
+ { 0x130b2, 0x1 },
+ { 0x131b4, 0x1 },
+ { 0x132b4, 0x1 },
+ { 0x133b4, 0x1 },
+ { 0x134b4, 0x1 },
+ { 0x135b4, 0x1 },
+ { 0x136b4, 0x1 },
+ { 0x137b4, 0x1 },
+ { 0x138b4, 0x1 },
+ { 0x2003a, 0x2 },
+ { 0xc0080, 0x2 },
+ { 0xd0000, 0x1 },
+};
+
+struct dram_fsp_msg lpddr4_dram_fsp_msg[] = {
+ {
+ /* P0 3200mts 1D */
+ .drate = 3200,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = lpddr4_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp0_cfg),
+ },
+ {
+ /* P1 400mts 1D */
+ .drate = 400,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = lpddr4_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp1_cfg),
+ },
+ {
+ /* P1 100mts 1D */
+ .drate = 100,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = lpddr4_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp2_cfg),
+ },
+ {
+ /* P0 3200mts 2D */
+ .drate = 3200,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = lpddr4_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp0_2d_cfg),
+ },
+};
+
+/* lpddr4 timing config params on EVK board */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = lpddr4_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(lpddr4_ddrc_cfg),
+ .ddrphy_cfg = lpddr4_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(lpddr4_ddrphy_cfg),
+ .fsp_msg = lpddr4_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(lpddr4_dram_fsp_msg),
+ .ddrphy_pie = lpddr4_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(lpddr4_phy_pie),
+ .fsp_table = { 3200, 400, 100, },
+};
diff --git a/board/freescale/imx8mq_evk/lpddr4_timing_b0.c b/board/freescale/imx8mq_evk/lpddr4_timing_b0.c
new file mode 100644
index 00000000000..5d8f2803be6
--- /dev/null
+++ b/board/freescale/imx8mq_evk/lpddr4_timing_b0.c
@@ -0,0 +1,1190 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+#include <asm/arch/lpddr4_define.h>
+
+#define WR_POST_EXT_3200 /* recommened to define */
+
+static struct dram_cfg_param lpddr4_ddrc_cfg[] = {
+ /* Start to config, default 3200mbps */
+ /* dis_dq=1, indicates no reads or writes are issued to SDRAM */
+ { DDRC_DBG1(0), 0x00000001 },
+ /* selfref_en=1, SDRAM enter self-refresh state */
+ { DDRC_PWRCTL(0), 0x00000001 },
+ { DDRC_MSTR(0), 0xa3080020 },
+ { DDRC_MSTR2(0), 0x00000000 },
+ { DDRC_RFSHTMG(0), 0x006100E0 },
+ { DDRC_INIT0(0), 0xC003061B },
+ { DDRC_INIT1(0), 0x009D0000 },
+ { DDRC_INIT3(0), 0x00D4002D },
+#ifdef WR_POST_EXT_3200 /* recommened to define */
+ { DDRC_INIT4(0), 0x00330008 },
+#else
+ { DDRC_INIT4(0), 0x00310008 },
+#endif
+ { DDRC_INIT6(0), 0x0066004a },
+ { DDRC_INIT7(0), 0x0006004a },
+
+ { DDRC_DRAMTMG0(0), 0x1A201B22 },
+ { DDRC_DRAMTMG1(0), 0x00060633 },
+ { DDRC_DRAMTMG3(0), 0x00C0C000 },
+ { DDRC_DRAMTMG4(0), 0x0F04080F },
+ { DDRC_DRAMTMG5(0), 0x02040C0C },
+ { DDRC_DRAMTMG6(0), 0x01010007 },
+ { DDRC_DRAMTMG7(0), 0x00000401 },
+ { DDRC_DRAMTMG12(0), 0x00020600 },
+ { DDRC_DRAMTMG13(0), 0x0C100002 },
+ { DDRC_DRAMTMG14(0), 0x000000E6 },
+ { DDRC_DRAMTMG17(0), 0x00A00050 },
+
+ { DDRC_ZQCTL0(0), 0x03200018 },
+ { DDRC_ZQCTL1(0), 0x028061A8 },
+ { DDRC_ZQCTL2(0), 0x00000000 },
+
+ { DDRC_DFITMG0(0), 0x0497820A },
+ { DDRC_DFITMG1(0), 0x00080303 },
+ { DDRC_DFIUPD0(0), 0xE0400018 },
+ { DDRC_DFIUPD1(0), 0x00DF00E4 },
+ { DDRC_DFIUPD2(0), 0x80000000 },
+ { DDRC_DFIMISC(0), 0x00000011 },
+ { DDRC_DFITMG2(0), 0x0000170A },
+
+ { DDRC_DBICTL(0), 0x00000001 },
+ { DDRC_DFIPHYMSTR(0), 0x00000001 },
+
+ /* need be refined by ddrphy trained value */
+ { DDRC_RANKCTL(0), 0x00000c99 },
+ { DDRC_DRAMTMG2(0), 0x070E171a },
+
+ /* address mapping */
+ /* Address map is from MSB 29: r15, r14, cs, r13-r0, b2-b0, c9-c0 */
+ { DDRC_ADDRMAP0(0), 0x00000015 },
+ { DDRC_ADDRMAP3(0), 0x00000000 },
+ /* addrmap_col_b10 addrmap_col_b11 set to de-activated (5-bit width) */
+ { DDRC_ADDRMAP4(0), 0x00001F1F },
+ /* bank interleave */
+ /* addrmap_bank_b2, addrmap_bank_b1, addrmap_bank_b0 */
+ { DDRC_ADDRMAP1(0), 0x00080808 },
+ /* addrmap_row_b11 addrmap_row_b10_b2 addrmap_row_b1 addrmap_row_b0 */
+ { DDRC_ADDRMAP5(0), 0x07070707 },
+ /* addrmap_row_b15 addrmap_row_b14 addrmap_row_b13 addrmap_row_b12 */
+ { DDRC_ADDRMAP6(0), 0x08080707 },
+
+ /* 667mts frequency setting */
+ { DDRC_FREQ1_DERATEEN(0), 0x0000000 },
+ { DDRC_FREQ1_DERATEINT(0), 0x0800000 },
+ { DDRC_FREQ1_RFSHCTL0(0), 0x0210000 },
+ { DDRC_FREQ1_RFSHTMG(0), 0x014001E },
+ { DDRC_FREQ1_INIT3(0), 0x0140009 },
+ { DDRC_FREQ1_INIT4(0), 0x00310008 },
+ { DDRC_FREQ1_INIT6(0), 0x0066004a },
+ { DDRC_FREQ1_INIT7(0), 0x0006004a },
+ { DDRC_FREQ1_DRAMTMG0(0), 0xB070A07 },
+ { DDRC_FREQ1_DRAMTMG1(0), 0x003040A },
+ { DDRC_FREQ1_DRAMTMG2(0), 0x305080C },
+ { DDRC_FREQ1_DRAMTMG3(0), 0x0505000 },
+ { DDRC_FREQ1_DRAMTMG4(0), 0x3040203 },
+ { DDRC_FREQ1_DRAMTMG5(0), 0x2030303 },
+ { DDRC_FREQ1_DRAMTMG6(0), 0x2020004 },
+ { DDRC_FREQ1_DRAMTMG7(0), 0x0000302 },
+ { DDRC_FREQ1_DRAMTMG12(0), 0x0020310 },
+ { DDRC_FREQ1_DRAMTMG13(0), 0xA100002 },
+ { DDRC_FREQ1_DRAMTMG14(0), 0x0000020 },
+ { DDRC_FREQ1_DRAMTMG17(0), 0x0220011 },
+ { DDRC_FREQ1_ZQCTL0(0), 0x0A70005 },
+ { DDRC_FREQ1_DFITMG0(0), 0x3858202 },
+ { DDRC_FREQ1_DFITMG1(0), 0x0000404 },
+ { DDRC_FREQ1_DFITMG2(0), 0x0000502 },
+
+ /* performance setting */
+ { DDRC_ODTCFG(0), 0x0b060908 },
+ { DDRC_ODTMAP(0), 0x00000000 },
+ { DDRC_SCHED(0), 0x29511505 },
+ { DDRC_SCHED1(0), 0x0000002c },
+ { DDRC_PERFHPR1(0), 0x5900575b },
+ /* 150T starve and 0x90 max tran len */
+ { DDRC_PERFLPR1(0), 0x90000096 },
+ /* 300T starve and 0x10 max tran len */
+ { DDRC_PERFWR1(0), 0x1000012c },
+ { DDRC_DBG0(0), 0x00000016 },
+ { DDRC_DBG1(0), 0x00000000 },
+ { DDRC_DBGCMD(0), 0x00000000 },
+ { DDRC_SWCTL(0), 0x00000001 },
+ { DDRC_POISONCFG(0), 0x00000011 },
+ { DDRC_PCCFG(0), 0x00000111 },
+ { DDRC_PCFGR_0(0), 0x000010f3 },
+ { DDRC_PCFGW_0(0), 0x000072ff },
+ { DDRC_PCTRL_0(0), 0x00000001 },
+ /* disable Read Qos*/
+ { DDRC_PCFGQOS0_0(0), 0x00000e00 },
+ { DDRC_PCFGQOS1_0(0), 0x0062ffff },
+ /* disable Write Qos*/
+ { DDRC_PCFGWQOS0_0(0), 0x00000e00 },
+ { DDRC_PCFGWQOS1_0(0), 0x0000ffff },
+ { DDRC_FREQ1_DERATEEN(0), 0x00000202 },
+ { DDRC_FREQ1_DERATEINT(0), 0xec78f4b5 },
+ { DDRC_FREQ1_RFSHCTL0(0), 0x00618040 },
+ { DDRC_FREQ1_RFSHTMG(0), 0x00610090 },
+};
+
+/* PHY Initialize Configuration */
+static struct dram_cfg_param lpddr4_ddrphy_cfg[] = {
+ { 0x20110, 0x02 }, /* MapCAB0toDFI */
+ { 0x20111, 0x03 }, /* MapCAB1toDFI */
+ { 0x20112, 0x04 }, /* MapCAB2toDFI */
+ { 0x20113, 0x05 }, /* MapCAB3toDFI */
+ { 0x20114, 0x00 }, /* MapCAB4toDFI */
+ { 0x20115, 0x01 }, /* MapCAB5toDFI */
+
+ /* Initialize PHY Configuration */
+ { 0x1005f, 0x1ff },
+ { 0x1015f, 0x1ff },
+ { 0x1105f, 0x1ff },
+ { 0x1115f, 0x1ff },
+ { 0x1205f, 0x1ff },
+ { 0x1215f, 0x1ff },
+ { 0x1305f, 0x1ff },
+ { 0x1315f, 0x1ff },
+
+ { 0x11005f, 0x1ff },
+ { 0x11015f, 0x1ff },
+ { 0x11105f, 0x1ff },
+ { 0x11115f, 0x1ff },
+ { 0x11205f, 0x1ff },
+ { 0x11215f, 0x1ff },
+ { 0x11305f, 0x1ff },
+ { 0x11315f, 0x1ff },
+
+ { 0x21005f, 0x1ff },
+ { 0x21015f, 0x1ff },
+ { 0x21105f, 0x1ff },
+ { 0x21115f, 0x1ff },
+ { 0x21205f, 0x1ff },
+ { 0x21215f, 0x1ff },
+ { 0x21305f, 0x1ff },
+ { 0x21315f, 0x1ff },
+
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x3055, 0x1ff },
+ { 0x4055, 0x1ff },
+ { 0x5055, 0x1ff },
+ { 0x6055, 0x1ff },
+ { 0x7055, 0x1ff },
+ { 0x8055, 0x1ff },
+ { 0x9055, 0x1ff },
+ { 0x200c5, 0x19 },
+ { 0x1200c5, 0x7 },
+ { 0x2200c5, 0x7 },
+ { 0x2002e, 0x2 },
+ { 0x12002e, 0x1 },
+ { 0x22002e, 0x2 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+
+ { 0x20024, 0xe3 },
+ { 0x2003a, 0x2 },
+ { 0x120024, 0xa3 },
+ { 0x2003a, 0x2 },
+ { 0x220024, 0xa3 },
+ { 0x2003a, 0x2 },
+
+ { 0x20056, 0x3 },
+ { 0x120056, 0xa },
+ { 0x220056, 0xa },
+
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x1204d, 0xe00 },
+ { 0x1214d, 0xe00 },
+ { 0x1304d, 0xe00 },
+ { 0x1314d, 0xe00 },
+ { 0x11004d, 0xe00 },
+ { 0x11014d, 0xe00 },
+ { 0x11104d, 0xe00 },
+ { 0x11114d, 0xe00 },
+ { 0x11204d, 0xe00 },
+ { 0x11214d, 0xe00 },
+ { 0x11304d, 0xe00 },
+ { 0x11314d, 0xe00 },
+ { 0x21004d, 0xe00 },
+ { 0x21014d, 0xe00 },
+ { 0x21104d, 0xe00 },
+ { 0x21114d, 0xe00 },
+ { 0x21204d, 0xe00 },
+ { 0x21214d, 0xe00 },
+ { 0x21304d, 0xe00 },
+ { 0x21314d, 0xe00 },
+
+ { 0x10049, 0xfbe },
+ { 0x10149, 0xfbe },
+ { 0x11049, 0xfbe },
+ { 0x11149, 0xfbe },
+ { 0x12049, 0xfbe },
+ { 0x12149, 0xfbe },
+ { 0x13049, 0xfbe },
+ { 0x13149, 0xfbe },
+
+ { 0x110049, 0xfbe },
+ { 0x110149, 0xfbe },
+ { 0x111049, 0xfbe },
+ { 0x111149, 0xfbe },
+ { 0x112049, 0xfbe },
+ { 0x112149, 0xfbe },
+ { 0x113049, 0xfbe },
+ { 0x113149, 0xfbe },
+
+ { 0x210049, 0xfbe },
+ { 0x210149, 0xfbe },
+ { 0x211049, 0xfbe },
+ { 0x211149, 0xfbe },
+ { 0x212049, 0xfbe },
+ { 0x212149, 0xfbe },
+ { 0x213049, 0xfbe },
+ { 0x213149, 0xfbe },
+
+ { 0x43, 0x63 },
+ { 0x1043, 0x63 },
+ { 0x2043, 0x63 },
+ { 0x3043, 0x63 },
+ { 0x4043, 0x63 },
+ { 0x5043, 0x63 },
+ { 0x6043, 0x63 },
+ { 0x7043, 0x63 },
+ { 0x8043, 0x63 },
+ { 0x9043, 0x63 },
+
+ { 0x20018, 0x3 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+ { 0x20008, 0x320 },
+ { 0x120008, 0xa7 },
+ { 0x220008, 0x19 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x104 },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x12043, 0x5a1 },
+ { 0x12143, 0x5a1 },
+ { 0x13043, 0x5a1 },
+ { 0x13143, 0x5a1 },
+ { 0x1200b2, 0x104 },
+ { 0x110043, 0x5a1 },
+ { 0x110143, 0x5a1 },
+ { 0x111043, 0x5a1 },
+ { 0x111143, 0x5a1 },
+ { 0x112043, 0x5a1 },
+ { 0x112143, 0x5a1 },
+ { 0x113043, 0x5a1 },
+ { 0x113143, 0x5a1 },
+ { 0x2200b2, 0x104 },
+ { 0x210043, 0x5a1 },
+ { 0x210143, 0x5a1 },
+ { 0x211043, 0x5a1 },
+ { 0x211143, 0x5a1 },
+ { 0x212043, 0x5a1 },
+ { 0x212143, 0x5a1 },
+ { 0x213043, 0x5a1 },
+ { 0x213143, 0x5a1 },
+ { 0x200fa, 0x1 },
+ { 0x1200fa, 0x1 },
+ { 0x2200fa, 0x1 },
+ { 0x20019, 0x1 },
+ { 0x120019, 0x1 },
+ { 0x220019, 0x1 },
+ { 0x200f0, 0x600 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5655 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x12002d, 0x0 },
+ { 0x22002d, 0x0 },
+};
+
+/* P0 message block paremeter for training firmware */
+static struct dram_cfg_param lpddr4_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x0 },
+ { 0x54003, 0xc80 },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, 0x131f },
+ { 0x54009, LPDDR4_HDT_CTL_3200_1D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_3200_1d << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, 0x0 },
+ { 0x54010, 0x0 },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54019, 0x2dd4 },
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x3) },
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0 },
+ { 0x5401f, 0x2dd4 },
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x3) },
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0xd400 },
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+ { 0x54034, (((LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8) },
+ { 0x54038, 0xd400 },
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+ { 0x5403a, (((LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+};
+
+/* P1 message block paremeter for training firmware */
+static struct dram_cfg_param lpddr4_fsp1_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x1 },
+ { 0x54003, 0x29c },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, 0x121f },
+ { 0x54009, 0xc8 },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, 0x0 },
+ { 0x5400e, 0x0 },
+ { 0x5400f, 0x0 },
+ { 0x54010, 0x0 },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54019, 0x914 },
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x1) },
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401e, 0x6 },
+ { 0x5401f, 0x914 },
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x1) },
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0x1400 },
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x09 },
+ { 0x54034, (((LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, 0x600 },
+ { 0x54038, 0x1400 },
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x1) << 8) | 0x09 },
+ { 0x5403a, (((LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0xd0000, 0x1 },
+
+};
+
+/* P0 2D message block paremeter for training firmware */
+static struct dram_cfg_param lpddr4_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54000, 0x0 },
+ { 0x54001, 0x0 },
+ { 0x54002, 0x0 },
+ { 0x54003, 0xc80 },
+ { 0x54004, 0x2 },
+ { 0x54005, ((LPDDR4_PHY_RON << 8) | LPDDR4_PHY_RTT) },
+ { 0x54006, LPDDR4_PHY_VREF_VALUE },
+ { 0x54007, 0x0 },
+ { 0x54008, 0x61 },
+ { 0x54009, LPDDR4_HDT_CTL_2D },
+ { 0x5400a, 0x0 },
+ { 0x5400b, 0x2 },
+ { 0x5400c, 0x0 },
+ { 0x5400d, (LPDDR4_CATRAIN_3200_2d << 8) },
+ { 0x5400e, 0x0 },
+ { 0x5400f, (LPDDR4_2D_SHARE << 8) | 0x00 },
+ { 0x54010, LPDDR4_2D_WEIGHT },
+ { 0x54011, 0x0 },
+ { 0x54012, 0x310 },
+ { 0x54013, 0x0 },
+ { 0x54014, 0x0 },
+ { 0x54015, 0x0 },
+ { 0x54016, 0x0 },
+ { 0x54017, 0x0 },
+ { 0x54018, 0x0 },
+ { 0x54024, 0x5 },
+ { 0x54019, 0x2dd4 },
+ { 0x5401a, (((LPDDR4_RON) << 3) | 0x3) },
+ { 0x5401b, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) },
+ { 0x5401c, ((LPDDR4_VREF_VALUE_DQ_RANK0 << 8) | 0x08) },
+ { 0x5401d, 0x0 },
+ { 0x5401e, LPDDR4_MR22_RANK0 },
+ { 0x5401f, 0x2dd4 },
+ { 0x54020, (((LPDDR4_RON) << 3) | 0x3) },
+ { 0x54021, ((LPDDR4_VREF_VALUE_CA << 8) |
+ (LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) },
+ { 0x54022, ((LPDDR4_VREF_VALUE_DQ_RANK1 << 8) | 0x08) },
+ { 0x54023, 0x0 },
+ { 0x54024, LPDDR4_MR22_RANK1 },
+ { 0x54025, 0x0 },
+ { 0x54026, 0x0 },
+ { 0x54027, 0x0 },
+ { 0x54028, 0x0 },
+ { 0x54029, 0x0 },
+ { 0x5402a, 0x0 },
+ { 0x5402b, 0x1000 },
+ { 0x5402c, 0x3 },
+ { 0x5402d, 0x0 },
+ { 0x5402e, 0x0 },
+ { 0x5402f, 0x0 },
+ { 0x54030, 0x0 },
+ { 0x54031, 0x0 },
+ { 0x54032, 0xd400 },
+ { 0x54033, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+ { 0x54034, (((LPDDR4_RTT_CA_BANK0 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x54035, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x54036, LPDDR4_VREF_VALUE_DQ_RANK0 },
+ { 0x54037, (LPDDR4_MR22_RANK0 << 8) },
+ { 0x54038, 0xd400 },
+ { 0x54039, ((((LPDDR4_RON) << 3) | 0x3) << 8) | 0x2d },
+ { 0x5403a, (((LPDDR4_RTT_CA_BANK1 << 4) | LPDDR4_RTT_DQ) << 8) },
+ { 0x5403b, (0x0800 | LPDDR4_VREF_VALUE_CA) },
+ { 0x5403c, LPDDR4_VREF_VALUE_DQ_RANK1 },
+ { 0x5403d, (LPDDR4_MR22_RANK1 << 8) },
+ { 0x5403e, 0x0 },
+ { 0x5403f, 0x0 },
+ { 0x54040, 0x0 },
+ { 0x54041, 0x0 },
+ { 0x54042, 0x0 },
+ { 0x54043, 0x0 },
+ { 0x54044, 0x0 },
+ { 0xd0000, 0x1 },
+
+};
+
+/* DRAM PHY init engine image */
+static struct dram_cfg_param lpddr4_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xb },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x630 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x630 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x630 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x0 },
+ { 0x90051, 0x45a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x448 },
+ { 0x90055, 0x109 },
+ { 0x90056, 0x40 },
+ { 0x90057, 0x630 },
+ { 0x90058, 0x179 },
+ { 0x90059, 0x1 },
+ { 0x9005a, 0x618 },
+ { 0x9005b, 0x109 },
+ { 0x9005c, 0x40c0 },
+ { 0x9005d, 0x630 },
+ { 0x9005e, 0x149 },
+ { 0x9005f, 0x8 },
+ { 0x90060, 0x4 },
+ { 0x90061, 0x48 },
+ { 0x90062, 0x4040 },
+ { 0x90063, 0x630 },
+ { 0x90064, 0x149 },
+ { 0x90065, 0x0 },
+ { 0x90066, 0x4 },
+ { 0x90067, 0x48 },
+ { 0x90068, 0x40 },
+ { 0x90069, 0x630 },
+ { 0x9006a, 0x149 },
+ { 0x9006b, 0x10 },
+ { 0x9006c, 0x4 },
+ { 0x9006d, 0x18 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x4 },
+ { 0x90070, 0x78 },
+ { 0x90071, 0x549 },
+ { 0x90072, 0x630 },
+ { 0x90073, 0x159 },
+ { 0x90074, 0xd49 },
+ { 0x90075, 0x630 },
+ { 0x90076, 0x159 },
+ { 0x90077, 0x94a },
+ { 0x90078, 0x630 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0x441 },
+ { 0x9007b, 0x630 },
+ { 0x9007c, 0x149 },
+ { 0x9007d, 0x42 },
+ { 0x9007e, 0x630 },
+ { 0x9007f, 0x149 },
+ { 0x90080, 0x1 },
+ { 0x90081, 0x630 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x0 },
+ { 0x90084, 0xe0 },
+ { 0x90085, 0x109 },
+ { 0x90086, 0xa },
+ { 0x90087, 0x10 },
+ { 0x90088, 0x109 },
+ { 0x90089, 0x9 },
+ { 0x9008a, 0x3c0 },
+ { 0x9008b, 0x149 },
+ { 0x9008c, 0x9 },
+ { 0x9008d, 0x3c0 },
+ { 0x9008e, 0x159 },
+ { 0x9008f, 0x18 },
+ { 0x90090, 0x10 },
+ { 0x90091, 0x109 },
+ { 0x90092, 0x0 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x109 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x4 },
+ { 0x90097, 0x48 },
+ { 0x90098, 0x18 },
+ { 0x90099, 0x4 },
+ { 0x9009a, 0x58 },
+ { 0x9009b, 0xa },
+ { 0x9009c, 0x10 },
+ { 0x9009d, 0x109 },
+ { 0x9009e, 0x2 },
+ { 0x9009f, 0x10 },
+ { 0x900a0, 0x109 },
+ { 0x900a1, 0x5 },
+ { 0x900a2, 0x7c0 },
+ { 0x900a3, 0x109 },
+ { 0x900a4, 0xd },
+ { 0x900a5, 0x7c0 },
+ { 0x900a6, 0x109 },
+ { 0x900a7, 0x4 },
+ { 0x900a8, 0x7c0 },
+ { 0x900a9, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x623 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x623 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900aa, 0x0 },
+ { 0x900ab, 0x790 },
+ { 0x900ac, 0x11a },
+ { 0x900ad, 0x8 },
+ { 0x900ae, 0x7aa },
+ { 0x900af, 0x2a },
+ { 0x900b0, 0x10 },
+ { 0x900b1, 0x7b2 },
+ { 0x900b2, 0x2a },
+ { 0x900b3, 0x0 },
+ { 0x900b4, 0x7c8 },
+ { 0x900b5, 0x109 },
+ { 0x900b6, 0x10 },
+ { 0x900b7, 0x10 },
+ { 0x900b8, 0x109 },
+ { 0x900b9, 0x10 },
+ { 0x900ba, 0x2a8 },
+ { 0x900bb, 0x129 },
+ { 0x900bc, 0x8 },
+ { 0x900bd, 0x370 },
+ { 0x900be, 0x129 },
+ { 0x900bf, 0xa },
+ { 0x900c0, 0x3c8 },
+ { 0x900c1, 0x1a9 },
+ { 0x900c2, 0xc },
+ { 0x900c3, 0x408 },
+ { 0x900c4, 0x199 },
+ { 0x900c5, 0x14 },
+ { 0x900c6, 0x790 },
+ { 0x900c7, 0x11a },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x4 },
+ { 0x900ca, 0x18 },
+ { 0x900cb, 0xe },
+ { 0x900cc, 0x408 },
+ { 0x900cd, 0x199 },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x8568 },
+ { 0x900d0, 0x108 },
+ { 0x900d1, 0x18 },
+ { 0x900d2, 0x790 },
+ { 0x900d3, 0x16a },
+ { 0x900d4, 0x8 },
+ { 0x900d5, 0x1d8 },
+ { 0x900d6, 0x169 },
+ { 0x900d7, 0x10 },
+ { 0x900d8, 0x8558 },
+ { 0x900d9, 0x168 },
+ { 0x900da, 0x70 },
+ { 0x900db, 0x788 },
+ { 0x900dc, 0x16a },
+ { 0x900dd, 0x1ff8 },
+ { 0x900de, 0x85a8 },
+ { 0x900df, 0x1e8 },
+ { 0x900e0, 0x50 },
+ { 0x900e1, 0x798 },
+ { 0x900e2, 0x16a },
+ { 0x900e3, 0x60 },
+ { 0x900e4, 0x7a0 },
+ { 0x900e5, 0x16a },
+ { 0x900e6, 0x8 },
+ { 0x900e7, 0x8310 },
+ { 0x900e8, 0x168 },
+ { 0x900e9, 0x8 },
+ { 0x900ea, 0xa310 },
+ { 0x900eb, 0x168 },
+ { 0x900ec, 0xa },
+ { 0x900ed, 0x408 },
+ { 0x900ee, 0x169 },
+ { 0x900ef, 0x6e },
+ { 0x900f0, 0x0 },
+ { 0x900f1, 0x68 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0x408 },
+ { 0x900f4, 0x169 },
+ { 0x900f5, 0x0 },
+ { 0x900f6, 0x8310 },
+ { 0x900f7, 0x168 },
+ { 0x900f8, 0x0 },
+ { 0x900f9, 0xa310 },
+ { 0x900fa, 0x168 },
+ { 0x900fb, 0x1ff8 },
+ { 0x900fc, 0x85a8 },
+ { 0x900fd, 0x1e8 },
+ { 0x900fe, 0x68 },
+ { 0x900ff, 0x798 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x78 },
+ { 0x90102, 0x7a0 },
+ { 0x90103, 0x16a },
+ { 0x90104, 0x68 },
+ { 0x90105, 0x790 },
+ { 0x90106, 0x16a },
+ { 0x90107, 0x8 },
+ { 0x90108, 0x8b10 },
+ { 0x90109, 0x168 },
+ { 0x9010a, 0x8 },
+ { 0x9010b, 0xab10 },
+ { 0x9010c, 0x168 },
+ { 0x9010d, 0xa },
+ { 0x9010e, 0x408 },
+ { 0x9010f, 0x169 },
+ { 0x90110, 0x58 },
+ { 0x90111, 0x0 },
+ { 0x90112, 0x68 },
+ { 0x90113, 0x0 },
+ { 0x90114, 0x408 },
+ { 0x90115, 0x169 },
+ { 0x90116, 0x0 },
+ { 0x90117, 0x8b10 },
+ { 0x90118, 0x168 },
+ { 0x90119, 0x0 },
+ { 0x9011a, 0xab10 },
+ { 0x9011b, 0x168 },
+ { 0x9011c, 0x0 },
+ { 0x9011d, 0x1d8 },
+ { 0x9011e, 0x169 },
+ { 0x9011f, 0x80 },
+ { 0x90120, 0x790 },
+ { 0x90121, 0x16a },
+ { 0x90122, 0x18 },
+ { 0x90123, 0x7aa },
+ { 0x90124, 0x6a },
+ { 0x90125, 0xa },
+ { 0x90126, 0x0 },
+ { 0x90127, 0x1e9 },
+ { 0x90128, 0x8 },
+ { 0x90129, 0x8080 },
+ { 0x9012a, 0x108 },
+ { 0x9012b, 0xf },
+ { 0x9012c, 0x408 },
+ { 0x9012d, 0x169 },
+ { 0x9012e, 0xc },
+ { 0x9012f, 0x0 },
+ { 0x90130, 0x68 },
+ { 0x90131, 0x9 },
+ { 0x90132, 0x0 },
+ { 0x90133, 0x1a9 },
+ { 0x90134, 0x0 },
+ { 0x90135, 0x408 },
+ { 0x90136, 0x169 },
+ { 0x90137, 0x0 },
+ { 0x90138, 0x8080 },
+ { 0x90139, 0x108 },
+ { 0x9013a, 0x8 },
+ { 0x9013b, 0x7aa },
+ { 0x9013c, 0x6a },
+ { 0x9013d, 0x0 },
+ { 0x9013e, 0x8568 },
+ { 0x9013f, 0x108 },
+ { 0x90140, 0xb7 },
+ { 0x90141, 0x790 },
+ { 0x90142, 0x16a },
+ { 0x90143, 0x1f },
+ { 0x90144, 0x0 },
+ { 0x90145, 0x68 },
+ { 0x90146, 0x8 },
+ { 0x90147, 0x8558 },
+ { 0x90148, 0x168 },
+ { 0x90149, 0xf },
+ { 0x9014a, 0x408 },
+ { 0x9014b, 0x169 },
+ { 0x9014c, 0xc },
+ { 0x9014d, 0x0 },
+ { 0x9014e, 0x68 },
+ { 0x9014f, 0x0 },
+ { 0x90150, 0x408 },
+ { 0x90151, 0x169 },
+ { 0x90152, 0x0 },
+ { 0x90153, 0x8558 },
+ { 0x90154, 0x168 },
+ { 0x90155, 0x8 },
+ { 0x90156, 0x3c8 },
+ { 0x90157, 0x1a9 },
+ { 0x90158, 0x3 },
+ { 0x90159, 0x370 },
+ { 0x9015a, 0x129 },
+ { 0x9015b, 0x20 },
+ { 0x9015c, 0x2aa },
+ { 0x9015d, 0x9 },
+ { 0x9015e, 0x0 },
+ { 0x9015f, 0x400 },
+ { 0x90160, 0x10e },
+ { 0x90161, 0x8 },
+ { 0x90162, 0xe8 },
+ { 0x90163, 0x109 },
+ { 0x90164, 0x0 },
+ { 0x90165, 0x8140 },
+ { 0x90166, 0x10c },
+ { 0x90167, 0x10 },
+ { 0x90168, 0x8138 },
+ { 0x90169, 0x10c },
+ { 0x9016a, 0x8 },
+ { 0x9016b, 0x7c8 },
+ { 0x9016c, 0x101 },
+ { 0x9016d, 0x8 },
+ { 0x9016e, 0x0 },
+ { 0x9016f, 0x8 },
+ { 0x90170, 0x8 },
+ { 0x90171, 0x448 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0xf },
+ { 0x90174, 0x7c0 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x0 },
+ { 0x90177, 0xe8 },
+ { 0x90178, 0x109 },
+ { 0x90179, 0x47 },
+ { 0x9017a, 0x630 },
+ { 0x9017b, 0x109 },
+ { 0x9017c, 0x8 },
+ { 0x9017d, 0x618 },
+ { 0x9017e, 0x109 },
+ { 0x9017f, 0x8 },
+ { 0x90180, 0xe0 },
+ { 0x90181, 0x109 },
+ { 0x90182, 0x0 },
+ { 0x90183, 0x7c8 },
+ { 0x90184, 0x109 },
+ { 0x90185, 0x8 },
+ { 0x90186, 0x8140 },
+ { 0x90187, 0x10c },
+ { 0x90188, 0x0 },
+ { 0x90189, 0x1 },
+ { 0x9018a, 0x8 },
+ { 0x9018b, 0x8 },
+ { 0x9018c, 0x4 },
+ { 0x9018d, 0x8 },
+ { 0x9018e, 0x8 },
+ { 0x9018f, 0x7c8 },
+ { 0x90190, 0x101 },
+ { 0x90006, 0x0 },
+ { 0x90007, 0x0 },
+ { 0x90008, 0x8 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x0 },
+ { 0x9000b, 0x0 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x2b },
+ { 0x90026, 0x6c },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+ { 0x2000b, 0x64 },
+ { 0x2000c, 0xc8 },
+ { 0x2000d, 0x7d0 },
+ { 0x2000e, 0x2c },
+ { 0x12000b, 0x14 },
+ { 0x12000c, 0x29 },
+ { 0x12000d, 0x1a1 },
+ { 0x12000e, 0x10 },
+ { 0x22000b, 0x3 },
+ { 0x22000c, 0x6 },
+ { 0x22000d, 0x3e },
+ { 0x22000e, 0x10 },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x60 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x140080, 0xe0 },
+ { 0x140081, 0x12 },
+ { 0x140082, 0xe0 },
+ { 0x140083, 0x12 },
+ { 0x140084, 0xe0 },
+ { 0x140085, 0x12 },
+ { 0x240080, 0xe0 },
+ { 0x240081, 0x12 },
+ { 0x240082, 0xe0 },
+ { 0x240083, 0x12 },
+ { 0x240084, 0xe0 },
+ { 0x240085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x12011, 0x1 },
+ { 0x12012, 0x1 },
+ { 0x12013, 0x180 },
+ { 0x12018, 0x1 },
+ { 0x12002, 0x6209 },
+ { 0x120b2, 0x1 },
+ { 0x121b4, 0x1 },
+ { 0x122b4, 0x1 },
+ { 0x123b4, 0x1 },
+ { 0x124b4, 0x1 },
+ { 0x125b4, 0x1 },
+ { 0x126b4, 0x1 },
+ { 0x127b4, 0x1 },
+ { 0x128b4, 0x1 },
+ { 0x13011, 0x1 },
+ { 0x13012, 0x1 },
+ { 0x13013, 0x180 },
+ { 0x13018, 0x1 },
+ { 0x13002, 0x6209 },
+ { 0x130b2, 0x1 },
+ { 0x131b4, 0x1 },
+ { 0x132b4, 0x1 },
+ { 0x133b4, 0x1 },
+ { 0x134b4, 0x1 },
+ { 0x135b4, 0x1 },
+ { 0x136b4, 0x1 },
+ { 0x137b4, 0x1 },
+ { 0x138b4, 0x1 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x2 },
+ { 0xd0000, 0x1 },
+};
+
+static struct dram_fsp_msg lpddr4_dram_fsp_msg[] = {
+ {
+ /* P0 3200mts 1D */
+ .drate = 3200,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = lpddr4_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp0_cfg),
+ },
+ {
+ /* P1 667mts 1D */
+ .drate = 667,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = lpddr4_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp1_cfg),
+ },
+ {
+ /* P0 3200mts 2D */
+ .drate = 3200,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = lpddr4_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(lpddr4_fsp0_2d_cfg),
+ },
+};
+
+/* lpddr4 timing config params on EVK board */
+struct dram_timing_info dram_timing_b0 = {
+ .ddrc_cfg = lpddr4_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(lpddr4_ddrc_cfg),
+ .ddrphy_cfg = lpddr4_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(lpddr4_ddrphy_cfg),
+ .fsp_msg = lpddr4_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(lpddr4_dram_fsp_msg),
+ .ddrphy_pie = lpddr4_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(lpddr4_phy_pie),
+ /*
+ * this table must be initialized if DDRPHY bypass mode is
+ * not used: all fsp drate > 666MTS.
+ */
+ .fsp_table = { 3200, 667, },
+};
diff --git a/board/freescale/imx8mq_evk/spl.c b/board/freescale/imx8mq_evk/spl.c
new file mode 100644
index 00000000000..a346305c863
--- /dev/null
+++ b/board/freescale/imx8mq_evk/spl.c
@@ -0,0 +1,256 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018, 2021 NXP
+ *
+ */
+
+#include <config.h>
+#include <hang.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <errno.h>
+#include <asm/io.h>
+#include <asm/arch/ddr.h>
+#include <asm/arch/imx8mq_pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch/clock.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/gpio.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/sections.h>
+#include <fsl_esdhc_imx.h>
+#include <fsl_sec.h>
+#include <mmc.h>
+#include <linux/delay.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include <spl.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+extern struct dram_timing_info dram_timing_b0;
+
+static void spl_dram_init(void)
+{
+ /* ddr init */
+ if (soc_rev() >= CHIP_REV_2_1)
+ ddr_init(&dram_timing);
+ else
+ ddr_init(&dram_timing_b0);
+}
+
+#define I2C_PAD_CTRL (PAD_CTL_DSE6 | PAD_CTL_HYS | PAD_CTL_PUE)
+#define PC MUX_PAD_CTRL(I2C_PAD_CTRL)
+static struct i2c_pads_info i2c_pad_info1 = {
+ .scl = {
+ .i2c_mode = IMX8MQ_PAD_I2C1_SCL__I2C1_SCL | PC,
+ .gpio_mode = IMX8MQ_PAD_I2C1_SCL__GPIO5_IO14 | PC,
+ .gp = IMX_GPIO_NR(5, 14),
+ },
+ .sda = {
+ .i2c_mode = IMX8MQ_PAD_I2C1_SDA__I2C1_SDA | PC,
+ .gpio_mode = IMX8MQ_PAD_I2C1_SDA__GPIO5_IO15 | PC,
+ .gp = IMX_GPIO_NR(5, 15),
+ },
+};
+
+#define USDHC2_CD_GPIO IMX_GPIO_NR(2, 12)
+#define USDHC1_PWR_GPIO IMX_GPIO_NR(2, 10)
+#define USDHC2_PWR_GPIO IMX_GPIO_NR(2, 19)
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ struct fsl_esdhc_cfg *cfg = (struct fsl_esdhc_cfg *)mmc->priv;
+ int ret = 0;
+
+ switch (cfg->esdhc_base) {
+ case USDHC1_BASE_ADDR:
+ ret = 1;
+ break;
+ case USDHC2_BASE_ADDR:
+ ret = !gpio_get_value(USDHC2_CD_GPIO);
+ return ret;
+ }
+
+ return 1;
+}
+
+#define USDHC_PAD_CTRL (PAD_CTL_DSE6 | PAD_CTL_HYS | PAD_CTL_PUE | \
+ PAD_CTL_FSEL2)
+#define USDHC_GPIO_PAD_CTRL (PAD_CTL_PUE | PAD_CTL_DSE1)
+
+static iomux_v3_cfg_t const usdhc1_pads[] = {
+ IMX8MQ_PAD_SD1_CLK__USDHC1_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_CMD__USDHC1_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA0__USDHC1_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA1__USDHC1_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA2__USDHC1_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA3__USDHC1_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA4__USDHC1_DATA4 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA5__USDHC1_DATA5 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA6__USDHC1_DATA6 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_DATA7__USDHC1_DATA7 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ IMX8MQ_PAD_SD1_RESET_B__GPIO2_IO10 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const usdhc2_pads[] = {
+ IMX8MQ_PAD_SD2_CLK__USDHC2_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0xd6 */
+ IMX8MQ_PAD_SD2_CMD__USDHC2_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0xd6 */
+ IMX8MQ_PAD_SD2_DATA0__USDHC2_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0xd6 */
+ IMX8MQ_PAD_SD2_DATA1__USDHC2_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0xd6 */
+ IMX8MQ_PAD_SD2_DATA2__USDHC2_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0x16 */
+ IMX8MQ_PAD_SD2_DATA3__USDHC2_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL), /* 0xd6 */
+ IMX8MQ_PAD_SD2_CD_B__GPIO2_IO12 | MUX_PAD_CTRL(USDHC_GPIO_PAD_CTRL),
+ IMX8MQ_PAD_SD2_RESET_B__GPIO2_IO19 | MUX_PAD_CTRL(USDHC_GPIO_PAD_CTRL),
+};
+
+static struct fsl_esdhc_cfg usdhc_cfg[2] = {
+ {USDHC1_BASE_ADDR, 0, 8},
+ {USDHC2_BASE_ADDR, 0, 4},
+};
+
+int board_mmc_init(struct bd_info *bis)
+{
+ int i, ret;
+ /*
+ * According to the board_mmc_init() the following map is done:
+ * (U-Boot device node) (Physical Port)
+ * mmc0 USDHC1
+ * mmc1 USDHC2
+ */
+ for (i = 0; i < CFG_SYS_FSL_USDHC_NUM; i++) {
+ switch (i) {
+ case 0:
+ init_clk_usdhc(0);
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(USDHC1_CLK_ROOT);
+ imx_iomux_v3_setup_multiple_pads(usdhc1_pads,
+ ARRAY_SIZE(usdhc1_pads));
+ gpio_request(USDHC1_PWR_GPIO, "usdhc1_reset");
+ gpio_direction_output(USDHC1_PWR_GPIO, 0);
+ udelay(500);
+ gpio_direction_output(USDHC1_PWR_GPIO, 1);
+ break;
+ case 1:
+ init_clk_usdhc(1);
+ usdhc_cfg[1].sdhc_clk = mxc_get_clock(USDHC2_CLK_ROOT);
+ imx_iomux_v3_setup_multiple_pads(usdhc2_pads,
+ ARRAY_SIZE(usdhc2_pads));
+ gpio_request(USDHC2_PWR_GPIO, "usdhc2_reset");
+ gpio_direction_output(USDHC2_PWR_GPIO, 0);
+ udelay(500);
+ gpio_direction_output(USDHC2_PWR_GPIO, 1);
+ break;
+ default:
+ printf("Warning: you configured more USDHC controllers(%d) than supported by the board\n", i + 1);
+ return -EINVAL;
+ }
+
+ ret = fsl_esdhc_initialize(bis, &usdhc_cfg[i]);
+ if (ret)
+ return ret;
+ }
+
+ return 0;
+}
+
+#if CONFIG_IS_ENABLED(POWER_LEGACY)
+#define I2C_PMIC 0
+int power_init_board(void)
+{
+ struct pmic *p;
+ int ret;
+ unsigned int reg;
+
+ ret = power_pfuze100_init(I2C_PMIC);
+ if (ret)
+ return -ENODEV;
+
+ p = pmic_get("PFUZE100");
+ ret = pmic_probe(p);
+ if (ret)
+ return -ENODEV;
+
+ pmic_reg_read(p, PFUZE100_DEVICEID, &reg);
+ printf("PMIC: PFUZE100 ID=0x%02x\n", reg);
+
+ pmic_reg_read(p, PFUZE100_SW3AVOL, &reg);
+ if ((reg & 0x3f) != 0x18) {
+ reg &= ~0x3f;
+ reg |= 0x18;
+ pmic_reg_write(p, PFUZE100_SW3AVOL, reg);
+ }
+
+ ret = pfuze_mode_init(p, APS_PFM);
+ if (ret < 0)
+ return ret;
+
+ /* set SW3A standby mode to off */
+ pmic_reg_read(p, PFUZE100_SW3AMODE, &reg);
+ reg &= ~0xf;
+ reg |= APS_OFF;
+ pmic_reg_write(p, PFUZE100_SW3AMODE, reg);
+
+ return 0;
+}
+#endif
+
+void spl_board_init(void)
+{
+ if (IS_ENABLED(CONFIG_FSL_CAAM)) {
+ if (sec_init())
+ printf("\nsec_init failed!\n");
+ }
+ puts("Normal Boot\n");
+}
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+void board_init_f(ulong dummy)
+{
+ int ret;
+
+ /* Clear global data */
+ memset((void *)gd, 0, sizeof(gd_t));
+
+ arch_cpu_init();
+
+ init_uart_clk(0);
+
+ board_early_init_f();
+
+ timer_init();
+
+ preloader_console_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ ret = spl_init();
+ if (ret) {
+ debug("spl_init() failed: %d\n", ret);
+ hang();
+ }
+
+ enable_tzc380();
+
+ setup_i2c(0, CONFIG_SYS_I2C_SPEED, 0x7f, &i2c_pad_info1);
+
+ power_init_board();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx8qm_mek/Kconfig b/board/freescale/imx8qm_mek/Kconfig
new file mode 100644
index 00000000000..5f2413f8dbf
--- /dev/null
+++ b/board/freescale/imx8qm_mek/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_IMX8QM_MEK
+
+config SYS_BOARD
+ default "imx8qm_mek"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8qm_mek"
+
+config IMX_CONFIG
+ default "board/freescale/imx8qm_mek/imximage.cfg"
+
+endif
diff --git a/board/freescale/imx8qm_mek/MAINTAINERS b/board/freescale/imx8qm_mek/MAINTAINERS
new file mode 100644
index 00000000000..115830df19b
--- /dev/null
+++ b/board/freescale/imx8qm_mek/MAINTAINERS
@@ -0,0 +1,6 @@
+i.MX8QM MEK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx8qm_mek/
+F: include/configs/imx8qm_mek.h
+F: configs/imx8qm_mek_defconfig
diff --git a/board/freescale/imx8qm_mek/Makefile b/board/freescale/imx8qm_mek/Makefile
new file mode 100644
index 00000000000..bc9a1260bde
--- /dev/null
+++ b/board/freescale/imx8qm_mek/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2018 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8qm_mek.o
+obj-$(CONFIG_SPL_BUILD) += spl.o
diff --git a/board/freescale/imx8qm_mek/README b/board/freescale/imx8qm_mek/README
new file mode 100644
index 00000000000..47fae3d2843
--- /dev/null
+++ b/board/freescale/imx8qm_mek/README
@@ -0,0 +1,54 @@
+U-Boot for the NXP i.MX8QM EVK board
+
+Quick Start
+===========
+
+- Build the ARM Trusted firmware binary
+- Get scfw_tcm.bin and ahab-container.img
+- Build U-Boot
+- Flash the binary into the SD card
+- Boot
+
+Get and Build the ARM Trusted firmware
+======================================
+
+$ git clone https://github.com/nxp-imx/imx-atf
+$ cd imx-atf/
+$ git checkout origin/imx_4.14.78_1.0.0_ga -b imx_4.14.78_1.0.0_ga
+$ make PLAT=imx8qm bl31
+
+And copy the resulting bl31.bin to u-boot directory:
+
+$ cp build/imx8qm/release/bl31.bin path/to/u-boot/
+
+Get scfw_tcm.bin and ahab-container.img
+=======================================
+
+$ wget https://www.nxp.com/lgfiles/NMG/MAD/YOCTO/imx-sc-firmware-1.1.bin
+$ chmod +x imx-sc-firmware-1.1.bin
+$ ./imx-sc-firmware-1.1.bin
+$ wget https://www.nxp.com/lgfiles/NMG/MAD/YOCTO/firmware-imx-8.0.bin
+$ chmod +x firmware-imx-8.0.bin
+$ ./firmware-imx-8.0.bin
+
+
+And copy the following firmwares to U-Boot folder:
+
+* `imx-sc-firmware-1.1/mx8qm-mek-scfw-tcm.bin`
+* `firmware-imx-8.0/firmware/seco/mx8qm-ahab-container.img`
+
+Build U-Boot
+============
+$ make imx8qm_mek_defconfig
+$ make
+
+Flash the binary into the SD card
+=================================
+
+Burn the flash.bin binary to SD card offset 32KB:
+
+$ sudo dd if=flash.bin of=/dev/sd[x] bs=1024 seek=32
+
+Boot
+====
+Set Boot switch SW2: 001100.
diff --git a/board/freescale/imx8qm_mek/imx8qm_mek.c b/board/freescale/imx8qm_mek/imx8qm_mek.c
new file mode 100644
index 00000000000..72527f774ca
--- /dev/null
+++ b/board/freescale/imx8qm_mek/imx8qm_mek.c
@@ -0,0 +1,137 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <cpu_func.h>
+#include <env.h>
+#include <errno.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <linux/libfdt.h>
+#include <fdt_support.h>
+#include <asm/io.h>
+#include <asm/gpio.h>
+#include <asm/arch/clock.h>
+#include <firmware/imx/sci/sci.h>
+#include <asm/arch/imx8-pins.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/sys_proto.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL ((SC_PAD_CONFIG_OUT_IN << PADRING_CONFIG_SHIFT) | \
+ (SC_PAD_ISO_OFF << PADRING_LPCONFIG_SHIFT) | \
+ (SC_PAD_28FDSOI_DSE_DV_HIGH << PADRING_DSE_SHIFT) | \
+ (SC_PAD_28FDSOI_PS_PU << PADRING_PULL_SHIFT))
+
+static iomux_cfg_t uart0_pads[] = {
+ SC_P_UART0_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ SC_P_UART0_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+static void setup_iomux_uart(void)
+{
+ imx8_iomux_setup_multiple_pads(uart0_pads, ARRAY_SIZE(uart0_pads));
+}
+
+int board_early_init_f(void)
+{
+ sc_pm_clock_rate_t rate = SC_80MHZ;
+ int ret;
+
+ /* Set UART0 clock root to 80 MHz */
+ ret = sc_pm_setup_uart(SC_R_UART_0, rate);
+ if (ret)
+ return ret;
+
+ setup_iomux_uart();
+
+ sc_pm_set_resource_power_mode(-1, SC_R_GPIO_5, SC_PM_PW_MODE_ON);
+
+ return 0;
+}
+
+#if CONFIG_IS_ENABLED(DM_GPIO)
+static void board_gpio_init(void)
+{
+ /* TODO */
+}
+#else
+static inline void board_gpio_init(void) {}
+#endif
+
+#if IS_ENABLED(CONFIG_FEC_MXC)
+#include <miiphy.h>
+
+int board_phy_config(struct phy_device *phydev)
+{
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x1f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x8);
+
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x00);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x82ee);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x05);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x100);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+#endif
+
+int checkboard(void)
+{
+ puts("Board: iMX8QM MEK\n");
+
+ build_info();
+ print_bootinfo();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* Power up base board */
+ sc_pm_set_resource_power_mode(-1, SC_R_BOARD_R1, SC_PM_PW_MODE_ON);
+
+ board_gpio_init();
+
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ return 0;
+}
+#endif
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int board_late_init(void)
+{
+ char *fdt_file;
+ bool m4_booted;
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "MEK");
+ env_set("board_rev", "iMX8QM");
+#endif
+
+ fdt_file = env_get("fdt_file");
+ m4_booted = m4_parts_booted();
+
+ if (fdt_file && !strcmp(fdt_file, "undefined")) {
+ if (m4_booted)
+ env_set("fdt_file", "imx8qm-mek-rpmsg.dtb");
+ else
+ env_set("fdt_file", "imx8qm-mek.dtb");
+ }
+
+ return 0;
+}
diff --git a/board/freescale/imx8qm_mek/imximage.cfg b/board/freescale/imx8qm_mek/imximage.cfg
new file mode 100644
index 00000000000..71612678c99
--- /dev/null
+++ b/board/freescale/imx8qm_mek/imximage.cfg
@@ -0,0 +1,18 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2018 NXP
+ */
+
+
+/* Boot from SD, sector size 0x400 */
+BOOT_FROM SD 0x400
+/* SoC type IMX8QM */
+SOC_TYPE IMX8QM
+/* Append seco container image */
+APPEND mx8qm-ahab-container.img
+/* Create the 2nd container */
+CONTAINER
+/* Add scfw image with exec attribute */
+IMAGE SCU mx8qm-mek-scfw-tcm.bin
+/* Add ATF image with exec attribute */
+IMAGE A35 spl/u-boot-spl.bin 0x00100000
diff --git a/board/freescale/imx8qm_mek/spl.c b/board/freescale/imx8qm_mek/spl.c
new file mode 100644
index 00000000000..ad786833309
--- /dev/null
+++ b/board/freescale/imx8qm_mek/spl.c
@@ -0,0 +1,71 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+/*
+ * Copyright 2018, 2021 NXP
+ *
+ */
+
+#include <dm.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+#include <dm/lists.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/sections.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void spl_board_init(void)
+{
+ struct udevice *dev;
+
+ uclass_get_device_by_driver(UCLASS_MISC, DM_DRIVER_GET(imx8_scu), &dev);
+
+ uclass_find_first_device(UCLASS_MISC, &dev);
+
+ for (; dev; uclass_find_next_device(&dev)) {
+ if (device_probe(dev))
+ continue;
+ }
+
+ arch_cpu_init();
+
+ board_early_init_f();
+
+ timer_init();
+
+ preloader_console_init();
+
+ puts("Normal Boot\n");
+}
+
+void spl_board_prepare_for_boot(void)
+{
+ imx8_power_off_pd_devices(NULL, 0);
+}
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+void board_init_f(ulong dummy)
+{
+ /* Clear global data */
+ memset((void *)gd, 0, sizeof(gd_t));
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx8qm_mek/uboot-container.cfg b/board/freescale/imx8qm_mek/uboot-container.cfg
new file mode 100644
index 00000000000..e25aa76fe18
--- /dev/null
+++ b/board/freescale/imx8qm_mek/uboot-container.cfg
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2019 NXP
+ */
+
+
+/* This file is to create a container image could be loaded by SPL */
+BOOT_FROM SD 0x400
+SOC_TYPE IMX8QM
+CONTAINER
+IMAGE A35 bl31.bin 0x80000000
+IMAGE A35 u-boot.bin CONFIG_TEXT_BASE
diff --git a/board/freescale/imx8qxp_mek/Kconfig b/board/freescale/imx8qxp_mek/Kconfig
new file mode 100644
index 00000000000..6533b4d9535
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_IMX8QXP_MEK
+
+config SYS_BOARD
+ default "imx8qxp_mek"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8qxp_mek"
+
+config IMX_CONFIG
+ default "board/freescale/imx8qxp_mek/imximage.cfg"
+
+endif
diff --git a/board/freescale/imx8qxp_mek/MAINTAINERS b/board/freescale/imx8qxp_mek/MAINTAINERS
new file mode 100644
index 00000000000..3a21f5521d8
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX8QXP MEK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/imx8qxp_mek/
+F: include/configs/imx8qxp_mek.h
+F: configs/imx8qxp_mek_defconfig
diff --git a/board/freescale/imx8qxp_mek/Makefile b/board/freescale/imx8qxp_mek/Makefile
new file mode 100644
index 00000000000..acaadcd84a4
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2017 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx8qxp_mek.o
+obj-$(CONFIG_SPL_BUILD) += spl.o
diff --git a/board/freescale/imx8qxp_mek/imx8qxp_mek.c b/board/freescale/imx8qxp_mek/imx8qxp_mek.c
new file mode 100644
index 00000000000..adb9556a021
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/imx8qxp_mek.c
@@ -0,0 +1,161 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <cpu_func.h>
+#include <env.h>
+#include <errno.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <linux/delay.h>
+#include <linux/libfdt.h>
+#include <fsl_esdhc_imx.h>
+#include <fdt_support.h>
+#include <asm/io.h>
+#include <asm/gpio.h>
+#include <asm/arch/clock.h>
+#include <firmware/imx/sci/sci.h>
+#include <asm/arch/imx8-pins.h>
+#include <asm/arch/snvs_security_sc.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/sys_proto.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define GPIO_PAD_CTRL ((SC_PAD_CONFIG_NORMAL << PADRING_CONFIG_SHIFT) | \
+ (SC_PAD_ISO_OFF << PADRING_LPCONFIG_SHIFT) | \
+ (SC_PAD_28FDSOI_DSE_DV_HIGH << PADRING_DSE_SHIFT) | \
+ (SC_PAD_28FDSOI_PS_PU << PADRING_PULL_SHIFT))
+
+#define UART_PAD_CTRL ((SC_PAD_CONFIG_OUT_IN << PADRING_CONFIG_SHIFT) | \
+ (SC_PAD_ISO_OFF << PADRING_LPCONFIG_SHIFT) | \
+ (SC_PAD_28FDSOI_DSE_DV_HIGH << PADRING_DSE_SHIFT) | \
+ (SC_PAD_28FDSOI_PS_PU << PADRING_PULL_SHIFT))
+
+static iomux_cfg_t uart0_pads[] = {
+ SC_P_UART0_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ SC_P_UART0_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+static void setup_iomux_uart(void)
+{
+ imx8_iomux_setup_multiple_pads(uart0_pads, ARRAY_SIZE(uart0_pads));
+}
+
+int board_early_init_f(void)
+{
+ sc_pm_clock_rate_t rate = SC_80MHZ;
+ int ret;
+
+ /* Set UART0 clock root to 80 MHz */
+ ret = sc_pm_setup_uart(SC_R_UART_0, rate);
+ if (ret)
+ return ret;
+
+ setup_iomux_uart();
+
+ return 0;
+}
+
+#if CONFIG_IS_ENABLED(DM_GPIO)
+static void board_gpio_init(void)
+{
+ struct gpio_desc desc;
+ int ret;
+
+ ret = dm_gpio_lookup_name("gpio@1a_3", &desc);
+ if (ret)
+ return;
+
+ ret = dm_gpio_request(&desc, "bb_per_rst_b");
+ if (ret)
+ return;
+
+ dm_gpio_set_dir_flags(&desc, GPIOD_IS_OUT);
+ dm_gpio_set_value(&desc, 0);
+ udelay(50);
+ dm_gpio_set_value(&desc, 1);
+}
+#else
+static inline void board_gpio_init(void) {}
+#endif
+
+#if IS_ENABLED(CONFIG_FEC_MXC)
+#include <miiphy.h>
+
+int board_phy_config(struct phy_device *phydev)
+{
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x1f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x8);
+
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x05);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x100);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+#endif
+
+int checkboard(void)
+{
+ puts("Board: iMX8QXP MEK\n");
+
+ build_info();
+ print_bootinfo();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ board_gpio_init();
+
+#ifdef CONFIG_IMX_SNVS_SEC_SC_AUTO
+ {
+ int ret = snvs_security_sc_init();
+
+ if (ret)
+ return ret;
+ }
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ return 0;
+}
+#endif
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int board_late_init(void)
+{
+ char *fdt_file;
+ bool m4_booted;
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "MEK");
+ env_set("board_rev", "iMX8QXP");
+#endif
+
+ fdt_file = env_get("fdt_file");
+ m4_booted = m4_parts_booted();
+
+ if (fdt_file && !strcmp(fdt_file, "undefined")) {
+ if (m4_booted)
+ env_set("fdt_file", "imx8qxp-mek-rpmsg.dtb");
+ else
+ env_set("fdt_file", "imx8qxp-mek.dtb");
+ }
+
+ return 0;
+}
diff --git a/board/freescale/imx8qxp_mek/imximage.cfg b/board/freescale/imx8qxp_mek/imximage.cfg
new file mode 100644
index 00000000000..88d6955a9ef
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/imximage.cfg
@@ -0,0 +1,20 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2018 NXP
+ *
+ * Refer doc/imx/mkimage/imx8image.txt for more details about how-to configure
+ * and create imx8image boot image
+ */
+
+
+BOOT_FROM sd
+/* SoC type IMX8QX */
+SOC_TYPE IMX8QX
+/* Append seco container image */
+APPEND ahab-container.img
+/* Create the 2nd container */
+CONTAINER
+/* Add scfw image with exec attribute */
+IMAGE SCU mx8qx-mek-scfw-tcm.bin
+/* Add ATF image with exec attribute */
+IMAGE A35 spl/u-boot-spl.bin 0x00100000
diff --git a/board/freescale/imx8qxp_mek/spl.c b/board/freescale/imx8qxp_mek/spl.c
new file mode 100644
index 00000000000..05e3c0a2ff2
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/spl.c
@@ -0,0 +1,89 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+/*
+ * Copyright 2018, 2021 NXP
+ *
+ */
+
+#include <dm.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+#include <dm/lists.h>
+#include <asm/io.h>
+#include <asm/gpio.h>
+#include <firmware/imx/sci/sci.h>
+#include <asm/arch/imx8-pins.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/sections.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define GPIO_PAD_CTRL ((SC_PAD_CONFIG_NORMAL << PADRING_CONFIG_SHIFT) | \
+ (SC_PAD_ISO_OFF << PADRING_LPCONFIG_SHIFT) | \
+ (SC_PAD_28FDSOI_DSE_DV_HIGH << PADRING_DSE_SHIFT) | \
+ (SC_PAD_28FDSOI_PS_PU << PADRING_PULL_SHIFT))
+
+#define USDHC2_SD_PWR IMX_GPIO_NR(4, 19)
+static iomux_cfg_t usdhc2_sd_pwr[] = {
+ SC_P_USDHC1_RESET_B | MUX_PAD_CTRL(GPIO_PAD_CTRL),
+};
+
+void spl_board_init(void)
+{
+ struct udevice *dev;
+
+ uclass_get_device_by_driver(UCLASS_MISC, DM_DRIVER_GET(imx8_scu), &dev);
+
+ uclass_find_first_device(UCLASS_MISC, &dev);
+
+ for (; dev; uclass_find_next_device(&dev)) {
+ if (device_probe(dev))
+ continue;
+ }
+
+ arch_cpu_init();
+
+ board_early_init_f();
+
+ timer_init();
+
+ imx8_iomux_setup_multiple_pads(usdhc2_sd_pwr, ARRAY_SIZE(usdhc2_sd_pwr));
+ gpio_direction_output(USDHC2_SD_PWR, 0);
+
+ preloader_console_init();
+
+ puts("Normal Boot\n");
+}
+
+void spl_board_prepare_for_boot(void)
+{
+ imx8_power_off_pd_devices(NULL, 0);
+}
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ /* Just empty function now - can't decide what to choose */
+ debug("%s: %s\n", __func__, name);
+
+ return 0;
+}
+#endif
+
+void board_init_f(ulong dummy)
+{
+ /* Clear global data */
+ memset((void *)gd, 0, sizeof(gd_t));
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx8qxp_mek/uboot-container.cfg b/board/freescale/imx8qxp_mek/uboot-container.cfg
new file mode 100644
index 00000000000..b481c98f929
--- /dev/null
+++ b/board/freescale/imx8qxp_mek/uboot-container.cfg
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2019 NXP
+ */
+
+
+/* This file is to create a container image could be loaded by SPL */
+BOOT_FROM SD 0x400
+SOC_TYPE IMX8QX
+CONTAINER
+IMAGE A35 bl31.bin 0x80000000
+IMAGE A35 u-boot.bin CONFIG_TEXT_BASE
diff --git a/board/freescale/imx8ulp_evk/Kconfig b/board/freescale/imx8ulp_evk/Kconfig
new file mode 100644
index 00000000000..4637b969be6
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_IMX8ULP_EVK
+
+config SYS_BOARD
+ default "imx8ulp_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx8ulp_evk"
+
+endif
diff --git a/board/freescale/imx8ulp_evk/MAINTAINERS b/board/freescale/imx8ulp_evk/MAINTAINERS
new file mode 100644
index 00000000000..267b7b0caa5
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/MAINTAINERS
@@ -0,0 +1,6 @@
+i.MX8ULP EVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx8ulp_evk/
+F: include/configs/imx8ulp_evk.h
+F: configs/imx8ulp_evk_defconfig
diff --git a/board/freescale/imx8ulp_evk/Makefile b/board/freescale/imx8ulp_evk/Makefile
new file mode 100644
index 00000000000..1cf148ab910
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/Makefile
@@ -0,0 +1,12 @@
+# SPDX-License-Identifier: GPL-2.0+
+
+obj-y += imx8ulp_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+ifdef CONFIG_IMX8ULP_ND_MODE
+obj-y += lpddr4_timing_264.o
+else
+obj-y += lpddr4_timing.o
+endif
+endif
diff --git a/board/freescale/imx8ulp_evk/imx8ulp_evk.c b/board/freescale/imx8ulp_evk/imx8ulp_evk.c
new file mode 100644
index 00000000000..0af61067263
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/imx8ulp_evk.c
@@ -0,0 +1,135 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2020 NXP
+ */
+
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/arch/imx8ulp-pins.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/pcc.h>
+#include <asm/arch/sys_proto.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/gpio.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if IS_ENABLED(CONFIG_FEC_MXC)
+#define ENET_CLK_PAD_CTRL (PAD_CTL_PUS_UP | PAD_CTL_DSE | PAD_CTL_IBE_ENABLE)
+static iomux_cfg_t const enet_clk_pads[] = {
+ IMX8ULP_PAD_PTE19__ENET0_REFCLK | MUX_PAD_CTRL(ENET_CLK_PAD_CTRL),
+ IMX8ULP_PAD_PTF10__ENET0_1588_CLKIN | MUX_PAD_CTRL(ENET_CLK_PAD_CTRL),
+};
+
+static int setup_fec(void)
+{
+ /*
+ * Since ref clock and timestamp clock are from external,
+ * set the iomux prior the clock enablement
+ */
+ imx8ulp_iomux_setup_multiple_pads(enet_clk_pads, ARRAY_SIZE(enet_clk_pads));
+
+ /* Select enet time stamp clock: 001 - External Timestamp Clock */
+ cgc1_enet_stamp_sel(1);
+
+ /* enable FEC PCC */
+ pcc_clock_enable(4, ENET_PCC4_SLOT, true);
+ pcc_reset_peripheral(4, ENET_PCC4_SLOT, false);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+ return 0;
+}
+#endif
+
+#define I2C_PAD_CTRL (PAD_CTL_ODE)
+static const iomux_cfg_t lpi2c0_pads[] = {
+ IMX8ULP_PAD_PTA8__LPI2C0_SCL | MUX_PAD_CTRL(I2C_PAD_CTRL),
+ IMX8ULP_PAD_PTA9__LPI2C0_SDA | MUX_PAD_CTRL(I2C_PAD_CTRL),
+};
+
+#define TPM_PAD_CTRL (PAD_CTL_DSE)
+static const iomux_cfg_t tpm0_pads[] = {
+ IMX8ULP_PAD_PTA3__TPM0_CH2 | MUX_PAD_CTRL(TPM_PAD_CTRL),
+};
+
+void mipi_dsi_mux_panel(void)
+{
+ int ret;
+ struct gpio_desc desc;
+
+ /* It is temp solution to directly access i2c, need change to rpmsg later */
+
+ /* enable lpi2c0 clock and iomux */
+ imx8ulp_iomux_setup_multiple_pads(lpi2c0_pads, ARRAY_SIZE(lpi2c0_pads));
+ writel(0xD2000000, 0x28091060);
+
+ ret = dm_gpio_lookup_name("gpio@20_9", &desc);
+ if (ret) {
+ printf("%s lookup gpio@20_9 failed ret = %d\n", __func__, ret);
+ return;
+ }
+
+ ret = dm_gpio_request(&desc, "dsi_mux");
+ if (ret) {
+ printf("%s request dsi_mux failed ret = %d\n", __func__, ret);
+ return;
+ }
+
+ dm_gpio_set_dir_flags(&desc, GPIOD_IS_OUT | GPIOD_IS_OUT_ACTIVE);
+}
+
+void mipi_dsi_panel_backlight(void)
+{
+ /* It is temp solution to directly access pwm, need change to rpmsg later */
+ imx8ulp_iomux_setup_multiple_pads(tpm0_pads, ARRAY_SIZE(tpm0_pads));
+ writel(0xD4000001, 0x28091054);
+
+ /* Use center-aligned PWM mode, CPWMS=1, MSnB:MSnA = 10, ELSnB:ELSnA = 00 */
+ writel(1000, 0x28095018);
+ writel(1000, 0x28095034); /* MOD = CV, full duty */
+ writel(0x28, 0x28095010);
+ writel(0x20, 0x28095030);
+}
+
+int board_init(void)
+{
+
+ if (IS_ENABLED(CONFIG_FEC_MXC))
+ setup_fec();
+
+ /* When sync with M33 is failed, use local driver to set for video */
+ if (!is_m33_handshake_necessary() && IS_ENABLED(CONFIG_VIDEO)) {
+ mipi_dsi_mux_panel();
+ mipi_dsi_panel_backlight();
+ }
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ return 0;
+}
+
+int board_late_init(void)
+{
+ ulong addr;
+
+#if CONFIG_IS_ENABLED(ENV_IS_IN_MMC)
+ board_late_mmc_env_init();
+#endif
+
+ /* clear fdtaddr to avoid obsolete data */
+ addr = env_get_hex("fdt_addr_r", 0);
+ if (addr)
+ memset((void *)addr, 0, 0x400);
+
+ return 0;
+}
diff --git a/board/freescale/imx8ulp_evk/lpddr4_timing.c b/board/freescale/imx8ulp_evk/lpddr4_timing.c
new file mode 100644
index 00000000000..6d2805315b4
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/lpddr4_timing.c
@@ -0,0 +1,1158 @@
+// SPDX-License-Identifier: GPL-2.0+ OR MIT
+/*
+ * Copyright 2021 NXP
+ *
+ * Generated code from MX8ULP_DDR_tool
+ *
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+/** CTL settings **/
+struct dram_cfg_param ddr_ctl_cfg[] = {
+ { 0x2e060000, 0xb00 }, /* 0 */
+ { 0x2e060028, 0x258100 }, /* 10 */
+ { 0x2e06002c, 0x17702 }, /* 11 */
+ { 0x2e060030, 0x5 }, /* 12 */
+ { 0x2e060034, 0x61 }, /* 13 */
+ { 0x2e060038, 0x4b00 }, /* 14 */
+ { 0x2e06003c, 0x2edfa }, /* 15 */
+ { 0x2e060040, 0x5 }, /* 16 */
+ { 0x2e060044, 0xc0 }, /* 17 */
+ { 0x2e060048, 0x19c7d }, /* 18 */
+ { 0x2e06004c, 0x101cdf }, /* 19 */
+ { 0x2e060050, 0x5 }, /* 20 */
+ { 0x2e060054, 0x420 }, /* 21 */
+ { 0x2e060058, 0x1010000 }, /* 22 */
+ { 0x2e06005c, 0x2011001 }, /* 23 */
+ { 0x2e060060, 0x2010000 }, /* 24 */
+ { 0x2e060064, 0x102 }, /* 25 */
+ { 0x2e060068, 0xa }, /* 26 */
+ { 0x2e06006c, 0x19 }, /* 27 */
+ { 0x2e060078, 0x2020200 }, /* 30 */
+ { 0x2e06007c, 0x1604 }, /* 31 */
+ { 0x2e060090, 0x10 }, /* 36 */
+ { 0x2e0600a4, 0x40c040c }, /* 41 */
+ { 0x2e0600a8, 0x8040614 }, /* 42 */
+ { 0x2e0600ac, 0x604 }, /* 43 */
+ { 0x2e0600b0, 0x3090003 }, /* 44 */
+ { 0x2e0600b4, 0x40002 }, /* 45 */
+ { 0x2e0600b8, 0x50008 }, /* 46 */
+ { 0x2e0600bc, 0x40309 }, /* 47 */
+ { 0x2e0600c0, 0x2106 }, /* 48 */
+ { 0x2e0600c4, 0xa090017 }, /* 49 */
+ { 0x2e0600c8, 0x8200016 }, /* 50 */
+ { 0x2e0600cc, 0xa0a }, /* 51 */
+ { 0x2e0600d0, 0x4000694 }, /* 52 */
+ { 0x2e0600d4, 0xa0a0804 }, /* 53 */
+ { 0x2e0600d8, 0x4000d29 }, /* 54 */
+ { 0x2e0600dc, 0xa0a0804 }, /* 55 */
+ { 0x2e0600e0, 0x4004864 }, /* 56 */
+ { 0x2e0600e4, 0x2030404 }, /* 57 */
+ { 0x2e0600e8, 0x4040400 }, /* 58 */
+ { 0x2e0600ec, 0x80b0a04 }, /* 59 */
+ { 0x2e0600f0, 0x7010100 }, /* 60 */
+ { 0x2e0600f4, 0x41507 }, /* 61 */
+ { 0x2e0600fc, 0x1010000 }, /* 63 */
+ { 0x2e060100, 0x1000000 }, /* 64 */
+ { 0x2e060104, 0xe0403 }, /* 65 */
+ { 0x2e060108, 0xb3 }, /* 66 */
+ { 0x2e06010c, 0x1b }, /* 67 */
+ { 0x2e060110, 0x16e }, /* 68 */
+ { 0x2e060114, 0x94 }, /* 69 */
+ { 0x2e060118, 0x803 }, /* 70 */
+ { 0x2e06011c, 0x5 }, /* 71 */
+ { 0x2e060120, 0x70000 }, /* 72 */
+ { 0x2e060124, 0xe000f }, /* 73 */
+ { 0x2e060128, 0x4a0026 }, /* 74 */
+ { 0x2e06012c, 0x4000f9 }, /* 75 */
+ { 0x2e060130, 0x120103 }, /* 76 */
+ { 0x2e060134, 0x50005 }, /* 77 */
+ { 0x2e060138, 0x7070005 }, /* 78 */
+ { 0x2e06013c, 0x505010d }, /* 79 */
+ { 0x2e060140, 0x101030a }, /* 80 */
+ { 0x2e060144, 0x30a0505 }, /* 81 */
+ { 0x2e060148, 0x5050101 }, /* 82 */
+ { 0x2e06014c, 0x1030a }, /* 83 */
+ { 0x2e060150, 0xe000e }, /* 84 */
+ { 0x2e060154, 0x1c001c }, /* 85 */
+ { 0x2e060158, 0x980098 }, /* 86 */
+ { 0x2e06015c, 0x3050505 }, /* 87 */
+ { 0x2e060160, 0x3010403 }, /* 88 */
+ { 0x2e060164, 0x3050505 }, /* 89 */
+ { 0x2e060168, 0x3010403 }, /* 90 */
+ { 0x2e06016c, 0x8050505 }, /* 91 */
+ { 0x2e060170, 0x3010403 }, /* 92 */
+ { 0x2e060174, 0x3010000 }, /* 93 */
+ { 0x2e060178, 0x10000 }, /* 94 */
+ { 0x2e060180, 0x1000000 }, /* 96 */
+ { 0x2e060184, 0x80104002 }, /* 97 */
+ { 0x2e060188, 0x40003 }, /* 98 */
+ { 0x2e06018c, 0x40005 }, /* 99 */
+ { 0x2e060190, 0x30000 }, /* 100 */
+ { 0x2e060194, 0x50004 }, /* 101 */
+ { 0x2e060198, 0x4 }, /* 102 */
+ { 0x2e06019c, 0x40003 }, /* 103 */
+ { 0x2e0601a0, 0x40005 }, /* 104 */
+ { 0x2e0601a8, 0x2cc0 }, /* 106 */
+ { 0x2e0601ac, 0x2cc0 }, /* 107 */
+ { 0x2e0601b0, 0x2cc0 }, /* 108 */
+ { 0x2e0601b4, 0x2cc0 }, /* 109 */
+ { 0x2e0601b8, 0x2cc0 }, /* 110 */
+ { 0x2e0601c0, 0x4e5 }, /* 112 */
+ { 0x2e0601c4, 0x5b80 }, /* 113 */
+ { 0x2e0601c8, 0x5b80 }, /* 114 */
+ { 0x2e0601cc, 0x5b80 }, /* 115 */
+ { 0x2e0601d0, 0x5b80 }, /* 116 */
+ { 0x2e0601d4, 0x5b80 }, /* 117 */
+ { 0x2e0601dc, 0xa02 }, /* 119 */
+ { 0x2e0601e0, 0x200c0 }, /* 120 */
+ { 0x2e0601e4, 0x200c0 }, /* 121 */
+ { 0x2e0601e8, 0x200c0 }, /* 122 */
+ { 0x2e0601ec, 0x200c0 }, /* 123 */
+ { 0x2e0601f0, 0x200c0 }, /* 124 */
+ { 0x2e0601f8, 0x3815 }, /* 126 */
+ { 0x2e06021c, 0x5000000 }, /* 135 */
+ { 0x2e060220, 0x5030503 }, /* 136 */
+ { 0x2e060224, 0x3 }, /* 137 */
+ { 0x2e060228, 0x7010a09 }, /* 138 */
+ { 0x2e06022c, 0xe0a09 }, /* 139 */
+ { 0x2e060230, 0x10a0900 }, /* 140 */
+ { 0x2e060234, 0xe0a0907 }, /* 141 */
+ { 0x2e060238, 0xa090000 }, /* 142 */
+ { 0x2e06023c, 0xa090701 }, /* 143 */
+ { 0x2e060240, 0x101000e }, /* 144 */
+ { 0x2e060244, 0x40003 }, /* 145 */
+ { 0x2e060248, 0x7 }, /* 146 */
+ { 0x2e060264, 0x4040100 }, /* 153 */
+ { 0x2e060268, 0x1000000 }, /* 154 */
+ { 0x2e06026c, 0x100000c0 }, /* 155 */
+ { 0x2e060270, 0x100000c0 }, /* 156 */
+ { 0x2e060274, 0x100000c0 }, /* 157 */
+ { 0x2e06027c, 0x1600 }, /* 159 */
+ { 0x2e060284, 0x1 }, /* 161 */
+ { 0x2e060288, 0x2 }, /* 162 */
+ { 0x2e06028c, 0x100e }, /* 163 */
+ { 0x2e0602a4, 0xa0000 }, /* 169 */
+ { 0x2e0602a8, 0xd0005 }, /* 170 */
+ { 0x2e0602ac, 0x404 }, /* 171 */
+ { 0x2e0602b0, 0xd }, /* 172 */
+ { 0x2e0602b4, 0xa0014 }, /* 173 */
+ { 0x2e0602b8, 0x4040018 }, /* 174 */
+ { 0x2e0602bc, 0x18 }, /* 175 */
+ { 0x2e0602c0, 0x35006a }, /* 176 */
+ { 0x2e0602c4, 0x4040084 }, /* 177 */
+ { 0x2e0602c8, 0x84 }, /* 178 */
+ { 0x2e0602d8, 0x40004 }, /* 182 */
+ { 0x2e0602dc, 0x30000914 }, /* 183 */
+ { 0x2e0602e0, 0x3030 }, /* 184 */
+ { 0x2e0602e4, 0x44440000 }, /* 185 */
+ { 0x2e0602e8, 0x19191944 }, /* 186 */
+ { 0x2e0602ec, 0x19191908 }, /* 187 */
+ { 0x2e0602f0, 0x4000000 }, /* 188 */
+ { 0x2e0602f4, 0x40404 }, /* 189 */
+ { 0x2e0602f8, 0x9140004 }, /* 190 */
+ { 0x2e0602fc, 0x30303000 }, /* 191 */
+ { 0x2e060304, 0x19444444 }, /* 193 */
+ { 0x2e060308, 0x19081919 }, /* 194 */
+ { 0x2e06030c, 0x1919 }, /* 195 */
+ { 0x2e060310, 0x4040400 }, /* 196 */
+ { 0x2e060314, 0x1010120 }, /* 197 */
+ { 0x2e060318, 0x1000100 }, /* 198 */
+ { 0x2e06031c, 0x1 }, /* 199 */
+ { 0x2e060324, 0x1000000 }, /* 201 */
+ { 0x2e060328, 0x1 }, /* 202 */
+ { 0x2e060354, 0x11000000 }, /* 213 */
+ { 0x2e060358, 0x40c1815 }, /* 214 */
+ { 0x2e060390, 0x30000 }, /* 228 */
+ { 0x2e060394, 0x1000200 }, /* 229 */
+ { 0x2e060398, 0x310040 }, /* 230 */
+ { 0x2e06039c, 0x20008 }, /* 231 */
+ { 0x2e0603a0, 0x400100 }, /* 232 */
+ { 0x2e0603a4, 0x80060 }, /* 233 */
+ { 0x2e0603a8, 0x1000200 }, /* 234 */
+ { 0x2e0603ac, 0x2100040 }, /* 235 */
+ { 0x2e0603b0, 0x10 }, /* 236 */
+ { 0x2e0603b4, 0x50003 }, /* 237 */
+ { 0x2e0603b8, 0x100001b }, /* 238 */
+ { 0x2e0603d8, 0xffff0b00 }, /* 246 */
+ { 0x2e0603dc, 0x1010001 }, /* 247 */
+ { 0x2e0603e0, 0x1010101 }, /* 248 */
+ { 0x2e0603e4, 0x10b0101 }, /* 249 */
+ { 0x2e0603e8, 0x10000 }, /* 250 */
+ { 0x2e0603ec, 0x4010101 }, /* 251 */
+ { 0x2e0603f0, 0x1010000 }, /* 252 */
+ { 0x2e0603f4, 0x4 }, /* 253 */
+ { 0x2e0603fc, 0x3030101 }, /* 255 */
+ { 0x2e060400, 0x103 }, /* 256 */
+ { 0x2e0604a4, 0x2020101 }, /* 297 */
+ { 0x2e0604a8, 0x10100 }, /* 298 */
+ { 0x2e0604ac, 0x1000101 }, /* 299 */
+ { 0x2e0604b0, 0x1010101 }, /* 300 */
+ { 0x2e0604b4, 0x4030300 }, /* 301 */
+ { 0x2e0604b8, 0x8080505 }, /* 302 */
+ { 0x2e0604bc, 0x8020808 }, /* 303 */
+ { 0x2e0604c0, 0x8020e00 }, /* 304 */
+ { 0x2e0604c4, 0xa020e00 }, /* 305 */
+ { 0x2e0604c8, 0x8000f00 }, /* 306 */
+ { 0x2e0604cc, 0xa08 }, /* 307 */
+ { 0x2e0604d0, 0x1010101 }, /* 308 */
+ { 0x2e0604d4, 0x01000102 }, /* 309 */
+ { 0x2e0604d8, 0x00000101 }, /* 310 */
+ { 0x2e0604dc, 0x40400 }, /* 311 */
+ { 0x2e0604e0, 0x4040000 }, /* 312 */
+ { 0x2e0604e4, 0x4000000 }, /* 313 */
+ { 0x2e0604e8, 0x10004 }, /* 314 */
+ { 0x2e0604f0, 0xfffff }, /* 316 */
+ { 0x2e0604f8, 0xfffff }, /* 318 */
+ { 0x2e060500, 0xfffff }, /* 320 */
+ { 0x2e060508, 0xfffff }, /* 322 */
+ { 0x2e060510, 0xfffff }, /* 324 */
+ { 0x2e060518, 0xfffff }, /* 326 */
+ { 0x2e060520, 0xfffff }, /* 328 */
+ { 0x2e060528, 0xfffff }, /* 330 */
+ { 0x2e060530, 0xfffff }, /* 332 */
+ { 0x2e060538, 0xfffff }, /* 334 */
+ { 0x2e060540, 0xfffff }, /* 336 */
+ { 0x2e060548, 0xfffff }, /* 338 */
+ { 0x2e060550, 0xfffff }, /* 340 */
+ { 0x2e060558, 0xfffff }, /* 342 */
+ { 0x2e060560, 0xfffff }, /* 344 */
+ { 0x2e060568, 0xfffff }, /* 346 */
+ { 0x2e060570, 0xfffff }, /* 348 */
+ { 0x2e060578, 0xfffff }, /* 350 */
+ { 0x2e060580, 0xfffff }, /* 352 */
+ { 0x2e060588, 0xfffff }, /* 354 */
+ { 0x2e060590, 0xfffff }, /* 356 */
+ { 0x2e060598, 0xfffff }, /* 358 */
+ { 0x2e0605a0, 0xfffff }, /* 360 */
+ { 0x2e0605a8, 0xfffff }, /* 362 */
+ { 0x2e0605b0, 0xfffff }, /* 364 */
+ { 0x2e0605b8, 0xfffff }, /* 366 */
+ { 0x2e0605c0, 0xfffff }, /* 368 */
+ { 0x2e0605c8, 0xfffff }, /* 370 */
+ { 0x2e0605d0, 0xfffff }, /* 372 */
+ { 0x2e0605d8, 0xfffff }, /* 374 */
+ { 0x2e0605e0, 0xfffff }, /* 376 */
+ { 0x2e0605e8, 0xfffff }, /* 378 */
+ { 0x2e0605f0, 0xfffff }, /* 380 */
+ { 0x2e0605f8, 0xfffff }, /* 382 */
+ { 0x2e060600, 0xfffff }, /* 384 */
+ { 0x2e060608, 0xfffff }, /* 386 */
+ { 0x2e060610, 0xfffff }, /* 388 */
+ { 0x2e060618, 0xfffff }, /* 390 */
+ { 0x2e060620, 0xfffff }, /* 392 */
+ { 0x2e060628, 0xfffff }, /* 394 */
+ { 0x2e060630, 0xfffff }, /* 396 */
+ { 0x2e060638, 0xfffff }, /* 398 */
+ { 0x2e060640, 0xfffff }, /* 400 */
+ { 0x2e060648, 0xfffff }, /* 402 */
+ { 0x2e060650, 0xfffff }, /* 404 */
+ { 0x2e060658, 0xfffff }, /* 406 */
+ { 0x2e060660, 0xfffff }, /* 408 */
+ { 0x2e060668, 0xfffff }, /* 410 */
+ { 0x2e060670, 0xfffff }, /* 412 */
+ { 0x2e060678, 0xfffff }, /* 414 */
+ { 0x2e060680, 0xfffff }, /* 416 */
+ { 0x2e060688, 0xfffff }, /* 418 */
+ { 0x2e060690, 0xfffff }, /* 420 */
+ { 0x2e060698, 0xfffff }, /* 422 */
+ { 0x2e0606a0, 0xfffff }, /* 424 */
+ { 0x2e0606a8, 0xfffff }, /* 426 */
+ { 0x2e0606b0, 0xfffff }, /* 428 */
+ { 0x2e0606b8, 0xfffff }, /* 430 */
+ { 0x2e0606c0, 0xfffff }, /* 432 */
+ { 0x2e0606c8, 0xfffff }, /* 434 */
+ { 0x2e0606d0, 0xfffff }, /* 436 */
+ { 0x2e0606d8, 0xfffff }, /* 438 */
+ { 0x2e0606e0, 0xfffff }, /* 440 */
+ { 0x2e0606e8, 0x30fffff }, /* 442 */
+ { 0x2e0606ec, 0xffffffff }, /* 443 */
+ { 0x2e0606f0, 0x30f0f }, /* 444 */
+ { 0x2e0606f4, 0xffffffff }, /* 445 */
+ { 0x2e0606f8, 0x30f0f }, /* 446 */
+ { 0x2e0606fc, 0xffffffff }, /* 447 */
+ { 0x2e060700, 0x30f0f }, /* 448 */
+ { 0x2e060704, 0xffffffff }, /* 449 */
+ { 0x2e060708, 0x30f0f }, /* 450 */
+ { 0x2e06070c, 0xffffffff }, /* 451 */
+ { 0x2e060710, 0x30f0f }, /* 452 */
+ { 0x2e060714, 0xffffffff }, /* 453 */
+ { 0x2e060718, 0x30f0f }, /* 454 */
+ { 0x2e06071c, 0xffffffff }, /* 455 */
+ { 0x2e060720, 0x30f0f }, /* 456 */
+ { 0x2e060724, 0xffffffff }, /* 457 */
+ { 0x2e060728, 0x30f0f }, /* 458 */
+ { 0x2e06072c, 0xffffffff }, /* 459 */
+ { 0x2e060730, 0x30f0f }, /* 460 */
+ { 0x2e060734, 0xffffffff }, /* 461 */
+ { 0x2e060738, 0x30f0f }, /* 462 */
+ { 0x2e06073c, 0xffffffff }, /* 463 */
+ { 0x2e060740, 0x30f0f }, /* 464 */
+ { 0x2e060744, 0xffffffff }, /* 465 */
+ { 0x2e060748, 0x30f0f }, /* 466 */
+ { 0x2e06074c, 0xffffffff }, /* 467 */
+ { 0x2e060750, 0x30f0f }, /* 468 */
+ { 0x2e060754, 0xffffffff }, /* 469 */
+ { 0x2e060758, 0x30f0f }, /* 470 */
+ { 0x2e06075c, 0xffffffff }, /* 471 */
+ { 0x2e060760, 0x30f0f }, /* 472 */
+ { 0x2e060764, 0xffffffff }, /* 473 */
+ { 0x2e060768, 0x30f0f }, /* 474 */
+ { 0x2e06076c, 0xffffffff }, /* 475 */
+ { 0x2e060770, 0x30f0f }, /* 476 */
+ { 0x2e060774, 0xffffffff }, /* 477 */
+ { 0x2e060778, 0x30f0f }, /* 478 */
+ { 0x2e06077c, 0xffffffff }, /* 479 */
+ { 0x2e060780, 0x30f0f }, /* 480 */
+ { 0x2e060784, 0xffffffff }, /* 481 */
+ { 0x2e060788, 0x30f0f }, /* 482 */
+ { 0x2e06078c, 0xffffffff }, /* 483 */
+ { 0x2e060790, 0x30f0f }, /* 484 */
+ { 0x2e060794, 0xffffffff }, /* 485 */
+ { 0x2e060798, 0x30f0f }, /* 486 */
+ { 0x2e06079c, 0xffffffff }, /* 487 */
+ { 0x2e0607a0, 0x30f0f }, /* 488 */
+ { 0x2e0607a4, 0xffffffff }, /* 489 */
+ { 0x2e0607a8, 0x30f0f }, /* 490 */
+ { 0x2e0607ac, 0xffffffff }, /* 491 */
+ { 0x2e0607b0, 0x30f0f }, /* 492 */
+ { 0x2e0607b4, 0xffffffff }, /* 493 */
+ { 0x2e0607b8, 0x30f0f }, /* 494 */
+ { 0x2e0607bc, 0xffffffff }, /* 495 */
+ { 0x2e0607c0, 0x30f0f }, /* 496 */
+ { 0x2e0607c4, 0xffffffff }, /* 497 */
+ { 0x2e0607c8, 0x30f0f }, /* 498 */
+ { 0x2e0607cc, 0xffffffff }, /* 499 */
+ { 0x2e0607d0, 0x30f0f }, /* 500 */
+ { 0x2e0607d4, 0xffffffff }, /* 501 */
+ { 0x2e0607d8, 0x30f0f }, /* 502 */
+ { 0x2e0607dc, 0xffffffff }, /* 503 */
+ { 0x2e0607e0, 0x30f0f }, /* 504 */
+ { 0x2e0607e4, 0xffffffff }, /* 505 */
+ { 0x2e0607e8, 0x30f0f }, /* 506 */
+ { 0x2e0607ec, 0xffffffff }, /* 507 */
+ { 0x2e0607f0, 0x30f0f }, /* 508 */
+ { 0x2e0607f4, 0xffffffff }, /* 509 */
+ { 0x2e0607f8, 0x30f0f }, /* 510 */
+ { 0x2e0607fc, 0xffffffff }, /* 511 */
+ { 0x2e060800, 0x30f0f }, /* 512 */
+ { 0x2e060804, 0xffffffff }, /* 513 */
+ { 0x2e060808, 0x30f0f }, /* 514 */
+ { 0x2e06080c, 0xffffffff }, /* 515 */
+ { 0x2e060810, 0x30f0f }, /* 516 */
+ { 0x2e060814, 0xffffffff }, /* 517 */
+ { 0x2e060818, 0x30f0f }, /* 518 */
+ { 0x2e06081c, 0xffffffff }, /* 519 */
+ { 0x2e060820, 0x30f0f }, /* 520 */
+ { 0x2e060824, 0xffffffff }, /* 521 */
+ { 0x2e060828, 0x30f0f }, /* 522 */
+ { 0x2e06082c, 0xffffffff }, /* 523 */
+ { 0x2e060830, 0x30f0f }, /* 524 */
+ { 0x2e060834, 0xffffffff }, /* 525 */
+ { 0x2e060838, 0x30f0f }, /* 526 */
+ { 0x2e06083c, 0xffffffff }, /* 527 */
+ { 0x2e060840, 0x30f0f }, /* 528 */
+ { 0x2e060844, 0xffffffff }, /* 529 */
+ { 0x2e060848, 0x30f0f }, /* 530 */
+ { 0x2e06084c, 0xffffffff }, /* 531 */
+ { 0x2e060850, 0x30f0f }, /* 532 */
+ { 0x2e060854, 0xffffffff }, /* 533 */
+ { 0x2e060858, 0x30f0f }, /* 534 */
+ { 0x2e06085c, 0xffffffff }, /* 535 */
+ { 0x2e060860, 0x30f0f }, /* 536 */
+ { 0x2e060864, 0xffffffff }, /* 537 */
+ { 0x2e060868, 0x30f0f }, /* 538 */
+ { 0x2e06086c, 0xffffffff }, /* 539 */
+ { 0x2e060870, 0x30f0f }, /* 540 */
+ { 0x2e060874, 0xffffffff }, /* 541 */
+ { 0x2e060878, 0x30f0f }, /* 542 */
+ { 0x2e06087c, 0xffffffff }, /* 543 */
+ { 0x2e060880, 0x30f0f }, /* 544 */
+ { 0x2e060884, 0xffffffff }, /* 545 */
+ { 0x2e060888, 0x30f0f }, /* 546 */
+ { 0x2e06088c, 0xffffffff }, /* 547 */
+ { 0x2e060890, 0x30f0f }, /* 548 */
+ { 0x2e060894, 0xffffffff }, /* 549 */
+ { 0x2e060898, 0x30f0f }, /* 550 */
+ { 0x2e06089c, 0xffffffff }, /* 551 */
+ { 0x2e0608a0, 0x30f0f }, /* 552 */
+ { 0x2e0608a4, 0xffffffff }, /* 553 */
+ { 0x2e0608a8, 0x30f0f }, /* 554 */
+ { 0x2e0608ac, 0xffffffff }, /* 555 */
+ { 0x2e0608b0, 0x30f0f }, /* 556 */
+ { 0x2e0608b4, 0xffffffff }, /* 557 */
+ { 0x2e0608b8, 0x30f0f }, /* 558 */
+ { 0x2e0608bc, 0xffffffff }, /* 559 */
+ { 0x2e0608c0, 0x30f0f }, /* 560 */
+ { 0x2e0608c4, 0xffffffff }, /* 561 */
+ { 0x2e0608c8, 0x30f0f }, /* 562 */
+ { 0x2e0608cc, 0xffffffff }, /* 563 */
+ { 0x2e0608d0, 0x30f0f }, /* 564 */
+ { 0x2e0608d4, 0xffffffff }, /* 565 */
+ { 0x2e0608d8, 0x30f0f }, /* 566 */
+ { 0x2e0608dc, 0xffffffff }, /* 567 */
+ { 0x2e0608e0, 0x30f0f }, /* 568 */
+ { 0x2e0608e4, 0xffffffff }, /* 569 */
+ { 0x2e0608e8, 0x32070f0f }, /* 570 */
+ { 0x2e0608ec, 0x1320000 }, /* 571 */
+ { 0x2e0608f0, 0x13200 }, /* 572 */
+ { 0x2e0608f4, 0x132 }, /* 573 */
+ { 0x2e0608fc, 0x1b1b0000 }, /* 575 */
+ { 0x2e060900, 0x21 }, /* 576 */
+ { 0x2e060904, 0xa }, /* 577 */
+ { 0x2e060908, 0x166 }, /* 578 */
+ { 0x2e06090c, 0x200 }, /* 579 */
+ { 0x2e060910, 0x200 }, /* 580 */
+ { 0x2e060914, 0x200 }, /* 581 */
+ { 0x2e060918, 0x200 }, /* 582 */
+ { 0x2e06091c, 0x432 }, /* 583 */
+ { 0x2e060920, 0xdfc }, /* 584 */
+ { 0x2e060924, 0x204 }, /* 585 */
+ { 0x2e060928, 0x2dc }, /* 586 */
+ { 0x2e06092c, 0x200 }, /* 587 */
+ { 0x2e060930, 0x200 }, /* 588 */
+ { 0x2e060934, 0x200 }, /* 589 */
+ { 0x2e060938, 0x200 }, /* 590 */
+ { 0x2e06093c, 0x894 }, /* 591 */
+ { 0x2e060940, 0x1c98 }, /* 592 */
+ { 0x2e060944, 0x204 }, /* 593 */
+ { 0x2e060948, 0x1006 }, /* 594 */
+ { 0x2e06094c, 0x200 }, /* 595 */
+ { 0x2e060950, 0x200 }, /* 596 */
+ { 0x2e060954, 0x200 }, /* 597 */
+ { 0x2e060958, 0x200 }, /* 598 */
+ { 0x2e06095c, 0x3012 }, /* 599 */
+ { 0x2e060960, 0xa03c }, /* 600 */
+ { 0x2e060964, 0x2020406 }, /* 601 */
+ { 0x2e060968, 0x2030202 }, /* 602 */
+ { 0x2e06096c, 0x1000202 }, /* 603 */
+ { 0x2e060970, 0x3040100 }, /* 604 */
+ { 0x2e060974, 0x10105 }, /* 605 */
+ { 0x2e060978, 0x10101 }, /* 606 */
+ { 0x2e06097c, 0x10101 }, /* 607 */
+ { 0x2e060980, 0x10001 }, /* 608 */
+ { 0x2e060984, 0x101 }, /* 609 */
+ { 0x2e060988, 0x2000201 }, /* 610 */
+ { 0x2e06098c, 0x2010000 }, /* 611 */
+ { 0x2e060990, 0x6000200 }, /* 612 */
+ { 0x2e060994, 0x3000a06 }, /* 613 */
+ { 0x2e060998, 0x2000c03 }, /* 614 */
+};
+
+/** PI settings **/
+struct dram_cfg_param ddr_pi_cfg[] = {
+ { 0x2e062000, 0xb00 }, /* 0 */
+ { 0x2e062004, 0xbeedb66f }, /* 1 */
+ { 0x2e062008, 0xabef6bd }, /* 2 */
+ { 0x2e06200c, 0x1001387 }, /* 3 */
+ { 0x2e062010, 0x1 }, /* 4 */
+ { 0x2e062014, 0x10064 }, /* 5 */
+ { 0x2e06202c, 0x201 }, /* 11 */
+ { 0x2e062030, 0x7 }, /* 12 */
+ { 0x2e062034, 0x50001 }, /* 13 */
+ { 0x2e062038, 0x3030800 }, /* 14 */
+ { 0x2e06203c, 0x1 }, /* 15 */
+ { 0x2e062040, 0x5 }, /* 16 */
+ { 0x2e062064, 0x1000000 }, /* 25 */
+ { 0x2e062068, 0xa000001 }, /* 26 */
+ { 0x2e06206c, 0x28 }, /* 27 */
+ { 0x2e062070, 0x1 }, /* 28 */
+ { 0x2e062074, 0x320005 }, /* 29 */
+ { 0x2e062080, 0x10102 }, /* 32 */
+ { 0x2e062084, 0x1 }, /* 33 */
+ { 0x2e062088, 0xaa }, /* 34 */
+ { 0x2e06208c, 0x55 }, /* 35 */
+ { 0x2e062090, 0xb5 }, /* 36 */
+ { 0x2e062094, 0x4a }, /* 37 */
+ { 0x2e062098, 0x56 }, /* 38 */
+ { 0x2e06209c, 0xa9 }, /* 39 */
+ { 0x2e0620a0, 0xa9 }, /* 40 */
+ { 0x2e0620a4, 0xb5 }, /* 41 */
+ { 0x2e0620a8, 0x10000 }, /* 42 */
+ { 0x2e0620ac, 0x100 }, /* 43 */
+ { 0x2e0620b0, 0x5050000 }, /* 44 */
+ { 0x2e0620b4, 0x13 }, /* 45 */
+ { 0x2e0620b8, 0x7d0 }, /* 46 */
+ { 0x2e0620bc, 0x300 }, /* 47 */
+ { 0x2e0620c8, 0x1000000 }, /* 50 */
+ { 0x2e0620cc, 0x10101 }, /* 51 */
+ { 0x2e0620d8, 0x10003 }, /* 54 */
+ { 0x2e0620dc, 0x170500 }, /* 55 */
+ { 0x2e0620ec, 0xa140a01 }, /* 59 */
+ { 0x2e0620f0, 0x204010a }, /* 60 */
+ { 0x2e0620f4, 0x21010 }, /* 61 */
+ { 0x2e0620f8, 0x40401 }, /* 62 */
+ { 0x2e0620fc, 0x10e0005 }, /* 63 */
+ { 0x2e062100, 0x5000001 }, /* 64 */
+ { 0x2e062104, 0x204 }, /* 65 */
+ { 0x2e062108, 0x34 }, /* 66 */
+ { 0x2e062114, 0x1000000 }, /* 69 */
+ { 0x2e062118, 0x1000000 }, /* 70 */
+ { 0x2e06211c, 0x80200 }, /* 71 */
+ { 0x2e062120, 0x2000200 }, /* 72 */
+ { 0x2e062124, 0x1000100 }, /* 73 */
+ { 0x2e062128, 0x1000000 }, /* 74 */
+ { 0x2e06212c, 0x2000200 }, /* 75 */
+ { 0x2e062130, 0x200 }, /* 76 */
+ { 0x2e062164, 0x400 }, /* 89 */
+ { 0x2e062168, 0x2010000 }, /* 90 */
+ { 0x2e06216c, 0x80103 }, /* 91 */
+ { 0x2e062174, 0x10008 }, /* 93 */
+ { 0x2e06217c, 0xaa00 }, /* 95 */
+ { 0x2e062188, 0x10000 }, /* 98 */
+ { 0x2e0621ec, 0x8 }, /* 123 */
+ { 0x2e062218, 0xf0000 }, /* 134 */
+ { 0x2e06221c, 0xa }, /* 135 */
+ { 0x2e062220, 0x19 }, /* 136 */
+ { 0x2e062224, 0x100 }, /* 137 */
+ { 0x2e062228, 0x100 }, /* 138 */
+ { 0x2e062238, 0x1000000 }, /* 142 */
+ { 0x2e06223c, 0x10003 }, /* 143 */
+ { 0x2e062240, 0x2000101 }, /* 144 */
+ { 0x2e062244, 0x1030001 }, /* 145 */
+ { 0x2e062248, 0x10400 }, /* 146 */
+ { 0x2e06224c, 0x6000105 }, /* 147 */
+ { 0x2e062250, 0x1070001 }, /* 148 */
+ { 0x2e062260, 0x10001 }, /* 152 */
+ { 0x2e062274, 0x401 }, /* 157 */
+ { 0x2e06227c, 0x10000 }, /* 159 */
+ { 0x2e062284, 0x2010000 }, /* 161 */
+ { 0x2e062288, 0xb }, /* 162 */
+ { 0x2e06228c, 0x34 }, /* 163 */
+ { 0x2e062290, 0x34 }, /* 164 */
+ { 0x2e062294, 0x2003c }, /* 165 */
+ { 0x2e062298, 0x2000200 }, /* 166 */
+ { 0x2e06229c, 0xc040c04 }, /* 167 */
+ { 0x2e0622a0, 0xe1406 }, /* 168 */
+ { 0x2e0622a4, 0xb3 }, /* 169 */
+ { 0x2e0622a8, 0x1b }, /* 170 */
+ { 0x2e0622ac, 0x16e }, /* 171 */
+ { 0x2e0622b0, 0x94 }, /* 172 */
+ { 0x2e0622b4, 0x4000803 }, /* 173 */
+ { 0x2e0622b8, 0x1010404 }, /* 174 */
+ { 0x2e0622bc, 0x1501 }, /* 175 */
+ { 0x2e0622c0, 0x1a0016 }, /* 176 */
+ { 0x2e0622c4, 0x1000100 }, /* 177 */
+ { 0x2e0622c8, 0x100 }, /* 178 */
+ { 0x2e0622d0, 0x5040303 }, /* 180 */
+ { 0x2e0622d4, 0x1010805 }, /* 181 */
+ { 0x2e0622d8, 0x1010101 }, /* 182 */
+ { 0x2e0622e8, 0x2060404 }, /* 186 */
+ { 0x2e0622ec, 0x2020402 }, /* 187 */
+ { 0x2e0622f0, 0x3102 }, /* 188 */
+ { 0x2e0622f4, 0x320009 }, /* 189 */
+ { 0x2e0622f8, 0x36000a }, /* 190 */
+ { 0x2e0622fc, 0x101000e }, /* 191 */
+ { 0x2e062300, 0xd0101 }, /* 192 */
+ { 0x2e062304, 0x1001801 }, /* 193 */
+ { 0x2e062308, 0x1000084 }, /* 194 */
+ { 0x2e06230c, 0xe000e }, /* 195 */
+ { 0x2e062310, 0x190100 }, /* 196 */
+ { 0x2e062314, 0x1000019 }, /* 197 */
+ { 0x2e062318, 0x850085 }, /* 198 */
+ { 0x2e06231c, 0x220f220f }, /* 199 */
+ { 0x2e062320, 0x101220f }, /* 200 */
+ { 0x2e062324, 0xa070601 }, /* 201 */
+ { 0x2e062328, 0xa07060d }, /* 202 */
+ { 0x2e06232c, 0xa07070d }, /* 203 */
+ { 0x2e062330, 0xc00d }, /* 204 */
+ { 0x2e062334, 0xc01000 }, /* 205 */
+ { 0x2e062338, 0xc01000 }, /* 206 */
+ { 0x2e06233c, 0x21000 }, /* 207 */
+ { 0x2e062340, 0x2000d }, /* 208 */
+ { 0x2e062344, 0x140018 }, /* 209 */
+ { 0x2e062348, 0x190084 }, /* 210 */
+ { 0x2e06234c, 0x220f0056 }, /* 211 */
+ { 0x2e062350, 0x101 }, /* 212 */
+ { 0x2e062354, 0x560019 }, /* 213 */
+ { 0x2e062358, 0x101220f }, /* 214 */
+ { 0x2e06235c, 0x1b00 }, /* 215 */
+ { 0x2e062360, 0x220f0056 }, /* 216 */
+ { 0x2e062364, 0x8000101 }, /* 217 */
+ { 0x2e062368, 0x4090403 }, /* 218 */
+ { 0x2e06236c, 0x5eb }, /* 219 */
+ { 0x2e062370, 0x20010003 }, /* 220 */
+ { 0x2e062374, 0x80a0a03 }, /* 221 */
+ { 0x2e062378, 0x4090403 }, /* 222 */
+ { 0x2e06237c, 0xbd8 }, /* 223 */
+ { 0x2e062380, 0x20010005 }, /* 224 */
+ { 0x2e062384, 0x80a0a03 }, /* 225 */
+ { 0x2e062388, 0xb090a0c }, /* 226 */
+ { 0x2e06238c, 0x4126 }, /* 227 */
+ { 0x2e062390, 0x20020017 }, /* 228 */
+ { 0x2e062394, 0xa0a08 }, /* 229 */
+ { 0x2e062398, 0x166 }, /* 230 */
+ { 0x2e06239c, 0xdfc }, /* 231 */
+ { 0x2e0623a0, 0x2dc }, /* 232 */
+ { 0x2e0623a4, 0x1c98 }, /* 233 */
+ { 0x2e0623a8, 0x1006 }, /* 234 */
+ { 0x2e0623ac, 0xa03c }, /* 235 */
+ { 0x2e0623b0, 0x1c000e }, /* 236 */
+ { 0x2e0623b4, 0x3030098 }, /* 237 */
+ { 0x2e0623b8, 0x258103 }, /* 238 */
+ { 0x2e0623bc, 0x17702 }, /* 239 */
+ { 0x2e0623c0, 0x5 }, /* 240 */
+ { 0x2e0623c4, 0x61 }, /* 241 */
+ { 0x2e0623c8, 0xe }, /* 242 */
+ { 0x2e0623cc, 0x4b00 }, /* 243 */
+ { 0x2e0623d0, 0x17702 }, /* 244 */
+ { 0x2e0623d4, 0x5 }, /* 245 */
+ { 0x2e0623d8, 0xc0 }, /* 246 */
+ { 0x2e0623dc, 0x1c }, /* 247 */
+ { 0x2e0623e0, 0x19c7d }, /* 248 */
+ { 0x2e0623e4, 0x17702 }, /* 249 */
+ { 0x2e0623e8, 0x5 }, /* 250 */
+ { 0x2e0623ec, 0x420 }, /* 251 */
+ { 0x2e0623f0, 0x1000098 }, /* 252 */
+ { 0x2e0623f4, 0x310040 }, /* 253 */
+ { 0x2e0623f8, 0x10008 }, /* 254 */
+ { 0x2e0623fc, 0x600040 }, /* 255 */
+ { 0x2e062400, 0x10008 }, /* 256 */
+ { 0x2e062404, 0x2100040 }, /* 257 */
+ { 0x2e062408, 0x310 }, /* 258 */
+ { 0x2e06240c, 0x1b000e }, /* 259 */
+ { 0x2e062410, 0x1010101 }, /* 260 */
+ { 0x2e062414, 0x2020101 }, /* 261 */
+ { 0x2e062418, 0x8080404 }, /* 262 */
+ { 0x2e06241c, 0x5508 }, /* 263 */
+ { 0x2e062420, 0x83c5a00 }, /* 264 */
+ { 0x2e062424, 0x55 }, /* 265 */
+ { 0x2e062428, 0x55083c5a }, /* 266 */
+ { 0x2e06242c, 0x5a000000 }, /* 267 */
+ { 0x2e062430, 0x55083c }, /* 268 */
+ { 0x2e062434, 0x3c5a0000 }, /* 269 */
+ { 0x2e062438, 0xf0e0d0c }, /* 270 */
+ { 0x2e06243c, 0xb0a0908 }, /* 271 */
+ { 0x2e062440, 0x7060504 }, /* 272 */
+ { 0x2e062444, 0x3020100 }, /* 273 */
+ { 0x2e06244c, 0x2020101 }, /* 275 */
+ { 0x2e062450, 0x8080404 }, /* 276 */
+ { 0x2e062454, 0x44300004 }, /* 277 */
+ { 0x2e062458, 0x4041919 }, /* 278 */
+ { 0x2e06245c, 0x19443000 }, /* 279 */
+ { 0x2e062460, 0x9140419 }, /* 280 */
+ { 0x2e062464, 0x19194430 }, /* 281 */
+ { 0x2e062468, 0x30000404 }, /* 282 */
+ { 0x2e06246c, 0x4191944 }, /* 283 */
+ { 0x2e062470, 0x44300004 }, /* 284 */
+ { 0x2e062474, 0x14041919 }, /* 285 */
+ { 0x2e062478, 0x19443009 }, /* 286 */
+ { 0x2e06247c, 0x40419 }, /* 287 */
+ { 0x2e062480, 0x19194430 }, /* 288 */
+ { 0x2e062484, 0x30000404 }, /* 289 */
+ { 0x2e062488, 0x4191944 }, /* 290 */
+ { 0x2e06248c, 0x44300914 }, /* 291 */
+ { 0x2e062490, 0x44041919 }, /* 292 */
+ { 0x2e062494, 0x19443000 }, /* 293 */
+ { 0x2e062498, 0x40419 }, /* 294 */
+ { 0x2e06249c, 0x19194430 }, /* 295 */
+ { 0x2e0624a0, 0x30091404 }, /* 296 */
+ { 0x2e0624a4, 0x4191944 }, /* 297 */
+};
+
+/** PHY_F1 settings **/
+struct dram_cfg_param ddr_phy_f1_cfg[] = {
+ { 0x2e064000, 0x4f0 }, /* 0 */
+ { 0x2e064008, 0x1030200 }, /* 2 */
+ { 0x2e064014, 0x3000000 }, /* 5 */
+ { 0x2e064018, 0x1000001 }, /* 6 */
+ { 0x2e06401c, 0x3000400 }, /* 7 */
+ { 0x2e064020, 0x1 }, /* 8 */
+ { 0x2e064024, 0x1 }, /* 9 */
+ { 0x2e064030, 0x10000 }, /* 12 */
+ { 0x2e064038, 0xc00004 }, /* 14 */
+ { 0x2e06403c, 0xcc0008 }, /* 15 */
+ { 0x2e064040, 0x660601 }, /* 16 */
+ { 0x2e064044, 0x3 }, /* 17 */
+ { 0x2e06404c, 0x1 }, /* 19 */
+ { 0x2e064050, 0xaaaa }, /* 20 */
+ { 0x2e064054, 0x5555 }, /* 21 */
+ { 0x2e064058, 0xb5b5 }, /* 22 */
+ { 0x2e06405c, 0x4a4a }, /* 23 */
+ { 0x2e064060, 0x5656 }, /* 24 */
+ { 0x2e064064, 0xa9a9 }, /* 25 */
+ { 0x2e064068, 0xb7b7 }, /* 26 */
+ { 0x2e06406c, 0x4848 }, /* 27 */
+ { 0x2e064078, 0x8000000 }, /* 30 */
+ { 0x2e06407c, 0x4010008 }, /* 31 */
+ { 0x2e064080, 0x408 }, /* 32 */
+ { 0x2e064084, 0x3102000 }, /* 33 */
+ { 0x2e064088, 0xc0020 }, /* 34 */
+ { 0x2e06408c, 0x10000 }, /* 35 */
+ { 0x2e064090, 0x55555555 }, /* 36 */
+ { 0x2e064094, 0xaaaaaaaa }, /* 37 */
+ { 0x2e064098, 0x55555555 }, /* 38 */
+ { 0x2e06409c, 0xaaaaaaaa }, /* 39 */
+ { 0x2e0640a0, 0x5555 }, /* 40 */
+ { 0x2e0640a4, 0x1000100 }, /* 41 */
+ { 0x2e0640a8, 0x800180 }, /* 42 */
+ { 0x2e0640ac, 0x1 }, /* 43 */
+ { 0x2e064100, 0x4 }, /* 64 */
+ { 0x2e06411c, 0x41f07ff }, /* 71 */
+ { 0x2e064120, 0x1 }, /* 72 */
+ { 0x2e064124, 0x1cc0800 }, /* 73 */
+ { 0x2e064128, 0x3003cc08 }, /* 74 */
+ { 0x2e06412c, 0x2000014e }, /* 75 */
+ { 0x2e064130, 0x7ff0200 }, /* 76 */
+ { 0x2e064134, 0x301 }, /* 77 */
+ { 0x2e064140, 0x30000 }, /* 80 */
+ { 0x2e064154, 0x2000000 }, /* 85 */
+ { 0x2e064158, 0x51515042 }, /* 86 */
+ { 0x2e06415c, 0x31c06000 }, /* 87 */
+ { 0x2e064160, 0x6bf000a }, /* 88 */
+ { 0x2e064164, 0xc0c000 }, /* 89 */
+ { 0x2e064168, 0x1000000 }, /* 90 */
+ { 0x2e06416c, 0x10001000 }, /* 91 */
+ { 0x2e064170, 0xc043242 }, /* 92 */
+ { 0x2e064174, 0xf0c0e01 }, /* 93 */
+ { 0x2e064178, 0x1000140 }, /* 94 */
+ { 0x2e06417c, 0xc000120 }, /* 95 */
+ { 0x2e064180, 0x118 }, /* 96 */
+ { 0x2e064184, 0x1000203 }, /* 97 */
+ { 0x2e064188, 0x56417032 }, /* 98 */
+ { 0x2e06418c, 0x8 }, /* 99 */
+ { 0x2e064190, 0x2980298 }, /* 100 */
+ { 0x2e064194, 0x2980298 }, /* 101 */
+ { 0x2e064198, 0x2980298 }, /* 102 */
+ { 0x2e06419c, 0x2980298 }, /* 103 */
+ { 0x2e0641a0, 0x298 }, /* 104 */
+ { 0x2e0641a4, 0x8000 }, /* 105 */
+ { 0x2e0641a8, 0x800080 }, /* 106 */
+ { 0x2e0641ac, 0x800080 }, /* 107 */
+ { 0x2e0641b0, 0x800080 }, /* 108 */
+ { 0x2e0641b4, 0x800080 }, /* 109 */
+ { 0x2e0641b8, 0x800080 }, /* 110 */
+ { 0x2e0641bc, 0x800080 }, /* 111 */
+ { 0x2e0641c0, 0x800080 }, /* 112 */
+ { 0x2e0641c4, 0x800080 }, /* 113 */
+ { 0x2e0641c8, 0x1940080 }, /* 114 */
+ { 0x2e0641cc, 0x1a00001 }, /* 115 */
+ { 0x2e0641d4, 0x10000 }, /* 117 */
+ { 0x2e0641d8, 0x80200 }, /* 118 */
+ { 0x2e064400, 0x4f0 }, /* 256 */
+ { 0x2e064408, 0x1030200 }, /* 258 */
+ { 0x2e064414, 0x3000000 }, /* 261 */
+ { 0x2e064418, 0x1000001 }, /* 262 */
+ { 0x2e06441c, 0x3000400 }, /* 263 */
+ { 0x2e064420, 0x1 }, /* 264 */
+ { 0x2e064424, 0x1 }, /* 265 */
+ { 0x2e064430, 0x10000 }, /* 268 */
+ { 0x2e064438, 0xc00004 }, /* 270 */
+ { 0x2e06443c, 0xcc0008 }, /* 271 */
+ { 0x2e064440, 0x660601 }, /* 272 */
+ { 0x2e064444, 0x3 }, /* 273 */
+ { 0x2e06444c, 0x1 }, /* 275 */
+ { 0x2e064450, 0xaaaa }, /* 276 */
+ { 0x2e064454, 0x5555 }, /* 277 */
+ { 0x2e064458, 0xb5b5 }, /* 278 */
+ { 0x2e06445c, 0x4a4a }, /* 279 */
+ { 0x2e064460, 0x5656 }, /* 280 */
+ { 0x2e064464, 0xa9a9 }, /* 281 */
+ { 0x2e064468, 0xb7b7 }, /* 282 */
+ { 0x2e06446c, 0x4848 }, /* 283 */
+ { 0x2e064478, 0x8000000 }, /* 286 */
+ { 0x2e06447c, 0x4010008 }, /* 287 */
+ { 0x2e064480, 0x408 }, /* 288 */
+ { 0x2e064484, 0x3102000 }, /* 289 */
+ { 0x2e064488, 0xc0020 }, /* 290 */
+ { 0x2e06448c, 0x10000 }, /* 291 */
+ { 0x2e064490, 0x55555555 }, /* 292 */
+ { 0x2e064494, 0xaaaaaaaa }, /* 293 */
+ { 0x2e064498, 0x55555555 }, /* 294 */
+ { 0x2e06449c, 0xaaaaaaaa }, /* 295 */
+ { 0x2e0644a0, 0x5555 }, /* 296 */
+ { 0x2e0644a4, 0x1000100 }, /* 297 */
+ { 0x2e0644a8, 0x800180 }, /* 298 */
+ { 0x2e064500, 0x4 }, /* 320 */
+ { 0x2e06451c, 0x41f07ff }, /* 327 */
+ { 0x2e064520, 0x1 }, /* 328 */
+ { 0x2e064524, 0x1cc0800 }, /* 329 */
+ { 0x2e064528, 0x3003cc08 }, /* 330 */
+ { 0x2e06452c, 0x2000014e }, /* 331 */
+ { 0x2e064530, 0x7ff0200 }, /* 332 */
+ { 0x2e064534, 0x301 }, /* 333 */
+ { 0x2e064540, 0x30000 }, /* 336 */
+ { 0x2e064554, 0x2000000 }, /* 341 */
+ { 0x2e064558, 0x51515042 }, /* 342 */
+ { 0x2e06455c, 0x31c06000 }, /* 343 */
+ { 0x2e064560, 0x6bf000a }, /* 344 */
+ { 0x2e064564, 0xc0c000 }, /* 345 */
+ { 0x2e064568, 0x1000000 }, /* 346 */
+ { 0x2e06456c, 0x10001000 }, /* 347 */
+ { 0x2e064570, 0xc043242 }, /* 348 */
+ { 0x2e064574, 0xf0c0e01 }, /* 349 */
+ { 0x2e064578, 0x1000140 }, /* 350 */
+ { 0x2e06457c, 0xc000120 }, /* 351 */
+ { 0x2e064580, 0x118 }, /* 352 */
+ { 0x2e064584, 0x1000203 }, /* 353 */
+ { 0x2e064588, 0x30217465 }, /* 354 */
+ { 0x2e06458c, 0x8 }, /* 355 */
+ { 0x2e064590, 0x2980298 }, /* 356 */
+ { 0x2e064594, 0x2980298 }, /* 357 */
+ { 0x2e064598, 0x2980298 }, /* 358 */
+ { 0x2e06459c, 0x2980298 }, /* 359 */
+ { 0x2e0645a0, 0x298 }, /* 360 */
+ { 0x2e0645a4, 0x8000 }, /* 361 */
+ { 0x2e0645a8, 0x800080 }, /* 362 */
+ { 0x2e0645ac, 0x800080 }, /* 363 */
+ { 0x2e0645b0, 0x800080 }, /* 364 */
+ { 0x2e0645b4, 0x800080 }, /* 365 */
+ { 0x2e0645b8, 0x800080 }, /* 366 */
+ { 0x2e0645bc, 0x800080 }, /* 367 */
+ { 0x2e0645c0, 0x800080 }, /* 368 */
+ { 0x2e0645c4, 0x800080 }, /* 369 */
+ { 0x2e0645c8, 0x1940080 }, /* 370 */
+ { 0x2e0645cc, 0x1a00001 }, /* 371 */
+ { 0x2e0645d4, 0x10000 }, /* 373 */
+ { 0x2e0645d8, 0x80200 }, /* 374 */
+ { 0x2e064800, 0x4f0 }, /* 512 */
+ { 0x2e064808, 0x1030200 }, /* 514 */
+ { 0x2e064814, 0x3000000 }, /* 517 */
+ { 0x2e064818, 0x1000001 }, /* 518 */
+ { 0x2e06481c, 0x3000400 }, /* 519 */
+ { 0x2e064820, 0x1 }, /* 520 */
+ { 0x2e064824, 0x1 }, /* 521 */
+ { 0x2e064830, 0x10000 }, /* 524 */
+ { 0x2e064838, 0xc00004 }, /* 526 */
+ { 0x2e06483c, 0xcc0008 }, /* 527 */
+ { 0x2e064840, 0x660601 }, /* 528 */
+ { 0x2e064844, 0x3 }, /* 529 */
+ { 0x2e06484c, 0x1 }, /* 531 */
+ { 0x2e064850, 0xaaaa }, /* 532 */
+ { 0x2e064854, 0x5555 }, /* 533 */
+ { 0x2e064858, 0xb5b5 }, /* 534 */
+ { 0x2e06485c, 0x4a4a }, /* 535 */
+ { 0x2e064860, 0x5656 }, /* 536 */
+ { 0x2e064864, 0xa9a9 }, /* 537 */
+ { 0x2e064868, 0xb7b7 }, /* 538 */
+ { 0x2e06486c, 0x4848 }, /* 539 */
+ { 0x2e064878, 0x8000000 }, /* 542 */
+ { 0x2e06487c, 0x4010008 }, /* 543 */
+ { 0x2e064880, 0x408 }, /* 544 */
+ { 0x2e064884, 0x3102000 }, /* 545 */
+ { 0x2e064888, 0xc0020 }, /* 546 */
+ { 0x2e06488c, 0x10000 }, /* 547 */
+ { 0x2e064890, 0x55555555 }, /* 548 */
+ { 0x2e064894, 0xaaaaaaaa }, /* 549 */
+ { 0x2e064898, 0x55555555 }, /* 550 */
+ { 0x2e06489c, 0xaaaaaaaa }, /* 551 */
+ { 0x2e0648a0, 0x5555 }, /* 552 */
+ { 0x2e0648a4, 0x1000100 }, /* 553 */
+ { 0x2e0648a8, 0x800180 }, /* 554 */
+ { 0x2e0648ac, 0x1 }, /* 555 */
+ { 0x2e064900, 0x4 }, /* 576 */
+ { 0x2e06491c, 0x41f07ff }, /* 583 */
+ { 0x2e064920, 0x1 }, /* 584 */
+ { 0x2e064924, 0x1cc0800 }, /* 585 */
+ { 0x2e064928, 0x3003cc08 }, /* 586 */
+ { 0x2e06492c, 0x2000014e }, /* 587 */
+ { 0x2e064930, 0x7ff0200 }, /* 588 */
+ { 0x2e064934, 0x301 }, /* 589 */
+ { 0x2e064940, 0x30000 }, /* 592 */
+ { 0x2e064954, 0x2000000 }, /* 597 */
+ { 0x2e064958, 0x51515042 }, /* 598 */
+ { 0x2e06495c, 0x31c06000 }, /* 599 */
+ { 0x2e064960, 0x6bf000a }, /* 600 */
+ { 0x2e064964, 0xc0c000 }, /* 601 */
+ { 0x2e064968, 0x1000000 }, /* 602 */
+ { 0x2e06496c, 0x10001000 }, /* 603 */
+ { 0x2e064970, 0xc043242 }, /* 604 */
+ { 0x2e064974, 0xf0c0e01 }, /* 605 */
+ { 0x2e064978, 0x1000140 }, /* 606 */
+ { 0x2e06497c, 0xc000120 }, /* 607 */
+ { 0x2e064980, 0x118 }, /* 608 */
+ { 0x2e064984, 0x1000203 }, /* 609 */
+ { 0x2e064988, 0x75436012 }, /* 610 */
+ { 0x2e06498c, 0x8 }, /* 611 */
+ { 0x2e064990, 0x2980298 }, /* 612 */
+ { 0x2e064994, 0x2980298 }, /* 613 */
+ { 0x2e064998, 0x2980298 }, /* 614 */
+ { 0x2e06499c, 0x2980298 }, /* 615 */
+ { 0x2e0649a0, 0x298 }, /* 616 */
+ { 0x2e0649a4, 0x8000 }, /* 617 */
+ { 0x2e0649a8, 0x800080 }, /* 618 */
+ { 0x2e0649ac, 0x800080 }, /* 619 */
+ { 0x2e0649b0, 0x800080 }, /* 620 */
+ { 0x2e0649b4, 0x800080 }, /* 621 */
+ { 0x2e0649b8, 0x800080 }, /* 622 */
+ { 0x2e0649bc, 0x800080 }, /* 623 */
+ { 0x2e0649c0, 0x800080 }, /* 624 */
+ { 0x2e0649c4, 0x800080 }, /* 625 */
+ { 0x2e0649c8, 0x1940080 }, /* 626 */
+ { 0x2e0649cc, 0x1a00001 }, /* 627 */
+ { 0x2e0649d4, 0x10000 }, /* 629 */
+ { 0x2e0649d8, 0x80200 }, /* 630 */
+ { 0x2e064c00, 0x4f0 }, /* 768 */
+ { 0x2e064c08, 0x1030200 }, /* 770 */
+ { 0x2e064c14, 0x3000000 }, /* 773 */
+ { 0x2e064c18, 0x1000001 }, /* 774 */
+ { 0x2e064c1c, 0x3000400 }, /* 775 */
+ { 0x2e064c20, 0x1 }, /* 776 */
+ { 0x2e064c24, 0x1 }, /* 777 */
+ { 0x2e064c30, 0x10000 }, /* 780 */
+ { 0x2e064c38, 0xc00004 }, /* 782 */
+ { 0x2e064c3c, 0xcc0008 }, /* 783 */
+ { 0x2e064c40, 0x660601 }, /* 784 */
+ { 0x2e064c44, 0x3 }, /* 785 */
+ { 0x2e064c4c, 0x1 }, /* 787 */
+ { 0x2e064c50, 0xaaaa }, /* 788 */
+ { 0x2e064c54, 0x5555 }, /* 789 */
+ { 0x2e064c58, 0xb5b5 }, /* 790 */
+ { 0x2e064c5c, 0x4a4a }, /* 791 */
+ { 0x2e064c60, 0x5656 }, /* 792 */
+ { 0x2e064c64, 0xa9a9 }, /* 793 */
+ { 0x2e064c68, 0xb7b7 }, /* 794 */
+ { 0x2e064c6c, 0x4848 }, /* 795 */
+ { 0x2e064c78, 0x8000000 }, /* 798 */
+ { 0x2e064c7c, 0x4010008 }, /* 799 */
+ { 0x2e064c80, 0x408 }, /* 800 */
+ { 0x2e064c84, 0x3102000 }, /* 801 */
+ { 0x2e064c88, 0xc0020 }, /* 802 */
+ { 0x2e064c8c, 0x10000 }, /* 803 */
+ { 0x2e064c90, 0x55555555 }, /* 804 */
+ { 0x2e064c94, 0xaaaaaaaa }, /* 805 */
+ { 0x2e064c98, 0x55555555 }, /* 806 */
+ { 0x2e064c9c, 0xaaaaaaaa }, /* 807 */
+ { 0x2e064ca0, 0x5555 }, /* 808 */
+ { 0x2e064ca4, 0x1000100 }, /* 809 */
+ { 0x2e064ca8, 0x800180 }, /* 810 */
+ { 0x2e064d00, 0x4 }, /* 832 */
+ { 0x2e064d1c, 0x41f07ff }, /* 839 */
+ { 0x2e064d20, 0x1 }, /* 840 */
+ { 0x2e064d24, 0x1cc0800 }, /* 841 */
+ { 0x2e064d28, 0x3003cc08 }, /* 842 */
+ { 0x2e064d2c, 0x2000014e }, /* 843 */
+ { 0x2e064d30, 0x7ff0200 }, /* 844 */
+ { 0x2e064d34, 0x301 }, /* 845 */
+ { 0x2e064d40, 0x30000 }, /* 848 */
+ { 0x2e064d54, 0x2000000 }, /* 853 */
+ { 0x2e064d58, 0x51515042 }, /* 854 */
+ { 0x2e064d5c, 0x31c06000 }, /* 855 */
+ { 0x2e064d60, 0x6bf000a }, /* 856 */
+ { 0x2e064d64, 0xc0c000 }, /* 857 */
+ { 0x2e064d68, 0x1000000 }, /* 858 */
+ { 0x2e064d6c, 0x10001000 }, /* 859 */
+ { 0x2e064d70, 0xc043242 }, /* 860 */
+ { 0x2e064d74, 0xf0c0e01 }, /* 861 */
+ { 0x2e064d78, 0x1000140 }, /* 862 */
+ { 0x2e064d7c, 0xc000120 }, /* 863 */
+ { 0x2e064d80, 0x118 }, /* 864 */
+ { 0x2e064d84, 0x1000203 }, /* 865 */
+ { 0x2e064d88, 0x32017465 }, /* 866 */
+ { 0x2e064d8c, 0x8 }, /* 867 */
+ { 0x2e064d90, 0x2980298 }, /* 868 */
+ { 0x2e064d94, 0x2980298 }, /* 869 */
+ { 0x2e064d98, 0x2980298 }, /* 870 */
+ { 0x2e064d9c, 0x2980298 }, /* 871 */
+ { 0x2e064da0, 0x298 }, /* 872 */
+ { 0x2e064da4, 0x8000 }, /* 873 */
+ { 0x2e064da8, 0x800080 }, /* 874 */
+ { 0x2e064dac, 0x800080 }, /* 875 */
+ { 0x2e064db0, 0x800080 }, /* 876 */
+ { 0x2e064db4, 0x800080 }, /* 877 */
+ { 0x2e064db8, 0x800080 }, /* 878 */
+ { 0x2e064dbc, 0x800080 }, /* 879 */
+ { 0x2e064dc0, 0x800080 }, /* 880 */
+ { 0x2e064dc4, 0x800080 }, /* 881 */
+ { 0x2e064dc8, 0x1940080 }, /* 882 */
+ { 0x2e064dcc, 0x1a00001 }, /* 883 */
+ { 0x2e064dd4, 0x10000 }, /* 885 */
+ { 0x2e064dd8, 0x80200 }, /* 886 */
+ { 0x2e065014, 0x100 }, /* 1029 */
+ { 0x2e065018, 0x201 }, /* 1030 */
+ { 0x2e06502c, 0x400000 }, /* 1035 */
+ { 0x2e065030, 0x80 }, /* 1036 */
+ { 0x2e065034, 0xdcba98 }, /* 1037 */
+ { 0x2e065038, 0x3000000 }, /* 1038 */
+ { 0x2e06504c, 0x2a }, /* 1043 */
+ { 0x2e065050, 0x15 }, /* 1044 */
+ { 0x2e065054, 0x15 }, /* 1045 */
+ { 0x2e065058, 0x2a }, /* 1046 */
+ { 0x2e06505c, 0x33 }, /* 1047 */
+ { 0x2e065060, 0xc }, /* 1048 */
+ { 0x2e065064, 0xc }, /* 1049 */
+ { 0x2e065068, 0x33 }, /* 1050 */
+ { 0x2e06506c, 0x543210 }, /* 1051 */
+ { 0x2e065070, 0x3f0000 }, /* 1052 */
+ { 0x2e065074, 0xf013f }, /* 1053 */
+ { 0x2e065078, 0xf }, /* 1054 */
+ { 0x2e06507c, 0x3cc }, /* 1055 */
+ { 0x2e065080, 0x30000 }, /* 1056 */
+ { 0x2e065084, 0x300 }, /* 1057 */
+ { 0x2e065088, 0x300 }, /* 1058 */
+ { 0x2e06508c, 0x300 }, /* 1059 */
+ { 0x2e065090, 0x300 }, /* 1060 */
+ { 0x2e065094, 0x300 }, /* 1061 */
+ { 0x2e065098, 0x42080010 }, /* 1062 */
+ { 0x2e06509c, 0x332 }, /* 1063 */
+ { 0x2e0650a0, 0x2 }, /* 1064 */
+ { 0x2e065414, 0x100 }, /* 1285 */
+ { 0x2e065418, 0x201 }, /* 1286 */
+ { 0x2e06542c, 0x400000 }, /* 1291 */
+ { 0x2e065430, 0x80 }, /* 1292 */
+ { 0x2e065434, 0xdcba98 }, /* 1293 */
+ { 0x2e065438, 0x3000000 }, /* 1294 */
+ { 0x2e06544c, 0x2a }, /* 1299 */
+ { 0x2e065450, 0x15 }, /* 1300 */
+ { 0x2e065454, 0x15 }, /* 1301 */
+ { 0x2e065458, 0x2a }, /* 1302 */
+ { 0x2e06545c, 0x33 }, /* 1303 */
+ { 0x2e065460, 0xc }, /* 1304 */
+ { 0x2e065464, 0xc }, /* 1305 */
+ { 0x2e065468, 0x33 }, /* 1306 */
+ { 0x2e06546c, 0x543210 }, /* 1307 */
+ { 0x2e065470, 0x3f0000 }, /* 1308 */
+ { 0x2e065474, 0xf013f }, /* 1309 */
+ { 0x2e065478, 0xf }, /* 1310 */
+ { 0x2e06547c, 0x3cc }, /* 1311 */
+ { 0x2e065480, 0x30000 }, /* 1312 */
+ { 0x2e065484, 0x300 }, /* 1313 */
+ { 0x2e065488, 0x300 }, /* 1314 */
+ { 0x2e06548c, 0x300 }, /* 1315 */
+ { 0x2e065490, 0x300 }, /* 1316 */
+ { 0x2e065494, 0x300 }, /* 1317 */
+ { 0x2e065498, 0x42080010 }, /* 1318 */
+ { 0x2e06549c, 0x332 }, /* 1319 */
+ { 0x2e0654a0, 0x2 }, /* 1320 */
+ { 0x2e065804, 0x100 }, /* 1537 */
+ { 0x2e065814, 0x50000 }, /* 1541 */
+ { 0x2e065818, 0x4000100 }, /* 1542 */
+ { 0x2e06581c, 0x55 }, /* 1543 */
+ { 0x2e06582c, 0xf0001 }, /* 1547 */
+ { 0x2e065830, 0x280040 }, /* 1548 */
+ { 0x2e065834, 0x5002 }, /* 1549 */
+ { 0x2e065838, 0x10101 }, /* 1550 */
+ { 0x2e065840, 0x90e0000 }, /* 1552 */
+ { 0x2e065844, 0x101010f }, /* 1553 */
+ { 0x2e065848, 0x10f0004 }, /* 1554 */
+ { 0x2e065854, 0x64 }, /* 1557 */
+ { 0x2e06585c, 0x1000000 }, /* 1559 */
+ { 0x2e065860, 0x8040201 }, /* 1560 */
+ { 0x2e065864, 0x2010201 }, /* 1561 */
+ { 0x2e065868, 0xf0f0f }, /* 1562 */
+ { 0x2e06586c, 0x241342 }, /* 1563 */
+ { 0x2e065874, 0x1020000 }, /* 1565 */
+ { 0x2e065878, 0x10701 }, /* 1566 */
+ { 0x2e06587c, 0x54 }, /* 1567 */
+ { 0x2e065880, 0x4102000 }, /* 1568 */
+ { 0x2e065884, 0x24410 }, /* 1569 */
+ { 0x2e065888, 0x4410 }, /* 1570 */
+ { 0x2e06588c, 0x4410 }, /* 1571 */
+ { 0x2e065890, 0x4410 }, /* 1572 */
+ { 0x2e065894, 0x4410 }, /* 1573 */
+ { 0x2e065898, 0x4410 }, /* 1574 */
+ { 0x2e06589c, 0x4410 }, /* 1575 */
+ { 0x2e0658a0, 0x4410 }, /* 1576 */
+ { 0x2e0658a4, 0x4410 }, /* 1577 */
+ { 0x2e0658b0, 0x60000 }, /* 1580 */
+ { 0x2e0658b8, 0x64 }, /* 1582 */
+ { 0x2e0658bc, 0x10000 }, /* 1583 */
+ { 0x2e0658c0, 0x8 }, /* 1584 */
+ { 0x2e0658d8, 0x3000000 }, /* 1590 */
+ { 0x2e0658e8, 0x4102006 }, /* 1594 */
+ { 0x2e0658ec, 0x41020 }, /* 1595 */
+ { 0x2e0658f0, 0x1c98c98 }, /* 1596 */
+ { 0x2e0658f4, 0x3f400000 }, /* 1597 */
+ { 0x2e0658f8, 0x3f3f1f3f }, /* 1598 */
+ { 0x2e0658fc, 0x1f }, /* 1599 */
+ { 0x2e06590c, 0x1 }, /* 1603 */
+ { 0x2e06591c, 0x1 }, /* 1607 */
+ { 0x2e065920, 0x76543210 }, /* 1608 */
+ { 0x2e065924, 0x10198 }, /* 1609 */
+ { 0x2e065934, 0x40700 }, /* 1613 */
+ { 0x2e06594c, 0x2 }, /* 1619 */
+ { 0x2e065958, 0xf3c3 }, /* 1622 */
+ { 0x2e065964, 0x11742 }, /* 1625 */
+ { 0x2e065968, 0x3020600 }, /* 1626 */
+ { 0x2e06596c, 0x30000 }, /* 1627 */
+ { 0x2e065970, 0x3000300 }, /* 1628 */
+ { 0x2e065974, 0x3000300 }, /* 1629 */
+ { 0x2e065978, 0x3000300 }, /* 1630 */
+ { 0x2e06597c, 0x3000300 }, /* 1631 */
+ { 0x2e065980, 0x300 }, /* 1632 */
+ { 0x2e065984, 0x300 }, /* 1633 */
+ { 0x2e065988, 0x300 }, /* 1634 */
+ { 0x2e06598c, 0x337cc }, /* 1635 */
+ { 0x2e065990, 0x8 }, /* 1636 */
+ { 0x2e065994, 0x1b7 }, /* 1637 */
+ { 0x2e06599c, 0x1b7 }, /* 1639 */
+ { 0x2e0659a4, 0x1b700 }, /* 1641 */
+ { 0x2e0659a8, 0x1980000 }, /* 1642 */
+ { 0x2e0659ac, 0x1b7cc }, /* 1643 */
+ { 0x2e0659b4, 0x1b700 }, /* 1645 */
+ { 0x2e0659b8, 0x1980000 }, /* 1646 */
+ { 0x2e0659bc, 0x1b700 }, /* 1647 */
+ { 0x2e0659c0, 0x1980000 }, /* 1648 */
+ { 0x2e0659c4, 0x1b700 }, /* 1649 */
+ { 0x2e0659c8, 0x1980000 }, /* 1650 */
+ { 0x2e0659cc, 0x1b700 }, /* 1651 */
+ { 0x2e0659d0, 0x1980000 }, /* 1652 */
+ { 0x2e0659d4, 0x20040003 }, /* 1653 */
+};
+
+/** PHY_F2 settings **/
+struct dram_cfg_param ddr_phy_f2_cfg[] = {
+ { 0x2e064168, 0x3020000 }, /* 90 */
+ { 0x2e064170, 0xc043e42 }, /* 92 */
+ { 0x2e064174, 0xf0c1701 }, /* 93 */
+ { 0x2e064180, 0x187 }, /* 96 */
+ { 0x2e064184, 0x3200203 }, /* 97 */
+ { 0x2e064190, 0x3070307 }, /* 100 */
+ { 0x2e064194, 0x3070307 }, /* 101 */
+ { 0x2e064198, 0x3070307 }, /* 102 */
+ { 0x2e06419c, 0x3070307 }, /* 103 */
+ { 0x2e0641a0, 0x307 }, /* 104 */
+ { 0x2e0641c8, 0x1bd0080 }, /* 114 */
+ { 0x2e064568, 0x3020000 }, /* 346 */
+ { 0x2e064570, 0xc043e42 }, /* 348 */
+ { 0x2e064574, 0xf0c1701 }, /* 349 */
+ { 0x2e064580, 0x187 }, /* 352 */
+ { 0x2e064584, 0x3200203 }, /* 353 */
+ { 0x2e064590, 0x3070307 }, /* 356 */
+ { 0x2e064594, 0x3070307 }, /* 357 */
+ { 0x2e064598, 0x3070307 }, /* 358 */
+ { 0x2e06459c, 0x3070307 }, /* 359 */
+ { 0x2e0645a0, 0x307 }, /* 360 */
+ { 0x2e0645c8, 0x1bd0080 }, /* 370 */
+ { 0x2e064968, 0x3020000 }, /* 602 */
+ { 0x2e064970, 0xc043e42 }, /* 604 */
+ { 0x2e064974, 0xf0c1701 }, /* 605 */
+ { 0x2e064980, 0x187 }, /* 608 */
+ { 0x2e064984, 0x3200203 }, /* 609 */
+ { 0x2e064990, 0x3070307 }, /* 612 */
+ { 0x2e064994, 0x3070307 }, /* 613 */
+ { 0x2e064998, 0x3070307 }, /* 614 */
+ { 0x2e06499c, 0x3070307 }, /* 615 */
+ { 0x2e0649a0, 0x307 }, /* 616 */
+ { 0x2e0649c8, 0x1bd0080 }, /* 626 */
+ { 0x2e064d68, 0x3020000 }, /* 858 */
+ { 0x2e064d70, 0xc043e42 }, /* 860 */
+ { 0x2e064d74, 0xf0c1701 }, /* 861 */
+ { 0x2e064d80, 0x187 }, /* 864 */
+ { 0x2e064d84, 0x3200203 }, /* 865 */
+ { 0x2e064d90, 0x3070307 }, /* 868 */
+ { 0x2e064d94, 0x3070307 }, /* 869 */
+ { 0x2e064d98, 0x3070307 }, /* 870 */
+ { 0x2e064d9c, 0x3070307 }, /* 871 */
+ { 0x2e064da0, 0x307 }, /* 872 */
+ { 0x2e064dc8, 0x1bd0080 }, /* 882 */
+ { 0x2e06509c, 0x33e }, /* 1063 */
+ { 0x2e06549c, 0x33e }, /* 1319 */
+ { 0x2e065878, 0x10703 }, /* 1566 */
+ { 0x2e065964, 0x1342 }, /* 1625 */
+};
+
+/* ddr timing config params */
+struct dram_timing_info2 dram_timing = {
+ .ctl_cfg = ddr_ctl_cfg,
+ .ctl_cfg_num = ARRAY_SIZE(ddr_ctl_cfg),
+ .pi_cfg = ddr_pi_cfg,
+ .pi_cfg_num = ARRAY_SIZE(ddr_pi_cfg),
+ .phy_f1_cfg = ddr_phy_f1_cfg,
+ .phy_f1_cfg_num = ARRAY_SIZE(ddr_phy_f1_cfg),
+ .phy_f2_cfg = ddr_phy_f2_cfg,
+ .phy_f2_cfg_num = ARRAY_SIZE(ddr_phy_f2_cfg),
+ .fsp_table = { 96, 192, 1056 },
+};
diff --git a/board/freescale/imx8ulp_evk/lpddr4_timing_266.c b/board/freescale/imx8ulp_evk/lpddr4_timing_266.c
new file mode 100644
index 00000000000..79457601461
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/lpddr4_timing_266.c
@@ -0,0 +1,1109 @@
+// SPDX-License-Identifier: GPL-2.0+ OR MIT
+/*
+ * Copyright 2021 NXP
+ *
+ * Generated code from MX8ULP_DDR_tool
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+/** CTL settings **/
+struct dram_cfg_param ddr_ctl_cfg[] = {
+ { 0x2e060000, 0xb00 }, /* 0 */
+ { 0x2e060028, 0x258100 }, /* 10 */
+ { 0x2e06002c, 0x17702 }, /* 11 */
+ { 0x2e060030, 0x5 }, /* 12 */
+ { 0x2e060034, 0x61 }, /* 13 */
+ { 0x2e060038, 0xce3f }, /* 14 */
+ { 0x2e06003c, 0x80e70 }, /* 15 */
+ { 0x2e060040, 0x5 }, /* 16 */
+ { 0x2e060044, 0x210 }, /* 17 */
+ { 0x2e060048, 0x19c7d }, /* 18 */
+ { 0x2e06004c, 0x101cdf }, /* 19 */
+ { 0x2e060050, 0x5 }, /* 20 */
+ { 0x2e060054, 0x420 }, /* 21 */
+ { 0x2e060058, 0x1010000 }, /* 22 */
+ { 0x2e06005c, 0x1011001 }, /* 23 */
+ { 0x2e060060, 0x10000 }, /* 24 */
+ { 0x2e060064, 0x102 }, /* 25 */
+ { 0x2e060068, 0xa }, /* 26 */
+ { 0x2e06006c, 0x19 }, /* 27 */
+ { 0x2e060078, 0x2020200 }, /* 30 */
+ { 0x2e06007c, 0x160b }, /* 31 */
+ { 0x2e060090, 0x10 }, /* 36 */
+ { 0x2e0600a4, 0x40c040c }, /* 41 */
+ { 0x2e0600a8, 0x8040614 }, /* 42 */
+ { 0x2e0600ac, 0x604 }, /* 43 */
+ { 0x2e0600b0, 0x3090003 }, /* 44 */
+ { 0x2e0600b4, 0x40002 }, /* 45 */
+ { 0x2e0600b8, 0xc0011 }, /* 46 */
+ { 0x2e0600bc, 0xb0509 }, /* 47 */
+ { 0x2e0600c0, 0x2106 }, /* 48 */
+ { 0x2e0600c4, 0xa090017 }, /* 49 */
+ { 0x2e0600c8, 0x8200016 }, /* 50 */
+ { 0x2e0600cc, 0xa0a }, /* 51 */
+ { 0x2e0600d0, 0x4000694 }, /* 52 */
+ { 0x2e0600d4, 0xa0a0804 }, /* 53 */
+ { 0x2e0600d8, 0x4002432 }, /* 54 */
+ { 0x2e0600dc, 0xa0a0804 }, /* 55 */
+ { 0x2e0600e0, 0x4004864 }, /* 56 */
+ { 0x2e0600e4, 0x2030404 }, /* 57 */
+ { 0x2e0600e8, 0x5040400 }, /* 58 */
+ { 0x2e0600ec, 0x80b0a06 }, /* 59 */
+ { 0x2e0600f0, 0x7010100 }, /* 60 */
+ { 0x2e0600f4, 0x4150b }, /* 61 */
+ { 0x2e0600fc, 0x1010000 }, /* 63 */
+ { 0x2e060100, 0x1000000 }, /* 64 */
+ { 0x2e060104, 0xe0403 }, /* 65 */
+ { 0x2e060108, 0xb3 }, /* 66 */
+ { 0x2e06010c, 0x4a }, /* 67 */
+ { 0x2e060110, 0x3fd }, /* 68 */
+ { 0x2e060114, 0x94 }, /* 69 */
+ { 0x2e060118, 0x803 }, /* 70 */
+ { 0x2e06011c, 0x5 }, /* 71 */
+ { 0x2e060120, 0x70000 }, /* 72 */
+ { 0x2e060124, 0x25000f }, /* 73 */
+ { 0x2e060128, 0x4a0078 }, /* 74 */
+ { 0x2e06012c, 0x4000f9 }, /* 75 */
+ { 0x2e060130, 0x120103 }, /* 76 */
+ { 0x2e060134, 0x50005 }, /* 77 */
+ { 0x2e060138, 0x8070005 }, /* 78 */
+ { 0x2e06013c, 0x505010d }, /* 79 */
+ { 0x2e060140, 0x101030a }, /* 80 */
+ { 0x2e060144, 0x30a0505 }, /* 81 */
+ { 0x2e060148, 0x5050101 }, /* 82 */
+ { 0x2e06014c, 0x1030a }, /* 83 */
+ { 0x2e060150, 0xe000e }, /* 84 */
+ { 0x2e060154, 0x4c004c }, /* 85 */
+ { 0x2e060158, 0x980098 }, /* 86 */
+ { 0x2e06015c, 0x3050505 }, /* 87 */
+ { 0x2e060160, 0x3010403 }, /* 88 */
+ { 0x2e060164, 0x4050505 }, /* 89 */
+ { 0x2e060168, 0x3010403 }, /* 90 */
+ { 0x2e06016c, 0x8050505 }, /* 91 */
+ { 0x2e060170, 0x3010403 }, /* 92 */
+ { 0x2e060174, 0x3010000 }, /* 93 */
+ { 0x2e060178, 0x10000 }, /* 94 */
+ { 0x2e060180, 0x1000000 }, /* 96 */
+ { 0x2e060184, 0x80104002 }, /* 97 */
+ { 0x2e060188, 0x40003 }, /* 98 */
+ { 0x2e06018c, 0x40005 }, /* 99 */
+ { 0x2e060190, 0x30000 }, /* 100 */
+ { 0x2e060194, 0x50004 }, /* 101 */
+ { 0x2e060198, 0x4 }, /* 102 */
+ { 0x2e06019c, 0x40003 }, /* 103 */
+ { 0x2e0601a0, 0x40005 }, /* 104 */
+ { 0x2e0601a8, 0x2cc0 }, /* 106 */
+ { 0x2e0601ac, 0x2cc0 }, /* 107 */
+ { 0x2e0601b0, 0x2cc0 }, /* 108 */
+ { 0x2e0601b4, 0x2cc0 }, /* 109 */
+ { 0x2e0601b8, 0x2cc0 }, /* 110 */
+ { 0x2e0601c0, 0x4e5 }, /* 112 */
+ { 0x2e0601c4, 0xff40 }, /* 113 */
+ { 0x2e0601c8, 0xff40 }, /* 114 */
+ { 0x2e0601cc, 0xff40 }, /* 115 */
+ { 0x2e0601d0, 0xff40 }, /* 116 */
+ { 0x2e0601d4, 0xff40 }, /* 117 */
+ { 0x2e0601dc, 0x1beb }, /* 119 */
+ { 0x2e0601e0, 0x200c0 }, /* 120 */
+ { 0x2e0601e4, 0x200c0 }, /* 121 */
+ { 0x2e0601e8, 0x200c0 }, /* 122 */
+ { 0x2e0601ec, 0x200c0 }, /* 123 */
+ { 0x2e0601f0, 0x200c0 }, /* 124 */
+ { 0x2e0601f8, 0x3815 }, /* 126 */
+ { 0x2e06021c, 0x5000000 }, /* 135 */
+ { 0x2e060220, 0x5030503 }, /* 136 */
+ { 0x2e060224, 0x3 }, /* 137 */
+ { 0x2e060228, 0x7010a09 }, /* 138 */
+ { 0x2e06022c, 0xe0a09 }, /* 139 */
+ { 0x2e060230, 0x10a0900 }, /* 140 */
+ { 0x2e060234, 0xe0a0907 }, /* 141 */
+ { 0x2e060238, 0xa090000 }, /* 142 */
+ { 0x2e06023c, 0xa090701 }, /* 143 */
+ { 0x2e060240, 0x101000e }, /* 144 */
+ { 0x2e060244, 0x40003 }, /* 145 */
+ { 0x2e060248, 0x7 }, /* 146 */
+ { 0x2e060264, 0x4040100 }, /* 153 */
+ { 0x2e060268, 0x1000000 }, /* 154 */
+ { 0x2e06026c, 0x100000c0 }, /* 155 */
+ { 0x2e060270, 0x100000c0 }, /* 156 */
+ { 0x2e060274, 0x100000c0 }, /* 157 */
+ { 0x2e06027c, 0x1600 }, /* 159 */
+ { 0x2e060284, 0x1 }, /* 161 */
+ { 0x2e060288, 0x2 }, /* 162 */
+ { 0x2e06028c, 0x100e }, /* 163 */
+ { 0x2e0602a4, 0xa0000 }, /* 169 */
+ { 0x2e0602a8, 0xd0005 }, /* 170 */
+ { 0x2e0602ac, 0x404 }, /* 171 */
+ { 0x2e0602b0, 0xd }, /* 172 */
+ { 0x2e0602b4, 0x1b0035 }, /* 173 */
+ { 0x2e0602b8, 0x4040042 }, /* 174 */
+ { 0x2e0602bc, 0x42 }, /* 175 */
+ { 0x2e0602c0, 0x35006a }, /* 176 */
+ { 0x2e0602c4, 0x4040084 }, /* 177 */
+ { 0x2e0602c8, 0x84 }, /* 178 */
+ { 0x2e0602d8, 0x40004 }, /* 182 */
+ { 0x2e0602dc, 0x30000914 }, /* 183 */
+ { 0x2e0602e0, 0x3030 }, /* 184 */
+ { 0x2e0602e4, 0x44440000 }, /* 185 */
+ { 0x2e0602e8, 0x19191944 }, /* 186 */
+ { 0x2e0602ec, 0x19191908 }, /* 187 */
+ { 0x2e0602f0, 0x4000000 }, /* 188 */
+ { 0x2e0602f4, 0x40404 }, /* 189 */
+ { 0x2e0602f8, 0x9140004 }, /* 190 */
+ { 0x2e0602fc, 0x30303000 }, /* 191 */
+ { 0x2e060304, 0x19444444 }, /* 193 */
+ { 0x2e060308, 0x19081919 }, /* 194 */
+ { 0x2e06030c, 0x1919 }, /* 195 */
+ { 0x2e060310, 0x4040400 }, /* 196 */
+ { 0x2e060314, 0x1010120 }, /* 197 */
+ { 0x2e060318, 0x1000100 }, /* 198 */
+ { 0x2e06031c, 0x1 }, /* 199 */
+ { 0x2e060324, 0x1000000 }, /* 201 */
+ { 0x2e060328, 0x1 }, /* 202 */
+ { 0x2e060354, 0x11000000 }, /* 213 */
+ { 0x2e060358, 0x40c1815 }, /* 214 */
+ { 0x2e060390, 0x30000 }, /* 228 */
+ { 0x2e060394, 0x1000200 }, /* 229 */
+ { 0x2e060398, 0x310040 }, /* 230 */
+ { 0x2e06039c, 0x20002 }, /* 231 */
+ { 0x2e0603a0, 0x400100 }, /* 232 */
+ { 0x2e0603a4, 0x80108 }, /* 233 */
+ { 0x2e0603a8, 0x1000200 }, /* 234 */
+ { 0x2e0603ac, 0x2100040 }, /* 235 */
+ { 0x2e0603b0, 0x10 }, /* 236 */
+ { 0x2e0603b4, 0xe0003 }, /* 237 */
+ { 0x2e0603b8, 0x100001b }, /* 238 */
+ { 0x2e0603d8, 0xffff0b00 }, /* 246 */
+ { 0x2e0603dc, 0x1010001 }, /* 247 */
+ { 0x2e0603e0, 0x1010101 }, /* 248 */
+ { 0x2e0603e4, 0x10b0101 }, /* 249 */
+ { 0x2e0603e8, 0x10000 }, /* 250 */
+ { 0x2e0603ec, 0x4010101 }, /* 251 */
+ { 0x2e0603f0, 0x1010000 }, /* 252 */
+ { 0x2e0603f4, 0x4 }, /* 253 */
+ { 0x2e0603fc, 0x3030101 }, /* 255 */
+ { 0x2e060400, 0x103 }, /* 256 */
+ { 0x2e0604a4, 0x2020101 }, /* 297 */
+ { 0x2e0604a8, 0x10100 }, /* 298 */
+ { 0x2e0604ac, 0x1000101 }, /* 299 */
+ { 0x2e0604b0, 0x1010101 }, /* 300 */
+ { 0x2e0604b4, 0x4030300 }, /* 301 */
+ { 0x2e0604b8, 0x8080505 }, /* 302 */
+ { 0x2e0604bc, 0x8020808 }, /* 303 */
+ { 0x2e0604c0, 0x8020e00 }, /* 304 */
+ { 0x2e0604c4, 0xa020e00 }, /* 305 */
+ { 0x2e0604c8, 0x8000f00 }, /* 306 */
+ { 0x2e0604cc, 0xa08 }, /* 307 */
+ { 0x2e0604d0, 0x1010101 }, /* 308 */
+ { 0x2e0604d4, 0x01000102 }, /* 309 */
+ { 0x2e0604d8, 0x00000101 }, /* 310 */
+ { 0x2e0604dc, 0x40400 }, /* 311 */
+ { 0x2e0604e0, 0x4040000 }, /* 312 */
+ { 0x2e0604e4, 0x4000000 }, /* 313 */
+ { 0x2e0604e8, 0x10004 }, /* 314 */
+ { 0x2e0604f0, 0xfffff }, /* 316 */
+ { 0x2e0604f8, 0xfffff }, /* 318 */
+ { 0x2e060500, 0xfffff }, /* 320 */
+ { 0x2e060508, 0xfffff }, /* 322 */
+ { 0x2e060510, 0xfffff }, /* 324 */
+ { 0x2e060518, 0xfffff }, /* 326 */
+ { 0x2e060520, 0xfffff }, /* 328 */
+ { 0x2e060528, 0xfffff }, /* 330 */
+ { 0x2e060530, 0xfffff }, /* 332 */
+ { 0x2e060538, 0xfffff }, /* 334 */
+ { 0x2e060540, 0xfffff }, /* 336 */
+ { 0x2e060548, 0xfffff }, /* 338 */
+ { 0x2e060550, 0xfffff }, /* 340 */
+ { 0x2e060558, 0xfffff }, /* 342 */
+ { 0x2e060560, 0xfffff }, /* 344 */
+ { 0x2e060568, 0xfffff }, /* 346 */
+ { 0x2e060570, 0xfffff }, /* 348 */
+ { 0x2e060578, 0xfffff }, /* 350 */
+ { 0x2e060580, 0xfffff }, /* 352 */
+ { 0x2e060588, 0xfffff }, /* 354 */
+ { 0x2e060590, 0xfffff }, /* 356 */
+ { 0x2e060598, 0xfffff }, /* 358 */
+ { 0x2e0605a0, 0xfffff }, /* 360 */
+ { 0x2e0605a8, 0xfffff }, /* 362 */
+ { 0x2e0605b0, 0xfffff }, /* 364 */
+ { 0x2e0605b8, 0xfffff }, /* 366 */
+ { 0x2e0605c0, 0xfffff }, /* 368 */
+ { 0x2e0605c8, 0xfffff }, /* 370 */
+ { 0x2e0605d0, 0xfffff }, /* 372 */
+ { 0x2e0605d8, 0xfffff }, /* 374 */
+ { 0x2e0605e0, 0xfffff }, /* 376 */
+ { 0x2e0605e8, 0xfffff }, /* 378 */
+ { 0x2e0605f0, 0xfffff }, /* 380 */
+ { 0x2e0605f8, 0xfffff }, /* 382 */
+ { 0x2e060600, 0xfffff }, /* 384 */
+ { 0x2e060608, 0xfffff }, /* 386 */
+ { 0x2e060610, 0xfffff }, /* 388 */
+ { 0x2e060618, 0xfffff }, /* 390 */
+ { 0x2e060620, 0xfffff }, /* 392 */
+ { 0x2e060628, 0xfffff }, /* 394 */
+ { 0x2e060630, 0xfffff }, /* 396 */
+ { 0x2e060638, 0xfffff }, /* 398 */
+ { 0x2e060640, 0xfffff }, /* 400 */
+ { 0x2e060648, 0xfffff }, /* 402 */
+ { 0x2e060650, 0xfffff }, /* 404 */
+ { 0x2e060658, 0xfffff }, /* 406 */
+ { 0x2e060660, 0xfffff }, /* 408 */
+ { 0x2e060668, 0xfffff }, /* 410 */
+ { 0x2e060670, 0xfffff }, /* 412 */
+ { 0x2e060678, 0xfffff }, /* 414 */
+ { 0x2e060680, 0xfffff }, /* 416 */
+ { 0x2e060688, 0xfffff }, /* 418 */
+ { 0x2e060690, 0xfffff }, /* 420 */
+ { 0x2e060698, 0xfffff }, /* 422 */
+ { 0x2e0606a0, 0xfffff }, /* 424 */
+ { 0x2e0606a8, 0xfffff }, /* 426 */
+ { 0x2e0606b0, 0xfffff }, /* 428 */
+ { 0x2e0606b8, 0xfffff }, /* 430 */
+ { 0x2e0606c0, 0xfffff }, /* 432 */
+ { 0x2e0606c8, 0xfffff }, /* 434 */
+ { 0x2e0606d0, 0xfffff }, /* 436 */
+ { 0x2e0606d8, 0xfffff }, /* 438 */
+ { 0x2e0606e0, 0xfffff }, /* 440 */
+ { 0x2e0606e8, 0x30fffff }, /* 442 */
+ { 0x2e0606ec, 0xffffffff }, /* 443 */
+ { 0x2e0606f0, 0x30f0f }, /* 444 */
+ { 0x2e0606f4, 0xffffffff }, /* 445 */
+ { 0x2e0606f8, 0x30f0f }, /* 446 */
+ { 0x2e0606fc, 0xffffffff }, /* 447 */
+ { 0x2e060700, 0x30f0f }, /* 448 */
+ { 0x2e060704, 0xffffffff }, /* 449 */
+ { 0x2e060708, 0x30f0f }, /* 450 */
+ { 0x2e06070c, 0xffffffff }, /* 451 */
+ { 0x2e060710, 0x30f0f }, /* 452 */
+ { 0x2e060714, 0xffffffff }, /* 453 */
+ { 0x2e060718, 0x30f0f }, /* 454 */
+ { 0x2e06071c, 0xffffffff }, /* 455 */
+ { 0x2e060720, 0x30f0f }, /* 456 */
+ { 0x2e060724, 0xffffffff }, /* 457 */
+ { 0x2e060728, 0x30f0f }, /* 458 */
+ { 0x2e06072c, 0xffffffff }, /* 459 */
+ { 0x2e060730, 0x30f0f }, /* 460 */
+ { 0x2e060734, 0xffffffff }, /* 461 */
+ { 0x2e060738, 0x30f0f }, /* 462 */
+ { 0x2e06073c, 0xffffffff }, /* 463 */
+ { 0x2e060740, 0x30f0f }, /* 464 */
+ { 0x2e060744, 0xffffffff }, /* 465 */
+ { 0x2e060748, 0x30f0f }, /* 466 */
+ { 0x2e06074c, 0xffffffff }, /* 467 */
+ { 0x2e060750, 0x30f0f }, /* 468 */
+ { 0x2e060754, 0xffffffff }, /* 469 */
+ { 0x2e060758, 0x30f0f }, /* 470 */
+ { 0x2e06075c, 0xffffffff }, /* 471 */
+ { 0x2e060760, 0x30f0f }, /* 472 */
+ { 0x2e060764, 0xffffffff }, /* 473 */
+ { 0x2e060768, 0x30f0f }, /* 474 */
+ { 0x2e06076c, 0xffffffff }, /* 475 */
+ { 0x2e060770, 0x30f0f }, /* 476 */
+ { 0x2e060774, 0xffffffff }, /* 477 */
+ { 0x2e060778, 0x30f0f }, /* 478 */
+ { 0x2e06077c, 0xffffffff }, /* 479 */
+ { 0x2e060780, 0x30f0f }, /* 480 */
+ { 0x2e060784, 0xffffffff }, /* 481 */
+ { 0x2e060788, 0x30f0f }, /* 482 */
+ { 0x2e06078c, 0xffffffff }, /* 483 */
+ { 0x2e060790, 0x30f0f }, /* 484 */
+ { 0x2e060794, 0xffffffff }, /* 485 */
+ { 0x2e060798, 0x30f0f }, /* 486 */
+ { 0x2e06079c, 0xffffffff }, /* 487 */
+ { 0x2e0607a0, 0x30f0f }, /* 488 */
+ { 0x2e0607a4, 0xffffffff }, /* 489 */
+ { 0x2e0607a8, 0x30f0f }, /* 490 */
+ { 0x2e0607ac, 0xffffffff }, /* 491 */
+ { 0x2e0607b0, 0x30f0f }, /* 492 */
+ { 0x2e0607b4, 0xffffffff }, /* 493 */
+ { 0x2e0607b8, 0x30f0f }, /* 494 */
+ { 0x2e0607bc, 0xffffffff }, /* 495 */
+ { 0x2e0607c0, 0x30f0f }, /* 496 */
+ { 0x2e0607c4, 0xffffffff }, /* 497 */
+ { 0x2e0607c8, 0x30f0f }, /* 498 */
+ { 0x2e0607cc, 0xffffffff }, /* 499 */
+ { 0x2e0607d0, 0x30f0f }, /* 500 */
+ { 0x2e0607d4, 0xffffffff }, /* 501 */
+ { 0x2e0607d8, 0x30f0f }, /* 502 */
+ { 0x2e0607dc, 0xffffffff }, /* 503 */
+ { 0x2e0607e0, 0x30f0f }, /* 504 */
+ { 0x2e0607e4, 0xffffffff }, /* 505 */
+ { 0x2e0607e8, 0x30f0f }, /* 506 */
+ { 0x2e0607ec, 0xffffffff }, /* 507 */
+ { 0x2e0607f0, 0x30f0f }, /* 508 */
+ { 0x2e0607f4, 0xffffffff }, /* 509 */
+ { 0x2e0607f8, 0x30f0f }, /* 510 */
+ { 0x2e0607fc, 0xffffffff }, /* 511 */
+ { 0x2e060800, 0x30f0f }, /* 512 */
+ { 0x2e060804, 0xffffffff }, /* 513 */
+ { 0x2e060808, 0x30f0f }, /* 514 */
+ { 0x2e06080c, 0xffffffff }, /* 515 */
+ { 0x2e060810, 0x30f0f }, /* 516 */
+ { 0x2e060814, 0xffffffff }, /* 517 */
+ { 0x2e060818, 0x30f0f }, /* 518 */
+ { 0x2e06081c, 0xffffffff }, /* 519 */
+ { 0x2e060820, 0x30f0f }, /* 520 */
+ { 0x2e060824, 0xffffffff }, /* 521 */
+ { 0x2e060828, 0x30f0f }, /* 522 */
+ { 0x2e06082c, 0xffffffff }, /* 523 */
+ { 0x2e060830, 0x30f0f }, /* 524 */
+ { 0x2e060834, 0xffffffff }, /* 525 */
+ { 0x2e060838, 0x30f0f }, /* 526 */
+ { 0x2e06083c, 0xffffffff }, /* 527 */
+ { 0x2e060840, 0x30f0f }, /* 528 */
+ { 0x2e060844, 0xffffffff }, /* 529 */
+ { 0x2e060848, 0x30f0f }, /* 530 */
+ { 0x2e06084c, 0xffffffff }, /* 531 */
+ { 0x2e060850, 0x30f0f }, /* 532 */
+ { 0x2e060854, 0xffffffff }, /* 533 */
+ { 0x2e060858, 0x30f0f }, /* 534 */
+ { 0x2e06085c, 0xffffffff }, /* 535 */
+ { 0x2e060860, 0x30f0f }, /* 536 */
+ { 0x2e060864, 0xffffffff }, /* 537 */
+ { 0x2e060868, 0x30f0f }, /* 538 */
+ { 0x2e06086c, 0xffffffff }, /* 539 */
+ { 0x2e060870, 0x30f0f }, /* 540 */
+ { 0x2e060874, 0xffffffff }, /* 541 */
+ { 0x2e060878, 0x30f0f }, /* 542 */
+ { 0x2e06087c, 0xffffffff }, /* 543 */
+ { 0x2e060880, 0x30f0f }, /* 544 */
+ { 0x2e060884, 0xffffffff }, /* 545 */
+ { 0x2e060888, 0x30f0f }, /* 546 */
+ { 0x2e06088c, 0xffffffff }, /* 547 */
+ { 0x2e060890, 0x30f0f }, /* 548 */
+ { 0x2e060894, 0xffffffff }, /* 549 */
+ { 0x2e060898, 0x30f0f }, /* 550 */
+ { 0x2e06089c, 0xffffffff }, /* 551 */
+ { 0x2e0608a0, 0x30f0f }, /* 552 */
+ { 0x2e0608a4, 0xffffffff }, /* 553 */
+ { 0x2e0608a8, 0x30f0f }, /* 554 */
+ { 0x2e0608ac, 0xffffffff }, /* 555 */
+ { 0x2e0608b0, 0x30f0f }, /* 556 */
+ { 0x2e0608b4, 0xffffffff }, /* 557 */
+ { 0x2e0608b8, 0x30f0f }, /* 558 */
+ { 0x2e0608bc, 0xffffffff }, /* 559 */
+ { 0x2e0608c0, 0x30f0f }, /* 560 */
+ { 0x2e0608c4, 0xffffffff }, /* 561 */
+ { 0x2e0608c8, 0x30f0f }, /* 562 */
+ { 0x2e0608cc, 0xffffffff }, /* 563 */
+ { 0x2e0608d0, 0x30f0f }, /* 564 */
+ { 0x2e0608d4, 0xffffffff }, /* 565 */
+ { 0x2e0608d8, 0x30f0f }, /* 566 */
+ { 0x2e0608dc, 0xffffffff }, /* 567 */
+ { 0x2e0608e0, 0x30f0f }, /* 568 */
+ { 0x2e0608e4, 0xffffffff }, /* 569 */
+ { 0x2e0608e8, 0x32070f0f }, /* 570 */
+ { 0x2e0608ec, 0x1320000 }, /* 571 */
+ { 0x2e0608f0, 0x13200 }, /* 572 */
+ { 0x2e0608f4, 0x132 }, /* 573 */
+ { 0x2e0608fc, 0x1d1b0000 }, /* 575 */
+ { 0x2e060900, 0x21 }, /* 576 */
+ { 0x2e060904, 0xa }, /* 577 */
+ { 0x2e060908, 0x166 }, /* 578 */
+ { 0x2e06090c, 0x200 }, /* 579 */
+ { 0x2e060910, 0x200 }, /* 580 */
+ { 0x2e060914, 0x200 }, /* 581 */
+ { 0x2e060918, 0x200 }, /* 582 */
+ { 0x2e06091c, 0x432 }, /* 583 */
+ { 0x2e060920, 0xdfc }, /* 584 */
+ { 0x2e060924, 0x204 }, /* 585 */
+ { 0x2e060928, 0x7fa }, /* 586 */
+ { 0x2e06092c, 0x200 }, /* 587 */
+ { 0x2e060930, 0x200 }, /* 588 */
+ { 0x2e060934, 0x200 }, /* 589 */
+ { 0x2e060938, 0x200 }, /* 590 */
+ { 0x2e06093c, 0x17ee }, /* 591 */
+ { 0x2e060940, 0x4fc4 }, /* 592 */
+ { 0x2e060944, 0x204 }, /* 593 */
+ { 0x2e060948, 0x1006 }, /* 594 */
+ { 0x2e06094c, 0x200 }, /* 595 */
+ { 0x2e060950, 0x200 }, /* 596 */
+ { 0x2e060954, 0x200 }, /* 597 */
+ { 0x2e060958, 0x200 }, /* 598 */
+ { 0x2e06095c, 0x3012 }, /* 599 */
+ { 0x2e060960, 0xa03c }, /* 600 */
+ { 0x2e060964, 0x2020406 }, /* 601 */
+ { 0x2e060968, 0x2030202 }, /* 602 */
+ { 0x2e06096c, 0x1000202 }, /* 603 */
+ { 0x2e060970, 0x3040100 }, /* 604 */
+ { 0x2e060974, 0x10105 }, /* 605 */
+ { 0x2e060978, 0x10101 }, /* 606 */
+ { 0x2e06097c, 0x10101 }, /* 607 */
+ { 0x2e060980, 0x10001 }, /* 608 */
+ { 0x2e060984, 0x101 }, /* 609 */
+ { 0x2e060988, 0x2000201 }, /* 610 */
+ { 0x2e06098c, 0x2010000 }, /* 611 */
+ { 0x2e060990, 0x6000200 }, /* 612 */
+ { 0x2e060994, 0x3000a06 }, /* 613 */
+ { 0x2e060998, 0x2000c06 }, /* 614 */
+};
+
+/** PI settings **/
+struct dram_cfg_param ddr_pi_cfg[] = {
+ { 0x2e062000, 0xb00 }, /* 0 */
+ { 0x2e062004, 0xbeedb66f }, /* 1 */
+ { 0x2e062008, 0xabef6bd }, /* 2 */
+ { 0x2e06200c, 0x1001387 }, /* 3 */
+ { 0x2e062010, 0x1 }, /* 4 */
+ { 0x2e062014, 0x10064 }, /* 5 */
+ { 0x2e06202c, 0x101 }, /* 11 */
+ { 0x2e062030, 0x3 }, /* 12 */
+ { 0x2e062034, 0x50001 }, /* 13 */
+ { 0x2e062038, 0x3030800 }, /* 14 */
+ { 0x2e06203c, 0x1 }, /* 15 */
+ { 0x2e062040, 0x5 }, /* 16 */
+ { 0x2e062064, 0x1000000 }, /* 25 */
+ { 0x2e062068, 0xa000001 }, /* 26 */
+ { 0x2e06206c, 0x28 }, /* 27 */
+ { 0x2e062070, 0x1 }, /* 28 */
+ { 0x2e062074, 0x320005 }, /* 29 */
+ { 0x2e062080, 0x10102 }, /* 32 */
+ { 0x2e062084, 0x1 }, /* 33 */
+ { 0x2e062088, 0xaa }, /* 34 */
+ { 0x2e06208c, 0x55 }, /* 35 */
+ { 0x2e062090, 0xb5 }, /* 36 */
+ { 0x2e062094, 0x4a }, /* 37 */
+ { 0x2e062098, 0x56 }, /* 38 */
+ { 0x2e06209c, 0xa9 }, /* 39 */
+ { 0x2e0620a0, 0xa9 }, /* 40 */
+ { 0x2e0620a4, 0xb5 }, /* 41 */
+ { 0x2e0620a8, 0x10000 }, /* 42 */
+ { 0x2e0620ac, 0x100 }, /* 43 */
+ { 0x2e0620b0, 0x5050000 }, /* 44 */
+ { 0x2e0620b4, 0x13 }, /* 45 */
+ { 0x2e0620b8, 0x7d0 }, /* 46 */
+ { 0x2e0620bc, 0x300 }, /* 47 */
+ { 0x2e0620c8, 0x1000000 }, /* 50 */
+ { 0x2e0620cc, 0x10101 }, /* 51 */
+ { 0x2e0620d8, 0x10003 }, /* 54 */
+ { 0x2e0620dc, 0x170500 }, /* 55 */
+ { 0x2e0620ec, 0xa140a01 }, /* 59 */
+ { 0x2e0620f0, 0x204010a }, /* 60 */
+ { 0x2e0620f4, 0x21010 }, /* 61 */
+ { 0x2e0620f8, 0x40401 }, /* 62 */
+ { 0x2e0620fc, 0x10e0005 }, /* 63 */
+ { 0x2e062100, 0x5000001 }, /* 64 */
+ { 0x2e062104, 0x204 }, /* 65 */
+ { 0x2e062108, 0x34 }, /* 66 */
+ { 0x2e062114, 0x1000000 }, /* 69 */
+ { 0x2e062118, 0x1000000 }, /* 70 */
+ { 0x2e06211c, 0x80200 }, /* 71 */
+ { 0x2e062120, 0x2000200 }, /* 72 */
+ { 0x2e062124, 0x1000100 }, /* 73 */
+ { 0x2e062128, 0x1000000 }, /* 74 */
+ { 0x2e06212c, 0x2000200 }, /* 75 */
+ { 0x2e062130, 0x200 }, /* 76 */
+ { 0x2e062164, 0x400 }, /* 89 */
+ { 0x2e062168, 0x2010000 }, /* 90 */
+ { 0x2e06216c, 0x80103 }, /* 91 */
+ { 0x2e062174, 0x10008 }, /* 93 */
+ { 0x2e06217c, 0xaa00 }, /* 95 */
+ { 0x2e062188, 0x10000 }, /* 98 */
+ { 0x2e0621ec, 0x8 }, /* 123 */
+ { 0x2e062218, 0xf0000 }, /* 134 */
+ { 0x2e06221c, 0xa }, /* 135 */
+ { 0x2e062220, 0x19 }, /* 136 */
+ { 0x2e062224, 0x100 }, /* 137 */
+ { 0x2e062228, 0x100 }, /* 138 */
+ { 0x2e062238, 0x1000000 }, /* 142 */
+ { 0x2e06223c, 0x10003 }, /* 143 */
+ { 0x2e062240, 0x2000101 }, /* 144 */
+ { 0x2e062244, 0x1030001 }, /* 145 */
+ { 0x2e062248, 0x10400 }, /* 146 */
+ { 0x2e06224c, 0x6000105 }, /* 147 */
+ { 0x2e062250, 0x1070001 }, /* 148 */
+ { 0x2e062260, 0x10001 }, /* 152 */
+ { 0x2e062274, 0x401 }, /* 157 */
+ { 0x2e06227c, 0x10000 }, /* 159 */
+ { 0x2e062284, 0x6010000 }, /* 161 */
+ { 0x2e062288, 0xb }, /* 162 */
+ { 0x2e06228c, 0x34 }, /* 163 */
+ { 0x2e062290, 0x36 }, /* 164 */
+ { 0x2e062294, 0x2003c }, /* 165 */
+ { 0x2e062298, 0x2000200 }, /* 166 */
+ { 0x2e06229c, 0xc040c04 }, /* 167 */
+ { 0x2e0622a0, 0xe1406 }, /* 168 */
+ { 0x2e0622a4, 0xb3 }, /* 169 */
+ { 0x2e0622a8, 0x4a }, /* 170 */
+ { 0x2e0622ac, 0x3fd }, /* 171 */
+ { 0x2e0622b0, 0x94 }, /* 172 */
+ { 0x2e0622b4, 0x4000803 }, /* 173 */
+ { 0x2e0622b8, 0x1010404 }, /* 174 */
+ { 0x2e0622bc, 0x1501 }, /* 175 */
+ { 0x2e0622c0, 0x1a0018 }, /* 176 */
+ { 0x2e0622c4, 0x1000100 }, /* 177 */
+ { 0x2e0622c8, 0x100 }, /* 178 */
+ { 0x2e0622d0, 0x5040303 }, /* 180 */
+ { 0x2e0622d4, 0x1010805 }, /* 181 */
+ { 0x2e0622d8, 0x1010101 }, /* 182 */
+ { 0x2e0622e8, 0x2060404 }, /* 186 */
+ { 0x2e0622ec, 0x2020402 }, /* 187 */
+ { 0x2e0622f0, 0x3102 }, /* 188 */
+ { 0x2e0622f4, 0x340009 }, /* 189 */
+ { 0x2e0622f8, 0x36000c }, /* 190 */
+ { 0x2e0622fc, 0x101000e }, /* 191 */
+ { 0x2e062300, 0xd0101 }, /* 192 */
+ { 0x2e062304, 0x1004201 }, /* 193 */
+ { 0x2e062308, 0x1000084 }, /* 194 */
+ { 0x2e06230c, 0xe000e }, /* 195 */
+ { 0x2e062310, 0x430100 }, /* 196 */
+ { 0x2e062314, 0x1000043 }, /* 197 */
+ { 0x2e062318, 0x850085 }, /* 198 */
+ { 0x2e06231c, 0x220f220f }, /* 199 */
+ { 0x2e062320, 0x101220f }, /* 200 */
+ { 0x2e062324, 0xa070601 }, /* 201 */
+ { 0x2e062328, 0xa07060d }, /* 202 */
+ { 0x2e06232c, 0xa07070d }, /* 203 */
+ { 0x2e062330, 0xc00d }, /* 204 */
+ { 0x2e062334, 0xc01000 }, /* 205 */
+ { 0x2e062338, 0xc01000 }, /* 206 */
+ { 0x2e06233c, 0x21000 }, /* 207 */
+ { 0x2e062340, 0x11000d }, /* 208 */
+ { 0x2e062344, 0x140042 }, /* 209 */
+ { 0x2e062348, 0x190084 }, /* 210 */
+ { 0x2e06234c, 0x220f0056 }, /* 211 */
+ { 0x2e062350, 0x101 }, /* 212 */
+ { 0x2e062354, 0x560019 }, /* 213 */
+ { 0x2e062358, 0x101220f }, /* 214 */
+ { 0x2e06235c, 0x1b00 }, /* 215 */
+ { 0x2e062360, 0x220f0056 }, /* 216 */
+ { 0x2e062364, 0x8000101 }, /* 217 */
+ { 0x2e062368, 0x4090403 }, /* 218 */
+ { 0x2e06236c, 0x5eb }, /* 219 */
+ { 0x2e062370, 0x20010003 }, /* 220 */
+ { 0x2e062374, 0x80a0a03 }, /* 221 */
+ { 0x2e062378, 0x6090506 }, /* 222 */
+ { 0x2e06237c, 0x2093 }, /* 223 */
+ { 0x2e062380, 0x2001000c }, /* 224 */
+ { 0x2e062384, 0x80a0a04 }, /* 225 */
+ { 0x2e062388, 0xb090a0c }, /* 226 */
+ { 0x2e06238c, 0x4126 }, /* 227 */
+ { 0x2e062390, 0x20020017 }, /* 228 */
+ { 0x2e062394, 0xa0a08 }, /* 229 */
+ { 0x2e062398, 0x166 }, /* 230 */
+ { 0x2e06239c, 0xdfc }, /* 231 */
+ { 0x2e0623a0, 0x7fa }, /* 232 */
+ { 0x2e0623a4, 0x4fc4 }, /* 233 */
+ { 0x2e0623a8, 0x1006 }, /* 234 */
+ { 0x2e0623ac, 0xa03c }, /* 235 */
+ { 0x2e0623b0, 0x4c000e }, /* 236 */
+ { 0x2e0623b4, 0x3030098 }, /* 237 */
+ { 0x2e0623b8, 0x258103 }, /* 238 */
+ { 0x2e0623bc, 0x17702 }, /* 239 */
+ { 0x2e0623c0, 0x5 }, /* 240 */
+ { 0x2e0623c4, 0x61 }, /* 241 */
+ { 0x2e0623c8, 0xe }, /* 242 */
+ { 0x2e0623cc, 0xce3f }, /* 243 */
+ { 0x2e0623d0, 0x80e70 }, /* 244 */
+ { 0x2e0623d4, 0x5 }, /* 245 */
+ { 0x2e0623d8, 0x210 }, /* 246 */
+ { 0x2e0623dc, 0x4c }, /* 247 */
+ { 0x2e0623e0, 0x19c7d }, /* 248 */
+ { 0x2e0623e4, 0x101cdf }, /* 249 */
+ { 0x2e0623e8, 0x5 }, /* 250 */
+ { 0x2e0623ec, 0x420 }, /* 251 */
+ { 0x2e0623f0, 0x1000098 }, /* 252 */
+ { 0x2e0623f4, 0x310040 }, /* 253 */
+ { 0x2e0623f8, 0x10002 }, /* 254 */
+ { 0x2e0623fc, 0x1080040 }, /* 255 */
+ { 0x2e062400, 0x10008 }, /* 256 */
+ { 0x2e062404, 0x2100040 }, /* 257 */
+ { 0x2e062408, 0x310 }, /* 258 */
+ { 0x2e06240c, 0x1b000e }, /* 259 */
+ { 0x2e062410, 0x1010101 }, /* 260 */
+ { 0x2e062414, 0x2020101 }, /* 261 */
+ { 0x2e062418, 0x8080404 }, /* 262 */
+ { 0x2e06241c, 0x5508 }, /* 263 */
+ { 0x2e062420, 0x83c5a00 }, /* 264 */
+ { 0x2e062424, 0x55 }, /* 265 */
+ { 0x2e062428, 0x55083c5a }, /* 266 */
+ { 0x2e06242c, 0x5a000000 }, /* 267 */
+ { 0x2e062430, 0x55083c }, /* 268 */
+ { 0x2e062434, 0x3c5a0000 }, /* 269 */
+ { 0x2e062438, 0xf0e0d0c }, /* 270 */
+ { 0x2e06243c, 0xb0a0908 }, /* 271 */
+ { 0x2e062440, 0x7060504 }, /* 272 */
+ { 0x2e062444, 0x3020100 }, /* 273 */
+ { 0x2e06244c, 0x2020101 }, /* 275 */
+ { 0x2e062450, 0x8080404 }, /* 276 */
+ { 0x2e062454, 0x44300004 }, /* 277 */
+ { 0x2e062458, 0x4041919 }, /* 278 */
+ { 0x2e06245c, 0x19443000 }, /* 279 */
+ { 0x2e062460, 0x9140419 }, /* 280 */
+ { 0x2e062464, 0x19194430 }, /* 281 */
+ { 0x2e062468, 0x30000404 }, /* 282 */
+ { 0x2e06246c, 0x4191944 }, /* 283 */
+ { 0x2e062470, 0x44300004 }, /* 284 */
+ { 0x2e062474, 0x14041919 }, /* 285 */
+ { 0x2e062478, 0x19443009 }, /* 286 */
+ { 0x2e06247c, 0x40419 }, /* 287 */
+ { 0x2e062480, 0x19194430 }, /* 288 */
+ { 0x2e062484, 0x30000404 }, /* 289 */
+ { 0x2e062488, 0x4191944 }, /* 290 */
+ { 0x2e06248c, 0x44300914 }, /* 291 */
+ { 0x2e062490, 0x44041919 }, /* 292 */
+ { 0x2e062494, 0x19443000 }, /* 293 */
+ { 0x2e062498, 0x40419 }, /* 294 */
+ { 0x2e06249c, 0x19194430 }, /* 295 */
+ { 0x2e0624a0, 0x30091404 }, /* 296 */
+ { 0x2e0624a4, 0x4191944 }, /* 297 */
+};
+
+/** PHY_F1 settings **/
+struct dram_cfg_param ddr_phy_f1_cfg[] = {
+ { 0x2e064000, 0x4f0 }, /* 0 */
+ { 0x2e064008, 0x1030200 }, /* 2 */
+ { 0x2e064014, 0x3000000 }, /* 5 */
+ { 0x2e064018, 0x1000001 }, /* 6 */
+ { 0x2e06401c, 0x3000400 }, /* 7 */
+ { 0x2e064020, 0x1 }, /* 8 */
+ { 0x2e064024, 0x1 }, /* 9 */
+ { 0x2e064030, 0x10000 }, /* 12 */
+ { 0x2e064038, 0xc00004 }, /* 14 */
+ { 0x2e06403c, 0xcc0008 }, /* 15 */
+ { 0x2e064040, 0x660601 }, /* 16 */
+ { 0x2e064044, 0x3 }, /* 17 */
+ { 0x2e06404c, 0x1 }, /* 19 */
+ { 0x2e064050, 0xaaaa }, /* 20 */
+ { 0x2e064054, 0x5555 }, /* 21 */
+ { 0x2e064058, 0xb5b5 }, /* 22 */
+ { 0x2e06405c, 0x4a4a }, /* 23 */
+ { 0x2e064060, 0x5656 }, /* 24 */
+ { 0x2e064064, 0xa9a9 }, /* 25 */
+ { 0x2e064068, 0xb7b7 }, /* 26 */
+ { 0x2e06406c, 0x4848 }, /* 27 */
+ { 0x2e064078, 0x8000000 }, /* 30 */
+ { 0x2e06407c, 0x4010008 }, /* 31 */
+ { 0x2e064080, 0x408 }, /* 32 */
+ { 0x2e064084, 0x3102000 }, /* 33 */
+ { 0x2e064088, 0xc0020 }, /* 34 */
+ { 0x2e06408c, 0x10000 }, /* 35 */
+ { 0x2e064090, 0x55555555 }, /* 36 */
+ { 0x2e064094, 0xaaaaaaaa }, /* 37 */
+ { 0x2e064098, 0x55555555 }, /* 38 */
+ { 0x2e06409c, 0xaaaaaaaa }, /* 39 */
+ { 0x2e0640a0, 0x5555 }, /* 40 */
+ { 0x2e0640a4, 0x1000100 }, /* 41 */
+ { 0x2e0640a8, 0x800180 }, /* 42 */
+ { 0x2e0640ac, 0x1 }, /* 43 */
+ { 0x2e064100, 0x4 }, /* 64 */
+ { 0x2e06411c, 0x41f07ff }, /* 71 */
+ { 0x2e064120, 0x1 }, /* 72 */
+ { 0x2e064124, 0x1cc0800 }, /* 73 */
+ { 0x2e064128, 0x3003cc08 }, /* 74 */
+ { 0x2e06412c, 0x2000014e }, /* 75 */
+ { 0x2e064130, 0x7ff0200 }, /* 76 */
+ { 0x2e064134, 0x301 }, /* 77 */
+ { 0x2e064140, 0x30000 }, /* 80 */
+ { 0x2e064154, 0x2000000 }, /* 85 */
+ { 0x2e064158, 0x51515042 }, /* 86 */
+ { 0x2e06415c, 0x31c06000 }, /* 87 */
+ { 0x2e064160, 0x6bf000a }, /* 88 */
+ { 0x2e064164, 0xc0c000 }, /* 89 */
+ { 0x2e064168, 0x1000000 }, /* 90 */
+ { 0x2e06416c, 0x10001000 }, /* 91 */
+ { 0x2e064170, 0xc043242 }, /* 92 */
+ { 0x2e064174, 0xf0c1201 }, /* 93 */
+ { 0x2e064178, 0x1000140 }, /* 94 */
+ { 0x2e06417c, 0xc000120 }, /* 95 */
+ { 0x2e064180, 0x143 }, /* 96 */
+ { 0x2e064184, 0x1000203 }, /* 97 */
+ { 0x2e064188, 0x56417032 }, /* 98 */
+ { 0x2e06418c, 0x8 }, /* 99 */
+ { 0x2e064190, 0x2c302c3 }, /* 100 */
+ { 0x2e064194, 0x2c302c3 }, /* 101 */
+ { 0x2e064198, 0x2c302c3 }, /* 102 */
+ { 0x2e06419c, 0x2c302c3 }, /* 103 */
+ { 0x2e0641a0, 0x2c3 }, /* 104 */
+ { 0x2e0641a4, 0x8000 }, /* 105 */
+ { 0x2e0641a8, 0x800080 }, /* 106 */
+ { 0x2e0641ac, 0x800080 }, /* 107 */
+ { 0x2e0641b0, 0x800080 }, /* 108 */
+ { 0x2e0641b4, 0x800080 }, /* 109 */
+ { 0x2e0641b8, 0x800080 }, /* 110 */
+ { 0x2e0641bc, 0x800080 }, /* 111 */
+ { 0x2e0641c0, 0x800080 }, /* 112 */
+ { 0x2e0641c4, 0x800080 }, /* 113 */
+ { 0x2e0641c8, 0x6b0080 }, /* 114 */
+ { 0x2e0641cc, 0x1a00001 }, /* 115 */
+ { 0x2e0641d4, 0x10000 }, /* 117 */
+ { 0x2e0641d8, 0x80200 }, /* 118 */
+ { 0x2e064400, 0x4f0 }, /* 256 */
+ { 0x2e064408, 0x1030200 }, /* 258 */
+ { 0x2e064414, 0x3000000 }, /* 261 */
+ { 0x2e064418, 0x1000001 }, /* 262 */
+ { 0x2e06441c, 0x3000400 }, /* 263 */
+ { 0x2e064420, 0x1 }, /* 264 */
+ { 0x2e064424, 0x1 }, /* 265 */
+ { 0x2e064430, 0x10000 }, /* 268 */
+ { 0x2e064438, 0xc00004 }, /* 270 */
+ { 0x2e06443c, 0xcc0008 }, /* 271 */
+ { 0x2e064440, 0x660601 }, /* 272 */
+ { 0x2e064444, 0x3 }, /* 273 */
+ { 0x2e06444c, 0x1 }, /* 275 */
+ { 0x2e064450, 0xaaaa }, /* 276 */
+ { 0x2e064454, 0x5555 }, /* 277 */
+ { 0x2e064458, 0xb5b5 }, /* 278 */
+ { 0x2e06445c, 0x4a4a }, /* 279 */
+ { 0x2e064460, 0x5656 }, /* 280 */
+ { 0x2e064464, 0xa9a9 }, /* 281 */
+ { 0x2e064468, 0xb7b7 }, /* 282 */
+ { 0x2e06446c, 0x4848 }, /* 283 */
+ { 0x2e064478, 0x8000000 }, /* 286 */
+ { 0x2e06447c, 0x4010008 }, /* 287 */
+ { 0x2e064480, 0x408 }, /* 288 */
+ { 0x2e064484, 0x3102000 }, /* 289 */
+ { 0x2e064488, 0xc0020 }, /* 290 */
+ { 0x2e06448c, 0x10000 }, /* 291 */
+ { 0x2e064490, 0x55555555 }, /* 292 */
+ { 0x2e064494, 0xaaaaaaaa }, /* 293 */
+ { 0x2e064498, 0x55555555 }, /* 294 */
+ { 0x2e06449c, 0xaaaaaaaa }, /* 295 */
+ { 0x2e0644a0, 0x5555 }, /* 296 */
+ { 0x2e0644a4, 0x1000100 }, /* 297 */
+ { 0x2e0644a8, 0x800180 }, /* 298 */
+ { 0x2e064500, 0x4 }, /* 320 */
+ { 0x2e06451c, 0x41f07ff }, /* 327 */
+ { 0x2e064520, 0x1 }, /* 328 */
+ { 0x2e064524, 0x1cc0800 }, /* 329 */
+ { 0x2e064528, 0x3003cc08 }, /* 330 */
+ { 0x2e06452c, 0x2000014e }, /* 331 */
+ { 0x2e064530, 0x7ff0200 }, /* 332 */
+ { 0x2e064534, 0x301 }, /* 333 */
+ { 0x2e064540, 0x30000 }, /* 336 */
+ { 0x2e064554, 0x2000000 }, /* 341 */
+ { 0x2e064558, 0x51515042 }, /* 342 */
+ { 0x2e06455c, 0x31c06000 }, /* 343 */
+ { 0x2e064560, 0x6bf000a }, /* 344 */
+ { 0x2e064564, 0xc0c000 }, /* 345 */
+ { 0x2e064568, 0x1000000 }, /* 346 */
+ { 0x2e06456c, 0x10001000 }, /* 347 */
+ { 0x2e064570, 0xc043242 }, /* 348 */
+ { 0x2e064574, 0xf0c1201 }, /* 349 */
+ { 0x2e064578, 0x1000140 }, /* 350 */
+ { 0x2e06457c, 0xc000120 }, /* 351 */
+ { 0x2e064580, 0x143 }, /* 352 */
+ { 0x2e064584, 0x1000203 }, /* 353 */
+ { 0x2e064588, 0x30217465 }, /* 354 */
+ { 0x2e06458c, 0x8 }, /* 355 */
+ { 0x2e064590, 0x2c302c3 }, /* 356 */
+ { 0x2e064594, 0x2c302c3 }, /* 357 */
+ { 0x2e064598, 0x2c302c3 }, /* 358 */
+ { 0x2e06459c, 0x2c302c3 }, /* 359 */
+ { 0x2e0645a0, 0x2c3 }, /* 360 */
+ { 0x2e0645a4, 0x8000 }, /* 361 */
+ { 0x2e0645a8, 0x800080 }, /* 362 */
+ { 0x2e0645ac, 0x800080 }, /* 363 */
+ { 0x2e0645b0, 0x800080 }, /* 364 */
+ { 0x2e0645b4, 0x800080 }, /* 365 */
+ { 0x2e0645b8, 0x800080 }, /* 366 */
+ { 0x2e0645bc, 0x800080 }, /* 367 */
+ { 0x2e0645c0, 0x800080 }, /* 368 */
+ { 0x2e0645c4, 0x800080 }, /* 369 */
+ { 0x2e0645c8, 0x6b0080 }, /* 370 */
+ { 0x2e0645cc, 0x1a00001 }, /* 371 */
+ { 0x2e0645d4, 0x10000 }, /* 373 */
+ { 0x2e0645d8, 0x80200 }, /* 374 */
+ { 0x2e064800, 0x4f0 }, /* 512 */
+ { 0x2e064808, 0x1030200 }, /* 514 */
+ { 0x2e064814, 0x3000000 }, /* 517 */
+ { 0x2e064818, 0x1000001 }, /* 518 */
+ { 0x2e06481c, 0x3000400 }, /* 519 */
+ { 0x2e064820, 0x1 }, /* 520 */
+ { 0x2e064824, 0x1 }, /* 521 */
+ { 0x2e064830, 0x10000 }, /* 524 */
+ { 0x2e064838, 0xc00004 }, /* 526 */
+ { 0x2e06483c, 0xcc0008 }, /* 527 */
+ { 0x2e064840, 0x660601 }, /* 528 */
+ { 0x2e064844, 0x3 }, /* 529 */
+ { 0x2e06484c, 0x1 }, /* 531 */
+ { 0x2e064850, 0xaaaa }, /* 532 */
+ { 0x2e064854, 0x5555 }, /* 533 */
+ { 0x2e064858, 0xb5b5 }, /* 534 */
+ { 0x2e06485c, 0x4a4a }, /* 535 */
+ { 0x2e064860, 0x5656 }, /* 536 */
+ { 0x2e064864, 0xa9a9 }, /* 537 */
+ { 0x2e064868, 0xb7b7 }, /* 538 */
+ { 0x2e06486c, 0x4848 }, /* 539 */
+ { 0x2e064878, 0x8000000 }, /* 542 */
+ { 0x2e06487c, 0x4010008 }, /* 543 */
+ { 0x2e064880, 0x408 }, /* 544 */
+ { 0x2e064884, 0x3102000 }, /* 545 */
+ { 0x2e064888, 0xc0020 }, /* 546 */
+ { 0x2e06488c, 0x10000 }, /* 547 */
+ { 0x2e064890, 0x55555555 }, /* 548 */
+ { 0x2e064894, 0xaaaaaaaa }, /* 549 */
+ { 0x2e064898, 0x55555555 }, /* 550 */
+ { 0x2e06489c, 0xaaaaaaaa }, /* 551 */
+ { 0x2e0648a0, 0x5555 }, /* 552 */
+ { 0x2e0648a4, 0x1000100 }, /* 553 */
+ { 0x2e0648a8, 0x800180 }, /* 554 */
+ { 0x2e0648ac, 0x1 }, /* 555 */
+ { 0x2e064900, 0x4 }, /* 576 */
+ { 0x2e06491c, 0x41f07ff }, /* 583 */
+ { 0x2e064920, 0x1 }, /* 584 */
+ { 0x2e064924, 0x1cc0800 }, /* 585 */
+ { 0x2e064928, 0x3003cc08 }, /* 586 */
+ { 0x2e06492c, 0x2000014e }, /* 587 */
+ { 0x2e064930, 0x7ff0200 }, /* 588 */
+ { 0x2e064934, 0x301 }, /* 589 */
+ { 0x2e064940, 0x30000 }, /* 592 */
+ { 0x2e064954, 0x2000000 }, /* 597 */
+ { 0x2e064958, 0x51515042 }, /* 598 */
+ { 0x2e06495c, 0x31c06000 }, /* 599 */
+ { 0x2e064960, 0x6bf000a }, /* 600 */
+ { 0x2e064964, 0xc0c000 }, /* 601 */
+ { 0x2e064968, 0x1000000 }, /* 602 */
+ { 0x2e06496c, 0x10001000 }, /* 603 */
+ { 0x2e064970, 0xc043242 }, /* 604 */
+ { 0x2e064974, 0xf0c1201 }, /* 605 */
+ { 0x2e064978, 0x1000140 }, /* 606 */
+ { 0x2e06497c, 0xc000120 }, /* 607 */
+ { 0x2e064980, 0x143 }, /* 608 */
+ { 0x2e064984, 0x1000203 }, /* 609 */
+ { 0x2e064988, 0x75436012 }, /* 610 */
+ { 0x2e06498c, 0x8 }, /* 611 */
+ { 0x2e064990, 0x2c302c3 }, /* 612 */
+ { 0x2e064994, 0x2c302c3 }, /* 613 */
+ { 0x2e064998, 0x2c302c3 }, /* 614 */
+ { 0x2e06499c, 0x2c302c3 }, /* 615 */
+ { 0x2e0649a0, 0x2c3 }, /* 616 */
+ { 0x2e0649a4, 0x8000 }, /* 617 */
+ { 0x2e0649a8, 0x800080 }, /* 618 */
+ { 0x2e0649ac, 0x800080 }, /* 619 */
+ { 0x2e0649b0, 0x800080 }, /* 620 */
+ { 0x2e0649b4, 0x800080 }, /* 621 */
+ { 0x2e0649b8, 0x800080 }, /* 622 */
+ { 0x2e0649bc, 0x800080 }, /* 623 */
+ { 0x2e0649c0, 0x800080 }, /* 624 */
+ { 0x2e0649c4, 0x800080 }, /* 625 */
+ { 0x2e0649c8, 0x6b0080 }, /* 626 */
+ { 0x2e0649cc, 0x1a00001 }, /* 627 */
+ { 0x2e0649d4, 0x10000 }, /* 629 */
+ { 0x2e0649d8, 0x80200 }, /* 630 */
+ { 0x2e064c00, 0x4f0 }, /* 768 */
+ { 0x2e064c08, 0x1030200 }, /* 770 */
+ { 0x2e064c14, 0x3000000 }, /* 773 */
+ { 0x2e064c18, 0x1000001 }, /* 774 */
+ { 0x2e064c1c, 0x3000400 }, /* 775 */
+ { 0x2e064c20, 0x1 }, /* 776 */
+ { 0x2e064c24, 0x1 }, /* 777 */
+ { 0x2e064c30, 0x10000 }, /* 780 */
+ { 0x2e064c38, 0xc00004 }, /* 782 */
+ { 0x2e064c3c, 0xcc0008 }, /* 783 */
+ { 0x2e064c40, 0x660601 }, /* 784 */
+ { 0x2e064c44, 0x3 }, /* 785 */
+ { 0x2e064c4c, 0x1 }, /* 787 */
+ { 0x2e064c50, 0xaaaa }, /* 788 */
+ { 0x2e064c54, 0x5555 }, /* 789 */
+ { 0x2e064c58, 0xb5b5 }, /* 790 */
+ { 0x2e064c5c, 0x4a4a }, /* 791 */
+ { 0x2e064c60, 0x5656 }, /* 792 */
+ { 0x2e064c64, 0xa9a9 }, /* 793 */
+ { 0x2e064c68, 0xb7b7 }, /* 794 */
+ { 0x2e064c6c, 0x4848 }, /* 795 */
+ { 0x2e064c78, 0x8000000 }, /* 798 */
+ { 0x2e064c7c, 0x4010008 }, /* 799 */
+ { 0x2e064c80, 0x408 }, /* 800 */
+ { 0x2e064c84, 0x3102000 }, /* 801 */
+ { 0x2e064c88, 0xc0020 }, /* 802 */
+ { 0x2e064c8c, 0x10000 }, /* 803 */
+ { 0x2e064c90, 0x55555555 }, /* 804 */
+ { 0x2e064c94, 0xaaaaaaaa }, /* 805 */
+ { 0x2e064c98, 0x55555555 }, /* 806 */
+ { 0x2e064c9c, 0xaaaaaaaa }, /* 807 */
+ { 0x2e064ca0, 0x5555 }, /* 808 */
+ { 0x2e064ca4, 0x1000100 }, /* 809 */
+ { 0x2e064ca8, 0x800180 }, /* 810 */
+ { 0x2e064d00, 0x4 }, /* 832 */
+ { 0x2e064d1c, 0x41f07ff }, /* 839 */
+ { 0x2e064d20, 0x1 }, /* 840 */
+ { 0x2e064d24, 0x1cc0800 }, /* 841 */
+ { 0x2e064d28, 0x3003cc08 }, /* 842 */
+ { 0x2e064d2c, 0x2000014e }, /* 843 */
+ { 0x2e064d30, 0x7ff0200 }, /* 844 */
+ { 0x2e064d34, 0x301 }, /* 845 */
+ { 0x2e064d40, 0x30000 }, /* 848 */
+ { 0x2e064d54, 0x2000000 }, /* 853 */
+ { 0x2e064d58, 0x51515042 }, /* 854 */
+ { 0x2e064d5c, 0x31c06000 }, /* 855 */
+ { 0x2e064d60, 0x6bf000a }, /* 856 */
+ { 0x2e064d64, 0xc0c000 }, /* 857 */
+ { 0x2e064d68, 0x1000000 }, /* 858 */
+ { 0x2e064d6c, 0x10001000 }, /* 859 */
+ { 0x2e064d70, 0xc043242 }, /* 860 */
+ { 0x2e064d74, 0xf0c1201 }, /* 861 */
+ { 0x2e064d78, 0x1000140 }, /* 862 */
+ { 0x2e064d7c, 0xc000120 }, /* 863 */
+ { 0x2e064d80, 0x143 }, /* 864 */
+ { 0x2e064d84, 0x1000203 }, /* 865 */
+ { 0x2e064d88, 0x32017465 }, /* 866 */
+ { 0x2e064d8c, 0x8 }, /* 867 */
+ { 0x2e064d90, 0x2c302c3 }, /* 868 */
+ { 0x2e064d94, 0x2c302c3 }, /* 869 */
+ { 0x2e064d98, 0x2c302c3 }, /* 870 */
+ { 0x2e064d9c, 0x2c302c3 }, /* 871 */
+ { 0x2e064da0, 0x2c3 }, /* 872 */
+ { 0x2e064da4, 0x8000 }, /* 873 */
+ { 0x2e064da8, 0x800080 }, /* 874 */
+ { 0x2e064dac, 0x800080 }, /* 875 */
+ { 0x2e064db0, 0x800080 }, /* 876 */
+ { 0x2e064db4, 0x800080 }, /* 877 */
+ { 0x2e064db8, 0x800080 }, /* 878 */
+ { 0x2e064dbc, 0x800080 }, /* 879 */
+ { 0x2e064dc0, 0x800080 }, /* 880 */
+ { 0x2e064dc4, 0x800080 }, /* 881 */
+ { 0x2e064dc8, 0x6b0080 }, /* 882 */
+ { 0x2e064dcc, 0x1a00001 }, /* 883 */
+ { 0x2e064dd4, 0x10000 }, /* 885 */
+ { 0x2e064dd8, 0x80200 }, /* 886 */
+ { 0x2e065014, 0x100 }, /* 1029 */
+ { 0x2e065018, 0x201 }, /* 1030 */
+ { 0x2e06502c, 0x400000 }, /* 1035 */
+ { 0x2e065030, 0x80 }, /* 1036 */
+ { 0x2e065034, 0xdcba98 }, /* 1037 */
+ { 0x2e065038, 0x3000000 }, /* 1038 */
+ { 0x2e06504c, 0x2a }, /* 1043 */
+ { 0x2e065050, 0x15 }, /* 1044 */
+ { 0x2e065054, 0x15 }, /* 1045 */
+ { 0x2e065058, 0x2a }, /* 1046 */
+ { 0x2e06505c, 0x33 }, /* 1047 */
+ { 0x2e065060, 0xc }, /* 1048 */
+ { 0x2e065064, 0xc }, /* 1049 */
+ { 0x2e065068, 0x33 }, /* 1050 */
+ { 0x2e06506c, 0x543210 }, /* 1051 */
+ { 0x2e065070, 0x3f0000 }, /* 1052 */
+ { 0x2e065074, 0xf013f }, /* 1053 */
+ { 0x2e065078, 0xf }, /* 1054 */
+ { 0x2e06507c, 0x3cc }, /* 1055 */
+ { 0x2e065080, 0x30000 }, /* 1056 */
+ { 0x2e065084, 0x300 }, /* 1057 */
+ { 0x2e065088, 0x300 }, /* 1058 */
+ { 0x2e06508c, 0x300 }, /* 1059 */
+ { 0x2e065090, 0x300 }, /* 1060 */
+ { 0x2e065094, 0x300 }, /* 1061 */
+ { 0x2e065098, 0x42080010 }, /* 1062 */
+ { 0x2e06509c, 0x332 }, /* 1063 */
+ { 0x2e0650a0, 0x2 }, /* 1064 */
+ { 0x2e065414, 0x100 }, /* 1285 */
+ { 0x2e065418, 0x201 }, /* 1286 */
+ { 0x2e06542c, 0x400000 }, /* 1291 */
+ { 0x2e065430, 0x80 }, /* 1292 */
+ { 0x2e065434, 0xdcba98 }, /* 1293 */
+ { 0x2e065438, 0x3000000 }, /* 1294 */
+ { 0x2e06544c, 0x2a }, /* 1299 */
+ { 0x2e065450, 0x15 }, /* 1300 */
+ { 0x2e065454, 0x15 }, /* 1301 */
+ { 0x2e065458, 0x2a }, /* 1302 */
+ { 0x2e06545c, 0x33 }, /* 1303 */
+ { 0x2e065460, 0xc }, /* 1304 */
+ { 0x2e065464, 0xc }, /* 1305 */
+ { 0x2e065468, 0x33 }, /* 1306 */
+ { 0x2e06546c, 0x543210 }, /* 1307 */
+ { 0x2e065470, 0x3f0000 }, /* 1308 */
+ { 0x2e065474, 0xf013f }, /* 1309 */
+ { 0x2e065478, 0xf }, /* 1310 */
+ { 0x2e06547c, 0x3cc }, /* 1311 */
+ { 0x2e065480, 0x30000 }, /* 1312 */
+ { 0x2e065484, 0x300 }, /* 1313 */
+ { 0x2e065488, 0x300 }, /* 1314 */
+ { 0x2e06548c, 0x300 }, /* 1315 */
+ { 0x2e065490, 0x300 }, /* 1316 */
+ { 0x2e065494, 0x300 }, /* 1317 */
+ { 0x2e065498, 0x42080010 }, /* 1318 */
+ { 0x2e06549c, 0x332 }, /* 1319 */
+ { 0x2e0654a0, 0x2 }, /* 1320 */
+ { 0x2e065804, 0x100 }, /* 1537 */
+ { 0x2e065814, 0x50000 }, /* 1541 */
+ { 0x2e065818, 0x4000100 }, /* 1542 */
+ { 0x2e06581c, 0x55 }, /* 1543 */
+ { 0x2e06582c, 0xf0001 }, /* 1547 */
+ { 0x2e065830, 0x280040 }, /* 1548 */
+ { 0x2e065834, 0x5002 }, /* 1549 */
+ { 0x2e065838, 0x10101 }, /* 1550 */
+ { 0x2e065840, 0x90e0000 }, /* 1552 */
+ { 0x2e065844, 0x101010f }, /* 1553 */
+ { 0x2e065848, 0x10f0004 }, /* 1554 */
+ { 0x2e065854, 0x64 }, /* 1557 */
+ { 0x2e06585c, 0x1000000 }, /* 1559 */
+ { 0x2e065860, 0x8040201 }, /* 1560 */
+ { 0x2e065864, 0x2010201 }, /* 1561 */
+ { 0x2e065868, 0xf0f0f }, /* 1562 */
+ { 0x2e06586c, 0x241342 }, /* 1563 */
+ { 0x2e065874, 0x1020000 }, /* 1565 */
+ { 0x2e065878, 0x701 }, /* 1566 */
+ { 0x2e06587c, 0x54 }, /* 1567 */
+ { 0x2e065880, 0x4102000 }, /* 1568 */
+ { 0x2e065884, 0x24410 }, /* 1569 */
+ { 0x2e065888, 0x4410 }, /* 1570 */
+ { 0x2e06588c, 0x4410 }, /* 1571 */
+ { 0x2e065890, 0x4410 }, /* 1572 */
+ { 0x2e065894, 0x4410 }, /* 1573 */
+ { 0x2e065898, 0x4410 }, /* 1574 */
+ { 0x2e06589c, 0x4410 }, /* 1575 */
+ { 0x2e0658a0, 0x4410 }, /* 1576 */
+ { 0x2e0658a4, 0x4410 }, /* 1577 */
+ { 0x2e0658b0, 0x60000 }, /* 1580 */
+ { 0x2e0658b8, 0x66 }, /* 1582 */
+ { 0x2e0658bc, 0x10000 }, /* 1583 */
+ { 0x2e0658c0, 0x8 }, /* 1584 */
+ { 0x2e0658d8, 0x3000000 }, /* 1590 */
+ { 0x2e0658e8, 0x4102006 }, /* 1594 */
+ { 0x2e0658ec, 0x41020 }, /* 1595 */
+ { 0x2e0658f0, 0x1c98c98 }, /* 1596 */
+ { 0x2e0658f4, 0x3f400000 }, /* 1597 */
+ { 0x2e0658f8, 0x3f3f1f3f }, /* 1598 */
+ { 0x2e0658fc, 0x1f }, /* 1599 */
+ { 0x2e06590c, 0x1 }, /* 1603 */
+ { 0x2e06591c, 0x1 }, /* 1607 */
+ { 0x2e065920, 0x76543210 }, /* 1608 */
+ { 0x2e065924, 0x10198 }, /* 1609 */
+ { 0x2e065934, 0x40700 }, /* 1613 */
+ { 0x2e06594c, 0x2 }, /* 1619 */
+ { 0x2e065958, 0xf3c3 }, /* 1622 */
+ { 0x2e065964, 0x11542 }, /* 1625 */
+ { 0x2e065968, 0x30209bf }, /* 1626 */
+ { 0x2e06596c, 0x30000 }, /* 1627 */
+ { 0x2e065970, 0x3000300 }, /* 1628 */
+ { 0x2e065974, 0x3000300 }, /* 1629 */
+ { 0x2e065978, 0x3000300 }, /* 1630 */
+ { 0x2e06597c, 0x3000300 }, /* 1631 */
+ { 0x2e065980, 0x300 }, /* 1632 */
+ { 0x2e065984, 0x300 }, /* 1633 */
+ { 0x2e065988, 0x300 }, /* 1634 */
+ { 0x2e06598c, 0x337cc }, /* 1635 */
+ { 0x2e065990, 0x8 }, /* 1636 */
+ { 0x2e065994, 0x1b7 }, /* 1637 */
+ { 0x2e06599c, 0x1b7 }, /* 1639 */
+ { 0x2e0659a4, 0x1b700 }, /* 1641 */
+ { 0x2e0659a8, 0x1980000 }, /* 1642 */
+ { 0x2e0659ac, 0x1b7cc }, /* 1643 */
+ { 0x2e0659b4, 0x1b700 }, /* 1645 */
+ { 0x2e0659b8, 0x1980000 }, /* 1646 */
+ { 0x2e0659bc, 0x1b700 }, /* 1647 */
+ { 0x2e0659c0, 0x1980000 }, /* 1648 */
+ { 0x2e0659c4, 0x1b700 }, /* 1649 */
+ { 0x2e0659c8, 0x1980000 }, /* 1650 */
+ { 0x2e0659cc, 0x1b700 }, /* 1651 */
+ { 0x2e0659d0, 0x1980000 }, /* 1652 */
+ { 0x2e0659d4, 0x20040003 }, /* 1653 */
+};
+
+/** PHY_F2 settings **/
+struct dram_cfg_param ddr_phy_f2_cfg[] = {
+};
+
+/* ddr timing config params */
+struct dram_timing_info2 dram_timing = {
+ .ctl_cfg = ddr_ctl_cfg,
+ .ctl_cfg_num = ARRAY_SIZE(ddr_ctl_cfg),
+ .pi_cfg = ddr_pi_cfg,
+ .pi_cfg_num = ARRAY_SIZE(ddr_pi_cfg),
+ .phy_f1_cfg = ddr_phy_f1_cfg,
+ .phy_f1_cfg_num = ARRAY_SIZE(ddr_phy_f1_cfg),
+ .phy_f2_cfg = ddr_phy_f2_cfg,
+ .phy_f2_cfg_num = ARRAY_SIZE(ddr_phy_f2_cfg),
+ .fsp_table = { 96, 528 },
+};
diff --git a/board/freescale/imx8ulp_evk/spl.c b/board/freescale/imx8ulp_evk/spl.c
new file mode 100644
index 00000000000..d123b21b722
--- /dev/null
+++ b/board/freescale/imx8ulp_evk/spl.c
@@ -0,0 +1,148 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2021 NXP
+ */
+
+#include <init.h>
+#include <spl.h>
+#include <asm/io.h>
+#include <errno.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx8ulp-pins.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+#include <dm/lists.h>
+#include <asm/arch/ddr.h>
+#include <asm/arch/rdc.h>
+#include <asm/arch/upower.h>
+#include <asm/mach-imx/ele_api.h>
+#include <asm/sections.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void spl_dram_init(void)
+{
+ /* Reboot in dual boot setting no need to init ddr again */
+ bool ddr_enable = pcc_clock_is_enable(5, LPDDR4_PCC5_SLOT);
+
+ if (!ddr_enable) {
+ init_clk_ddr();
+ ddr_init(&dram_timing);
+ } else {
+ /* reinit pfd/pfddiv and lpavnic except pll4*/
+ cgc2_pll4_init(false);
+ }
+}
+
+u32 spl_boot_device(void)
+{
+ return BOOT_DEVICE_BOOTROM;
+}
+
+int power_init_board(void)
+{
+ if (IS_ENABLED(CONFIG_IMX8ULP_LD_MODE)) {
+ /* Set buck3 to 0.9v LD */
+ upower_pmic_i2c_write(0x22, 0x18);
+ } else if (IS_ENABLED(CONFIG_IMX8ULP_ND_MODE)) {
+ /* Set buck3 to 1.0v ND */
+ upower_pmic_i2c_write(0x22, 0x20);
+ } else {
+ /* Set buck3 to 1.1v OD */
+ upower_pmic_i2c_write(0x22, 0x28);
+ }
+
+ return 0;
+}
+
+void display_ele_fw_version(void)
+{
+ u32 fw_version, sha1, res;
+ int ret;
+
+ ret = ele_get_fw_version(&fw_version, &sha1, &res);
+ if (ret) {
+ printf("ele get firmware version failed %d, 0x%x\n", ret, res);
+ } else {
+ printf("ELE firmware version %u.%u.%u-%x",
+ (fw_version & (0x00ff0000)) >> 16,
+ (fw_version & (0x0000ff00)) >> 8,
+ (fw_version & (0x000000ff)), sha1);
+ ((fw_version & (0x80000000)) >> 31) == 1 ? puts("-dirty\n") : puts("\n");
+ }
+}
+
+void spl_board_init(void)
+{
+ u32 res;
+ int ret;
+
+ ret = imx8ulp_dm_post_init();
+ if (ret)
+ return;
+
+ board_early_init_f();
+
+ preloader_console_init();
+
+ puts("Normal Boot\n");
+
+ display_ele_fw_version();
+
+ /* After AP set iomuxc0, the i2c can't work, Need M33 to set it now */
+
+ /* Load the lposc fuse to work around ROM issue. The fuse depends on S400 to read. */
+ if (is_soc_rev(CHIP_REV_1_0))
+ load_lposc_fuse();
+
+ upower_init();
+
+ power_init_board();
+
+ clock_init_late();
+
+ /* This must place after upower init, so access to MDA and MRC are valid */
+ /* Init XRDC MDA */
+ xrdc_init_mda();
+
+ /* Init XRDC MRC for VIDEO, DSP domains */
+ xrdc_init_mrc();
+
+ xrdc_init_pdac_msc();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* Call it after PS16 power up */
+ set_lpav_qos();
+
+ /* Enable A35 access to the CAAM */
+ ret = ele_release_caam(0x7, &res);
+ if (ret)
+ printf("ele release caam failed %d, 0x%x\n", ret, res);
+
+ /*
+ * RNG start only available on the A1 soc revision.
+ * Check some JTAG register for the SoC revision.
+ */
+ if (!is_soc_rev(CHIP_REV_1_0)) {
+ ret = ele_start_rng();
+ if (ret)
+ printf("Fail to start RNG: %d\n", ret);
+ }
+}
+
+void board_init_f(ulong dummy)
+{
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ timer_init();
+
+ arch_cpu_init();
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imx93_evk/Kconfig b/board/freescale/imx93_evk/Kconfig
new file mode 100644
index 00000000000..821144c9382
--- /dev/null
+++ b/board/freescale/imx93_evk/Kconfig
@@ -0,0 +1,19 @@
+if TARGET_IMX93_11X11_EVK
+
+config SYS_BOARD
+ default "imx93_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "imx93_evk"
+
+config IMX93_EVK_LPDDR4X
+ bool "Using LPDDR4X Timing and PMIC voltage"
+ default y
+ select IMX9_LPDDR4X
+ help
+ Select the LPDDR4X timing and 0.6V VDDQ
+
+endif
diff --git a/board/freescale/imx93_evk/MAINTAINERS b/board/freescale/imx93_evk/MAINTAINERS
new file mode 100644
index 00000000000..34ba278fcdf
--- /dev/null
+++ b/board/freescale/imx93_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+i.MX93 MEK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/imx93_evk/
+F: include/configs/imx93_evk.h
+F: configs/imx93_11x11_evk_defconfig
+F: configs/imx93_11x11_evk_ld_defconfig
diff --git a/board/freescale/imx93_evk/Makefile b/board/freescale/imx93_evk/Makefile
new file mode 100644
index 00000000000..17956d24bf7
--- /dev/null
+++ b/board/freescale/imx93_evk/Makefile
@@ -0,0 +1,16 @@
+#
+# Copyright 2022 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += imx93_evk.o
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+ifdef CONFIG_IMX9_LOW_DRIVE_MODE
+obj-$(CONFIG_IMX93_EVK_LPDDR4X) += lpddr4x_timing_ld.o
+else
+obj-$(CONFIG_IMX93_EVK_LPDDR4X) += lpddr4x_timing.o
+endif
+endif
diff --git a/board/freescale/imx93_evk/imx93_evk.c b/board/freescale/imx93_evk/imx93_evk.c
new file mode 100644
index 00000000000..341831a7d30
--- /dev/null
+++ b/board/freescale/imx93_evk/imx93_evk.c
@@ -0,0 +1,70 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2022 NXP
+ */
+
+#include <env.h>
+#include <init.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <asm/arch-imx9/ccm_regs.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch-imx9/imx93_pins.h>
+#include <asm/arch/clock.h>
+#include <power/pmic.h>
+#include <dm/device.h>
+#include <dm/uclass.h>
+#include <usb.h>
+#include <dwc3-uboot.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_DSE(6) | PAD_CTL_FSEL2)
+#define WDOG_PAD_CTRL (PAD_CTL_DSE(6) | PAD_CTL_ODE | PAD_CTL_PUE | PAD_CTL_PE)
+
+static iomux_v3_cfg_t const uart_pads[] = {
+ MX93_PAD_UART1_RXD__LPUART1_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX93_PAD_UART1_TXD__LPUART1_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+int board_early_init_f(void)
+{
+ imx_iomux_v3_setup_multiple_pads(uart_pads, ARRAY_SIZE(uart_pads));
+
+ return 0;
+}
+
+static int setup_fec(void)
+{
+ return set_clk_enet(ENET_125MHZ);
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+
+int board_init(void)
+{
+ if (IS_ENABLED(CONFIG_FEC_MXC))
+ setup_fec();
+
+ return 0;
+}
+
+int board_late_init(void)
+{
+#ifdef CONFIG_ENV_IS_IN_MMC
+ board_late_mmc_env_init();
+#endif
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "11X11_EVK");
+ env_set("board_rev", "iMX93");
+#endif
+ return 0;
+}
diff --git a/board/freescale/imx93_evk/lpddr4x_timing.c b/board/freescale/imx93_evk/lpddr4x_timing.c
new file mode 100644
index 00000000000..ffdf96b739f
--- /dev/null
+++ b/board/freescale/imx93_evk/lpddr4x_timing.c
@@ -0,0 +1,1994 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2023 NXP
+ *
+ * Code generated with DDR Tool v2.0.0_5.3.
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ {0x4e300110, 0x44100001},
+ {0x4e300000, 0x8000ff},
+ {0x4e300008, 0x0},
+ {0x4e300080, 0x80000512},
+ {0x4e300084, 0x0},
+ {0x4e300114, 0x1002},
+ {0x4e300260, 0x80},
+ {0x4e300f04, 0x80},
+ {0x4e300800, 0x43b30002},
+ {0x4e300804, 0x1f1f1f1f},
+ {0x4e301000, 0x0},
+ {0x4e301240, 0x0},
+ {0x4e301244, 0x0},
+ {0x4e301248, 0x0},
+ {0x4e30124c, 0x0},
+ {0x4e301250, 0x0},
+ {0x4e301254, 0x0},
+ {0x4e301258, 0x0},
+ {0x4e30125c, 0x0},
+};
+
+/* dram fsp cfg */
+static struct dram_fsp_cfg ddr_dram_fsp_cfg[] = {
+ {
+ {
+ {0x4e300100, 0x24AB321B},
+ {0x4e300104, 0xF8EE001B},
+ {0x4e300108, 0x2F2EE233},
+ {0x4e30010C, 0x0005E18B},
+ {0x4e300124, 0x1C770000},
+ {0x4e300160, 0x00009102},
+ {0x4e30016C, 0x35F00000},
+ {0x4e300170, 0x8B0B0608},
+ {0x4e300250, 0x00000028},
+ {0x4e300254, 0x015B015B},
+ {0x4e300258, 0x00000008},
+ {0x4e30025C, 0x00000400},
+ {0x4e300300, 0x224F2213},
+ {0x4e300304, 0x015B2213},
+ {0x4e300308, 0x0A3C0E3C},
+ },
+ {
+ {0x01, 0xE4},
+ {0x02, 0x36},
+ {0x03, 0x32},
+ {0x0b, 0x46},
+ {0x0c, 0x11},
+ {0x0e, 0x11},
+ {0x16, 0x04},
+ },
+ 0,
+ },
+ {
+ {
+ {0x4e300100, 0x12552100},
+ {0x4e300104, 0xF877000E},
+ {0x4e300108, 0x1816B4AA},
+ {0x4e30010C, 0x005101E6},
+ {0x4e300124, 0x0E3C0000},
+ {0x4e300160, 0x00009102},
+ {0x4e30016C, 0x30900000},
+ {0x4e300170, 0x8A0A0508},
+ {0x4e300250, 0x00000014},
+ {0x4e300254, 0x00AA00AA},
+ {0x4e300258, 0x00000008},
+ {0x4e30025C, 0x00000400},
+ },
+ {
+ {0x01, 0xB4},
+ {0x02, 0x1B},
+ {0x03, 0x32},
+ {0x0b, 0x46},
+ {0x0c, 0x11},
+ {0x0e, 0x11},
+ {0x16, 0x04},
+ },
+ 0,
+ },
+ {
+ {
+ {0x4e300100, 0x00061000},
+ {0x4e300104, 0xF855000A},
+ {0x4e300108, 0x6E62FA48},
+ {0x4e30010C, 0x0031010D},
+ {0x4e300124, 0x04C50000},
+ {0x4e300160, 0x00009102},
+ {0x4e30016C, 0x30000000},
+ {0x4e300170, 0x89090408},
+ {0x4e300250, 0x00000007},
+ {0x4e300254, 0x00340034},
+ {0x4e300258, 0x00000008},
+ {0x4e30025C, 0x00000400},
+ },
+ {
+ {0x01, 0x94},
+ {0x02, 0x9},
+ {0x03, 0x32},
+ {0x0b, 0x46},
+ {0x0c, 0x11},
+ {0x0e, 0x11},
+ {0x16, 0x04},
+ },
+ 1,
+ }
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ {0x100a0, 0x4},
+ {0x100a1, 0x5},
+ {0x100a2, 0x6},
+ {0x100a3, 0x7},
+ {0x100a4, 0x0},
+ {0x100a5, 0x1},
+ {0x100a6, 0x2},
+ {0x100a7, 0x3},
+ {0x110a0, 0x3},
+ {0x110a1, 0x2},
+ {0x110a2, 0x0},
+ {0x110a3, 0x1},
+ {0x110a4, 0x7},
+ {0x110a5, 0x6},
+ {0x110a6, 0x4},
+ {0x110a7, 0x5},
+ {0x1005f, 0x5ff},
+ {0x1015f, 0x5ff},
+ {0x1105f, 0x5ff},
+ {0x1115f, 0x5ff},
+ {0x11005f, 0x5ff},
+ {0x11015f, 0x5ff},
+ {0x11105f, 0x5ff},
+ {0x11115f, 0x5ff},
+ {0x21005f, 0x5ff},
+ {0x21015f, 0x5ff},
+ {0x21105f, 0x5ff},
+ {0x21115f, 0x5ff},
+ {0x55, 0x1ff},
+ {0x1055, 0x1ff},
+ {0x2055, 0x1ff},
+ {0x200c5, 0x19},
+ {0x1200c5, 0xb},
+ {0x2200c5, 0x7},
+ {0x2002e, 0x2},
+ {0x12002e, 0x2},
+ {0x22002e, 0x2},
+ {0x90204, 0x0},
+ {0x190204, 0x0},
+ {0x290204, 0x0},
+ {0x20024, 0x1e3},
+ {0x2003a, 0x2},
+ {0x2007d, 0x212},
+ {0x2007c, 0x61},
+ {0x120024, 0x1e3},
+ {0x2003a, 0x2},
+ {0x12007d, 0x212},
+ {0x12007c, 0x61},
+ {0x220024, 0x1e3},
+ {0x2003a, 0x2},
+ {0x22007d, 0x212},
+ {0x22007c, 0x61},
+ {0x20056, 0x3},
+ {0x120056, 0x3},
+ {0x220056, 0x3},
+ {0x1004d, 0x600},
+ {0x1014d, 0x600},
+ {0x1104d, 0x600},
+ {0x1114d, 0x600},
+ {0x11004d, 0x600},
+ {0x11014d, 0x600},
+ {0x11104d, 0x600},
+ {0x11114d, 0x600},
+ {0x21004d, 0x600},
+ {0x21014d, 0x600},
+ {0x21104d, 0x600},
+ {0x21114d, 0x600},
+ {0x10049, 0xe00},
+ {0x10149, 0xe00},
+ {0x11049, 0xe00},
+ {0x11149, 0xe00},
+ {0x110049, 0xe00},
+ {0x110149, 0xe00},
+ {0x111049, 0xe00},
+ {0x111149, 0xe00},
+ {0x210049, 0xe00},
+ {0x210149, 0xe00},
+ {0x211049, 0xe00},
+ {0x211149, 0xe00},
+ {0x43, 0x60},
+ {0x1043, 0x60},
+ {0x2043, 0x60},
+ {0x20018, 0x1},
+ {0x20075, 0x4},
+ {0x20050, 0x0},
+ {0x2009b, 0x2},
+ {0x20008, 0x3a5},
+ {0x120008, 0x1d3},
+ {0x220008, 0x9c},
+ {0x20088, 0x9},
+ {0x200b2, 0x10c},
+ {0x10043, 0x5a1},
+ {0x10143, 0x5a1},
+ {0x11043, 0x5a1},
+ {0x11143, 0x5a1},
+ {0x1200b2, 0x10c},
+ {0x110043, 0x5a1},
+ {0x110143, 0x5a1},
+ {0x111043, 0x5a1},
+ {0x111143, 0x5a1},
+ {0x2200b2, 0x10c},
+ {0x210043, 0x5a1},
+ {0x210143, 0x5a1},
+ {0x211043, 0x5a1},
+ {0x211143, 0x5a1},
+ {0x200fa, 0x2},
+ {0x1200fa, 0x2},
+ {0x2200fa, 0x2},
+ {0x20019, 0x1},
+ {0x120019, 0x1},
+ {0x220019, 0x1},
+ {0x200f0, 0x600},
+ {0x200f1, 0x0},
+ {0x200f2, 0x4444},
+ {0x200f3, 0x8888},
+ {0x200f4, 0x5655},
+ {0x200f5, 0x0},
+ {0x200f6, 0x0},
+ {0x200f7, 0xf000},
+ {0x1004a, 0x500},
+ {0x1104a, 0x500},
+ {0x20025, 0x0},
+ {0x2002d, 0x0},
+ {0x12002d, 0x0},
+ {0x22002d, 0x0},
+ {0x2002c, 0x0},
+ {0x20021, 0x0},
+ {0x200c7, 0x21},
+ {0x1200c7, 0x21},
+ {0x200ca, 0x24},
+ {0x1200ca, 0x24}
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ {0x1005f, 0x0},
+ {0x1015f, 0x0},
+ {0x1105f, 0x0},
+ {0x1115f, 0x0},
+ {0x11005f, 0x0},
+ {0x11015f, 0x0},
+ {0x11105f, 0x0},
+ {0x11115f, 0x0},
+ {0x21005f, 0x0},
+ {0x21015f, 0x0},
+ {0x21105f, 0x0},
+ {0x21115f, 0x0},
+ {0x55, 0x0},
+ {0x1055, 0x0},
+ {0x2055, 0x0},
+ {0x200c5, 0x0},
+ {0x1200c5, 0x0},
+ {0x2200c5, 0x0},
+ {0x2002e, 0x0},
+ {0x12002e, 0x0},
+ {0x22002e, 0x0},
+ {0x90204, 0x0},
+ {0x190204, 0x0},
+ {0x290204, 0x0},
+ {0x20024, 0x0},
+ {0x2003a, 0x0},
+ {0x2007d, 0x0},
+ {0x2007c, 0x0},
+ {0x120024, 0x0},
+ {0x12007d, 0x0},
+ {0x12007c, 0x0},
+ {0x220024, 0x0},
+ {0x22007d, 0x0},
+ {0x22007c, 0x0},
+ {0x20056, 0x0},
+ {0x120056, 0x0},
+ {0x220056, 0x0},
+ {0x1004d, 0x0},
+ {0x1014d, 0x0},
+ {0x1104d, 0x0},
+ {0x1114d, 0x0},
+ {0x11004d, 0x0},
+ {0x11014d, 0x0},
+ {0x11104d, 0x0},
+ {0x11114d, 0x0},
+ {0x21004d, 0x0},
+ {0x21014d, 0x0},
+ {0x21104d, 0x0},
+ {0x21114d, 0x0},
+ {0x10049, 0x0},
+ {0x10149, 0x0},
+ {0x11049, 0x0},
+ {0x11149, 0x0},
+ {0x110049, 0x0},
+ {0x110149, 0x0},
+ {0x111049, 0x0},
+ {0x111149, 0x0},
+ {0x210049, 0x0},
+ {0x210149, 0x0},
+ {0x211049, 0x0},
+ {0x211149, 0x0},
+ {0x43, 0x0},
+ {0x1043, 0x0},
+ {0x2043, 0x0},
+ {0x20018, 0x0},
+ {0x20075, 0x0},
+ {0x20050, 0x0},
+ {0x2009b, 0x0},
+ {0x20008, 0x0},
+ {0x120008, 0x0},
+ {0x220008, 0x0},
+ {0x20088, 0x0},
+ {0x200b2, 0x0},
+ {0x10043, 0x0},
+ {0x10143, 0x0},
+ {0x11043, 0x0},
+ {0x11143, 0x0},
+ {0x1200b2, 0x0},
+ {0x110043, 0x0},
+ {0x110143, 0x0},
+ {0x111043, 0x0},
+ {0x111143, 0x0},
+ {0x2200b2, 0x0},
+ {0x210043, 0x0},
+ {0x210143, 0x0},
+ {0x211043, 0x0},
+ {0x211143, 0x0},
+ {0x200fa, 0x0},
+ {0x1200fa, 0x0},
+ {0x2200fa, 0x0},
+ {0x20019, 0x0},
+ {0x120019, 0x0},
+ {0x220019, 0x0},
+ {0x200f0, 0x0},
+ {0x200f1, 0x0},
+ {0x200f2, 0x0},
+ {0x200f3, 0x0},
+ {0x200f4, 0x0},
+ {0x200f5, 0x0},
+ {0x200f6, 0x0},
+ {0x200f7, 0x0},
+ {0x1004a, 0x0},
+ {0x1104a, 0x0},
+ {0x20025, 0x0},
+ {0x2002d, 0x0},
+ {0x12002d, 0x0},
+ {0x22002d, 0x0},
+ {0x2002c, 0x0},
+ {0xd0000, 0x0},
+ {0x90000, 0x0},
+ {0x90001, 0x0},
+ {0x90002, 0x0},
+ {0x90003, 0x0},
+ {0x90004, 0x0},
+ {0x90005, 0x0},
+ {0x90029, 0x0},
+ {0x9002a, 0x0},
+ {0x9002b, 0x0},
+ {0x9002c, 0x0},
+ {0x9002d, 0x0},
+ {0x9002e, 0x0},
+ {0x9002f, 0x0},
+ {0x90030, 0x0},
+ {0x90031, 0x0},
+ {0x90032, 0x0},
+ {0x90033, 0x0},
+ {0x90034, 0x0},
+ {0x90035, 0x0},
+ {0x90036, 0x0},
+ {0x90037, 0x0},
+ {0x90038, 0x0},
+ {0x90039, 0x0},
+ {0x9003a, 0x0},
+ {0x9003b, 0x0},
+ {0x9003c, 0x0},
+ {0x9003d, 0x0},
+ {0x9003e, 0x0},
+ {0x9003f, 0x0},
+ {0x90040, 0x0},
+ {0x90041, 0x0},
+ {0x90042, 0x0},
+ {0x90043, 0x0},
+ {0x90044, 0x0},
+ {0x90045, 0x0},
+ {0x90046, 0x0},
+ {0x90047, 0x0},
+ {0x90048, 0x0},
+ {0x90049, 0x0},
+ {0x9004a, 0x0},
+ {0x9004b, 0x0},
+ {0x9004c, 0x0},
+ {0x9004d, 0x0},
+ {0x9004e, 0x0},
+ {0x9004f, 0x0},
+ {0x90050, 0x0},
+ {0x90051, 0x0},
+ {0x90052, 0x0},
+ {0x90053, 0x0},
+ {0x90054, 0x0},
+ {0x90055, 0x0},
+ {0x90056, 0x0},
+ {0x90057, 0x0},
+ {0x90058, 0x0},
+ {0x90059, 0x0},
+ {0x9005a, 0x0},
+ {0x9005b, 0x0},
+ {0x9005c, 0x0},
+ {0x9005d, 0x0},
+ {0x9005e, 0x0},
+ {0x9005f, 0x0},
+ {0x90060, 0x0},
+ {0x90061, 0x0},
+ {0x90062, 0x0},
+ {0x90063, 0x0},
+ {0x90064, 0x0},
+ {0x90065, 0x0},
+ {0x90066, 0x0},
+ {0x90067, 0x0},
+ {0x90068, 0x0},
+ {0x90069, 0x0},
+ {0x9006a, 0x0},
+ {0x9006b, 0x0},
+ {0x9006c, 0x0},
+ {0x9006d, 0x0},
+ {0x9006e, 0x0},
+ {0x9006f, 0x0},
+ {0x90070, 0x0},
+ {0x90071, 0x0},
+ {0x90072, 0x0},
+ {0x90073, 0x0},
+ {0x90074, 0x0},
+ {0x90075, 0x0},
+ {0x90076, 0x0},
+ {0x90077, 0x0},
+ {0x90078, 0x0},
+ {0x90079, 0x0},
+ {0x9007a, 0x0},
+ {0x9007b, 0x0},
+ {0x9007c, 0x0},
+ {0x9007d, 0x0},
+ {0x9007e, 0x0},
+ {0x9007f, 0x0},
+ {0x90080, 0x0},
+ {0x90081, 0x0},
+ {0x90082, 0x0},
+ {0x90083, 0x0},
+ {0x90084, 0x0},
+ {0x90085, 0x0},
+ {0x90086, 0x0},
+ {0x90087, 0x0},
+ {0x90088, 0x0},
+ {0x90089, 0x0},
+ {0x9008a, 0x0},
+ {0x9008b, 0x0},
+ {0x9008c, 0x0},
+ {0x9008d, 0x0},
+ {0x9008e, 0x0},
+ {0x9008f, 0x0},
+ {0x90090, 0x0},
+ {0x90091, 0x0},
+ {0x90092, 0x0},
+ {0x90093, 0x0},
+ {0x90094, 0x0},
+ {0x90095, 0x0},
+ {0x90096, 0x0},
+ {0x90097, 0x0},
+ {0x90098, 0x0},
+ {0x90099, 0x0},
+ {0x9009a, 0x0},
+ {0x9009b, 0x0},
+ {0x9009c, 0x0},
+ {0x9009d, 0x0},
+ {0x9009e, 0x0},
+ {0x9009f, 0x0},
+ {0x900a0, 0x0},
+ {0x900a1, 0x0},
+ {0x900a2, 0x0},
+ {0x900a3, 0x0},
+ {0x900a4, 0x0},
+ {0x900a5, 0x0},
+ {0x900a6, 0x0},
+ {0x900a7, 0x0},
+ {0x900a8, 0x0},
+ {0x900a9, 0x0},
+ {0x40000, 0x0},
+ {0x40020, 0x0},
+ {0x40040, 0x0},
+ {0x40060, 0x0},
+ {0x40001, 0x0},
+ {0x40021, 0x0},
+ {0x40041, 0x0},
+ {0x40061, 0x0},
+ {0x40002, 0x0},
+ {0x40022, 0x0},
+ {0x40042, 0x0},
+ {0x40062, 0x0},
+ {0x40003, 0x0},
+ {0x40023, 0x0},
+ {0x40043, 0x0},
+ {0x40063, 0x0},
+ {0x40004, 0x0},
+ {0x40024, 0x0},
+ {0x40044, 0x0},
+ {0x40064, 0x0},
+ {0x40005, 0x0},
+ {0x40025, 0x0},
+ {0x40045, 0x0},
+ {0x40065, 0x0},
+ {0x40006, 0x0},
+ {0x40026, 0x0},
+ {0x40046, 0x0},
+ {0x40066, 0x0},
+ {0x40007, 0x0},
+ {0x40027, 0x0},
+ {0x40047, 0x0},
+ {0x40067, 0x0},
+ {0x40008, 0x0},
+ {0x40028, 0x0},
+ {0x40048, 0x0},
+ {0x40068, 0x0},
+ {0x40009, 0x0},
+ {0x40029, 0x0},
+ {0x40049, 0x0},
+ {0x40069, 0x0},
+ {0x4000a, 0x0},
+ {0x4002a, 0x0},
+ {0x4004a, 0x0},
+ {0x4006a, 0x0},
+ {0x4000b, 0x0},
+ {0x4002b, 0x0},
+ {0x4004b, 0x0},
+ {0x4006b, 0x0},
+ {0x4000c, 0x0},
+ {0x4002c, 0x0},
+ {0x4004c, 0x0},
+ {0x4006c, 0x0},
+ {0x4000d, 0x0},
+ {0x4002d, 0x0},
+ {0x4004d, 0x0},
+ {0x4006d, 0x0},
+ {0x4000e, 0x0},
+ {0x4002e, 0x0},
+ {0x4004e, 0x0},
+ {0x4006e, 0x0},
+ {0x4000f, 0x0},
+ {0x4002f, 0x0},
+ {0x4004f, 0x0},
+ {0x4006f, 0x0},
+ {0x40010, 0x0},
+ {0x40030, 0x0},
+ {0x40050, 0x0},
+ {0x40070, 0x0},
+ {0x40011, 0x0},
+ {0x40031, 0x0},
+ {0x40051, 0x0},
+ {0x40071, 0x0},
+ {0x40012, 0x0},
+ {0x40032, 0x0},
+ {0x40052, 0x0},
+ {0x40072, 0x0},
+ {0x40013, 0x0},
+ {0x40033, 0x0},
+ {0x40053, 0x0},
+ {0x40073, 0x0},
+ {0x40014, 0x0},
+ {0x40034, 0x0},
+ {0x40054, 0x0},
+ {0x40074, 0x0},
+ {0x40015, 0x0},
+ {0x40035, 0x0},
+ {0x40055, 0x0},
+ {0x40075, 0x0},
+ {0x40016, 0x0},
+ {0x40036, 0x0},
+ {0x40056, 0x0},
+ {0x40076, 0x0},
+ {0x40017, 0x0},
+ {0x40037, 0x0},
+ {0x40057, 0x0},
+ {0x40077, 0x0},
+ {0x40018, 0x0},
+ {0x40038, 0x0},
+ {0x40058, 0x0},
+ {0x40078, 0x0},
+ {0x40019, 0x0},
+ {0x40039, 0x0},
+ {0x40059, 0x0},
+ {0x40079, 0x0},
+ {0x4001a, 0x0},
+ {0x4003a, 0x0},
+ {0x4005a, 0x0},
+ {0x4007a, 0x0},
+ {0x900aa, 0x0},
+ {0x900ab, 0x0},
+ {0x900ac, 0x0},
+ {0x900ad, 0x0},
+ {0x900ae, 0x0},
+ {0x900af, 0x0},
+ {0x900b0, 0x0},
+ {0x900b1, 0x0},
+ {0x900b2, 0x0},
+ {0x900b3, 0x0},
+ {0x900b4, 0x0},
+ {0x900b5, 0x0},
+ {0x900b6, 0x0},
+ {0x900b7, 0x0},
+ {0x900b8, 0x0},
+ {0x900b9, 0x0},
+ {0x900ba, 0x0},
+ {0x900bb, 0x0},
+ {0x900bc, 0x0},
+ {0x900bd, 0x0},
+ {0x900be, 0x0},
+ {0x900bf, 0x0},
+ {0x900c0, 0x0},
+ {0x900c1, 0x0},
+ {0x900c2, 0x0},
+ {0x900c3, 0x0},
+ {0x900c4, 0x0},
+ {0x900c5, 0x0},
+ {0x900c6, 0x0},
+ {0x900c7, 0x0},
+ {0x900c8, 0x0},
+ {0x900c9, 0x0},
+ {0x900ca, 0x0},
+ {0x900cb, 0x0},
+ {0x900cc, 0x0},
+ {0x900cd, 0x0},
+ {0x900ce, 0x0},
+ {0x900cf, 0x0},
+ {0x900d0, 0x0},
+ {0x900d1, 0x0},
+ {0x900d2, 0x0},
+ {0x900d3, 0x0},
+ {0x900d4, 0x0},
+ {0x900d5, 0x0},
+ {0x900d6, 0x0},
+ {0x900d7, 0x0},
+ {0x900d8, 0x0},
+ {0x900d9, 0x0},
+ {0x900da, 0x0},
+ {0x900db, 0x0},
+ {0x900dc, 0x0},
+ {0x900dd, 0x0},
+ {0x900de, 0x0},
+ {0x900df, 0x0},
+ {0x900e0, 0x0},
+ {0x900e1, 0x0},
+ {0x900e2, 0x0},
+ {0x900e3, 0x0},
+ {0x900e4, 0x0},
+ {0x900e5, 0x0},
+ {0x900e6, 0x0},
+ {0x900e7, 0x0},
+ {0x900e8, 0x0},
+ {0x900e9, 0x0},
+ {0x900ea, 0x0},
+ {0x900eb, 0x0},
+ {0x900ec, 0x0},
+ {0x900ed, 0x0},
+ {0x900ee, 0x0},
+ {0x900ef, 0x0},
+ {0x900f0, 0x0},
+ {0x900f1, 0x0},
+ {0x900f2, 0x0},
+ {0x900f3, 0x0},
+ {0x900f4, 0x0},
+ {0x900f5, 0x0},
+ {0x900f6, 0x0},
+ {0x900f7, 0x0},
+ {0x900f8, 0x0},
+ {0x900f9, 0x0},
+ {0x900fa, 0x0},
+ {0x900fb, 0x0},
+ {0x900fc, 0x0},
+ {0x900fd, 0x0},
+ {0x900fe, 0x0},
+ {0x900ff, 0x0},
+ {0x90100, 0x0},
+ {0x90101, 0x0},
+ {0x90102, 0x0},
+ {0x90103, 0x0},
+ {0x90104, 0x0},
+ {0x90105, 0x0},
+ {0x90106, 0x0},
+ {0x90107, 0x0},
+ {0x90108, 0x0},
+ {0x90109, 0x0},
+ {0x9010a, 0x0},
+ {0x9010b, 0x0},
+ {0x9010c, 0x0},
+ {0x9010d, 0x0},
+ {0x9010e, 0x0},
+ {0x9010f, 0x0},
+ {0x90110, 0x0},
+ {0x90111, 0x0},
+ {0x90112, 0x0},
+ {0x90113, 0x0},
+ {0x90114, 0x0},
+ {0x90115, 0x0},
+ {0x90116, 0x0},
+ {0x90117, 0x0},
+ {0x90118, 0x0},
+ {0x90119, 0x0},
+ {0x9011a, 0x0},
+ {0x9011b, 0x0},
+ {0x9011c, 0x0},
+ {0x9011d, 0x0},
+ {0x9011e, 0x0},
+ {0x9011f, 0x0},
+ {0x90120, 0x0},
+ {0x90121, 0x0},
+ {0x90122, 0x0},
+ {0x90123, 0x0},
+ {0x90124, 0x0},
+ {0x90125, 0x0},
+ {0x90126, 0x0},
+ {0x90127, 0x0},
+ {0x90128, 0x0},
+ {0x90129, 0x0},
+ {0x9012a, 0x0},
+ {0x9012b, 0x0},
+ {0x9012c, 0x0},
+ {0x9012d, 0x0},
+ {0x9012e, 0x0},
+ {0x9012f, 0x0},
+ {0x90130, 0x0},
+ {0x90131, 0x0},
+ {0x90132, 0x0},
+ {0x90133, 0x0},
+ {0x90134, 0x0},
+ {0x90135, 0x0},
+ {0x90136, 0x0},
+ {0x90137, 0x0},
+ {0x90138, 0x0},
+ {0x90139, 0x0},
+ {0x9013a, 0x0},
+ {0x9013b, 0x0},
+ {0x9013c, 0x0},
+ {0x9013d, 0x0},
+ {0x9013e, 0x0},
+ {0x9013f, 0x0},
+ {0x90140, 0x0},
+ {0x90141, 0x0},
+ {0x90142, 0x0},
+ {0x90143, 0x0},
+ {0x90144, 0x0},
+ {0x90145, 0x0},
+ {0x90146, 0x0},
+ {0x90147, 0x0},
+ {0x90148, 0x0},
+ {0x90149, 0x0},
+ {0x9014a, 0x0},
+ {0x9014b, 0x0},
+ {0x9014c, 0x0},
+ {0x9014d, 0x0},
+ {0x9014e, 0x0},
+ {0x9014f, 0x0},
+ {0x90150, 0x0},
+ {0x90151, 0x0},
+ {0x90152, 0x0},
+ {0x90153, 0x0},
+ {0x90154, 0x0},
+ {0x90155, 0x0},
+ {0x90156, 0x0},
+ {0x90157, 0x0},
+ {0x90158, 0x0},
+ {0x90159, 0x0},
+ {0x9015a, 0x0},
+ {0x9015b, 0x0},
+ {0x9015c, 0x0},
+ {0x9015d, 0x0},
+ {0x9015e, 0x0},
+ {0x9015f, 0x0},
+ {0x90160, 0x0},
+ {0x90161, 0x0},
+ {0x90162, 0x0},
+ {0x90163, 0x0},
+ {0x90164, 0x0},
+ {0x90165, 0x0},
+ {0x90166, 0x0},
+ {0x90167, 0x0},
+ {0x90168, 0x0},
+ {0x90169, 0x0},
+ {0x9016a, 0x0},
+ {0x9016b, 0x0},
+ {0x9016c, 0x0},
+ {0x9016d, 0x0},
+ {0x9016e, 0x0},
+ {0x9016f, 0x0},
+ {0x90170, 0x0},
+ {0x90171, 0x0},
+ {0x90172, 0x0},
+ {0x90173, 0x0},
+ {0x90174, 0x0},
+ {0x90175, 0x0},
+ {0x90176, 0x0},
+ {0x90177, 0x0},
+ {0x90178, 0x0},
+ {0x90179, 0x0},
+ {0x9017a, 0x0},
+ {0x9017b, 0x0},
+ {0x9017c, 0x0},
+ {0x9017d, 0x0},
+ {0x9017e, 0x0},
+ {0x9017f, 0x0},
+ {0x90180, 0x0},
+ {0x90181, 0x0},
+ {0x90182, 0x0},
+ {0x90183, 0x0},
+ {0x90184, 0x0},
+ {0x90006, 0x0},
+ {0x90007, 0x0},
+ {0x90008, 0x0},
+ {0x90009, 0x0},
+ {0x9000a, 0x0},
+ {0x9000b, 0x0},
+ {0xd00e7, 0x0},
+ {0x90017, 0x0},
+ {0x9001f, 0x0},
+ {0x90026, 0x0},
+ {0x400d0, 0x0},
+ {0x400d1, 0x0},
+ {0x400d2, 0x0},
+ {0x400d3, 0x0},
+ {0x400d4, 0x0},
+ {0x400d5, 0x0},
+ {0x400d6, 0x0},
+ {0x400d7, 0x0},
+ {0x200be, 0x0},
+ {0x2000b, 0x0},
+ {0x2000c, 0x0},
+ {0x2000d, 0x0},
+ {0x2000e, 0x0},
+ {0x12000b, 0x0},
+ {0x12000c, 0x0},
+ {0x12000d, 0x0},
+ {0x12000e, 0x0},
+ {0x22000b, 0x0},
+ {0x22000c, 0x0},
+ {0x22000d, 0x0},
+ {0x22000e, 0x0},
+ {0x9000c, 0x0},
+ {0x9000d, 0x0},
+ {0x9000e, 0x0},
+ {0x9000f, 0x0},
+ {0x90010, 0x0},
+ {0x90011, 0x0},
+ {0x90012, 0x0},
+ {0x90013, 0x0},
+ {0x20010, 0x0},
+ {0x20011, 0x0},
+ {0x120010, 0x0},
+ {0x120011, 0x0},
+ {0x40080, 0x0},
+ {0x40081, 0x0},
+ {0x40082, 0x0},
+ {0x40083, 0x0},
+ {0x40084, 0x0},
+ {0x40085, 0x0},
+ {0x140080, 0x0},
+ {0x140081, 0x0},
+ {0x140082, 0x0},
+ {0x140083, 0x0},
+ {0x140084, 0x0},
+ {0x140085, 0x0},
+ {0x240080, 0x0},
+ {0x240081, 0x0},
+ {0x240082, 0x0},
+ {0x240083, 0x0},
+ {0x240084, 0x0},
+ {0x240085, 0x0},
+ {0x400fd, 0x0},
+ {0x400f1, 0x0},
+ {0x10011, 0x0},
+ {0x10012, 0x0},
+ {0x10013, 0x0},
+ {0x10018, 0x0},
+ {0x10002, 0x0},
+ {0x100b2, 0x0},
+ {0x101b4, 0x0},
+ {0x102b4, 0x0},
+ {0x103b4, 0x0},
+ {0x104b4, 0x0},
+ {0x105b4, 0x0},
+ {0x106b4, 0x0},
+ {0x107b4, 0x0},
+ {0x108b4, 0x0},
+ {0x11011, 0x0},
+ {0x11012, 0x0},
+ {0x11013, 0x0},
+ {0x11018, 0x0},
+ {0x11002, 0x0},
+ {0x110b2, 0x0},
+ {0x111b4, 0x0},
+ {0x112b4, 0x0},
+ {0x113b4, 0x0},
+ {0x114b4, 0x0},
+ {0x115b4, 0x0},
+ {0x116b4, 0x0},
+ {0x117b4, 0x0},
+ {0x118b4, 0x0},
+ {0x20089, 0x0},
+ {0xc0080, 0x0},
+ {0x200cb, 0x0},
+ {0x10068, 0x0},
+ {0x10069, 0x0},
+ {0x10168, 0x0},
+ {0x10169, 0x0},
+ {0x10268, 0x0},
+ {0x10269, 0x0},
+ {0x10368, 0x0},
+ {0x10369, 0x0},
+ {0x10468, 0x0},
+ {0x10469, 0x0},
+ {0x10568, 0x0},
+ {0x10569, 0x0},
+ {0x10668, 0x0},
+ {0x10669, 0x0},
+ {0x10768, 0x0},
+ {0x10769, 0x0},
+ {0x10868, 0x0},
+ {0x10869, 0x0},
+ {0x100aa, 0x0},
+ {0x10062, 0x0},
+ {0x10001, 0x0},
+ {0x100a0, 0x0},
+ {0x100a1, 0x0},
+ {0x100a2, 0x0},
+ {0x100a3, 0x0},
+ {0x100a4, 0x0},
+ {0x100a5, 0x0},
+ {0x100a6, 0x0},
+ {0x100a7, 0x0},
+ {0x11068, 0x0},
+ {0x11069, 0x0},
+ {0x11168, 0x0},
+ {0x11169, 0x0},
+ {0x11268, 0x0},
+ {0x11269, 0x0},
+ {0x11368, 0x0},
+ {0x11369, 0x0},
+ {0x11468, 0x0},
+ {0x11469, 0x0},
+ {0x11568, 0x0},
+ {0x11569, 0x0},
+ {0x11668, 0x0},
+ {0x11669, 0x0},
+ {0x11768, 0x0},
+ {0x11769, 0x0},
+ {0x11868, 0x0},
+ {0x11869, 0x0},
+ {0x110aa, 0x0},
+ {0x11062, 0x0},
+ {0x11001, 0x0},
+ {0x110a0, 0x0},
+ {0x110a1, 0x0},
+ {0x110a2, 0x0},
+ {0x110a3, 0x0},
+ {0x110a4, 0x0},
+ {0x110a5, 0x0},
+ {0x110a6, 0x0},
+ {0x110a7, 0x0},
+ {0x80, 0x0},
+ {0x1080, 0x0},
+ {0x2080, 0x0},
+ {0x10020, 0x0},
+ {0x10080, 0x0},
+ {0x10081, 0x0},
+ {0x100d0, 0x0},
+ {0x100d1, 0x0},
+ {0x1008c, 0x0},
+ {0x1008d, 0x0},
+ {0x10180, 0x0},
+ {0x10181, 0x0},
+ {0x101d0, 0x0},
+ {0x101d1, 0x0},
+ {0x1018c, 0x0},
+ {0x1018d, 0x0},
+ {0x100c0, 0x0},
+ {0x100c1, 0x0},
+ {0x101c0, 0x0},
+ {0x101c1, 0x0},
+ {0x102c0, 0x0},
+ {0x102c1, 0x0},
+ {0x103c0, 0x0},
+ {0x103c1, 0x0},
+ {0x104c0, 0x0},
+ {0x104c1, 0x0},
+ {0x105c0, 0x0},
+ {0x105c1, 0x0},
+ {0x106c0, 0x0},
+ {0x106c1, 0x0},
+ {0x107c0, 0x0},
+ {0x107c1, 0x0},
+ {0x108c0, 0x0},
+ {0x108c1, 0x0},
+ {0x100ae, 0x0},
+ {0x100af, 0x0},
+ {0x11020, 0x0},
+ {0x11080, 0x0},
+ {0x11081, 0x0},
+ {0x110d0, 0x0},
+ {0x110d1, 0x0},
+ {0x1108c, 0x0},
+ {0x1108d, 0x0},
+ {0x11180, 0x0},
+ {0x11181, 0x0},
+ {0x111d0, 0x0},
+ {0x111d1, 0x0},
+ {0x1118c, 0x0},
+ {0x1118d, 0x0},
+ {0x110c0, 0x0},
+ {0x110c1, 0x0},
+ {0x111c0, 0x0},
+ {0x111c1, 0x0},
+ {0x112c0, 0x0},
+ {0x112c1, 0x0},
+ {0x113c0, 0x0},
+ {0x113c1, 0x0},
+ {0x114c0, 0x0},
+ {0x114c1, 0x0},
+ {0x115c0, 0x0},
+ {0x115c1, 0x0},
+ {0x116c0, 0x0},
+ {0x116c1, 0x0},
+ {0x117c0, 0x0},
+ {0x117c1, 0x0},
+ {0x118c0, 0x0},
+ {0x118c1, 0x0},
+ {0x110ae, 0x0},
+ {0x110af, 0x0},
+ {0x90201, 0x0},
+ {0x90202, 0x0},
+ {0x90203, 0x0},
+ {0x90205, 0x0},
+ {0x90206, 0x0},
+ {0x90207, 0x0},
+ {0x90208, 0x0},
+ {0x20020, 0x0},
+ {0x100080, 0x0},
+ {0x101080, 0x0},
+ {0x102080, 0x0},
+ {0x110020, 0x0},
+ {0x110080, 0x0},
+ {0x110081, 0x0},
+ {0x1100d0, 0x0},
+ {0x1100d1, 0x0},
+ {0x11008c, 0x0},
+ {0x11008d, 0x0},
+ {0x110180, 0x0},
+ {0x110181, 0x0},
+ {0x1101d0, 0x0},
+ {0x1101d1, 0x0},
+ {0x11018c, 0x0},
+ {0x11018d, 0x0},
+ {0x1100c0, 0x0},
+ {0x1100c1, 0x0},
+ {0x1101c0, 0x0},
+ {0x1101c1, 0x0},
+ {0x1102c0, 0x0},
+ {0x1102c1, 0x0},
+ {0x1103c0, 0x0},
+ {0x1103c1, 0x0},
+ {0x1104c0, 0x0},
+ {0x1104c1, 0x0},
+ {0x1105c0, 0x0},
+ {0x1105c1, 0x0},
+ {0x1106c0, 0x0},
+ {0x1106c1, 0x0},
+ {0x1107c0, 0x0},
+ {0x1107c1, 0x0},
+ {0x1108c0, 0x0},
+ {0x1108c1, 0x0},
+ {0x1100ae, 0x0},
+ {0x1100af, 0x0},
+ {0x111020, 0x0},
+ {0x111080, 0x0},
+ {0x111081, 0x0},
+ {0x1110d0, 0x0},
+ {0x1110d1, 0x0},
+ {0x11108c, 0x0},
+ {0x11108d, 0x0},
+ {0x111180, 0x0},
+ {0x111181, 0x0},
+ {0x1111d0, 0x0},
+ {0x1111d1, 0x0},
+ {0x11118c, 0x0},
+ {0x11118d, 0x0},
+ {0x1110c0, 0x0},
+ {0x1110c1, 0x0},
+ {0x1111c0, 0x0},
+ {0x1111c1, 0x0},
+ {0x1112c0, 0x0},
+ {0x1112c1, 0x0},
+ {0x1113c0, 0x0},
+ {0x1113c1, 0x0},
+ {0x1114c0, 0x0},
+ {0x1114c1, 0x0},
+ {0x1115c0, 0x0},
+ {0x1115c1, 0x0},
+ {0x1116c0, 0x0},
+ {0x1116c1, 0x0},
+ {0x1117c0, 0x0},
+ {0x1117c1, 0x0},
+ {0x1118c0, 0x0},
+ {0x1118c1, 0x0},
+ {0x1110ae, 0x0},
+ {0x1110af, 0x0},
+ {0x190201, 0x0},
+ {0x190202, 0x0},
+ {0x190203, 0x0},
+ {0x190205, 0x0},
+ {0x190206, 0x0},
+ {0x190207, 0x0},
+ {0x190208, 0x0},
+ {0x120020, 0x0},
+ {0x200080, 0x0},
+ {0x201080, 0x0},
+ {0x202080, 0x0},
+ {0x210020, 0x0},
+ {0x210080, 0x0},
+ {0x210081, 0x0},
+ {0x2100d0, 0x0},
+ {0x2100d1, 0x0},
+ {0x21008c, 0x0},
+ {0x21008d, 0x0},
+ {0x210180, 0x0},
+ {0x210181, 0x0},
+ {0x2101d0, 0x0},
+ {0x2101d1, 0x0},
+ {0x21018c, 0x0},
+ {0x21018d, 0x0},
+ {0x2100c0, 0x0},
+ {0x2100c1, 0x0},
+ {0x2101c0, 0x0},
+ {0x2101c1, 0x0},
+ {0x2102c0, 0x0},
+ {0x2102c1, 0x0},
+ {0x2103c0, 0x0},
+ {0x2103c1, 0x0},
+ {0x2104c0, 0x0},
+ {0x2104c1, 0x0},
+ {0x2105c0, 0x0},
+ {0x2105c1, 0x0},
+ {0x2106c0, 0x0},
+ {0x2106c1, 0x0},
+ {0x2107c0, 0x0},
+ {0x2107c1, 0x0},
+ {0x2108c0, 0x0},
+ {0x2108c1, 0x0},
+ {0x2100ae, 0x0},
+ {0x2100af, 0x0},
+ {0x211020, 0x0},
+ {0x211080, 0x0},
+ {0x211081, 0x0},
+ {0x2110d0, 0x0},
+ {0x2110d1, 0x0},
+ {0x21108c, 0x0},
+ {0x21108d, 0x0},
+ {0x211180, 0x0},
+ {0x211181, 0x0},
+ {0x2111d0, 0x0},
+ {0x2111d1, 0x0},
+ {0x21118c, 0x0},
+ {0x21118d, 0x0},
+ {0x2110c0, 0x0},
+ {0x2110c1, 0x0},
+ {0x2111c0, 0x0},
+ {0x2111c1, 0x0},
+ {0x2112c0, 0x0},
+ {0x2112c1, 0x0},
+ {0x2113c0, 0x0},
+ {0x2113c1, 0x0},
+ {0x2114c0, 0x0},
+ {0x2114c1, 0x0},
+ {0x2115c0, 0x0},
+ {0x2115c1, 0x0},
+ {0x2116c0, 0x0},
+ {0x2116c1, 0x0},
+ {0x2117c0, 0x0},
+ {0x2117c1, 0x0},
+ {0x2118c0, 0x0},
+ {0x2118c1, 0x0},
+ {0x2110ae, 0x0},
+ {0x2110af, 0x0},
+ {0x290201, 0x0},
+ {0x290202, 0x0},
+ {0x290203, 0x0},
+ {0x290205, 0x0},
+ {0x290206, 0x0},
+ {0x290207, 0x0},
+ {0x290208, 0x0},
+ {0x220020, 0x0},
+ {0x20077, 0x0},
+ {0x20072, 0x0},
+ {0x20073, 0x0},
+ {0x400c0, 0x0},
+ {0x10040, 0x0},
+ {0x10140, 0x0},
+ {0x10240, 0x0},
+ {0x10340, 0x0},
+ {0x10440, 0x0},
+ {0x10540, 0x0},
+ {0x10640, 0x0},
+ {0x10740, 0x0},
+ {0x10840, 0x0},
+ {0x11040, 0x0},
+ {0x11140, 0x0},
+ {0x11240, 0x0},
+ {0x11340, 0x0},
+ {0x11440, 0x0},
+ {0x11540, 0x0},
+ {0x11640, 0x0},
+ {0x11740, 0x0},
+ {0x11840, 0x0},
+};
+
+/* P0 message block parameter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ {0xd0000, 0x0},
+ {0x54003, 0xe94},
+ {0x54004, 0x4},
+ {0x54006, 0x15},
+ {0x54008, 0x131f},
+ {0x54009, 0xc8},
+ {0x5400b, 0x4},
+ {0x5400d, 0x100},
+ {0x5400f, 0x100},
+ {0x54012, 0x110},
+ {0x54019, 0x36e4},
+ {0x5401a, 0x32},
+ {0x5401b, 0x1146},
+ {0x5401c, 0x1108},
+ {0x5401e, 0x4},
+ {0x5401f, 0x36e4},
+ {0x54020, 0x32},
+ {0x54021, 0x1146},
+ {0x54022, 0x1108},
+ {0x54024, 0x4},
+ {0x54032, 0xe400},
+ {0x54033, 0x3236},
+ {0x54034, 0x4600},
+ {0x54035, 0x811},
+ {0x54036, 0x11},
+ {0x54037, 0x400},
+ {0x54038, 0xe400},
+ {0x54039, 0x3236},
+ {0x5403a, 0x4600},
+ {0x5403b, 0x811},
+ {0x5403c, 0x11},
+ {0x5403d, 0x400},
+ {0xd0000, 0x1}
+};
+
+/* P1 message block parameter for training firmware */
+struct dram_cfg_param ddr_fsp1_cfg[] = {
+ {0xd0000, 0x0},
+ {0x54002, 0x1},
+ {0x54003, 0x74a},
+ {0x54004, 0x4},
+ {0x54006, 0x15},
+ {0x54008, 0x121f},
+ {0x54009, 0xc8},
+ {0x5400b, 0x4},
+ {0x5400d, 0x100},
+ {0x5400f, 0x100},
+ {0x54012, 0x110},
+ {0x54019, 0x1bb4},
+ {0x5401a, 0x32},
+ {0x5401b, 0x1146},
+ {0x5401c, 0x1108},
+ {0x5401e, 0x4},
+ {0x5401f, 0x1bb4},
+ {0x54020, 0x32},
+ {0x54021, 0x1146},
+ {0x54022, 0x1108},
+ {0x54024, 0x4},
+ {0x54032, 0xb400},
+ {0x54033, 0x321b},
+ {0x54034, 0x4600},
+ {0x54035, 0x811},
+ {0x54036, 0x11},
+ {0x54037, 0x400},
+ {0x54038, 0xb400},
+ {0x54039, 0x321b},
+ {0x5403a, 0x4600},
+ {0x5403b, 0x811},
+ {0x5403c, 0x11},
+ {0x5403d, 0x400},
+ {0xd0000, 0x1}
+};
+
+/* P2 message block parameter for training firmware */
+struct dram_cfg_param ddr_fsp2_cfg[] = {
+ {0xd0000, 0x0},
+ {0x54002, 0x102},
+ {0x54003, 0x270},
+ {0x54004, 0x4},
+ {0x54006, 0x15},
+ {0x54008, 0x121f},
+ {0x54009, 0xc8},
+ {0x5400b, 0x4},
+ {0x5400d, 0x100},
+ {0x5400f, 0x100},
+ {0x54012, 0x110},
+ {0x54019, 0x994},
+ {0x5401a, 0x32},
+ {0x5401b, 0x1146},
+ {0x5401c, 0x1100},
+ {0x5401e, 0x4},
+ {0x5401f, 0x994},
+ {0x54020, 0x32},
+ {0x54021, 0x1146},
+ {0x54022, 0x1100},
+ {0x54024, 0x4},
+ {0x54032, 0x9400},
+ {0x54033, 0x3209},
+ {0x54034, 0x4600},
+ {0x54035, 0x11},
+ {0x54036, 0x11},
+ {0x54037, 0x400},
+ {0x54038, 0x9400},
+ {0x54039, 0x3209},
+ {0x5403a, 0x4600},
+ {0x5403b, 0x11},
+ {0x5403c, 0x11},
+ {0x5403d, 0x400},
+ {0xd0000, 0x1}
+};
+
+/* P0 2D message block parameter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ {0xd0000, 0x0},
+ {0x54003, 0xe94},
+ {0x54004, 0x4},
+ {0x54006, 0x15},
+ {0x54008, 0x61},
+ {0x54009, 0xc8},
+ {0x5400b, 0x4},
+ {0x5400d, 0x100},
+ {0x5400f, 0x100},
+ {0x54010, 0x2080},
+ {0x54012, 0x110},
+ {0x54019, 0x36e4},
+ {0x5401a, 0x32},
+ {0x5401b, 0x1146},
+ {0x5401c, 0x1108},
+ {0x5401e, 0x4},
+ {0x5401f, 0x36e4},
+ {0x54020, 0x32},
+ {0x54021, 0x1146},
+ {0x54022, 0x1108},
+ {0x54024, 0x4},
+ {0x54032, 0xe400},
+ {0x54033, 0x3236},
+ {0x54034, 0x4600},
+ {0x54035, 0x811},
+ {0x54036, 0x11},
+ {0x54037, 0x400},
+ {0x54038, 0xe400},
+ {0x54039, 0x3236},
+ {0x5403a, 0x4600},
+ {0x5403b, 0x811},
+ {0x5403c, 0x11},
+ {0x5403d, 0x400},
+ {0xd0000, 0x1}
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ {0xd0000, 0x0},
+ {0x90000, 0x10},
+ {0x90001, 0x400},
+ {0x90002, 0x10e},
+ {0x90003, 0x0},
+ {0x90004, 0x0},
+ {0x90005, 0x8},
+ {0x90029, 0xb},
+ {0x9002a, 0x480},
+ {0x9002b, 0x109},
+ {0x9002c, 0x8},
+ {0x9002d, 0x448},
+ {0x9002e, 0x139},
+ {0x9002f, 0x8},
+ {0x90030, 0x478},
+ {0x90031, 0x109},
+ {0x90032, 0x0},
+ {0x90033, 0xe8},
+ {0x90034, 0x109},
+ {0x90035, 0x2},
+ {0x90036, 0x10},
+ {0x90037, 0x139},
+ {0x90038, 0xb},
+ {0x90039, 0x7c0},
+ {0x9003a, 0x139},
+ {0x9003b, 0x44},
+ {0x9003c, 0x633},
+ {0x9003d, 0x159},
+ {0x9003e, 0x14f},
+ {0x9003f, 0x630},
+ {0x90040, 0x159},
+ {0x90041, 0x47},
+ {0x90042, 0x633},
+ {0x90043, 0x149},
+ {0x90044, 0x4f},
+ {0x90045, 0x633},
+ {0x90046, 0x179},
+ {0x90047, 0x8},
+ {0x90048, 0xe0},
+ {0x90049, 0x109},
+ {0x9004a, 0x0},
+ {0x9004b, 0x7c8},
+ {0x9004c, 0x109},
+ {0x9004d, 0x0},
+ {0x9004e, 0x1},
+ {0x9004f, 0x8},
+ {0x90050, 0x30},
+ {0x90051, 0x65a},
+ {0x90052, 0x9},
+ {0x90053, 0x0},
+ {0x90054, 0x45a},
+ {0x90055, 0x9},
+ {0x90056, 0x0},
+ {0x90057, 0x448},
+ {0x90058, 0x109},
+ {0x90059, 0x40},
+ {0x9005a, 0x633},
+ {0x9005b, 0x179},
+ {0x9005c, 0x1},
+ {0x9005d, 0x618},
+ {0x9005e, 0x109},
+ {0x9005f, 0x40c0},
+ {0x90060, 0x633},
+ {0x90061, 0x149},
+ {0x90062, 0x8},
+ {0x90063, 0x4},
+ {0x90064, 0x48},
+ {0x90065, 0x4040},
+ {0x90066, 0x633},
+ {0x90067, 0x149},
+ {0x90068, 0x0},
+ {0x90069, 0x4},
+ {0x9006a, 0x48},
+ {0x9006b, 0x40},
+ {0x9006c, 0x633},
+ {0x9006d, 0x149},
+ {0x9006e, 0x0},
+ {0x9006f, 0x658},
+ {0x90070, 0x109},
+ {0x90071, 0x10},
+ {0x90072, 0x4},
+ {0x90073, 0x18},
+ {0x90074, 0x0},
+ {0x90075, 0x4},
+ {0x90076, 0x78},
+ {0x90077, 0x549},
+ {0x90078, 0x633},
+ {0x90079, 0x159},
+ {0x9007a, 0xd49},
+ {0x9007b, 0x633},
+ {0x9007c, 0x159},
+ {0x9007d, 0x94a},
+ {0x9007e, 0x633},
+ {0x9007f, 0x159},
+ {0x90080, 0x441},
+ {0x90081, 0x633},
+ {0x90082, 0x149},
+ {0x90083, 0x42},
+ {0x90084, 0x633},
+ {0x90085, 0x149},
+ {0x90086, 0x1},
+ {0x90087, 0x633},
+ {0x90088, 0x149},
+ {0x90089, 0x0},
+ {0x9008a, 0xe0},
+ {0x9008b, 0x109},
+ {0x9008c, 0xa},
+ {0x9008d, 0x10},
+ {0x9008e, 0x109},
+ {0x9008f, 0x9},
+ {0x90090, 0x3c0},
+ {0x90091, 0x149},
+ {0x90092, 0x9},
+ {0x90093, 0x3c0},
+ {0x90094, 0x159},
+ {0x90095, 0x18},
+ {0x90096, 0x10},
+ {0x90097, 0x109},
+ {0x90098, 0x0},
+ {0x90099, 0x3c0},
+ {0x9009a, 0x109},
+ {0x9009b, 0x18},
+ {0x9009c, 0x4},
+ {0x9009d, 0x48},
+ {0x9009e, 0x18},
+ {0x9009f, 0x4},
+ {0x900a0, 0x58},
+ {0x900a1, 0xb},
+ {0x900a2, 0x10},
+ {0x900a3, 0x109},
+ {0x900a4, 0x1},
+ {0x900a5, 0x10},
+ {0x900a6, 0x109},
+ {0x900a7, 0x5},
+ {0x900a8, 0x7c0},
+ {0x900a9, 0x109},
+ {0x40000, 0x811},
+ {0x40020, 0x880},
+ {0x40040, 0x0},
+ {0x40060, 0x0},
+ {0x40001, 0x4008},
+ {0x40021, 0x83},
+ {0x40041, 0x4f},
+ {0x40061, 0x0},
+ {0x40002, 0x4040},
+ {0x40022, 0x83},
+ {0x40042, 0x51},
+ {0x40062, 0x0},
+ {0x40003, 0x811},
+ {0x40023, 0x880},
+ {0x40043, 0x0},
+ {0x40063, 0x0},
+ {0x40004, 0x720},
+ {0x40024, 0xf},
+ {0x40044, 0x1740},
+ {0x40064, 0x0},
+ {0x40005, 0x16},
+ {0x40025, 0x83},
+ {0x40045, 0x4b},
+ {0x40065, 0x0},
+ {0x40006, 0x716},
+ {0x40026, 0xf},
+ {0x40046, 0x2001},
+ {0x40066, 0x0},
+ {0x40007, 0x716},
+ {0x40027, 0xf},
+ {0x40047, 0x2800},
+ {0x40067, 0x0},
+ {0x40008, 0x716},
+ {0x40028, 0xf},
+ {0x40048, 0xf00},
+ {0x40068, 0x0},
+ {0x40009, 0x720},
+ {0x40029, 0xf},
+ {0x40049, 0x1400},
+ {0x40069, 0x0},
+ {0x4000a, 0xe08},
+ {0x4002a, 0xc15},
+ {0x4004a, 0x0},
+ {0x4006a, 0x0},
+ {0x4000b, 0x625},
+ {0x4002b, 0x15},
+ {0x4004b, 0x0},
+ {0x4006b, 0x0},
+ {0x4000c, 0x4028},
+ {0x4002c, 0x80},
+ {0x4004c, 0x0},
+ {0x4006c, 0x0},
+ {0x4000d, 0xe08},
+ {0x4002d, 0xc1a},
+ {0x4004d, 0x0},
+ {0x4006d, 0x0},
+ {0x4000e, 0x625},
+ {0x4002e, 0x1a},
+ {0x4004e, 0x0},
+ {0x4006e, 0x0},
+ {0x4000f, 0x4040},
+ {0x4002f, 0x80},
+ {0x4004f, 0x0},
+ {0x4006f, 0x0},
+ {0x40010, 0x2604},
+ {0x40030, 0x15},
+ {0x40050, 0x0},
+ {0x40070, 0x0},
+ {0x40011, 0x708},
+ {0x40031, 0x5},
+ {0x40051, 0x0},
+ {0x40071, 0x2002},
+ {0x40012, 0x8},
+ {0x40032, 0x80},
+ {0x40052, 0x0},
+ {0x40072, 0x0},
+ {0x40013, 0x2604},
+ {0x40033, 0x1a},
+ {0x40053, 0x0},
+ {0x40073, 0x0},
+ {0x40014, 0x708},
+ {0x40034, 0xa},
+ {0x40054, 0x0},
+ {0x40074, 0x2002},
+ {0x40015, 0x4040},
+ {0x40035, 0x80},
+ {0x40055, 0x0},
+ {0x40075, 0x0},
+ {0x40016, 0x60a},
+ {0x40036, 0x15},
+ {0x40056, 0x1200},
+ {0x40076, 0x0},
+ {0x40017, 0x61a},
+ {0x40037, 0x15},
+ {0x40057, 0x1300},
+ {0x40077, 0x0},
+ {0x40018, 0x60a},
+ {0x40038, 0x1a},
+ {0x40058, 0x1200},
+ {0x40078, 0x0},
+ {0x40019, 0x642},
+ {0x40039, 0x1a},
+ {0x40059, 0x1300},
+ {0x40079, 0x0},
+ {0x4001a, 0x4808},
+ {0x4003a, 0x880},
+ {0x4005a, 0x0},
+ {0x4007a, 0x0},
+ {0x900aa, 0x0},
+ {0x900ab, 0x790},
+ {0x900ac, 0x11a},
+ {0x900ad, 0x8},
+ {0x900ae, 0x7aa},
+ {0x900af, 0x2a},
+ {0x900b0, 0x10},
+ {0x900b1, 0x7b2},
+ {0x900b2, 0x2a},
+ {0x900b3, 0x0},
+ {0x900b4, 0x7c8},
+ {0x900b5, 0x109},
+ {0x900b6, 0x10},
+ {0x900b7, 0x10},
+ {0x900b8, 0x109},
+ {0x900b9, 0x10},
+ {0x900ba, 0x2a8},
+ {0x900bb, 0x129},
+ {0x900bc, 0x8},
+ {0x900bd, 0x370},
+ {0x900be, 0x129},
+ {0x900bf, 0xa},
+ {0x900c0, 0x3c8},
+ {0x900c1, 0x1a9},
+ {0x900c2, 0xc},
+ {0x900c3, 0x408},
+ {0x900c4, 0x199},
+ {0x900c5, 0x14},
+ {0x900c6, 0x790},
+ {0x900c7, 0x11a},
+ {0x900c8, 0x8},
+ {0x900c9, 0x4},
+ {0x900ca, 0x18},
+ {0x900cb, 0xe},
+ {0x900cc, 0x408},
+ {0x900cd, 0x199},
+ {0x900ce, 0x8},
+ {0x900cf, 0x8568},
+ {0x900d0, 0x108},
+ {0x900d1, 0x18},
+ {0x900d2, 0x790},
+ {0x900d3, 0x16a},
+ {0x900d4, 0x8},
+ {0x900d5, 0x1d8},
+ {0x900d6, 0x169},
+ {0x900d7, 0x10},
+ {0x900d8, 0x8558},
+ {0x900d9, 0x168},
+ {0x900da, 0x1ff8},
+ {0x900db, 0x85a8},
+ {0x900dc, 0x1e8},
+ {0x900dd, 0x50},
+ {0x900de, 0x798},
+ {0x900df, 0x16a},
+ {0x900e0, 0x60},
+ {0x900e1, 0x7a0},
+ {0x900e2, 0x16a},
+ {0x900e3, 0x8},
+ {0x900e4, 0x8310},
+ {0x900e5, 0x168},
+ {0x900e6, 0x8},
+ {0x900e7, 0xa310},
+ {0x900e8, 0x168},
+ {0x900e9, 0xa},
+ {0x900ea, 0x408},
+ {0x900eb, 0x169},
+ {0x900ec, 0x6e},
+ {0x900ed, 0x0},
+ {0x900ee, 0x68},
+ {0x900ef, 0x0},
+ {0x900f0, 0x408},
+ {0x900f1, 0x169},
+ {0x900f2, 0x0},
+ {0x900f3, 0x8310},
+ {0x900f4, 0x168},
+ {0x900f5, 0x0},
+ {0x900f6, 0xa310},
+ {0x900f7, 0x168},
+ {0x900f8, 0x1ff8},
+ {0x900f9, 0x85a8},
+ {0x900fa, 0x1e8},
+ {0x900fb, 0x68},
+ {0x900fc, 0x798},
+ {0x900fd, 0x16a},
+ {0x900fe, 0x78},
+ {0x900ff, 0x7a0},
+ {0x90100, 0x16a},
+ {0x90101, 0x68},
+ {0x90102, 0x790},
+ {0x90103, 0x16a},
+ {0x90104, 0x8},
+ {0x90105, 0x8b10},
+ {0x90106, 0x168},
+ {0x90107, 0x8},
+ {0x90108, 0xab10},
+ {0x90109, 0x168},
+ {0x9010a, 0xa},
+ {0x9010b, 0x408},
+ {0x9010c, 0x169},
+ {0x9010d, 0x58},
+ {0x9010e, 0x0},
+ {0x9010f, 0x68},
+ {0x90110, 0x0},
+ {0x90111, 0x408},
+ {0x90112, 0x169},
+ {0x90113, 0x0},
+ {0x90114, 0x8b10},
+ {0x90115, 0x168},
+ {0x90116, 0x1},
+ {0x90117, 0xab10},
+ {0x90118, 0x168},
+ {0x90119, 0x0},
+ {0x9011a, 0x1d8},
+ {0x9011b, 0x169},
+ {0x9011c, 0x80},
+ {0x9011d, 0x790},
+ {0x9011e, 0x16a},
+ {0x9011f, 0x18},
+ {0x90120, 0x7aa},
+ {0x90121, 0x6a},
+ {0x90122, 0xa},
+ {0x90123, 0x0},
+ {0x90124, 0x1e9},
+ {0x90125, 0x8},
+ {0x90126, 0x8080},
+ {0x90127, 0x108},
+ {0x90128, 0xf},
+ {0x90129, 0x408},
+ {0x9012a, 0x169},
+ {0x9012b, 0xc},
+ {0x9012c, 0x0},
+ {0x9012d, 0x68},
+ {0x9012e, 0x9},
+ {0x9012f, 0x0},
+ {0x90130, 0x1a9},
+ {0x90131, 0x0},
+ {0x90132, 0x408},
+ {0x90133, 0x169},
+ {0x90134, 0x0},
+ {0x90135, 0x8080},
+ {0x90136, 0x108},
+ {0x90137, 0x8},
+ {0x90138, 0x7aa},
+ {0x90139, 0x6a},
+ {0x9013a, 0x0},
+ {0x9013b, 0x8568},
+ {0x9013c, 0x108},
+ {0x9013d, 0xb7},
+ {0x9013e, 0x790},
+ {0x9013f, 0x16a},
+ {0x90140, 0x1f},
+ {0x90141, 0x0},
+ {0x90142, 0x68},
+ {0x90143, 0x8},
+ {0x90144, 0x8558},
+ {0x90145, 0x168},
+ {0x90146, 0xf},
+ {0x90147, 0x408},
+ {0x90148, 0x169},
+ {0x90149, 0xd},
+ {0x9014a, 0x0},
+ {0x9014b, 0x68},
+ {0x9014c, 0x0},
+ {0x9014d, 0x408},
+ {0x9014e, 0x169},
+ {0x9014f, 0x0},
+ {0x90150, 0x8558},
+ {0x90151, 0x168},
+ {0x90152, 0x8},
+ {0x90153, 0x3c8},
+ {0x90154, 0x1a9},
+ {0x90155, 0x3},
+ {0x90156, 0x370},
+ {0x90157, 0x129},
+ {0x90158, 0x20},
+ {0x90159, 0x2aa},
+ {0x9015a, 0x9},
+ {0x9015b, 0x8},
+ {0x9015c, 0xe8},
+ {0x9015d, 0x109},
+ {0x9015e, 0x0},
+ {0x9015f, 0x8140},
+ {0x90160, 0x10c},
+ {0x90161, 0x10},
+ {0x90162, 0x8138},
+ {0x90163, 0x104},
+ {0x90164, 0x8},
+ {0x90165, 0x448},
+ {0x90166, 0x109},
+ {0x90167, 0xf},
+ {0x90168, 0x7c0},
+ {0x90169, 0x109},
+ {0x9016a, 0x0},
+ {0x9016b, 0xe8},
+ {0x9016c, 0x109},
+ {0x9016d, 0x47},
+ {0x9016e, 0x630},
+ {0x9016f, 0x109},
+ {0x90170, 0x8},
+ {0x90171, 0x618},
+ {0x90172, 0x109},
+ {0x90173, 0x8},
+ {0x90174, 0xe0},
+ {0x90175, 0x109},
+ {0x90176, 0x0},
+ {0x90177, 0x7c8},
+ {0x90178, 0x109},
+ {0x90179, 0x8},
+ {0x9017a, 0x8140},
+ {0x9017b, 0x10c},
+ {0x9017c, 0x0},
+ {0x9017d, 0x478},
+ {0x9017e, 0x109},
+ {0x9017f, 0x0},
+ {0x90180, 0x1},
+ {0x90181, 0x8},
+ {0x90182, 0x8},
+ {0x90183, 0x4},
+ {0x90184, 0x0},
+ {0x90006, 0x8},
+ {0x90007, 0x7c8},
+ {0x90008, 0x109},
+ {0x90009, 0x0},
+ {0x9000a, 0x400},
+ {0x9000b, 0x106},
+ {0xd00e7, 0x400},
+ {0x90017, 0x0},
+ {0x9001f, 0x2b},
+ {0x90026, 0x69},
+ {0x400d0, 0x0},
+ {0x400d1, 0x101},
+ {0x400d2, 0x105},
+ {0x400d3, 0x107},
+ {0x400d4, 0x10f},
+ {0x400d5, 0x202},
+ {0x400d6, 0x20a},
+ {0x400d7, 0x20b},
+ {0x2003a, 0x2},
+ {0x200be, 0x3},
+ {0x2000b, 0x41a},
+ {0x2000c, 0xe9},
+ {0x2000d, 0x91c},
+ {0x2000e, 0x2c},
+ {0x12000b, 0x20d},
+ {0x12000c, 0x74},
+ {0x12000d, 0x48e},
+ {0x12000e, 0x2c},
+ {0x22000b, 0xb0},
+ {0x22000c, 0x27},
+ {0x22000d, 0x186},
+ {0x22000e, 0x10},
+ {0x9000c, 0x0},
+ {0x9000d, 0x173},
+ {0x9000e, 0x60},
+ {0x9000f, 0x6110},
+ {0x90010, 0x2152},
+ {0x90011, 0xdfbd},
+ {0x90012, 0x2060},
+ {0x90013, 0x6152},
+ {0x20010, 0x5a},
+ {0x20011, 0x3},
+ {0x120010, 0x5a},
+ {0x120011, 0x3},
+ {0x40080, 0xe0},
+ {0x40081, 0x12},
+ {0x40082, 0xe0},
+ {0x40083, 0x12},
+ {0x40084, 0xe0},
+ {0x40085, 0x12},
+ {0x140080, 0xe0},
+ {0x140081, 0x12},
+ {0x140082, 0xe0},
+ {0x140083, 0x12},
+ {0x140084, 0xe0},
+ {0x140085, 0x12},
+ {0x240080, 0xe0},
+ {0x240081, 0x12},
+ {0x240082, 0xe0},
+ {0x240083, 0x12},
+ {0x240084, 0xe0},
+ {0x240085, 0x12},
+ {0x400fd, 0xf},
+ {0x400f1, 0xe},
+ {0x10011, 0x1},
+ {0x10012, 0x1},
+ {0x10013, 0x180},
+ {0x10018, 0x1},
+ {0x10002, 0x6209},
+ {0x100b2, 0x1},
+ {0x101b4, 0x1},
+ {0x102b4, 0x1},
+ {0x103b4, 0x1},
+ {0x104b4, 0x1},
+ {0x105b4, 0x1},
+ {0x106b4, 0x1},
+ {0x107b4, 0x1},
+ {0x108b4, 0x1},
+ {0x11011, 0x1},
+ {0x11012, 0x1},
+ {0x11013, 0x180},
+ {0x11018, 0x1},
+ {0x11002, 0x6209},
+ {0x110b2, 0x1},
+ {0x111b4, 0x1},
+ {0x112b4, 0x1},
+ {0x113b4, 0x1},
+ {0x114b4, 0x1},
+ {0x115b4, 0x1},
+ {0x116b4, 0x1},
+ {0x117b4, 0x1},
+ {0x118b4, 0x1},
+ {0x20089, 0x1},
+ {0x20088, 0x19},
+ {0xc0080, 0x0},
+ {0xd0000, 0x1},
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 3733mts 1D */
+ .drate = 3733,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P1 1866mts 1D */
+ .drate = 1866,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp1_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp1_cfg),
+ },
+ {
+ /* P2 625mts 1D */
+ .drate = 625,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp2_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp2_cfg),
+ },
+ {
+ /* P0 3733mts 2D */
+ .drate = 3733,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 3733, 1866, 625, },
+ .fsp_cfg = ddr_dram_fsp_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_dram_fsp_cfg),
+};
diff --git a/board/freescale/imx93_evk/lpddr4x_timing_ld.c b/board/freescale/imx93_evk/lpddr4x_timing_ld.c
new file mode 100644
index 00000000000..f080322f112
--- /dev/null
+++ b/board/freescale/imx93_evk/lpddr4x_timing_ld.c
@@ -0,0 +1,1496 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2022 NXP
+ *
+ * Generated code from IMX_DDR_tool
+ *
+ * Align with uboot version:
+ * imx_v2019.04_5.4.x and above version
+ */
+
+#include <linux/kernel.h>
+#include <asm/arch/ddr.h>
+
+struct dram_cfg_param ddr_ddrc_cfg[] = {
+ /** Initialize DDRC registers **/
+ { 0x4e300110, 0x44140001 },
+ { 0x4e301000, 0x0 },
+ { 0x4e300000, 0x8000ff },
+ { 0x4e300008, 0x0 },
+ { 0x4e300080, 0x80000512 },
+ { 0x4e300084, 0x0 },
+ { 0x4e300114, 0x2 },
+ { 0x4e300260, 0x0 },
+ { 0x4e30017c, 0x0 },
+ { 0x4e300f04, 0x80 },
+ { 0x4e300104, 0xaa77000e },
+ { 0x4e300108, 0x1816b1aa },
+ { 0x4e30010c, 0x5101e6 },
+ { 0x4e300100, 0x12552100 },
+ { 0x4e300160, 0x9002 },
+ { 0x4e30016c, 0x30900000 },
+ { 0x4e300250, 0x14 },
+ { 0x4e300254, 0xaa00aa },
+ { 0x4e300258, 0x8 },
+ { 0x4e30025c, 0x400 },
+ { 0x4e300300, 0x11281109 },
+ { 0x4e300304, 0xaa110a },
+ { 0x4e300308, 0x620071e },
+ { 0x4e300170, 0x8a0a0508 },
+ { 0x4e300124, 0xe3c0000 },
+ { 0x4e300804, 0x1f1f1f1f },
+ { 0x4e301240, 0x0 },
+ { 0x4e301244, 0x0 },
+ { 0x4e301248, 0x0 },
+ { 0x4e30124c, 0x0 },
+ { 0x4e301250, 0x0 },
+ { 0x4e301254, 0x0 },
+ { 0x4e301258, 0x0 },
+ { 0x4e30125c, 0x0 },
+};
+
+/* PHY Initialize Configuration */
+struct dram_cfg_param ddr_ddrphy_cfg[] = {
+ { 0x100a0, 0x4 },
+ { 0x100a1, 0x5 },
+ { 0x100a2, 0x6 },
+ { 0x100a3, 0x7 },
+ { 0x100a4, 0x0 },
+ { 0x100a5, 0x1 },
+ { 0x100a6, 0x2 },
+ { 0x100a7, 0x3 },
+ { 0x110a0, 0x3 },
+ { 0x110a1, 0x2 },
+ { 0x110a2, 0x0 },
+ { 0x110a3, 0x1 },
+ { 0x110a4, 0x7 },
+ { 0x110a5, 0x6 },
+ { 0x110a6, 0x4 },
+ { 0x110a7, 0x5 },
+ { 0x1005f, 0x5ff },
+ { 0x1015f, 0x5ff },
+ { 0x1105f, 0x5ff },
+ { 0x1115f, 0x5ff },
+ { 0x55, 0x1ff },
+ { 0x1055, 0x1ff },
+ { 0x2055, 0x1ff },
+ { 0x200c5, 0xb },
+ { 0x2002e, 0x2 },
+ { 0x90204, 0x0 },
+ { 0x20024, 0x1e3 },
+ { 0x2003a, 0x2 },
+ { 0x2007d, 0x212 },
+ { 0x2007c, 0x61 },
+ { 0x20056, 0x3 },
+ { 0x1004d, 0xe00 },
+ { 0x1014d, 0xe00 },
+ { 0x1104d, 0xe00 },
+ { 0x1114d, 0xe00 },
+ { 0x10049, 0xe00 },
+ { 0x10149, 0xe00 },
+ { 0x11049, 0xe00 },
+ { 0x11149, 0xe00 },
+ { 0x43, 0x60 },
+ { 0x1043, 0x60 },
+ { 0x2043, 0x60 },
+ { 0x20018, 0x1 },
+ { 0x20075, 0x4 },
+ { 0x20050, 0x0 },
+ { 0x2009b, 0x2 },
+ { 0x20008, 0x1d3 },
+ { 0x20088, 0x9 },
+ { 0x200b2, 0x10c },
+ { 0x10043, 0x5a1 },
+ { 0x10143, 0x5a1 },
+ { 0x11043, 0x5a1 },
+ { 0x11143, 0x5a1 },
+ { 0x200fa, 0x2 },
+ { 0x20019, 0x1 },
+ { 0x200f0, 0x0 },
+ { 0x200f1, 0x0 },
+ { 0x200f2, 0x4444 },
+ { 0x200f3, 0x8888 },
+ { 0x200f4, 0x5555 },
+ { 0x200f5, 0x0 },
+ { 0x200f6, 0x0 },
+ { 0x200f7, 0xf000 },
+ { 0x1004a, 0x500 },
+ { 0x1104a, 0x500 },
+ { 0x20025, 0x0 },
+ { 0x2002d, 0x0 },
+ { 0x20021, 0x0 },
+ { 0x2002c, 0x0 },
+};
+
+/* ddr phy trained csr */
+struct dram_cfg_param ddr_ddrphy_trained_csr[] = {
+ { 0x200b2, 0x0 },
+ { 0x1200b2, 0x0 },
+ { 0x2200b2, 0x0 },
+ { 0x200cb, 0x0 },
+ { 0x10043, 0x0 },
+ { 0x110043, 0x0 },
+ { 0x210043, 0x0 },
+ { 0x10143, 0x0 },
+ { 0x110143, 0x0 },
+ { 0x210143, 0x0 },
+ { 0x11043, 0x0 },
+ { 0x111043, 0x0 },
+ { 0x211043, 0x0 },
+ { 0x11143, 0x0 },
+ { 0x111143, 0x0 },
+ { 0x211143, 0x0 },
+ { 0x12043, 0x0 },
+ { 0x112043, 0x0 },
+ { 0x212043, 0x0 },
+ { 0x12143, 0x0 },
+ { 0x112143, 0x0 },
+ { 0x212143, 0x0 },
+ { 0x13043, 0x0 },
+ { 0x113043, 0x0 },
+ { 0x213043, 0x0 },
+ { 0x13143, 0x0 },
+ { 0x113143, 0x0 },
+ { 0x213143, 0x0 },
+ { 0x80, 0x0 },
+ { 0x100080, 0x0 },
+ { 0x200080, 0x0 },
+ { 0x1080, 0x0 },
+ { 0x101080, 0x0 },
+ { 0x201080, 0x0 },
+ { 0x2080, 0x0 },
+ { 0x102080, 0x0 },
+ { 0x202080, 0x0 },
+ { 0x3080, 0x0 },
+ { 0x103080, 0x0 },
+ { 0x203080, 0x0 },
+ { 0x4080, 0x0 },
+ { 0x104080, 0x0 },
+ { 0x204080, 0x0 },
+ { 0x5080, 0x0 },
+ { 0x105080, 0x0 },
+ { 0x205080, 0x0 },
+ { 0x6080, 0x0 },
+ { 0x106080, 0x0 },
+ { 0x206080, 0x0 },
+ { 0x7080, 0x0 },
+ { 0x107080, 0x0 },
+ { 0x207080, 0x0 },
+ { 0x8080, 0x0 },
+ { 0x108080, 0x0 },
+ { 0x208080, 0x0 },
+ { 0x9080, 0x0 },
+ { 0x109080, 0x0 },
+ { 0x209080, 0x0 },
+ { 0x10080, 0x0 },
+ { 0x110080, 0x0 },
+ { 0x210080, 0x0 },
+ { 0x10180, 0x0 },
+ { 0x110180, 0x0 },
+ { 0x210180, 0x0 },
+ { 0x11080, 0x0 },
+ { 0x111080, 0x0 },
+ { 0x211080, 0x0 },
+ { 0x11180, 0x0 },
+ { 0x111180, 0x0 },
+ { 0x211180, 0x0 },
+ { 0x12080, 0x0 },
+ { 0x112080, 0x0 },
+ { 0x212080, 0x0 },
+ { 0x12180, 0x0 },
+ { 0x112180, 0x0 },
+ { 0x212180, 0x0 },
+ { 0x13080, 0x0 },
+ { 0x113080, 0x0 },
+ { 0x213080, 0x0 },
+ { 0x13180, 0x0 },
+ { 0x113180, 0x0 },
+ { 0x213180, 0x0 },
+ { 0x10081, 0x0 },
+ { 0x110081, 0x0 },
+ { 0x210081, 0x0 },
+ { 0x10181, 0x0 },
+ { 0x110181, 0x0 },
+ { 0x210181, 0x0 },
+ { 0x11081, 0x0 },
+ { 0x111081, 0x0 },
+ { 0x211081, 0x0 },
+ { 0x11181, 0x0 },
+ { 0x111181, 0x0 },
+ { 0x211181, 0x0 },
+ { 0x12081, 0x0 },
+ { 0x112081, 0x0 },
+ { 0x212081, 0x0 },
+ { 0x12181, 0x0 },
+ { 0x112181, 0x0 },
+ { 0x212181, 0x0 },
+ { 0x13081, 0x0 },
+ { 0x113081, 0x0 },
+ { 0x213081, 0x0 },
+ { 0x13181, 0x0 },
+ { 0x113181, 0x0 },
+ { 0x213181, 0x0 },
+ { 0x100d0, 0x0 },
+ { 0x1100d0, 0x0 },
+ { 0x2100d0, 0x0 },
+ { 0x101d0, 0x0 },
+ { 0x1101d0, 0x0 },
+ { 0x2101d0, 0x0 },
+ { 0x110d0, 0x0 },
+ { 0x1110d0, 0x0 },
+ { 0x2110d0, 0x0 },
+ { 0x111d0, 0x0 },
+ { 0x1111d0, 0x0 },
+ { 0x2111d0, 0x0 },
+ { 0x120d0, 0x0 },
+ { 0x1120d0, 0x0 },
+ { 0x2120d0, 0x0 },
+ { 0x121d0, 0x0 },
+ { 0x1121d0, 0x0 },
+ { 0x2121d0, 0x0 },
+ { 0x130d0, 0x0 },
+ { 0x1130d0, 0x0 },
+ { 0x2130d0, 0x0 },
+ { 0x131d0, 0x0 },
+ { 0x1131d0, 0x0 },
+ { 0x2131d0, 0x0 },
+ { 0x100d1, 0x0 },
+ { 0x1100d1, 0x0 },
+ { 0x2100d1, 0x0 },
+ { 0x101d1, 0x0 },
+ { 0x1101d1, 0x0 },
+ { 0x2101d1, 0x0 },
+ { 0x110d1, 0x0 },
+ { 0x1110d1, 0x0 },
+ { 0x2110d1, 0x0 },
+ { 0x111d1, 0x0 },
+ { 0x1111d1, 0x0 },
+ { 0x2111d1, 0x0 },
+ { 0x120d1, 0x0 },
+ { 0x1120d1, 0x0 },
+ { 0x2120d1, 0x0 },
+ { 0x121d1, 0x0 },
+ { 0x1121d1, 0x0 },
+ { 0x2121d1, 0x0 },
+ { 0x130d1, 0x0 },
+ { 0x1130d1, 0x0 },
+ { 0x2130d1, 0x0 },
+ { 0x131d1, 0x0 },
+ { 0x1131d1, 0x0 },
+ { 0x2131d1, 0x0 },
+ { 0x10068, 0x0 },
+ { 0x10168, 0x0 },
+ { 0x10268, 0x0 },
+ { 0x10368, 0x0 },
+ { 0x10468, 0x0 },
+ { 0x10568, 0x0 },
+ { 0x10668, 0x0 },
+ { 0x10768, 0x0 },
+ { 0x10868, 0x0 },
+ { 0x11068, 0x0 },
+ { 0x11168, 0x0 },
+ { 0x11268, 0x0 },
+ { 0x11368, 0x0 },
+ { 0x11468, 0x0 },
+ { 0x11568, 0x0 },
+ { 0x11668, 0x0 },
+ { 0x11768, 0x0 },
+ { 0x11868, 0x0 },
+ { 0x12068, 0x0 },
+ { 0x12168, 0x0 },
+ { 0x12268, 0x0 },
+ { 0x12368, 0x0 },
+ { 0x12468, 0x0 },
+ { 0x12568, 0x0 },
+ { 0x12668, 0x0 },
+ { 0x12768, 0x0 },
+ { 0x12868, 0x0 },
+ { 0x13068, 0x0 },
+ { 0x13168, 0x0 },
+ { 0x13268, 0x0 },
+ { 0x13368, 0x0 },
+ { 0x13468, 0x0 },
+ { 0x13568, 0x0 },
+ { 0x13668, 0x0 },
+ { 0x13768, 0x0 },
+ { 0x13868, 0x0 },
+ { 0x10069, 0x0 },
+ { 0x10169, 0x0 },
+ { 0x10269, 0x0 },
+ { 0x10369, 0x0 },
+ { 0x10469, 0x0 },
+ { 0x10569, 0x0 },
+ { 0x10669, 0x0 },
+ { 0x10769, 0x0 },
+ { 0x10869, 0x0 },
+ { 0x11069, 0x0 },
+ { 0x11169, 0x0 },
+ { 0x11269, 0x0 },
+ { 0x11369, 0x0 },
+ { 0x11469, 0x0 },
+ { 0x11569, 0x0 },
+ { 0x11669, 0x0 },
+ { 0x11769, 0x0 },
+ { 0x11869, 0x0 },
+ { 0x12069, 0x0 },
+ { 0x12169, 0x0 },
+ { 0x12269, 0x0 },
+ { 0x12369, 0x0 },
+ { 0x12469, 0x0 },
+ { 0x12569, 0x0 },
+ { 0x12669, 0x0 },
+ { 0x12769, 0x0 },
+ { 0x12869, 0x0 },
+ { 0x13069, 0x0 },
+ { 0x13169, 0x0 },
+ { 0x13269, 0x0 },
+ { 0x13369, 0x0 },
+ { 0x13469, 0x0 },
+ { 0x13569, 0x0 },
+ { 0x13669, 0x0 },
+ { 0x13769, 0x0 },
+ { 0x13869, 0x0 },
+ { 0x1008c, 0x0 },
+ { 0x11008c, 0x0 },
+ { 0x21008c, 0x0 },
+ { 0x1018c, 0x0 },
+ { 0x11018c, 0x0 },
+ { 0x21018c, 0x0 },
+ { 0x1108c, 0x0 },
+ { 0x11108c, 0x0 },
+ { 0x21108c, 0x0 },
+ { 0x1118c, 0x0 },
+ { 0x11118c, 0x0 },
+ { 0x21118c, 0x0 },
+ { 0x1208c, 0x0 },
+ { 0x11208c, 0x0 },
+ { 0x21208c, 0x0 },
+ { 0x1218c, 0x0 },
+ { 0x11218c, 0x0 },
+ { 0x21218c, 0x0 },
+ { 0x1308c, 0x0 },
+ { 0x11308c, 0x0 },
+ { 0x21308c, 0x0 },
+ { 0x1318c, 0x0 },
+ { 0x11318c, 0x0 },
+ { 0x21318c, 0x0 },
+ { 0x1008d, 0x0 },
+ { 0x11008d, 0x0 },
+ { 0x21008d, 0x0 },
+ { 0x1018d, 0x0 },
+ { 0x11018d, 0x0 },
+ { 0x21018d, 0x0 },
+ { 0x1108d, 0x0 },
+ { 0x11108d, 0x0 },
+ { 0x21108d, 0x0 },
+ { 0x1118d, 0x0 },
+ { 0x11118d, 0x0 },
+ { 0x21118d, 0x0 },
+ { 0x1208d, 0x0 },
+ { 0x11208d, 0x0 },
+ { 0x21208d, 0x0 },
+ { 0x1218d, 0x0 },
+ { 0x11218d, 0x0 },
+ { 0x21218d, 0x0 },
+ { 0x1308d, 0x0 },
+ { 0x11308d, 0x0 },
+ { 0x21308d, 0x0 },
+ { 0x1318d, 0x0 },
+ { 0x11318d, 0x0 },
+ { 0x21318d, 0x0 },
+ { 0x100c0, 0x0 },
+ { 0x1100c0, 0x0 },
+ { 0x2100c0, 0x0 },
+ { 0x101c0, 0x0 },
+ { 0x1101c0, 0x0 },
+ { 0x2101c0, 0x0 },
+ { 0x102c0, 0x0 },
+ { 0x1102c0, 0x0 },
+ { 0x2102c0, 0x0 },
+ { 0x103c0, 0x0 },
+ { 0x1103c0, 0x0 },
+ { 0x2103c0, 0x0 },
+ { 0x104c0, 0x0 },
+ { 0x1104c0, 0x0 },
+ { 0x2104c0, 0x0 },
+ { 0x105c0, 0x0 },
+ { 0x1105c0, 0x0 },
+ { 0x2105c0, 0x0 },
+ { 0x106c0, 0x0 },
+ { 0x1106c0, 0x0 },
+ { 0x2106c0, 0x0 },
+ { 0x107c0, 0x0 },
+ { 0x1107c0, 0x0 },
+ { 0x2107c0, 0x0 },
+ { 0x108c0, 0x0 },
+ { 0x1108c0, 0x0 },
+ { 0x2108c0, 0x0 },
+ { 0x110c0, 0x0 },
+ { 0x1110c0, 0x0 },
+ { 0x2110c0, 0x0 },
+ { 0x111c0, 0x0 },
+ { 0x1111c0, 0x0 },
+ { 0x2111c0, 0x0 },
+ { 0x112c0, 0x0 },
+ { 0x1112c0, 0x0 },
+ { 0x2112c0, 0x0 },
+ { 0x113c0, 0x0 },
+ { 0x1113c0, 0x0 },
+ { 0x2113c0, 0x0 },
+ { 0x114c0, 0x0 },
+ { 0x1114c0, 0x0 },
+ { 0x2114c0, 0x0 },
+ { 0x115c0, 0x0 },
+ { 0x1115c0, 0x0 },
+ { 0x2115c0, 0x0 },
+ { 0x116c0, 0x0 },
+ { 0x1116c0, 0x0 },
+ { 0x2116c0, 0x0 },
+ { 0x117c0, 0x0 },
+ { 0x1117c0, 0x0 },
+ { 0x2117c0, 0x0 },
+ { 0x118c0, 0x0 },
+ { 0x1118c0, 0x0 },
+ { 0x2118c0, 0x0 },
+ { 0x120c0, 0x0 },
+ { 0x1120c0, 0x0 },
+ { 0x2120c0, 0x0 },
+ { 0x121c0, 0x0 },
+ { 0x1121c0, 0x0 },
+ { 0x2121c0, 0x0 },
+ { 0x122c0, 0x0 },
+ { 0x1122c0, 0x0 },
+ { 0x2122c0, 0x0 },
+ { 0x123c0, 0x0 },
+ { 0x1123c0, 0x0 },
+ { 0x2123c0, 0x0 },
+ { 0x124c0, 0x0 },
+ { 0x1124c0, 0x0 },
+ { 0x2124c0, 0x0 },
+ { 0x125c0, 0x0 },
+ { 0x1125c0, 0x0 },
+ { 0x2125c0, 0x0 },
+ { 0x126c0, 0x0 },
+ { 0x1126c0, 0x0 },
+ { 0x2126c0, 0x0 },
+ { 0x127c0, 0x0 },
+ { 0x1127c0, 0x0 },
+ { 0x2127c0, 0x0 },
+ { 0x128c0, 0x0 },
+ { 0x1128c0, 0x0 },
+ { 0x2128c0, 0x0 },
+ { 0x130c0, 0x0 },
+ { 0x1130c0, 0x0 },
+ { 0x2130c0, 0x0 },
+ { 0x131c0, 0x0 },
+ { 0x1131c0, 0x0 },
+ { 0x2131c0, 0x0 },
+ { 0x132c0, 0x0 },
+ { 0x1132c0, 0x0 },
+ { 0x2132c0, 0x0 },
+ { 0x133c0, 0x0 },
+ { 0x1133c0, 0x0 },
+ { 0x2133c0, 0x0 },
+ { 0x134c0, 0x0 },
+ { 0x1134c0, 0x0 },
+ { 0x2134c0, 0x0 },
+ { 0x135c0, 0x0 },
+ { 0x1135c0, 0x0 },
+ { 0x2135c0, 0x0 },
+ { 0x136c0, 0x0 },
+ { 0x1136c0, 0x0 },
+ { 0x2136c0, 0x0 },
+ { 0x137c0, 0x0 },
+ { 0x1137c0, 0x0 },
+ { 0x2137c0, 0x0 },
+ { 0x138c0, 0x0 },
+ { 0x1138c0, 0x0 },
+ { 0x2138c0, 0x0 },
+ { 0x100c1, 0x0 },
+ { 0x1100c1, 0x0 },
+ { 0x2100c1, 0x0 },
+ { 0x101c1, 0x0 },
+ { 0x1101c1, 0x0 },
+ { 0x2101c1, 0x0 },
+ { 0x102c1, 0x0 },
+ { 0x1102c1, 0x0 },
+ { 0x2102c1, 0x0 },
+ { 0x103c1, 0x0 },
+ { 0x1103c1, 0x0 },
+ { 0x2103c1, 0x0 },
+ { 0x104c1, 0x0 },
+ { 0x1104c1, 0x0 },
+ { 0x2104c1, 0x0 },
+ { 0x105c1, 0x0 },
+ { 0x1105c1, 0x0 },
+ { 0x2105c1, 0x0 },
+ { 0x106c1, 0x0 },
+ { 0x1106c1, 0x0 },
+ { 0x2106c1, 0x0 },
+ { 0x107c1, 0x0 },
+ { 0x1107c1, 0x0 },
+ { 0x2107c1, 0x0 },
+ { 0x108c1, 0x0 },
+ { 0x1108c1, 0x0 },
+ { 0x2108c1, 0x0 },
+ { 0x110c1, 0x0 },
+ { 0x1110c1, 0x0 },
+ { 0x2110c1, 0x0 },
+ { 0x111c1, 0x0 },
+ { 0x1111c1, 0x0 },
+ { 0x2111c1, 0x0 },
+ { 0x112c1, 0x0 },
+ { 0x1112c1, 0x0 },
+ { 0x2112c1, 0x0 },
+ { 0x113c1, 0x0 },
+ { 0x1113c1, 0x0 },
+ { 0x2113c1, 0x0 },
+ { 0x114c1, 0x0 },
+ { 0x1114c1, 0x0 },
+ { 0x2114c1, 0x0 },
+ { 0x115c1, 0x0 },
+ { 0x1115c1, 0x0 },
+ { 0x2115c1, 0x0 },
+ { 0x116c1, 0x0 },
+ { 0x1116c1, 0x0 },
+ { 0x2116c1, 0x0 },
+ { 0x117c1, 0x0 },
+ { 0x1117c1, 0x0 },
+ { 0x2117c1, 0x0 },
+ { 0x118c1, 0x0 },
+ { 0x1118c1, 0x0 },
+ { 0x2118c1, 0x0 },
+ { 0x120c1, 0x0 },
+ { 0x1120c1, 0x0 },
+ { 0x2120c1, 0x0 },
+ { 0x121c1, 0x0 },
+ { 0x1121c1, 0x0 },
+ { 0x2121c1, 0x0 },
+ { 0x122c1, 0x0 },
+ { 0x1122c1, 0x0 },
+ { 0x2122c1, 0x0 },
+ { 0x123c1, 0x0 },
+ { 0x1123c1, 0x0 },
+ { 0x2123c1, 0x0 },
+ { 0x124c1, 0x0 },
+ { 0x1124c1, 0x0 },
+ { 0x2124c1, 0x0 },
+ { 0x125c1, 0x0 },
+ { 0x1125c1, 0x0 },
+ { 0x2125c1, 0x0 },
+ { 0x126c1, 0x0 },
+ { 0x1126c1, 0x0 },
+ { 0x2126c1, 0x0 },
+ { 0x127c1, 0x0 },
+ { 0x1127c1, 0x0 },
+ { 0x2127c1, 0x0 },
+ { 0x128c1, 0x0 },
+ { 0x1128c1, 0x0 },
+ { 0x2128c1, 0x0 },
+ { 0x130c1, 0x0 },
+ { 0x1130c1, 0x0 },
+ { 0x2130c1, 0x0 },
+ { 0x131c1, 0x0 },
+ { 0x1131c1, 0x0 },
+ { 0x2131c1, 0x0 },
+ { 0x132c1, 0x0 },
+ { 0x1132c1, 0x0 },
+ { 0x2132c1, 0x0 },
+ { 0x133c1, 0x0 },
+ { 0x1133c1, 0x0 },
+ { 0x2133c1, 0x0 },
+ { 0x134c1, 0x0 },
+ { 0x1134c1, 0x0 },
+ { 0x2134c1, 0x0 },
+ { 0x135c1, 0x0 },
+ { 0x1135c1, 0x0 },
+ { 0x2135c1, 0x0 },
+ { 0x136c1, 0x0 },
+ { 0x1136c1, 0x0 },
+ { 0x2136c1, 0x0 },
+ { 0x137c1, 0x0 },
+ { 0x1137c1, 0x0 },
+ { 0x2137c1, 0x0 },
+ { 0x138c1, 0x0 },
+ { 0x1138c1, 0x0 },
+ { 0x2138c1, 0x0 },
+ { 0x10020, 0x0 },
+ { 0x110020, 0x0 },
+ { 0x210020, 0x0 },
+ { 0x11020, 0x0 },
+ { 0x111020, 0x0 },
+ { 0x211020, 0x0 },
+ { 0x12020, 0x0 },
+ { 0x112020, 0x0 },
+ { 0x212020, 0x0 },
+ { 0x13020, 0x0 },
+ { 0x113020, 0x0 },
+ { 0x213020, 0x0 },
+ { 0x20072, 0x0 },
+ { 0x20073, 0x0 },
+ { 0x20074, 0x0 },
+ { 0x100aa, 0x0 },
+ { 0x110aa, 0x0 },
+ { 0x120aa, 0x0 },
+ { 0x130aa, 0x0 },
+ { 0x20010, 0x0 },
+ { 0x120010, 0x0 },
+ { 0x220010, 0x0 },
+ { 0x20011, 0x0 },
+ { 0x120011, 0x0 },
+ { 0x220011, 0x0 },
+ { 0x100ae, 0x0 },
+ { 0x1100ae, 0x0 },
+ { 0x2100ae, 0x0 },
+ { 0x100af, 0x0 },
+ { 0x1100af, 0x0 },
+ { 0x2100af, 0x0 },
+ { 0x110ae, 0x0 },
+ { 0x1110ae, 0x0 },
+ { 0x2110ae, 0x0 },
+ { 0x110af, 0x0 },
+ { 0x1110af, 0x0 },
+ { 0x2110af, 0x0 },
+ { 0x120ae, 0x0 },
+ { 0x1120ae, 0x0 },
+ { 0x2120ae, 0x0 },
+ { 0x120af, 0x0 },
+ { 0x1120af, 0x0 },
+ { 0x2120af, 0x0 },
+ { 0x130ae, 0x0 },
+ { 0x1130ae, 0x0 },
+ { 0x2130ae, 0x0 },
+ { 0x130af, 0x0 },
+ { 0x1130af, 0x0 },
+ { 0x2130af, 0x0 },
+ { 0x20020, 0x0 },
+ { 0x120020, 0x0 },
+ { 0x220020, 0x0 },
+ { 0x100a0, 0x0 },
+ { 0x100a1, 0x0 },
+ { 0x100a2, 0x0 },
+ { 0x100a3, 0x0 },
+ { 0x100a4, 0x0 },
+ { 0x100a5, 0x0 },
+ { 0x100a6, 0x0 },
+ { 0x100a7, 0x0 },
+ { 0x110a0, 0x0 },
+ { 0x110a1, 0x0 },
+ { 0x110a2, 0x0 },
+ { 0x110a3, 0x0 },
+ { 0x110a4, 0x0 },
+ { 0x110a5, 0x0 },
+ { 0x110a6, 0x0 },
+ { 0x110a7, 0x0 },
+ { 0x120a0, 0x0 },
+ { 0x120a1, 0x0 },
+ { 0x120a2, 0x0 },
+ { 0x120a3, 0x0 },
+ { 0x120a4, 0x0 },
+ { 0x120a5, 0x0 },
+ { 0x120a6, 0x0 },
+ { 0x120a7, 0x0 },
+ { 0x130a0, 0x0 },
+ { 0x130a1, 0x0 },
+ { 0x130a2, 0x0 },
+ { 0x130a3, 0x0 },
+ { 0x130a4, 0x0 },
+ { 0x130a5, 0x0 },
+ { 0x130a6, 0x0 },
+ { 0x130a7, 0x0 },
+ { 0x2007c, 0x0 },
+ { 0x12007c, 0x0 },
+ { 0x22007c, 0x0 },
+ { 0x2007d, 0x0 },
+ { 0x12007d, 0x0 },
+ { 0x22007d, 0x0 },
+ { 0x400fd, 0x0 },
+ { 0x400c0, 0x0 },
+ { 0x90201, 0x0 },
+ { 0x190201, 0x0 },
+ { 0x290201, 0x0 },
+ { 0x90202, 0x0 },
+ { 0x190202, 0x0 },
+ { 0x290202, 0x0 },
+ { 0x90203, 0x0 },
+ { 0x190203, 0x0 },
+ { 0x290203, 0x0 },
+ { 0x90204, 0x0 },
+ { 0x190204, 0x0 },
+ { 0x290204, 0x0 },
+ { 0x90205, 0x0 },
+ { 0x190205, 0x0 },
+ { 0x290205, 0x0 },
+ { 0x90206, 0x0 },
+ { 0x190206, 0x0 },
+ { 0x290206, 0x0 },
+ { 0x90207, 0x0 },
+ { 0x190207, 0x0 },
+ { 0x290207, 0x0 },
+ { 0x90208, 0x0 },
+ { 0x190208, 0x0 },
+ { 0x290208, 0x0 },
+ { 0x10062, 0x0 },
+ { 0x10162, 0x0 },
+ { 0x10262, 0x0 },
+ { 0x10362, 0x0 },
+ { 0x10462, 0x0 },
+ { 0x10562, 0x0 },
+ { 0x10662, 0x0 },
+ { 0x10762, 0x0 },
+ { 0x10862, 0x0 },
+ { 0x11062, 0x0 },
+ { 0x11162, 0x0 },
+ { 0x11262, 0x0 },
+ { 0x11362, 0x0 },
+ { 0x11462, 0x0 },
+ { 0x11562, 0x0 },
+ { 0x11662, 0x0 },
+ { 0x11762, 0x0 },
+ { 0x11862, 0x0 },
+ { 0x12062, 0x0 },
+ { 0x12162, 0x0 },
+ { 0x12262, 0x0 },
+ { 0x12362, 0x0 },
+ { 0x12462, 0x0 },
+ { 0x12562, 0x0 },
+ { 0x12662, 0x0 },
+ { 0x12762, 0x0 },
+ { 0x12862, 0x0 },
+ { 0x13062, 0x0 },
+ { 0x13162, 0x0 },
+ { 0x13262, 0x0 },
+ { 0x13362, 0x0 },
+ { 0x13462, 0x0 },
+ { 0x13562, 0x0 },
+ { 0x13662, 0x0 },
+ { 0x13762, 0x0 },
+ { 0x13862, 0x0 },
+ { 0x20077, 0x0 },
+ { 0x10001, 0x0 },
+ { 0x11001, 0x0 },
+ { 0x12001, 0x0 },
+ { 0x13001, 0x0 },
+ { 0x10040, 0x0 },
+ { 0x10140, 0x0 },
+ { 0x10240, 0x0 },
+ { 0x10340, 0x0 },
+ { 0x10440, 0x0 },
+ { 0x10540, 0x0 },
+ { 0x10640, 0x0 },
+ { 0x10740, 0x0 },
+ { 0x10840, 0x0 },
+ { 0x10030, 0x0 },
+ { 0x10130, 0x0 },
+ { 0x10230, 0x0 },
+ { 0x10330, 0x0 },
+ { 0x10430, 0x0 },
+ { 0x10530, 0x0 },
+ { 0x10630, 0x0 },
+ { 0x10730, 0x0 },
+ { 0x10830, 0x0 },
+ { 0x11040, 0x0 },
+ { 0x11140, 0x0 },
+ { 0x11240, 0x0 },
+ { 0x11340, 0x0 },
+ { 0x11440, 0x0 },
+ { 0x11540, 0x0 },
+ { 0x11640, 0x0 },
+ { 0x11740, 0x0 },
+ { 0x11840, 0x0 },
+ { 0x11030, 0x0 },
+ { 0x11130, 0x0 },
+ { 0x11230, 0x0 },
+ { 0x11330, 0x0 },
+ { 0x11430, 0x0 },
+ { 0x11530, 0x0 },
+ { 0x11630, 0x0 },
+ { 0x11730, 0x0 },
+ { 0x11830, 0x0 },
+ { 0x12040, 0x0 },
+ { 0x12140, 0x0 },
+ { 0x12240, 0x0 },
+ { 0x12340, 0x0 },
+ { 0x12440, 0x0 },
+ { 0x12540, 0x0 },
+ { 0x12640, 0x0 },
+ { 0x12740, 0x0 },
+ { 0x12840, 0x0 },
+ { 0x12030, 0x0 },
+ { 0x12130, 0x0 },
+ { 0x12230, 0x0 },
+ { 0x12330, 0x0 },
+ { 0x12430, 0x0 },
+ { 0x12530, 0x0 },
+ { 0x12630, 0x0 },
+ { 0x12730, 0x0 },
+ { 0x12830, 0x0 },
+ { 0x13040, 0x0 },
+ { 0x13140, 0x0 },
+ { 0x13240, 0x0 },
+ { 0x13340, 0x0 },
+ { 0x13440, 0x0 },
+ { 0x13540, 0x0 },
+ { 0x13640, 0x0 },
+ { 0x13740, 0x0 },
+ { 0x13840, 0x0 },
+ { 0x13030, 0x0 },
+ { 0x13130, 0x0 },
+ { 0x13230, 0x0 },
+ { 0x13330, 0x0 },
+ { 0x13430, 0x0 },
+ { 0x13530, 0x0 },
+ { 0x13630, 0x0 },
+ { 0x13730, 0x0 },
+ { 0x13830, 0x0 },
+};
+
+/* P0 message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x74a },
+ { 0x54004, 0x4 },
+ { 0x54006, 0x15 },
+ { 0x54008, 0x131f },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x4 },
+ { 0x5400c, 0x1 },
+ { 0x5400d, 0x100 },
+ { 0x5400f, 0x100 },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x1bb4 },
+ { 0x5401a, 0x32 },
+ { 0x5401b, 0x1f46 },
+ { 0x5401c, 0x1708 },
+ { 0x5401e, 0x6 },
+ { 0x5401f, 0x1bb4 },
+ { 0x54020, 0x32 },
+ { 0x54021, 0x1f46 },
+ { 0x54022, 0x1708 },
+ { 0x54024, 0x6 },
+ { 0x54032, 0xb400 },
+ { 0x54033, 0x321b },
+ { 0x54034, 0x4600 },
+ { 0x54035, 0x81f },
+ { 0x54036, 0x17 },
+ { 0x54037, 0x600 },
+ { 0x54038, 0xb400 },
+ { 0x54039, 0x321b },
+ { 0x5403a, 0x4600 },
+ { 0x5403b, 0x81f },
+ { 0x5403c, 0x17 },
+ { 0x5403d, 0x600 },
+ { 0xd0000, 0x1 },
+};
+
+/* P0 2D message block paremeter for training firmware */
+struct dram_cfg_param ddr_fsp0_2d_cfg[] = {
+ { 0xd0000, 0x0 },
+ { 0x54003, 0x74a },
+ { 0x54004, 0x4 },
+ { 0x54006, 0x15 },
+ { 0x54008, 0x61 },
+ { 0x54009, 0xc8 },
+ { 0x5400b, 0x4 },
+ { 0x5400c, 0x1 },
+ { 0x5400d, 0x100 },
+ { 0x5400f, 0x100 },
+ { 0x54010, 0x2080 },
+ { 0x54012, 0x110 },
+ { 0x54019, 0x1bb4 },
+ { 0x5401a, 0x32 },
+ { 0x5401b, 0x1f46 },
+ { 0x5401c, 0x1708 },
+ { 0x5401e, 0x6 },
+ { 0x5401f, 0x1bb4 },
+ { 0x54020, 0x32 },
+ { 0x54021, 0x1f46 },
+ { 0x54022, 0x1708 },
+ { 0x54024, 0x6 },
+ { 0x54032, 0xb400 },
+ { 0x54033, 0x321b },
+ { 0x54034, 0x4600 },
+ { 0x54035, 0x81f },
+ { 0x54036, 0x17 },
+ { 0x54037, 0x600 },
+ { 0x54038, 0xb400 },
+ { 0x54039, 0x321b },
+ { 0x5403a, 0x4600 },
+ { 0x5403b, 0x81f },
+ { 0x5403c, 0x17 },
+ { 0x5403d, 0x600 },
+ { 0xd0000, 0x1 },
+};
+
+/* DRAM PHY init engine image */
+struct dram_cfg_param ddr_phy_pie[] = {
+ { 0xd0000, 0x0 },
+ { 0x90000, 0x10 },
+ { 0x90001, 0x400 },
+ { 0x90002, 0x10e },
+ { 0x90003, 0x0 },
+ { 0x90004, 0x0 },
+ { 0x90005, 0x8 },
+ { 0x90029, 0xb },
+ { 0x9002a, 0x480 },
+ { 0x9002b, 0x109 },
+ { 0x9002c, 0x8 },
+ { 0x9002d, 0x448 },
+ { 0x9002e, 0x139 },
+ { 0x9002f, 0x8 },
+ { 0x90030, 0x478 },
+ { 0x90031, 0x109 },
+ { 0x90032, 0x0 },
+ { 0x90033, 0xe8 },
+ { 0x90034, 0x109 },
+ { 0x90035, 0x2 },
+ { 0x90036, 0x10 },
+ { 0x90037, 0x139 },
+ { 0x90038, 0xb },
+ { 0x90039, 0x7c0 },
+ { 0x9003a, 0x139 },
+ { 0x9003b, 0x44 },
+ { 0x9003c, 0x633 },
+ { 0x9003d, 0x159 },
+ { 0x9003e, 0x14f },
+ { 0x9003f, 0x630 },
+ { 0x90040, 0x159 },
+ { 0x90041, 0x47 },
+ { 0x90042, 0x633 },
+ { 0x90043, 0x149 },
+ { 0x90044, 0x4f },
+ { 0x90045, 0x633 },
+ { 0x90046, 0x179 },
+ { 0x90047, 0x8 },
+ { 0x90048, 0xe0 },
+ { 0x90049, 0x109 },
+ { 0x9004a, 0x0 },
+ { 0x9004b, 0x7c8 },
+ { 0x9004c, 0x109 },
+ { 0x9004d, 0x0 },
+ { 0x9004e, 0x1 },
+ { 0x9004f, 0x8 },
+ { 0x90050, 0x30 },
+ { 0x90051, 0x65a },
+ { 0x90052, 0x9 },
+ { 0x90053, 0x0 },
+ { 0x90054, 0x45a },
+ { 0x90055, 0x9 },
+ { 0x90056, 0x0 },
+ { 0x90057, 0x448 },
+ { 0x90058, 0x109 },
+ { 0x90059, 0x40 },
+ { 0x9005a, 0x633 },
+ { 0x9005b, 0x179 },
+ { 0x9005c, 0x1 },
+ { 0x9005d, 0x618 },
+ { 0x9005e, 0x109 },
+ { 0x9005f, 0x40c0 },
+ { 0x90060, 0x633 },
+ { 0x90061, 0x149 },
+ { 0x90062, 0x8 },
+ { 0x90063, 0x4 },
+ { 0x90064, 0x48 },
+ { 0x90065, 0x4040 },
+ { 0x90066, 0x633 },
+ { 0x90067, 0x149 },
+ { 0x90068, 0x0 },
+ { 0x90069, 0x4 },
+ { 0x9006a, 0x48 },
+ { 0x9006b, 0x40 },
+ { 0x9006c, 0x633 },
+ { 0x9006d, 0x149 },
+ { 0x9006e, 0x0 },
+ { 0x9006f, 0x658 },
+ { 0x90070, 0x109 },
+ { 0x90071, 0x10 },
+ { 0x90072, 0x4 },
+ { 0x90073, 0x18 },
+ { 0x90074, 0x0 },
+ { 0x90075, 0x4 },
+ { 0x90076, 0x78 },
+ { 0x90077, 0x549 },
+ { 0x90078, 0x633 },
+ { 0x90079, 0x159 },
+ { 0x9007a, 0xd49 },
+ { 0x9007b, 0x633 },
+ { 0x9007c, 0x159 },
+ { 0x9007d, 0x94a },
+ { 0x9007e, 0x633 },
+ { 0x9007f, 0x159 },
+ { 0x90080, 0x441 },
+ { 0x90081, 0x633 },
+ { 0x90082, 0x149 },
+ { 0x90083, 0x42 },
+ { 0x90084, 0x633 },
+ { 0x90085, 0x149 },
+ { 0x90086, 0x1 },
+ { 0x90087, 0x633 },
+ { 0x90088, 0x149 },
+ { 0x90089, 0x0 },
+ { 0x9008a, 0xe0 },
+ { 0x9008b, 0x109 },
+ { 0x9008c, 0xa },
+ { 0x9008d, 0x10 },
+ { 0x9008e, 0x109 },
+ { 0x9008f, 0x9 },
+ { 0x90090, 0x3c0 },
+ { 0x90091, 0x149 },
+ { 0x90092, 0x9 },
+ { 0x90093, 0x3c0 },
+ { 0x90094, 0x159 },
+ { 0x90095, 0x18 },
+ { 0x90096, 0x10 },
+ { 0x90097, 0x109 },
+ { 0x90098, 0x0 },
+ { 0x90099, 0x3c0 },
+ { 0x9009a, 0x109 },
+ { 0x9009b, 0x18 },
+ { 0x9009c, 0x4 },
+ { 0x9009d, 0x48 },
+ { 0x9009e, 0x18 },
+ { 0x9009f, 0x4 },
+ { 0x900a0, 0x58 },
+ { 0x900a1, 0xb },
+ { 0x900a2, 0x10 },
+ { 0x900a3, 0x109 },
+ { 0x900a4, 0x1 },
+ { 0x900a5, 0x10 },
+ { 0x900a6, 0x109 },
+ { 0x900a7, 0x5 },
+ { 0x900a8, 0x7c0 },
+ { 0x900a9, 0x109 },
+ { 0x40000, 0x811 },
+ { 0x40020, 0x880 },
+ { 0x40040, 0x0 },
+ { 0x40060, 0x0 },
+ { 0x40001, 0x4008 },
+ { 0x40021, 0x83 },
+ { 0x40041, 0x4f },
+ { 0x40061, 0x0 },
+ { 0x40002, 0x4040 },
+ { 0x40022, 0x83 },
+ { 0x40042, 0x51 },
+ { 0x40062, 0x0 },
+ { 0x40003, 0x811 },
+ { 0x40023, 0x880 },
+ { 0x40043, 0x0 },
+ { 0x40063, 0x0 },
+ { 0x40004, 0x720 },
+ { 0x40024, 0xf },
+ { 0x40044, 0x1740 },
+ { 0x40064, 0x0 },
+ { 0x40005, 0x16 },
+ { 0x40025, 0x83 },
+ { 0x40045, 0x4b },
+ { 0x40065, 0x0 },
+ { 0x40006, 0x716 },
+ { 0x40026, 0xf },
+ { 0x40046, 0x2001 },
+ { 0x40066, 0x0 },
+ { 0x40007, 0x716 },
+ { 0x40027, 0xf },
+ { 0x40047, 0x2800 },
+ { 0x40067, 0x0 },
+ { 0x40008, 0x716 },
+ { 0x40028, 0xf },
+ { 0x40048, 0xf00 },
+ { 0x40068, 0x0 },
+ { 0x40009, 0x720 },
+ { 0x40029, 0xf },
+ { 0x40049, 0x1400 },
+ { 0x40069, 0x0 },
+ { 0x4000a, 0xe08 },
+ { 0x4002a, 0xc15 },
+ { 0x4004a, 0x0 },
+ { 0x4006a, 0x0 },
+ { 0x4000b, 0x625 },
+ { 0x4002b, 0x15 },
+ { 0x4004b, 0x0 },
+ { 0x4006b, 0x0 },
+ { 0x4000c, 0x4028 },
+ { 0x4002c, 0x80 },
+ { 0x4004c, 0x0 },
+ { 0x4006c, 0x0 },
+ { 0x4000d, 0xe08 },
+ { 0x4002d, 0xc1a },
+ { 0x4004d, 0x0 },
+ { 0x4006d, 0x0 },
+ { 0x4000e, 0x625 },
+ { 0x4002e, 0x1a },
+ { 0x4004e, 0x0 },
+ { 0x4006e, 0x0 },
+ { 0x4000f, 0x4040 },
+ { 0x4002f, 0x80 },
+ { 0x4004f, 0x0 },
+ { 0x4006f, 0x0 },
+ { 0x40010, 0x2604 },
+ { 0x40030, 0x15 },
+ { 0x40050, 0x0 },
+ { 0x40070, 0x0 },
+ { 0x40011, 0x708 },
+ { 0x40031, 0x5 },
+ { 0x40051, 0x0 },
+ { 0x40071, 0x2002 },
+ { 0x40012, 0x8 },
+ { 0x40032, 0x80 },
+ { 0x40052, 0x0 },
+ { 0x40072, 0x0 },
+ { 0x40013, 0x2604 },
+ { 0x40033, 0x1a },
+ { 0x40053, 0x0 },
+ { 0x40073, 0x0 },
+ { 0x40014, 0x708 },
+ { 0x40034, 0xa },
+ { 0x40054, 0x0 },
+ { 0x40074, 0x2002 },
+ { 0x40015, 0x4040 },
+ { 0x40035, 0x80 },
+ { 0x40055, 0x0 },
+ { 0x40075, 0x0 },
+ { 0x40016, 0x60a },
+ { 0x40036, 0x15 },
+ { 0x40056, 0x1200 },
+ { 0x40076, 0x0 },
+ { 0x40017, 0x61a },
+ { 0x40037, 0x15 },
+ { 0x40057, 0x1300 },
+ { 0x40077, 0x0 },
+ { 0x40018, 0x60a },
+ { 0x40038, 0x1a },
+ { 0x40058, 0x1200 },
+ { 0x40078, 0x0 },
+ { 0x40019, 0x642 },
+ { 0x40039, 0x1a },
+ { 0x40059, 0x1300 },
+ { 0x40079, 0x0 },
+ { 0x4001a, 0x4808 },
+ { 0x4003a, 0x880 },
+ { 0x4005a, 0x0 },
+ { 0x4007a, 0x0 },
+ { 0x900aa, 0x0 },
+ { 0x900ab, 0x790 },
+ { 0x900ac, 0x11a },
+ { 0x900ad, 0x8 },
+ { 0x900ae, 0x7aa },
+ { 0x900af, 0x2a },
+ { 0x900b0, 0x10 },
+ { 0x900b1, 0x7b2 },
+ { 0x900b2, 0x2a },
+ { 0x900b3, 0x0 },
+ { 0x900b4, 0x7c8 },
+ { 0x900b5, 0x109 },
+ { 0x900b6, 0x10 },
+ { 0x900b7, 0x10 },
+ { 0x900b8, 0x109 },
+ { 0x900b9, 0x10 },
+ { 0x900ba, 0x2a8 },
+ { 0x900bb, 0x129 },
+ { 0x900bc, 0x8 },
+ { 0x900bd, 0x370 },
+ { 0x900be, 0x129 },
+ { 0x900bf, 0xa },
+ { 0x900c0, 0x3c8 },
+ { 0x900c1, 0x1a9 },
+ { 0x900c2, 0xc },
+ { 0x900c3, 0x408 },
+ { 0x900c4, 0x199 },
+ { 0x900c5, 0x14 },
+ { 0x900c6, 0x790 },
+ { 0x900c7, 0x11a },
+ { 0x900c8, 0x8 },
+ { 0x900c9, 0x4 },
+ { 0x900ca, 0x18 },
+ { 0x900cb, 0xe },
+ { 0x900cc, 0x408 },
+ { 0x900cd, 0x199 },
+ { 0x900ce, 0x8 },
+ { 0x900cf, 0x8568 },
+ { 0x900d0, 0x108 },
+ { 0x900d1, 0x18 },
+ { 0x900d2, 0x790 },
+ { 0x900d3, 0x16a },
+ { 0x900d4, 0x8 },
+ { 0x900d5, 0x1d8 },
+ { 0x900d6, 0x169 },
+ { 0x900d7, 0x10 },
+ { 0x900d8, 0x8558 },
+ { 0x900d9, 0x168 },
+ { 0x900da, 0x1ff8 },
+ { 0x900db, 0x85a8 },
+ { 0x900dc, 0x1e8 },
+ { 0x900dd, 0x50 },
+ { 0x900de, 0x798 },
+ { 0x900df, 0x16a },
+ { 0x900e0, 0x60 },
+ { 0x900e1, 0x7a0 },
+ { 0x900e2, 0x16a },
+ { 0x900e3, 0x8 },
+ { 0x900e4, 0x8310 },
+ { 0x900e5, 0x168 },
+ { 0x900e6, 0x8 },
+ { 0x900e7, 0xa310 },
+ { 0x900e8, 0x168 },
+ { 0x900e9, 0xa },
+ { 0x900ea, 0x408 },
+ { 0x900eb, 0x169 },
+ { 0x900ec, 0x6e },
+ { 0x900ed, 0x0 },
+ { 0x900ee, 0x68 },
+ { 0x900ef, 0x0 },
+ { 0x900f0, 0x408 },
+ { 0x900f1, 0x169 },
+ { 0x900f2, 0x0 },
+ { 0x900f3, 0x8310 },
+ { 0x900f4, 0x168 },
+ { 0x900f5, 0x0 },
+ { 0x900f6, 0xa310 },
+ { 0x900f7, 0x168 },
+ { 0x900f8, 0x1ff8 },
+ { 0x900f9, 0x85a8 },
+ { 0x900fa, 0x1e8 },
+ { 0x900fb, 0x68 },
+ { 0x900fc, 0x798 },
+ { 0x900fd, 0x16a },
+ { 0x900fe, 0x78 },
+ { 0x900ff, 0x7a0 },
+ { 0x90100, 0x16a },
+ { 0x90101, 0x68 },
+ { 0x90102, 0x790 },
+ { 0x90103, 0x16a },
+ { 0x90104, 0x8 },
+ { 0x90105, 0x8b10 },
+ { 0x90106, 0x168 },
+ { 0x90107, 0x8 },
+ { 0x90108, 0xab10 },
+ { 0x90109, 0x168 },
+ { 0x9010a, 0xa },
+ { 0x9010b, 0x408 },
+ { 0x9010c, 0x169 },
+ { 0x9010d, 0x58 },
+ { 0x9010e, 0x0 },
+ { 0x9010f, 0x68 },
+ { 0x90110, 0x0 },
+ { 0x90111, 0x408 },
+ { 0x90112, 0x169 },
+ { 0x90113, 0x0 },
+ { 0x90114, 0x8b10 },
+ { 0x90115, 0x168 },
+ { 0x90116, 0x1 },
+ { 0x90117, 0xab10 },
+ { 0x90118, 0x168 },
+ { 0x90119, 0x0 },
+ { 0x9011a, 0x1d8 },
+ { 0x9011b, 0x169 },
+ { 0x9011c, 0x80 },
+ { 0x9011d, 0x790 },
+ { 0x9011e, 0x16a },
+ { 0x9011f, 0x18 },
+ { 0x90120, 0x7aa },
+ { 0x90121, 0x6a },
+ { 0x90122, 0xa },
+ { 0x90123, 0x0 },
+ { 0x90124, 0x1e9 },
+ { 0x90125, 0x8 },
+ { 0x90126, 0x8080 },
+ { 0x90127, 0x108 },
+ { 0x90128, 0xf },
+ { 0x90129, 0x408 },
+ { 0x9012a, 0x169 },
+ { 0x9012b, 0xc },
+ { 0x9012c, 0x0 },
+ { 0x9012d, 0x68 },
+ { 0x9012e, 0x9 },
+ { 0x9012f, 0x0 },
+ { 0x90130, 0x1a9 },
+ { 0x90131, 0x0 },
+ { 0x90132, 0x408 },
+ { 0x90133, 0x169 },
+ { 0x90134, 0x0 },
+ { 0x90135, 0x8080 },
+ { 0x90136, 0x108 },
+ { 0x90137, 0x8 },
+ { 0x90138, 0x7aa },
+ { 0x90139, 0x6a },
+ { 0x9013a, 0x0 },
+ { 0x9013b, 0x8568 },
+ { 0x9013c, 0x108 },
+ { 0x9013d, 0xb7 },
+ { 0x9013e, 0x790 },
+ { 0x9013f, 0x16a },
+ { 0x90140, 0x1f },
+ { 0x90141, 0x0 },
+ { 0x90142, 0x68 },
+ { 0x90143, 0x8 },
+ { 0x90144, 0x8558 },
+ { 0x90145, 0x168 },
+ { 0x90146, 0xf },
+ { 0x90147, 0x408 },
+ { 0x90148, 0x169 },
+ { 0x90149, 0xd },
+ { 0x9014a, 0x0 },
+ { 0x9014b, 0x68 },
+ { 0x9014c, 0x0 },
+ { 0x9014d, 0x408 },
+ { 0x9014e, 0x169 },
+ { 0x9014f, 0x0 },
+ { 0x90150, 0x8558 },
+ { 0x90151, 0x168 },
+ { 0x90152, 0x8 },
+ { 0x90153, 0x3c8 },
+ { 0x90154, 0x1a9 },
+ { 0x90155, 0x3 },
+ { 0x90156, 0x370 },
+ { 0x90157, 0x129 },
+ { 0x90158, 0x20 },
+ { 0x90159, 0x2aa },
+ { 0x9015a, 0x9 },
+ { 0x9015b, 0x8 },
+ { 0x9015c, 0xe8 },
+ { 0x9015d, 0x109 },
+ { 0x9015e, 0x0 },
+ { 0x9015f, 0x8140 },
+ { 0x90160, 0x10c },
+ { 0x90161, 0x10 },
+ { 0x90162, 0x8138 },
+ { 0x90163, 0x104 },
+ { 0x90164, 0x8 },
+ { 0x90165, 0x448 },
+ { 0x90166, 0x109 },
+ { 0x90167, 0xf },
+ { 0x90168, 0x7c0 },
+ { 0x90169, 0x109 },
+ { 0x9016a, 0x0 },
+ { 0x9016b, 0xe8 },
+ { 0x9016c, 0x109 },
+ { 0x9016d, 0x47 },
+ { 0x9016e, 0x630 },
+ { 0x9016f, 0x109 },
+ { 0x90170, 0x8 },
+ { 0x90171, 0x618 },
+ { 0x90172, 0x109 },
+ { 0x90173, 0x8 },
+ { 0x90174, 0xe0 },
+ { 0x90175, 0x109 },
+ { 0x90176, 0x0 },
+ { 0x90177, 0x7c8 },
+ { 0x90178, 0x109 },
+ { 0x90179, 0x8 },
+ { 0x9017a, 0x8140 },
+ { 0x9017b, 0x10c },
+ { 0x9017c, 0x0 },
+ { 0x9017d, 0x478 },
+ { 0x9017e, 0x109 },
+ { 0x9017f, 0x0 },
+ { 0x90180, 0x1 },
+ { 0x90181, 0x8 },
+ { 0x90182, 0x8 },
+ { 0x90183, 0x4 },
+ { 0x90184, 0x0 },
+ { 0x90006, 0x8 },
+ { 0x90007, 0x7c8 },
+ { 0x90008, 0x109 },
+ { 0x90009, 0x0 },
+ { 0x9000a, 0x400 },
+ { 0x9000b, 0x106 },
+ { 0xd00e7, 0x400 },
+ { 0x90017, 0x0 },
+ { 0x9001f, 0x2b },
+ { 0x90026, 0x69 },
+ { 0x400d0, 0x0 },
+ { 0x400d1, 0x101 },
+ { 0x400d2, 0x105 },
+ { 0x400d3, 0x107 },
+ { 0x400d4, 0x10f },
+ { 0x400d5, 0x202 },
+ { 0x400d6, 0x20a },
+ { 0x400d7, 0x20b },
+ { 0x2003a, 0x2 },
+ { 0x200be, 0x0 },
+ { 0x2000b, 0x20c },
+ { 0x2000c, 0x74 },
+ { 0x2000d, 0x48e },
+ { 0x2000e, 0x2c },
+ { 0x9000c, 0x0 },
+ { 0x9000d, 0x173 },
+ { 0x9000e, 0x60 },
+ { 0x9000f, 0x6110 },
+ { 0x90010, 0x2152 },
+ { 0x90011, 0xdfbd },
+ { 0x90012, 0x2060 },
+ { 0x90013, 0x6152 },
+ { 0x20010, 0x5a },
+ { 0x20011, 0x3 },
+ { 0x40080, 0xe0 },
+ { 0x40081, 0x12 },
+ { 0x40082, 0xe0 },
+ { 0x40083, 0x12 },
+ { 0x40084, 0xe0 },
+ { 0x40085, 0x12 },
+ { 0x400fd, 0xf },
+ { 0x400f1, 0xe },
+ { 0x10011, 0x1 },
+ { 0x10012, 0x1 },
+ { 0x10013, 0x180 },
+ { 0x10018, 0x1 },
+ { 0x10002, 0x6209 },
+ { 0x100b2, 0x1 },
+ { 0x101b4, 0x1 },
+ { 0x102b4, 0x1 },
+ { 0x103b4, 0x1 },
+ { 0x104b4, 0x1 },
+ { 0x105b4, 0x1 },
+ { 0x106b4, 0x1 },
+ { 0x107b4, 0x1 },
+ { 0x108b4, 0x1 },
+ { 0x11011, 0x1 },
+ { 0x11012, 0x1 },
+ { 0x11013, 0x180 },
+ { 0x11018, 0x1 },
+ { 0x11002, 0x6209 },
+ { 0x110b2, 0x1 },
+ { 0x111b4, 0x1 },
+ { 0x112b4, 0x1 },
+ { 0x113b4, 0x1 },
+ { 0x114b4, 0x1 },
+ { 0x115b4, 0x1 },
+ { 0x116b4, 0x1 },
+ { 0x117b4, 0x1 },
+ { 0x118b4, 0x1 },
+ { 0x20089, 0x1 },
+ { 0x20088, 0x19 },
+ { 0xc0080, 0x0 },
+ { 0xd0000, 0x1 }
+};
+
+struct dram_fsp_msg ddr_dram_fsp_msg[] = {
+ {
+ /* P0 1866mts 1D */
+ .drate = 1866,
+ .fw_type = FW_1D_IMAGE,
+ .fsp_cfg = ddr_fsp0_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_cfg),
+ },
+ {
+ /* P0 1866mts 2D */
+ .drate = 1866,
+ .fw_type = FW_2D_IMAGE,
+ .fsp_cfg = ddr_fsp0_2d_cfg,
+ .fsp_cfg_num = ARRAY_SIZE(ddr_fsp0_2d_cfg),
+ },
+};
+
+/* ddr timing config params */
+struct dram_timing_info dram_timing = {
+ .ddrc_cfg = ddr_ddrc_cfg,
+ .ddrc_cfg_num = ARRAY_SIZE(ddr_ddrc_cfg),
+ .ddrphy_cfg = ddr_ddrphy_cfg,
+ .ddrphy_cfg_num = ARRAY_SIZE(ddr_ddrphy_cfg),
+ .fsp_msg = ddr_dram_fsp_msg,
+ .fsp_msg_num = ARRAY_SIZE(ddr_dram_fsp_msg),
+ .ddrphy_trained_csr = ddr_ddrphy_trained_csr,
+ .ddrphy_trained_csr_num = ARRAY_SIZE(ddr_ddrphy_trained_csr),
+ .ddrphy_pie = ddr_phy_pie,
+ .ddrphy_pie_num = ARRAY_SIZE(ddr_phy_pie),
+ .fsp_table = { 1866, },
+};
diff --git a/board/freescale/imx93_evk/spl.c b/board/freescale/imx93_evk/spl.c
new file mode 100644
index 00000000000..e5807134bb2
--- /dev/null
+++ b/board/freescale/imx93_evk/spl.c
@@ -0,0 +1,146 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2022 NXP
+ */
+
+#include <command.h>
+#include <cpu_func.h>
+#include <hang.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/imx93_pins.h>
+#include <asm/arch/mu.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/arch-mx7ulp/gpio.h>
+#include <asm/mach-imx/ele_api.h>
+#include <asm/mach-imx/syscounter.h>
+#include <asm/sections.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+#include <dm/uclass-internal.h>
+#include <dm/device-internal.h>
+#include <linux/delay.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/ccm_regs.h>
+#include <asm/arch/ddr.h>
+#include <power/pmic.h>
+#include <power/pca9450.h>
+#include <asm/arch/trdc.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int spl_board_boot_device(enum boot_device boot_dev_spl)
+{
+ return BOOT_DEVICE_BOOTROM;
+}
+
+void spl_board_init(void)
+{
+ int ret;
+
+ ret = ele_start_rng();
+ if (ret)
+ printf("Fail to start RNG: %d\n", ret);
+
+ puts("Normal Boot\n");
+}
+
+void spl_dram_init(void)
+{
+ ddr_init(&dram_timing);
+}
+
+#if CONFIG_IS_ENABLED(DM_PMIC_PCA9450)
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+
+ ret = pmic_get("pmic@25", &dev);
+ if (ret == -ENODEV) {
+ puts("No pca9450@25\n");
+ return 0;
+ }
+ if (ret != 0)
+ return ret;
+
+ /* BUCKxOUT_DVS0/1 control BUCK123 output */
+ pmic_reg_write(dev, PCA9450_BUCK123_DVS, 0x29);
+
+ /* enable DVS control through PMIC_STBY_REQ */
+ pmic_reg_write(dev, PCA9450_BUCK1CTRL, 0x59);
+
+ if (IS_ENABLED(CONFIG_IMX9_LOW_DRIVE_MODE)) {
+ /* 0.75v for Low drive mode
+ */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x0c);
+ pmic_reg_write(dev, PCA9450_BUCK3OUT_DVS0, 0x0c);
+ } else {
+ /* 0.9v for Over drive mode
+ */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS0, 0x18);
+ pmic_reg_write(dev, PCA9450_BUCK3OUT_DVS0, 0x18);
+ }
+
+ /* set standby voltage to 0.65v */
+ pmic_reg_write(dev, PCA9450_BUCK1OUT_DVS1, 0x4);
+
+ /* I2C_LT_EN*/
+ pmic_reg_write(dev, 0xa, 0x3);
+ return 0;
+}
+#endif
+
+void board_init_f(ulong dummy)
+{
+ int ret;
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ timer_init();
+
+ arch_cpu_init();
+
+ board_early_init_f();
+
+ spl_early_init();
+
+ preloader_console_init();
+
+ ret = imx9_probe_mu();
+ if (ret) {
+ printf("Fail to init Sentinel API\n");
+ } else {
+ debug("SOC: 0x%x\n", gd->arch.soc_rev);
+ debug("LC: 0x%x\n", gd->arch.lifecycle);
+ }
+
+ power_init_board();
+
+ if (!IS_ENABLED(CONFIG_IMX9_LOW_DRIVE_MODE))
+ set_arm_clk(get_cpu_speed_grade_hz());
+
+ /* Init power of mix */
+ soc_power_init();
+
+ /* Setup TRDC for DDR access */
+ trdc_init();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* Put M33 into CPUWAIT for following kick */
+ ret = m33_prepare();
+ if (!ret)
+ printf("M33 prepare ok\n");
+
+ board_init_r(NULL, 0);
+}
diff --git a/board/freescale/imxrt1020-evk/Kconfig b/board/freescale/imxrt1020-evk/Kconfig
new file mode 100644
index 00000000000..3cb8fb1e6e9
--- /dev/null
+++ b/board/freescale/imxrt1020-evk/Kconfig
@@ -0,0 +1,21 @@
+if TARGET_IMXRT1020_EVK
+
+config SYS_BOARD
+ string
+ default "imxrt1020-evk"
+
+config SYS_VENDOR
+ string
+ default "freescale"
+
+config SYS_SOC
+ string
+ default "imxrt1020"
+
+config SYS_CONFIG_NAME
+ default "imxrt1020-evk"
+
+config IMX_CONFIG
+ default "board/freescale/imxrt1020-evk/imximage.cfg"
+
+endif
diff --git a/board/freescale/imxrt1020-evk/MAINTAINERS b/board/freescale/imxrt1020-evk/MAINTAINERS
new file mode 100644
index 00000000000..05f017b2bab
--- /dev/null
+++ b/board/freescale/imxrt1020-evk/MAINTAINERS
@@ -0,0 +1,6 @@
+IMXRT1020 EVALUATION KIT
+M: Giulio Benetti <giulio.benetti@benettiengineering.com>
+S: Maintained
+F: board/freescale/imxrt1020-evk
+F: include/configs/imxrt1020-evk.h
+F: configs/imxrt1020-evk_defconfig
diff --git a/board/freescale/imxrt1020-evk/Makefile b/board/freescale/imxrt1020-evk/Makefile
new file mode 100644
index 00000000000..807dc7c35e1
--- /dev/null
+++ b/board/freescale/imxrt1020-evk/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2020
+# Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+
+obj-y := imxrt1020-evk.o
diff --git a/board/freescale/imxrt1020-evk/imximage.cfg b/board/freescale/imxrt1020-evk/imximage.cfg
new file mode 100644
index 00000000000..0ed71479a60
--- /dev/null
+++ b/board/freescale/imxrt1020-evk/imximage.cfg
@@ -0,0 +1,35 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2020
+ * Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Set all FlexRAM as OCRAM(01b) */
+DATA 4 0x400AC044 0x00005555
+/* Use FLEXRAM_BANK_CFG to config FlexRAM */
+SET_BIT 4 0x400AC040 0x4
diff --git a/board/freescale/imxrt1020-evk/imxrt1020-evk.c b/board/freescale/imxrt1020-evk/imxrt1020-evk.c
new file mode 100644
index 00000000000..42a0a67ae93
--- /dev/null
+++ b/board/freescale/imxrt1020-evk/imxrt1020-evk.c
@@ -0,0 +1,79 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2020
+ * Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <dm.h>
+#include <init.h>
+#include <log.h>
+#include <ram.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/armv7m.h>
+#include <serial.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+#ifndef CONFIG_SUPPORT_SPL
+ int rv;
+ struct udevice *dev;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv) {
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+ }
+
+#endif
+ return fdtdec_setup_mem_size_base();
+}
+
+int dram_init_banksize(void)
+{
+ return fdtdec_setup_memory_banksize();
+}
+
+#ifdef CONFIG_SPL_BUILD
+#ifdef CONFIG_SPL_OS_BOOT
+int spl_start_uboot(void)
+{
+ debug("SPL: booting kernel\n");
+ /* break into full u-boot on 'c' */
+ return serial_tstc() && serial_getc() == 'c';
+}
+#endif
+
+int spl_dram_init(void)
+{
+ struct udevice *dev;
+ int rv;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv)
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+}
+
+void spl_board_init(void)
+{
+ preloader_console_init();
+ spl_dram_init();
+ arch_cpu_init(); /* to configure mpu for sdram rw permissions */
+}
+
+u32 spl_boot_device(void)
+{
+ return BOOT_DEVICE_MMC1;
+}
+#endif
+
+int board_init(void)
+{
+ gd->bd->bi_boot_params = gd->bd->bi_dram[0].start + 0x100;
+
+ return 0;
+}
diff --git a/board/freescale/imxrt1050-evk/Kconfig b/board/freescale/imxrt1050-evk/Kconfig
new file mode 100644
index 00000000000..068130beca9
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/Kconfig
@@ -0,0 +1,21 @@
+if TARGET_IMXRT1050_EVK
+
+config SYS_BOARD
+ string
+ default "imxrt1050-evk"
+
+config SYS_VENDOR
+ string
+ default "freescale"
+
+config SYS_SOC
+ string
+ default "imxrt1050"
+
+config SYS_CONFIG_NAME
+ default "imxrt1050-evk"
+
+config IMX_CONFIG
+ default "board/freescale/imxrt1050-evk/imximage.cfg"
+
+endif
diff --git a/board/freescale/imxrt1050-evk/MAINTAINERS b/board/freescale/imxrt1050-evk/MAINTAINERS
new file mode 100644
index 00000000000..890825b39ae
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/MAINTAINERS
@@ -0,0 +1,7 @@
+IMXRT1050 EVALUATION KIT
+M: Giulio Benetti <giulio.benetti@benettiengineering.com>
+S: Maintained
+F: board/freescale/imxrt1050-evk
+F: include/configs/imxrt1050-evk.h
+F: configs/imxrt1050-evk_defconfig
+F: configs/imxrt1050-evk_fspi_defconfig
diff --git a/board/freescale/imxrt1050-evk/Makefile b/board/freescale/imxrt1050-evk/Makefile
new file mode 100644
index 00000000000..0e984d1d7a8
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2019
+# Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+
+obj-y := imxrt1050-evk.o
diff --git a/board/freescale/imxrt1050-evk/imximage-nor.cfg b/board/freescale/imxrt1050-evk/imximage-nor.cfg
new file mode 100644
index 00000000000..829be6cbe2b
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/imximage-nor.cfg
@@ -0,0 +1,41 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2024
+ * Author(s): Jesse Taube <Mr.Bossman075@gmail.com>
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM nor
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/*
+ * 0x400AC044 is used to configure the flexram.
+ * Unfortunately setting all to OCRAM only works for MMC
+ * and setting all to DTCM only works for FLEXSPI NOR.
+ * This configuration fortunately works for both SPI and MMC.
+*/
+/* Set first two banks FlexRAM as OCRAM(01b) and the rest to DTCM(10b) */
+DATA 4 0x400AC044 0x55aaaaaa
+/* Use FLEXRAM_BANK_CFG to config FlexRAM */
+SET_BIT 4 0x400AC040 0x4
diff --git a/board/freescale/imxrt1050-evk/imximage.cfg b/board/freescale/imxrt1050-evk/imximage.cfg
new file mode 100644
index 00000000000..b30d8521947
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/imximage.cfg
@@ -0,0 +1,41 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2019
+ * Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/*
+ * 0x400AC044 is used to configure the flexram.
+ * Unfortunately setting all to OCRAM only works for MMC
+ * and setting all to DTCM only works for FLEXSPI NOR.
+ * This configuration fortunately works for both SPI and MMC.
+*/
+/* Set first two banks FlexRAM as OCRAM(01b) and the rest to DTCM(10b) */
+DATA 4 0x400AC044 0x55aaaaaa
+/* Use FLEXRAM_BANK_CFG to config FlexRAM */
+SET_BIT 4 0x400AC040 0x4
diff --git a/board/freescale/imxrt1050-evk/imxrt1050-evk.c b/board/freescale/imxrt1050-evk/imxrt1050-evk.c
new file mode 100644
index 00000000000..46a644908e9
--- /dev/null
+++ b/board/freescale/imxrt1050-evk/imxrt1050-evk.c
@@ -0,0 +1,84 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2019
+ * Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <dm.h>
+#include <init.h>
+#include <log.h>
+#include <ram.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/armv7m.h>
+#include <serial.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+#ifndef CONFIG_SUPPORT_SPL
+ int rv;
+ struct udevice *dev;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv) {
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+ }
+
+#endif
+ return fdtdec_setup_mem_size_base();
+}
+
+int dram_init_banksize(void)
+{
+ return fdtdec_setup_memory_banksize();
+}
+
+#ifdef CONFIG_SPL_BUILD
+#ifdef CONFIG_SPL_OS_BOOT
+int spl_start_uboot(void)
+{
+ debug("SPL: booting kernel\n");
+ /* break into full u-boot on 'c' */
+ return serial_tstc() && serial_getc() == 'c';
+}
+#endif
+
+int spl_dram_init(void)
+{
+ struct udevice *dev;
+ int rv;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv)
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+}
+
+void spl_board_init(void)
+{
+ preloader_console_init();
+ spl_dram_init();
+ arch_cpu_init(); /* to configure mpu for sdram rw permissions */
+}
+
+u32 spl_boot_device(void)
+{
+ /* There is no way to find the boot device so look if there is a valid IVT in RAM for MMC */
+ u32 nor_ivt = *(u32 *)(CONFIG_SYS_LOAD_ADDR - 0xC00);
+
+ if (nor_ivt == 0x402000d1)
+ return BOOT_DEVICE_MMC1;
+ return BOOT_DEVICE_NOR;
+}
+#endif
+
+int board_init(void)
+{
+ gd->bd->bi_boot_params = gd->bd->bi_dram[0].start + 0x100;
+
+ return 0;
+}
diff --git a/board/freescale/imxrt1170-evk/Kconfig b/board/freescale/imxrt1170-evk/Kconfig
new file mode 100644
index 00000000000..b433d6e5df0
--- /dev/null
+++ b/board/freescale/imxrt1170-evk/Kconfig
@@ -0,0 +1,21 @@
+if TARGET_IMXRT1170_EVK
+
+config SYS_BOARD
+ string
+ default "imxrt1170-evk"
+
+config SYS_VENDOR
+ string
+ default "freescale"
+
+config SYS_SOC
+ string
+ default "imxrt1170"
+
+config SYS_CONFIG_NAME
+ default "imxrt1170-evk"
+
+config IMX_CONFIG
+ default "board/freescale/imxrt1170-evk/imximage.cfg"
+
+endif
diff --git a/board/freescale/imxrt1170-evk/MAINTAINERS b/board/freescale/imxrt1170-evk/MAINTAINERS
new file mode 100644
index 00000000000..1fc3179c005
--- /dev/null
+++ b/board/freescale/imxrt1170-evk/MAINTAINERS
@@ -0,0 +1,7 @@
+IMXRT1170 EVALUATION KIT
+M: Giulio Benetti <giulio.benetti@benettiengineering.com>
+M: Jesse Taube <Mr.Bossman075@gmail.com>
+S: Maintained
+F: board/freescale/imxrt1170-evk
+F: include/configs/imxrt1170-evk.h
+F: configs/imxrt1170-evk_defconfig
diff --git a/board/freescale/imxrt1170-evk/Makefile b/board/freescale/imxrt1170-evk/Makefile
new file mode 100644
index 00000000000..857a168b09d
--- /dev/null
+++ b/board/freescale/imxrt1170-evk/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2019
+# Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+
+obj-y := imxrt1170-evk.o
diff --git a/board/freescale/imxrt1170-evk/imximage.cfg b/board/freescale/imxrt1170-evk/imximage.cfg
new file mode 100644
index 00000000000..57583d04ce6
--- /dev/null
+++ b/board/freescale/imxrt1170-evk/imximage.cfg
@@ -0,0 +1,31 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2022
+ * Author(s): Jesse Taube <Mr.Bossman075@gmail.com>
+ * Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
diff --git a/board/freescale/imxrt1170-evk/imxrt1170-evk.c b/board/freescale/imxrt1170-evk/imxrt1170-evk.c
new file mode 100644
index 00000000000..e10b8830ec6
--- /dev/null
+++ b/board/freescale/imxrt1170-evk/imxrt1170-evk.c
@@ -0,0 +1,79 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2019
+ * Author(s): Giulio Benetti <giulio.benetti@benettiengineering.com>
+ */
+
+#include <dm.h>
+#include <init.h>
+#include <log.h>
+#include <ram.h>
+#include <spl.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/armv7m.h>
+#include <serial.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+#ifndef CONFIG_SUPPORT_SPL
+ int rv;
+ struct udevice *dev;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv) {
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+ }
+
+#endif
+ return fdtdec_setup_mem_size_base();
+}
+
+int dram_init_banksize(void)
+{
+ return fdtdec_setup_memory_banksize();
+}
+
+#ifdef CONFIG_SPL_BUILD
+#ifdef CONFIG_SPL_OS_BOOT
+int spl_start_uboot(void)
+{
+ debug("SPL: booting kernel\n");
+ /* break into full u-boot on 'c' */
+ return serial_tstc() && serial_getc() == 'c';
+}
+#endif
+
+int spl_dram_init(void)
+{
+ struct udevice *dev;
+ int rv;
+
+ rv = uclass_get_device(UCLASS_RAM, 0, &dev);
+ if (rv)
+ debug("DRAM init failed: %d\n", rv);
+ return rv;
+}
+
+void spl_board_init(void)
+{
+ preloader_console_init();
+ spl_dram_init();
+ arch_cpu_init(); /* to configure mpu for sdram rw permissions */
+}
+
+u32 spl_boot_device(void)
+{
+ return BOOT_DEVICE_MMC1;
+}
+#endif
+
+int board_init(void)
+{
+ gd->bd->bi_boot_params = gd->bd->bi_dram[0].start + 0x100;
+
+ return 0;
+}
diff --git a/board/freescale/ls1012afrdm/Kconfig b/board/freescale/ls1012afrdm/Kconfig
new file mode 100644
index 00000000000..a7e59e62656
--- /dev/null
+++ b/board/freescale/ls1012afrdm/Kconfig
@@ -0,0 +1,80 @@
+if TARGET_LS1012AFRDM
+
+config SYS_BOARD
+ default "ls1012afrdm"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1012afrdm"
+
+config SYS_LS_PFE_FW_ADDR
+ hex "Flash address of PFE firmware"
+ default 0x40a00000
+
+config SYS_LS_PFE_FW_LENGTH
+ hex "length of PFE firmware"
+ default 0x40000
+
+endif
+
+if FSL_PFE
+
+config BOARD_SPECIFIC_OPTIONS # dummy
+ def_bool y
+ select PHYLIB
+ imply PHY_REALTEK
+ imply PHY_ATHEROS
+
+config DDR_PFE_PHYS_BASEADDR
+ hex "PFE DDR physical base address"
+ default 0x03800000
+
+config DDR_PFE_BASEADDR
+ hex "PFE DDR base address"
+ default 0x83800000
+
+config PFE_EMAC1_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x2
+
+config PFE_EMAC2_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x1
+
+endif
+
+if TARGET_LS1012AFRWY
+
+config SYS_BOARD
+ default "ls1012afrdm"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1012afrwy"
+
+config SYS_LS_PFE_FW_ADDR
+ hex "Flash address of PFE firmware"
+ default 0x40020000
+
+config SYS_LS_PFE_FW_LENGTH
+ hex "length of PFE firmware"
+ default 0x40000
+
+config SYS_LS_PFE_ESBC_ADDR
+ hex "PFE Firmware HDR Addr"
+ default 0x401f8000
+
+config SYS_LS_PFE_ESBC_LENGTH
+ hex "length of PFE Firmware HDR"
+ default 0xc00
+endif
diff --git a/board/freescale/ls1012afrdm/MAINTAINERS b/board/freescale/ls1012afrdm/MAINTAINERS
new file mode 100644
index 00000000000..89d1085b00b
--- /dev/null
+++ b/board/freescale/ls1012afrdm/MAINTAINERS
@@ -0,0 +1,17 @@
+LS1012AFRDM BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1012afrdm/
+F: include/configs/ls1012afrdm.h
+F: configs/ls1012afrdm_qspi_defconfig
+F: configs/ls1012afrdm_tfa_defconfig
+F: configs/ls1012afrwy_tfa_defconfig
+F: configs/ls1012afrwy_tfa_SECURE_BOOT_defconfig
+
+LS1012AFRWY BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1012afrwy/
+F: include/configs/ls1012afrwy.h
+F: configs/ls1012afrwy_qspi_defconfig
+F: configs/ls1012afrwy_qspi_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1012afrdm/Makefile b/board/freescale/ls1012afrdm/Makefile
new file mode 100644
index 00000000000..1e53c967304
--- /dev/null
+++ b/board/freescale/ls1012afrdm/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2016 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1012afrdm.o
+obj-$(CONFIG_FSL_PFE) += eth.o
diff --git a/board/freescale/ls1012afrdm/README b/board/freescale/ls1012afrdm/README
new file mode 100644
index 00000000000..e60ed606ec1
--- /dev/null
+++ b/board/freescale/ls1012afrdm/README
@@ -0,0 +1,58 @@
+Overview
+--------
+QorIQ LS1012A FREEDOM (LS1012AFRDM) is a high-performance development
+platform, with a complete debugging environment. The LS1012AFRDM board
+supports the QorIQ LS1012A processor and is optimized to support the
+high-bandwidth DDR3L memory and a full complement of high-speed SerDes ports.
+
+LS1012A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS2080A
+SoC overview.
+
+ LS1012AFRDM board Overview
+ -----------------------
+ - SERDES Connections, 2 lanes supportingspeeds upto 1 Gbit/s
+ - 2 SGMII 1G PHYs
+ - DDR Controller
+ - 4 Gb DDR3L SDRAM memory, running at data rates up to 1 GT/s
+ operating at 1.35 V
+ - QSPI
+ - Onboard 512 Mbit QSPI flash memory running at speed up
+ to 108/54 MHz
+ - One high-speed USB 2.0/3.0 port, one USB 2.0 port
+ - USB 2.0/3.0 port is configured as On-The-Go (OTG) with a
+ Micro-AB connector.
+ - USB 2.0 port is a debug port (CMSIS DAP) and is configured
+ as a Micro-AB device.
+ - I2C controller
+ - One I2C bus with connectivity to Arduino headers
+ - UART
+ - UART (Console): UART1 (Without flow control) for console
+ - ARM JTAG support
+ - ARM Cortex® 10-pin JTAG connector for LS1012A
+ - CMSIS DAP through K20 microcontroller
+ - SAI Audio interface
+ - One SAI port, SAI 2 with full duplex support
+ - Clocks
+ - 25 MHz crystal for LS1012A
+ - 8 MHz Crystal for K20
+ - 24 MHz for SC16IS740IPW SPI to Dual UART bridge
+ - Power Supplies
+ - 5 V input supply from USB
+ - 0.9 V, 1.35 V, and 1.8 V for VDD/Core, DDR, I/O, and
+ other board interfaces
+
+Booting Options
+---------------
+QSPI Flash 1
+
+QSPI flash map
+--------------
+Images | Size |QSPI Flash Address
+------------------------------------------
+RCW + PBI | 1MB | 0x4000_0000
+U-Boot | 1MB | 0x4010_0000
+U-Boot Env | 1MB | 0x4020_0000
+PPA FIT image | 2MB | 0x4050_0000
+Linux ITB | ~53MB | 0x40A0_0000
diff --git a/board/freescale/ls1012afrdm/eth.c b/board/freescale/ls1012afrdm/eth.c
new file mode 100644
index 00000000000..c431e5e611b
--- /dev/null
+++ b/board/freescale/ls1012afrdm/eth.c
@@ -0,0 +1,124 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015-2016 Freescale Semiconductor, Inc.
+ * Copyright 2017 NXP
+ */
+
+#include <dm.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <asm/types.h>
+#include <fsl_dtsec.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/config.h>
+#include <asm/arch-fsl-layerscape/immap_lsch2.h>
+#include <asm/arch/fsl_serdes.h>
+#include <linux/delay.h>
+#include <net/pfe_eth/pfe_eth.h>
+#include <dm/platform_data/pfe_dm_eth.h>
+
+#define DEFAULT_PFE_MDIO_NAME "PFE_MDIO"
+#define DEFAULT_PFE_MDIO1_NAME "PFE_MDIO1"
+
+#define MASK_ETH_PHY_RST 0x00000100
+
+static inline void ls1012afrdm_reset_phy(void)
+{
+ unsigned int val;
+ struct ccsr_gpio *pgpio = (void *)(GPIO1_BASE_ADDR);
+
+ setbits_be32(&pgpio->gpdir, MASK_ETH_PHY_RST);
+
+ val = in_be32(&pgpio->gpdat);
+ setbits_be32(&pgpio->gpdat, val & ~MASK_ETH_PHY_RST);
+ mdelay(10);
+
+ val = in_be32(&pgpio->gpdat);
+ setbits_be32(&pgpio->gpdat, val | MASK_ETH_PHY_RST);
+ mdelay(50);
+}
+
+int pfe_eth_board_init(struct udevice *dev)
+{
+ static int init_done;
+ struct mii_dev *bus;
+ struct pfe_mdio_info mac_mdio_info;
+ struct pfe_eth_dev *priv = dev_get_priv(dev);
+
+ if (!init_done) {
+ ls1012afrdm_reset_phy();
+
+ mac_mdio_info.reg_base = (void *)EMAC1_BASE_ADDR;
+ mac_mdio_info.name = DEFAULT_PFE_MDIO_NAME;
+
+ bus = pfe_mdio_init(&mac_mdio_info);
+ if (!bus) {
+ printf("Failed to register mdio\n");
+ return -1;
+ }
+
+ init_done = 1;
+ }
+
+ if (priv->gemac_port) {
+ mac_mdio_info.reg_base = (void *)EMAC2_BASE_ADDR;
+ mac_mdio_info.name = DEFAULT_PFE_MDIO1_NAME;
+ bus = pfe_mdio_init(&mac_mdio_info);
+ if (!bus) {
+ printf("Failed to register mdio\n");
+ return -1;
+ }
+ }
+
+ pfe_set_mdio(priv->gemac_port,
+ miiphy_get_dev_by_name(DEFAULT_PFE_MDIO_NAME));
+ if (!priv->gemac_port)
+ /* MAC1 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC1_PHY_ADDR,
+ PHY_INTERFACE_MODE_SGMII);
+ else
+ /* MAC2 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC2_PHY_ADDR,
+ PHY_INTERFACE_MODE_SGMII);
+ return 0;
+}
+
+static struct pfe_eth_pdata pfe_pdata0 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC1_BASE_ADDR,
+ .phy_interface = 0,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+static struct pfe_eth_pdata pfe_pdata1 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC2_BASE_ADDR,
+ .phy_interface = 1,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe0) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata0,
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe1) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata1,
+};
diff --git a/board/freescale/ls1012afrdm/ls1012afrdm.c b/board/freescale/ls1012afrdm/ls1012afrdm.c
new file mode 100644
index 00000000000..dae2cf097bc
--- /dev/null
+++ b/board/freescale/ls1012afrdm/ls1012afrdm.c
@@ -0,0 +1,188 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2017-2018, 2021 NXP
+ */
+
+#include <config.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <asm/cache.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/soc.h>
+#include <fsl_esdhc.h>
+#include <hwconfig.h>
+#include <env_internal.h>
+#include <fsl_mmdc.h>
+#include <netdev.h>
+#include <net/pfe_eth/pfe/pfe_hw.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+static inline int get_board_version(void)
+{
+ uint32_t val;
+#ifdef CONFIG_TARGET_LS1012AFRDM
+ val = 0;
+#else
+ struct ccsr_gpio *pgpio = (void *)(GPIO2_BASE_ADDR);
+
+ val = in_be32(&pgpio->gpdat) & BOARD_REV_MASK;/*Get GPIO2 11,12,14*/
+
+#endif
+ return val;
+}
+
+int checkboard(void)
+{
+#ifdef CONFIG_TARGET_LS1012AFRDM
+ puts("Board: LS1012AFRDM ");
+#else
+ int rev;
+
+ rev = get_board_version();
+
+ puts("Board: FRWY-LS1012A ");
+
+ puts("Version");
+
+ switch (rev) {
+ case BOARD_REV_A_B:
+ puts(": RevA/B ");
+ break;
+ case BOARD_REV_C:
+ puts(": RevC ");
+ break;
+ default:
+ puts(": unknown");
+ break;
+ }
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_TARGET_LS1012AFRWY
+int esdhc_status_fixup(void *blob, const char *compat)
+{
+ char esdhc0_path[] = "/soc/esdhc@1560000";
+ char esdhc1_path[] = "/soc/esdhc@1580000";
+
+ do_fixup_by_path(blob, esdhc0_path, "status", "okay",
+ sizeof("okay"), 1);
+
+ do_fixup_by_path(blob, esdhc1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_TFABOOT
+int dram_init(void)
+{
+#ifdef CONFIG_TARGET_LS1012AFRWY
+ int board_rev;
+#endif
+
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size) {
+#ifdef CONFIG_TARGET_LS1012AFRWY
+ board_rev = get_board_version();
+
+ if (board_rev & BOARD_REV_C)
+ gd->ram_size = SYS_SDRAM_SIZE_1024;
+ else
+ gd->ram_size = SYS_SDRAM_SIZE_512;
+#else
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+#endif
+ }
+ return 0;
+}
+#else
+int dram_init(void)
+{
+#ifdef CONFIG_TARGET_LS1012AFRWY
+ int board_rev;
+#endif
+ struct fsl_mmdc_info mparam = {
+ 0x04180000, /* mdctl */
+ 0x00030035, /* mdpdc */
+ 0x12554000, /* mdotc */
+ 0xbabf7954, /* mdcfg0 */
+ 0xdb328f64, /* mdcfg1 */
+ 0x01ff00db, /* mdcfg2 */
+ 0x00001680, /* mdmisc */
+ 0x0f3c8000, /* mdref */
+ 0x00002000, /* mdrwd */
+ 0x00bf1023, /* mdor */
+ 0x0000003f, /* mdasp */
+ 0x0000022a, /* mpodtctrl */
+ 0xa1390003, /* mpzqhwctrl */
+ };
+
+#ifdef CONFIG_TARGET_LS1012AFRWY
+ board_rev = get_board_version();
+
+ if (board_rev == BOARD_REV_C) {
+ mparam.mdctl = 0x05180000;
+ gd->ram_size = SYS_SDRAM_SIZE_1024;
+ } else {
+ gd->ram_size = SYS_SDRAM_SIZE_512;
+ }
+#else
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+#endif
+ mmdc_init(&mparam);
+
+#if !defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD)
+ /* This will break-before-make MMU for DDR */
+ update_early_mmu_table();
+#endif
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
+
+ /*
+ * Set CCI-400 control override register to enable barrier
+ * transaction
+ */
+ if (current_el() == 3)
+ out_le32(&cci->ctrl_ord, CCI400_CTRLORD_EN_BARRIER);
+
+ return 0;
+}
+
+#ifdef CONFIG_FSL_PFE
+void board_quiesce_devices(void)
+{
+ pfe_command_stop(0, NULL);
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ arch_fixup_fdt(blob);
+
+ ft_cpu_setup(blob, bd);
+
+ return 0;
+}
diff --git a/board/freescale/ls1012aqds/Kconfig b/board/freescale/ls1012aqds/Kconfig
new file mode 100644
index 00000000000..d333069898f
--- /dev/null
+++ b/board/freescale/ls1012aqds/Kconfig
@@ -0,0 +1,72 @@
+if TARGET_LS1012AQDS
+
+config SYS_BOARD
+ default "ls1012aqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1012aqds"
+
+if CHAIN_OF_TRUST
+config SYS_LS_PFE_ESBC_ADDR
+ hex "PFE Firmware HDR Addr"
+ default 0x40700000
+
+config SYS_LS_PFE_ESBC_LENGTH
+ hex "length of PFE Firmware HDR"
+ default 0xc00
+endif
+
+if FSL_PFE
+
+config BOARD_SPECIFIC_OPTIONS # dummy
+ def_bool y
+ select PHYLIB
+ imply PHY_VITESSE
+ imply PHY_REALTEK
+ imply PHY_AQUANTIA
+ imply PHYLIB_10G
+
+config PFE_RGMII_RESET_WA
+ def_bool y
+
+config SYS_LS_PFE_FW_ADDR
+ hex "Flash address of PFE firmware"
+ default 0x40a00000
+
+config SYS_LS_PFE_FW_LENGTH
+ hex "length of PFE firmware"
+ default 0x300000
+
+config DDR_PFE_PHYS_BASEADDR
+ hex "PFE DDR physical base address"
+ default 0x03800000
+
+config DDR_PFE_BASEADDR
+ hex "PFE DDR base address"
+ default 0x83800000
+
+config PFE_EMAC1_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x1e
+
+config PFE_EMAC2_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x1
+
+config PFE_SGMII_2500_PHY1_ADDR
+ hex "PFE DDR base address"
+ default 0x1
+
+config PFE_SGMII_2500_PHY2_ADDR
+ hex "PFE DDR base address"
+ default 0x2
+
+endif
+
+endif
diff --git a/board/freescale/ls1012aqds/MAINTAINERS b/board/freescale/ls1012aqds/MAINTAINERS
new file mode 100644
index 00000000000..eabf5805765
--- /dev/null
+++ b/board/freescale/ls1012aqds/MAINTAINERS
@@ -0,0 +1,8 @@
+LS1012AQDS BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1012aqds/
+F: include/configs/ls1012aqds.h
+F: configs/ls1012aqds_qspi_defconfig
+F: configs/ls1012aqds_tfa_defconfig
+F: configs/ls1012aqds_tfa_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1012aqds/Makefile b/board/freescale/ls1012aqds/Makefile
new file mode 100644
index 00000000000..5aba9caf927
--- /dev/null
+++ b/board/freescale/ls1012aqds/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2016 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1012aqds.o
+obj-$(CONFIG_FSL_PFE) += eth.o
diff --git a/board/freescale/ls1012aqds/README b/board/freescale/ls1012aqds/README
new file mode 100644
index 00000000000..e9b80cad506
--- /dev/null
+++ b/board/freescale/ls1012aqds/README
@@ -0,0 +1,59 @@
+Overview
+--------
+QorIQ LS1012A Development System (LS1012AQDS) is a high-performance
+development platform, with a complete debugging environment.
+The LS1012AQDS board supports the QorIQ LS1012A processor and is
+optimized to support the high-bandwidth DDR3L memory and
+a full complement of high-speed SerDes ports.
+
+LS1012A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS1012A
+SoC overview.
+
+LS1012AQDS board Overview
+-----------------------
+ - SERDES Connections, 4 lanes supporting:
+ - PCI Express - 3.0
+ - SGMII, SGMII 2.5
+ - SATA 3.0
+ - DDR Controller
+ - 16-bit, 1 GB DDR3L SDRAM memory, running at data rates up to 1 GT/s
+ - QSPI Controller
+ - A dual 1:3 switch, NX3L4357GM,115 (U35) drives the QSPI chip-select
+ signals to QSPI NOR flash memory (2 virtual banks) and the QSPI
+ emulator
+ - USB 3.0
+ - One USB 3.0 controller with integrated PHY
+ - One high-speed USB 3.0 port
+ - USB 2.0
+ - One USB 2.0 controller with ULPI interface
+ - Two enhanced secure digital host controllers:
+ - SDHC1 controller can be connected to onboard SDHC connector
+ - SDHC2 controller: 1-/4-bit SD/MMC card supporting 1.8 V devices
+ - 2 I2C controllers
+ - One SATA onboard connectors
+ - UART
+ - 5 SAI
+ - One SAI port with audio codec SGTL5000:
+ • Provides MIC bias
+ • Provides headphone and line output
+ - One SAI port terminated at 2x6 header
+ - Three SAI Tx/Rx ports terminated at 2x3 headers
+ - ARM JTAG support
+
+Booting Options
+---------------
+a) QSPI Flash Emu Boot
+b) QSPI Flash 1
+c) QSPI Flash 2
+
+QSPI flash map
+--------------
+Images | Size |QSPI Flash Address
+------------------------------------------
+RCW + PBI | 1MB | 0x4000_0000
+U-Boot | 1MB | 0x4010_0000
+U-Boot Env | 1MB | 0x4020_0000
+PPA FIT image | 2MB | 0x4050_0000
+Linux ITB | ~53MB | 0x40A0_0000
diff --git a/board/freescale/ls1012aqds/eth.c b/board/freescale/ls1012aqds/eth.c
new file mode 100644
index 00000000000..d5e87c5393b
--- /dev/null
+++ b/board/freescale/ls1012aqds/eth.c
@@ -0,0 +1,309 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015-2016 Freescale Semiconductor, Inc.
+ * Copyright 2017 NXP
+ */
+
+#include <config.h>
+#include <dm.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <asm/types.h>
+#include <fsl_dtsec.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/config.h>
+#include <asm/arch-fsl-layerscape/immap_lsch2.h>
+#include <asm/arch/fsl_serdes.h>
+#include <linux/delay.h>
+#include "../common/qixis.h"
+#include <net/pfe_eth/pfe_eth.h>
+#include <dm/platform_data/pfe_dm_eth.h>
+#include "ls1012aqds_qixis.h"
+
+#define EMI_NONE 0xFF
+#define EMI1_RGMII 1
+#define EMI1_SLOT1 2
+#define EMI1_SLOT2 3
+
+#define DEFAULT_PFE_MDIO_NAME "PFE_MDIO"
+#define DEFAULT_PFE_MDIO1_NAME "PFE_MDIO1"
+
+static const char * const mdio_names[] = {
+ "NULL",
+ "LS1012AQDS_MDIO_RGMII",
+ "LS1012AQDS_MDIO_SLOT1",
+ "LS1012AQDS_MDIO_SLOT2",
+ "NULL",
+};
+
+static const char *ls1012aqds_mdio_name_for_muxval(u8 muxval)
+{
+ return mdio_names[muxval];
+}
+
+struct ls1012aqds_mdio {
+ u8 muxval;
+ struct mii_dev *realbus;
+};
+
+static void ls1012aqds_mux_mdio(u8 muxval)
+{
+ u8 brdcfg4;
+
+ if (muxval < 7) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_EMISEL_MASK;
+ brdcfg4 |= (muxval << BRDCFG4_EMISEL_SHIFT);
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+ }
+}
+
+static int ls1012aqds_mdio_read(struct mii_dev *bus, int addr, int devad,
+ int regnum)
+{
+ struct ls1012aqds_mdio *priv = bus->priv;
+
+ ls1012aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->read(priv->realbus, addr, devad, regnum);
+}
+
+static int ls1012aqds_mdio_write(struct mii_dev *bus, int addr, int devad,
+ int regnum, u16 value)
+{
+ struct ls1012aqds_mdio *priv = bus->priv;
+
+ ls1012aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->write(priv->realbus, addr, devad, regnum, value);
+}
+
+static int ls1012aqds_mdio_reset(struct mii_dev *bus)
+{
+ struct ls1012aqds_mdio *priv = bus->priv;
+
+ if (priv->realbus->reset)
+ return priv->realbus->reset(priv->realbus);
+ else
+ return -1;
+}
+
+static int ls1012aqds_mdio_init(char *realbusname, u8 muxval)
+{
+ struct ls1012aqds_mdio *pmdio;
+ struct mii_dev *bus = mdio_alloc();
+
+ if (!bus) {
+ printf("Failed to allocate ls1012aqds MDIO bus\n");
+ return -1;
+ }
+
+ pmdio = malloc(sizeof(*pmdio));
+ if (!pmdio) {
+ printf("Failed to allocate ls1012aqds private data\n");
+ free(bus);
+ return -1;
+ }
+
+ bus->read = ls1012aqds_mdio_read;
+ bus->write = ls1012aqds_mdio_write;
+ bus->reset = ls1012aqds_mdio_reset;
+ sprintf(bus->name, ls1012aqds_mdio_name_for_muxval(muxval));
+
+ pmdio->realbus = miiphy_get_dev_by_name(realbusname);
+
+ if (!pmdio->realbus) {
+ printf("No bus with name %s\n", realbusname);
+ free(bus);
+ free(pmdio);
+ return -1;
+ }
+
+ pmdio->muxval = muxval;
+ bus->priv = pmdio;
+ return mdio_register(bus);
+}
+
+int pfe_eth_board_init(struct udevice *dev)
+{
+ static int init_done;
+ struct mii_dev *bus;
+ static const char *mdio_name;
+ struct pfe_mdio_info mac_mdio_info;
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+ u8 data8;
+ struct pfe_eth_dev *priv = dev_get_priv(dev);
+
+ int srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ ls1012aqds_mux_mdio(EMI1_SLOT1);
+
+ if (!init_done) {
+ mac_mdio_info.reg_base = (void *)EMAC1_BASE_ADDR;
+ mac_mdio_info.name = DEFAULT_PFE_MDIO_NAME;
+
+ bus = pfe_mdio_init(&mac_mdio_info);
+ if (!bus) {
+ printf("Failed to register mdio\n");
+ return -1;
+ }
+ init_done = 1;
+ }
+
+ if (priv->gemac_port) {
+ mac_mdio_info.reg_base = (void *)EMAC2_BASE_ADDR;
+ mac_mdio_info.name = DEFAULT_PFE_MDIO1_NAME;
+
+ bus = pfe_mdio_init(&mac_mdio_info);
+ if (!bus) {
+ printf("Failed to register mdio\n");
+ return -1;
+ }
+ }
+
+ switch (srds_s1) {
+ case 0x3508:
+ printf("ls1012aqds:supported SerDes PRCTL= %d\n", srds_s1);
+#ifdef CONFIG_PFE_RGMII_RESET_WA
+ /*
+ * Work around for FPGA registers initialization
+ * This is needed for RGMII to work.
+ */
+ printf("Reset RGMII WA....\n");
+ data8 = QIXIS_READ(rst_frc[0]);
+ data8 |= 0x2;
+ QIXIS_WRITE(rst_frc[0], data8);
+ data8 = QIXIS_READ(rst_frc[0]);
+
+ data8 = QIXIS_READ(res8[6]);
+ data8 |= 0xff;
+ QIXIS_WRITE(res8[6], data8);
+ data8 = QIXIS_READ(res8[6]);
+#endif
+ if (priv->gemac_port) {
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_RGMII);
+ if (ls1012aqds_mdio_init(DEFAULT_PFE_MDIO_NAME, EMI1_RGMII)
+ < 0) {
+ printf("Failed to register mdio for %s\n", mdio_name);
+ }
+
+ /* MAC2 */
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_RGMII);
+ bus = miiphy_get_dev_by_name(mdio_name);
+ pfe_set_mdio(priv->gemac_port, bus);
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC2_PHY_ADDR,
+ PHY_INTERFACE_MODE_RGMII);
+
+ } else {
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT1);
+ if (ls1012aqds_mdio_init(DEFAULT_PFE_MDIO_NAME, EMI1_SLOT1)
+ < 0) {
+ printf("Failed to register mdio for %s\n", mdio_name);
+ }
+
+ /* MAC1 */
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT1);
+ bus = miiphy_get_dev_by_name(mdio_name);
+ pfe_set_mdio(priv->gemac_port, bus);
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC1_PHY_ADDR,
+ PHY_INTERFACE_MODE_SGMII);
+ }
+
+ break;
+
+ case 0x2205:
+ printf("ls1012aqds:supported SerDes PRCTL= %d\n", srds_s1);
+ /*
+ * Work around for FPGA registers initialization
+ * This is needed for RGMII to work.
+ */
+ printf("Reset SLOT1 SLOT2....\n");
+ data8 = QIXIS_READ(rst_frc[2]);
+ data8 |= 0xc0;
+ QIXIS_WRITE(rst_frc[2], data8);
+ mdelay(100);
+ data8 = QIXIS_READ(rst_frc[2]);
+ data8 &= 0x3f;
+ QIXIS_WRITE(rst_frc[2], data8);
+
+ if (priv->gemac_port) {
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT2);
+ if (ls1012aqds_mdio_init(DEFAULT_PFE_MDIO_NAME, EMI1_SLOT2)
+ < 0) {
+ printf("Failed to register mdio for %s\n", mdio_name);
+ }
+ /* MAC2 */
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT2);
+ bus = miiphy_get_dev_by_name(mdio_name);
+ pfe_set_mdio(1, bus);
+ pfe_set_phy_address_mode(1, CONFIG_PFE_SGMII_2500_PHY2_ADDR,
+ PHY_INTERFACE_MODE_2500BASEX);
+
+ data8 = QIXIS_READ(brdcfg[12]);
+ data8 |= 0x20;
+ QIXIS_WRITE(brdcfg[12], data8);
+
+ } else {
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT1);
+ if (ls1012aqds_mdio_init(DEFAULT_PFE_MDIO_NAME, EMI1_SLOT1)
+ < 0) {
+ printf("Failed to register mdio for %s\n", mdio_name);
+ }
+
+ /* MAC1 */
+ mdio_name = ls1012aqds_mdio_name_for_muxval(EMI1_SLOT1);
+ bus = miiphy_get_dev_by_name(mdio_name);
+ pfe_set_mdio(0, bus);
+ pfe_set_phy_address_mode(0,
+ CONFIG_PFE_SGMII_2500_PHY1_ADDR,
+ PHY_INTERFACE_MODE_2500BASEX);
+ }
+ break;
+
+ default:
+ printf("ls1012aqds:unsupported SerDes PRCTL= %d\n", srds_s1);
+ break;
+ }
+ return 0;
+}
+
+static struct pfe_eth_pdata pfe_pdata0 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC1_BASE_ADDR,
+ .phy_interface = 0,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+static struct pfe_eth_pdata pfe_pdata1 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC2_BASE_ADDR,
+ .phy_interface = 1,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe0) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata0,
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe1) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata1,
+};
diff --git a/board/freescale/ls1012aqds/ls1012aqds.c b/board/freescale/ls1012aqds/ls1012aqds.c
new file mode 100644
index 00000000000..7d56eb0117d
--- /dev/null
+++ b/board/freescale/ls1012aqds/ls1012aqds.c
@@ -0,0 +1,287 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <fdt_support.h>
+#include <asm/cache.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/fdt.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/soc.h>
+#include <ahci.h>
+#include <hwconfig.h>
+#include <mmc.h>
+#include <env_internal.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_esdhc.h>
+#include <fsl_mmdc.h>
+#include <spl.h>
+#include <netdev.h>
+#include "../common/qixis.h"
+#include "ls1012aqds_qixis.h"
+#include "ls1012aqds_pfe.h"
+#include <net/pfe_eth/pfe/pfe_hw.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ char buf[64];
+ u8 sw;
+
+ sw = QIXIS_READ(arch);
+ printf("Board Arch: V%d, ", sw >> 4);
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A' - 1);
+
+ sw = QIXIS_READ(brdcfg[QIXIS_LBMAP_BRDCFG_REG]);
+
+ if (sw & QIXIS_LBMAP_ALTBANK)
+ printf("flash: 2\n");
+ else
+ printf("flash: 1\n");
+
+ printf("FPGA: v%d (%s), build %d",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+ return 0;
+}
+
+#ifdef CONFIG_TFABOOT
+int dram_init(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+ if (!gd->ram_size)
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+
+ return 0;
+}
+#else
+int dram_init(void)
+{
+ static const struct fsl_mmdc_info mparam = {
+ 0x05180000, /* mdctl */
+ 0x00030035, /* mdpdc */
+ 0x12554000, /* mdotc */
+ 0xbabf7954, /* mdcfg0 */
+ 0xdb328f64, /* mdcfg1 */
+ 0x01ff00db, /* mdcfg2 */
+ 0x00001680, /* mdmisc */
+ 0x0f3c8000, /* mdref */
+ 0x00002000, /* mdrwd */
+ 0x00bf1023, /* mdor */
+ 0x0000003f, /* mdasp */
+ 0x0000022a, /* mpodtctrl */
+ 0xa1390003, /* mpzqhwctrl */
+ };
+
+ mmdc_init(&mparam);
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+#if !defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD)
+ /* This will break-before-make MMU for DDR */
+ update_early_mmu_table();
+#endif
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ u8 mux_sdhc_cd = 0x80;
+ int bus_num = 0;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(bus_num, CFG_SYS_I2C_FPGA_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return ret;
+ }
+ dm_i2c_write(dev, 0x5a, &mux_sdhc_cd, 1);
+#else
+ i2c_set_bus_num(bus_num);
+
+ i2c_write(CFG_SYS_I2C_FPGA_ADDR, 0x5a, 1, &mux_sdhc_cd, 1);
+#endif
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
+
+ /* Set CCI-400 control override register to enable barrier
+ * transaction */
+ if (current_el() == 3)
+ out_le32(&cci->ctrl_ord,
+ CCI400_CTRLORD_EN_BARRIER);
+
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_FSL_PFE
+void board_quiesce_devices(void)
+{
+ pfe_command_stop(0, NULL);
+}
+#endif
+
+int esdhc_status_fixup(void *blob, const char *compat)
+{
+ char esdhc0_path[] = "/soc/esdhc@1560000";
+ char esdhc1_path[] = "/soc/esdhc@1580000";
+ u8 card_id;
+
+ do_fixup_by_path(blob, esdhc0_path, "status", "okay",
+ sizeof("okay"), 1);
+
+ /*
+ * The Presence Detect 2 register detects the installation
+ * of cards in various PCI Express or SGMII slots.
+ *
+ * STAT_PRS2[7:5]: Specifies the type of card installed in the
+ * SDHC2 Adapter slot. 0b111 indicates no adapter is installed.
+ */
+ card_id = (QIXIS_READ(present2) & 0xe0) >> 5;
+
+ /* If no adapter is installed in SDHC2, disable SDHC2 */
+ if (card_id == 0x7)
+ do_fixup_by_path(blob, esdhc1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ else
+ do_fixup_by_path(blob, esdhc1_path, "status", "okay",
+ sizeof("okay"), 1);
+ return 0;
+}
+
+static int pfe_set_properties(void *set_blob, struct pfe_prop_val prop_val,
+ char *enet_path, char *mdio_path)
+{
+ do_fixup_by_path(set_blob, enet_path, "fsl,gemac-bus-id",
+ &prop_val.busid, PFE_PROP_LEN, 1);
+ do_fixup_by_path(set_blob, enet_path, "fsl,gemac-phy-id",
+ &prop_val.phyid, PFE_PROP_LEN, 1);
+ do_fixup_by_path(set_blob, enet_path, "fsl,mdio-mux-val",
+ &prop_val.mux_val, PFE_PROP_LEN, 1);
+ do_fixup_by_path(set_blob, enet_path, "phy-mode",
+ prop_val.phy_mode, strlen(prop_val.phy_mode) + 1, 1);
+ do_fixup_by_path(set_blob, mdio_path, "fsl,mdio-phy-mask",
+ &prop_val.phy_mask, PFE_PROP_LEN, 1);
+ return 0;
+}
+
+static void fdt_fsl_fixup_of_pfe(void *blob)
+{
+ int i = 0;
+ struct pfe_prop_val prop_val;
+ void *l_blob = blob;
+
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+ unsigned int srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ for (i = 0; i < NUM_ETH_NODE; i++) {
+ switch (srds_s1) {
+ case SERDES_1_G_PROTOCOL:
+ if (i == 0) {
+ prop_val.busid = cpu_to_fdt32(
+ ETH_1_1G_BUS_ID);
+ prop_val.phyid = cpu_to_fdt32(
+ ETH_1_1G_PHY_ID);
+ prop_val.mux_val = cpu_to_fdt32(
+ ETH_1_1G_MDIO_MUX);
+ prop_val.phy_mask = cpu_to_fdt32(
+ ETH_1G_MDIO_PHY_MASK);
+ prop_val.phy_mode = "sgmii";
+ pfe_set_properties(l_blob, prop_val, ETH_1_PATH,
+ ETH_1_MDIO);
+ } else {
+ prop_val.busid = cpu_to_fdt32(
+ ETH_2_1G_BUS_ID);
+ prop_val.phyid = cpu_to_fdt32(
+ ETH_2_1G_PHY_ID);
+ prop_val.mux_val = cpu_to_fdt32(
+ ETH_2_1G_MDIO_MUX);
+ prop_val.phy_mask = cpu_to_fdt32(
+ ETH_1G_MDIO_PHY_MASK);
+ prop_val.phy_mode = "rgmii";
+ pfe_set_properties(l_blob, prop_val, ETH_2_PATH,
+ ETH_2_MDIO);
+ }
+ break;
+ case SERDES_2_5_G_PROTOCOL:
+ if (i == 0) {
+ prop_val.busid = cpu_to_fdt32(
+ ETH_1_2_5G_BUS_ID);
+ prop_val.phyid = cpu_to_fdt32(
+ ETH_1_2_5G_PHY_ID);
+ prop_val.mux_val = cpu_to_fdt32(
+ ETH_1_2_5G_MDIO_MUX);
+ prop_val.phy_mask = cpu_to_fdt32(
+ ETH_2_5G_MDIO_PHY_MASK);
+ prop_val.phy_mode = "2500base-x";
+ pfe_set_properties(l_blob, prop_val, ETH_1_PATH,
+ ETH_1_MDIO);
+ } else {
+ prop_val.busid = cpu_to_fdt32(
+ ETH_2_2_5G_BUS_ID);
+ prop_val.phyid = cpu_to_fdt32(
+ ETH_2_2_5G_PHY_ID);
+ prop_val.mux_val = cpu_to_fdt32(
+ ETH_2_2_5G_MDIO_MUX);
+ prop_val.phy_mask = cpu_to_fdt32(
+ ETH_2_5G_MDIO_PHY_MASK);
+ prop_val.phy_mode = "2500base-x";
+ pfe_set_properties(l_blob, prop_val, ETH_2_PATH,
+ ETH_2_MDIO);
+ }
+ break;
+ default:
+ printf("serdes:[%d]\n", srds_s1);
+ }
+ }
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ arch_fixup_fdt(blob);
+
+ ft_cpu_setup(blob, bd);
+ fdt_fsl_fixup_of_pfe(blob);
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1012aqds/ls1012aqds_pfe.h b/board/freescale/ls1012aqds/ls1012aqds_pfe.h
new file mode 100644
index 00000000000..5ab283ce8d5
--- /dev/null
+++ b/board/freescale/ls1012aqds/ls1012aqds_pfe.h
@@ -0,0 +1,44 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2017 NXP
+ */
+
+#define ETH_1_1G_BUS_ID 0x1
+#define ETH_1_1G_PHY_ID 0x1e
+#define ETH_1_1G_MDIO_MUX 0x2
+#define ETH_1G_MDIO_PHY_MASK 0xBFFFFFFD
+#define ETH_1_1G_PHY_MODE "sgmii"
+#define ETH_2_1G_BUS_ID 0x1
+#define ETH_2_1G_PHY_ID 0x1
+#define ETH_2_1G_MDIO_MUX 0x1
+#define ETH_2_1G_PHY_MODE "rgmii"
+
+#define ETH_1_2_5G_BUS_ID 0x0
+#define ETH_1_2_5G_PHY_ID 0x1
+#define ETH_1_2_5G_MDIO_MUX 0x2
+#define ETH_2_5G_MDIO_PHY_MASK 0xFFFFFFF9
+#define ETH_2_5G_PHY_MODE "2500base-x"
+#define ETH_2_2_5G_BUS_ID 0x1
+#define ETH_2_2_5G_PHY_ID 0x2
+#define ETH_2_2_5G_MDIO_MUX 0x3
+
+#define SERDES_1_G_PROTOCOL 0x3508
+#define SERDES_2_5_G_PROTOCOL 0x2205
+
+#define PFE_PROP_LEN 4
+
+#define ETH_1_PATH "/pfe@04000000/ethernet@0"
+#define ETH_1_MDIO ETH_1_PATH "/mdio@0"
+
+#define ETH_2_PATH "/pfe@04000000/ethernet@1"
+#define ETH_2_MDIO ETH_2_PATH "/mdio@0"
+
+#define NUM_ETH_NODE 2
+
+struct pfe_prop_val {
+ int busid;
+ int phyid;
+ int mux_val;
+ int phy_mask;
+ char *phy_mode;
+};
diff --git a/board/freescale/ls1012aqds/ls1012aqds_qixis.h b/board/freescale/ls1012aqds/ls1012aqds_qixis.h
new file mode 100644
index 00000000000..19f522d9eaa
--- /dev/null
+++ b/board/freescale/ls1012aqds/ls1012aqds_qixis.h
@@ -0,0 +1,34 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS1043AQDS_QIXIS_H__
+#define __LS1043AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1043AQDS */
+
+/* BRDCFG4[4:7] select EC1 and EC2 as a pair */
+#define BRDCFG4_EMISEL_MASK 0xe0
+#define BRDCFG4_EMISEL_SHIFT 6
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+/* BRDCFG2 - SD clock*/
+#define QIXIS_SDCLK1_100 0x0
+#define QIXIS_SDCLK1_125 0x1
+#define QIXIS_SDCLK1_165 0x2
+#define QIXIS_SDCLK1_100_SP 0x3
+
+#endif
diff --git a/board/freescale/ls1012ardb/Kconfig b/board/freescale/ls1012ardb/Kconfig
new file mode 100644
index 00000000000..b55660d485f
--- /dev/null
+++ b/board/freescale/ls1012ardb/Kconfig
@@ -0,0 +1,108 @@
+if TARGET_LS1012ARDB
+
+config SYS_BOARD
+ default "ls1012ardb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1012ardb"
+
+if CHAIN_OF_TRUST
+config SYS_LS_PFE_ESBC_ADDR
+ hex "PFE Firmware HDR Addr"
+ default 0x40640000
+
+config SYS_LS_PFE_ESBC_LENGTH
+ hex "length of PFE Firmware HDR"
+ default 0xc00
+endif
+
+if FSL_PFE
+
+config BOARD_SPECIFIC_OPTIONS # dummy
+ def_bool y
+ select PHYLIB
+ imply PHY_REALTEK
+
+config SYS_LS_PFE_FW_ADDR
+ hex "Flash address of PFE firmware"
+ default 0x40a00000
+
+config SYS_LS_PFE_FW_LENGTH
+ hex "length of PFE firmware"
+ default 0x300000
+
+config DDR_PFE_PHYS_BASEADDR
+ hex "PFE DDR physical base address"
+ default 0x03800000
+
+config DDR_PFE_BASEADDR
+ hex "PFE DDR base address"
+ default 0x83800000
+
+config PFE_EMAC1_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x2
+
+config PFE_EMAC2_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x1
+
+endif
+
+endif
+
+if TARGET_LS1012A2G5RDB
+
+config SYS_BOARD
+ default "ls1012ardb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1012a2g5rdb"
+
+if FSL_PFE
+
+config BOARD_SPECIFIC_OPTIONS # dummy
+ def_bool y
+ select PHYLIB
+ imply PHYLIB_10G
+ imply PHY_AQUANTIA
+
+config SYS_LS_PFE_FW_ADDR
+ hex "Flash address of PFE firmware"
+ default 0x40a00000
+
+config SYS_LS_PFE_FW_LENGTH
+ hex "length of PFE firmware"
+ default 0x300000
+
+config DDR_PFE_PHYS_BASEADDR
+ hex "PFE DDR physical base address"
+ default 0x03800000
+
+config DDR_PFE_BASEADDR
+ hex "PFE DDR base address"
+ default 0x83800000
+
+config PFE_EMAC1_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x2
+
+config PFE_EMAC2_PHY_ADDR
+ hex "PFE DDR base address"
+ default 0x1
+
+endif
+
+endif
diff --git a/board/freescale/ls1012ardb/MAINTAINERS b/board/freescale/ls1012ardb/MAINTAINERS
new file mode 100644
index 00000000000..ce2f9a16cc7
--- /dev/null
+++ b/board/freescale/ls1012ardb/MAINTAINERS
@@ -0,0 +1,17 @@
+LS1012ARDB BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1012ardb/
+F: include/configs/ls1012ardb.h
+F: configs/ls1012ardb_qspi_defconfig
+F: configs/ls1012ardb_tfa_defconfig
+F: configs/ls1012ardb_tfa_SECURE_BOOT_defconfig
+F: configs/ls1012a2g5rdb_tfa_defconfig
+F: configs/ls1012ardb_qspi_SECURE_BOOT_defconfig
+
+LS1012A2G5RDB BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1012ardb/
+F: include/configs/ls1012a2g5rdb.h
+F: configs/ls1012a2g5rdb_qspi_defconfig
diff --git a/board/freescale/ls1012ardb/Makefile b/board/freescale/ls1012ardb/Makefile
new file mode 100644
index 00000000000..70c7b33273d
--- /dev/null
+++ b/board/freescale/ls1012ardb/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2016 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1012ardb.o
+obj-$(CONFIG_FSL_PFE) += eth.o
diff --git a/board/freescale/ls1012ardb/README b/board/freescale/ls1012ardb/README
new file mode 100644
index 00000000000..26b0485a7f8
--- /dev/null
+++ b/board/freescale/ls1012ardb/README
@@ -0,0 +1,97 @@
+Overview
+--------
+QorIQ LS1012A Reference Design System (LS1012ARDB) is a high-performance
+development platform, with a complete debugging environment.
+The LS1012ARDB board supports the QorIQ LS1012A processor and is
+optimized to support the high-bandwidth DDR3L memory and
+a full complement of high-speed SerDes ports.
+
+LS1012A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS2080A
+SoC overview.
+
+LS1012ARDB board Overview
+-----------------------
+ - SERDES Connections, 4 lanes supporting:
+ - PCI Express - 3.0
+ - SGMII, SGMII 2.5
+ - SATA 3.0
+ - DDR Controller
+ - 16-bit, 1 GB DDR3L SDRAM memory, running at data rates up to 1 GT/s
+ -QSPI: A dual 1:3 switch, NX3L4357GM,115 (U35) drives the QSPI chip-select
+ signals to
+ - QSPI NOR flash memory (2 virtual banks)
+ - the QSPI emulator.s
+ - USB 3.0
+ - one high-speed USB 2.0/3.0 port.
+ - Two enhanced secure digital host controllers:
+ - SDHC1 controller can be connected to onboard SDHC connector
+ - SDHC2 controller: Three dual 1:4 mux/demux devices,
+ 74CBTLV3253DS (U30, U31, U33) drive the SDHC2 signals to eMMC,
+ SDIO WiFi, SPI, and Ardiuno shield
+ - 2 I2C controllers
+ - One SATA onboard connectors
+ - UART
+ - The LS1012A processor consists of two UART controllers,
+ out of which only UART1 is used on RDB.
+ - ARM JTAG support
+
+Booting Options
+---------------
+a) QSPI Flash Emu Boot
+b) QSPI Flash 1
+c) QSPI Flash 2
+
+QSPI flash map
+--------------
+Images | Size |QSPI Flash Address
+------------------------------------------
+RCW + PBI | 1MB | 0x4000_0000
+U-Boot | 1MB | 0x4010_0000
+U-Boot Env | 1MB | 0x4020_0000
+PPA FIT image | 2MB | 0x4050_0000
+Linux ITB | ~53MB | 0x40A0_0000
+
+LS1012A2G5RDB board Overview
+-----------------------
+ - SERDES Connections, 3 lanes supporting:
+ - SGMII, SGMII 2.5
+ - SATA 3.0
+ - DDR Controller
+ - 16-bit, 1 GB DDR3L SDRAM memory, running at data rates up to 1 GT/s
+ -QSPI: A dual 1:3 switch, NX3L4357GM,115 (U35) drives the QSPI chip-select
+ signals to
+ - QSPI NOR flash memory
+ - USB 3.0
+ - one high-speed USB 2.0/3.0 port.
+ - SDIO WiFi, SPI
+ - 2 I2C controllers
+ - One SATA onboard connectors
+ - UART
+ - The LS1012A processor consists of two UART controllers,
+ out of which only UART1 is used on 2G5RDB.
+ - ARM JTAG support
+
+Major Difference between LS1012ARDB and LS1012A-2G5RDB
+------------------------------------------------------
+1. LS1012A-2G5RDB has Type C USB connector unlike USB Type A/B of LS1012ARDB
+2. LS1012A-2G5RDB has 2 2.5G AQR PHY unlike 2 1G Realtek RTL8211FS PHYs
+ of LS1012ARDB
+3. LS1012A-2G5RDB is not having Arduino header
+4. LS1012A-2G5RDB doesn't have PCI slot
+
+Booting Options
+---------------
+QSPI Flash
+
+QSPI flash map
+--------------
+Images | Size |QSPI Flash Address
+------------------------------------------
+RCW + PBI | 1MB | 0x4000_0000
+U-Boot | 1MB | 0x4010_0000
+U-Boot Env | 1MB | 0x4030_0000
+PPA FIT image | 2MB | 0x4040_0000
+PFE firmware | 20K | 0x00a0_0000
+Linux ITB | ~53MB | 0x4100_0000
diff --git a/board/freescale/ls1012ardb/eth.c b/board/freescale/ls1012ardb/eth.c
new file mode 100644
index 00000000000..71cb2988a56
--- /dev/null
+++ b/board/freescale/ls1012ardb/eth.c
@@ -0,0 +1,171 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015-2016 Freescale Semiconductor, Inc.
+ * Copyright 2017 NXP
+ */
+
+#include <config.h>
+#include <dm.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <asm/types.h>
+#include <fsl_dtsec.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/config.h>
+#include <asm/arch-fsl-layerscape/immap_lsch2.h>
+#include <asm/arch/fsl_serdes.h>
+#include <linux/delay.h>
+#include <net/pfe_eth/pfe_eth.h>
+#include <dm/platform_data/pfe_dm_eth.h>
+#include <i2c.h>
+
+#define DEFAULT_PFE_MDIO_NAME "PFE_MDIO"
+
+static inline void ls1012ardb_reset_phy(void)
+{
+#ifdef CONFIG_TARGET_LS1012ARDB
+ /* Through reset IO expander reset both RGMII and SGMII PHYs */
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ /*
+ * The I2C IO-expander PCAL9555A is mouted on I2C1 bus(bus number is 0).
+ */
+ ret = i2c_get_chip_for_busnum(0, I2C_MUX_IO2_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ 0);
+ return;
+ }
+ /* Config port 0
+ * - config pin IOXP_RST_ETH1_B and IOXP_RST_ETH2_B
+ * are enabled as an output.
+ */
+ dm_i2c_reg_write(dev, 6, __PHY_MASK);
+
+ /*
+ * Set port 0 output a value to reset ETH2 interface
+ * - pin IOXP_RST_ETH2_B output 0b0
+ */
+ dm_i2c_reg_write(dev, 2, __PHY_ETH2_MASK);
+ mdelay(10);
+ dm_i2c_reg_write(dev, 2, __PHY_ETH1_MASK);
+ /*
+ * Set port 0 output a value to reset ETH1 interface
+ * - pin IOXP_RST_ETH1_B output 0b0
+ */
+ mdelay(10);
+ dm_i2c_reg_write(dev, 2, 0xFF);
+#else
+ i2c_reg_write(I2C_MUX_IO2_ADDR, 6, __PHY_MASK);
+ i2c_reg_write(I2C_MUX_IO2_ADDR, 2, __PHY_ETH2_MASK);
+ mdelay(10);
+ i2c_reg_write(I2C_MUX_IO2_ADDR, 2, __PHY_ETH1_MASK);
+ mdelay(10);
+ i2c_reg_write(I2C_MUX_IO2_ADDR, 2, 0xFF);
+#endif
+ mdelay(50);
+#endif
+}
+
+int pfe_eth_board_init(struct udevice *dev)
+{
+ static int init_done;
+ struct mii_dev *bus;
+ struct pfe_mdio_info mac_mdio_info;
+ struct pfe_eth_dev *priv = dev_get_priv(dev);
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+
+ int srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ if (!init_done) {
+ ls1012ardb_reset_phy();
+ mac_mdio_info.reg_base = (void *)EMAC1_BASE_ADDR;
+ mac_mdio_info.name = DEFAULT_PFE_MDIO_NAME;
+
+ bus = pfe_mdio_init(&mac_mdio_info);
+ if (!bus) {
+ printf("Failed to register mdio\n");
+ return -1;
+ }
+ init_done = 1;
+ }
+
+ pfe_set_mdio(priv->gemac_port,
+ miiphy_get_dev_by_name(DEFAULT_PFE_MDIO_NAME));
+
+ switch (srds_s1) {
+ case 0x3508:
+ if (!priv->gemac_port) {
+ /* MAC1 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC1_PHY_ADDR,
+ PHY_INTERFACE_MODE_SGMII);
+ } else {
+ /* MAC2 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC2_PHY_ADDR,
+ PHY_INTERFACE_MODE_RGMII_ID);
+ }
+ break;
+ case 0x2208:
+ if (!priv->gemac_port) {
+ /* MAC1 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC1_PHY_ADDR,
+ PHY_INTERFACE_MODE_2500BASEX);
+ } else {
+ /* MAC2 */
+ pfe_set_phy_address_mode(priv->gemac_port,
+ CONFIG_PFE_EMAC2_PHY_ADDR,
+ PHY_INTERFACE_MODE_2500BASEX);
+ }
+ break;
+ default:
+ printf("unsupported SerDes PRCTL= %d\n", srds_s1);
+ break;
+ }
+ return 0;
+}
+
+static struct pfe_eth_pdata pfe_pdata0 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC1_BASE_ADDR,
+ .phy_interface = 0,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+static struct pfe_eth_pdata pfe_pdata1 = {
+ .pfe_eth_pdata_mac = {
+ .iobase = (phys_addr_t)EMAC2_BASE_ADDR,
+ .phy_interface = 1,
+ },
+
+ .pfe_ddr_addr = {
+ .ddr_pfe_baseaddr = (void *)CONFIG_DDR_PFE_BASEADDR,
+ .ddr_pfe_phys_baseaddr = CONFIG_DDR_PFE_PHYS_BASEADDR,
+ },
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe0) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata0,
+};
+
+U_BOOT_DRVINFO(ls1012a_pfe1) = {
+ .name = "pfe_eth",
+ .plat = &pfe_pdata1,
+};
diff --git a/board/freescale/ls1012ardb/ls1012ardb.c b/board/freescale/ls1012ardb/ls1012ardb.c
new file mode 100644
index 00000000000..7f8001b4981
--- /dev/null
+++ b/board/freescale/ls1012ardb/ls1012ardb.c
@@ -0,0 +1,412 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <fdt_support.h>
+#include <hang.h>
+#include <i2c.h>
+#include <asm/cache.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/soc.h>
+#include <hwconfig.h>
+#include <ahci.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fsl_esdhc.h>
+#include <env_internal.h>
+#include <fsl_mmdc.h>
+#include <netdev.h>
+#include <net/pfe_eth/pfe/pfe_hw.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define BOOT_FROM_UPPER_BANK 0x2
+#define BOOT_FROM_LOWER_BANK 0x1
+
+int checkboard(void)
+{
+#ifdef CONFIG_TARGET_LS1012ARDB
+ u8 in1;
+ int ret, bus_num = 0;
+
+ puts("Board: LS1012ARDB ");
+
+ /* Initialize i2c early for Serial flash bank information */
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_MUX_IO_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return -ENXIO;
+ }
+ ret = dm_i2c_read(dev, I2C_MUX_IO_1, &in1, 1);
+#else /* Non DM I2C support - will be removed */
+ i2c_set_bus_num(bus_num);
+ ret = i2c_read(I2C_MUX_IO_ADDR, I2C_MUX_IO_1, 1, &in1, 1);
+#endif
+ if (ret < 0) {
+ printf("Error reading i2c boot information!\n");
+ return 0; /* Don't want to hang() on this error */
+ }
+
+ puts("Version");
+ switch (in1 & SW_REV_MASK) {
+ case SW_REV_A:
+ puts(": RevA");
+ break;
+ case SW_REV_B:
+ puts(": RevB");
+ break;
+ case SW_REV_C:
+ puts(": RevC");
+ break;
+ case SW_REV_C1:
+ puts(": RevC1");
+ break;
+ case SW_REV_C2:
+ puts(": RevC2");
+ break;
+ case SW_REV_D:
+ puts(": RevD");
+ break;
+ case SW_REV_E:
+ puts(": RevE");
+ break;
+ default:
+ puts(": unknown");
+ break;
+ }
+
+ printf(", boot from QSPI");
+ if ((in1 & SW_BOOT_MASK) == SW_BOOT_EMU)
+ puts(": emu\n");
+ else if ((in1 & SW_BOOT_MASK) == SW_BOOT_BANK1)
+ puts(": bank1\n");
+ else if ((in1 & SW_BOOT_MASK) == SW_BOOT_BANK2)
+ puts(": bank2\n");
+ else
+ puts("unknown\n");
+#else
+
+ puts("Board: LS1012A2G5RDB ");
+#endif
+ return 0;
+}
+
+#ifdef CONFIG_TFABOOT
+int dram_init(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+ if (!gd->ram_size)
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+
+ return 0;
+}
+#else
+int dram_init(void)
+{
+#ifndef CONFIG_TFABOOT
+ static const struct fsl_mmdc_info mparam = {
+ 0x05180000, /* mdctl */
+ 0x00030035, /* mdpdc */
+ 0x12554000, /* mdotc */
+ 0xbabf7954, /* mdcfg0 */
+ 0xdb328f64, /* mdcfg1 */
+ 0x01ff00db, /* mdcfg2 */
+ 0x00001680, /* mdmisc */
+ 0x0f3c8000, /* mdref */
+ 0x00002000, /* mdrwd */
+ 0x00bf1023, /* mdor */
+ 0x0000003f, /* mdasp */
+ 0x0000022a, /* mpodtctrl */
+ 0xa1390003, /* mpzqhwctrl */
+ };
+
+ mmdc_init(&mparam);
+#endif
+
+ gd->ram_size = CFG_SYS_SDRAM_SIZE;
+#if !defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD)
+ /* This will break-before-make MMU for DDR */
+ update_early_mmu_table();
+#endif
+
+ return 0;
+}
+#endif
+
+
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ struct ccsr_cci400 *cci = (struct ccsr_cci400 *)(CONFIG_SYS_IMMR +
+ CONFIG_SYS_CCI400_OFFSET);
+ /*
+ * Set CCI-400 control override register to enable barrier
+ * transaction
+ */
+ if (current_el() == 3)
+ out_le32(&cci->ctrl_ord, CCI400_CTRLORD_EN_BARRIER);
+
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_FSL_PFE
+void board_quiesce_devices(void)
+{
+ pfe_command_stop(0, NULL);
+}
+#endif
+
+#ifdef CONFIG_TARGET_LS1012ARDB
+int esdhc_status_fixup(void *blob, const char *compat)
+{
+ char esdhc1_path[] = "/soc/esdhc@1580000";
+ bool sdhc2_en = false;
+ u8 mux_sdhc2;
+ u8 io = 0;
+ int ret, bus_num = 0;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_MUX_IO_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return -ENXIO;
+ }
+ ret = dm_i2c_read(dev, I2C_MUX_IO_1, &io, 1);
+#else
+ i2c_set_bus_num(bus_num);
+ /* IO1[7:3] is the field of board revision info. */
+ ret = i2c_read(I2C_MUX_IO_ADDR, I2C_MUX_IO_1, 1, &io, 1);
+#endif
+ if (ret < 0) {
+ printf("Error reading i2c boot information!\n");
+ return 0;
+ }
+
+ /* hwconfig method is used for RevD and later versions. */
+ if ((io & SW_REV_MASK) <= SW_REV_D) {
+#ifdef CONFIG_HWCONFIG
+ if (hwconfig("esdhc1"))
+ sdhc2_en = true;
+#endif
+ } else {
+ /*
+ * The I2C IO-expander for mux select is used to control
+ * the muxing of various onboard interfaces.
+ *
+ * IO0[3:2] indicates SDHC2 interface demultiplexer
+ * select lines.
+ * 00 - SDIO wifi
+ * 01 - GPIO (to Arduino)
+ * 10 - eMMC Memory
+ * 11 - SPI
+ */
+#if CONFIG_IS_ENABLED(DM_I2C)
+ ret = dm_i2c_read(dev, I2C_MUX_IO_0, &io, 1);
+#else
+ ret = i2c_read(I2C_MUX_IO_ADDR, I2C_MUX_IO_0, 1, &io, 1);
+#endif
+ if (ret < 0) {
+ printf("Error reading i2c boot information!\n");
+ return 0;
+ }
+
+ mux_sdhc2 = (io & 0x0c) >> 2;
+ /* Enable SDHC2 only when use SDIO wifi and eMMC */
+ if (mux_sdhc2 == 2 || mux_sdhc2 == 0)
+ sdhc2_en = true;
+ }
+ if (sdhc2_en)
+ do_fixup_by_path(blob, esdhc1_path, "status", "okay",
+ sizeof("okay"), 1);
+ else
+ do_fixup_by_path(blob, esdhc1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ return 0;
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ arch_fixup_fdt(blob);
+
+ ft_cpu_setup(blob, bd);
+
+ return 0;
+}
+
+static int switch_to_bank1(void)
+{
+ u8 data = 0xf4, chip_addr = 0x24, offset_addr = 0x03;
+ int ret, bus_num = 0;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(bus_num, chip_addr,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return -ENXIO;
+ }
+ /*
+ * --------------------------------------------------------------------
+ * |bus |I2C address| Device | Notes |
+ * --------------------------------------------------------------------
+ * |I2C1|0x24, 0x25,| IO expander (CFG,| Provides 16bits of General |
+ * | |0x26 | RESET, and INT/ | Purpose parallel Input/Output|
+ * | | | KW41GPIO) - NXP | (GPIO) expansion for the |
+ * | | | PCAL9555AHF | I2C bus |
+ * ----- --------------------------------------------------------------
+ * - mount three IO expander(PCAL9555AHF) on I2C1
+ *
+ * PCAL9555A device address
+ * slave address
+ * --------------------------------------
+ * | 0 | 1 | 0 | 0 | A2 | A1 | A0 | R/W |
+ * --------------------------------------
+ * | fixed | hardware selectable|
+ *
+ * Output port 1(Pinter register bits = 0x03)
+ *
+ * P1_[7~0] = 0xf4
+ * P1_0 <---> CFG_MUX_QSPI_S0
+ * P1_1 <---> CFG_MUX_QSPI_S1
+ * CFG_MUX_QSPI_S[1:0] = 0b00
+ *
+ * QSPI chip-select demultiplexer select
+ * ---------------------------------------------------------------------
+ * CFG_MUX_QSPI_S1|CFG_MUX_QSPI_S0| Values
+ * ---------------------------------------------------------------------
+ * 0 | 0 |CS routed to SPI memory bank1(default)
+ * ---------------------------------------------------------------------
+ * 0 | 1 |CS routed to SPI memory bank2
+ * ---------------------------------------------------------------------
+ *
+ */
+ ret = dm_i2c_write(dev, offset_addr, &data, 1);
+#else /* Non DM I2C support - will be removed */
+ i2c_set_bus_num(bus_num);
+ ret = i2c_write(chip_addr, offset_addr, 1, &data, 1);
+#endif
+
+ if (ret) {
+ printf("i2c write error to chip : %u, addr : %u, data : %u\n",
+ chip_addr, offset_addr, data);
+ }
+
+ return ret;
+}
+
+static int switch_to_bank2(void)
+{
+ u8 data[2] = {0xfc, 0xf5}, offset_addr[2] = {0x7, 0x3};
+ u8 chip_addr = 0x24;
+ int ret, i, bus_num = 0;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(bus_num, chip_addr,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return -ENXIO;
+ }
+#else /* Non DM I2C support - will be removed */
+ i2c_set_bus_num(bus_num);
+#endif
+
+ /*
+ * 1th step: config port 1
+ * - the port 1 pin is enabled as an output
+ * 2th step: output port 1
+ * - P1_[7:0] output 0xf5,
+ * then CFG_MUX_QSPI_S[1:0] equal to 0b01,
+ * CS routed to SPI memory bank2
+ */
+ for (i = 0; i < sizeof(data); i++) {
+#if CONFIG_IS_ENABLED(DM_I2C)
+ ret = dm_i2c_write(dev, offset_addr[i], &data[i], 1);
+#else /* Non DM I2C support - will be removed */
+ ret = i2c_write(chip_addr, offset_addr[i], 1, &data[i], 1);
+#endif
+ if (ret) {
+ printf("i2c write error to chip : %u, addr : %u, data : %u\n",
+ chip_addr, offset_addr[i], data[i]);
+ goto err;
+ }
+ }
+
+err:
+ return ret;
+}
+
+static int convert_flash_bank(int bank)
+{
+ int ret = 0;
+
+ switch (bank) {
+ case BOOT_FROM_UPPER_BANK:
+ ret = switch_to_bank2();
+ break;
+ case BOOT_FROM_LOWER_BANK:
+ ret = switch_to_bank1();
+ break;
+ default:
+ ret = CMD_RET_USAGE;
+ break;
+ };
+
+ return ret;
+}
+
+static int flash_bank_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc != 2)
+ return CMD_RET_USAGE;
+ if (strcmp(argv[1], "1") == 0)
+ convert_flash_bank(BOOT_FROM_LOWER_BANK);
+ else if (strcmp(argv[1], "2") == 0)
+ convert_flash_bank(BOOT_FROM_UPPER_BANK);
+ else
+ return CMD_RET_USAGE;
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ boot_bank, 2, 0, flash_bank_cmd,
+ "Flash bank Selection Control",
+ "bank[1-lower bank/2-upper bank] (e.g. boot_bank 1)"
+);
diff --git a/board/freescale/ls1021aiot/Kconfig b/board/freescale/ls1021aiot/Kconfig
new file mode 100644
index 00000000000..4a12c1687fc
--- /dev/null
+++ b/board/freescale/ls1021aiot/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS1021AIOT
+
+config SYS_BOARD
+ default "ls1021aiot"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "ls102xa"
+
+config SYS_CONFIG_NAME
+ default "ls1021aiot"
+
+endif
diff --git a/board/freescale/ls1021aiot/MAINTAINERS b/board/freescale/ls1021aiot/MAINTAINERS
new file mode 100644
index 00000000000..65f21bee344
--- /dev/null
+++ b/board/freescale/ls1021aiot/MAINTAINERS
@@ -0,0 +1,7 @@
+LS1021AIOT BOARD
+M: Alison Wang <alison.wang@nxp.com>
+S: Maintained
+F: board/freescale/ls1021aiot/
+F: include/configs/ls1021aiot.h
+F: configs/ls1021aiot_sdcard_defconfig
+F: configs/ls1021aiot_qspi_defconfig
diff --git a/board/freescale/ls1021aiot/Makefile b/board/freescale/ls1021aiot/Makefile
new file mode 100644
index 00000000000..587bbd79ddf
--- /dev/null
+++ b/board/freescale/ls1021aiot/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2016 Freescale Semiconductor, Inc.
+
+obj-y += ls1021aiot.o
+obj-$(CONFIG_ARMV7_PSCI) += psci.o
diff --git a/board/freescale/ls1021aiot/README b/board/freescale/ls1021aiot/README
new file mode 100644
index 00000000000..08b0268b9bd
--- /dev/null
+++ b/board/freescale/ls1021aiot/README
@@ -0,0 +1,58 @@
+Overview
+--------
+The LS1021A-IOT is a Freescale reference board that hosts
+the LS1021A SoC.
+
+LS1021AIOT board Overview
+-------------------------
+ - DDR Controller
+ - Supports 1GB un-buffered DDR3L SDRAM discrete
+ devices(32-bit bus) with 4 bit ECC
+ - DDR power supplies 1.35V to all devices with
+ automatic tracking of VTT
+ - Soldered DDR chip
+ - Supprot one fixed speed
+ - Ethernet
+ - Two on-board SGMII 10/100/1G ethernet ports
+ - One Gbit Etherent RGMII interface to 4-ports switch
+ with 4x 10/100/1000 RJ145 ports
+ - CPLD
+ - 8-bit registers in CPLD for system configuration
+ - connected to IFC_AD[0:7]
+ - Power Supplies
+ - 12V@5A DC
+ - SDHC
+ - SDHC port connects directly to a full 8-bit SD/MMC slot
+ - Support for SDIO devices
+ - USB
+ - Two on-board USB 3.0
+ - One on-board USB k22
+ - PCIe
+ - Two MiniPCIe Solts
+ - SATA
+ - Support SATA Connector
+ - AUDIO
+ - AUDIO in and out
+ - I/O Expansion
+ - Arduino Shield Connector
+ - Port0 - CAN/GPIO/Flextimer
+ - Port1 - GPIO/CPLD Expansion
+ - Port2 - SPI/I2C/UART
+
+Memory map
+-----------
+The addresses in brackets are physical addresses.
+
+Start Address End Address Description Size
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_4000_0000 0x00_43FF_FFFF QSPI(Chip select 0) 64MB
+0x00_4400_0000 0x00_47FF_FFFF QSPI(Chip select 1) 64MB
+0x00_6000_0000 0x00_6000_FFFF CPLD 64K
+0x00_8000_0000 0x00_BFFF_FFFF DDR 1GB
+
+Boot description
+-----------------
+LS1021A-IOT support two ways of boot:
+Qspi boot and SD boot
+The board doesn't support boot from another
+source without changing any switch/jumper.
diff --git a/board/freescale/ls1021aiot/ls1021aiot.c b/board/freescale/ls1021aiot/ls1021aiot.c
new file mode 100644
index 00000000000..7abc4126933
--- /dev/null
+++ b/board/freescale/ls1021aiot/ls1021aiot.c
@@ -0,0 +1,203 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <fdt_support.h>
+#include <init.h>
+#include <net.h>
+#include <asm/arch/immap_ls102xa.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/ls102xa_stream_id.h>
+#include <asm/global_data.h>
+#include <linux/delay.h>
+
+#include <asm/arch/ls102xa_devdis.h>
+#include <asm/arch/ls102xa_soc.h>
+#include <asm/sections.h>
+#include <fsl_csu.h>
+#include <fsl_immap.h>
+#include <netdev.h>
+#include <fsl_mdio.h>
+#include <tsec.h>
+#include <spl.h>
+
+#include <fsl_validate.h>
+#include "../common/sleep.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define DDR_SIZE 0x40000000
+
+
+int checkboard(void)
+{
+ puts("Board: LS1021AIOT\n");
+
+#ifndef CONFIG_QSPI_BOOT
+ struct ccsr_gur *dcfg = (struct ccsr_gur *)CFG_SYS_FSL_GUTS_ADDR;
+ u32 cpldrev;
+
+ cpldrev = in_be32(&dcfg->gpporcr1);
+
+ printf("CPLD: V%d.%d\n", ((cpldrev >> 28) & 0xf), ((cpldrev >> 24) &
+ 0xf));
+#endif
+ return 0;
+}
+
+void ddrmc_init(void)
+{
+ struct ccsr_ddr *ddr = (struct ccsr_ddr *)CFG_SYS_FSL_DDR_ADDR;
+ u32 temp_sdram_cfg, tmp;
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG);
+
+ out_be32(&ddr->cs0_bnds, DDR_CS0_BNDS);
+ out_be32(&ddr->cs0_config, DDR_CS0_CONFIG);
+
+ out_be32(&ddr->timing_cfg_0, DDR_TIMING_CFG_0);
+ out_be32(&ddr->timing_cfg_1, DDR_TIMING_CFG_1);
+ out_be32(&ddr->timing_cfg_2, DDR_TIMING_CFG_2);
+ out_be32(&ddr->timing_cfg_3, DDR_TIMING_CFG_3);
+ out_be32(&ddr->timing_cfg_4, DDR_TIMING_CFG_4);
+ out_be32(&ddr->timing_cfg_5, DDR_TIMING_CFG_5);
+
+ out_be32(&ddr->sdram_cfg_2, DDR_SDRAM_CFG_2);
+ out_be32(&ddr->ddr_cdr2, DDR_DDR_CDR2);
+
+ out_be32(&ddr->sdram_mode, DDR_SDRAM_MODE);
+ out_be32(&ddr->sdram_mode_2, DDR_SDRAM_MODE_2);
+
+ out_be32(&ddr->sdram_interval, DDR_SDRAM_INTERVAL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl, DDR_DDR_WRLVL_CNTL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl_2, DDR_DDR_WRLVL_CNTL_2);
+ out_be32(&ddr->ddr_wrlvl_cntl_3, DDR_DDR_WRLVL_CNTL_3);
+
+ out_be32(&ddr->ddr_cdr1, DDR_DDR_CDR1);
+
+ out_be32(&ddr->sdram_clk_cntl, DDR_SDRAM_CLK_CNTL);
+ out_be32(&ddr->ddr_zq_cntl, DDR_DDR_ZQ_CNTL);
+
+ out_be32(&ddr->cs0_config_2, DDR_CS0_CONFIG_2);
+
+ /* DDR erratum A-009942 */
+ tmp = in_be32(&ddr->debug[28]);
+ out_be32(&ddr->debug[28], tmp | 0x0070006f);
+
+ udelay(500);
+
+ temp_sdram_cfg = (DDR_SDRAM_CFG_MEM_EN & ~SDRAM_CFG_BI);
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG | temp_sdram_cfg);
+}
+
+int dram_init(void)
+{
+#if (!defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD))
+ ddrmc_init();
+#endif
+
+ erratum_a008850_post();
+
+ gd->ram_size = DDR_SIZE;
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_TSEC_ENET
+ /* clear BD & FR bits for BE BD's and frame data */
+ clrbits_be32(&scfg->etsecdmamcr, SCFG_ETSECDMAMCR_LE_BD_FR);
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE2_CLK125);
+
+#endif
+
+ arch_soc_init();
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+void board_init_f(ulong dummy)
+{
+ /* Clear the BSS */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ get_clocks();
+
+ preloader_console_init();
+
+ dram_init();
+
+ /* Allow OCRAM access permission as R/W */
+
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+
+ board_init_r(NULL, 0);
+}
+#endif
+
+int board_init(void)
+{
+#ifndef CONFIG_SYS_FSL_NO_SERDES
+ fsl_serdes_init();
+#endif
+
+ ls102xa_smmu_stream_id_init();
+
+ return 0;
+}
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_MISC_INIT_R)
+int misc_init_r(void)
+{
+#ifdef CONFIG_FSL_DEVICE_DISABLE
+ device_disable(devdis_tbl, ARRAY_SIZE(devdis_tbl));
+
+#endif
+ return 0;
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_PCI
+ ft_pci_setup(blob, bd);
+#endif
+
+ return 0;
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
diff --git a/board/freescale/ls1021aiot/ls102xa_pbi.cfg b/board/freescale/ls1021aiot/ls102xa_pbi.cfg
new file mode 100644
index 00000000000..b5ac5e27e9d
--- /dev/null
+++ b/board/freescale/ls1021aiot/ls102xa_pbi.cfg
@@ -0,0 +1,14 @@
+#PBI commands
+
+09570200 ffffffff
+09570158 00000300
+8940007c 21f47300
+
+#Configure Scratch register
+09ee0200 10000000
+#Configure alternate space
+09570158 00001000
+#Flush PBL data
+096100c0 000FFFFF
+
+09ea085c 00502880
diff --git a/board/freescale/ls1021aiot/ls102xa_rcw_sd.cfg b/board/freescale/ls1021aiot/ls102xa_rcw_sd.cfg
new file mode 100644
index 00000000000..a1984c713d5
--- /dev/null
+++ b/board/freescale/ls1021aiot/ls102xa_rcw_sd.cfg
@@ -0,0 +1,27 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# serdes protocol
+
+#Default with 2 x SGMII (no SATA)
+0608000a 00000000 00000000 00000000
+20000000 08407900 60025a00 21046000
+00000000 00000000 00000000 20038000
+20024800 881b1340 00000000 00000000
+
+#SATA set-up
+#0608000a 00000000 00000000 00000000
+#70000000 08007900 60025a00 21046000
+#00000000 00000000 00000000 20038000
+#20024800 881b1340 00000000 00000000
+
+#HDMI set-up
+#0608000a 00000000 00000000 00000000
+#20000000 08407900 60025a00 21046000
+#00000000 00000000 00000000 20038000
+#00000000 881b1340 00000000 00000000
+
+#QE testing
+#0608000a 00000000 00000000 00000000
+#20000000 08407900 60025a00 21046000
+#00000000 00000000 00000000 00038000
+#20094800 881b1340 00000000 00000000
diff --git a/board/freescale/ls1021aiot/psci.S b/board/freescale/ls1021aiot/psci.S
new file mode 100644
index 00000000000..d0106ba3905
--- /dev/null
+++ b/board/freescale/ls1021aiot/psci.S
@@ -0,0 +1,27 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 NXP Semiconductor.
+ * Author: Feng Li <feng.li_2@nxp.com>
+ */
+
+#include <config.h>
+#include <linux/linkage.h>
+
+#include <asm/armv7.h>
+#include <asm/psci.h>
+
+ .pushsection ._secure.text, "ax"
+
+ .arch_extension sec
+
+ .align 5
+
+.globl psci_system_off
+psci_system_off:
+1: wfi
+ b 1b
+
+.globl psci_text_end
+psci_text_end:
+ nop
+ .popsection
diff --git a/board/freescale/ls1021aqds/Kconfig b/board/freescale/ls1021aqds/Kconfig
new file mode 100644
index 00000000000..119b9550410
--- /dev/null
+++ b/board/freescale/ls1021aqds/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS1021AQDS
+
+config SYS_BOARD
+ default "ls1021aqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "ls102xa"
+
+config SYS_CONFIG_NAME
+ default "ls1021aqds"
+
+endif
diff --git a/board/freescale/ls1021aqds/MAINTAINERS b/board/freescale/ls1021aqds/MAINTAINERS
new file mode 100644
index 00000000000..913d251eeb7
--- /dev/null
+++ b/board/freescale/ls1021aqds/MAINTAINERS
@@ -0,0 +1,14 @@
+LS1021AQDS BOARD
+M: Alison Wang <alison.wang@nxp.com>
+S: Maintained
+F: board/freescale/ls1021aqds/
+F: include/configs/ls1021aqds.h
+F: configs/ls1021aqds_nor_defconfig
+F: configs/ls1021aqds_ddr4_nor_defconfig
+F: configs/ls1021aqds_ddr4_nor_lpuart_defconfig
+F: configs/ls1021aqds_nor_SECURE_BOOT_defconfig
+F: configs/ls1021aqds_nor_lpuart_defconfig
+F: configs/ls1021aqds_sdcard_ifc_defconfig
+F: configs/ls1021aqds_sdcard_qspi_defconfig
+F: configs/ls1021aqds_qspi_defconfig
+F: configs/ls1021aqds_nand_defconfig
diff --git a/board/freescale/ls1021aqds/Makefile b/board/freescale/ls1021aqds/Makefile
new file mode 100644
index 00000000000..8cbf33fa0ce
--- /dev/null
+++ b/board/freescale/ls1021aqds/Makefile
@@ -0,0 +1,9 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1021aqds.o
+obj-y += ddr.o
+obj-$(CONFIG_ARMV7_PSCI) += psci.o
diff --git a/board/freescale/ls1021aqds/README b/board/freescale/ls1021aqds/README
new file mode 100644
index 00000000000..e2ce00165bd
--- /dev/null
+++ b/board/freescale/ls1021aqds/README
@@ -0,0 +1,117 @@
+Overview
+--------
+The LS1021AQDS is a Freescale reference board that hosts the LS1021A SoC.
+
+LS1021A SoC Overview
+------------------
+The QorIQ LS1 family, which includes the LS1021A communications processor,
+is built on Layerscape architecture, the industry's first software-aware,
+core-agnostic networking architecture to offer unprecedented efficiency
+and scale.
+
+A member of the value-performance tier, the QorIQ LS1021A processor provides
+extensive integration and power efficiency for fanless, small form factor
+enterprise networking applications. Incorporating dual ARM Cortex-A7 cores
+running up to 1.0 GHz, the LS1021A processor delivers pre-silicon CoreMark
+performance of over 6,000, as well as virtualization support, advanced
+security features and the broadest array of high-speed interconnects and
+optimized peripheral features ever offered in a sub-3 W processor.
+
+The QorIQ LS1021A processor features an integrated LCD controller,
+CAN controller for implementing industrial protocols, DDR3L/4 running
+up to 1600 MHz, integrated security engine and QUICC Engine, and ECC
+protection on both L1 and L2 caches. The LS1021A processor is pin- and
+software-compatible with the QorIQ LS1020A and LS1022A processors.
+
+The LS1021A SoC includes the following function and features:
+
+ - ARM Cortex-A7 MPCore compliant with ARMv7-A architecture
+ - Dual high-preformance ARM Cortex-A7 cores, each core includes:
+ - 32 Kbyte L1 Instruction Cache and Data Cache for each core (ECC protection)
+ - 512 Kbyte shared coherent L2 Cache (with ECC protection)
+ - NEON Co-processor (per core)
+ - 40-bit physical addressing
+ - Vector floating-point support
+ - ARM Core-Link CCI-400 Cache Coherent Interconnect
+ - One DDR3L/DDR4 SDRAM memory controller with x8/x16/x32-bit configuration
+ supporting speeds up to 1600Mtps
+ - ECC and interleaving support
+ - VeTSEC Ethernet complex
+ - Up to 3x virtualized 10/100/1000 Ethernet controllers
+ - MII, RMII, RGMII, and SGMII support
+ - QoS, lossless flow control, and IEEE 1588 support
+ - 4-lane 6GHz SerDes
+ - High speed interconnect (4 SerDes lanes with are muxed for these protocol)
+ - Two PCI Express Gen2 controllers running at up to 5 GHz
+ - One Serial ATA 3.0 supporting 6 GT/s operation
+ - Two SGMII interfaces supporting 1000 Mbps
+ - Additional peripheral interfaces
+ - One high-speed USB 3.0 controller with integrated PHY and one high-speed
+ USB 2.00 controller with ULPI
+ - Integrated flash controller (IFC) with 16-bit interface
+ - Quad SPI NOR Flash
+ - One enhanced Secure digital host controller
+ - Display controller unit (DCU) 24-bit RGB (12-bit DDR pin interface)
+ - Ten UARTs comprised of two 16550 compliant DUARTs, and six low power
+ UARTs
+ - Three I2C controllers
+ - Eight FlexTimers four supporting PWM and four FlexCAN ports
+ - Four GPIO controllers supporting up to 109 general purpose I/O signals
+ - Integrated advanced audio block:
+ - Four synchronous audio interfaces (SAI)
+ - Sony/Philips Digital Interconnect Format (SPDIF)
+ - Asynchronous Sample Rate Converter (ASRC)
+ - Hardware based crypto offload engine
+ - IPSec forwarding at up to 1Gbps
+ - QorIQ Trust Architecture, Secure Boot, and ARM TrustZone supported
+ - Public key hardware accelerator
+ - True Random Number Generator (NIST Certified)
+ - Advanced Encryption Standard Accelerators (AESA)
+ - Data Encryption Standard Accelerators
+ - QUICC Engine ULite block
+ - Two universal communication controllers (TDM and HDLC) supporting 64
+ multichannels, each running at 64 Kbps
+ - Support for 256 channels of HDLC
+ - QorIQ TrustArchitecture with Secure Boot, as well as ARM TrustZone supported
+
+LS1021AQDS board Overview
+-------------------------
+ - DDR Controller
+ - Supports rates of up to 1600 MHz data-rate
+ - Supports one DDR3LP UDIMM, of single-, dual- types.
+ - IFC/Local Bus
+ - NAND flash: 512M 8-bit NAND flash
+ - NOR: 128MB 16-bit NOR Flash
+ - Ethernet
+ - Three on-board RGMII 10/100/1G ethernet ports.
+ - FPGA
+ - Clocks
+ - System and DDR clock (SYSCLK, DDRCLK)
+ - SERDES clocks
+ - Power Supplies
+ - SDHC
+ - SDHC/SDXC connector
+ - Other IO
+ - Two Serial ports
+ - Three I2C ports
+
+Memory map
+-----------
+The addresses in brackets are physical addresses.
+
+Start Address End Address Description Size
+0x00_0000_0000 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 0x00_20FF_FFFF DCSR 16MB
+0x00_4000_0000 0x00_5FFF_FFFF QSPI 512MB
+0x00_6000_0000 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_7E80_0000 0x00_7E80_FFFF IFC - NAND Flash 64KB
+0x00_7FB0_0000 0x00_7FB0_0FFF IFC - FPGA 4KB
+0x00_8000_0000 0x00_FFFF_FFFF DRAM1 2GB
+
+LS1021a rev1.0 Soc specific Options/Settings
+--------------------------------------------
+If the LS1021a Soc is rev1.0, you need modify the configuration and enable
+CONFIG_SPL_SKIP_LOWLEVEL_INIT in menuconfig or similar.
diff --git a/board/freescale/ls1021aqds/ddr.c b/board/freescale/ls1021aqds/ddr.c
new file mode 100644
index 00000000000..5b0f23688f0
--- /dev/null
+++ b/board/freescale/ls1021aqds/ddr.c
@@ -0,0 +1,199 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <linux/delay.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 3) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ popts->cpo_override = pbsp->cpo_override;
+ popts->write_data_delay =
+ pbsp->write_data_delay;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+
+ /* force DDR bus width to 32 bits */
+ popts->data_bus_width = 1;
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 1;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+#ifdef CONFIG_SYS_FSL_DDR4
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm) |
+ DDR_CDR2_VREF_OVRD(70); /* Vref = 70% */
+#else
+ popts->cswl_override = DDR_CSWL_CS0;
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x58;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+#endif
+}
+
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1071,
+ .caslat_x = 0xfe << 4, /* 5,6,7,8 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 7500,
+ .trp_ps = 13125,
+ .tras_ps = 37500,
+ .trc_ps = 50625,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 37500,
+};
+
+int fsl_ddr_get_dimm_params(dimm_params_t *pdimm,
+ unsigned int controller_number,
+ unsigned int dimm_number)
+{
+ static const char dimm_model[] = "Fixed DDR on board";
+
+ if (((controller_number == 0) && (dimm_number == 0)) ||
+ ((controller_number == 1) && (dimm_number == 0))) {
+ memcpy(pdimm, &ddr_raw_timing, sizeof(dimm_params_t));
+ memset(pdimm->mpart, 0, sizeof(pdimm->mpart));
+ memcpy(pdimm->mpart, dimm_model, sizeof(dimm_model) - 1);
+ }
+
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_mem_sleep_setup(void)
+{
+ void __iomem *qixis_base = (void *)QIXIS_BASE;
+
+ /* does not provide HW signals for power management */
+ clrbits_8(qixis_base + 0x21, 0x2);
+ udelay(1);
+}
+#endif
+
+int fsl_initdram(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_SPL)
+ puts("Initializing DDR....using SPD\n");
+ dram_size = fsl_ddr_sdram();
+#else
+ dram_size = fsl_ddr_sdram_size();
+#endif
+
+#if defined(CONFIG_DEEP_SLEEP) && !defined(CONFIG_SPL_BUILD)
+ fsl_dp_resume();
+#endif
+
+ erratum_a008850_post();
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
+
+int dram_init_banksize(void)
+{
+ gd->bd->bi_dram[0].start = CFG_SYS_SDRAM_BASE;
+ gd->bd->bi_dram[0].size = gd->ram_size;
+
+ return 0;
+}
diff --git a/board/freescale/ls1021aqds/ddr.h b/board/freescale/ls1021aqds/ddr.h
new file mode 100644
index 00000000000..58a88384367
--- /dev/null
+++ b/board/freescale/ls1021aqds/ddr.h
@@ -0,0 +1,61 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+
+void erratum_a008850_post(void);
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+ u32 cpo_override;
+ u32 write_data_delay;
+ u32 force_2t;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl | cpo |wrdata|2T
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 | |delay |
+ */
+#ifdef CONFIG_SYS_FSL_DDR4
+ {2, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A,},
+ {2, 1900, 0, 8, 6, 0x08080A0C, 0x0D0E0F0A,},
+ {1, 1666, 0, 8, 8, 0x090A0B0B, 0x0C0D0E0C,},
+ {1, 1900, 0, 8, 9, 0x0A0B0C0B, 0x0D0E0F0D,},
+ {1, 2200, 0, 8, 10, 0x0B0C0D0C, 0x0E0F110E,},
+#elif defined(CONFIG_SYS_FSL_DDR3)
+ {1, 833, 1, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {1, 1350, 1, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {1, 833, 2, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {1, 1350, 2, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 833, 4, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {2, 1350, 4, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 1350, 0, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 1666, 4, 8, 0xa, 0x0B08090C, 0x0B0E0D0A, 0x1f, 2, 0},
+ {2, 1666, 0, 8, 0xa, 0x0B08090C, 0x0B0E0D0A, 0x1f, 2, 0},
+#else
+#error DDR type not defined
+#endif
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+#endif
diff --git a/board/freescale/ls1021aqds/ls1021aqds.c b/board/freescale/ls1021aqds/ls1021aqds.c
new file mode 100644
index 00000000000..930ef6be385
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls1021aqds.c
@@ -0,0 +1,456 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2019, 2021 NXP
+ */
+
+#include <clock_legacy.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <init.h>
+#include <log.h>
+#include <asm/io.h>
+#include <asm/arch/immap_ls102xa.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/ls102xa_soc.h>
+#include <asm/arch/ls102xa_devdis.h>
+#include <asm/sections.h>
+#include <hwconfig.h>
+#include <mmc.h>
+#include <fsl_csu.h>
+#include <fsl_ifc.h>
+#include <spl.h>
+#include <fsl_devdis.h>
+#include <fsl_validate.h>
+#include <fsl_ddr.h>
+#include "../common/i2c_mux.h"
+#include "../common/sleep.h"
+#include "../common/qixis.h"
+#include "ls1021aqds_qixis.h"
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+
+#define PIN_MUX_SEL_CAN 0x03
+#define PIN_MUX_SEL_IIC2 0xa0
+#define PIN_MUX_SEL_RGMII 0x00
+#define PIN_MUX_SEL_SAI 0x0c
+#define PIN_MUX_SEL_SDHC 0x00
+
+#define SET_SDHC_MUX_SEL(reg, value) ((reg & 0x0f) | value)
+#define SET_EC_MUX_SEL(reg, value) ((reg & 0xf0) | value)
+enum {
+ MUX_TYPE_CAN,
+ MUX_TYPE_IIC2,
+ MUX_TYPE_RGMII,
+ MUX_TYPE_SAI,
+ MUX_TYPE_SDHC,
+ MUX_TYPE_SD_PCI4,
+ MUX_TYPE_SD_PC_SA_SG_SG,
+ MUX_TYPE_SD_PC_SA_PC_SG,
+ MUX_TYPE_SD_PC_SG_SG,
+};
+
+enum {
+ GE0_CLK125,
+ GE2_CLK125,
+ GE1_CLK125,
+};
+
+int checkboard(void)
+{
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+ char buf[64];
+#endif
+#if !defined(CONFIG_SD_BOOT) && !defined(CONFIG_QSPI_BOOT)
+ u8 sw;
+#endif
+
+ puts("Board: LS1021AQDS\n");
+
+#ifdef CONFIG_SD_BOOT
+ puts("SD\n");
+#elif CONFIG_QSPI_BOOT
+ puts("QSPI\n");
+#else
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank: %d\n", sw);
+ else if (sw == 0x8)
+ puts("PromJet\n");
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else if (sw == 0x15)
+ printf("IFCCard\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+#endif
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+ printf("Sys ID:0x%02x, Sys Ver: 0x%02x\n",
+ QIXIS_READ(id), QIXIS_READ(arch));
+
+ printf("FPGA: v%d (%s), build %d\n",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_DYNAMIC_SYS_CLK_FREQ
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0f) {
+ case QIXIS_SYSCLK_64:
+ return 64000000;
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+ return 66666666;
+}
+#endif
+
+#ifdef CONFIG_DYNAMIC_DDR_CLK_FREQ
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+ return 66666666;
+}
+#endif
+
+int dram_init(void)
+{
+ /*
+ * When resuming from deep sleep, the I2C channel may not be
+ * in the default channel. So, switch to the default channel
+ * before accessing DDR SPD.
+ *
+ * PCA9547(0x77) mount on I2C1 bus
+ */
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ return fsl_initdram();
+}
+
+int board_early_init_f(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_TSEC_ENET
+ /* clear BD & FR bits for BE BD's and frame data */
+ clrbits_be32(&scfg->etsecdmamcr, SCFG_ETSECDMAMCR_LE_BD_FR);
+#endif
+
+#ifdef CONFIG_FSL_IFC
+ init_early_memctl_regs();
+#endif
+
+ arch_soc_init();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+void board_init_f(ulong dummy)
+{
+#ifdef CONFIG_NAND_BOOT
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+ u32 porsr1, pinctl;
+
+ /*
+ * There is LS1 SoC issue where NOR, FPGA are inaccessible during
+ * NAND boot because IFC signals > IFC_AD7 are not enabled.
+ * This workaround changes RCW source to make all signals enabled.
+ */
+ porsr1 = in_be32(&gur->porsr1);
+ pinctl = ((porsr1 & ~(DCFG_CCSR_PORSR1_RCW_MASK)) |
+ DCFG_CCSR_PORSR1_RCW_SRC_I2C);
+ out_be32((unsigned int *)(CFG_SYS_DCSR_DCFG_ADDR + DCFG_DCSR_PORCR1),
+ pinctl);
+#endif
+
+ /* Clear the BSS */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+#ifdef CONFIG_FSL_IFC
+ init_early_memctl_regs();
+#endif
+
+ get_clocks();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ preloader_console_init();
+
+#ifdef CONFIG_SPL_I2C
+ i2c_init_all();
+#endif
+
+ timer_init();
+ dram_init();
+
+ /* Allow OCRAM access permission as R/W */
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+
+ board_init_r(NULL, 0);
+}
+#endif
+
+void config_etseccm_source(int etsec_gtx_125_mux)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+ switch (etsec_gtx_125_mux) {
+ case GE0_CLK125:
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE0_CLK125);
+ debug("etseccm set to GE0_CLK125\n");
+ break;
+
+ case GE2_CLK125:
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE2_CLK125);
+ debug("etseccm set to GE2_CLK125\n");
+ break;
+
+ case GE1_CLK125:
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE1_CLK125);
+ debug("etseccm set to GE1_CLK125\n");
+ break;
+
+ default:
+ printf("Error! trying to set etseccm to invalid value\n");
+ break;
+ }
+}
+
+int config_board_mux(int ctrl_type)
+{
+ u8 reg12, reg14;
+
+ reg12 = QIXIS_READ(brdcfg[12]);
+ reg14 = QIXIS_READ(brdcfg[14]);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_CAN:
+ config_etseccm_source(GE2_CLK125);
+ reg14 = SET_EC_MUX_SEL(reg14, PIN_MUX_SEL_CAN);
+ break;
+ case MUX_TYPE_IIC2:
+ reg14 = SET_SDHC_MUX_SEL(reg14, PIN_MUX_SEL_IIC2);
+ break;
+ case MUX_TYPE_RGMII:
+ reg14 = SET_EC_MUX_SEL(reg14, PIN_MUX_SEL_RGMII);
+ break;
+ case MUX_TYPE_SAI:
+ config_etseccm_source(GE2_CLK125);
+ reg14 = SET_EC_MUX_SEL(reg14, PIN_MUX_SEL_SAI);
+ break;
+ case MUX_TYPE_SDHC:
+ reg14 = SET_SDHC_MUX_SEL(reg14, PIN_MUX_SEL_SDHC);
+ break;
+ case MUX_TYPE_SD_PCI4:
+ reg12 = 0x38;
+ break;
+ case MUX_TYPE_SD_PC_SA_SG_SG:
+ reg12 = 0x01;
+ break;
+ case MUX_TYPE_SD_PC_SA_PC_SG:
+ reg12 = 0x01;
+ break;
+ case MUX_TYPE_SD_PC_SG_SG:
+ reg12 = 0x21;
+ break;
+ default:
+ printf("Wrong mux interface type\n");
+ return -1;
+ }
+
+ QIXIS_WRITE(brdcfg[12], reg12);
+ QIXIS_WRITE(brdcfg[14], reg14);
+
+ return 0;
+}
+
+int config_serdes_mux(void)
+{
+ struct ccsr_gur *gur = (struct ccsr_gur *)CFG_SYS_FSL_GUTS_ADDR;
+ u32 cfg;
+
+ cfg = in_be32(&gur->rcwsr[4]) & RCWSR4_SRDS1_PRTCL_MASK;
+ cfg >>= RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ switch (cfg) {
+ case 0x0:
+ config_board_mux(MUX_TYPE_SD_PCI4);
+ break;
+ case 0x30:
+ config_board_mux(MUX_TYPE_SD_PC_SA_SG_SG);
+ break;
+ case 0x60:
+ config_board_mux(MUX_TYPE_SD_PC_SG_SG);
+ break;
+ case 0x70:
+ config_board_mux(MUX_TYPE_SD_PC_SA_PC_SG);
+ break;
+ default:
+ printf("SRDS1 prtcl:0x%x\n", cfg);
+ break;
+ }
+
+ return 0;
+}
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+#ifdef CONFIG_CHAIN_OF_TRUST
+ fsl_setenv_chain_of_trust();
+#endif
+
+ return 0;
+}
+#endif
+
+int misc_init_r(void)
+{
+ int conflict_flag;
+
+ /* some signals can not enable simultaneous*/
+ conflict_flag = 0;
+ if (hwconfig("sdhc"))
+ conflict_flag++;
+ if (hwconfig("iic2"))
+ conflict_flag++;
+ if (conflict_flag > 1) {
+ printf("WARNING: pin conflict !\n");
+ return 0;
+ }
+
+ conflict_flag = 0;
+ if (hwconfig("rgmii"))
+ conflict_flag++;
+ if (hwconfig("can"))
+ conflict_flag++;
+ if (hwconfig("sai"))
+ conflict_flag++;
+ if (conflict_flag > 1) {
+ printf("WARNING: pin conflict !\n");
+ return 0;
+ }
+
+ if (hwconfig("can"))
+ config_board_mux(MUX_TYPE_CAN);
+ else if (hwconfig("rgmii"))
+ config_board_mux(MUX_TYPE_RGMII);
+ else if (hwconfig("sai"))
+ config_board_mux(MUX_TYPE_SAI);
+
+ if (hwconfig("iic2"))
+ config_board_mux(MUX_TYPE_IIC2);
+ else if (hwconfig("sdhc"))
+ config_board_mux(MUX_TYPE_SDHC);
+
+#ifdef CONFIG_FSL_DEVICE_DISABLE
+ device_disable(devdis_tbl, ARRAY_SIZE(devdis_tbl));
+#endif
+ return 0;
+}
+
+int board_init(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+#ifdef CONFIG_SYS_FSL_ERRATUM_A009942
+ erratum_a009942_check_cpo();
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+
+#ifndef CONFIG_SYS_FSL_NO_SERDES
+ fsl_serdes_init();
+ config_serdes_mux();
+#endif
+
+ ls102xa_smmu_stream_id_init();
+
+#ifdef CONFIG_U_QE
+ u_qe_init();
+#endif
+
+ return 0;
+}
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_sleep_prepare(void)
+{
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_PCI
+ ft_pci_setup(blob, bd);
+#endif
+
+ return 0;
+}
+
+u8 flash_read8(void *addr)
+{
+ return __raw_readb(addr + 1);
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
diff --git a/board/freescale/ls1021aqds/ls1021aqds_qixis.h b/board/freescale/ls1021aqds/ls1021aqds_qixis.h
new file mode 100644
index 00000000000..7ad08a54ea6
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls1021aqds_qixis.h
@@ -0,0 +1,36 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS1021AQDS_QIXIS_H__
+#define __LS1021AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1021AQDS */
+
+/* BRDCFG4[4:7]] select EC1 and EC2 as a pair */
+#define BRDCFG4_EMISEL_MASK 0xe0
+#define BRDCFG4_EMISEL_SHIFT 5
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+#define QIXIS_SYSCLK_64 0x8
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+#define QIXIS_SRDS1CLK_100 0x0
+
+#define QIXIS_DCU_BRDCFG5 0x55
+
+#endif
diff --git a/board/freescale/ls1021aqds/ls102xa_pbi.cfg b/board/freescale/ls1021aqds/ls102xa_pbi.cfg
new file mode 100644
index 00000000000..f1a1b63ab77
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls102xa_pbi.cfg
@@ -0,0 +1,12 @@
+#PBI commands
+
+09570200 ffffffff
+09570158 00000300
+8940007c 21f47300
+
+#Configure Scratch register
+09ee0200 10000000
+#Configure alternate space
+09570158 00001000
+#Flush PBL data
+096100c0 000FFFFF
diff --git a/board/freescale/ls1021aqds/ls102xa_rcw_nand.cfg b/board/freescale/ls1021aqds/ls102xa_rcw_nand.cfg
new file mode 100644
index 00000000000..d76e9132e35
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls102xa_rcw_nand.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# serdes protocol
+0608000c 00000000 00000000 00000000
+60000000 00407900 e0106a00 21046000
+00000000 00000000 00000000 00038000
+00000000 001b7200 00000000 00000000
diff --git a/board/freescale/ls1021aqds/ls102xa_rcw_sd_ifc.cfg b/board/freescale/ls1021aqds/ls102xa_rcw_sd_ifc.cfg
new file mode 100644
index 00000000000..f0cf9c2b38d
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls102xa_rcw_sd_ifc.cfg
@@ -0,0 +1,14 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+
+#enable IFC, disable QSPI and DSPI
+0608000c 00000000 00000000 00000000
+60000000 00407900 60040a00 21046000
+00000000 00000000 00000000 00038000
+00000000 001b7200 00000000 00000000
+
+#disable IFC, enable QSPI and DSPI
+#0608000c 00000000 00000000 00000000
+#60000000 00407900 60040a00 21046000
+#00000000 00000000 00000000 00038000
+#20024800 001b7200 00000000 00000000
diff --git a/board/freescale/ls1021aqds/ls102xa_rcw_sd_qspi.cfg b/board/freescale/ls1021aqds/ls102xa_rcw_sd_qspi.cfg
new file mode 100644
index 00000000000..10cc4a9ab0b
--- /dev/null
+++ b/board/freescale/ls1021aqds/ls102xa_rcw_sd_qspi.cfg
@@ -0,0 +1,14 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+
+#enable IFC, disable QSPI and DSPI
+#0608000c 00000000 00000000 00000000
+#60000000 00407900 60040a00 21046000
+#00000000 00000000 00000000 00038000
+#00000000 001b7200 00000000 00000000
+
+#disable IFC, enable QSPI and DSPI
+0608000c 00000000 00000000 00000000
+60000000 00407900 60040a00 21046000
+00000000 00000000 00000000 00038000
+20024800 001b7200 00000000 00000000
diff --git a/board/freescale/ls1021aqds/psci.S b/board/freescale/ls1021aqds/psci.S
new file mode 100644
index 00000000000..0f38c934ddf
--- /dev/null
+++ b/board/freescale/ls1021aqds/psci.S
@@ -0,0 +1,32 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 NXP Semiconductor.
+ * Author: Wang Dongsheng <dongsheng.wang@freescale.com>
+ */
+
+#include <config.h>
+#include <linux/linkage.h>
+
+#include <asm/armv7.h>
+#include <asm/psci.h>
+
+ .pushsection ._secure.text, "ax"
+
+ .arch_extension sec
+
+ .align 5
+
+.globl psci_system_off
+psci_system_off:
+ @ Get QIXIS base address
+ movw r1, #(QIXIS_BASE & 0xffff)
+ movt r1, #(QIXIS_BASE >> 16)
+
+ ldrb r2, [r1, #QIXIS_PWR_CTL]
+ orr r2, r2, #QIXIS_PWR_CTL_POWEROFF
+ strb r2, [r1, #QIXIS_PWR_CTL]
+
+1: wfi
+ b 1b
+
+ .popsection
diff --git a/board/freescale/ls1021atsn/Kconfig b/board/freescale/ls1021atsn/Kconfig
new file mode 100644
index 00000000000..aa42a06c663
--- /dev/null
+++ b/board/freescale/ls1021atsn/Kconfig
@@ -0,0 +1,16 @@
+# SPDX-License-Identifier: GPL-2.0
+if TARGET_LS1021ATSN
+
+config SYS_BOARD
+ default "ls1021atsn"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "ls102xa"
+
+config SYS_CONFIG_NAME
+ default "ls1021atsn"
+
+endif
diff --git a/board/freescale/ls1021atsn/MAINTAINERS b/board/freescale/ls1021atsn/MAINTAINERS
new file mode 100644
index 00000000000..560bb615d2f
--- /dev/null
+++ b/board/freescale/ls1021atsn/MAINTAINERS
@@ -0,0 +1,8 @@
+NXP LS1021A-TSN Board
+M: Vladimir Oltean <olteanv@gmail.com>
+S: Maintained
+F: arch/arm/dts/ls1021a-tsn.dts
+F: board/freescale/ls1021atsn/
+F: include/configs/ls1021atsn.h
+F: configs/ls1021atsn_qspi_defconfig
+F: configs/ls1021atsn_sdcard_defconfig
diff --git a/board/freescale/ls1021atsn/Makefile b/board/freescale/ls1021atsn/Makefile
new file mode 100644
index 00000000000..b4808f05e8e
--- /dev/null
+++ b/board/freescale/ls1021atsn/Makefile
@@ -0,0 +1,3 @@
+# SPDX-License-Identifier: GPL-2.0
+obj-y += ls1021atsn.o
+obj-$(CONFIG_ARMV7_PSCI) += ../ls1021atwr/psci.o
diff --git a/board/freescale/ls1021atsn/README.rst b/board/freescale/ls1021atsn/README.rst
new file mode 100644
index 00000000000..cd12291d8aa
--- /dev/null
+++ b/board/freescale/ls1021atsn/README.rst
@@ -0,0 +1,97 @@
+.. SPDX-License-Identifier: GPL-2.0
+
+LS1021A-TSN Board Overview
+==========================
+
+ - 1GB DDR3 at 800 MHz
+ - Spansion/Cypress 64 MB (Rev. A) / 32 MB (Rev. B and C) QSPI NOR flash
+ - Ethernet
+ - 2 SGMII 10/100/1G Ethernet ports (Atheros AR8031)
+ - One SJA1105T switch with 4 Ethernet ports (Broadcom BCM5464R)
+ - One internal RGMII port connected to the switch
+ - SDHC
+ - microSDHC/SDXC connector
+ - Other I/O
+ - One Serial port
+ - Arduino and expansion headers
+ - mPCIE slot
+ - SATA port
+ - USB3.0 port
+
+LS1021A Memory map
+==================
+
+The addresses in brackets are physical addresses.
+
+============== ============== ============================== =======
+Start Address End Address Description Size
+============== ============== ============================== =======
+0x00_0000_0000 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 0x00_20FF_FFFF DCSR 16MB
+0x00_4000_0000 0x00_5FFF_FFFF QSPI 512MB
+0x00_6000_0000 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_8000_0000 0x00_FFFF_FFFF DRAM1 2GB
+============== ============== ============================== =======
+
+Compiling and flashing
+======================
+
+The LS1021A-TSN board comes along with a microSD card with OpenIL U-Boot that
+can be used to update its internal QSPI flash (which is empty out of the
+factory).
+
+To compile and flash an SD card image::
+
+ make ls1021atsn_sdcard_defconfig && make -j 8 && sudo cp u-boot-with-spl-pbl.bin /srv/tftpboot/
+ => tftp 0x82000000 u-boot-with-spl-pbl.bin && mmc rescan && mmc erase 8 0x1100 && mmc write 0x82000000 8 0x1100
+
+For the QSPI flash, first obtain the Reset Configuration Word binary for
+bootimg from the QSPI flash from the rcw project
+(https://github.com/nxp-qoriq/rcw)::
+
+ make -j 8 && sudo cp ls1021atsn/SSR_PNS_30/rcw_1200_qspiboot.bin.swapped /srv/tftpboot/
+
+The above RCW binary takes care of swapping the QSPI AMBA memory, so that the
+U-Boot binary does not need to be swapped when flashing it.
+
+To compile and flash a U-Boot image for QSPI::
+
+ make ls1021atsn_qspi_defconfig && make -j 8 && sudo cp u-boot.bin /srv/tftpboot/
+
+Then optionally create a custom uboot-env.txt file (although the default
+environment already supports distro boot) and convert it to binary format::
+
+ mkenvimage -s 2M -o /srv/tftpboot/uboot-env.bin uboot-env.txt
+
+To program the QSPI flash with the images::
+
+ => tftp 0x82000000 rcw_1200_qspiboot.bin.swapped && sf probe && sf erase 0x0 +${filesize} && sf write 0x82000000 0x0 ${filesize}
+ => tftp 0x82000000 u-boot.bin && sf probe && sf erase 0x100000 +${filesize} && sf write 0x82000000 0x100000 ${filesize}
+ => tftp 0x82000000 uboot-env.bin && sf probe && sf erase 0x400000 +${filesize} && sf write 0x82000000 0x400000 ${filesize}
+
+The boards contain an AT24 I2C EEPROM that is supposed to hold the MAC
+addresses of the Ethernet interfaces, however the EEPROM comes blank out of
+the factory, and the MAC addresses are printed on a label on the bottom of
+the boards.
+
+To write the MAC addresses to the EEPROM, the following needs to be done once::
+
+ => mac id
+ => mac 0 00:1F:7B:xx:xx:xx
+ => mac 1 00:1F:7B:xx:xx:xx
+ => mac 2 00:1F:7B:xx:xx:xx
+ => mac save
+
+The switch ports do not have their own MAC address - they inherit it from the
+master enet2 port.
+
+Known issues and limitations
+============================
+
+- The 4 SJA1105 switch ports are not functional in U-Boot for now.
+- Since the IFC pins are multiplexed with QSPI on LS1021A, currently there is
+ no way to talk to the CPLD for e.g. running the "qixis_reset" command, or
+ turning the fan on, etc.
diff --git a/board/freescale/ls1021atsn/ls1021atsn.c b/board/freescale/ls1021atsn/ls1021atsn.c
new file mode 100644
index 00000000000..b7e043b2e62
--- /dev/null
+++ b/board/freescale/ls1021atsn/ls1021atsn.c
@@ -0,0 +1,263 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright 2016-2019, 2021 NXP
+ */
+#include <clock_legacy.h>
+#include <fdt_support.h>
+#include <init.h>
+#include <net.h>
+#include <asm/arch-ls102xa/ls102xa_soc.h>
+#include <asm/arch/ls102xa_devdis.h>
+#include <asm/arch/immap_ls102xa.h>
+#include <asm/arch/ls102xa_soc.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/global_data.h>
+#include <asm/sections.h>
+#include <linux/delay.h>
+#include "../common/sleep.h"
+#include <fsl_validate.h>
+#include <fsl_immap.h>
+#include <fsl_csu.h>
+#include <netdev.h>
+#include <spl.h>
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+
+DECLARE_GLOBAL_DATA_PTR;
+
+static void ddrmc_init(void)
+{
+#if (!defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD))
+ struct ccsr_ddr *ddr = (struct ccsr_ddr *)CFG_SYS_FSL_DDR_ADDR;
+ u32 temp_sdram_cfg, tmp;
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG);
+
+ out_be32(&ddr->cs0_bnds, DDR_CS0_BNDS);
+ out_be32(&ddr->cs0_config, DDR_CS0_CONFIG);
+
+ out_be32(&ddr->timing_cfg_0, DDR_TIMING_CFG_0);
+ out_be32(&ddr->timing_cfg_1, DDR_TIMING_CFG_1);
+ out_be32(&ddr->timing_cfg_2, DDR_TIMING_CFG_2);
+ out_be32(&ddr->timing_cfg_3, DDR_TIMING_CFG_3);
+ out_be32(&ddr->timing_cfg_4, DDR_TIMING_CFG_4);
+ out_be32(&ddr->timing_cfg_5, DDR_TIMING_CFG_5);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ out_be32(&ddr->sdram_cfg_2,
+ DDR_SDRAM_CFG_2 & ~SDRAM_CFG2_D_INIT);
+ out_be32(&ddr->init_addr, CFG_SYS_SDRAM_BASE);
+ out_be32(&ddr->init_ext_addr, (1 << 31));
+
+ /* DRAM VRef will not be trained */
+ out_be32(&ddr->ddr_cdr2,
+ DDR_DDR_CDR2 & ~DDR_CDR2_VREF_TRAIN_EN);
+ } else
+#endif
+ {
+ out_be32(&ddr->sdram_cfg_2, DDR_SDRAM_CFG_2);
+ out_be32(&ddr->ddr_cdr2, DDR_DDR_CDR2);
+ }
+
+ out_be32(&ddr->sdram_mode, DDR_SDRAM_MODE);
+ out_be32(&ddr->sdram_mode_2, DDR_SDRAM_MODE_2);
+
+ out_be32(&ddr->sdram_interval, DDR_SDRAM_INTERVAL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl, DDR_DDR_WRLVL_CNTL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl_2, DDR_DDR_WRLVL_CNTL_2);
+ out_be32(&ddr->ddr_wrlvl_cntl_3, DDR_DDR_WRLVL_CNTL_3);
+
+ out_be32(&ddr->ddr_cdr1, DDR_DDR_CDR1);
+
+ out_be32(&ddr->sdram_clk_cntl, DDR_SDRAM_CLK_CNTL);
+ out_be32(&ddr->ddr_zq_cntl, DDR_DDR_ZQ_CNTL);
+
+ out_be32(&ddr->cs0_config_2, DDR_CS0_CONFIG_2);
+
+ /* DDR erratum A-009942 */
+ tmp = in_be32(&ddr->debug[28]);
+ out_be32(&ddr->debug[28], tmp | 0x0070006f);
+
+ udelay(1);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ /* enter self-refresh */
+ temp_sdram_cfg = in_be32(&ddr->sdram_cfg_2);
+ temp_sdram_cfg |= SDRAM_CFG2_FRC_SR;
+ out_be32(&ddr->sdram_cfg_2, temp_sdram_cfg);
+
+ temp_sdram_cfg = (DDR_SDRAM_CFG_MEM_EN | SDRAM_CFG_BI);
+ } else
+#endif
+ temp_sdram_cfg = (DDR_SDRAM_CFG_MEM_EN & ~SDRAM_CFG_BI);
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG | temp_sdram_cfg);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ /* exit self-refresh */
+ temp_sdram_cfg = in_be32(&ddr->sdram_cfg_2);
+ temp_sdram_cfg &= ~SDRAM_CFG2_FRC_SR;
+ out_be32(&ddr->sdram_cfg_2, temp_sdram_cfg);
+ }
+#endif
+#endif /* !defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD) */
+}
+
+int dram_init(void)
+{
+ ddrmc_init();
+
+ erratum_a008850_post();
+
+ gd->ram_size = get_ram_size((void *)PHYS_SDRAM, PHYS_SDRAM_SIZE);
+
+#if defined(CONFIG_DEEP_SLEEP) && !defined(CONFIG_SPL_BUILD)
+ fsl_dp_resume();
+#endif
+
+ return 0;
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ return pci_eth_init(bis);
+}
+
+int board_early_init_f(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_TSEC_ENET
+ /*
+ * Clear BD & FR bits for big endian BD's and frame data (aka set
+ * correct eTSEC endianness). This is crucial in ensuring that it does
+ * not report Data Parity Errors in its RX/TX FIFOs when attempting to
+ * send traffic.
+ */
+ clrbits_be32(&scfg->etsecdmamcr, SCFG_ETSECDMAMCR_LE_BD_FR);
+ /* EC3_GTX_CLK125 (of enet2) used for all RGMII interfaces */
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE2_CLK125);
+#endif
+
+ arch_soc_init();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot()) {
+ timer_init();
+ dram_init();
+ }
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+void board_init_f(ulong dummy)
+{
+ void (*second_uboot)(void);
+
+ /* Clear the BSS */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ get_clocks();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ preloader_console_init();
+
+ dram_init();
+
+ /* Allow OCRAM access permission as R/W */
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+ enable_layerscape_ns_access();
+#endif
+
+ /*
+ * if it is woken up from deep sleep, then jump to second
+ * stage U-Boot and continue executing without recopying
+ * it from SD since it has already been reserved in memory
+ * in last boot.
+ */
+ if (is_warm_boot()) {
+ second_uboot = (void (*)(void))CONFIG_TEXT_BASE;
+ second_uboot();
+ }
+
+ board_init_r(NULL, 0);
+}
+#endif
+
+int board_init(void)
+{
+#ifndef CONFIG_SYS_FSL_NO_SERDES
+ fsl_serdes_init();
+#endif
+ ls102xa_smmu_stream_id_init();
+
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+
+#ifdef CONFIG_U_QE
+ u_qe_init();
+#endif
+
+ return 0;
+}
+
+#if defined(CONFIG_SPL_BUILD)
+void spl_board_init(void)
+{
+ ls102xa_smmu_stream_id_init();
+}
+#endif
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+#ifdef CONFIG_CHAIN_OF_TRUST
+ fsl_setenv_chain_of_trust();
+#endif
+
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_MISC_INIT_R)
+int misc_init_r(void)
+{
+#ifdef CONFIG_FSL_DEVICE_DISABLE
+ device_disable(devdis_tbl, ARRAY_SIZE(devdis_tbl));
+#endif
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_sleep_prepare(void)
+{
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_PCI
+ ft_pci_setup(blob, bd);
+#endif
+
+ return 0;
+}
diff --git a/board/freescale/ls1021atsn/ls102xa_pbi.cfg b/board/freescale/ls1021atsn/ls102xa_pbi.cfg
new file mode 100644
index 00000000000..ba1499b2644
--- /dev/null
+++ b/board/freescale/ls1021atsn/ls102xa_pbi.cfg
@@ -0,0 +1,15 @@
+# PBI commands
+
+09570200 ffffffff
+09570158 00000300
+8940007c 21f47300
+
+# Configure Scratch register
+09ee0200 10000000
+# Configure alternate space
+09570158 00001000
+# Flush PBL data
+096100c0 000FFFFF
+
+09ea085c 00502880
+09ea0560 80800000
diff --git a/board/freescale/ls1021atsn/ls102xa_rcw_sd.cfg b/board/freescale/ls1021atsn/ls102xa_rcw_sd.cfg
new file mode 100644
index 00000000000..a6fc91436f2
--- /dev/null
+++ b/board/freescale/ls1021atsn/ls102xa_rcw_sd.cfg
@@ -0,0 +1,8 @@
+# PBL preamble and RCW header
+aa55aa55 01ee0100
+
+# Disable IFC, enable QSPI and DSPI
+0608000c 00000000 00000000 00000000
+30000000 08007900 40105a00 21046000
+00000000 00000000 00000000 10002000
+20124801 8804b340 00000000 00000000
diff --git a/board/freescale/ls1021atwr/Kconfig b/board/freescale/ls1021atwr/Kconfig
new file mode 100644
index 00000000000..bc50b8d9668
--- /dev/null
+++ b/board/freescale/ls1021atwr/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS1021ATWR
+
+config SYS_BOARD
+ default "ls1021atwr"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "ls102xa"
+
+config SYS_CONFIG_NAME
+ default "ls1021atwr"
+
+endif
diff --git a/board/freescale/ls1021atwr/MAINTAINERS b/board/freescale/ls1021atwr/MAINTAINERS
new file mode 100644
index 00000000000..7ab8347e9ed
--- /dev/null
+++ b/board/freescale/ls1021atwr/MAINTAINERS
@@ -0,0 +1,12 @@
+LS1021ATWR BOARD
+M: Alison Wang <alison.wang@nxp.com>
+S: Maintained
+F: board/freescale/ls1021atwr/
+F: include/configs/ls1021atwr.h
+F: configs/ls1021atwr_nor_defconfig
+F: configs/ls1021atwr_nor_SECURE_BOOT_defconfig
+F: configs/ls1021atwr_nor_lpuart_defconfig
+F: configs/ls1021atwr_sdcard_ifc_defconfig
+F: configs/ls1021atwr_sdcard_qspi_defconfig
+F: configs/ls1021atwr_qspi_defconfig
+F: configs/ls1021atwr_sdcard_ifc_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1021atwr/Makefile b/board/freescale/ls1021atwr/Makefile
new file mode 100644
index 00000000000..cfa6c0c8540
--- /dev/null
+++ b/board/freescale/ls1021atwr/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1021atwr.o
+obj-$(CONFIG_ARMV7_PSCI) += psci.o
diff --git a/board/freescale/ls1021atwr/README b/board/freescale/ls1021atwr/README
new file mode 100644
index 00000000000..a4639cd7476
--- /dev/null
+++ b/board/freescale/ls1021atwr/README
@@ -0,0 +1,114 @@
+Overview
+--------
+The LS1021ATWR is a Freescale reference board that hosts the LS1021A SoC.
+
+LS1021A SoC Overview
+------------------
+The QorIQ LS1 family, which includes the LS1021A communications processor,
+is built on Layerscape architecture, the industry's first software-aware,
+core-agnostic networking architecture to offer unprecedented efficiency
+and scale.
+
+A member of the value-performance tier, the QorIQ LS1021A processor provides
+extensive integration and power efficiency for fanless, small form factor
+enterprise networking applications. Incorporating dual ARM Cortex-A7 cores
+running up to 1.0 GHz, the LS1021A processor delivers pre-silicon CoreMark
+performance of over 6,000, as well as virtualization support, advanced
+security features and the broadest array of high-speed interconnects and
+optimized peripheral features ever offered in a sub-3 W processor.
+
+The QorIQ LS1021A processor features an integrated LCD controller,
+CAN controller for implementing industrial protocols, DDR3L/4 running
+up to 1600 MHz, integrated security engine and QUICC Engine, and ECC
+protection on both L1 and L2 caches. The LS1021A processor is pin- and
+software-compatible with the QorIQ LS1020A and LS1022A processors.
+
+The LS1021A SoC includes the following function and features:
+
+ - ARM Cortex-A7 MPCore compliant with ARMv7-A architecture
+ - Dual high-preformance ARM Cortex-A7 cores, each core includes:
+ - 32 Kbyte L1 Instruction Cache and Data Cache for each core (ECC protection)
+ - 512 Kbyte shared coherent L2 Cache (with ECC protection)
+ - NEON Co-processor (per core)
+ - 40-bit physical addressing
+ - Vector floating-point support
+ - ARM Core-Link CCI-400 Cache Coherent Interconnect
+ - One DDR3L/DDR4 SDRAM memory controller with x8/x16/x32-bit configuration
+ supporting speeds up to 1600Mtps
+ - ECC and interleaving support
+ - VeTSEC Ethernet complex
+ - Up to 3x virtualized 10/100/1000 Ethernet controllers
+ - MII, RMII, RGMII, and SGMII support
+ - QoS, lossless flow control, and IEEE 1588 support
+ - 4-lane 6GHz SerDes
+ - High speed interconnect (4 SerDes lanes with are muxed for these protocol)
+ - Two PCI Express Gen2 controllers running at up to 5 GHz
+ - One Serial ATA 3.0 supporting 6 GT/s operation
+ - Two SGMII interfaces supporting 1000 Mbps
+ - Additional peripheral interfaces
+ - One high-speed USB 3.0 controller with integrated PHY and one high-speed
+ USB 2.00 controller with ULPI
+ - Integrated flash controller (IFC) with 16-bit interface
+ - Quad SPI NOR Flash
+ - One enhanced Secure digital host controller
+ - Display controller unit (DCU) 24-bit RGB (12-bit DDR pin interface)
+ - Ten UARTs comprised of two 16550 compliant DUARTs, and six low power
+ UARTs
+ - Three I2C controllers
+ - Eight FlexTimers four supporting PWM and four FlexCAN ports
+ - Four GPIO controllers supporting up to 109 general purpose I/O signals
+ - Integrated advanced audio block:
+ - Four synchronous audio interfaces (SAI)
+ - Sony/Philips Digital Interconnect Format (SPDIF)
+ - Asynchronous Sample Rate Converter (ASRC)
+ - Hardware based crypto offload engine
+ - IPSec forwarding at up to 1Gbps
+ - QorIQ Trust Architecture, Secure Boot, and ARM TrustZone supported
+ - Public key hardware accelerator
+ - True Random Number Generator (NIST Certified)
+ - Advanced Encryption Standard Accelerators (AESA)
+ - Data Encryption Standard Accelerators
+ - QUICC Engine ULite block
+ - Two universal communication controllers (TDM and HDLC) supporting 64
+ multichannels, each running at 64 Kbps
+ - Support for 256 channels of HDLC
+ - QorIQ TrustArchitecture with Secure Boot, as well as ARM TrustZone supported
+
+LS1021ATWR board Overview
+-------------------------
+ - DDR Controller
+ - Supports rates of up to 1600 MHz data-rate
+ - Supports one DDR3LP SDRAM.
+ - IFC/Local Bus
+ - NOR: 128MB 16-bit NOR Flash
+ - Ethernet
+ - Three on-board RGMII 10/100/1G ethernet ports.
+ - CPLD
+ - Clocks
+ - System and DDR clock (SYSCLK, DDRCLK)
+ - SERDES clocks
+ - Power Supplies
+ - SDHC
+ - SDHC/SDXC connector
+ - Other IO
+ - One Serial port
+ - Three I2C ports
+
+Memory map
+-----------
+The addresses in brackets are physical addresses.
+
+Start Address End Address Description Size
+0x00_0000_0000 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 0x00_20FF_FFFF DCSR 16MB
+0x00_4000_0000 0x00_5FFF_FFFF QSPI 512MB
+0x00_6000_0000 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_8000_0000 0x00_FFFF_FFFF DRAM1 2GB
+
+LS1021a rev1.0 Soc specific Options/Settings
+--------------------------------------------
+If the LS1021a Soc is rev1.0, you need modify the configuration and enable
+CONFIG_SPL_SKIP_LOWLEVEL_INIT in menuconfig or similar.
diff --git a/board/freescale/ls1021atwr/ls1021atwr.c b/board/freescale/ls1021atwr/ls1021atwr.c
new file mode 100644
index 00000000000..78006afce86
--- /dev/null
+++ b/board/freescale/ls1021atwr/ls1021atwr.c
@@ -0,0 +1,752 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2019, 2021-2022 NXP
+ */
+
+#include <clock_legacy.h>
+#include <command.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <init.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/immap_ls102xa.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/ls102xa_devdis.h>
+#include <asm/arch/ls102xa_soc.h>
+#include <asm/sections.h>
+#include <hwconfig.h>
+#include <mmc.h>
+#include <fsl_csu.h>
+#include <fsl_ifc.h>
+#include <fsl_immap.h>
+#include <netdev.h>
+#include <fsl_mdio.h>
+#include <tsec.h>
+#include <fsl_devdis.h>
+#include <spl.h>
+#include <linux/delay.h>
+#include "../common/sleep.h"
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+#include <fsl_validate.h>
+#include <dm/uclass.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define VERSION_MASK 0x00FF
+#define BANK_MASK 0x0001
+#define CFG_RESET 0x1
+#define INIT_RESET 0x1
+
+#define CPLD_SET_MUX_SERDES 0x20
+#define CPLD_SET_BOOT_BANK 0x40
+
+#define BOOT_FROM_UPPER_BANK 0x0
+#define BOOT_FROM_LOWER_BANK 0x1
+
+#define LANEB_SATA (0x01)
+#define LANEB_SGMII1 (0x02)
+#define LANEC_SGMII1 (0x04)
+#define LANEC_PCIEX1 (0x08)
+#define LANED_PCIEX2 (0x10)
+#define LANED_SGMII2 (0x20)
+
+#define MASK_LANE_B 0x1
+#define MASK_LANE_C 0x2
+#define MASK_LANE_D 0x4
+#define MASK_SGMII 0x8
+
+#define KEEP_STATUS 0x0
+#define NEED_RESET 0x1
+
+#define SOFT_MUX_ON_I2C3_IFC 0x2
+#define SOFT_MUX_ON_CAN3_USB2 0x8
+#define SOFT_MUX_ON_QE_LCD 0x10
+
+#define PIN_I2C3_IFC_MUX_I2C3 0x0
+#define PIN_I2C3_IFC_MUX_IFC 0x1
+#define PIN_CAN3_USB2_MUX_USB2 0x0
+#define PIN_CAN3_USB2_MUX_CAN3 0x1
+#define PIN_QE_LCD_MUX_LCD 0x0
+#define PIN_QE_LCD_MUX_QE 0x1
+
+struct cpld_data {
+ u8 cpld_ver; /* cpld revision */
+ u8 cpld_ver_sub; /* cpld sub revision */
+ u8 pcba_ver; /* pcb revision number */
+ u8 system_rst; /* reset system by cpld */
+ u8 soft_mux_on; /* CPLD override physical switches Enable */
+ u8 cfg_rcw_src1; /* Reset config word 1 */
+ u8 cfg_rcw_src2; /* Reset config word 2 */
+ u8 vbank; /* Flash bank selection Control */
+ u8 gpio; /* GPIO for TWR-ELEV */
+ u8 i2c3_ifc_mux;
+ u8 mux_spi2;
+ u8 can3_usb2_mux; /* CAN3 and USB2 Selection */
+ u8 qe_lcd_mux; /* QE and LCD Selection */
+ u8 serdes_mux; /* Multiplexed pins for SerDes Lanes */
+ u8 global_rst; /* reset with init CPLD reg to default */
+ u8 rev1; /* Reserved */
+ u8 rev2; /* Reserved */
+};
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+static void cpld_show(void)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ printf("CPLD: V%x.%x\nPCBA: V%x.0\nVBank: %d\n",
+ in_8(&cpld_data->cpld_ver) & VERSION_MASK,
+ in_8(&cpld_data->cpld_ver_sub) & VERSION_MASK,
+ in_8(&cpld_data->pcba_ver) & VERSION_MASK,
+ in_8(&cpld_data->vbank) & BANK_MASK);
+
+#ifdef DEBUG
+ printf("soft_mux_on =%x\n",
+ in_8(&cpld_data->soft_mux_on));
+ printf("cfg_rcw_src1 =%x\n",
+ in_8(&cpld_data->cfg_rcw_src1));
+ printf("cfg_rcw_src2 =%x\n",
+ in_8(&cpld_data->cfg_rcw_src2));
+ printf("vbank =%x\n",
+ in_8(&cpld_data->vbank));
+ printf("gpio =%x\n",
+ in_8(&cpld_data->gpio));
+ printf("i2c3_ifc_mux =%x\n",
+ in_8(&cpld_data->i2c3_ifc_mux));
+ printf("mux_spi2 =%x\n",
+ in_8(&cpld_data->mux_spi2));
+ printf("can3_usb2_mux =%x\n",
+ in_8(&cpld_data->can3_usb2_mux));
+ printf("qe_lcd_mux =%x\n",
+ in_8(&cpld_data->qe_lcd_mux));
+ printf("serdes_mux =%x\n",
+ in_8(&cpld_data->serdes_mux));
+#endif
+}
+#endif
+
+int checkboard(void)
+{
+ puts("Board: LS1021ATWR\n");
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+ cpld_show();
+#endif
+
+ return 0;
+}
+
+void ddrmc_init(void)
+{
+ struct ccsr_ddr *ddr = (struct ccsr_ddr *)CFG_SYS_FSL_DDR_ADDR;
+ u32 temp_sdram_cfg, tmp;
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG);
+
+ out_be32(&ddr->cs0_bnds, DDR_CS0_BNDS);
+ out_be32(&ddr->cs0_config, DDR_CS0_CONFIG);
+
+ out_be32(&ddr->timing_cfg_0, DDR_TIMING_CFG_0);
+ out_be32(&ddr->timing_cfg_1, DDR_TIMING_CFG_1);
+ out_be32(&ddr->timing_cfg_2, DDR_TIMING_CFG_2);
+ out_be32(&ddr->timing_cfg_3, DDR_TIMING_CFG_3);
+ out_be32(&ddr->timing_cfg_4, DDR_TIMING_CFG_4);
+ out_be32(&ddr->timing_cfg_5, DDR_TIMING_CFG_5);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ out_be32(&ddr->sdram_cfg_2,
+ DDR_SDRAM_CFG_2 & ~SDRAM_CFG2_D_INIT);
+ out_be32(&ddr->init_addr, CFG_SYS_SDRAM_BASE);
+ out_be32(&ddr->init_ext_addr, (1 << 31));
+
+ /* DRAM VRef will not be trained */
+ out_be32(&ddr->ddr_cdr2,
+ DDR_DDR_CDR2 & ~DDR_CDR2_VREF_TRAIN_EN);
+ } else
+#endif
+ {
+ out_be32(&ddr->sdram_cfg_2, DDR_SDRAM_CFG_2);
+ out_be32(&ddr->ddr_cdr2, DDR_DDR_CDR2);
+ }
+
+ out_be32(&ddr->sdram_mode, DDR_SDRAM_MODE);
+ out_be32(&ddr->sdram_mode_2, DDR_SDRAM_MODE_2);
+
+ out_be32(&ddr->sdram_interval, DDR_SDRAM_INTERVAL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl, DDR_DDR_WRLVL_CNTL);
+
+ out_be32(&ddr->ddr_wrlvl_cntl_2, DDR_DDR_WRLVL_CNTL_2);
+ out_be32(&ddr->ddr_wrlvl_cntl_3, DDR_DDR_WRLVL_CNTL_3);
+
+ out_be32(&ddr->ddr_cdr1, DDR_DDR_CDR1);
+
+ out_be32(&ddr->sdram_clk_cntl, DDR_SDRAM_CLK_CNTL);
+ out_be32(&ddr->ddr_zq_cntl, DDR_DDR_ZQ_CNTL);
+
+ out_be32(&ddr->cs0_config_2, DDR_CS0_CONFIG_2);
+
+ /* DDR erratum A-009942 */
+ tmp = in_be32(&ddr->debug[28]);
+ out_be32(&ddr->debug[28], tmp | 0x0070006f);
+
+ udelay(1);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ /* enter self-refresh */
+ temp_sdram_cfg = in_be32(&ddr->sdram_cfg_2);
+ temp_sdram_cfg |= SDRAM_CFG2_FRC_SR;
+ out_be32(&ddr->sdram_cfg_2, temp_sdram_cfg);
+
+ temp_sdram_cfg = (DDR_SDRAM_CFG_MEM_EN | SDRAM_CFG_BI);
+ } else
+#endif
+ temp_sdram_cfg = (DDR_SDRAM_CFG_MEM_EN & ~SDRAM_CFG_BI);
+
+ out_be32(&ddr->sdram_cfg, DDR_SDRAM_CFG | temp_sdram_cfg);
+
+#ifdef CONFIG_DEEP_SLEEP
+ if (is_warm_boot()) {
+ /* exit self-refresh */
+ temp_sdram_cfg = in_be32(&ddr->sdram_cfg_2);
+ temp_sdram_cfg &= ~SDRAM_CFG2_FRC_SR;
+ out_be32(&ddr->sdram_cfg_2, temp_sdram_cfg);
+ }
+#endif
+}
+
+int dram_init(void)
+{
+#if (!defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD))
+ ddrmc_init();
+#endif
+
+ erratum_a008850_post();
+
+ gd->ram_size = get_ram_size((void *)PHYS_SDRAM, PHYS_SDRAM_SIZE);
+
+#if defined(CONFIG_DEEP_SLEEP) && !defined(CONFIG_SPL_BUILD)
+ fsl_dp_resume();
+#endif
+
+ return 0;
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ return pci_eth_init(bis);
+}
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+static void convert_serdes_mux(int type, int need_reset)
+{
+ char current_serdes;
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ current_serdes = cpld_data->serdes_mux;
+
+ switch (type) {
+ case LANEB_SATA:
+ current_serdes &= ~MASK_LANE_B;
+ break;
+ case LANEB_SGMII1:
+ current_serdes |= (MASK_LANE_B | MASK_SGMII | MASK_LANE_C);
+ break;
+ case LANEC_SGMII1:
+ current_serdes &= ~(MASK_LANE_B | MASK_SGMII | MASK_LANE_C);
+ break;
+ case LANED_SGMII2:
+ current_serdes |= MASK_LANE_D;
+ break;
+ case LANEC_PCIEX1:
+ current_serdes |= MASK_LANE_C;
+ break;
+ case (LANED_PCIEX2 | LANEC_PCIEX1):
+ current_serdes |= MASK_LANE_C;
+ current_serdes &= ~MASK_LANE_D;
+ break;
+ default:
+ printf("CPLD serdes MUX: unsupported MUX type 0x%x\n", type);
+ return;
+ }
+
+ cpld_data->soft_mux_on |= CPLD_SET_MUX_SERDES;
+ cpld_data->serdes_mux = current_serdes;
+
+ if (need_reset == 1) {
+ printf("Reset board to enable configuration\n");
+ cpld_data->system_rst = CFG_RESET;
+ }
+}
+
+int config_serdes_mux(void)
+{
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 protocol = in_be32(&gur->rcwsr[4]) & RCWSR4_SRDS1_PRTCL_MASK;
+
+ protocol >>= RCWSR4_SRDS1_PRTCL_SHIFT;
+ switch (protocol) {
+ case 0x10:
+ convert_serdes_mux(LANEB_SATA, KEEP_STATUS);
+ convert_serdes_mux(LANED_PCIEX2 |
+ LANEC_PCIEX1, KEEP_STATUS);
+ break;
+ case 0x20:
+ convert_serdes_mux(LANEB_SGMII1, KEEP_STATUS);
+ convert_serdes_mux(LANEC_PCIEX1, KEEP_STATUS);
+ convert_serdes_mux(LANED_SGMII2, KEEP_STATUS);
+ break;
+ case 0x30:
+ convert_serdes_mux(LANEB_SATA, KEEP_STATUS);
+ convert_serdes_mux(LANEC_SGMII1, KEEP_STATUS);
+ convert_serdes_mux(LANED_SGMII2, KEEP_STATUS);
+ break;
+ case 0x70:
+ convert_serdes_mux(LANEB_SATA, KEEP_STATUS);
+ convert_serdes_mux(LANEC_PCIEX1, KEEP_STATUS);
+ convert_serdes_mux(LANED_SGMII2, KEEP_STATUS);
+ break;
+ }
+
+ return 0;
+}
+#endif
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+int config_board_mux(void)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ int conflict_flag;
+
+ conflict_flag = 0;
+ if (hwconfig("i2c3")) {
+ conflict_flag++;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_I2C3_IFC;
+ cpld_data->i2c3_ifc_mux = PIN_I2C3_IFC_MUX_I2C3;
+ }
+
+ if (hwconfig("ifc")) {
+ conflict_flag++;
+ /* some signals can not enable simultaneous*/
+ if (conflict_flag > 1)
+ goto conflict;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_I2C3_IFC;
+ cpld_data->i2c3_ifc_mux = PIN_I2C3_IFC_MUX_IFC;
+ }
+
+ conflict_flag = 0;
+ if (hwconfig("usb2")) {
+ conflict_flag++;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_CAN3_USB2;
+ cpld_data->can3_usb2_mux = PIN_CAN3_USB2_MUX_USB2;
+ }
+
+ if (hwconfig("can3")) {
+ conflict_flag++;
+ /* some signals can not enable simultaneous*/
+ if (conflict_flag > 1)
+ goto conflict;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_CAN3_USB2;
+ cpld_data->can3_usb2_mux = PIN_CAN3_USB2_MUX_CAN3;
+ }
+
+ conflict_flag = 0;
+ if (hwconfig("lcd")) {
+ conflict_flag++;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_QE_LCD;
+ cpld_data->qe_lcd_mux = PIN_QE_LCD_MUX_LCD;
+ }
+
+ if (hwconfig("qe")) {
+ conflict_flag++;
+ /* some signals can not enable simultaneous*/
+ if (conflict_flag > 1)
+ goto conflict;
+ cpld_data->soft_mux_on |= SOFT_MUX_ON_QE_LCD;
+ cpld_data->qe_lcd_mux = PIN_QE_LCD_MUX_QE;
+ }
+
+ return 0;
+
+conflict:
+ printf("WARNING: pin conflict! MUX setting may failed!\n");
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_TSEC_ENET
+ /* clear BD & FR bits for BE BD's and frame data */
+ clrbits_be32(&scfg->etsecdmamcr, SCFG_ETSECDMAMCR_LE_BD_FR);
+ out_be32(&scfg->etsecmcr, SCFG_ETSECCMCR_GE2_CLK125);
+#endif
+
+#ifdef CONFIG_FSL_IFC
+ init_early_memctl_regs();
+#endif
+
+ arch_soc_init();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot()) {
+ timer_init();
+ dram_init();
+ }
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+void board_init_f(ulong dummy)
+{
+ void (*second_uboot)(void);
+
+ /* Clear the BSS */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ get_clocks();
+
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ preloader_console_init();
+
+ timer_init();
+ dram_init();
+
+ /* Allow OCRAM access permission as R/W */
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+
+ /*
+ * if it is woken up from deep sleep, then jump to second
+ * stage uboot and continue executing without recopying
+ * it from SD since it has already been reserved in memeory
+ * in last boot.
+ */
+ if (is_warm_boot()) {
+ second_uboot = (void (*)(void))CONFIG_TEXT_BASE;
+ second_uboot();
+ }
+
+ board_init_r(NULL, 0);
+}
+#endif
+
+#ifdef CONFIG_DEEP_SLEEP
+/* program the regulator (MC34VR500) to support deep sleep */
+void ls1twr_program_regulator(void)
+{
+ u8 i2c_device_id;
+
+#define LS1TWR_I2C_BUS_MC34VR500 1
+#define MC34VR500_ADDR 0x8
+#define MC34VR500_DEVICEID 0x4
+#define MC34VR500_DEVICEID_MASK 0x0f
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(LS1TWR_I2C_BUS_MC34VR500, MC34VR500_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ LS1TWR_I2C_BUS_MC34VR500);
+ return;
+ }
+ i2c_device_id = dm_i2c_reg_read(dev, 0x0) &
+ MC34VR500_DEVICEID_MASK;
+ if (i2c_device_id != MC34VR500_DEVICEID) {
+ printf("The regulator (MC34VR500) does not exist. The device does not support deep sleep.\n");
+ return;
+ }
+
+ dm_i2c_reg_write(dev, 0x31, 0x4);
+ dm_i2c_reg_write(dev, 0x4d, 0x4);
+ dm_i2c_reg_write(dev, 0x6d, 0x38);
+ dm_i2c_reg_write(dev, 0x6f, 0x37);
+ dm_i2c_reg_write(dev, 0x71, 0x30);
+#else
+ unsigned int i2c_bus;
+ i2c_bus = i2c_get_bus_num();
+ i2c_set_bus_num(LS1TWR_I2C_BUS_MC34VR500);
+ i2c_device_id = i2c_reg_read(MC34VR500_ADDR, 0x0) &
+ MC34VR500_DEVICEID_MASK;
+ if (i2c_device_id != MC34VR500_DEVICEID) {
+ printf("The regulator (MC34VR500) does not exist. The device does not support deep sleep.\n");
+ return;
+ }
+
+ i2c_reg_write(MC34VR500_ADDR, 0x31, 0x4);
+ i2c_reg_write(MC34VR500_ADDR, 0x4d, 0x4);
+ i2c_reg_write(MC34VR500_ADDR, 0x6d, 0x38);
+ i2c_reg_write(MC34VR500_ADDR, 0x6f, 0x37);
+ i2c_reg_write(MC34VR500_ADDR, 0x71, 0x30);
+
+ i2c_set_bus_num(i2c_bus);
+#endif
+}
+#endif
+
+int board_init(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+
+#ifndef CONFIG_SYS_FSL_NO_SERDES
+ fsl_serdes_init();
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+ config_serdes_mux();
+#endif
+#endif
+
+ ls102xa_smmu_stream_id_init();
+
+#ifdef CONFIG_U_QE
+ u_qe_init();
+#endif
+
+#ifdef CONFIG_DEEP_SLEEP
+ ls1twr_program_regulator();
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_SPL_BUILD)
+void spl_board_init(void)
+{
+ if (IS_ENABLED(CONFIG_FSL_CAAM)) {
+ struct udevice *dev;
+ int ret;
+
+ ret = uclass_get_device_by_driver(UCLASS_MISC, DM_DRIVER_GET(caam_jr), &dev);
+ if (ret)
+ printf("Failed to initialize caam_jr: %d\n", ret);
+ }
+
+ ls102xa_smmu_stream_id_init();
+}
+#endif
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+#ifdef CONFIG_CHAIN_OF_TRUST
+ fsl_setenv_chain_of_trust();
+#endif
+
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_MISC_INIT_R)
+int misc_init_r(void)
+{
+#ifdef CONFIG_FSL_DEVICE_DISABLE
+ device_disable(devdis_tbl, ARRAY_SIZE(devdis_tbl));
+#endif
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI)
+ config_board_mux();
+#endif
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_sleep_prepare(void)
+{
+#ifdef CONFIG_LAYERSCAPE_NS_ACCESS
+ enable_layerscape_ns_access();
+#endif
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_PCI
+ ft_pci_setup(blob, bd);
+#endif
+
+ return 0;
+}
+
+u8 flash_read8(void *addr)
+{
+ return __raw_readb(addr + 1);
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
+
+#if !defined(CONFIG_QSPI_BOOT) && !defined(CONFIG_SD_BOOT_QSPI) \
+ && !defined(CONFIG_SPL_BUILD)
+static void convert_flash_bank(char bank)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ printf("Now switch to boot from flash bank %d.\n", bank);
+ cpld_data->soft_mux_on = CPLD_SET_BOOT_BANK;
+ cpld_data->vbank = bank;
+
+ printf("Reset board to enable configuration.\n");
+ cpld_data->system_rst = CFG_RESET;
+}
+
+static int flash_bank_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc != 2)
+ return CMD_RET_USAGE;
+ if (strcmp(argv[1], "0") == 0)
+ convert_flash_bank(BOOT_FROM_UPPER_BANK);
+ else if (strcmp(argv[1], "1") == 0)
+ convert_flash_bank(BOOT_FROM_LOWER_BANK);
+ else
+ return CMD_RET_USAGE;
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ boot_bank, 2, 0, flash_bank_cmd,
+ "Flash bank Selection Control",
+ "bank[0-upper bank/1-lower bank] (e.g. boot_bank 0)"
+);
+
+static int cpld_reset_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ if (argc > 2)
+ return CMD_RET_USAGE;
+ if ((argc == 1) || (strcmp(argv[1], "conf") == 0))
+ cpld_data->system_rst = CFG_RESET;
+ else if (strcmp(argv[1], "init") == 0)
+ cpld_data->global_rst = INIT_RESET;
+ else
+ return CMD_RET_USAGE;
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ cpld_reset, 2, 0, cpld_reset_cmd,
+ "Reset via CPLD",
+ "conf\n"
+ " -reset with current CPLD configuration\n"
+ "init\n"
+ " -reset and initial CPLD configuration with default value"
+
+);
+
+static void print_serdes_mux(void)
+{
+ char current_serdes;
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ current_serdes = cpld_data->serdes_mux;
+
+ printf("Serdes Lane B: ");
+ if ((current_serdes & MASK_LANE_B) == 0)
+ printf("SATA,\n");
+ else
+ printf("SGMII 1,\n");
+
+ printf("Serdes Lane C: ");
+ if ((current_serdes & MASK_LANE_C) == 0)
+ printf("SGMII 1,\n");
+ else
+ printf("PCIe,\n");
+
+ printf("Serdes Lane D: ");
+ if ((current_serdes & MASK_LANE_D) == 0)
+ printf("PCIe,\n");
+ else
+ printf("SGMII 2,\n");
+
+ printf("SGMII 1 is on lane ");
+ if ((current_serdes & MASK_SGMII) == 0)
+ printf("C.\n");
+ else
+ printf("B.\n");
+}
+
+static int serdes_mux_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc != 2)
+ return CMD_RET_USAGE;
+ if (strcmp(argv[1], "sata") == 0) {
+ printf("Set serdes lane B to SATA.\n");
+ convert_serdes_mux(LANEB_SATA, NEED_RESET);
+ } else if (strcmp(argv[1], "sgmii1b") == 0) {
+ printf("Set serdes lane B to SGMII 1.\n");
+ convert_serdes_mux(LANEB_SGMII1, NEED_RESET);
+ } else if (strcmp(argv[1], "sgmii1c") == 0) {
+ printf("Set serdes lane C to SGMII 1.\n");
+ convert_serdes_mux(LANEC_SGMII1, NEED_RESET);
+ } else if (strcmp(argv[1], "sgmii2") == 0) {
+ printf("Set serdes lane D to SGMII 2.\n");
+ convert_serdes_mux(LANED_SGMII2, NEED_RESET);
+ } else if (strcmp(argv[1], "pciex1") == 0) {
+ printf("Set serdes lane C to PCIe X1.\n");
+ convert_serdes_mux(LANEC_PCIEX1, NEED_RESET);
+ } else if (strcmp(argv[1], "pciex2") == 0) {
+ printf("Set serdes lane C & lane D to PCIe X2.\n");
+ convert_serdes_mux((LANED_PCIEX2 | LANEC_PCIEX1), NEED_RESET);
+ } else if (strcmp(argv[1], "show") == 0) {
+ print_serdes_mux();
+ } else {
+ return CMD_RET_USAGE;
+ }
+
+ return 0;
+}
+
+U_BOOT_CMD(
+ lane_bank, 2, 0, serdes_mux_cmd,
+ "Multiplexed function setting for SerDes Lanes",
+ "sata\n"
+ " -change lane B to sata\n"
+ "lane_bank sgmii1b\n"
+ " -change lane B to SGMII1\n"
+ "lane_bank sgmii1c\n"
+ " -change lane C to SGMII1\n"
+ "lane_bank sgmii2\n"
+ " -change lane D to SGMII2\n"
+ "lane_bank pciex1\n"
+ " -change lane C to PCIeX1\n"
+ "lane_bank pciex2\n"
+ " -change lane C & lane D to PCIeX2\n"
+ "\nWARNING: If you aren't familiar with the setting of serdes, don't try to change anything!\n"
+);
+#endif
diff --git a/board/freescale/ls1021atwr/ls102xa_pbi.cfg b/board/freescale/ls1021atwr/ls102xa_pbi.cfg
new file mode 100644
index 00000000000..f1a1b63ab77
--- /dev/null
+++ b/board/freescale/ls1021atwr/ls102xa_pbi.cfg
@@ -0,0 +1,12 @@
+#PBI commands
+
+09570200 ffffffff
+09570158 00000300
+8940007c 21f47300
+
+#Configure Scratch register
+09ee0200 10000000
+#Configure alternate space
+09570158 00001000
+#Flush PBL data
+096100c0 000FFFFF
diff --git a/board/freescale/ls1021atwr/ls102xa_rcw_sd_ifc.cfg b/board/freescale/ls1021atwr/ls102xa_rcw_sd_ifc.cfg
new file mode 100644
index 00000000000..f94997d5384
--- /dev/null
+++ b/board/freescale/ls1021atwr/ls102xa_rcw_sd_ifc.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+
+#enable IFC, disable QSPI and DSPI
+0608000c 00000000 00000000 00000000
+30000000 00007900 60040a00 21046000
+00000000 00000000 00000000 20000000
+00080000 881b7340 00000000 00000000
diff --git a/board/freescale/ls1021atwr/ls102xa_rcw_sd_qspi.cfg b/board/freescale/ls1021atwr/ls102xa_rcw_sd_qspi.cfg
new file mode 100644
index 00000000000..541b604cffc
--- /dev/null
+++ b/board/freescale/ls1021atwr/ls102xa_rcw_sd_qspi.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+
+#disable IFC, enable QSPI and DSPI
+0608000c 00000000 00000000 00000000
+30000000 00007900 60040a00 21046000
+00000000 00000000 00000000 20000000
+20024800 881b7340 00000000 00000000
diff --git a/board/freescale/ls1021atwr/psci.S b/board/freescale/ls1021atwr/psci.S
new file mode 100644
index 00000000000..3c093aa33cb
--- /dev/null
+++ b/board/freescale/ls1021atwr/psci.S
@@ -0,0 +1,24 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 NXP Semiconductor.
+ * Author: Wang Dongsheng <dongsheng.wang@freescale.com>
+ */
+
+#include <config.h>
+#include <linux/linkage.h>
+
+#include <asm/armv7.h>
+#include <asm/psci.h>
+
+ .pushsection ._secure.text, "ax"
+
+ .arch_extension sec
+
+ .align 5
+
+.globl psci_system_off
+psci_system_off:
+1: wfi
+ b 1b
+
+ .popsection
diff --git a/board/freescale/ls1028a/Kconfig b/board/freescale/ls1028a/Kconfig
new file mode 100644
index 00000000000..fb6ee17ce89
--- /dev/null
+++ b/board/freescale/ls1028a/Kconfig
@@ -0,0 +1,47 @@
+if TARGET_LS1028AQDS
+
+config SYS_BOARD
+ default "ls1028a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1028aqds"
+
+config EMMC_BOOT
+ bool "Support for booting from EMMC"
+
+config TEXT_BASE
+ default 0x96000000 if SD_BOOT || EMMC_BOOT
+ default 0x82000000 if TFABOOT
+ default 0x20100000
+
+endif
+
+if TARGET_LS1028ARDB
+
+config SYS_BOARD
+ default "ls1028a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1028ardb"
+
+config EMMC_BOOT
+ bool "Support for booting from EMMC"
+
+config TEXT_BASE
+ default 0x96000000 if SD_BOOT || EMMC_BOOT
+ default 0x82000000 if TFABOOT
+ default 0x20100000
+
+endif
diff --git a/board/freescale/ls1028a/MAINTAINERS b/board/freescale/ls1028a/MAINTAINERS
new file mode 100644
index 00000000000..551f6a08651
--- /dev/null
+++ b/board/freescale/ls1028a/MAINTAINERS
@@ -0,0 +1,26 @@
+LS1028AQDS BOARD
+M: Tang Yuantian <andy.tang@nxp.com>
+S: Maintained
+F: board/freescale/ls1028a/
+F: include/configs/ls1028a_common.h
+F: include/configs/ls1028aqds.h
+F: configs/ls1028aqds_tfa_defconfig
+F: configs/ls1028aqds_tfa_lpuart_defconfig
+
+LS1028ARDB BOARD
+M: Tang Yuantian <andy.tang@nxp.com>
+S: Maintained
+F: board/freescale/ls1028a/
+F: include/configs/ls1028a_common.h
+F: include/configs/ls1028ardb.h
+F: configs/ls1028ardb_tfa_defconfig
+
+LS1028AQDS_SECURE_BOOT BOARD
+M: Tang Yuantian <andy.tang@nxp.com>
+S: Maintained
+F: configs/ls1028aqds_tfa_SECURE_BOOT_defconfig
+
+LS1028ARDB_SECURE_BOOT BOARD
+M: Tang Yuantian <andy.tang@nxp.com>
+S: Maintained
+F: configs/ls1028ardb_tfa_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1028a/Makefile b/board/freescale/ls1028a/Makefile
new file mode 100644
index 00000000000..9bc144cbfea
--- /dev/null
+++ b/board/freescale/ls1028a/Makefile
@@ -0,0 +1,8 @@
+#
+# Copyright 2019 NXP
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ls1028a.o
+obj-y += ddr.o
diff --git a/board/freescale/ls1028a/README b/board/freescale/ls1028a/README
new file mode 100644
index 00000000000..323881faa50
--- /dev/null
+++ b/board/freescale/ls1028a/README
@@ -0,0 +1,164 @@
+Overview
+--------
+The LS1028A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports ARM SoC LS1028A and its
+derivatives.
+
+LS1028A SoC Overview
+--------------------------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc
+
+RDB Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+For XSPI NOR boot (default)
+SW2: 1111_1000
+SW3: 1111_0000
+SW5: 0011_1001
+
+For SD Boot
+SW2: 1000_1000
+SW3: 1111_0000
+SW5: 0011_1001
+
+For eMMC Boot
+SW2: 1001_1000
+SW3: 1111_0000
+SW5: 0011_1001
+
+LS1028ARDB board Overview
+-------------------------
+Processor
+ Two Arm Cortex- A72 processor cores:
+ - Based on 64-bit ARMv8 architecture
+ - Up to 1.3 GHz operation
+ - Single-threaded cores with 48 KB L1 instruction cache and 32 KB L1
+ data cache
+ - Arranged as a single cluster of two cores sharing a single 1 MB L2
+ cache
+DDR memory
+ - Five onboard 1G x8 discrete memory modules (Four data byte lanes
+ ECC)
+ - 32-bit data and 4-bit ECC
+ - One chip select
+ - Data transfer rates of up to 1.6 GT/s
+ - Single-bit error correction and double-bit error detection ECC (4-bit
+ check word across 32-bit data)
+High-speed serial ports(SerDes)
+ - Lane 0: Supports one 1 GbE RJ45 SGMII, connected through the
+ Qualcomm AR8033 PHY
+ - Lane 1: Supports four 1.25 GbE RJ45 QSGMII, each connected
+ through the NXP F104S8A PHY
+ - Lane 2: Connects to one PCIe M.2 Key-E slot to support PCIe Gen3
+ (8 Gbit/s) cards
+ - Lane 3: Connects to one PCIe M.2 Key-E slot or one SATA M.2 Key-B
+ slot through a register mux to support either PCIe Gen 3 (8 Gbit/s) or
+ SATA Gen 3 cards (6 Gbit/s) at a time
+eSDHC
+ - eSDHC1, eSDHC2
+SPI
+ - Connects to two mikroBUS sockets to support mikro-click modules,
+ such as Bluetooth 4.0, 2.4 GHz IEEE 802.15.4 radio transceiver, near
+ field communications (NFC) controller
+Octal SPI (XSPI)
+ - One 256 MB onboard XSPI serial NOR flash memory
+ - One 512 MB onboard XSPI serial NAND flash memory
+ - Supports a QSPI emulator for offboard QSPI emulation
+I2C
+ - All system devices are accessed via I2C1, which is multiplexed on
+ I2C multiplexer PCA9848 to isolate address conflicts and reduce
+ capacitive load
+ - I2C1 is used for EEPROMs, RTC, INA220 current-power sensor,
+ thermal monitor, PCIe/SATA M.2 connectors and mikro-click modules
+ 1 and 2
+CAN
+ - The two CAN DB9 ports can support CAN FD fast phase at data rates of
+ up to 5 Mbit/s
+Serial audio interface(SAI)
+ - Audio codec SGTL5000 provides headphone and audio LINEOUT for
+ stereo speakers
+ - IEEE1588 interface to support audio on SAI4
+
+QDS Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+For SD Boot
+SW1 : 1000_0000
+SW2 : 1110_0110
+SW3 : 0000_0010
+SW4 : 0000_0000
+SW5 : 0000_0000
+SW6 : 0000_0000
+SW7 : 1111_0011
+SW8 : 1110_0000
+SW9 : 1000_0001
+SW10: 1110_0000
+
+For XSPI Boot
+SW1 : 1111_0000
+SW2 : 0000_0110
+SW3 : 0000_0010
+SW4 : 0000_0000
+SW5 : 0110_0000
+SW6 : 0101_0000
+SW7 : 1111_0011
+SW8 : 1110_0000
+SW9 : 1000_0000
+SW10: 1110_0000
+
+LS1028AQDS board Overview
+-------------------------
+Processor
+ Two Arm Cortex- A72 processor cores:
+ - Based on 64-bit ARMv8 architecture
+ - Up to 1.3 GHz operation
+ - Single-threaded cores with 48 KB L1 instruction cache and 32 KB L1
+ data cache
+ - Arranged as a single cluster of two cores sharing a single 1 MB L2
+ cache
+DDR memory
+ - Supports data rates of up to 1.6 GT/s for both, DDR4 and DDR3L
+ - Supports a single- or dual-ranked SODIMM or UDIMM connector
+ - 32-bit data and 4-bit ECC
+ - Supports x8/x16 devices
+ - Supports ECC error detection and correction
+ - 1.35 V or 1.2 V DDR power supply, with automatic tracking of VTT, to
+ all devices in case of DDR3L or DDR4, respectively. Power can
+ switch to 1.35 V or 1.2 V, based on the switch settings for DDR3L or
+ DDR4 devices, respectively
+SerDes (Serializer/Deserializer)
+ - Four-lane (0-3) SerDes:
+ - Lane 0: supports PCIe Gen1/2/3 with x1, x2, and x4 operation, 10
+ Gbit SXGMII, 1 Gbit SGMII
+ - Lane 1: supports PCIe Gen1/2/3 with x1, x2, and x4 operation, 1 Gbit
+ SGMII, 10 Gbit QXGMII, 5 Gbit QSGMII, 1 Gbit SGMII
+ - Lane 2: supports PCIe Gen1/2/3 with x1, x2, and x4 operation, 1 Gbit
+ SGMII
+ - Lane 3: supports PCIe Gen1/2/3 with x1, x2, and x4 operation, 1 Gbit
+ SGMII, SATA 2.0/3.0
+ - Four slots on SerDes lanes support PCIe Gen1/2/3, 1 Gbit SGMII
+ add-in cards
+ - Lane 1 connects to a 2x10 connector with SFP+ through a retimer;
+ lane 2 (TX lines) connects to an SMA connector
+ Lane 3 connects to 1x7 header to support SATA devices
+eSDHC
+ - eSDHC1, eSDHC2
+SPI
+ - SPI1 and SPI2 support three onboard SPI flash memory devices:
+ 512 Mbit high-speed flash (with speed of up to 108/54 MHz)
+ memory for storage
+ 4 Mbit low-speed flash memory (with speed of up to 40 MHz)
+ 64 Mbit high-speed flash memory (with speed of up to 104/80
+ MHz)
+ - SPI3 supports one onboard 64 Mbit SPI flash memory (with speed of
+ up to 104/80 MHz)
+ - All memories operate at 1.8 V
+ - A header is provided on SPI1 to test SPI slave mode
+I2C
+ - LS1028A supports eight I2C controllers
+Serial audio interface(SAI)
+ Two SAI ports with audio codec SGTL5000:
+ - Include stereo LINEIN with support for external analog input
+ - Provide headphone and line output
+Display
+ - DisplayPort connector to connect the DP data to a 4K display device
+ (computer monitor)
+ - eDP connector to connect the DP data to a 4K display panel
diff --git a/board/freescale/ls1028a/ddr.c b/board/freescale/ls1028a/ddr.c
new file mode 100644
index 00000000000..c406f2436d1
--- /dev/null
+++ b/board/freescale/ls1028a/ddr.c
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
diff --git a/board/freescale/ls1028a/ls1028a.c b/board/freescale/ls1028a/ls1028a.c
new file mode 100644
index 00000000000..e01b5a8c2eb
--- /dev/null
+++ b/board/freescale/ls1028a/ls1028a.c
@@ -0,0 +1,329 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019-2022 NXP
+ */
+
+#include <config.h>
+#include <display_options.h>
+#include <init.h>
+#include <malloc.h>
+#include <errno.h>
+#include <fsl_ddr.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <hwconfig.h>
+#include <fdt_support.h>
+#include <linux/libfdt.h>
+#include <env_internal.h>
+#include <asm/arch-fsl-layerscape/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <i2c.h>
+#include <asm/arch/soc.h>
+#include <fsl_immap.h>
+#include <netdev.h>
+
+#include <fdtdec.h>
+#include <miiphy.h>
+#include "../common/qixis.h"
+#include "../drivers/net/fsl_enetc.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int config_board_mux(void)
+{
+#ifndef CONFIG_LPUART
+#if defined(CONFIG_TARGET_LS1028AQDS) && defined(CONFIG_FSL_QIXIS)
+ u8 reg;
+
+ reg = QIXIS_READ(brdcfg[13]);
+ /* Field| Function
+ * 7-6 | Controls I2C3 routing (net CFG_MUX_I2C3):
+ * I2C3 | 10= Routes {SCL, SDA} to CAN1 transceiver as {TX, RX}.
+ * 5-4 | Controls I2C4 routing (net CFG_MUX_I2C4):
+ * I2C4 |11= Routes {SCL, SDA} to CAN2 transceiver as {TX, RX}.
+ */
+ reg &= ~(0xf0);
+ reg |= 0xb0;
+ QIXIS_WRITE(brdcfg[13], reg);
+
+ reg = QIXIS_READ(brdcfg[15]);
+ /* Field| Function
+ * 7 | Controls the CAN1 transceiver (net CFG_CAN1_STBY):
+ * CAN1 | 0= CAN #1 transceiver enabled
+ * 6 | Controls the CAN2 transceiver (net CFG_CAN2_STBY):
+ * CAN2 | 0= CAN #2 transceiver enabled
+ */
+ reg &= ~(0xc0);
+ QIXIS_WRITE(brdcfg[15], reg);
+#endif
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_LPUART
+u32 get_lpuart_clk(void)
+{
+ return gd->bus_clk / CONFIG_SYS_FSL_LPUART_CLK_DIV;
+}
+#endif
+
+int board_init(void)
+{
+#ifndef CONFIG_SYS_EARLY_PCI_INIT
+ pci_init();
+#endif
+
+#if defined(CONFIG_TARGET_LS1028ARDB)
+ u8 val = I2C_MUX_CH_DEFAULT;
+
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_MUX_PCA_ADDR_PRI, 0x0b, 1, &val, 1);
+#else
+ struct udevice *dev;
+
+ if (!i2c_get_chip_for_busnum(0, I2C_MUX_PCA_ADDR_PRI, 1, &dev))
+ dm_i2c_write(dev, 0x0b, &val, 1);
+#endif
+#endif
+
+#if defined(CONFIG_TARGET_LS1028ARDB)
+ u8 reg;
+
+ reg = QIXIS_READ(brdcfg[4]);
+ /*
+ * Field | Function
+ * 3 | DisplayPort Power Enable (net DP_PWR_EN):
+ * DPPWR | 0= DP_PWR is enabled.
+ */
+ reg &= ~(DP_PWD_EN_DEFAULT_MASK);
+ QIXIS_WRITE(brdcfg[4], reg);
+#endif
+ return 0;
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ return pci_eth_init(bis);
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ config_board_mux();
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+#ifdef CONFIG_LPUART
+ u8 uart;
+#endif
+
+#if defined(CONFIG_SYS_I2C_EARLY_INIT) && defined(CONFIG_SPL_BUILD)
+ i2c_early_init_f();
+#endif
+
+ fsl_lsch3_early_init_f();
+
+#ifdef CONFIG_LPUART
+ /*
+ * Field| Function
+ * --------------------------------------------------------------
+ * 7-6 | Controls I2C3 routing (net CFG_MUX_I2C3):
+ * I2C3 | 11= Routes {SCL, SDA} to LPUART1 header as {SOUT, SIN}.
+ * --------------------------------------------------------------
+ * 5-4 | Controls I2C4 routing (net CFG_MUX_I2C4):
+ * I2C4 |11= Routes {SCL, SDA} to LPUART1 header as {CTS_B, RTS_B}.
+ */
+ /* use lpuart0 as system console */
+ uart = QIXIS_READ(brdcfg[13]);
+ uart &= ~CFG_LPUART_MUX_MASK;
+ uart |= CFG_LPUART_EN;
+ QIXIS_WRITE(brdcfg[13], uart);
+#endif
+
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ puts("\nDDR ");
+ print_size(gd->bd->bi_dram[0].size + gd->bd->bi_dram[1].size, "");
+ print_ddr_info(0);
+}
+
+int esdhc_status_fixup(void *blob, const char *compat)
+{
+ void __iomem *dcfg_ccsr = (void __iomem *)DCFG_BASE;
+ char esdhc1_path[] = "/soc/mmc@2140000";
+ char esdhc2_path[] = "/soc/mmc@2150000";
+ char dspi1_path[] = "/soc/spi@2100000";
+ char dspi2_path[] = "/soc/spi@2110000";
+ u32 mux_sdhc1, mux_sdhc2;
+ u32 io = 0;
+
+ /*
+ * The PMUX IO-expander for mux select is used to control
+ * the muxing of various onboard interfaces.
+ */
+
+ io = in_le32(dcfg_ccsr + DCFG_RCWSR12);
+ mux_sdhc1 = (io >> DCFG_RCWSR12_SDHC_SHIFT) & DCFG_RCWSR12_SDHC_MASK;
+
+ /* Disable esdhc1/dspi1 if not selected. */
+ if (mux_sdhc1 != 0)
+ do_fixup_by_path(blob, esdhc1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ if (mux_sdhc1 != 2)
+ do_fixup_by_path(blob, dspi1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+
+ io = in_le32(dcfg_ccsr + DCFG_RCWSR13);
+ mux_sdhc2 = (io >> DCFG_RCWSR13_SDHC_SHIFT) & DCFG_RCWSR13_SDHC_MASK;
+
+ /* Disable esdhc2/dspi2 if not selected. */
+ if (mux_sdhc2 != 0)
+ do_fixup_by_path(blob, esdhc2_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ if (mux_sdhc2 != 2)
+ do_fixup_by_path(blob, dspi2_path, "status", "disabled",
+ sizeof("disabled"), 1);
+
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ ft_cpu_setup(blob, bd);
+
+ /* fixup DT for the two GPP DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+#endif
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+
+ fdt_fixup_icid(blob);
+
+#ifdef CONFIG_FSL_ENETC
+ fdt_fixup_enetc_mac(blob);
+#endif
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_FSL_QIXIS
+int checkboard(void)
+{
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+#endif
+ u8 sw;
+
+ int clock;
+ char *board;
+ char buf[64] = {0};
+ static const char *freq[6] = {"100.00", "125.00", "156.25",
+ "161.13", "322.26", "100.00 SS"};
+
+ cpu_name(buf);
+ /* find the board details */
+ sw = QIXIS_READ(id);
+
+ switch (sw) {
+ case 0x46:
+ board = "QDS";
+ break;
+ case 0x47:
+ board = "RDB";
+ break;
+ case 0x49:
+ board = "HSSI";
+ break;
+ default:
+ board = "unknown";
+ break;
+ }
+
+ sw = QIXIS_READ(arch);
+ printf("Board: %s-%s, Version: %c, boot from ",
+ buf, board, (sw & 0xf) + 'A' - 1);
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+#ifdef CONFIG_TFABOOT
+ if (src == BOOT_SOURCE_SD_MMC) {
+ puts("SD\n");
+ } else if (src == BOOT_SOURCE_SD_MMC2) {
+ puts("eMMC\n");
+ } else {
+#endif
+#ifdef CONFIG_SD_BOOT
+ puts("SD\n");
+#elif defined(CONFIG_EMMC_BOOT)
+ puts("eMMC\n");
+#else
+ switch (sw) {
+ case 0:
+ case 4:
+ printf("NOR\n");
+ break;
+ case 1:
+ printf("NAND\n");
+ break;
+ default:
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+ break;
+ }
+#endif
+#ifdef CONFIG_TFABOOT
+ }
+#endif
+
+ printf("FPGA: v%d (%s)\n", QIXIS_READ(scver), board);
+ puts("SERDES1 Reference : ");
+
+ sw = QIXIS_READ(brdcfg[2]);
+#ifdef CONFIG_TARGET_LS1028ARDB
+ clock = (sw >> 6) & 3;
+#else
+ clock = (sw >> 4) & 0xf;
+#endif
+
+ printf("Clock1 = %sMHz ", freq[clock]);
+#ifdef CONFIG_TARGET_LS1028ARDB
+ clock = (sw >> 4) & 3;
+#else
+ clock = sw & 0xf;
+#endif
+ printf("Clock2 = %sMHz\n", freq[clock]);
+
+ return 0;
+}
+#endif
+
+void *video_hw_init(void)
+{
+ return NULL;
+}
diff --git a/board/freescale/ls1043aqds/Kconfig b/board/freescale/ls1043aqds/Kconfig
new file mode 100644
index 00000000000..7e27f8f5b13
--- /dev/null
+++ b/board/freescale/ls1043aqds/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS1043AQDS
+
+config SYS_BOARD
+ default "ls1043aqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1043aqds"
+
+endif
diff --git a/board/freescale/ls1043aqds/MAINTAINERS b/board/freescale/ls1043aqds/MAINTAINERS
new file mode 100644
index 00000000000..f7420ecd303
--- /dev/null
+++ b/board/freescale/ls1043aqds/MAINTAINERS
@@ -0,0 +1,14 @@
+LS1043AQDS BOARD
+M: Mingkai Hu <mingkai.hu@nxp.com>
+S: Maintained
+F: board/freescale/ls1043aqds/
+F: include/configs/ls1043aqds.h
+F: configs/ls1043aqds_defconfig
+F: configs/ls1043aqds_nor_ddr3_defconfig
+F: configs/ls1043aqds_nand_defconfig
+F: configs/ls1043aqds_sdcard_ifc_defconfig
+F: configs/ls1043aqds_sdcard_qspi_defconfig
+F: configs/ls1043aqds_qspi_defconfig
+F: configs/ls1043aqds_lpuart_defconfig
+F: configs/ls1043aqds_tfa_defconfig
+F: configs/ls1043aqds_tfa_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1043aqds/Makefile b/board/freescale/ls1043aqds/Makefile
new file mode 100644
index 00000000000..49d8d7d9b96
--- /dev/null
+++ b/board/freescale/ls1043aqds/Makefile
@@ -0,0 +1,11 @@
+#
+# Copyright 2015 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ddr.o
+ifndef CONFIG_SPL_BUILD
+obj-y += eth.o
+endif
+obj-y += ls1043aqds.o
diff --git a/board/freescale/ls1043aqds/README b/board/freescale/ls1043aqds/README
new file mode 100644
index 00000000000..f5aa51da87e
--- /dev/null
+++ b/board/freescale/ls1043aqds/README
@@ -0,0 +1,64 @@
+Overview
+--------
+The LS1043A Development System (QDS) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS1043A
+LayerScape Architecture processor. The LS1043AQDS provides SW development
+platform for the Freescale LS1043A processor series, with a complete
+debugging environment.
+
+LS1043A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS1043A
+SoC overview.
+
+ LS1043AQDS board Overview
+ -----------------------
+ - SERDES Connections, 4 lanes supporting:
+ - PCI Express - 3.0
+ - SGMII, SGMII 2.5
+ - QSGMII
+ - SATA 3.0
+ - 10GBase-R
+ - DDR Controller
+ - 2GB 40bits (8-bits ECC) DDR4 SDRAM. Support rates of up to 1600MT/s
+ -IFC/Local Bus
+ - One in-socket 128 MB NOR flash 16-bit data bus
+ - One 512 MB NAND flash with ECC support
+ - PromJet Port
+ - FPGA connection
+ - USB 3.0
+ - Three high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - The other two USB 3.0 ports configured as OTG with micro-AB connector
+ - SDHC port connects directly to an adapter card slot, featuring:
+ - Optional clock feedback paths, and optional high-speed voltage translation assistance
+ - SD slots for SD, SDHC (1x, 4x, 8x), and/or MMC
+ - eMMC memory devices
+ - DSPI: Onboard support for three SPI flash memory devices
+ - 4 I2C controllers
+ - One SATA onboard connectors
+ - UART
+ - Two 4-pin serial ports at up to 115.2 Kbit/s
+ - Two DB9 D-Type connectors supporting one Serial port each
+ - ARM JTAG support
+
+Memory map from core's view
+----------------------------
+Start Address End Address Description Size
+0x00_0000_0000 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 0x00_20FF_FFFF DCSR 16MB
+0x00_6000_0000 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_7E80_0000 0x00_7E80_FFFF IFC - NAND Flash 64KB
+0x00_7FB0_0000 0x00_7FB0_0FFF IFC - FPGA 4KB
+0x00_8000_0000 0x00_FFFF_FFFF DRAM1 2GB
+
+Booting Options
+---------------
+a) Promjet Boot
+b) NOR boot
+c) NAND boot
+d) SD boot
+e) QSPI boot
diff --git a/board/freescale/ls1043aqds/ddr.c b/board/freescale/ls1043aqds/ddr.c
new file mode 100644
index 00000000000..2a9717df616
--- /dev/null
+++ b/board/freescale/ls1043aqds/ddr.c
@@ -0,0 +1,145 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#ifdef CONFIG_FSL_DEEP_SLEEP
+#include <fsl_sleep.h>
+#endif
+#include <log.h>
+#include <asm/arch/clock.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 3) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ popts->cpo_override = pbsp->cpo_override;
+ popts->write_data_delay =
+ pbsp->write_data_delay;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+
+ /* force DDR bus width to 32 bits */
+ popts->data_bus_width = 1;
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+ popts->bstopre = 0; /* enable auto precharge */
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 1;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+#ifdef CONFIG_SYS_FSL_DDR4
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm) |
+ DDR_CDR2_VREF_OVRD(70); /* Vref = 70% */
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x59;
+#else
+ popts->cswl_override = DDR_CSWL_CS0;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+#endif
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+#else
+ puts("Initializing DDR....using SPD\n");
+
+ dram_size = fsl_ddr_sdram();
+#endif
+ erratum_a008850_post();
+
+#ifdef CONFIG_FSL_DEEP_SLEEP
+ fsl_dp_ddr_restore();
+#endif
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1043aqds/ddr.h b/board/freescale/ls1043aqds/ddr.h
new file mode 100644
index 00000000000..65b0250d370
--- /dev/null
+++ b/board/freescale/ls1043aqds/ddr.h
@@ -0,0 +1,61 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+
+extern void erratum_a008850_post(void);
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+ u32 cpo_override;
+ u32 write_data_delay;
+ u32 force_2t;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl | cpo |wrdata|2T
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 | |delay |
+ */
+#ifdef CONFIG_SYS_FSL_DDR4
+ {2, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A,},
+ {2, 1900, 0, 8, 6, 0x08080A0C, 0x0D0E0F0A,},
+ {1, 1666, 0, 8, 6, 0x0708090B, 0x0C0D0E0A,},
+ {1, 1900, 0, 8, 9, 0x0A0B0C0B, 0x0D0E0F0D,},
+ {1, 2200, 0, 8, 10, 0x0B0C0D0C, 0x0E0F110E,},
+#elif defined(CONFIG_SYS_FSL_DDR3)
+ {1, 833, 1, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {1, 1350, 1, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {1, 833, 2, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {1, 1350, 2, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 833, 4, 12, 8, 0x06060607, 0x08080807, 0x1f, 2, 0},
+ {2, 1350, 4, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 1350, 0, 12, 8, 0x0708080A, 0x0A0B0C09, 0x1f, 2, 0},
+ {2, 1666, 4, 8, 0xa, 0x0B08090C, 0x0B0E0D0A, 0x1f, 2, 0},
+ {2, 1666, 0, 8, 0xa, 0x0B08090C, 0x0B0E0D0A, 0x1f, 2, 0},
+#else
+#error DDR type not defined
+#endif
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+#endif
diff --git a/board/freescale/ls1043aqds/eth.c b/board/freescale/ls1043aqds/eth.c
new file mode 100644
index 00000000000..5a8ca27b327
--- /dev/null
+++ b/board/freescale/ls1043aqds/eth.c
@@ -0,0 +1,501 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2019 NXP
+ */
+
+#include <config.h>
+#include <log.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fdt_support.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <fsl_dtsec.h>
+#include <linux/libfdt.h>
+#include <malloc.h>
+#include <asm/arch/fsl_serdes.h>
+
+#include "../common/qixis.h"
+#include "../common/fman.h"
+#include "ls1043aqds_qixis.h"
+
+#define EMI_NONE 0xFF
+#define EMI1_RGMII1 0
+#define EMI1_RGMII2 1
+#define EMI1_SLOT1 2
+#define EMI1_SLOT2 3
+#define EMI1_SLOT3 4
+#define EMI1_SLOT4 5
+#define EMI2 6
+
+static const char * const mdio_names[] = {
+ "LS1043AQDS_MDIO_RGMII1",
+ "LS1043AQDS_MDIO_RGMII2",
+ "LS1043AQDS_MDIO_SLOT1",
+ "LS1043AQDS_MDIO_SLOT2",
+ "LS1043AQDS_MDIO_SLOT3",
+ "LS1043AQDS_MDIO_SLOT4",
+ "NULL",
+};
+
+/* Map SerDes1 4 lanes to default slot, will be initialized dynamically */
+#ifdef CONFIG_FMAN_ENET
+static int mdio_mux[NUM_FM_PORTS];
+
+static u8 lane_to_slot[] = {1, 2, 3, 4};
+#endif
+
+static const char *ls1043aqds_mdio_name_for_muxval(u8 muxval)
+{
+ return mdio_names[muxval];
+}
+
+struct mii_dev *mii_dev_for_muxval(u8 muxval)
+{
+ struct mii_dev *bus;
+ const char *name;
+
+ if (muxval > EMI2)
+ return NULL;
+
+ name = ls1043aqds_mdio_name_for_muxval(muxval);
+
+ if (!name) {
+ printf("No bus for muxval %x\n", muxval);
+ return NULL;
+ }
+
+ bus = miiphy_get_dev_by_name(name);
+
+ if (!bus) {
+ printf("No bus by name %s\n", name);
+ return NULL;
+ }
+
+ return bus;
+}
+
+#ifdef CONFIG_FMAN_ENET
+struct ls1043aqds_mdio {
+ u8 muxval;
+ struct mii_dev *realbus;
+};
+
+static void ls1043aqds_mux_mdio(u8 muxval)
+{
+ u8 brdcfg4;
+
+ if (muxval < 7) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_EMISEL_MASK;
+ brdcfg4 |= (muxval << BRDCFG4_EMISEL_SHIFT);
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+ }
+}
+
+static int ls1043aqds_mdio_read(struct mii_dev *bus, int addr, int devad,
+ int regnum)
+{
+ struct ls1043aqds_mdio *priv = bus->priv;
+
+ ls1043aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->read(priv->realbus, addr, devad, regnum);
+}
+
+static int ls1043aqds_mdio_write(struct mii_dev *bus, int addr, int devad,
+ int regnum, u16 value)
+{
+ struct ls1043aqds_mdio *priv = bus->priv;
+
+ ls1043aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->write(priv->realbus, addr, devad,
+ regnum, value);
+}
+
+static int ls1043aqds_mdio_reset(struct mii_dev *bus)
+{
+ struct ls1043aqds_mdio *priv = bus->priv;
+
+ return priv->realbus->reset(priv->realbus);
+}
+
+static int ls1043aqds_mdio_init(char *realbusname, u8 muxval)
+{
+ struct ls1043aqds_mdio *pmdio;
+ struct mii_dev *bus = mdio_alloc();
+
+ if (!bus) {
+ printf("Failed to allocate ls1043aqds MDIO bus\n");
+ return -1;
+ }
+
+ pmdio = malloc(sizeof(*pmdio));
+ if (!pmdio) {
+ printf("Failed to allocate ls1043aqds private data\n");
+ free(bus);
+ return -1;
+ }
+
+ bus->read = ls1043aqds_mdio_read;
+ bus->write = ls1043aqds_mdio_write;
+ bus->reset = ls1043aqds_mdio_reset;
+ strcpy(bus->name, ls1043aqds_mdio_name_for_muxval(muxval));
+
+ pmdio->realbus = miiphy_get_dev_by_name(realbusname);
+
+ if (!pmdio->realbus) {
+ printf("No bus with name %s\n", realbusname);
+ free(bus);
+ free(pmdio);
+ return -1;
+ }
+
+ pmdio->muxval = muxval;
+ bus->priv = pmdio;
+ return mdio_register(bus);
+}
+
+void board_ft_fman_fixup_port(void *fdt, char *compat, phys_addr_t addr,
+ enum fm_port port, int offset)
+{
+ struct fixed_link f_link;
+
+ if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_SGMII) {
+ if (port == FM1_DTSEC9) {
+ fdt_set_phy_handle(fdt, compat, addr,
+ "sgmii-riser-s1-p1");
+ } else if (port == FM1_DTSEC2) {
+ fdt_set_phy_handle(fdt, compat, addr,
+ "sgmii-riser-s2-p1");
+ } else if (port == FM1_DTSEC5) {
+ fdt_set_phy_handle(fdt, compat, addr,
+ "sgmii-riser-s3-p1");
+ } else if (port == FM1_DTSEC6) {
+ fdt_set_phy_handle(fdt, compat, addr,
+ "sgmii-riser-s4-p1");
+ }
+ } else if (fm_info_get_enet_if(port) ==
+ PHY_INTERFACE_MODE_2500BASEX) {
+ /* 2.5G SGMII interface */
+ f_link.phy_id = cpu_to_fdt32(port);
+ f_link.duplex = cpu_to_fdt32(1);
+ f_link.link_speed = cpu_to_fdt32(1000);
+ f_link.pause = 0;
+ f_link.asym_pause = 0;
+ /* no PHY for 2.5G SGMII */
+ fdt_delprop(fdt, offset, "phy-handle");
+ fdt_setprop(fdt, offset, "fixed-link", &f_link, sizeof(f_link));
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "2500base-x");
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_QSGMII) {
+ switch (mdio_mux[port]) {
+ case EMI1_SLOT1:
+ switch (port) {
+ case FM1_DTSEC1:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s1-p1");
+ break;
+ case FM1_DTSEC2:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s1-p2");
+ break;
+ case FM1_DTSEC5:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s1-p3");
+ break;
+ case FM1_DTSEC6:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s1-p4");
+ break;
+ default:
+ break;
+ }
+ break;
+ case EMI1_SLOT2:
+ switch (port) {
+ case FM1_DTSEC1:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s2-p1");
+ break;
+ case FM1_DTSEC2:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s2-p2");
+ break;
+ case FM1_DTSEC5:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s2-p3");
+ break;
+ case FM1_DTSEC6:
+ fdt_set_phy_handle(fdt, compat, addr,
+ "qsgmii-s2-p4");
+ break;
+ default:
+ break;
+ }
+ break;
+ default:
+ break;
+ }
+ fdt_delprop(fdt, offset, "phy-connection-type");
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "qsgmii");
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_XGMII &&
+ port == FM1_10GEC1) {
+ /* 10GBase-R interface */
+ f_link.phy_id = cpu_to_fdt32(port);
+ f_link.duplex = cpu_to_fdt32(1);
+ f_link.link_speed = cpu_to_fdt32(10000);
+ f_link.pause = 0;
+ f_link.asym_pause = 0;
+ /* no PHY for 10GBase-R */
+ fdt_delprop(fdt, offset, "phy-handle");
+ fdt_setprop(fdt, offset, "fixed-link", &f_link, sizeof(f_link));
+ fdt_setprop_string(fdt, offset, "phy-connection-type", "xgmii");
+ }
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ int i;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ for (i = FM1_DTSEC1; i < NUM_FM_PORTS; i++) {
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_SGMII:
+ case PHY_INTERFACE_MODE_QSGMII:
+ switch (mdio_mux[i]) {
+ case EMI1_SLOT1:
+ fdt_status_okay_by_alias(fdt, "emi1-slot1");
+ break;
+ case EMI1_SLOT2:
+ fdt_status_okay_by_alias(fdt, "emi1-slot2");
+ break;
+ case EMI1_SLOT3:
+ fdt_status_okay_by_alias(fdt, "emi1-slot3");
+ break;
+ case EMI1_SLOT4:
+ fdt_status_okay_by_alias(fdt, "emi1-slot4");
+ break;
+ default:
+ break;
+ }
+ break;
+ case PHY_INTERFACE_MODE_XGMII:
+ break;
+ default:
+ break;
+ }
+ }
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ int i, idx, lane, slot, interface;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ /* Initialize the mdio_mux array so we can recognize empty elements */
+ for (i = 0; i < NUM_FM_PORTS; i++)
+ mdio_mux[i] = EMI_NONE;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ /* Register the muxing front-ends to the MDIO buses */
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII1);
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII2);
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT1);
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT2);
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT3);
+ ls1043aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT4);
+ ls1043aqds_mdio_init(DEFAULT_FM_TGEC_MDIO_NAME, EMI2);
+
+ /* Set the two on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY1_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY2_ADDR);
+
+ switch (srds_s1) {
+ case 0x2555:
+ /* 2.5G SGMII on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, 9);
+ break;
+ case 0x4555:
+ case 0x4558:
+ /* QSGMII on lane A, MAC 1/2/5/6 */
+ fm_info_set_phy_address(FM1_DTSEC1,
+ QSGMII_CARD_PORT1_PHY_ADDR_S1);
+ fm_info_set_phy_address(FM1_DTSEC2,
+ QSGMII_CARD_PORT2_PHY_ADDR_S1);
+ fm_info_set_phy_address(FM1_DTSEC5,
+ QSGMII_CARD_PORT3_PHY_ADDR_S1);
+ fm_info_set_phy_address(FM1_DTSEC6,
+ QSGMII_CARD_PORT4_PHY_ADDR_S1);
+ break;
+ case 0x1355:
+ /* SGMII on lane B, MAC 2*/
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT1_PHY_ADDR);
+ break;
+ case 0x2355:
+ /* 2.5G SGMII on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, 9);
+ /* SGMII on lane B, MAC 2*/
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT1_PHY_ADDR);
+ break;
+ case 0x3335:
+ /* SGMII on lane C, MAC 5 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT1_PHY_ADDR);
+ case 0x3355:
+ case 0x3358:
+ /* SGMII on lane B, MAC 2 */
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT1_PHY_ADDR);
+ case 0x3555:
+ case 0x3558:
+ /* SGMII on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ break;
+ case 0x1455:
+ /* QSGMII on lane B, MAC 1/2/5/6 */
+ fm_info_set_phy_address(FM1_DTSEC1,
+ QSGMII_CARD_PORT1_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC2,
+ QSGMII_CARD_PORT2_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC5,
+ QSGMII_CARD_PORT3_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC6,
+ QSGMII_CARD_PORT4_PHY_ADDR_S2);
+ break;
+ case 0x2455:
+ /* 2.5G SGMII on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, 9);
+ /* QSGMII on lane B, MAC 1/2/5/6 */
+ fm_info_set_phy_address(FM1_DTSEC1,
+ QSGMII_CARD_PORT1_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC2,
+ QSGMII_CARD_PORT2_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC5,
+ QSGMII_CARD_PORT3_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC6,
+ QSGMII_CARD_PORT4_PHY_ADDR_S2);
+ break;
+ case 0x2255:
+ /* 2.5G SGMII on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, 9);
+ /* 2.5G SGMII on lane B, MAC 2 */
+ fm_info_set_phy_address(FM1_DTSEC2, 2);
+ break;
+ case 0x3333:
+ /* SGMII on lane A/B/C/D, MAC 9/2/5/6 */
+ fm_info_set_phy_address(FM1_DTSEC9,
+ SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2,
+ SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC5,
+ SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6,
+ SGMII_CARD_PORT1_PHY_ADDR);
+ break;
+ default:
+ printf("Invalid SerDes protocol 0x%x for LS1043AQDS\n",
+ srds_s1);
+ break;
+ }
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ idx = i - FM1_DTSEC1;
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_SGMII:
+ case PHY_INTERFACE_MODE_2500BASEX:
+ case PHY_INTERFACE_MODE_QSGMII:
+ if (interface == PHY_INTERFACE_MODE_SGMII) {
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ SGMII_FM1_DTSEC1 + idx);
+ } else if (interface == PHY_INTERFACE_MODE_2500BASEX) {
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ SGMII_2500_FM1_DTSEC1 + idx);
+ } else {
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ QSGMII_FM1_A);
+ }
+
+ if (lane < 0)
+ break;
+
+ slot = lane_to_slot[lane];
+ debug("FM1@DTSEC%u expects SGMII in slot %u\n",
+ idx + 1, slot);
+ if (QIXIS_READ(present2) & (1 << (slot - 1)))
+ fm_disable_port(i);
+
+ switch (slot) {
+ case 1:
+ mdio_mux[i] = EMI1_SLOT1;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 2:
+ mdio_mux[i] = EMI1_SLOT2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 3:
+ mdio_mux[i] = EMI1_SLOT3;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 4:
+ mdio_mux[i] = EMI1_SLOT4;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ default:
+ break;
+ }
+ break;
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ if (i == FM1_DTSEC3)
+ mdio_mux[i] = EMI1_RGMII1;
+ else if (i == FM1_DTSEC4)
+ mdio_mux[i] = EMI1_RGMII2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(mdio_mux[i]));
+ break;
+ default:
+ break;
+ }
+ }
+
+ cpu_eth_init(bis);
+
+ return pci_eth_init(bis);
+}
+#endif /* CONFIG_FMAN_ENET */
diff --git a/board/freescale/ls1043aqds/ls1043aqds.c b/board/freescale/ls1043aqds/ls1043aqds.c
new file mode 100644
index 00000000000..fdf011efc5b
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds.c
@@ -0,0 +1,596 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2019-2020 NXP
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <i2c.h>
+#include <fdt_support.h>
+#include <fsl_ddr_sdram.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/fdt.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/cpu.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <ahci.h>
+#include <hwconfig.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_esdhc.h>
+#include <fsl_ifc.h>
+#include <spl.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/qixis.h"
+#include "ls1043aqds_qixis.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+enum {
+ MUX_TYPE_GPIO,
+};
+
+/* LS1043AQDS serdes mux */
+#define CFG_SD_MUX1_SLOT2 0x0 /* SLOT2 TX/RX0 */
+#define CFG_SD_MUX1_SLOT1 0x1 /* SLOT1 TX/RX1 */
+#define CFG_SD_MUX2_SLOT3 0x0 /* SLOT3 TX/RX0 */
+#define CFG_SD_MUX2_SLOT1 0x1 /* SLOT1 TX/RX2 */
+#define CFG_SD_MUX3_SLOT4 0x0 /* SLOT4 TX/RX0 */
+#define CFG_SD_MUX3_MUX4 0x1 /* MUX4 */
+#define CFG_SD_MUX4_SLOT3 0x0 /* SLOT3 TX/RX1 */
+#define CFG_SD_MUX4_SLOT1 0x1 /* SLOT1 TX/RX3 */
+#define CFG_UART_MUX_MASK 0x6
+#define CFG_UART_MUX_SHIFT 1
+#define CFG_LPUART_EN 0x1
+
+#ifdef CONFIG_TFABOOT
+struct ifc_regs ifc_cfg_nor_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nor0",
+ CFG_SYS_NOR0_CSPR,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+
+ },
+ {
+ "nor1",
+ CFG_SYS_NOR1_CSPR,
+ CFG_SYS_NOR1_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ CFG_SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ CFG_SYS_FPGA_FTIM0,
+ CFG_SYS_FPGA_FTIM1,
+ CFG_SYS_FPGA_FTIM2,
+ CFG_SYS_FPGA_FTIM3
+ },
+ }
+};
+
+struct ifc_regs ifc_cfg_nand_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "nor0",
+ CFG_SYS_NOR0_CSPR,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "nor1",
+ CFG_SYS_NOR1_CSPR,
+ CFG_SYS_NOR1_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ CFG_SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ CFG_SYS_FPGA_FTIM0,
+ CFG_SYS_FPGA_FTIM1,
+ CFG_SYS_FPGA_FTIM2,
+ CFG_SYS_FPGA_FTIM3
+ },
+ }
+};
+
+void ifc_cfg_boot_info(struct ifc_regs_info *regs_info)
+{
+ enum boot_src src = get_boot_src();
+
+ if (src == BOOT_SOURCE_IFC_NAND)
+ regs_info->regs = ifc_cfg_nand_boot;
+ else
+ regs_info->regs = ifc_cfg_nor_boot;
+ regs_info->cs_size = CONFIG_SYS_FSL_IFC_BANK_COUNT;
+}
+#endif
+
+int checkboard(void)
+{
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+#endif
+ char buf[64];
+#ifndef CONFIG_SD_BOOT
+ u8 sw;
+#endif
+
+ puts("Board: LS1043AQDS, boot from ");
+
+#ifdef CONFIG_TFABOOT
+ if (src == BOOT_SOURCE_SD_MMC)
+ puts("SD\n");
+ else {
+#endif
+
+#ifdef CONFIG_SD_BOOT
+ puts("SD\n");
+#else
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank: %d\n", sw);
+ else if (sw == 0x8)
+ puts("PromJet\n");
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else if (sw == 0xF)
+ printf("QSPI\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+#endif
+
+#ifdef CONFIG_TFABOOT
+ }
+#endif
+ printf("Sys ID: 0x%02x, Sys Ver: 0x%02x\n",
+ QIXIS_READ(id), QIXIS_READ(arch));
+
+ printf("FPGA: v%d (%s), build %d\n",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+
+ return 0;
+}
+
+bool if_board_diff_clk(void)
+{
+ u8 diff_conf = QIXIS_READ(brdcfg[11]);
+
+ return diff_conf & 0x40;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0f) {
+ case QIXIS_SYSCLK_64:
+ return 64000000;
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ if (if_board_diff_clk())
+ return get_board_sys_clk();
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+
+ return 66666666;
+}
+
+int dram_init(void)
+{
+ /*
+ * When resuming from deep sleep, the I2C channel may not be
+ * in the default channel. So, switch to the default channel
+ * before accessing DDR SPD.
+ *
+ * PCA9547 mount on I2C1 bus
+ */
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ fsl_initdram();
+#if (!defined(CONFIG_SPL) && !defined(CONFIG_TFABOOT)) || \
+ defined(CONFIG_SPL_BUILD)
+ /* This will break-before-make MMU for DDR */
+ update_early_mmu_table();
+#endif
+
+ return 0;
+}
+
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+void board_retimer_init(void)
+{
+ u8 reg;
+ int bus_num = 0;
+
+ /* Retimer is connected to I2C1_CH7_CH5 */
+ select_i2c_ch_pca9547(I2C_MUX_CH7, bus_num);
+ reg = I2C_MUX_CH5;
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_MUX_PCA_ADDR_SEC,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return;
+ }
+ dm_i2c_write(dev, 0, &reg, 1);
+
+ /* Access to Control/Shared register */
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_RETIMER_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return;
+ }
+
+ reg = 0x0;
+ dm_i2c_write(dev, 0xff, &reg, 1);
+
+ /* Read device revision and ID */
+ dm_i2c_read(dev, 1, &reg, 1);
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+ dm_i2c_write(dev, 0xff, &reg, 1);
+
+ /* Reset Channel Registers */
+ dm_i2c_read(dev, 0, &reg, 1);
+ reg |= 0x4;
+ dm_i2c_write(dev, 0, &reg, 1);
+
+ /* Enable override divider select and Enable Override Output Mux */
+ dm_i2c_read(dev, 9, &reg, 1);
+ reg |= 0x24;
+ dm_i2c_write(dev, 9, &reg, 1);
+
+ /* Select VCO Divider to full rate (000) */
+ dm_i2c_read(dev, 0x18, &reg, 1);
+ reg &= 0x8f;
+ dm_i2c_write(dev, 0x18, &reg, 1);
+
+ /* Selects active PFD MUX Input as Re-timed Data (001) */
+ dm_i2c_read(dev, 0x1e, &reg, 1);
+ reg &= 0x3f;
+ reg |= 0x20;
+ dm_i2c_write(dev, 0x1e, &reg, 1);
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x0;
+ dm_i2c_write(dev, 0x60, &reg, 1);
+ reg = 0xb2;
+ dm_i2c_write(dev, 0x61, &reg, 1);
+ reg = 0x90;
+ dm_i2c_write(dev, 0x62, &reg, 1);
+ reg = 0xb3;
+ dm_i2c_write(dev, 0x63, &reg, 1);
+ reg = 0xcd;
+ dm_i2c_write(dev, 0x64, &reg, 1);
+#else
+ i2c_write(I2C_MUX_PCA_ADDR_SEC, 0, 1, &reg, 1);
+
+ /* Access to Control/Shared register */
+ reg = 0x0;
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, &reg, 1);
+
+ /* Read device revision and ID */
+ i2c_read(I2C_RETIMER_ADDR, 1, 1, &reg, 1);
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, &reg, 1);
+
+ /* Reset Channel Registers */
+ i2c_read(I2C_RETIMER_ADDR, 0, 1, &reg, 1);
+ reg |= 0x4;
+ i2c_write(I2C_RETIMER_ADDR, 0, 1, &reg, 1);
+
+ /* Enable override divider select and Enable Override Output Mux */
+ i2c_read(I2C_RETIMER_ADDR, 9, 1, &reg, 1);
+ reg |= 0x24;
+ i2c_write(I2C_RETIMER_ADDR, 9, 1, &reg, 1);
+
+ /* Select VCO Divider to full rate (000) */
+ i2c_read(I2C_RETIMER_ADDR, 0x18, 1, &reg, 1);
+ reg &= 0x8f;
+ i2c_write(I2C_RETIMER_ADDR, 0x18, 1, &reg, 1);
+
+ /* Selects active PFD MUX Input as Re-timed Data (001) */
+ i2c_read(I2C_RETIMER_ADDR, 0x1e, 1, &reg, 1);
+ reg &= 0x3f;
+ reg |= 0x20;
+ i2c_write(I2C_RETIMER_ADDR, 0x1e, 1, &reg, 1);
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x0;
+ i2c_write(I2C_RETIMER_ADDR, 0x60, 1, &reg, 1);
+ reg = 0xb2;
+ i2c_write(I2C_RETIMER_ADDR, 0x61, 1, &reg, 1);
+ reg = 0x90;
+ i2c_write(I2C_RETIMER_ADDR, 0x62, 1, &reg, 1);
+ reg = 0xb3;
+ i2c_write(I2C_RETIMER_ADDR, 0x63, 1, &reg, 1);
+ reg = 0xcd;
+ i2c_write(I2C_RETIMER_ADDR, 0x64, 1, &reg, 1);
+#endif
+
+ /* Return the default channel */
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, bus_num);
+}
+
+int board_early_init_f(void)
+{
+ u32 __iomem *cntcr = (u32 *)CFG_SYS_FSL_TIMER_ADDR;
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+ u32 usb_pwrfault;
+#endif
+#ifdef CONFIG_LPUART
+ u8 uart;
+#endif
+
+ /*
+ * Enable secure system counter for timer
+ */
+ out_le32(cntcr, 0x1);
+
+#if defined(CONFIG_SYS_I2C_EARLY_INIT)
+ i2c_early_init_f();
+#endif
+ fsl_lsch2_early_init_f();
+
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ out_be32(&scfg->rcwpmuxcr0, 0x3333);
+ out_be32(&scfg->usbdrvvbus_selcr, SCFG_USBDRVVBUS_SELCR_USB1);
+ usb_pwrfault =
+ (SCFG_USBPWRFAULT_DEDICATED << SCFG_USBPWRFAULT_USB3_SHIFT) |
+ (SCFG_USBPWRFAULT_DEDICATED << SCFG_USBPWRFAULT_USB2_SHIFT) |
+ (SCFG_USBPWRFAULT_SHARED << SCFG_USBPWRFAULT_USB1_SHIFT);
+ out_be32(&scfg->usbpwrfault_selcr, usb_pwrfault);
+#endif
+
+#ifdef CONFIG_LPUART
+ /* We use lpuart0 as system console */
+ uart = QIXIS_READ(brdcfg[14]);
+ uart &= ~CFG_UART_MUX_MASK;
+ uart |= CFG_LPUART_EN << CFG_UART_MUX_SHIFT;
+ QIXIS_WRITE(brdcfg[14], uart);
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_FSL_DEEP_SLEEP
+/* determine if it is a warm boot */
+bool is_warm_boot(void)
+{
+#define DCFG_CCSR_CRSTSR_WDRFR (1 << 3)
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+
+ if (in_be32(&gur->crstsr) & DCFG_CCSR_CRSTSR_WDRFR)
+ return 1;
+
+ return 0;
+}
+#endif
+
+int config_board_mux(int ctrl_type)
+{
+ u8 reg14;
+
+ reg14 = QIXIS_READ(brdcfg[14]);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_GPIO:
+ reg14 = (reg14 & (~0x30)) | 0x20;
+ break;
+ default:
+ puts("Unsupported mux interface type\n");
+ return -1;
+ }
+
+ QIXIS_WRITE(brdcfg[14], reg14);
+
+ return 0;
+}
+
+int config_serdes_mux(void)
+{
+ return 0;
+}
+
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ if (hwconfig("gpio"))
+ config_board_mux(MUX_TYPE_GPIO);
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ board_retimer_init();
+
+#ifdef CFG_SYS_FSL_SERDES
+ config_serdes_mux();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+ u8 reg;
+
+ /* fixup DT for the two DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_FMAN_ENET
+ fdt_fixup_board_enet(blob);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ reg = QIXIS_READ(brdcfg[0]);
+ reg = (reg & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ /* Disable IFC if QSPI is enabled */
+ if (reg == 0xF)
+ do_fixup_by_compat(blob, "fsl,ifc",
+ "status", "disabled", 8 + 1, 1);
+
+ return 0;
+}
+#endif
+
+u8 flash_read8(void *addr)
+{
+ return __raw_readb(addr + 1);
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
+
+#if defined(CONFIG_TFABOOT) && defined(CONFIG_ENV_IS_IN_SPI_FLASH)
+void *env_sf_get_env_addr(void)
+{
+ return (void *)(CFG_SYS_FSL_QSPI_BASE + CONFIG_ENV_OFFSET);
+}
+#endif
diff --git a/board/freescale/ls1043aqds/ls1043aqds_pbi.cfg b/board/freescale/ls1043aqds/ls1043aqds_pbi.cfg
new file mode 100644
index 00000000000..f072274f474
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds_pbi.cfg
@@ -0,0 +1,14 @@
+#Configure Scratch register
+09570600 00000000
+09570604 10000000
+#Alt base register
+09570158 00001000
+#Disable CCI barrier tranaction
+09570178 0000e010
+09180000 00000008
+#USB PHY frequency sel
+09570418 0000009e
+0957041c 0000009e
+09570420 0000009e
+#flush PBI data
+096100c0 000fffff
diff --git a/board/freescale/ls1043aqds/ls1043aqds_qixis.h b/board/freescale/ls1043aqds/ls1043aqds_qixis.h
new file mode 100644
index 00000000000..bba494ae413
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds_qixis.h
@@ -0,0 +1,38 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS1043AQDS_QIXIS_H__
+#define __LS1043AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1043AQDS */
+
+/* BRDCFG4[4:7] select EC1 and EC2 as a pair */
+#define BRDCFG4_EMISEL_MASK 0xe0
+#define BRDCFG4_EMISEL_SHIFT 5
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+#define QIXIS_SYSCLK_64 0x8
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+/* BRDCFG2 - SD clock*/
+#define QIXIS_SDCLK1_100 0x0
+#define QIXIS_SDCLK1_125 0x1
+#define QIXIS_SDCLK1_165 0x2
+#define QIXIS_SDCLK1_100_SP 0x3
+
+#endif
diff --git a/board/freescale/ls1043aqds/ls1043aqds_rcw_nand.cfg b/board/freescale/ls1043aqds/ls1043aqds_rcw_nand.cfg
new file mode 100644
index 00000000000..d87058b7efe
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds_rcw_nand.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# serdes protocol
+08100010 0a000000 00000000 00000000
+14550002 80004012 e0106000 c1002000
+00000000 00000000 00000000 00038800
+00000000 00001100 00000096 00000001
diff --git a/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_ifc.cfg b/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_ifc.cfg
new file mode 100644
index 00000000000..b6b5e0b1018
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_ifc.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+# Enable IFC; disable QSPI
+08100010 0a000000 00000000 00000000
+14550002 80004012 60040000 c1002000
+00000000 00000000 00000000 00038800
+00000000 00001100 00000096 00000001
diff --git a/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_qspi.cfg b/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_qspi.cfg
new file mode 100644
index 00000000000..7783521b95b
--- /dev/null
+++ b/board/freescale/ls1043aqds/ls1043aqds_rcw_sd_qspi.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+# Enable QSPI; disable IFC
+08100010 0a000000 00000000 00000000
+14550002 80004012 60040000 c1002000
+00000000 00000000 00000000 00038800
+20124000 00001100 00000096 00000001
diff --git a/board/freescale/ls1043ardb/Kconfig b/board/freescale/ls1043ardb/Kconfig
new file mode 100644
index 00000000000..51818ec5801
--- /dev/null
+++ b/board/freescale/ls1043ardb/Kconfig
@@ -0,0 +1,16 @@
+
+if TARGET_LS1043ARDB
+
+config SYS_BOARD
+ default "ls1043ardb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1043ardb"
+
+endif
diff --git a/board/freescale/ls1043ardb/MAINTAINERS b/board/freescale/ls1043ardb/MAINTAINERS
new file mode 100644
index 00000000000..06b23889f6d
--- /dev/null
+++ b/board/freescale/ls1043ardb/MAINTAINERS
@@ -0,0 +1,13 @@
+LS1043A BOARD
+M: Mingkai Hu <mingkai.hu@nxp.com>
+S: Maintained
+F: board/freescale/ls1043ardb/
+F: include/configs/ls1043ardb.h
+F: configs/ls1043ardb_defconfig
+F: configs/ls1043ardb_nand_defconfig
+F: configs/ls1043ardb_sdcard_defconfig
+F: configs/ls1043ardb_tfa_defconfig
+F: configs/ls1043ardb_tfa_SECURE_BOOT_defconfig
+F: configs/ls1043ardb_SECURE_BOOT_defconfig
+F: configs/ls1043ardb_sdcard_SECURE_BOOT_defconfig
+F: configs/ls1043ardb_nand_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1043ardb/Makefile b/board/freescale/ls1043ardb/Makefile
new file mode 100644
index 00000000000..5309576c688
--- /dev/null
+++ b/board/freescale/ls1043ardb/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2015 Freescale Semiconductor
+
+obj-y += ddr.o
+obj-y += ls1043ardb.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_NET) += eth.o
+obj-y += cpld.o
+endif
diff --git a/board/freescale/ls1043ardb/README b/board/freescale/ls1043ardb/README
new file mode 100644
index 00000000000..66ee578e99d
--- /dev/null
+++ b/board/freescale/ls1043ardb/README
@@ -0,0 +1,54 @@
+Overview
+--------
+The LS1043A Reference Design Board (RDB) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS1043A
+LayerScape Architecture processor. The LS1043ARDB provides SW development
+platform for the Freescale LS1043A processor series, with a complete
+debugging environment. The LS1043A RDB is lead-free and RoHS-compliant.
+
+LS1043A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS1043A
+SoC overview.
+
+ LS1043ARDB board Overview
+ -----------------------
+ - SERDES Connections, 4 lanes supporting:
+ - PCI Express 2.0 with two PCIe connectors supporting: miniPCIe card and
+ standard PCIe card
+ - QSGMII with x4 RJ45 connector
+ - 10GBase-R with x1 RJ45 connector
+ - DDR Controller
+ - 2GB 32bits DDR4 SDRAM. Support rates of up to 1600MT/s
+ -IFC/Local Bus
+ - One 128MB NOR flash 16-bit data bus
+ - One 512 MB NAND flash with ECC support
+ - CPLD connection
+ - USB 3.0
+ - Two super speed USB 3.0 Type A ports
+ - SDHC: connects directly to a full SD/MMC slot
+ - DSPI: 16 MB high-speed flash Memory for boot code and storage (up to 108MHz)
+ - 4 I2C controllers
+ - UART
+ - Two 4-pin serial ports at up to 115.2 Kbit/s
+ - Two DB9 D-Type connectors supporting one Serial port each
+ - ARM JTAG support
+
+Memory map from core's view
+----------------------------
+Start Address End Address Description Size
+0x00_0000_0000 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 0x00_20FF_FFFF DCSR 16MB
+0x00_6000_0000 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_7E80_0000 0x00_7E80_FFFF IFC - NAND Flash 64KB
+0x00_7FB0_0000 0x00_7FB0_0FFF IFC - FPGA 4KB
+0x00_8000_0000 0x00_FFFF_FFFF DRAM1 2GB
+
+Booting Options
+---------------
+a) NOR boot
+b) NAND boot
+c) SD boot
diff --git a/board/freescale/ls1043ardb/cpld.c b/board/freescale/ls1043ardb/cpld.c
new file mode 100644
index 00000000000..bda2f3ac3a6
--- /dev/null
+++ b/board/freescale/ls1043ardb/cpld.c
@@ -0,0 +1,177 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor
+ *
+ * Freescale LS1043ARDB board-specific CPLD controlling supports.
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/* Set the boot bank to the alternate bank */
+void cpld_set_altbank(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_NOR;
+ u8 reg4 = CPLD_READ(soft_mux_on);
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+ u8 reg7 = CPLD_READ(vbank);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, reg4 | CPLD_SW_MUX_BANK_SEL | 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ reg7 = (reg7 & ~CPLD_BANK_SEL_MASK) | CPLD_BANK_SEL_ALTBANK;
+ CPLD_WRITE(vbank, reg7);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+/* Set the boot bank to the default bank */
+void cpld_set_defbank(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_NOR;
+ u8 reg4 = CPLD_READ(soft_mux_on);
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, reg4 | CPLD_SW_MUX_BANK_SEL | 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ CPLD_WRITE(vbank, 0);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+void cpld_set_nand(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_NAND;
+
+ if (CPLD_READ(cpld_ver) > 0x2)
+ reg = CPLD_CFG_RCW_SRC_NAND_4K;
+
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+void cpld_set_sd(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_SD;
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ CPLD_WRITE(system_rst, 1);
+}
+#ifdef DEBUG
+static void cpld_dump_regs(void)
+{
+ printf("cpld_ver = %x\n", CPLD_READ(cpld_ver));
+ printf("cpld_ver_sub = %x\n", CPLD_READ(cpld_ver_sub));
+ printf("pcba_ver = %x\n", CPLD_READ(pcba_ver));
+ printf("soft_mux_on = %x\n", CPLD_READ(soft_mux_on));
+ printf("cfg_rcw_src1 = %x\n", CPLD_READ(cfg_rcw_src1));
+ printf("cfg_rcw_src2 = %x\n", CPLD_READ(cfg_rcw_src2));
+ printf("vbank = %x\n", CPLD_READ(vbank));
+ printf("sysclk_sel = %x\n", CPLD_READ(sysclk_sel));
+ printf("uart_sel = %x\n", CPLD_READ(uart_sel));
+ printf("sd1refclk_sel = %x\n", CPLD_READ(sd1refclk_sel));
+ printf("tdmclk_mux_sel = %x\n", CPLD_READ(tdmclk_mux_sel));
+ printf("sdhc_spics_sel = %x\n", CPLD_READ(sdhc_spics_sel));
+ printf("status_led = %x\n", CPLD_READ(status_led));
+ putc('\n');
+}
+#endif
+
+void cpld_rev_bit(unsigned char *value)
+{
+ u8 rev_val, val;
+ int i;
+
+ val = *value;
+ rev_val = val & 1;
+ for (i = 1; i <= 7; i++) {
+ val >>= 1;
+ rev_val <<= 1;
+ rev_val |= val & 1;
+ }
+
+ *value = rev_val;
+}
+
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else if (strcmp(argv[2], "nand") == 0)
+ cpld_set_nand();
+ else if (strcmp(argv[2], "sd") == 0)
+ cpld_set_sd();
+ else
+ cpld_set_defbank();
+#ifdef DEBUG
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+#endif
+ } else {
+ rc = cmd_usage(cmdtp);
+ }
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset: reset to default bank\n"
+ "cpld reset altbank: reset to alternate bank\n"
+ "cpld reset nand: reset to boot from NAND flash\n"
+ "cpld reset sd: reset to boot from SD card\n"
+#ifdef DEBUG
+ "cpld dump - display the CPLD registers\n"
+#endif
+);
diff --git a/board/freescale/ls1043ardb/cpld.h b/board/freescale/ls1043ardb/cpld.h
new file mode 100644
index 00000000000..eed34d63546
--- /dev/null
+++ b/board/freescale/ls1043ardb/cpld.h
@@ -0,0 +1,46 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor
+ */
+
+#ifndef __CPLD_H__
+#define __CPLD_H__
+
+/*
+ * CPLD register set of LS1043ARDB board-specific.
+ */
+struct cpld_data {
+ u8 cpld_ver; /* 0x0 - CPLD Major Revision Register */
+ u8 cpld_ver_sub; /* 0x1 - CPLD Minor Revision Register */
+ u8 pcba_ver; /* 0x2 - PCBA Revision Register */
+ u8 system_rst; /* 0x3 - system reset register */
+ u8 soft_mux_on; /* 0x4 - Switch Control Enable Register */
+ u8 cfg_rcw_src1; /* 0x5 - Reset config word 1 */
+ u8 cfg_rcw_src2; /* 0x6 - Reset config word 1 */
+ u8 vbank; /* 0x7 - Flash bank selection Control */
+ u8 sysclk_sel; /* 0x8 - */
+ u8 uart_sel; /* 0x9 - */
+ u8 sd1refclk_sel; /* 0xA - */
+ u8 tdmclk_mux_sel; /* 0xB - */
+ u8 sdhc_spics_sel; /* 0xC - */
+ u8 status_led; /* 0xD - */
+ u8 global_rst; /* 0xE - */
+};
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+void cpld_rev_bit(unsigned char *value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value) \
+ cpld_write(offsetof(struct cpld_data, reg), value)
+
+/* CPLD on IFC */
+#define CPLD_SW_MUX_BANK_SEL 0x40
+#define CPLD_BANK_SEL_MASK 0x07
+#define CPLD_BANK_SEL_ALTBANK 0x04
+#define CPLD_CFG_RCW_SRC_NOR 0x025
+#define CPLD_CFG_RCW_SRC_NAND 0x106
+#define CPLD_CFG_RCW_SRC_NAND_4K 0x118
+#define CPLD_CFG_RCW_SRC_SD 0x040
+#endif
diff --git a/board/freescale/ls1043ardb/ddr.c b/board/freescale/ls1043ardb/ddr.c
new file mode 100644
index 00000000000..187925e981a
--- /dev/null
+++ b/board/freescale/ls1043ardb/ddr.c
@@ -0,0 +1,254 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+#include <log.h>
+#include <vsprintf.h>
+#ifdef CONFIG_FSL_DEEP_SLEEP
+#include <fsl_sleep.h>
+#endif
+#include <asm/arch/clock.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ popts->cpo_override = pbsp->cpo_override;
+ popts->write_data_delay =
+ pbsp->write_data_delay;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+
+ /* force DDR bus width to 32 bits */
+ popts->data_bus_width = 1;
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 1;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x46;
+
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm) |
+ DDR_CDR2_VREF_OVRD(70); /* Vref = 70% */
+}
+
+/* DDR model number: MT40A512M8HX-093E */
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 2147483648u,
+ .capacity = 2147483648u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .bank_addr_bits = 2,
+ .bank_group_bits = 2,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 938,
+ .tckmax_ps = 1500,
+ .caslat_x = 0x000DFA00,
+ .taa_ps = 13500,
+ .trcd_ps = 13500,
+ .trp_ps = 13500,
+ .tras_ps = 33000,
+ .trc_ps = 46500,
+ .trfc1_ps = 260000,
+ .trfc2_ps = 160000,
+ .trfc4_ps = 110000,
+ .tfaw_ps = 21000,
+ .trrds_ps = 3700,
+ .trrdl_ps = 5300,
+ .tccdl_ps = 5355,
+ .refresh_rate_ps = 7800000,
+ .dq_mapping[0] = 0x0,
+ .dq_mapping[1] = 0x0,
+ .dq_mapping[2] = 0x0,
+ .dq_mapping[3] = 0x0,
+ .dq_mapping[4] = 0x0,
+ .dq_mapping[5] = 0x0,
+ .dq_mapping[6] = 0x0,
+ .dq_mapping[7] = 0x0,
+ .dq_mapping[8] = 0x0,
+ .dq_mapping[9] = 0x0,
+ .dq_mapping[10] = 0x0,
+ .dq_mapping[11] = 0x0,
+ .dq_mapping[12] = 0x0,
+ .dq_mapping[13] = 0x0,
+ .dq_mapping[14] = 0x0,
+ .dq_mapping[15] = 0x0,
+ .dq_mapping[16] = 0x0,
+ .dq_mapping[17] = 0x0,
+ .dq_mapping_ors = 0,
+};
+
+int fsl_ddr_get_dimm_params(dimm_params_t *pdimm,
+ unsigned int controller_number,
+ unsigned int dimm_number)
+{
+ static const char dimm_model[] = "Fixed DDR on board";
+
+ if (((controller_number == 0) && (dimm_number == 0)) ||
+ ((controller_number == 1) && (dimm_number == 0))) {
+ memcpy(pdimm, &ddr_raw_timing, sizeof(dimm_params_t));
+ memset(pdimm->mpart, 0, sizeof(pdimm->mpart));
+ memcpy(pdimm->mpart, dimm_model, sizeof(dimm_model) - 1);
+ }
+
+ return 0;
+}
+#else
+
+phys_size_t fixed_sdram(void)
+{
+ int i;
+ char buf[32];
+ fsl_ddr_cfg_regs_t ddr_cfg_regs;
+ phys_size_t ddr_size;
+ ulong ddr_freq, ddr_freq_mhz;
+
+ ddr_freq = get_ddr_freq(0);
+ ddr_freq_mhz = ddr_freq / 1000000;
+
+ printf("Configuring DDR for %s MT/s data rate\n",
+ strmhz(buf, ddr_freq));
+
+ for (i = 0; fixed_ddr_parm_0[i].max_freq > 0; i++) {
+ if ((ddr_freq_mhz > fixed_ddr_parm_0[i].min_freq) &&
+ (ddr_freq_mhz <= fixed_ddr_parm_0[i].max_freq)) {
+ memcpy(&ddr_cfg_regs,
+ fixed_ddr_parm_0[i].ddr_settings,
+ sizeof(ddr_cfg_regs));
+ break;
+ }
+ }
+
+ if (fixed_ddr_parm_0[i].max_freq == 0)
+ panic("Unsupported DDR data rate %s MT/s data rate\n",
+ strmhz(buf, ddr_freq));
+
+ ddr_size = (phys_size_t)2048 * 1024 * 1024;
+ fsl_ddr_set_memctl_regs(&ddr_cfg_regs, 0, 0);
+
+ return ddr_size;
+}
+#endif
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+ if (!gd->ram_size)
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+ gd->ram_size = fsl_ddr_sdram_size();
+#else
+ gd->ram_size = 0x80000000;
+#endif
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+ phys_size_t dram_size;
+
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_SPL)
+ puts("Initializing DDR....\n");
+ dram_size = fsl_ddr_sdram();
+#else
+ dram_size = fsl_ddr_sdram_size();
+#endif
+#else
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_SPL)
+ puts("Initialzing DDR using fixed setting\n");
+ dram_size = fixed_sdram();
+#else
+ gd->ram_size = 0x80000000;
+
+ return 0;
+#endif
+#endif
+ erratum_a008850_post();
+
+#ifdef CONFIG_FSL_DEEP_SLEEP
+ fsl_dp_ddr_restore();
+#endif
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1043ardb/ddr.h b/board/freescale/ls1043ardb/ddr.h
new file mode 100644
index 00000000000..85ed920ca6d
--- /dev/null
+++ b/board/freescale/ls1043ardb/ddr.h
@@ -0,0 +1,116 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+
+extern void erratum_a008850_post(void);
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+ u32 cpo_override;
+ u32 write_data_delay;
+ u32 force_2t;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl | cpo |wrdata|2T
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 | |delay |
+ */
+#ifdef CONFIG_SYS_FSL_DDR4
+ {1, 1666, 0, 12, 7, 0x07090800, 0x00000000,},
+ {1, 1900, 0, 12, 7, 0x07090800, 0x00000000,},
+ {1, 2200, 0, 12, 7, 0x07090800, 0x00000000,},
+#endif
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+#ifndef CONFIG_SYS_DDR_RAW_TIMING
+fsl_ddr_cfg_regs_t ddr_cfg_regs_1600 = {
+ .cs[0].bnds = 0x0000007F,
+ .cs[1].bnds = 0,
+ .cs[2].bnds = 0,
+ .cs[3].bnds = 0,
+ .cs[0].config = 0x80040322,
+ .cs[0].config_2 = 0,
+ .cs[1].config = 0,
+ .cs[1].config_2 = 0,
+ .cs[2].config = 0,
+ .cs[3].config = 0,
+ .timing_cfg_3 = 0x010C1000,
+ .timing_cfg_0 = 0x91550018,
+ .timing_cfg_1 = 0xBBB48C42,
+ .timing_cfg_2 = 0x0048C111,
+ .ddr_sdram_cfg = 0xC50C0008,
+ .ddr_sdram_cfg_2 = 0x00401100,
+ .ddr_sdram_cfg_3 = 0,
+ .ddr_sdram_mode = 0x03010210,
+ .ddr_sdram_mode_2 = 0,
+ .ddr_sdram_mode_3 = 0x00010210,
+ .ddr_sdram_mode_4 = 0,
+ .ddr_sdram_mode_5 = 0x00010210,
+ .ddr_sdram_mode_6 = 0,
+ .ddr_sdram_mode_7 = 0x00010210,
+ .ddr_sdram_mode_8 = 0,
+ .ddr_sdram_mode_9 = 0x00000500,
+ .ddr_sdram_mode_10 = 0x04000000,
+ .ddr_sdram_mode_11 = 0x00000400,
+ .ddr_sdram_mode_12 = 0x04000000,
+ .ddr_sdram_mode_13 = 0x00000400,
+ .ddr_sdram_mode_14 = 0x04000000,
+ .ddr_sdram_mode_15 = 0x00000400,
+ .ddr_sdram_mode_16 = 0x04000000,
+ .ddr_sdram_interval = 0x18600618,
+ .ddr_data_init = 0xDEADBEEF,
+ .ddr_sdram_clk_cntl = 0x03000000,
+ .ddr_init_addr = 0,
+ .ddr_init_ext_addr = 0,
+ .timing_cfg_4 = 0x00000002,
+ .timing_cfg_5 = 0x03401400,
+ .timing_cfg_6 = 0,
+ .timing_cfg_7 = 0x13300000,
+ .timing_cfg_8 = 0x02115600,
+ .timing_cfg_9 = 0,
+ .ddr_zq_cntl = 0x8A090705,
+ .ddr_wrlvl_cntl = 0x8675F607,
+ .ddr_wrlvl_cntl_2 = 0x07090800,
+ .ddr_wrlvl_cntl_3 = 0,
+ .ddr_sr_cntr = 0,
+ .ddr_sdram_rcw_1 = 0,
+ .ddr_sdram_rcw_2 = 0,
+ .ddr_cdr1 = 0x80040000,
+ .ddr_cdr2 = 0x0000A181,
+ .dq_map_0 = 0,
+ .dq_map_1 = 0,
+ .dq_map_2 = 0,
+ .dq_map_3 = 0,
+ .debug[28] = 0x00700046,
+
+};
+
+fixed_ddr_parm_t fixed_ddr_parm_0[] = {
+ {1550, 1650, &ddr_cfg_regs_1600},
+ {0, 0, NULL}
+};
+
+#endif
+#endif
diff --git a/board/freescale/ls1043ardb/eth.c b/board/freescale/ls1043ardb/eth.c
new file mode 100644
index 00000000000..cacc49c0584
--- /dev/null
+++ b/board/freescale/ls1043ardb/eth.c
@@ -0,0 +1,77 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+#include <config.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_dtsec.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+
+#include "../common/fman.h"
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_FMAN_ENET
+ int i;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ struct mii_dev *dev;
+ u32 srds_s1;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ /* Set the two on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY1_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY2_ADDR);
+
+ /* QSGMII on lane B, MAC 1/2/5/6 */
+ fm_info_set_phy_address(FM1_DTSEC1, QSGMII_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, QSGMII_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC5, QSGMII_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, QSGMII_PORT4_PHY_ADDR);
+
+ switch (srds_s1) {
+ case 0x1455:
+ break;
+ default:
+ printf("Invalid SerDes protocol 0x%x for LS1043ARDB\n",
+ srds_s1);
+ break;
+ }
+
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++)
+ fm_info_set_mdio(i, dev);
+
+ /* 10GBase-R on lane A, MAC 9 */
+ fm_info_set_phy_address(FM1_10GEC1, FM1_10GEC1_PHY_ADDR);
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(FM1_10GEC1, dev);
+
+ cpu_eth_init(bis);
+#endif
+
+ return pci_eth_init(bis);
+}
diff --git a/board/freescale/ls1043ardb/ls1043ardb.c b/board/freescale/ls1043ardb/ls1043ardb.c
new file mode 100644
index 00000000000..cf84ff9e638
--- /dev/null
+++ b/board/freescale/ls1043ardb/ls1043ardb.c
@@ -0,0 +1,415 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ * Copyright 2021-2022 NXP
+ */
+
+#include <i2c.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <fdt_support.h>
+#include <hwconfig.h>
+#include <ahci.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_esdhc.h>
+#include <fsl_ifc.h>
+#include "cpld.h"
+#ifdef CONFIG_U_QE
+#include <fsl_qe.h>
+#endif
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_TFABOOT
+struct ifc_regs ifc_cfg_nor_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nor",
+ CFG_SYS_NOR_CSPR,
+ CFG_SYS_NOR_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+
+ },
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "cpld",
+ CFG_SYS_CPLD_CSPR,
+ CFG_SYS_CPLD_CSPR_EXT,
+ CFG_SYS_CPLD_AMASK,
+ CFG_SYS_CPLD_CSOR,
+ {
+ CFG_SYS_CPLD_FTIM0,
+ CFG_SYS_CPLD_FTIM1,
+ CFG_SYS_CPLD_FTIM2,
+ CFG_SYS_CPLD_FTIM3
+ },
+ }
+};
+
+struct ifc_regs ifc_cfg_nand_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "nor",
+ CFG_SYS_NOR_CSPR,
+ CFG_SYS_NOR_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "cpld",
+ CFG_SYS_CPLD_CSPR,
+ CFG_SYS_CPLD_CSPR_EXT,
+ CFG_SYS_CPLD_AMASK,
+ CFG_SYS_CPLD_CSOR,
+ {
+ CFG_SYS_CPLD_FTIM0,
+ CFG_SYS_CPLD_FTIM1,
+ CFG_SYS_CPLD_FTIM2,
+ CFG_SYS_CPLD_FTIM3
+ },
+ }
+};
+
+void ifc_cfg_boot_info(struct ifc_regs_info *regs_info)
+{
+ enum boot_src src = get_boot_src();
+
+ if (src == BOOT_SOURCE_IFC_NAND)
+ regs_info->regs = ifc_cfg_nand_boot;
+ else
+ regs_info->regs = ifc_cfg_nor_boot;
+ regs_info->cs_size = CONFIG_SYS_FSL_IFC_BANK_COUNT;
+}
+
+#endif
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+#ifndef CONFIG_SPL_BUILD
+
+int checkboard(void)
+{
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+#endif
+ static const char *freq[2] = {"100.00MHZ", "156.25MHZ"};
+#ifndef CONFIG_SD_BOOT
+ u8 cfg_rcw_src1, cfg_rcw_src2;
+ u16 cfg_rcw_src;
+#endif
+ u8 sd1refclk_sel;
+
+ printf("Board: LS1043ARDB, boot from ");
+
+#ifdef CONFIG_TFABOOT
+ if (src == BOOT_SOURCE_SD_MMC)
+ puts("SD\n");
+ else {
+#endif
+
+#ifdef CONFIG_SD_BOOT
+ puts("SD\n");
+#else
+ cfg_rcw_src1 = CPLD_READ(cfg_rcw_src1);
+ cfg_rcw_src2 = CPLD_READ(cfg_rcw_src2);
+ cpld_rev_bit(&cfg_rcw_src1);
+ cfg_rcw_src = cfg_rcw_src1;
+ cfg_rcw_src = (cfg_rcw_src << 1) | cfg_rcw_src2;
+
+ if (cfg_rcw_src == 0x25)
+ printf("vBank %d\n", CPLD_READ(vbank));
+ else if ((cfg_rcw_src == 0x106) || (cfg_rcw_src == 0x118))
+ puts("NAND\n");
+ else
+ printf("Invalid setting of SW4\n");
+#endif
+
+#ifdef CONFIG_TFABOOT
+ }
+#endif
+ printf("CPLD: V%x.%x\nPCBA: V%x.0\n", CPLD_READ(cpld_ver),
+ CPLD_READ(cpld_ver_sub), CPLD_READ(pcba_ver));
+
+ puts("SERDES Reference Clocks:\n");
+ sd1refclk_sel = CPLD_READ(sd1refclk_sel);
+ printf("SD1_CLK1 = %s, SD1_CLK2 = %s\n", freq[sd1refclk_sel], freq[0]);
+
+ return 0;
+}
+
+int board_init(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_SYS_FSL_ERRATUM_A010315
+ erratum_a010315();
+#endif
+
+#ifdef CONFIG_FSL_IFC
+ init_final_memctl_regs();
+#endif
+
+#ifdef CONFIG_NXP_ESBC
+ /* In case of Secure Boot, the IBR configures the SMMU
+ * to allow only Secure transactions.
+ * SMMU must be reset in bypass mode.
+ * Set the ClientPD bit and Clear the USFCFG Bit
+ */
+ u32 val;
+ val = (in_le32(SMMU_SCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_SCR0, val);
+ val = (in_le32(SMMU_NSCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_NSCR0, val);
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT) && defined(CONFIG_DM_ETH)
+ pci_init();
+#endif
+
+#ifdef CONFIG_U_QE
+ u_qe_init();
+#endif
+ /* invert AQR105 IRQ pins polarity */
+ out_be32(&scfg->intpcr, AQR105_IRQ_MASK);
+
+ return 0;
+}
+
+int config_board_mux(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+ u32 usb_pwrfault;
+
+ if (hwconfig("qe-hdlc")) {
+ out_be32(&scfg->rcwpmuxcr0,
+ (in_be32(&scfg->rcwpmuxcr0) & ~0xff00) | 0x6600);
+ printf("Assign to qe-hdlc clk, rcwpmuxcr0=%x\n",
+ in_be32(&scfg->rcwpmuxcr0));
+ } else {
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ out_be32(&scfg->rcwpmuxcr0, 0x3333);
+ out_be32(&scfg->usbdrvvbus_selcr, SCFG_USBDRVVBUS_SELCR_USB1);
+ usb_pwrfault = (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB3_SHIFT) |
+ (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB2_SHIFT) |
+ (SCFG_USBPWRFAULT_SHARED <<
+ SCFG_USBPWRFAULT_USB1_SHIFT);
+ out_be32(&scfg->usbpwrfault_selcr, usb_pwrfault);
+#endif
+ }
+ return 0;
+}
+
+#if defined(CONFIG_MISC_INIT_R)
+int misc_init_r(void)
+{
+ config_board_mux();
+ return 0;
+}
+#endif
+
+void fdt_del_qe(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "fsl,qe")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+/* Update the address of the Aquantia PHY on the MDIO bus for boards revision
+ * v7.0 and up. Also rename the PHY node to align with the address change.
+ */
+void fdt_fixup_phy_addr(void *blob)
+{
+ const char phy_path[] =
+ "/soc/fman@1a00000/mdio@fd000/ethernet-phy@1";
+ int ret, offset, new_addr = AQR113C_PHY_ADDR;
+ char new_name[] = "ethernet-phy@00";
+
+ if (CPLD_READ(pcba_ver) < 0x7)
+ return;
+
+ offset = fdt_path_offset(blob, phy_path);
+ if (offset < 0) {
+ printf("ethernet-phy@1 node not found in the dts\n");
+ return;
+ }
+
+ ret = fdt_setprop_u32(blob, offset, "reg", new_addr);
+ if (ret < 0) {
+ printf("Unable to set 'reg' for node ethernet-phy@1: %s\n",
+ fdt_strerror(ret));
+ return;
+ }
+
+ sprintf(new_name, "ethernet-phy@%x", new_addr);
+ ret = fdt_set_name(blob, offset, new_name);
+ if (ret < 0)
+ printf("Unable to rename node ethernet-phy@1: %s\n",
+ fdt_strerror(ret));
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ /* fixup DT for the two DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+ fdt_fixup_phy_addr(blob);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ /*
+ * qe-hdlc and usb multi-use the pins,
+ * when set hwconfig to qe-hdlc, delete usb node.
+ */
+ if (hwconfig("qe-hdlc"))
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ fdt_del_node_and_alias(blob, "usb1");
+#endif
+ /*
+ * qe just support qe-uart and qe-hdlc,
+ * if qe-uart and qe-hdlc are not set in hwconfig,
+ * delete qe node.
+ */
+ if (!hwconfig("qe-uart") && !hwconfig("qe-hdlc"))
+ fdt_del_qe(blob);
+
+ return 0;
+}
+
+void nand_fixup(void)
+{
+ u32 csor = 0;
+
+ if (CPLD_READ(pcba_ver) < 0x7)
+ return;
+
+ /* Change NAND Flash PGS/SPRZ configuration */
+ csor = CFG_SYS_NAND_CSOR;
+ if ((csor & CSOR_NAND_PGS_MASK) == CSOR_NAND_PGS_2K)
+ csor = (csor & ~(CSOR_NAND_PGS_MASK)) | CSOR_NAND_PGS_4K;
+
+ if ((csor & CSOR_NAND_SPRZ_MASK) == CSOR_NAND_SPRZ_64)
+ csor = (csor & ~(CSOR_NAND_SPRZ_MASK)) | CSOR_NAND_SPRZ_224;
+
+ if (IS_ENABLED(CONFIG_TFABOOT)) {
+ u8 cfg_rcw_src1, cfg_rcw_src2;
+ u16 cfg_rcw_src;
+
+ cfg_rcw_src1 = CPLD_READ(cfg_rcw_src1);
+ cfg_rcw_src2 = CPLD_READ(cfg_rcw_src2);
+ cpld_rev_bit(&cfg_rcw_src1);
+ cfg_rcw_src = cfg_rcw_src1;
+ cfg_rcw_src = (cfg_rcw_src << 1) | cfg_rcw_src2;
+
+ if (cfg_rcw_src == 0x25)
+ set_ifc_csor(IFC_CS1, csor);
+ else if (cfg_rcw_src == 0x118)
+ set_ifc_csor(IFC_CS0, csor);
+ else
+ printf("Invalid setting\n");
+ } else {
+ if (IS_ENABLED(CONFIG_NAND_BOOT))
+ set_ifc_csor(IFC_CS0, csor);
+ else
+ set_ifc_csor(IFC_CS1, csor);
+ }
+}
+
+#if IS_ENABLED(CONFIG_OF_BOARD_FIXUP)
+int board_fix_fdt(void *blob)
+{
+ /* nand driver fix up */
+ nand_fixup();
+
+ /* fdt fix up */
+ fdt_fixup_phy_addr(blob);
+
+ return 0;
+}
+#endif
+
+u8 flash_read8(void *addr)
+{
+ return __raw_readb(addr + 1);
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
+
+#endif
diff --git a/board/freescale/ls1043ardb/ls1043ardb_pbi.cfg b/board/freescale/ls1043ardb/ls1043ardb_pbi.cfg
new file mode 100644
index 00000000000..f072274f474
--- /dev/null
+++ b/board/freescale/ls1043ardb/ls1043ardb_pbi.cfg
@@ -0,0 +1,14 @@
+#Configure Scratch register
+09570600 00000000
+09570604 10000000
+#Alt base register
+09570158 00001000
+#Disable CCI barrier tranaction
+09570178 0000e010
+09180000 00000008
+#USB PHY frequency sel
+09570418 0000009e
+0957041c 0000009e
+09570420 0000009e
+#flush PBI data
+096100c0 000fffff
diff --git a/board/freescale/ls1043ardb/ls1043ardb_rcw_nand.cfg b/board/freescale/ls1043ardb/ls1043ardb_rcw_nand.cfg
new file mode 100644
index 00000000000..d87058b7efe
--- /dev/null
+++ b/board/freescale/ls1043ardb/ls1043ardb_rcw_nand.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# serdes protocol
+08100010 0a000000 00000000 00000000
+14550002 80004012 e0106000 c1002000
+00000000 00000000 00000000 00038800
+00000000 00001100 00000096 00000001
diff --git a/board/freescale/ls1043ardb/ls1043ardb_rcw_sd.cfg b/board/freescale/ls1043ardb/ls1043ardb_rcw_sd.cfg
new file mode 100644
index 00000000000..e2ee34b7dfc
--- /dev/null
+++ b/board/freescale/ls1043ardb/ls1043ardb_rcw_sd.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+08100010 0a000000 00000000 00000000
+14550002 80004012 60040000 c1002000
+00000000 00000000 00000000 00038800
+00000000 00001100 00000096 00000001
diff --git a/board/freescale/ls1046afrwy/Kconfig b/board/freescale/ls1046afrwy/Kconfig
new file mode 100644
index 00000000000..68329d78caf
--- /dev/null
+++ b/board/freescale/ls1046afrwy/Kconfig
@@ -0,0 +1,16 @@
+
+if TARGET_LS1046AFRWY
+
+config SYS_BOARD
+ default "ls1046afrwy"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1046afrwy"
+
+endif
diff --git a/board/freescale/ls1046afrwy/MAINTAINERS b/board/freescale/ls1046afrwy/MAINTAINERS
new file mode 100644
index 00000000000..8f360e1820f
--- /dev/null
+++ b/board/freescale/ls1046afrwy/MAINTAINERS
@@ -0,0 +1,8 @@
+LS1046AFRWY BOARD
+M: Pramod Kumar <pramod.kumar_1@nxp.com>
+S: Maintained
+F: board/freescale/ls1046afrwy/
+F: board/freescale/ls1046afrwy/ls1046afrwy.c
+F: include/configs/ls1046afrwy.h
+F: configs/ls1046afrwy_tfa_defconfig
+F: configs/ls1046afrwy_tfa_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1046afrwy/Makefile b/board/freescale/ls1046afrwy/Makefile
new file mode 100644
index 00000000000..c70f5cda797
--- /dev/null
+++ b/board/freescale/ls1046afrwy/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2019 NXP
+
+obj-y += ddr.o
+obj-y += ls1046afrwy.o
+obj-$(CONFIG_NET) += eth.o
diff --git a/board/freescale/ls1046afrwy/README b/board/freescale/ls1046afrwy/README
new file mode 100644
index 00000000000..2c7c797a879
--- /dev/null
+++ b/board/freescale/ls1046afrwy/README
@@ -0,0 +1,76 @@
+Overview
+--------
+The LS1046A Freeway Board (iFRWY) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS1046A
+LayerScape Architecture processor. The FRWY-LS1046A provides SW development
+platform for the Freescale LS1046A processor series, with a complete
+debugging environment. The FRWY-LS1046A is lead-free and RoHS-compliant.
+
+LS1046A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS1046A
+SoC overview.
+
+ FRWY-LS1046A board Overview
+ -----------------------
+ - SERDES1 Connections, 4 lanes supporting:
+ - Lane0: Unused
+ - Lane1: Unused
+ - Lane2: QSGMII
+ - Lane3: Unused
+ - SERDES2 Connections, 4 lanes supporting:
+ - Lane0: Unused
+ - Lane1: PCIe3 with PCIe x1 slot
+ - Lane2: Unused
+ - Lane3: PCIe3 with PCIe x1 slot
+ - DDR Controller
+ - 8GB 64bits DDR4 SDRAM. Support rates of up to 2133MT/s
+ -IFC/Local Bus
+ - One 512 MB NAND flash with ECC support
+ - USB 3.0
+ - Two Type A port
+ - SDHC: connects directly to a full microSD slot
+ - QSPI: 64 MB high-speed flash Memory for boot code and storage
+ - 4 I2C controllers
+ - UART
+ - Two 4-pin serial ports at up to 115.2 Kbit/s
+ - Two DB9 D-Type connectors supporting one Serial port each
+ - ARM JTAG support
+
+Memory map from core's view
+----------------------------
+Start Address End Address Description Size
+0x00_0000_0000 - 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 - 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 - 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 - 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 - 0x00_20FF_FFFF DCSR 16MB
+0x00_7E80_0000 - 0x00_7E80_FFFF IFC - NAND Flash 64KB
+0x00_7FB0_0000 - 0x00_7FB0_0FFF IFC - CPLD 4KB
+0x00_8000_0000 - 0x00_FFFF_FFFF DRAM1 2GB
+0x05_0000_0000 - 0x05_07FF_FFFF QMAN S/W Portal 128M
+0x05_0800_0000 - 0x05_0FFF_FFFF BMAN S/W Portal 128M
+0x08_8000_0000 - 0x09_FFFF_FFFF DRAM2 6GB
+0x40_0000_0000 - 0x47_FFFF_FFFF PCI Express1 32G
+0x48_0000_0000 - 0x4F_FFFF_FFFF PCI Express2 32G
+0x50_0000_0000 - 0x57_FFFF_FFFF PCI Express3 32G
+
+QSPI flash map:
+Start Address End Address Description Size
+0x00_4000_0000 - 0x00_400F_FFFF RCW + PBI + BL2 1MB
+0x00_4010_0000 - 0x00_404F_FFFF FIP Image
+ (Bl31 + BL32(optee.
+ bin) + Bl33(uboot)
+ + headers for secure
+ boot) 4MB
+0x00_4050_0000 - 0x00_405F_FFFF Boot Firmware Env 1MB
+0x00_4060_0000 - 0x00_408F_FFFF Secure boot headers 3MB
+0x00_4090_0000 - 0x00_4093_FFFF FMan ucode 256KB
+0x00_4094_0000 - 0x00_4097_FFFF QE/uQE firmware 256KB
+0x00_409C_0000 - 0x00_409F_FFFF Reserved 256KB
+0x00_4100_0000 - 0x00_43FF_FFFF FIT Image 48MB
+
+Booting Options
+---------------
+a) QSPI boot
+b) microSD boot
diff --git a/board/freescale/ls1046afrwy/ddr.c b/board/freescale/ls1046afrwy/ddr.c
new file mode 100644
index 00000000000..b08caee1d97
--- /dev/null
+++ b/board/freescale/ls1046afrwy/ddr.c
@@ -0,0 +1,19 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
diff --git a/board/freescale/ls1046afrwy/eth.c b/board/freescale/ls1046afrwy/eth.c
new file mode 100644
index 00000000000..8efc7f68424
--- /dev/null
+++ b/board/freescale/ls1046afrwy/eth.c
@@ -0,0 +1,118 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019 NXP
+ */
+#include <config.h>
+#include <fdt_support.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_dtsec.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+
+#include "../common/fman.h"
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_FMAN_ENET
+ struct memac_mdio_info dtsec_mdio_info;
+ struct mii_dev *dev;
+ u32 srds_s1;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ /* QSGMII on lane B, MAC 6/5/10/1 */
+ fm_info_set_phy_address(FM1_DTSEC6, QSGMII_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC5, QSGMII_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, QSGMII_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC1, QSGMII_PORT4_PHY_ADDR);
+
+ switch (srds_s1) {
+ case 0x3040:
+ break;
+ default:
+ printf("Invalid SerDes protocol 0x%x for LS1046AFRWY\n",
+ srds_s1);
+ break;
+ }
+
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ fm_info_set_mdio(FM1_DTSEC6, dev);
+ fm_info_set_mdio(FM1_DTSEC5, dev);
+ fm_info_set_mdio(FM1_DTSEC10, dev);
+ fm_info_set_mdio(FM1_DTSEC1, dev);
+
+ fm_disable_port(FM1_DTSEC9);
+
+ cpu_eth_init(bis);
+#endif
+
+ return pci_eth_init(bis);
+}
+
+#ifdef CONFIG_FMAN_ENET
+int fdt_update_ethernet_dt(void *blob)
+{
+ u32 srds_s1;
+ int i, prop;
+ int offset, nodeoff;
+ const char *path;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ /* Cycle through all aliases */
+ for (prop = 0; ; prop++) {
+ const char *name;
+
+ /* FDT might have been edited, recompute the offset */
+ offset = fdt_first_property_offset(blob,
+ fdt_path_offset(blob,
+ "/aliases")
+ );
+ /* Select property number 'prop' */
+ for (i = 0; i < prop; i++)
+ offset = fdt_next_property_offset(blob, offset);
+
+ if (offset < 0)
+ break;
+
+ path = fdt_getprop_by_offset(blob, offset, &name, NULL);
+ nodeoff = fdt_path_offset(blob, path);
+
+ switch (srds_s1) {
+ case 0x3040:
+ if (!strcmp(name, "ethernet1"))
+ fdt_status_disabled(blob, nodeoff);
+ if (!strcmp(name, "ethernet2"))
+ fdt_status_disabled(blob, nodeoff);
+ if (!strcmp(name, "ethernet3"))
+ fdt_status_disabled(blob, nodeoff);
+ if (!strcmp(name, "ethernet6"))
+ fdt_status_disabled(blob, nodeoff);
+ break;
+ default:
+ printf("%s:Invalid SerDes prtcl 0x%x for LS1046AFRWY\n",
+ __func__, srds_s1);
+ break;
+ }
+ }
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1046afrwy/ls1046afrwy.c b/board/freescale/ls1046afrwy/ls1046afrwy.c
new file mode 100644
index 00000000000..8889c24f1f0
--- /dev/null
+++ b/board/freescale/ls1046afrwy/ls1046afrwy.c
@@ -0,0 +1,218 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2019, 2021 NXP
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <fdt_support.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <hwconfig.h>
+#include <ahci.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_csu.h>
+#include <fsl_esdhc.h>
+#include <fsl_dspi.h>
+#include "../common/i2c_mux.h"
+
+#define LS1046A_PORSR1_REG 0x1EE0000
+#define BOOT_SRC_SD 0x20000000
+#define BOOT_SRC_MASK 0xFF800000
+#define BOARD_REV_GPIO_SHIFT 17
+#define BOARD_REV_MASK 0x03
+#define USB2_SEL_MASK 0x00000100
+
+#define BYTE_SWAP_32(word) ((((word) & 0xff000000) >> 24) | \
+(((word) & 0x00ff0000) >> 8) | \
+(((word) & 0x0000ff00) << 8) | \
+(((word) & 0x000000ff) << 24))
+#define SPI_MCR_REG 0x2100000
+
+DECLARE_GLOBAL_DATA_PTR;
+
+static inline void demux_select_usb2(void)
+{
+ u32 val;
+ struct ccsr_gpio *pgpio = (void *)(GPIO3_BASE_ADDR);
+
+ val = in_be32(&pgpio->gpdir);
+ val |= USB2_SEL_MASK;
+ out_be32(&pgpio->gpdir, val);
+
+ val = in_be32(&pgpio->gpdat);
+ val |= USB2_SEL_MASK;
+ out_be32(&pgpio->gpdat, val);
+}
+
+static inline void set_spi_cs_signal_inactive(void)
+{
+ /* default: all CS signals inactive state is high */
+ uint mcr_val;
+ uint mcr_cfg_val = DSPI_MCR_MSTR | DSPI_MCR_PCSIS_MASK |
+ DSPI_MCR_CRXF | DSPI_MCR_CTXF;
+
+ mcr_val = in_be32(SPI_MCR_REG);
+ mcr_val |= DSPI_MCR_HALT;
+ out_be32(SPI_MCR_REG, mcr_val);
+ out_be32(SPI_MCR_REG, mcr_cfg_val);
+ mcr_val = in_be32(SPI_MCR_REG);
+ mcr_val &= ~DSPI_MCR_HALT;
+ out_be32(SPI_MCR_REG, mcr_val);
+}
+
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+static inline uint8_t get_board_version(void)
+{
+ struct ccsr_gpio *pgpio = (void *)(GPIO2_BASE_ADDR);
+
+ /* GPIO 13 and GPIO 14 are used for Board Rev */
+ u32 gpio_val = ((in_be32(&pgpio->gpdat) >> BOARD_REV_GPIO_SHIFT))
+ & BOARD_REV_MASK;
+
+ /* GPIOs' are 0..31 in Big Endiness, swap GPIO 13 and GPIO 14 */
+ u8 val = ((gpio_val >> 1) | (gpio_val << 1)) & BOARD_REV_MASK;
+
+ return val;
+}
+
+int checkboard(void)
+{
+ static const char *freq[2] = {"100.00MHZ", "100.00MHZ"};
+ u32 boot_src;
+ u8 rev;
+
+ rev = get_board_version();
+ switch (rev) {
+ case 0x00:
+ puts("Board: LS1046AFRWY, Rev: A, boot from ");
+ break;
+ case 0x01:
+ puts("Board: LS1046AFRWY, Rev: B, boot from ");
+ break;
+ default:
+ puts("Board: LS1046AFRWY, Rev: Unknown, boot from ");
+ break;
+ }
+ boot_src = BYTE_SWAP_32(readl(LS1046A_PORSR1_REG));
+
+ if ((boot_src & BOOT_SRC_MASK) == BOOT_SRC_SD)
+ puts("SD\n");
+ else
+ puts("QSPI\n");
+ printf("SD1_CLK1 = %s, SD1_CLK2 = %s\n", freq[0], freq[1]);
+
+ return 0;
+}
+
+int board_init(void)
+{
+#ifdef CONFIG_NXP_ESBC
+ /*
+ * In case of Secure Boot, the IBR configures the SMMU
+ * to allow only Secure transactions.
+ * SMMU must be reset in bypass mode.
+ * Set the ClientPD bit and Clear the USFCFG Bit
+ */
+ u32 val;
+val = (in_le32(SMMU_SCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_SCR0, val);
+ val = (in_le32(SMMU_NSCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_NSCR0, val);
+#endif
+
+ if (!IS_ENABLED(CONFIG_SYS_EARLY_PCI_INIT))
+ pci_init();
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ return 0;
+}
+
+int board_setup_core_volt(u32 vdd)
+{
+ return 0;
+}
+
+void config_board_mux(void)
+{
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+ u32 usb_pwrfault;
+ /*
+ * USB2 is used, configure mux to USB2_DRVVBUS/USB2_PWRFAULT
+ * USB3 is not used, configure mux to IIC4_SCL/IIC4_SDA
+ */
+ out_be32(&scfg->rcwpmuxcr0, 0x3300);
+#ifdef CONFIG_HAS_FSL_IIC3
+ /* IIC3 is used, configure mux to use IIC3_SCL/IIC3/SDA */
+ out_be32(&scfg->rcwpmuxcr0, 0x0000);
+#endif
+ out_be32(&scfg->usbdrvvbus_selcr, SCFG_USBDRVVBUS_SELCR_USB1);
+ usb_pwrfault = (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB3_SHIFT) |
+ (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB2_SHIFT) |
+ (SCFG_USBPWRFAULT_SHARED <<
+ SCFG_USBPWRFAULT_USB1_SHIFT);
+ out_be32(&scfg->usbpwrfault_selcr, usb_pwrfault);
+#ifndef CONFIG_HAS_FSL_IIC3
+ /*
+ * LS1046A FRWY board has demultiplexer NX3DV42GU with GPIO3_23 as input
+ * to select I2C3_USB2_SEL_IO
+ * I2C3_USB2_SEL = 0: I2C3_SCL/SDA signals are routed to
+ * I2C3 header (default)
+ * I2C3_USB2_SEL = 1: USB2_DRVVBUS/PWRFAULT signals are routed to
+ * USB2 port
+ * programmed to select USB2 by setting GPIO3_23 output to one
+ */
+ demux_select_usb2();
+#endif
+#endif
+ set_spi_cs_signal_inactive();
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ config_board_mux();
+ return 0;
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ /* fixup DT for the two DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+#endif
+
+ fdt_fixup_icid(blob);
+
+ return 0;
+}
diff --git a/board/freescale/ls1046aqds/Kconfig b/board/freescale/ls1046aqds/Kconfig
new file mode 100644
index 00000000000..723f4ba90a0
--- /dev/null
+++ b/board/freescale/ls1046aqds/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS1046AQDS
+
+config SYS_BOARD
+ default "ls1046aqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1046aqds"
+
+endif
diff --git a/board/freescale/ls1046aqds/MAINTAINERS b/board/freescale/ls1046aqds/MAINTAINERS
new file mode 100644
index 00000000000..e1db2aaa8e4
--- /dev/null
+++ b/board/freescale/ls1046aqds/MAINTAINERS
@@ -0,0 +1,14 @@
+LS1046AQDS BOARD
+M: Mingkai Hu <Mingkai.Hu@nxp.com>
+S: Maintained
+F: board/freescale/ls1046aqds/
+F: include/configs/ls1046aqds.h
+F: configs/ls1046aqds_defconfig
+F: configs/ls1046aqds_nand_defconfig
+F: configs/ls1046aqds_sdcard_ifc_defconfig
+F: configs/ls1046aqds_sdcard_qspi_defconfig
+F: configs/ls1046aqds_qspi_defconfig
+F: configs/ls1046aqds_lpuart_defconfig
+F: configs/ls1046aqds_tfa_defconfig
+F: configs/ls1046aqds_tfa_SECURE_BOOT_defconfig
+F: configs/ls1046aqds_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1046aqds/Makefile b/board/freescale/ls1046aqds/Makefile
new file mode 100644
index 00000000000..6267522cc26
--- /dev/null
+++ b/board/freescale/ls1046aqds/Makefile
@@ -0,0 +1,11 @@
+#
+# Copyright 2016 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += ddr.o
+ifndef CONFIG_SPL_BUILD
+obj-y += eth.o
+endif
+obj-y += ls1046aqds.o
diff --git a/board/freescale/ls1046aqds/README b/board/freescale/ls1046aqds/README
new file mode 100644
index 00000000000..cb694735a46
--- /dev/null
+++ b/board/freescale/ls1046aqds/README
@@ -0,0 +1,70 @@
+Overview
+--------
+The LS1046A Development System (QDS) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS1046A
+LayerScape Architecture processor. The LS1046AQDS provides SW development
+platform for the Freescale LS1046A processor series, with a complete
+debugging environment.
+
+LS1046A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS1046A
+SoC overview.
+
+ LS1046AQDS board Overview
+ -----------------------
+ - SERDES Connections, 8 lanes supporting:
+ - PCI Express - 3.0
+ - SGMII, SGMII 2.5
+ - QSGMII
+ - SATA 3.0
+ - 10GBase-R
+ - DDR Controller
+ - 8GB 64bits DDR4 SDRAM. Support rates of up to 2133MT/s
+ -IFC/Local Bus
+ - One in-socket 128 MB NOR flash 16-bit data bus
+ - One 512 MB NAND flash with ECC support
+ - PromJet Port
+ - FPGA connection
+ - USB 3.0
+ - Three high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - The other two USB 3.0 ports configured as OTG with micro-AB connector
+ - SDHC port connects directly to an adapter card slot, featuring:
+ - Optional clock feedback paths, and optional high-speed voltage translation assistance
+ - SD slots for SD, SDHC (1x, 4x, 8x), and/or MMC
+ - eMMC memory devices
+ - DSPI: Onboard support for three SPI flash memory devices
+ - 4 I2C controllers
+ - One SATA onboard connectors
+ - UART
+ - Two 4-pin serial ports at up to 115.2 Kbit/s
+ - Two DB9 D-Type connectors supporting one Serial port each
+ - ARM JTAG support
+
+Memory map from core's view
+----------------------------
+Start Address End Address Description Size
+0x00_0000_0000 - 0x00_000F_FFFF Secure Boot ROM 1MB
+0x00_0100_0000 - 0x00_0FFF_FFFF CCSRBAR 240MB
+0x00_1000_0000 - 0x00_1000_FFFF OCRAM0 64KB
+0x00_1001_0000 - 0x00_1001_FFFF OCRAM1 64KB
+0x00_2000_0000 - 0x00_20FF_FFFF DCSR 16MB
+0x00_6000_0000 - 0x00_67FF_FFFF IFC - NOR Flash 128MB
+0x00_7E80_0000 - 0x00_7E80_FFFF IFC - NAND Flash 64KB
+0x00_7FB0_0000 - 0x00_7FB0_0FFF IFC - FPGA 4KB
+0x00_8000_0000 - 0x00_FFFF_FFFF DRAM1 2GB
+0x05_0000_0000 - 0x05_07FF_FFFF QMAN S/W Portal 128M
+0x05_0800_0000 - 0x05_0FFF_FFFF BMAN S/W Portal 128M
+0x08_8000_0000 - 0x09_FFFF_FFFF DRAM2 6GB
+0x40_0000_0000 - 0x47_FFFF_FFFF PCI Express1 32G
+0x48_0000_0000 - 0x4F_FFFF_FFFF PCI Express2 32G
+0x50_0000_0000 - 0x57_FFFF_FFFF PCI Express3 32G
+
+Booting Options
+---------------
+a) Promjet Boot
+b) NOR boot
+c) NAND boot
+d) SD boot
+e) QSPI boot
diff --git a/board/freescale/ls1046aqds/ddr.c b/board/freescale/ls1046aqds/ddr.c
new file mode 100644
index 00000000000..ac1b6049721
--- /dev/null
+++ b/board/freescale/ls1046aqds/ddr.c
@@ -0,0 +1,130 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#ifdef CONFIG_FSL_DEEP_SLEEP
+#include <fsl_sleep.h>
+#endif
+#include <log.h>
+#include <asm/arch/clock.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 3) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+
+ popts->data_bus_width = 0; /* 64b data bus */
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+ popts->bstopre = 0; /* enable auto precharge */
+
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm) |
+ DDR_CDR2_VREF_TRAIN_EN | DDR_CDR2_VREF_RANGE_2;
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x70;
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+#else
+ puts("Initializing DDR....using SPD\n");
+
+ dram_size = fsl_ddr_sdram();
+#endif
+
+#ifdef CONFIG_FSL_DEEP_SLEEP
+ fsl_dp_ddr_restore();
+#endif
+
+ erratum_a008850_post();
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1046aqds/ddr.h b/board/freescale/ls1046aqds/ddr.h
new file mode 100644
index 00000000000..e55446f2b29
--- /dev/null
+++ b/board/freescale/ls1046aqds/ddr.h
@@ -0,0 +1,43 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+
+void erratum_a008850_post(void);
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl |
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 |
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 8, 7, 0x08090A0C, 0x0D0F100B,},
+ {2, 1900, 0, 8, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2300, 0, 8, 9, 0x0A0C0D11, 0x1214150E,},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+#endif
diff --git a/board/freescale/ls1046aqds/eth.c b/board/freescale/ls1046aqds/eth.c
new file mode 100644
index 00000000000..cd3500c2e96
--- /dev/null
+++ b/board/freescale/ls1046aqds/eth.c
@@ -0,0 +1,431 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2018-2020 NXP
+ */
+
+#include <config.h>
+#include <log.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fdt_support.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <fsl_dtsec.h>
+#include <malloc.h>
+#include <asm/arch/fsl_serdes.h>
+
+#include "../common/qixis.h"
+#include "../common/fman.h"
+#include "ls1046aqds_qixis.h"
+
+#define EMI_NONE 0xFF
+#define EMI1_RGMII1 0
+#define EMI1_RGMII2 1
+#define EMI1_SLOT1 2
+#define EMI1_SLOT2 3
+#define EMI1_SLOT4 4
+
+static const char * const mdio_names[] = {
+ "LS1046AQDS_MDIO_RGMII1",
+ "LS1046AQDS_MDIO_RGMII2",
+ "LS1046AQDS_MDIO_SLOT1",
+ "LS1046AQDS_MDIO_SLOT2",
+ "LS1046AQDS_MDIO_SLOT4",
+ "NULL",
+};
+
+/* Map SerDes 1 & 2 lanes to default slot. */
+#ifdef CONFIG_FMAN_ENET
+static int mdio_mux[NUM_FM_PORTS];
+
+static u8 lane_to_slot[] = {1, 1, 1, 1, 0, 4, 0 , 0};
+#endif
+
+static const char *ls1046aqds_mdio_name_for_muxval(u8 muxval)
+{
+ return mdio_names[muxval];
+}
+
+struct mii_dev *mii_dev_for_muxval(u8 muxval)
+{
+ struct mii_dev *bus;
+ const char *name;
+
+ if (muxval > EMI1_SLOT4)
+ return NULL;
+
+ name = ls1046aqds_mdio_name_for_muxval(muxval);
+
+ if (!name) {
+ printf("No bus for muxval %x\n", muxval);
+ return NULL;
+ }
+
+ bus = miiphy_get_dev_by_name(name);
+
+ if (!bus) {
+ printf("No bus by name %s\n", name);
+ return NULL;
+ }
+
+ return bus;
+}
+
+#ifdef CONFIG_FMAN_ENET
+struct ls1046aqds_mdio {
+ u8 muxval;
+ struct mii_dev *realbus;
+};
+
+static void ls1046aqds_mux_mdio(u8 muxval)
+{
+ u8 brdcfg4;
+
+ if (muxval < 7) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_EMISEL_MASK;
+ brdcfg4 |= (muxval << BRDCFG4_EMISEL_SHIFT);
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+ }
+}
+
+static int ls1046aqds_mdio_read(struct mii_dev *bus, int addr, int devad,
+ int regnum)
+{
+ struct ls1046aqds_mdio *priv = bus->priv;
+
+ ls1046aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->read(priv->realbus, addr, devad, regnum);
+}
+
+static int ls1046aqds_mdio_write(struct mii_dev *bus, int addr, int devad,
+ int regnum, u16 value)
+{
+ struct ls1046aqds_mdio *priv = bus->priv;
+
+ ls1046aqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->write(priv->realbus, addr, devad,
+ regnum, value);
+}
+
+static int ls1046aqds_mdio_reset(struct mii_dev *bus)
+{
+ struct ls1046aqds_mdio *priv = bus->priv;
+
+ return priv->realbus->reset(priv->realbus);
+}
+
+static int ls1046aqds_mdio_init(char *realbusname, u8 muxval)
+{
+ struct ls1046aqds_mdio *pmdio;
+ struct mii_dev *bus = mdio_alloc();
+
+ if (!bus) {
+ printf("Failed to allocate ls1046aqds MDIO bus\n");
+ return -1;
+ }
+
+ pmdio = malloc(sizeof(*pmdio));
+ if (!pmdio) {
+ printf("Failed to allocate ls1046aqds private data\n");
+ free(bus);
+ return -1;
+ }
+
+ bus->read = ls1046aqds_mdio_read;
+ bus->write = ls1046aqds_mdio_write;
+ bus->reset = ls1046aqds_mdio_reset;
+ sprintf(bus->name, ls1046aqds_mdio_name_for_muxval(muxval));
+
+ pmdio->realbus = miiphy_get_dev_by_name(realbusname);
+
+ if (!pmdio->realbus) {
+ printf("No bus with name %s\n", realbusname);
+ free(bus);
+ free(pmdio);
+ return -1;
+ }
+
+ pmdio->muxval = muxval;
+ bus->priv = pmdio;
+ return mdio_register(bus);
+}
+
+void board_ft_fman_fixup_port(void *fdt, char *compat, phys_addr_t addr,
+ enum fm_port port, int offset)
+{
+ struct fixed_link f_link;
+ const char *phyconn;
+
+ if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_SGMII) {
+ switch (port) {
+ case FM1_DTSEC9:
+ fdt_set_phy_handle(fdt, compat, addr, "sgmii-s1-p1");
+ break;
+ case FM1_DTSEC10:
+ fdt_set_phy_handle(fdt, compat, addr, "sgmii-s1-p2");
+ break;
+ case FM1_DTSEC5:
+ fdt_set_phy_handle(fdt, compat, addr, "sgmii-s1-p3");
+ break;
+ case FM1_DTSEC6:
+ fdt_set_phy_handle(fdt, compat, addr, "sgmii-s1-p4");
+ break;
+ case FM1_DTSEC2:
+ fdt_set_phy_handle(fdt, compat, addr, "sgmii-s4-p1");
+ break;
+ default:
+ break;
+ }
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_2500BASEX) {
+ /* 2.5G SGMII interface */
+ f_link.phy_id = cpu_to_fdt32(port);
+ f_link.duplex = cpu_to_fdt32(1);
+ f_link.link_speed = cpu_to_fdt32(1000);
+ f_link.pause = 0;
+ f_link.asym_pause = 0;
+ /* no PHY for 2.5G SGMII on QDS */
+ fdt_delprop(fdt, offset, "phy-handle");
+ fdt_setprop(fdt, offset, "fixed-link", &f_link, sizeof(f_link));
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "2500base-x");
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_QSGMII) {
+ switch (port) {
+ case FM1_DTSEC1:
+ fdt_set_phy_handle(fdt, compat, addr, "qsgmii-s2-p4");
+ break;
+ case FM1_DTSEC5:
+ fdt_set_phy_handle(fdt, compat, addr, "qsgmii-s2-p2");
+ break;
+ case FM1_DTSEC6:
+ fdt_set_phy_handle(fdt, compat, addr, "qsgmii-s2-p1");
+ break;
+ case FM1_DTSEC10:
+ fdt_set_phy_handle(fdt, compat, addr, "qsgmii-s2-p3");
+ break;
+ default:
+ break;
+ }
+ fdt_delprop(fdt, offset, "phy-connection-type");
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "qsgmii");
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_XGMII &&
+ (port == FM1_10GEC1 || port == FM1_10GEC2)) {
+ phyconn = fdt_getprop(fdt, offset, "phy-connection-type", NULL);
+ if (is_backplane_mode(phyconn)) {
+ /* Backplane KR mode: skip fixups */
+ printf("Interface %d in backplane KR mode\n", port);
+ } else {
+ /* 10GBase-R interface */
+ f_link.phy_id = cpu_to_fdt32(port);
+ f_link.duplex = cpu_to_fdt32(1);
+ f_link.link_speed = cpu_to_fdt32(10000);
+ f_link.pause = 0;
+ f_link.asym_pause = 0;
+ /* no PHY for 10GBase-R */
+ fdt_delprop(fdt, offset, "phy-handle");
+ fdt_setprop(fdt, offset, "fixed-link", &f_link,
+ sizeof(f_link));
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "xgmii");
+ }
+ }
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ int i;
+
+ for (i = FM1_DTSEC1; i < NUM_FM_PORTS; i++) {
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_SGMII:
+ case PHY_INTERFACE_MODE_QSGMII:
+ switch (mdio_mux[i]) {
+ case EMI1_SLOT1:
+ fdt_status_okay_by_alias(fdt, "emi1-slot1");
+ break;
+ case EMI1_SLOT2:
+ fdt_status_okay_by_alias(fdt, "emi1-slot2");
+ break;
+ case EMI1_SLOT4:
+ fdt_status_okay_by_alias(fdt, "emi1-slot4");
+ break;
+ default:
+ break;
+ }
+ break;
+ default:
+ break;
+ }
+ }
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ int i, idx, lane, slot, interface;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 srds_s1, srds_s2;
+ u8 brdcfg12;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ srds_s2 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS2_PRTCL_MASK;
+ srds_s2 >>= FSL_CHASSIS2_RCWSR4_SRDS2_PRTCL_SHIFT;
+
+ /* Initialize the mdio_mux array so we can recognize empty elements */
+ for (i = 0; i < NUM_FM_PORTS; i++)
+ mdio_mux[i] = EMI_NONE;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ /* Register the muxing front-ends to the MDIO buses */
+ ls1046aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII1);
+ ls1046aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII2);
+ ls1046aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT1);
+ ls1046aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT2);
+ ls1046aqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT4);
+
+ /* Set the two on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY1_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY2_ADDR);
+
+ switch (srds_s1) {
+ case 0x3333:
+ /* SGMII on slot 1, MAC 9 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ case 0x1333:
+ case 0x2333:
+ /* SGMII on slot 1, MAC 10 */
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ case 0x1133:
+ case 0x2233:
+ /* SGMII on slot 1, MAC 5/6 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ case 0x1040:
+ case 0x2040:
+ /* QSGMII on lane B, MAC 6/5/10/1 */
+ fm_info_set_phy_address(FM1_DTSEC6,
+ QSGMII_CARD_PORT1_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC5,
+ QSGMII_CARD_PORT2_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC10,
+ QSGMII_CARD_PORT3_PHY_ADDR_S2);
+ fm_info_set_phy_address(FM1_DTSEC1,
+ QSGMII_CARD_PORT4_PHY_ADDR_S2);
+ break;
+ case 0x3363:
+ /* SGMII on slot 1, MAC 9/10 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ case 0x1163:
+ case 0x2263:
+ case 0x2223:
+ /* SGMII on slot 1, MAC 6 */
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ default:
+ printf("Invalid SerDes protocol 0x%x for LS1046AQDS\n",
+ srds_s1);
+ break;
+ }
+
+ if (srds_s2 == 0x5a59 || srds_s2 == 0x5a06)
+ /* SGMII on slot 4, MAC 2 */
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT1_PHY_ADDR);
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ idx = i - FM1_DTSEC1;
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_SGMII:
+ case PHY_INTERFACE_MODE_QSGMII:
+ if (interface == PHY_INTERFACE_MODE_SGMII) {
+ if (i == FM1_DTSEC5) {
+ /* route lane 2 to slot1 so to have
+ * one sgmii riser card supports
+ * MAC5 and MAC6.
+ */
+ brdcfg12 = QIXIS_READ(brdcfg[12]);
+ QIXIS_WRITE(brdcfg[12],
+ brdcfg12 | 0x80);
+ }
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ SGMII_FM1_DTSEC1 + idx);
+ } else {
+ /* clear the bit 7 to route lane B on slot2. */
+ brdcfg12 = QIXIS_READ(brdcfg[12]);
+ QIXIS_WRITE(brdcfg[12], brdcfg12 & 0x7f);
+
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ QSGMII_FM1_A);
+ lane_to_slot[lane] = 2;
+ }
+
+ if (i == FM1_DTSEC2)
+ lane = 5;
+
+ if (lane < 0)
+ break;
+
+ slot = lane_to_slot[lane];
+ debug("FM1@DTSEC%u expects SGMII in slot %u\n",
+ idx + 1, slot);
+ if (QIXIS_READ(present2) & (1 << (slot - 1)))
+ fm_disable_port(i);
+
+ switch (slot) {
+ case 1:
+ mdio_mux[i] = EMI1_SLOT1;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 2:
+ mdio_mux[i] = EMI1_SLOT2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 4:
+ mdio_mux[i] = EMI1_SLOT4;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ default:
+ break;
+ }
+ break;
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ if (i == FM1_DTSEC3)
+ mdio_mux[i] = EMI1_RGMII1;
+ else if (i == FM1_DTSEC4)
+ mdio_mux[i] = EMI1_RGMII2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(mdio_mux[i]));
+ break;
+ default:
+ break;
+ }
+ }
+
+ cpu_eth_init(bis);
+
+ return pci_eth_init(bis);
+}
+#endif /* CONFIG_FMAN_ENET */
diff --git a/board/freescale/ls1046aqds/ls1046aqds.c b/board/freescale/ls1046aqds/ls1046aqds.c
new file mode 100644
index 00000000000..a83b2170651
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds.c
@@ -0,0 +1,479 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2019-2021 NXP
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <i2c.h>
+#include <fdt_support.h>
+#include <fsl_ddr_sdram.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/fdt.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/cpu.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <ahci.h>
+#include <hwconfig.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_csu.h>
+#include <fsl_esdhc.h>
+#include <fsl_ifc.h>
+#include <spl.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/vid.h"
+#include "../common/qixis.h"
+#include "ls1046aqds_qixis.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_TFABOOT
+struct ifc_regs ifc_cfg_nor_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nor0",
+ CFG_SYS_NOR0_CSPR,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+
+ },
+ {
+ "nor1",
+ CFG_SYS_NOR1_CSPR,
+ CFG_SYS_NOR1_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ CFG_SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ CFG_SYS_FPGA_FTIM0,
+ CFG_SYS_FPGA_FTIM1,
+ CFG_SYS_FPGA_FTIM2,
+ CFG_SYS_FPGA_FTIM3
+ },
+ }
+};
+
+struct ifc_regs ifc_cfg_nand_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "nor0",
+ CFG_SYS_NOR0_CSPR,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "nor1",
+ CFG_SYS_NOR1_CSPR,
+ CFG_SYS_NOR1_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ CFG_SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ CFG_SYS_FPGA_FTIM0,
+ CFG_SYS_FPGA_FTIM1,
+ CFG_SYS_FPGA_FTIM2,
+ CFG_SYS_FPGA_FTIM3
+ },
+ }
+};
+
+void ifc_cfg_boot_info(struct ifc_regs_info *regs_info)
+{
+ enum boot_src src = get_boot_src();
+
+ if (src == BOOT_SOURCE_IFC_NAND)
+ regs_info->regs = ifc_cfg_nand_boot;
+ else
+ regs_info->regs = ifc_cfg_nor_boot;
+ regs_info->cs_size = CONFIG_SYS_FSL_IFC_BANK_COUNT;
+}
+
+#endif
+
+enum {
+ MUX_TYPE_GPIO,
+};
+
+int checkboard(void)
+{
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+#endif
+ char buf[64];
+#ifndef CONFIG_SD_BOOT
+ u8 sw;
+#endif
+
+ puts("Board: LS1046AQDS, boot from ");
+
+#ifdef CONFIG_TFABOOT
+ if (src == BOOT_SOURCE_SD_MMC)
+ puts("SD\n");
+ else {
+#endif
+
+#ifdef CONFIG_SD_BOOT
+ puts("SD\n");
+#else
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank: %d\n", sw);
+ else if (sw == 0x8)
+ puts("PromJet\n");
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else if (sw == 0xF)
+ printf("QSPI\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+#endif
+
+#ifdef CONFIG_TFABOOT
+ }
+#endif
+ printf("Sys ID: 0x%02x, Sys Ver: 0x%02x\n",
+ QIXIS_READ(id), QIXIS_READ(arch));
+
+ printf("FPGA: v%d (%s), build %d\n",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+
+ return 0;
+}
+
+bool if_board_diff_clk(void)
+{
+ u8 diff_conf = QIXIS_READ(brdcfg[11]);
+
+ return diff_conf & 0x40;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0f) {
+ case QIXIS_SYSCLK_64:
+ return 64000000;
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ if (if_board_diff_clk())
+ return get_board_sys_clk();
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+
+ return 66666666;
+}
+
+#ifdef CONFIG_LPUART
+u32 get_lpuart_clk(void)
+{
+ return gd->bus_clk;
+}
+#endif
+
+int dram_init(void)
+{
+ /*
+ * When resuming from deep sleep, the I2C channel may not be
+ * in the default channel. So, switch to the default channel
+ * before accessing DDR SPD.
+ *
+ * PCA9547 mount on I2C1 bus
+ */
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ fsl_initdram();
+#if (!defined(CONFIG_SPL) && !defined(CONFIG_TFABOOT)) || \
+ defined(CONFIG_SPL_BUILD)
+ /* This will break-before-make MMU for DDR */
+ update_early_mmu_table();
+#endif
+
+ return 0;
+}
+
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+int board_early_init_f(void)
+{
+ u32 __iomem *cntcr = (u32 *)CFG_SYS_FSL_TIMER_ADDR;
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+ u32 usb_pwrfault;
+#endif
+#ifdef CONFIG_LPUART
+ u8 uart;
+#endif
+
+ /*
+ * Enable secure system counter for timer
+ */
+ out_le32(cntcr, 0x1);
+
+#if defined(CONFIG_SYS_I2C_EARLY_INIT)
+ i2c_early_init_f();
+#endif
+ fsl_lsch2_early_init_f();
+
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ out_be32(&scfg->rcwpmuxcr0, 0x3333);
+ out_be32(&scfg->usbdrvvbus_selcr, SCFG_USBDRVVBUS_SELCR_USB1);
+ usb_pwrfault = (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB3_SHIFT) |
+ (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB2_SHIFT) |
+ (SCFG_USBPWRFAULT_SHARED <<
+ SCFG_USBPWRFAULT_USB1_SHIFT);
+ out_be32(&scfg->usbpwrfault_selcr, usb_pwrfault);
+#endif
+
+#ifdef CONFIG_LPUART
+ /* We use lpuart0 as system console */
+ uart = QIXIS_READ(brdcfg[14]);
+ uart &= ~CFG_UART_MUX_MASK;
+ uart |= CFG_LPUART_EN << CFG_UART_MUX_SHIFT;
+ QIXIS_WRITE(brdcfg[14], uart);
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_FSL_DEEP_SLEEP
+/* determine if it is a warm boot */
+bool is_warm_boot(void)
+{
+#define DCFG_CCSR_CRSTSR_WDRFR (1 << 3)
+ struct ccsr_gur __iomem *gur = (void *)CFG_SYS_FSL_GUTS_ADDR;
+
+ if (in_be32(&gur->crstsr) & DCFG_CCSR_CRSTSR_WDRFR)
+ return 1;
+
+ return 0;
+}
+#endif
+
+int config_board_mux(int ctrl_type)
+{
+ u8 reg14;
+
+ reg14 = QIXIS_READ(brdcfg[14]);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_GPIO:
+ reg14 = (reg14 & (~0x6)) | 0x2;
+ break;
+ default:
+ puts("Unsupported mux interface type\n");
+ return -1;
+ }
+
+ QIXIS_WRITE(brdcfg[14], reg14);
+
+ return 0;
+}
+
+int config_serdes_mux(void)
+{
+ return 0;
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ if (hwconfig("gpio"))
+ config_board_mux(MUX_TYPE_GPIO);
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+
+#ifdef CFG_SYS_FSL_SERDES
+ config_serdes_mux();
+#endif
+
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+
+#ifdef CONFIG_NXP_ESBC
+ /*
+ * In case of Secure Boot, the IBR configures the SMMU
+ * to allow only Secure transactions.
+ * SMMU must be reset in bypass mode.
+ * Set the ClientPD bit and Clear the USFCFG Bit
+ */
+ u32 val;
+ val = (in_le32(SMMU_SCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_SCR0, val);
+ val = (in_le32(SMMU_NSCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_NSCR0, val);
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+ u8 reg;
+
+ /* fixup DT for the two DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_FMAN_ENET
+ fdt_fixup_board_enet(blob);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ reg = QIXIS_READ(brdcfg[0]);
+ reg = (reg & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ /* Disable IFC if QSPI is enabled */
+ if (reg == 0xF)
+ do_fixup_by_compat(blob, "fsl,ifc",
+ "status", "disabled", 8 + 1, 1);
+
+ return 0;
+}
+#endif
+
+u8 flash_read8(void *addr)
+{
+ return __raw_readb(addr + 1);
+}
+
+void flash_write16(u16 val, void *addr)
+{
+ u16 shftval = (((val >> 8) & 0xff) | ((val << 8) & 0xff00));
+
+ __raw_writew(shftval, addr);
+}
+
+u16 flash_read16(void *addr)
+{
+ u16 val = __raw_readw(addr);
+
+ return (((val) >> 8) & 0x00ff) | (((val) << 8) & 0xff00);
+}
+
+#if defined(CONFIG_TFABOOT) && defined(CONFIG_ENV_IS_IN_SPI_FLASH)
+void *env_sf_get_env_addr(void)
+{
+ return (void *)(CFG_SYS_FSL_QSPI_BASE + CONFIG_ENV_OFFSET);
+}
+#endif
diff --git a/board/freescale/ls1046aqds/ls1046aqds_pbi.cfg b/board/freescale/ls1046aqds/ls1046aqds_pbi.cfg
new file mode 100644
index 00000000000..5a6b7b84a4c
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds_pbi.cfg
@@ -0,0 +1,17 @@
+#Configure Scratch register
+09570600 00000000
+09570604 10000000
+#Alt base register
+09570158 00001000
+#Disable CCI barrier tranaction
+09570178 0000e010
+09180000 00000008
+#USB PHY frequency sel
+09570418 0000009e
+0957041c 0000009e
+09570420 0000009e
+#Serdes SATA
+09eb1300 80104e20
+09eb08dc 00502880
+#flush PBI data
+096100c0 000fffff
diff --git a/board/freescale/ls1046aqds/ls1046aqds_qixis.h b/board/freescale/ls1046aqds/ls1046aqds_qixis.h
new file mode 100644
index 00000000000..f371056e37a
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds_qixis.h
@@ -0,0 +1,38 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS1046AQDS_QIXIS_H__
+#define __LS1046AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1046AQDS */
+
+/* BRDCFG4[4:7] select EC1 and EC2 as a pair */
+#define BRDCFG4_EMISEL_MASK 0xe0
+#define BRDCFG4_EMISEL_SHIFT 5
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+#define QIXIS_SYSCLK_64 0x8
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+/* BRDCFG2 - SD clock*/
+#define QIXIS_SDCLK1_100 0x0
+#define QIXIS_SDCLK1_125 0x1
+#define QIXIS_SDCLK1_165 0x2
+#define QIXIS_SDCLK1_100_SP 0x3
+
+#endif
diff --git a/board/freescale/ls1046aqds/ls1046aqds_rcw_nand.cfg b/board/freescale/ls1046aqds/ls1046aqds_rcw_nand.cfg
new file mode 100644
index 00000000000..b5fc08ce2ab
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds_rcw_nand.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# serdes protocol
+0c150010 0e000000 00000000 00000000
+11335559 40005012 e0116000 c1000000
+00000000 00000000 00000000 00038800
+00000000 01001101 00000096 00000001
diff --git a/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_ifc.cfg b/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_ifc.cfg
new file mode 100644
index 00000000000..59d24d67908
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_ifc.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+# Enable IFC; disable QSPI
+0c150010 0e000000 00000000 00000000
+11335559 40005012 60040000 c1000000
+00000000 00000000 00000000 00038800
+00000000 01001101 00000096 00000001
diff --git a/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_qspi.cfg b/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_qspi.cfg
new file mode 100644
index 00000000000..9401a6f0f4f
--- /dev/null
+++ b/board/freescale/ls1046aqds/ls1046aqds_rcw_sd_qspi.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+# Enable QSPI; disable IFC
+0c150010 0e000000 00000000 00000000
+11335559 40005012 60040000 c1000000
+00000000 00000000 00000000 00038800
+20124000 01001101 00000096 00000001
diff --git a/board/freescale/ls1046ardb/Kconfig b/board/freescale/ls1046ardb/Kconfig
new file mode 100644
index 00000000000..a62255c78db
--- /dev/null
+++ b/board/freescale/ls1046ardb/Kconfig
@@ -0,0 +1,16 @@
+
+if TARGET_LS1046ARDB
+
+config SYS_BOARD
+ default "ls1046ardb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1046ardb"
+
+endif
diff --git a/board/freescale/ls1046ardb/MAINTAINERS b/board/freescale/ls1046ardb/MAINTAINERS
new file mode 100644
index 00000000000..d5a6b261519
--- /dev/null
+++ b/board/freescale/ls1046ardb/MAINTAINERS
@@ -0,0 +1,16 @@
+LS1046A BOARD
+M: Mingkai Hu <mingkai.hu@nxp.com>
+S: Maintained
+F: board/freescale/ls1046ardb/
+F: board/freescale/ls1046ardb/ls1046ardb.c
+F: include/configs/ls1046ardb.h
+F: configs/ls1046ardb_qspi_defconfig
+F: configs/ls1046ardb_qspi_spl_defconfig
+F: configs/ls1046ardb_sdcard_defconfig
+F: configs/ls1046ardb_emmc_defconfig
+F: configs/ls1046ardb_tfa_defconfig
+F: configs/ls1046ardb_tfa_SECURE_BOOT_defconfig
+F: configs/ls1046ardb_SECURE_BOOT_defconfig
+F: configs/ls1046ardb_sdcard_SECURE_BOOT_defconfig
+F: configs/ls1046ardb_qspi_SECURE_BOOT_defconfig
+F: doc/board/nxp/ls1046ardb.rst
diff --git a/board/freescale/ls1046ardb/Makefile b/board/freescale/ls1046ardb/Makefile
new file mode 100644
index 00000000000..1c13ed6b6f0
--- /dev/null
+++ b/board/freescale/ls1046ardb/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2016 Freescale Semiconductor
+
+obj-y += ddr.o
+obj-y += ls1046ardb.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_NET) += eth.o
+obj-y += cpld.o
+endif
diff --git a/board/freescale/ls1046ardb/cpld.c b/board/freescale/ls1046ardb/cpld.c
new file mode 100644
index 00000000000..7f8ca2e857f
--- /dev/null
+++ b/board/freescale/ls1046ardb/cpld.c
@@ -0,0 +1,166 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor
+ *
+ * Freescale LS1046ARDB board-specific CPLD controlling supports.
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/* Set the boot bank to the alternate bank */
+void cpld_set_altbank(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_QSPI;
+ u8 reg4 = CPLD_READ(soft_mux_on);
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+ u8 reg7 = CPLD_READ(vbank);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, reg4 | CPLD_SW_MUX_BANK_SEL | 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ reg7 = (reg7 & ~CPLD_BANK_SEL_MASK) | CPLD_BANK_SEL_ALTBANK;
+ CPLD_WRITE(vbank, reg7);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+/* Set the boot bank to the default bank */
+void cpld_set_defbank(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_QSPI;
+ u8 reg4 = CPLD_READ(soft_mux_on);
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, reg4 | CPLD_SW_MUX_BANK_SEL | 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ CPLD_WRITE(vbank, 0);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+void cpld_set_sd(void)
+{
+ u16 reg = CPLD_CFG_RCW_SRC_SD;
+ u8 reg5 = (u8)(reg >> 1);
+ u8 reg6 = (u8)(reg & 1);
+
+ cpld_rev_bit(&reg5);
+
+ CPLD_WRITE(soft_mux_on, 1);
+
+ CPLD_WRITE(cfg_rcw_src1, reg5);
+ CPLD_WRITE(cfg_rcw_src2, reg6);
+
+ CPLD_WRITE(system_rst, 1);
+}
+
+void cpld_select_core_volt(bool en_0v9)
+{
+ u8 reg17 = en_0v9;
+
+ CPLD_WRITE(vdd_en, 1);
+ CPLD_WRITE(vdd_sel, reg17);
+}
+
+#ifdef DEBUG
+static void cpld_dump_regs(void)
+{
+ printf("cpld_ver = %x\n", CPLD_READ(cpld_ver));
+ printf("cpld_ver_sub = %x\n", CPLD_READ(cpld_ver_sub));
+ printf("pcba_ver = %x\n", CPLD_READ(pcba_ver));
+ printf("soft_mux_on = %x\n", CPLD_READ(soft_mux_on));
+ printf("cfg_rcw_src1 = %x\n", CPLD_READ(cfg_rcw_src1));
+ printf("cfg_rcw_src2 = %x\n", CPLD_READ(cfg_rcw_src2));
+ printf("vbank = %x\n", CPLD_READ(vbank));
+ printf("sysclk_sel = %x\n", CPLD_READ(sysclk_sel));
+ printf("uart_sel = %x\n", CPLD_READ(uart_sel));
+ printf("sd1refclk_sel = %x\n", CPLD_READ(sd1refclk_sel));
+ printf("rgmii_1588_sel = %x\n", CPLD_READ(rgmii_1588_sel));
+ printf("1588_clk_sel = %x\n", CPLD_READ(reg_1588_clk_sel));
+ printf("status_led = %x\n", CPLD_READ(status_led));
+ printf("sd_emmc = %x\n", CPLD_READ(sd_emmc));
+ printf("vdd_en = %x\n", CPLD_READ(vdd_en));
+ printf("vdd_sel = %x\n", CPLD_READ(vdd_sel));
+ putc('\n');
+}
+#endif
+
+void cpld_rev_bit(unsigned char *value)
+{
+ u8 rev_val, val;
+ int i;
+
+ val = *value;
+ rev_val = val & 1;
+ for (i = 1; i <= 7; i++) {
+ val >>= 1;
+ rev_val <<= 1;
+ rev_val |= val & 1;
+ }
+
+ *value = rev_val;
+}
+
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else if (strcmp(argv[2], "sd") == 0)
+ cpld_set_sd();
+ else
+ cpld_set_defbank();
+#ifdef DEBUG
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+#endif
+ } else {
+ rc = cmd_usage(cmdtp);
+ }
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset: reset to default bank\n"
+ "cpld reset altbank: reset to alternate bank\n"
+ "cpld reset sd: reset to boot from SD card\n"
+#ifdef DEBUG
+ "cpld dump - display the CPLD registers\n"
+#endif
+);
diff --git a/board/freescale/ls1046ardb/cpld.h b/board/freescale/ls1046ardb/cpld.h
new file mode 100644
index 00000000000..e87044f5c0d
--- /dev/null
+++ b/board/freescale/ls1046ardb/cpld.h
@@ -0,0 +1,49 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Freescale Semiconductor
+ */
+
+#ifndef __CPLD_H__
+#define __CPLD_H__
+
+/*
+ * CPLD register set of LS1046ARDB board-specific.
+ * CPLD Revision: V2.1
+ */
+struct cpld_data {
+ u8 cpld_ver; /* 0x0 - CPLD Major Revision Register */
+ u8 cpld_ver_sub; /* 0x1 - CPLD Minor Revision Register */
+ u8 pcba_ver; /* 0x2 - PCBA Revision Register */
+ u8 system_rst; /* 0x3 - system reset register */
+ u8 soft_mux_on; /* 0x4 - Switch Control Enable Register */
+ u8 cfg_rcw_src1; /* 0x5 - RCW Source Location POR Regsiter 1 */
+ u8 cfg_rcw_src2; /* 0x6 - RCW Source Location POR Regsiter 2 */
+ u8 vbank; /* 0x7 - QSPI Flash Bank Setting Register */
+ u8 sysclk_sel; /* 0x8 - System clock POR Register */
+ u8 uart_sel; /* 0x9 - UART1 Connection Control Register */
+ u8 sd1refclk_sel; /* 0xA - */
+ u8 rgmii_1588_sel; /* 0xB - */
+ u8 reg_1588_clk_sel; /* 0xC - */
+ u8 status_led; /* 0xD - */
+ u8 global_rst; /* 0xE - */
+ u8 sd_emmc; /* 0xF - SD/EMMC Interface Control Regsiter */
+ u8 vdd_en; /* 0x10 - VDD Voltage Control Enable Register */
+ u8 vdd_sel; /* 0x11 - VDD Voltage Control Register */
+};
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+void cpld_rev_bit(unsigned char *value);
+void cpld_select_core_volt(bool en_0v9);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value) \
+ cpld_write(offsetof(struct cpld_data, reg), value)
+
+/* CPLD on IFC */
+#define CPLD_SW_MUX_BANK_SEL 0x40
+#define CPLD_BANK_SEL_MASK 0x07
+#define CPLD_BANK_SEL_ALTBANK 0x04
+#define CPLD_CFG_RCW_SRC_QSPI 0x044
+#define CPLD_CFG_RCW_SRC_SD 0x040
+#endif
diff --git a/board/freescale/ls1046ardb/ddr.c b/board/freescale/ls1046ardb/ddr.c
new file mode 100644
index 00000000000..68353022e7d
--- /dev/null
+++ b/board/freescale/ls1046ardb/ddr.c
@@ -0,0 +1,132 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+#ifdef CONFIG_FSL_DEEP_SLEEP
+#include <fsl_sleep.h>
+#endif
+#include <log.h>
+#include <asm/arch/clock.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ if (popts->registered_dimm_en)
+ pbsp = rdimms[0];
+ else
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+
+ popts->data_bus_width = 0; /* 64-bit data bus */
+ popts->bstopre = 0; /* enable auto precharge */
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm) |
+ DDR_CDR2_VREF_TRAIN_EN | DDR_CDR2_VREF_RANGE_2;
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x61;
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+#else
+ puts("Initializing DDR....using SPD\n");
+
+ dram_size = fsl_ddr_sdram();
+#endif
+
+ erratum_a008850_post();
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1046ardb/ddr.h b/board/freescale/ls1046ardb/ddr.h
new file mode 100644
index 00000000000..05baef232ab
--- /dev/null
+++ b/board/freescale/ls1046ardb/ddr.h
@@ -0,0 +1,62 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+
+void erratum_a008850_post(void);
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 8, 7, 0x08090A0C, 0x0D0F100B,},
+ {2, 1900, 0, 8, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2300, 0, 8, 7, 0x08090A0E, 0x1011120C,},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+static const struct board_specific_parameters rdimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1666, 0, 0x8, 0x0D, 0x0C0B0A08, 0x0A0B0C08,},
+ {2, 1900, 0, 0x8, 0x0E, 0x0D0C0B09, 0x0B0C0D09,},
+ {2, 2300, 0, 0xa, 0x12, 0x100F0D0C, 0x0E0F100C,},
+ {1, 1666, 0, 0x8, 0x0D, 0x0C0B0A08, 0x0A0B0C08,},
+ {1, 1900, 0, 0x8, 0x0E, 0x0D0C0B09, 0x0B0C0D09,},
+ {1, 2300, 0, 0xa, 0x12, 0x100F0D0C, 0x0E0F100C,},
+ {}
+};
+
+static const struct board_specific_parameters *rdimms[] = {
+ rdimm0,
+};
+
+#endif
diff --git a/board/freescale/ls1046ardb/eth.c b/board/freescale/ls1046ardb/eth.c
new file mode 100644
index 00000000000..fee8e0e21d4
--- /dev/null
+++ b/board/freescale/ls1046ardb/eth.c
@@ -0,0 +1,129 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ */
+#include <config.h>
+#include <fdt_support.h>
+#include <net.h>
+#include <asm/io.h>
+#include <netdev.h>
+#include <fm_eth.h>
+#include <fsl_dtsec.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+
+#include "../common/fman.h"
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_FMAN_ENET
+ int i;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ struct mii_dev *dev;
+ u32 srds_s1;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ /* Set the two on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY1_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY2_ADDR);
+
+ /* Set the two on-board SGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_PHY1_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_PHY2_ADDR);
+
+ /* Set the on-board AQ PHY address */
+ fm_info_set_phy_address(FM1_10GEC1, FM1_10GEC1_PHY_ADDR);
+
+ switch (srds_s1) {
+ case 0x1133:
+ break;
+ default:
+ printf("Invalid SerDes protocol 0x%x for LS1046ARDB\n",
+ srds_s1);
+ break;
+ }
+
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++)
+ fm_info_set_mdio(i, dev);
+
+ /* 10GBase-R on lane A, MAC 9 */
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(FM1_10GEC1, dev);
+
+ cpu_eth_init(bis);
+#endif
+
+ return pci_eth_init(bis);
+}
+
+#ifdef CONFIG_FMAN_ENET
+int fdt_update_ethernet_dt(void *blob)
+{
+ u32 srds_s1;
+ int i, prop;
+ int offset, nodeoff;
+ const char *path;
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ /* Cycle through all aliases */
+ for (prop = 0; ; prop++) {
+ const char *name;
+
+ /* FDT might have been edited, recompute the offset */
+ offset = fdt_first_property_offset(blob,
+ fdt_path_offset(blob,
+ "/aliases")
+ );
+ /* Select property number 'prop' */
+ for (i = 0; i < prop; i++)
+ offset = fdt_next_property_offset(blob, offset);
+
+ if (offset < 0)
+ break;
+
+ path = fdt_getprop_by_offset(blob, offset, &name, NULL);
+ nodeoff = fdt_path_offset(blob, path);
+
+ switch (srds_s1) {
+ case 0x1133:
+ if (!strcmp(name, "ethernet0"))
+ fdt_status_disabled(blob, nodeoff);
+
+ if (!strcmp(name, "ethernet1"))
+ fdt_status_disabled(blob, nodeoff);
+ break;
+ default:
+ printf("%s: Invalid SerDes prtcl 0x%x for LS1046ARDB\n",
+ __func__, srds_s1);
+ break;
+ }
+ }
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1046ardb/ls1046ardb.c b/board/freescale/ls1046ardb/ls1046ardb.c
new file mode 100644
index 00000000000..0492f0a8c0a
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb.c
@@ -0,0 +1,192 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2016 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <fdt_support.h>
+#include <init.h>
+#include <semihosting.h>
+#include <serial.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include <hwconfig.h>
+#include <ahci.h>
+#include <mmc.h>
+#include <scsi.h>
+#include <fm_eth.h>
+#include <fsl_csu.h>
+#include <fsl_esdhc.h>
+#include <power/mc34vr500_pmic.h>
+#include "cpld.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+struct serial_device *default_serial_console(void)
+{
+#if IS_ENABLED(CONFIG_SEMIHOSTING_SERIAL)
+ if (semihosting_enabled())
+ return &serial_smh_device;
+#endif
+ return &eserial1_device;
+}
+
+int board_early_init_f(void)
+{
+ fsl_lsch2_early_init_f();
+
+ return 0;
+}
+
+#ifndef CONFIG_SPL_BUILD
+int checkboard(void)
+{
+ static const char *freq[2] = {"100.00MHZ", "156.25MHZ"};
+ u8 cfg_rcw_src1, cfg_rcw_src2;
+ u16 cfg_rcw_src;
+ u8 sd1refclk_sel;
+
+ puts("Board: LS1046ARDB, boot from ");
+
+ cfg_rcw_src1 = CPLD_READ(cfg_rcw_src1);
+ cfg_rcw_src2 = CPLD_READ(cfg_rcw_src2);
+ cpld_rev_bit(&cfg_rcw_src1);
+ cfg_rcw_src = cfg_rcw_src1;
+ cfg_rcw_src = (cfg_rcw_src << 1) | cfg_rcw_src2;
+
+ if (cfg_rcw_src == 0x44)
+ printf("QSPI vBank %d\n", CPLD_READ(vbank));
+ else if (cfg_rcw_src == 0x40)
+ puts("SD\n");
+ else
+ puts("Invalid setting of SW5\n");
+
+ printf("CPLD: V%x.%x\nPCBA: V%x.0\n", CPLD_READ(cpld_ver),
+ CPLD_READ(cpld_ver_sub), CPLD_READ(pcba_ver));
+
+ puts("SERDES Reference Clocks:\n");
+ sd1refclk_sel = CPLD_READ(sd1refclk_sel);
+ printf("SD1_CLK1 = %s, SD1_CLK2 = %s\n", freq[sd1refclk_sel], freq[0]);
+
+ return 0;
+}
+
+int board_init(void)
+{
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+
+#ifdef CONFIG_NXP_ESBC
+ /*
+ * In case of Secure Boot, the IBR configures the SMMU
+ * to allow only Secure transactions.
+ * SMMU must be reset in bypass mode.
+ * Set the ClientPD bit and Clear the USFCFG Bit
+ */
+ u32 val;
+ val = (in_le32(SMMU_SCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_SCR0, val);
+ val = (in_le32(SMMU_NSCR0) | SCR0_CLIENTPD_MASK) & ~(SCR0_USFCFG_MASK);
+ out_le32(SMMU_NSCR0, val);
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT) && defined(CONFIG_DM_ETH)
+ pci_init();
+#endif
+
+ /* invert AQR105 IRQ pins polarity */
+ out_be32(&scfg->intpcr, AQR105_IRQ_MASK);
+
+ return 0;
+}
+
+int board_setup_core_volt(u32 vdd)
+{
+ bool en_0v9;
+
+ en_0v9 = (vdd == 900) ? true : false;
+ cpld_select_core_volt(en_0v9);
+
+ return 0;
+}
+
+int get_serdes_volt(void)
+{
+ return mc34vr500_get_sw_volt(SW4);
+}
+
+int set_serdes_volt(int svdd)
+{
+ return mc34vr500_set_sw_volt(SW4, svdd);
+}
+
+int power_init_board(void)
+{
+ int ret;
+
+ ret = power_mc34vr500_init(0);
+ if (ret)
+ return ret;
+
+ setup_chip_volt();
+
+ return 0;
+}
+
+void config_board_mux(void)
+{
+#ifdef CONFIG_HAS_FSL_XHCI_USB
+ struct ccsr_scfg *scfg = (struct ccsr_scfg *)CFG_SYS_FSL_SCFG_ADDR;
+ u32 usb_pwrfault;
+
+ /* USB3 is not used, configure mux to IIC4_SCL/IIC4_SDA */
+ out_be32(&scfg->rcwpmuxcr0, 0x3300);
+ out_be32(&scfg->usbdrvvbus_selcr, SCFG_USBDRVVBUS_SELCR_USB1);
+ usb_pwrfault = (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB3_SHIFT) |
+ (SCFG_USBPWRFAULT_DEDICATED <<
+ SCFG_USBPWRFAULT_USB2_SHIFT) |
+ (SCFG_USBPWRFAULT_SHARED <<
+ SCFG_USBPWRFAULT_USB1_SHIFT);
+ out_be32(&scfg->usbpwrfault_selcr, usb_pwrfault);
+#endif
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ config_board_mux();
+ return 0;
+}
+#endif
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ /* fixup DT for the two DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+ ft_cpu_setup(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+#endif
+
+ fdt_fixup_icid(blob);
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/ls1046ardb/ls1046ardb_pbi.cfg b/board/freescale/ls1046ardb/ls1046ardb_pbi.cfg
new file mode 100644
index 00000000000..5478217524d
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb_pbi.cfg
@@ -0,0 +1,22 @@
+#Configure Scratch register
+09570600 00000000
+09570604 10000000
+#Disable CCI barrier tranaction
+09570178 0000e010
+09180000 00000008
+#USB PHY frequency sel
+09570418 0000009e
+0957041c 0000009e
+09570420 0000009e
+#Serdes SATA
+09eb1300 80104e20
+09eb08dc 00502880
+#PEX gen3 link
+09570158 00000300
+89400890 01048000
+89500890 01048000
+89600890 01048000
+#Alt base register
+09570158 00001000
+#flush PBI data
+096100c0 000fffff
diff --git a/board/freescale/ls1046ardb/ls1046ardb_qspi_pbi.cfg b/board/freescale/ls1046ardb/ls1046ardb_qspi_pbi.cfg
new file mode 100644
index 00000000000..735d46c9f9b
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb_qspi_pbi.cfg
@@ -0,0 +1,26 @@
+#QSPI clk
+0957015c 40100000
+#Configure Scratch register
+09570600 00000000
+09570604 10000000
+#Disable CCI barrier tranaction
+09570178 0000e010
+09180000 00000008
+#USB PHY frequency sel
+09570418 0000009e
+0957041c 0000009e
+09570420 0000009e
+#Serdes SATA
+09eb1300 80104e20
+09eb08dc 00502880
+#PEX gen3 link
+09570158 00000300
+89400890 01048000
+89500890 01048000
+89600890 01048000
+#Alt base register
+09570158 00001000
+#flush PBI data
+096100c0 000fffff
+#Change endianness
+09550000 000f400c
diff --git a/board/freescale/ls1046ardb/ls1046ardb_rcw_emmc.cfg b/board/freescale/ls1046ardb/ls1046ardb_rcw_emmc.cfg
new file mode 100644
index 00000000000..ccedf87e849
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb_rcw_emmc.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+0c150012 0e000000 00000000 00000000
+11335559 40000012 60040000 c1000000
+00000000 00000000 00000000 00238800
+20124000 00003000 00000096 00000001
diff --git a/board/freescale/ls1046ardb/ls1046ardb_rcw_qspi.cfg b/board/freescale/ls1046ardb/ls1046ardb_rcw_qspi.cfg
new file mode 100644
index 00000000000..7b9be0ad3f8
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb_rcw_qspi.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+0c150010 0e000000 00000000 00000000
+11335559 40005012 40025000 c1000000
+00000000 00000000 00000000 00238800
+20124000 00003101 00000096 00000001
diff --git a/board/freescale/ls1046ardb/ls1046ardb_rcw_sd.cfg b/board/freescale/ls1046ardb/ls1046ardb_rcw_sd.cfg
new file mode 100644
index 00000000000..d3b152282f2
--- /dev/null
+++ b/board/freescale/ls1046ardb/ls1046ardb_rcw_sd.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 01ee0100
+# RCW
+0c150012 0e000000 00000000 00000000
+11335559 40005012 60040000 c1000000
+00000000 00000000 00000000 00238800
+20124000 00003101 00000096 00000001
diff --git a/board/freescale/ls1088a/Kconfig b/board/freescale/ls1088a/Kconfig
new file mode 100644
index 00000000000..1ada661743e
--- /dev/null
+++ b/board/freescale/ls1088a/Kconfig
@@ -0,0 +1,31 @@
+if TARGET_LS1088AQDS
+
+config SYS_BOARD
+ default "ls1088a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1088aqds"
+
+endif
+
+if TARGET_LS1088ARDB
+
+config SYS_BOARD
+ default "ls1088a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls1088ardb"
+
+endif
diff --git a/board/freescale/ls1088a/MAINTAINERS b/board/freescale/ls1088a/MAINTAINERS
new file mode 100644
index 00000000000..95a14149e4f
--- /dev/null
+++ b/board/freescale/ls1088a/MAINTAINERS
@@ -0,0 +1,35 @@
+LS1088ARDB BOARD
+M: Ashish Kumar <Ashish.Kumar@nxp.com>
+S: Maintained
+F: board/freescale/ls1088a/
+F: include/configs/ls1088ardb.h
+F: configs/ls1088ardb_qspi_defconfig
+F: configs/ls1088ardb_sdcard_qspi_defconfig
+F: configs/ls1088ardb_tfa_defconfig
+F: configs/ls1088ardb_tfa_SECURE_BOOT_defconfig
+
+LS1088AQDS BOARD
+M: Ashish Kumar <Ashish.Kumar@nxp.com>
+S: Maintained
+F: board/freescale/ls1088a/
+F: include/configs/ls1088aqds.h
+F: configs/ls1088aqds_qspi_defconfig
+F: configs/ls1088aqds_sdcard_qspi_defconfig
+F: configs/ls1088aqds_defconfig
+F: configs/ls1088aqds_sdcard_ifc_defconfig
+F: configs/ls1088aqds_tfa_defconfig
+
+LS1088AQDS_QSPI_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls1088aqds_qspi_SECURE_BOOT_defconfig
+
+LS1088ARDB_QSPI_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls1088ardb_qspi_SECURE_BOOT_defconfig
+
+LS1088ARDB_SD_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls1088ardb_sdcard_qspi_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls1088a/Makefile b/board/freescale/ls1088a/Makefile
new file mode 100644
index 00000000000..c2b0e7dc0f4
--- /dev/null
+++ b/board/freescale/ls1088a/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2017 NXP
+
+obj-y += ls1088a.o
+obj-y += ddr.o
+ifndef CONFIG_SPL_BUILD
+obj-$(CONFIG_TARGET_LS1088ARDB) += eth_ls1088ardb.o
+obj-$(CONFIG_TARGET_LS1088AQDS) += eth_ls1088aqds.o
+endif
diff --git a/board/freescale/ls1088a/README b/board/freescale/ls1088a/README
new file mode 100644
index 00000000000..5315909defc
--- /dev/null
+++ b/board/freescale/ls1088a/README
@@ -0,0 +1,145 @@
+Overview
+--------
+The LS1088A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports ARM SoC LS1088A and its
+derivatives.
+
+
+LS1088A SoC Overview
+--------------------------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc
+
+RDB Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+
+For QSPI Boot
+SW1 0011 0001
+SW2 x100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+For SD Boot
+SW1 0010 0000
+SW2 0100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+For eMMC Boot
+SW1 0010 0000
+SW2 1100 0000
+SW3 1111 0010
+SW4 1001 0011
+SW5 1111 0000
+
+Alternately you can use this command to switch from QSPI to SD
+
+=> i2c mw 66 0x60 0x20; i2c mw 66 10 10;i2c mw 66 10 21
+
+ LS1088ARDB board Overview
+ -------------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SATA 3.0
+ - 10GBase-R
+ - QSGMII
+ - DDR Controller
+ - One ports of 72-bits (8-bits ECC, 64-bits DATA) DDR4. Each port supports four
+ chip-selects on one DIMM connector. Support is up to 2133MT/s, Although MAX default
+ with FSL refernce software is 2100MT/s
+ - 2 QSPI-NOR Spansion(S25FS512SDSMFI011) flash of size 64MB
+ - IFC/Local Bus
+ - One 2 GB NAND flash with ECC support, not as boot source
+ - CPLD of size 2K
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC/eMMC
+ - SDHC slot and onboard eMMC are muxed together
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - 2 UART
+ - JTAG support
+ - QSPI emulator support
+ - TDM riser support
+
+QDS Default Switch Settings (1: ON; 0: OFF)
+-------------------------------------------
+
+For 16b IFC-NOR
+SW1 0001 0010
+SW2 x110 1111
+
+For QSPI Boot
+SW1 0011 0001
+SW2 0110 1111
+
+For SD Boot
+SW1 0010 0000
+SW2 0110 1111
+
+For eMMC Boot
+SW1 0010 0000
+SW2 1110 1111
+
+For I2C (ext. addr.)
+SW1 0010 0100
+SW2 1110 1111
+
+SW3 to SW12 are identical for all boot source
+
+SW3 0010 0100
+SW4 0010 0000
+SW5 1110 0111
+SW6 1110 1000
+SW7 0001 1101
+SW8 0000 1101
+SW9 1100 1010
+SW10 1110 1000
+SW11 1111 0100
+SW12 1111 1111
+
+ LS1088AQDS board Overview
+ -------------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SATA 3.0
+ - 2 10GBase-R
+ - QSGMII, SGMII with help for Riser card
+ - 2 RGMII
+ - 5 slot for Riser card or PCIe NIC
+ - DDR Controller
+ - One ports of 72-bits (8-bits ECC, 64-bits DATA) DDR4. Each port supports four
+ chip-selects on one DIMM connector. Support is up to 2133MT/s, Although MAX default
+ with FSL refernce software is 2100MT/s
+ - 2 QSPI-NOR Spansion(S25FS512SDSMFI011) flash of size 64MB
+ - IFC/Local Bus
+ - One 2 GB NAND flash with ECC support, not as boot source
+ - CPLD of size 2K
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC/eMMC
+ - SDHC/eMMC slot via adaptor
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - 2 UART
+ - JTAG support
+ - DSPI
+ - PROMJET support
+ - QSPI emulator support
+ - TDM riser support
+
+QSPI flash memory map valid for both QDS and RDB
+ Image Flash Offset
+ RCW+PBI 0x00000000
+ Boot firmware (U-Boot) 0x00100000
+ Boot firmware Environment 0x00300000
+ PPA firmware 0x00400000
+ DPAA2 MC 0x00A00000
+ DPAA2 DPL 0x00D00000
+ DPAA2 DPC 0x00E00000
+ Kernel.itb 0x01000000
diff --git a/board/freescale/ls1088a/ddr.c b/board/freescale/ls1088a/ddr.c
new file mode 100644
index 00000000000..d2e239c4d61
--- /dev/null
+++ b/board/freescale/ls1088a/ddr.c
@@ -0,0 +1,135 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2017 NXP
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <log.h>
+#include <asm/arch/soc.h>
+#include <asm/arch/clock.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if defined(CONFIG_VID) && (!defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD))
+static void fsl_ddr_setup_0v9_volt(memctl_options_t *popts)
+{
+ int vdd;
+
+ vdd = get_core_volt_from_fuse();
+ /* Nothing to do for silicons doesn't support VID */
+ if (vdd < 0)
+ return;
+
+ if (vdd == 900) {
+ popts->ddr_cdr1 |= DDR_CDR1_V0PT9_EN;
+ debug("VID: configure DDR to support 900 mV\n");
+ }
+}
+#endif
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for %lu MT/s\n",
+ ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* Enable DDR hashing */
+ popts->addr_hash = 1;
+
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_60ohm);
+#if defined(CONFIG_VID) && (!defined(CONFIG_SPL) || defined(CONFIG_SPL_BUILD))
+ fsl_ddr_setup_0v9_volt(popts);
+#endif
+
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_60ohm) |
+ DDR_CDR2_VREF_TRAIN_EN | DDR_CDR2_VREF_RANGE_2;
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+ puts("Initializing DDR....using SPD\n");
+
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+#else
+ gd->ram_size = fsl_ddr_sdram();
+#endif
+ return 0;
+}
+#endif /* CONFIG_TFABOOT */
diff --git a/board/freescale/ls1088a/ddr.h b/board/freescale/ls1088a/ddr.h
new file mode 100644
index 00000000000..b35c4ae2dad
--- /dev/null
+++ b/board/freescale/ls1088a/ddr.h
@@ -0,0 +1,48 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2017 NXP
+ */
+
+#ifndef __LS1088A_DDR_H__
+#define __LS1088A_DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+#if defined(CONFIG_TARGET_LS1088ARDB)
+
+ {2, 1666, 0, 8, 8, 0x090A0B0E, 0x0F10110D,},
+ {2, 1900, 0, 8, 9, 0x0A0B0C10, 0x1112140E,},
+ {2, 2300, 0, 8, 9, 0x0A0C0E11, 0x1214160F,},
+ {}
+#elif defined(CONFIG_TARGET_LS1088AQDS)
+ {2, 1666, 0, 8, 8, 0x0A0A0C0E, 0x0F10110C,},
+ {2, 1900, 0, 8, 9, 0x0A0B0C10, 0x1112140E,},
+ {2, 2300, 0, 4, 9, 0x0A0C0D11, 0x1214150E,},
+ {}
+
+#endif
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+#endif
diff --git a/board/freescale/ls1088a/eth_ls1088aqds.c b/board/freescale/ls1088a/eth_ls1088aqds.c
new file mode 100644
index 00000000000..e6033d251c5
--- /dev/null
+++ b/board/freescale/ls1088a/eth_ls1088aqds.c
@@ -0,0 +1,105 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2017 NXP
+ */
+
+#include <config.h>
+#include <vsprintf.h>
+#include <linux/string.h>
+#include <asm/io.h>
+#include <asm/arch/fsl_serdes.h>
+#include <fsl-mc/fsl_mc.h>
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+ mc_env_boot();
+}
+#endif /* CONFIG_RESET_PHY_R */
+
+#if defined(CONFIG_MULTI_DTB_FIT)
+
+/* Structure to hold SERDES protocols supported (network interfaces are
+ * described in the DTS).
+ *
+ * @serdes_block: the index of the SERDES block
+ * @serdes_protocol: the decimal value of the protocol supported
+ * @dts_needed: DTS notes describing the current configuration are needed
+ *
+ * When dts_needed is true, the board_fit_config_name_match() function
+ * will try to exactly match the current configuration of the block with a DTS
+ * name provided.
+ */
+static struct serdes_configuration {
+ u8 serdes_block;
+ u32 serdes_protocol;
+ bool dts_needed;
+} supported_protocols[] = {
+ /* Serdes block #1 */
+ {1, 21, true},
+ {1, 29, true},
+};
+
+#define SUPPORTED_SERDES_PROTOCOLS ARRAY_SIZE(supported_protocols)
+
+static bool protocol_supported(u8 serdes_block, u32 protocol)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol)
+ return true;
+ }
+
+ return false;
+}
+
+static void get_str_protocol(u8 serdes_block, u32 protocol, char *str)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol) {
+ if (serdes_conf.dts_needed == true)
+ sprintf(str, "%u", protocol);
+ else
+ sprintf(str, "x");
+ return;
+ }
+ }
+}
+
+int board_fit_config_name_match(const char *name)
+{
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ char expected_dts[100];
+ char srds_s1_str[2];
+ u32 srds_s1, cfg;
+
+ cfg = in_le32(&gur->rcwsr[FSL_CHASSIS3_SRDS1_REGSR - 1]) &
+ FSL_CHASSIS3_SRDS1_PRTCL_MASK;
+ cfg >>= FSL_CHASSIS3_SRDS1_PRTCL_SHIFT;
+ srds_s1 = serdes_get_number(FSL_SRDS_1, cfg);
+
+ /* Check for supported protocols. The default DTS will be used
+ * in this case
+ */
+ if (!protocol_supported(1, srds_s1))
+ return -1;
+
+ get_str_protocol(1, srds_s1, srds_s1_str);
+
+ sprintf(expected_dts, "fsl-ls1088a-qds-%s-x", srds_s1_str);
+
+ if (!strcmp(name, expected_dts))
+ return 0;
+
+ return -1;
+}
+#endif
diff --git a/board/freescale/ls1088a/eth_ls1088ardb.c b/board/freescale/ls1088a/eth_ls1088ardb.c
new file mode 100644
index 00000000000..fb6f9c1a813
--- /dev/null
+++ b/board/freescale/ls1088a/eth_ls1088ardb.c
@@ -0,0 +1,13 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2017 NXP
+ */
+
+#include <fsl-mc/fsl_mc.h>
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+ mc_env_boot();
+}
+#endif /* CONFIG_RESET_PHY_R */
diff --git a/board/freescale/ls1088a/ls1088a.c b/board/freescale/ls1088a/ls1088a.c
new file mode 100644
index 00000000000..58951f2bb2a
--- /dev/null
+++ b/board/freescale/ls1088a/ls1088a.c
@@ -0,0 +1,1034 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2017-2022 NXP
+ */
+#include <config.h>
+#include <clock_legacy.h>
+#include <display_options.h>
+#include <env.h>
+#include <i2c.h>
+#include <init.h>
+#include <log.h>
+#include <malloc.h>
+#include <errno.h>
+#include <netdev.h>
+#include <fsl_ifc.h>
+#include <fsl_ddr.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <fdt_support.h>
+#include <linux/delay.h>
+#include <linux/libfdt.h>
+#include <fsl-mc/fsl_mc.h>
+#include <env_internal.h>
+#include <asm/arch-fsl-layerscape/soc.h>
+#include <hwconfig.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/qixis.h"
+#include "ls1088a_qixis.h"
+#include "../common/vid.h"
+#include <fsl_immap.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+#ifdef CONFIG_TFABOOT
+struct ifc_regs ifc_cfg_ifc_nor_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nor0",
+ CFG_SYS_NOR0_CSPR_EARLY,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ 0,
+ CFG_SYS_NOR0_CSPR,
+ 0,
+ },
+ {
+ "nor1",
+ CFG_SYS_NOR1_CSPR_EARLY,
+ CFG_SYS_NOR0_CSPR_EXT,
+ CFG_SYS_NOR_AMASK_EARLY,
+ CFG_SYS_NOR_CSOR,
+ {
+ CFG_SYS_NOR_FTIM0,
+ CFG_SYS_NOR_FTIM1,
+ CFG_SYS_NOR_FTIM2,
+ CFG_SYS_NOR_FTIM3
+ },
+ 0,
+ CFG_SYS_NOR1_CSPR,
+ CFG_SYS_NOR_AMASK,
+ },
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ SYS_FPGA_CS_FTIM0,
+ SYS_FPGA_CS_FTIM1,
+ SYS_FPGA_CS_FTIM2,
+ SYS_FPGA_CS_FTIM3
+ },
+ 0,
+ SYS_FPGA_CSPR_FINAL,
+ 0,
+ }
+};
+
+struct ifc_regs ifc_cfg_qspi_nor_boot[CONFIG_SYS_FSL_IFC_BANK_COUNT] = {
+ {
+ "nand",
+ CFG_SYS_NAND_CSPR,
+ CFG_SYS_NAND_CSPR_EXT,
+ CFG_SYS_NAND_AMASK,
+ CFG_SYS_NAND_CSOR,
+ {
+ CFG_SYS_NAND_FTIM0,
+ CFG_SYS_NAND_FTIM1,
+ CFG_SYS_NAND_FTIM2,
+ CFG_SYS_NAND_FTIM3
+ },
+ },
+ {
+ "reserved",
+ },
+ {
+ "fpga",
+ CFG_SYS_FPGA_CSPR,
+ CFG_SYS_FPGA_CSPR_EXT,
+ SYS_FPGA_AMASK,
+ CFG_SYS_FPGA_CSOR,
+ {
+ SYS_FPGA_CS_FTIM0,
+ SYS_FPGA_CS_FTIM1,
+ SYS_FPGA_CS_FTIM2,
+ SYS_FPGA_CS_FTIM3
+ },
+ 0,
+ SYS_FPGA_CSPR_FINAL,
+ 0,
+ }
+};
+
+void ifc_cfg_boot_info(struct ifc_regs_info *regs_info)
+{
+ enum boot_src src = get_boot_src();
+
+ if (src == BOOT_SOURCE_QSPI_NOR)
+ regs_info->regs = ifc_cfg_qspi_nor_boot;
+ else
+ regs_info->regs = ifc_cfg_ifc_nor_boot;
+
+ regs_info->cs_size = CONFIG_SYS_FSL_IFC_BANK_COUNT;
+}
+#endif /* CONFIG_TFABOOT */
+#endif /* CONFIG_TARGET_LS1088AQDS */
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_SYS_I2C_EARLY_INIT) && defined(CONFIG_TARGET_LS1088AQDS)
+ i2c_early_init_f();
+#endif
+ fsl_lsch3_early_init_f();
+ return 0;
+}
+
+#ifdef CONFIG_FSL_QIXIS
+unsigned long long get_qixis_addr(void)
+{
+ unsigned long long addr;
+
+ if (gd->flags & GD_FLG_RELOC)
+ addr = QIXIS_BASE_PHYS;
+ else
+ addr = QIXIS_BASE_PHYS_EARLY;
+
+ /*
+ * IFC address under 256MB is mapped to 0x30000000, any address above
+ * is mapped to 0x5_10000000 up to 4GB.
+ */
+ addr = addr > 0x10000000 ? addr + 0x500000000ULL : addr + 0x30000000;
+
+ return addr;
+}
+#endif
+
+#if defined(CONFIG_VID)
+static int setup_core_voltage(void)
+{
+ if (adjust_vdd(0) < 0)
+ printf("core voltage not adjusted\n");
+
+ return 0;
+}
+EVENT_SPY_SIMPLE(EVT_MISC_INIT_F, setup_core_voltage);
+
+u16 soc_get_fuse_vid(int vid_index)
+{
+ static const u16 vdd[32] = {
+ 10250,
+ 9875,
+ 9750,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 9000,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 10000, /* 1.0000V */
+ 10125,
+ 10250,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ };
+
+ return vdd[vid_index];
+};
+#endif
+
+int is_pb_board(void)
+{
+ u8 board_id;
+
+ board_id = QIXIS_READ(id);
+ if (board_id == LS1088ARDB_PB_BOARD)
+ return 1;
+ else
+ return 0;
+}
+
+int fixup_ls1088ardb_pb_banner(void *fdt)
+{
+ fdt_setprop_string(fdt, 0, "model", "LS1088ARDB-PB Board");
+
+ return 0;
+}
+
+#if !defined(CONFIG_SPL_BUILD)
+int checkboard(void)
+{
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+#endif
+ char buf[64];
+ u8 sw;
+ static const char *const freq[] = {"100", "125", "156.25",
+ "100 separate SSCG"};
+ int clock;
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("Board: LS1088A-QDS, ");
+#else
+ if (is_pb_board())
+ printf("Board: LS1088ARDB-PB, ");
+ else
+ printf("Board: LS1088A-RDB, ");
+#endif
+
+ sw = QIXIS_READ(arch);
+ printf("Board Arch: V%d, ", sw >> 4);
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A' - 1);
+#else
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A');
+#endif
+
+ memset((u8 *)buf, 0x00, ARRAY_SIZE(buf));
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+#ifdef CONFIG_TFABOOT
+ if (src == BOOT_SOURCE_SD_MMC)
+ puts("SD card\n");
+#else
+#ifdef CONFIG_SD_BOOT
+ puts("SD card\n");
+#endif
+#endif /* CONFIG_TFABOOT */
+ switch (sw) {
+#ifdef CONFIG_TARGET_LS1088AQDS
+ case 0:
+ case 1:
+ case 2:
+ case 3:
+ case 4:
+ case 5:
+ case 6:
+ case 7:
+ printf("vBank: %d\n", sw);
+ break;
+ case 8:
+ puts("PromJet\n");
+ break;
+ case 15:
+ puts("IFCCard\n");
+ break;
+ case 14:
+#else
+ case 0:
+#endif
+ puts("QSPI:");
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_QMAP_MASK) >> QIXIS_QMAP_SHIFT;
+ if (sw == 0 || sw == 4)
+ puts("0\n");
+ else if (sw == 1)
+ puts("1\n");
+ else
+ puts("EMU\n");
+ break;
+
+ default:
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+ break;
+ }
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ printf("FPGA: v%d (%s), build %d",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+#else
+ printf("CPLD: v%d.%d\n", QIXIS_READ(scver), QIXIS_READ(tagdata));
+#endif
+
+ /*
+ * Display the actual SERDES reference clocks as configured by the
+ * dip switches on the board. Note that the SWx registers could
+ * technically be set to force the reference clocks to match the
+ * values that the SERDES expects (or vice versa). For now, however,
+ * we just display both values and hope the user notices when they
+ * don't match.
+ */
+ puts("SERDES1 Reference : ");
+ sw = QIXIS_READ(brdcfg[2]);
+ clock = (sw >> 6) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 4) & 3;
+ printf("Clock2 = %sMHz", freq[clock]);
+
+ puts("\nSERDES2 Reference : ");
+ clock = (sw >> 2) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 0) & 3;
+ printf("Clock2 = %sMHz\n", freq[clock]);
+
+ return 0;
+}
+#endif
+
+bool if_board_diff_clk(void)
+{
+#ifdef CONFIG_TARGET_LS1088AQDS
+ u8 diff_conf = QIXIS_READ(brdcfg[11]);
+ return diff_conf & 0x40;
+#else
+ u8 diff_conf = QIXIS_READ(dutcfg[11]);
+ return diff_conf & 0x80;
+#endif
+}
+
+#ifdef CONFIG_DYNAMIC_SYS_CLK_FREQ
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0f) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+
+ return 66666666;
+}
+#endif
+
+#ifdef CONFIG_DYNAMIC_DDR_CLK_FREQ
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ if (if_board_diff_clk())
+ return get_board_sys_clk();
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+
+ return 66666666;
+}
+#endif
+
+#if !defined(CONFIG_SPL_BUILD)
+void board_retimer_init(void)
+{
+ u8 reg;
+
+ /* Retimer is connected to I2C1_CH5 */
+ select_i2c_ch_pca9547(I2C_MUX_CH5, 0);
+
+ /* Access to Control/Shared register */
+ reg = 0x0;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, &reg, 1);
+#else
+ struct udevice *dev;
+
+ i2c_get_chip_for_busnum(0, I2C_RETIMER_ADDR, 1, &dev);
+ dm_i2c_write(dev, 0xff, &reg, 1);
+#endif
+
+ /* Read device revision and ID */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR, 1, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 1, &reg, 1);
+#endif
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0xff, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0xff, &reg, 1);
+#endif
+
+ /* Reset Channel Registers */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR, 0, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 0, &reg, 1);
+#endif
+ reg |= 0x4;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0, &reg, 1);
+#endif
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x90;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x60, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x60, &reg, 1);
+#endif
+ reg = 0xb3;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x61, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x61, &reg, 1);
+#endif
+ reg = 0x90;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x62, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x62, &reg, 1);
+#endif
+ reg = 0xb3;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x63, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x63, &reg, 1);
+#endif
+ reg = 0xcd;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x64, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x64, &reg, 1);
+#endif
+
+ /* Select VCO Divider to full rate (000) */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR, 0x2F, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 0x2F, &reg, 1);
+#endif
+ reg &= 0x0f;
+ reg |= 0x70;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR, 0x2F, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x2F, &reg, 1);
+#endif
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ /* Retimer is connected to I2C1_CH5 */
+ select_i2c_ch_pca9547(I2C_MUX_CH5, 0);
+
+ /* Access to Control/Shared register */
+ reg = 0x0;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0xff, 1, &reg, 1);
+#else
+ i2c_get_chip_for_busnum(0, I2C_RETIMER_ADDR2, 1, &dev);
+ dm_i2c_write(dev, 0xff, &reg, 1);
+#endif
+
+ /* Read device revision and ID */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR2, 1, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 1, &reg, 1);
+#endif
+ debug("Retimer version id = 0x%x\n", reg);
+
+ /* Enable Broadcast. All writes target all channel register sets */
+ reg = 0x0c;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0xff, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0xff, &reg, 1);
+#endif
+
+ /* Reset Channel Registers */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR2, 0, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 0, &reg, 1);
+#endif
+ reg |= 0x4;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0, &reg, 1);
+#endif
+
+ /* Set data rate as 10.3125 Gbps */
+ reg = 0x90;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x60, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x60, &reg, 1);
+#endif
+ reg = 0xb3;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x61, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x61, &reg, 1);
+#endif
+ reg = 0x90;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x62, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x62, &reg, 1);
+#endif
+ reg = 0xb3;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x63, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x63, &reg, 1);
+#endif
+ reg = 0xcd;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x64, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x64, &reg, 1);
+#endif
+
+ /* Select VCO Divider to full rate (000) */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_read(I2C_RETIMER_ADDR2, 0x2F, 1, &reg, 1);
+#else
+ dm_i2c_read(dev, 0x2F, &reg, 1);
+#endif
+ reg &= 0x0f;
+ reg |= 0x70;
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ i2c_write(I2C_RETIMER_ADDR2, 0x2F, 1, &reg, 1);
+#else
+ dm_i2c_write(dev, 0x2F, &reg, 1);
+#endif
+
+#endif
+ /*return the default channel*/
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+#ifdef CONFIG_TARGET_LS1088ARDB
+ u8 brdcfg5;
+
+ if (hwconfig("esdhc-force-sd")) {
+ brdcfg5 = QIXIS_READ(brdcfg[5]);
+ brdcfg5 &= ~BRDCFG5_SPISDHC_MASK;
+ brdcfg5 |= BRDCFG5_FORCE_SD;
+ QIXIS_WRITE(brdcfg[5], brdcfg5);
+ }
+#endif
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+ u8 brdcfg4, brdcfg5;
+
+ if (hwconfig("dspi-on-board")) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_USBOSC_MASK;
+ brdcfg4 |= BRDCFG4_SPI;
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+
+ brdcfg5 = QIXIS_READ(brdcfg[5]);
+ brdcfg5 &= ~BRDCFG5_SPR_MASK;
+ brdcfg5 |= BRDCFG5_SPI_ON_BOARD;
+ QIXIS_WRITE(brdcfg[5], brdcfg5);
+ } else if (hwconfig("dspi-off-board")) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_USBOSC_MASK;
+ brdcfg4 |= BRDCFG4_SPI;
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+
+ brdcfg5 = QIXIS_READ(brdcfg[5]);
+ brdcfg5 &= ~BRDCFG5_SPR_MASK;
+ brdcfg5 |= BRDCFG5_SPI_OFF_BOARD;
+ QIXIS_WRITE(brdcfg[5], brdcfg5);
+ }
+#endif
+ return 0;
+}
+#endif
+#endif
+
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+#ifdef CONFIG_TARGET_LS1088AQDS
+/* read the current value(SVDD) of the LTM Regulator Voltage */
+int get_serdes_volt(void)
+{
+ int ret, vcode = 0;
+ u8 chan = PWM_CHANNEL0;
+
+ /* Select the PAGE 0 using PMBus commands PAGE for VDD */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_write(I2C_SVDD_MONITOR_ADDR,
+ PMBUS_CMD_PAGE, 1, &chan, 1);
+#else
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(0, I2C_SVDD_MONITOR_ADDR, 1, &dev);
+ if (!ret)
+ ret = dm_i2c_write(dev, PMBUS_CMD_PAGE,
+ &chan, 1);
+#endif
+
+ if (ret) {
+ printf("VID: failed to select VDD Page 0\n");
+ return ret;
+ }
+
+ /* Read the output voltage using PMBus command READ_VOUT */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_read(I2C_SVDD_MONITOR_ADDR,
+ PMBUS_CMD_READ_VOUT, 1, (void *)&vcode, 2);
+#else
+ dm_i2c_read(dev, PMBUS_CMD_READ_VOUT, (void *)&vcode, 2);
+#endif
+ if (ret) {
+ printf("VID: failed to read the volatge\n");
+ return ret;
+ }
+
+ return vcode;
+}
+
+int set_serdes_volt(int svdd)
+{
+ int ret, vdd_last;
+ u8 buff[5] = {0x04, PWM_CHANNEL0, PMBUS_CMD_VOUT_COMMAND,
+ svdd & 0xFF, (svdd & 0xFF00) >> 8};
+
+ /* Write the desired voltage code to the SVDD regulator */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_write(I2C_SVDD_MONITOR_ADDR,
+ PMBUS_CMD_PAGE_PLUS_WRITE, 1, (void *)&buff, 5);
+#else
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(0, I2C_SVDD_MONITOR_ADDR, 1, &dev);
+ if (!ret)
+ ret = dm_i2c_write(dev, PMBUS_CMD_PAGE_PLUS_WRITE,
+ (void *)&buff, 5);
+#endif
+ if (ret) {
+ printf("VID: I2C failed to write to the volatge regulator\n");
+ return -1;
+ }
+
+ /* Wait for the volatge to get to the desired value */
+ do {
+ vdd_last = get_serdes_volt();
+ if (vdd_last < 0) {
+ printf("VID: Couldn't read sensor abort VID adjust\n");
+ return -1;
+ }
+ } while (vdd_last != svdd);
+
+ return 1;
+}
+#else
+int get_serdes_volt(void)
+{
+ return 0;
+}
+
+int set_serdes_volt(int svdd)
+{
+ int ret;
+ u8 brdcfg4;
+
+ printf("SVDD changing of RDB\n");
+
+ /* Read the BRDCFG54 via CLPD */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_read(CFG_SYS_I2C_FPGA_ADDR,
+ QIXIS_BRDCFG4_OFFSET, 1, (void *)&brdcfg4, 1);
+#else
+ struct udevice *dev;
+
+ ret = i2c_get_chip_for_busnum(0, CFG_SYS_I2C_FPGA_ADDR, 1, &dev);
+ if (!ret)
+ ret = dm_i2c_read(dev, QIXIS_BRDCFG4_OFFSET,
+ (void *)&brdcfg4, 1);
+#endif
+
+ if (ret) {
+ printf("VID: I2C failed to read the CPLD BRDCFG4\n");
+ return -1;
+ }
+
+ brdcfg4 = brdcfg4 | 0x08;
+
+ /* Write to the BRDCFG4 */
+#if !CONFIG_IS_ENABLED(DM_I2C)
+ ret = i2c_write(CFG_SYS_I2C_FPGA_ADDR,
+ QIXIS_BRDCFG4_OFFSET, 1, (void *)&brdcfg4, 1);
+#else
+ ret = dm_i2c_write(dev, QIXIS_BRDCFG4_OFFSET,
+ (void *)&brdcfg4, 1);
+#endif
+
+ if (ret) {
+ debug("VID: I2C failed to set the SVDD CPLD BRDCFG4\n");
+ return -1;
+ }
+
+ /* Wait for the volatge to get to the desired value */
+ udelay(10000);
+
+ return 1;
+}
+#endif
+
+/* this function disables the SERDES, changes the SVDD Voltage and enables it*/
+int board_adjust_vdd(int vdd)
+{
+ int ret = 0;
+
+ debug("%s: vdd = %d\n", __func__, vdd);
+
+ /* Special settings to be performed when voltage is 900mV */
+ if (vdd == 900) {
+ ret = setup_serdes_volt(vdd);
+ if (ret < 0) {
+ ret = -1;
+ goto exit;
+ }
+ }
+exit:
+ return ret;
+}
+
+#if !defined(CONFIG_SPL_BUILD)
+int board_init(void)
+{
+ init_final_memctl_regs();
+#if defined(CONFIG_TARGET_LS1088ARDB) && defined(CONFIG_FSL_MC_ENET)
+ u32 __iomem *irq_ccsr = (u32 __iomem *)ISC_BASE;
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ board_retimer_init();
+
+#if defined(CONFIG_TARGET_LS1088ARDB) && defined(CONFIG_FSL_MC_ENET)
+ /* invert AQR105 IRQ pins polarity */
+ out_le32(irq_ccsr + IRQCR_OFFSET / 4, AQR105_IRQ_MASK);
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT)
+ pci_init();
+#endif
+
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ puts("\nDDR ");
+ print_size(gd->bd->bi_dram[0].size + gd->bd->bi_dram[1].size, "");
+ print_ddr_info(0);
+}
+
+#ifdef CONFIG_FSL_MC_ENET
+void board_quiesce_devices(void)
+{
+ fsl_mc_ldpaa_exit(gd->bd);
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ int offset;
+
+ offset = fdt_path_offset(fdt, "/fsl-mc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/soc/fsl-mc");
+
+ if (offset < 0) {
+ printf("%s: ERROR: fsl-mc node not found in device tree (error %d)\n",
+ __func__, offset);
+ return;
+ }
+
+ if (get_mc_boot_status() == 0 &&
+ (is_lazy_dpl_addr_valid() || get_dpl_apply_status() == 0))
+ fdt_status_okay(fdt, offset);
+ else
+ fdt_status_fail(fdt, offset);
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+void fsl_fdt_fixup_flash(void *fdt)
+{
+ int offset;
+#ifdef CONFIG_TFABOOT
+ u32 __iomem *dcfg_ccsr = (u32 __iomem *)DCFG_BASE;
+ u32 val;
+#endif
+
+/*
+ * IFC-NOR and QSPI are muxed on SoC.
+ * So disable IFC node in dts if QSPI is enabled or
+ * disable QSPI node in dts in case QSPI is not enabled.
+ */
+
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+ bool disable_ifc = false;
+
+ switch (src) {
+ case BOOT_SOURCE_IFC_NOR:
+ disable_ifc = false;
+ break;
+ case BOOT_SOURCE_QSPI_NOR:
+ disable_ifc = true;
+ break;
+ default:
+ val = in_le32(dcfg_ccsr + DCFG_RCWSR15 / 4);
+ if (DCFG_RCWSR15_IFCGRPABASE_QSPI == (val & (u32)0x3))
+ disable_ifc = true;
+ break;
+ }
+
+ if (disable_ifc) {
+ offset = fdt_path_offset(fdt, "/soc/memory-controller/nor");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/memory-controller/nor");
+ } else {
+ offset = fdt_path_offset(fdt, "/soc/quadspi");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/quadspi");
+ }
+
+#else
+#ifdef CONFIG_FSL_QSPI
+ offset = fdt_path_offset(fdt, "/soc/memory-controller/nor");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/memory-controller/nor");
+#else
+ offset = fdt_path_offset(fdt, "/soc/quadspi");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/quadspi");
+#endif
+#endif
+ if (offset < 0)
+ return;
+
+ fdt_status_disabled(fdt, offset);
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ int i;
+ u16 mc_memory_bank = 0;
+
+ u64 *base;
+ u64 *size;
+ u64 mc_memory_base = 0;
+ u64 mc_memory_size = 0;
+ u16 total_memory_banks;
+
+ ft_cpu_setup(blob, bd);
+
+ fdt_fixup_mc_ddr(&mc_memory_base, &mc_memory_size);
+
+ if (mc_memory_base != 0)
+ mc_memory_bank++;
+
+ total_memory_banks = CONFIG_NR_DRAM_BANKS + mc_memory_bank;
+
+ base = calloc(total_memory_banks, sizeof(u64));
+ size = calloc(total_memory_banks, sizeof(u64));
+
+ /* fixup DT for the two GPP DDR banks */
+ for (i = 0; i < CONFIG_NR_DRAM_BANKS; i++) {
+ base[i] = gd->bd->bi_dram[i].start;
+ size[i] = gd->bd->bi_dram[i].size;
+ }
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+#endif
+
+ if (mc_memory_base != 0) {
+ for (i = 0; i <= total_memory_banks; i++) {
+ if (base[i] == 0 && size[i] == 0) {
+ base[i] = mc_memory_base;
+ size[i] = mc_memory_size;
+ break;
+ }
+ }
+ }
+
+ fdt_fixup_memory_banks(blob, base, size, total_memory_banks);
+
+ fdt_fsl_mc_fixup_iommu_map_entry(blob);
+
+ fsl_fdt_fixup_flash(blob);
+
+#ifdef CONFIG_FSL_MC_ENET
+ fdt_fixup_board_enet(blob);
+ fdt_reserve_mc_mem(blob, 0x300);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ if (is_pb_board())
+ fixup_ls1088ardb_pb_banner(blob);
+
+ return 0;
+}
+#endif
+#endif /* defined(CONFIG_SPL_BUILD) */
+
+#ifdef CONFIG_TFABOOT
+#ifdef CONFIG_MTD_NOR_FLASH
+int is_flash_available(void)
+{
+ char *env_hwconfig = env_get("hwconfig");
+ enum boot_src src = get_boot_src();
+ int is_nor_flash_available = 1;
+
+ switch (src) {
+ case BOOT_SOURCE_IFC_NOR:
+ is_nor_flash_available = 1;
+ break;
+ case BOOT_SOURCE_QSPI_NOR:
+ is_nor_flash_available = 0;
+ break;
+ /*
+ * In Case of SD boot,if qspi is defined in env_hwconfig
+ * disable nor flash probe.
+ */
+ default:
+ if (hwconfig_f("qspi", env_hwconfig))
+ is_nor_flash_available = 0;
+ break;
+ }
+ return is_nor_flash_available;
+}
+#endif
+
+#ifdef CONFIG_ENV_IS_IN_SPI_FLASH
+void *env_sf_get_env_addr(void)
+{
+ return (void *)(CFG_SYS_FSL_QSPI_BASE + CONFIG_ENV_OFFSET);
+}
+#endif
+#endif
diff --git a/board/freescale/ls1088a/ls1088a_qixis.h b/board/freescale/ls1088a/ls1088a_qixis.h
new file mode 100644
index 00000000000..e3502eb1d19
--- /dev/null
+++ b/board/freescale/ls1088a/ls1088a_qixis.h
@@ -0,0 +1,55 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2017 NXP
+ */
+
+#ifndef __LS1088AQDS_QIXIS_H__
+#define __LS1088AQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for LS1088AQDS */
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+/* BRDCFG2 - SD clock*/
+#define QIXIS_SDCLK1_100 0x0
+#define QIXIS_SDCLK1_125 0x1
+#define QIXIS_SDCLK1_165 0x2
+#define QIXIS_SDCLK1_100_SP 0x3
+
+#define BRDCFG4_EMISEL_MASK 0xE0
+#define BRDCFG4_EMISEL_SHIFT 5
+#define BRDCFG9_SFPTX_MASK 0x10
+#define BRDCFG9_SFPTX_SHIFT 4
+
+/* Definitions of QIXIS Registers for LS1088ARDB */
+
+/* BRDCFG5 */
+#define BRDCFG5_SPISDHC_MASK 0x0C
+#define BRDCFG5_FORCE_SD 0x08
+
+/* Definitions of QIXIS Registers for LS1088AQDS */
+
+/* BRDCFG4 */
+#define BRDCFG4_USBOSC_MASK 0x01
+#define BRDCFG4_SPI 0x01
+
+/* BRDCFG5 */
+#define BRDCFG5_SPR_MASK 0x0f
+#define BRDCFG5_SPI_ON_BOARD 0x0a
+#define BRDCFG5_SPI_OFF_BOARD 0x0f
+
+#endif
diff --git a/board/freescale/ls2080aqds/Kconfig b/board/freescale/ls2080aqds/Kconfig
new file mode 100644
index 00000000000..2f997e9de1a
--- /dev/null
+++ b/board/freescale/ls2080aqds/Kconfig
@@ -0,0 +1,16 @@
+
+if TARGET_LS2080AQDS
+
+config SYS_BOARD
+ default "ls2080aqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls2080aqds"
+
+endif
diff --git a/board/freescale/ls2080aqds/MAINTAINERS b/board/freescale/ls2080aqds/MAINTAINERS
new file mode 100644
index 00000000000..fdad199ec25
--- /dev/null
+++ b/board/freescale/ls2080aqds/MAINTAINERS
@@ -0,0 +1,13 @@
+LS2080A BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: board/freescale/ls2080aqds/
+F: board/freescale/ls2080a/ls2080aqds.c
+F: include/configs/ls2080aqds.h
+F: configs/ls2080aqds_defconfig
+F: configs/ls2080aqds_nand_defconfig
+F: configs/ls2080aqds_qspi_defconfig
+F: configs/ls2080aqds_sdcard_defconfig
+F: configs/ls2088aqds_tfa_defconfig
+F: configs/ls2080aqds_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls2080aqds/Makefile b/board/freescale/ls2080aqds/Makefile
new file mode 100644
index 00000000000..efc51b4a34d
--- /dev/null
+++ b/board/freescale/ls2080aqds/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2015 Freescale Semiconductor
+
+obj-y += ls2080aqds.o
+obj-y += ddr.o
+obj-y += eth.o
diff --git a/board/freescale/ls2080aqds/README b/board/freescale/ls2080aqds/README
new file mode 100644
index 00000000000..a4cb1a6cac4
--- /dev/null
+++ b/board/freescale/ls2080aqds/README
@@ -0,0 +1,215 @@
+Overview
+--------
+The LS2080A Development System (QDS) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS2080A
+and LS2088A Layerscape Architecture processor. The LS2080AQDS provides
+validation and SW development platform for the Freescale LS2080A, LS2088A
+processor series, with a complete debugging environment.
+
+LS2080A, LS2088A SoC Overview
+--------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS2080A,
+LS2088A SoC overview.
+
+ LS2080AQDS board Overview
+ -----------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SGMII, SGMII 2.5
+ - QSGMII
+ - SATA 3.0
+ - XAUI
+ - 10GBase-R
+ - DDR Controller
+ - Two ports of 72-bits (8-bits ECC) DDR4. Each port supports four
+ chip-selects and two DIMM connectors. Support is up to 2133MT/s.
+ - One port of 40-bits (8-bits ECC) DDR4 which supports four chip-selects
+ and two DIMM connectors. Support is up to 1600MT/s.
+ -IFC/Local Bus
+ - IFC rev. 2.0 implementation supporting Little Endian connection scheme.
+ - One in-socket 128 MB NOR flash 16-bit data bus
+ - One 512 MB NAND flash with ECC support
+ - IFC Test Port
+ - PromJet Port
+ - FPGA connection
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC: PCIe x1 Right Angle connector for supporting following cards
+ - 1/4-/8-bit SD/MMC Legacy CARD supporting 3.3V devices only
+ - 1-/4-/8-bit SD/MMC Card supporting 1.8V devices only
+ - 4-bit eMMC Card Rev 4.4 (1.8V only)
+ - 8-bit eMMC Card Rev 4.5 (1.8V only)
+ - SD Card Rev 2.0 and Rev 3.0
+ - DSPI: 3 high-speed flash Memory for storage
+ - 16 MB high-speed flash Memory for boot code and storage (up to 108MHz)
+ - 8 MB high-speed flash Memory (up to 104 MHz)
+ - 512 MB low-speed flash Memory (up to 40 MHz)
+ - QSPI: via NAND/QSPI Card
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - UART
+ - Two 4-pin (HW control) or four 2-pin (SW control) serial ports at up to 115.2 Kbit/s
+ - Two DB9 D-Type connectors supporting one Serial port each
+ - ARM JTAG support
+
+Memory map from core's view
+----------------------------
+0x00_0000_0000 .. 0x00_000F_FFFF Boot Rom
+0x00_0100_0000 .. 0x00_0FFF_FFFF CCSR
+0x00_1800_0000 .. 0x00_181F_FFFF OCRAM
+0x00_3000_0000 .. 0x00_3FFF_FFFF IFC region #1
+0x00_8000_0000 .. 0x00_FFFF_FFFF DDR region #1
+0x05_1000_0000 .. 0x05_FFFF_FFFF IFC region #2
+0x80_8000_0000 .. 0xFF_FFFF_FFFF DDR region #2
+
+Other addresses are either reserved, or not used directly by U-Boot.
+This list should be updated when more addresses are used.
+
+IFC region map from core's view
+-------------------------------
+During boot i.e. IFC Region #1:-
+ 0x30000000 - 0x37ffffff : 128MB : NOR flash
+ 0x38000000 - 0x3BFFFFFF : 64MB : Promjet
+ 0x3C000000 - 0x40000000 : 64MB : FPGA etc
+
+After relocate to DDR i.e. IFC Region #2:-
+ 0x5_1000_0000..0x5_1fff_ffff Memory Hole
+ 0x5_2000_0000..0x5_3fff_ffff IFC CSx (FPGA, NAND and others 512MB)
+ 0x5_4000_0000..0x5_7fff_ffff ASIC or others 1GB
+ 0x5_8000_0000..0x5_bfff_ffff IFC CS0 1GB (NOR/Promjet)
+ 0x5_C000_0000..0x5_ffff_ffff IFC CS1 1GB (NOR/Promjet)
+
+Booting Options
+---------------
+a) Promjet Boot
+b) NOR boot
+c) NAND boot
+d) SD boot
+e) QSPI boot
+
+Memory map for NOR boot
+-------------------------
+Image Flash Offset
+RCW+PBI 0x00000000
+Boot firmware (U-Boot) 0x00100000
+Boot firmware Environment 0x00300000
+PPA firmware 0x00400000
+Secure Headers 0x00600000
+DPAA2 MC 0x00A00000
+DPAA2 DPL 0x00D00000
+DPAA2 DPC 0x00E00000
+Kernel.itb 0x01000000
+
+Memory map for SD boot
+-------------------------
+Image Flash Offset SD Card
+ Start Block No.
+RCW+PBI 0x00000000 0x00008
+Boot firmware (U-Boot) 0x00100000 0x00800
+Boot firmware Environment 0x00300000 0x01800
+PPA firmware 0x00400000 0x02000
+DPAA2 MC 0x00A00000 0x05000
+DPAA2 DPL 0x00D00000 0x06800
+DPAA2 DPC 0x00E00000 0x07000
+Kernel.itb 0x01000000 0x08000
+
+Environment Variables
+---------------------
+- mcboottimeout: MC boot timeout in milliseconds. If this variable is not defined
+ the value CFG_SYS_LS_MC_BOOT_TIMEOUT_MS will be assumed.
+
+- mcmemsize: MC DRAM block size. If this variable is not defined
+ the value CFG_SYS_LS_MC_DRAM_BLOCK_MIN_SIZE will be assumed.
+
+Booting Linux flavors which do not support 48-bit VA (< Linux 3.18)
+-------------------------------------------------------------------
+One needs to use appropriate bootargs to boot Linux flavors which do
+not support 48-bit VA (for e.g. < Linux 3.18) by appending mem=2048M, as shown
+below:
+
+=> setenv bootargs 'console=ttyS1,115200 root=/dev/ram
+ earlycon=uart8250,mmio,0x21c0600,115200 default_hugepagesz=2m hugepagesz=2m
+ hugepages=16 mem=2048M'
+
+
+X-QSGMII-16PORT riser card
+----------------------------
+The X-QSGMII-16PORT is a 4xQSGMII/8xSGMII riser card with eighth SerDes
+interfaces implemented in PCIe form factor board.
+It supports following:
+ - Card can operate with up to 4 QSGMII lane simultaneously
+ - Card can operate with up to 8 SGMII lane simultaneously
+
+Supported card configuration
+ - CSEL : ON ON ON ON
+ - MSEL1 : ON ON ON ON OFF OFF OFF OFF
+ - MSEL2 : OFF OFF OFF OFF ON ON ON ON
+
+To enable this card: modify hwconfig to add "xqsgmii" variable.
+
+Supported PHY addresses during SGMII:
+#define XQSGMII_CARD_PHY1_PORT0_ADDR 0x0
+#define XQSGMII_CARD_PHY1_PORT2_ADDR 0x2
+#define XQSGMII_CARD_PHY2_PORT0_ADDR 0x4
+#define XQSGMII_CARD_PHY2_PORT2_ADDR 0x6
+#define XQSGMII_CARD_PHY3_PORT0_ADDR 0x8
+#define XQSGMII_CARD_PHY3_PORT2_ADDR 0xa
+#define XQSGMII_CARD_PHY4_PORT0_ADDR 0xc
+#define XQSGMII_CARD_PHY4_PORT2_ADDR 0xe
+
+Mapping DPMACx to PHY during SGMII
+DPMAC1 -> PHY1-P0
+DPMAC2 -> PHY2-P0
+DPMAC3 -> PHY3-P0
+DPMAC4 -> PHY4-P0
+DPMAC5 -> PHY3-P2
+DPMAC6 -> PHY1-P2
+DPMAC7 -> PHY4-P1
+DPMAC8 -> PHY2-P2
+DPMAC9 -> PHY1-P0
+DPMAC10 -> PHY2-P0
+DPMAC11 -> PHY3-P0
+DPMAC12 -> PHY4-P0
+DPMAC13 -> PHY3-P2
+DPMAC14 -> PHY1-P2
+DPMAC15 -> PHY4-P1
+DPMAC16 -> PHY2-P2
+
+
+Supported PHY address during QSGMII
+#define XQSGMII_CARD_PHY1_PORT0_ADDR 0x0
+#define XQSGMII_CARD_PHY1_PORT1_ADDR 0x1
+#define XQSGMII_CARD_PHY1_PORT2_ADDR 0x2
+#define XQSGMII_CARD_PHY1_PORT3_ADDR 0x3
+#define XQSGMII_CARD_PHY2_PORT0_ADDR 0x4
+#define XQSGMII_CARD_PHY2_PORT1_ADDR 0x5
+#define XQSGMII_CARD_PHY2_PORT2_ADDR 0x6
+#define XQSGMII_CARD_PHY2_PORT3_ADDR 0x7
+#define XQSGMII_CARD_PHY3_PORT0_ADDR 0x8
+#define XQSGMII_CARD_PHY3_PORT1_ADDR 0x9
+#define XQSGMII_CARD_PHY3_PORT2_ADDR 0xa
+#define XQSGMII_CARD_PHY3_PORT3_ADDR 0xb
+#define XQSGMII_CARD_PHY4_PORT0_ADDR 0xc
+#define XQSGMII_CARD_PHY4_PORT1_ADDR 0xd
+#define XQSGMII_CARD_PHY4_PORT2_ADDR 0xe
+#define XQSGMII_CARD_PHY4_PORT3_ADDR 0xf
+
+Mapping DPMACx to PHY during QSGMII
+DPMAC1 -> PHY1-P3
+DPMAC2 -> PHY1-P2
+DPMAC3 -> PHY1-P1
+DPMAC4 -> PHY1-P0
+DPMAC5 -> PHY2-P3
+DPMAC6 -> PHY2-P2
+DPMAC7 -> PHY2-P1
+DPMAC8 -> PHY2-P0
+DPMAC9 -> PHY3-P0
+DPMAC10 -> PHY3-P1
+DPMAC11 -> PHY3-P2
+DPMAC12 -> PHY3-P3
+DPMAC13 -> PHY4-P0
+DPMAC14 -> PHY4-P1
+DPMAC15 -> PHY4-P2
+DPMAC16 -> PHY4-P3
diff --git a/board/freescale/ls2080aqds/ddr.c b/board/freescale/ls2080aqds/ddr.c
new file mode 100644
index 00000000000..2986ffb7a82
--- /dev/null
+++ b/board/freescale/ls2080aqds/ddr.c
@@ -0,0 +1,182 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <log.h>
+#include <asm/arch/soc.h>
+#include <asm/arch/clock.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ u8 dq_mapping_0, dq_mapping_2, dq_mapping_3;
+#endif
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+ int slot;
+
+ if (ctrl_num > 2) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+
+ for (slot = 0; slot < CONFIG_DIMM_SLOTS_PER_CTLR; slot++) {
+ if (pdimm[slot].n_ranks)
+ break;
+ }
+
+ if (slot >= CONFIG_DIMM_SLOTS_PER_CTLR)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ if (popts->registered_dimm_en)
+ pbsp = rdimms[ctrl_num];
+ else
+ pbsp = udimms[ctrl_num];
+
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(ctrl_num) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm[slot].n_ranks &&
+ (pdimm[slot].rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for data rate %lu MT/s\n"
+ "Trying to use the highest speed (%u) parameters\n",
+ ddr_freq, pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ if (ctrl_num == CONFIG_DP_DDR_CTRL) {
+ /* force DDR bus width to 32 bits */
+ popts->data_bus_width = 1;
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+ popts->bstopre = 0; /* enable auto precharge */
+ /*
+ * Layout optimization results byte mapping
+ * Byte 0 -> Byte ECC
+ * Byte 1 -> Byte 3
+ * Byte 2 -> Byte 2
+ * Byte 3 -> Byte 1
+ * Byte ECC -> Byte 0
+ */
+ dq_mapping_0 = pdimm[slot].dq_mapping[0];
+ dq_mapping_2 = pdimm[slot].dq_mapping[2];
+ dq_mapping_3 = pdimm[slot].dq_mapping[3];
+ pdimm[slot].dq_mapping[0] = pdimm[slot].dq_mapping[8];
+ pdimm[slot].dq_mapping[1] = pdimm[slot].dq_mapping[9];
+ pdimm[slot].dq_mapping[2] = pdimm[slot].dq_mapping[6];
+ pdimm[slot].dq_mapping[3] = pdimm[slot].dq_mapping[7];
+ pdimm[slot].dq_mapping[6] = dq_mapping_2;
+ pdimm[slot].dq_mapping[7] = dq_mapping_3;
+ pdimm[slot].dq_mapping[8] = dq_mapping_0;
+ pdimm[slot].dq_mapping[9] = 0;
+ pdimm[slot].dq_mapping[10] = 0;
+ pdimm[slot].dq_mapping[11] = 0;
+ pdimm[slot].dq_mapping[12] = 0;
+ pdimm[slot].dq_mapping[13] = 0;
+ pdimm[slot].dq_mapping[14] = 0;
+ pdimm[slot].dq_mapping[15] = 0;
+ pdimm[slot].dq_mapping[16] = 0;
+ pdimm[slot].dq_mapping[17] = 0;
+ }
+#endif
+ /* To work at higher than 1333MT/s */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0x0; /* 32 clocks */
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ if (ddr_freq < 2350) {
+ if (pdimm[0].n_ranks == 2 && pdimm[1].n_ranks == 2) {
+ /* four chip-selects */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm);
+ popts->twot_en = 1; /* enable 2T timing */
+ } else {
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_60ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_60ohm) |
+ DDR_CDR2_VREF_RANGE_2;
+ }
+ } else {
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_100ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_100ohm) |
+ DDR_CDR2_VREF_RANGE_2;
+ }
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+#else
+ puts("Initializing DDR....using SPD\n");
+
+ gd->ram_size = fsl_ddr_sdram();
+#endif
+
+ return 0;
+}
+#endif /* CONFIG_TFABOOT */
diff --git a/board/freescale/ls2080aqds/ddr.h b/board/freescale/ls2080aqds/ddr.h
new file mode 100644
index 00000000000..b5d790a4a05
--- /dev/null
+++ b/board/freescale/ls2080aqds/ddr.h
@@ -0,0 +1,91 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 8, 7, 0x08090A0C, 0x0D0F100B,},
+ {2, 1900, 0, 8, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2300, 0, 8, 8, 0x090A0C0F, 0x1012130C,},
+ {}
+};
+
+/* DP-DDR DIMM */
+static const struct board_specific_parameters udimm2[] = {
+ /*
+ * memory controller 2
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 0xd, 0x0C0A0A00, 0x00000009,},
+ {2, 1666, 0, 8, 0xd, 0x0C0A0A00, 0x00000009,},
+ {2, 1900, 0, 8, 0xe, 0x0D0C0B00, 0x0000000A,},
+ {2, 2200, 0, 8, 0xe, 0x0D0C0B00, 0x0000000A,},
+ {}
+};
+
+static const struct board_specific_parameters rdimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 8, 7, 0x08090A0C, 0x0D0F100B,},
+ {2, 1900, 0, 8, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2200, 0, 8, 8, 0x090A0C0F, 0x1012130C,},
+ {}
+};
+
+/* DP-DDR DIMM */
+static const struct board_specific_parameters rdimm2[] = {
+ /*
+ * memory controller 2
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 8, 7, 0x0B0A090C, 0x0D0F100B,},
+ {2, 1900, 0, 8, 7, 0x09090B0D, 0x0E10120B,},
+ {2, 2200, 0, 8, 8, 0x090A0C0F, 0x1012130C,},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+ udimm0,
+ udimm2,
+};
+
+static const struct board_specific_parameters *rdimms[] = {
+ rdimm0,
+ rdimm0,
+ rdimm2,
+};
+
+
+#endif
diff --git a/board/freescale/ls2080aqds/eth.c b/board/freescale/ls2080aqds/eth.c
new file mode 100644
index 00000000000..b47e2ec5a79
--- /dev/null
+++ b/board/freescale/ls2080aqds/eth.c
@@ -0,0 +1,117 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <vsprintf.h>
+#include <linux/string.h>
+#include <asm/io.h>
+#include <asm/arch/fsl_serdes.h>
+#include <fsl-mc/fsl_mc.h>
+
+#define MC_BOOT_ENV_VAR "mcinitcmd"
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+ mc_env_boot();
+}
+#endif /* CONFIG_RESET_PHY_R */
+
+#if defined(CONFIG_MULTI_DTB_FIT)
+
+/* Structure to hold SERDES protocols supported (network interfaces are
+ * described in the DTS).
+ *
+ * @serdes_block: the index of the SERDES block
+ * @serdes_protocol: the decimal value of the protocol supported
+ * @dts_needed: DTS notes describing the current configuration are needed
+ *
+ * When dts_needed is true, the board_fit_config_name_match() function
+ * will try to exactly match the current configuration of the block with a DTS
+ * name provided.
+ */
+static struct serdes_configuration {
+ u8 serdes_block;
+ u32 serdes_protocol;
+ bool dts_needed;
+} supported_protocols[] = {
+ /* Serdes block #1 */
+ {1, 42, true},
+
+ /* Serdes block #2 */
+ {2, 65, false},
+};
+
+#define SUPPORTED_SERDES_PROTOCOLS ARRAY_SIZE(supported_protocols)
+
+static bool protocol_supported(u8 serdes_block, u32 protocol)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol)
+ return true;
+ }
+
+ return false;
+}
+
+static void get_str_protocol(u8 serdes_block, u32 protocol, char *str)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol) {
+ if (serdes_conf.dts_needed == true)
+ sprintf(str, "%u", protocol);
+ else
+ sprintf(str, "x");
+ return;
+ }
+ }
+}
+
+int board_fit_config_name_match(const char *name)
+{
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 rcw_status = in_le32(&gur->rcwsr[28]);
+ char srds_s1_str[2], srds_s2_str[2];
+ u32 srds_s1, srds_s2;
+ char expected_dts[100];
+
+ srds_s1 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_SHIFT;
+
+ srds_s2 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_MASK;
+ srds_s2 >>= FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_SHIFT;
+
+ /* Check for supported protocols. The default DTS will be used
+ * in this case
+ */
+ if (!protocol_supported(1, srds_s1) ||
+ !protocol_supported(2, srds_s2))
+ return -1;
+
+ get_str_protocol(1, srds_s1, srds_s1_str);
+ get_str_protocol(2, srds_s2, srds_s2_str);
+
+ printf("expected_dts %s\n", expected_dts);
+ sprintf(expected_dts, "fsl-ls2080a-qds-%s-%s",
+ srds_s1_str, srds_s2_str);
+
+ if (!strcmp(name, expected_dts))
+ return 0;
+
+ printf("this is not!\n");
+ return -1;
+}
+
+#endif
diff --git a/board/freescale/ls2080aqds/ls2080aqds.c b/board/freescale/ls2080aqds/ls2080aqds.c
new file mode 100644
index 00000000000..4c8d0706688
--- /dev/null
+++ b/board/freescale/ls2080aqds/ls2080aqds.c
@@ -0,0 +1,349 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor
+ * Copyright 2021 NXP
+ */
+#include <config.h>
+#include <clock_legacy.h>
+#include <display_options.h>
+#include <env.h>
+#include <init.h>
+#include <malloc.h>
+#include <errno.h>
+#include <netdev.h>
+#include <fsl_ifc.h>
+#include <fsl_ddr.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <fdt_support.h>
+#include <linux/libfdt.h>
+#include <fsl-mc/fsl_mc.h>
+#include <env_internal.h>
+#include <i2c.h>
+#include <rtc.h>
+#include <asm/arch/soc.h>
+#include <hwconfig.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/qixis.h"
+#include "ls2080aqds_qixis.h"
+#include "../common/vid.h"
+
+#define PIN_MUX_SEL_SDHC 0x00
+#define PIN_MUX_SEL_DSPI 0x0a
+#define SCFG_QSPICLKCTRL_DIV_20 (5 << 27)
+
+#define SET_SDHC_MUX_SEL(reg, value) ((reg & 0xf0) | value)
+
+DECLARE_GLOBAL_DATA_PTR;
+
+enum {
+ MUX_TYPE_SDHC,
+ MUX_TYPE_DSPI,
+};
+
+unsigned long long get_qixis_addr(void)
+{
+ unsigned long long addr;
+
+ if (gd->flags & GD_FLG_RELOC)
+ addr = QIXIS_BASE_PHYS;
+ else
+ addr = QIXIS_BASE_PHYS_EARLY;
+
+ /*
+ * IFC address under 256MB is mapped to 0x30000000, any address above
+ * is mapped to 0x5_10000000 up to 4GB.
+ */
+ addr = addr > 0x10000000 ? addr + 0x500000000ULL : addr + 0x30000000;
+
+ return addr;
+}
+
+int checkboard(void)
+{
+ char buf[64];
+ u8 sw;
+ static const char *const freq[] = {"100", "125", "156.25",
+ "100 separate SSCG"};
+ int clock;
+
+ cpu_name(buf);
+ printf("Board: %s-QDS, ", buf);
+
+ sw = QIXIS_READ(arch);
+ printf("Board Arch: V%d, ", sw >> 4);
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A' - 1);
+
+ memset((u8 *)buf, 0x00, ARRAY_SIZE(buf));
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank: %d\n", sw);
+ else if (sw == 0x8)
+ puts("PromJet\n");
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else if (sw == 0xf)
+ puts("QSPI\n");
+ else if (sw == 0x15)
+ printf("IFCCard\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+
+ printf("FPGA: v%d (%s), build %d",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+
+ /*
+ * Display the actual SERDES reference clocks as configured by the
+ * dip switches on the board. Note that the SWx registers could
+ * technically be set to force the reference clocks to match the
+ * values that the SERDES expects (or vice versa). For now, however,
+ * we just display both values and hope the user notices when they
+ * don't match.
+ */
+ puts("SERDES1 Reference : ");
+ sw = QIXIS_READ(brdcfg[2]);
+ clock = (sw >> 6) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 4) & 3;
+ printf("Clock2 = %sMHz", freq[clock]);
+
+ puts("\nSERDES2 Reference : ");
+ clock = (sw >> 2) & 3;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = (sw >> 0) & 3;
+ printf("Clock2 = %sMHz\n", freq[clock]);
+
+ return 0;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0F) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+ return 66666666;
+}
+
+int config_board_mux(int ctrl_type)
+{
+ u8 reg5;
+
+ reg5 = QIXIS_READ(brdcfg[5]);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_SDHC:
+ reg5 = SET_SDHC_MUX_SEL(reg5, PIN_MUX_SEL_SDHC);
+ break;
+ case MUX_TYPE_DSPI:
+ reg5 = SET_SDHC_MUX_SEL(reg5, PIN_MUX_SEL_DSPI);
+ break;
+ default:
+ printf("Wrong mux interface type\n");
+ return -1;
+ }
+
+ QIXIS_WRITE(brdcfg[5], reg5);
+
+ return 0;
+}
+
+int board_init(void)
+{
+ char *env_hwconfig;
+ u32 __iomem *dcfg_ccsr = (u32 __iomem *)DCFG_BASE;
+ u32 val;
+
+ init_final_memctl_regs();
+
+ val = in_le32(dcfg_ccsr + DCFG_RCWSR13 / 4);
+
+ env_hwconfig = env_get("hwconfig");
+
+ if (hwconfig_f("dspi", env_hwconfig) &&
+ DCFG_RCWSR13_DSPI == (val & (u32)(0xf << 8)))
+ config_board_mux(MUX_TYPE_DSPI);
+ else
+ config_board_mux(MUX_TYPE_SDHC);
+
+#if defined(CONFIG_MTD_RAW_NAND) && defined(CONFIG_FSL_QSPI)
+ val = in_le32(dcfg_ccsr + DCFG_RCWSR15 / 4);
+
+ if (DCFG_RCWSR15_IFCGRPABASE_QSPI == (val & (u32)0x3))
+ QIXIS_WRITE(brdcfg[9],
+ (QIXIS_READ(brdcfg[9]) & 0xf8) |
+ FSL_QIXIS_BRDCFG9_QSPI);
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+
+#ifdef CONFIG_RTC_ENABLE_32KHZ_OUTPUT
+#if CONFIG_IS_ENABLED(DM_I2C)
+ rtc_enable_32khz_output(0, CFG_SYS_I2C_RTC_ADDR);
+#else
+ rtc_enable_32khz_output();
+#endif
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT)
+ pci_init();
+#endif
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_SYS_I2C_EARLY_INIT)
+ i2c_early_init_f();
+#endif
+ fsl_lsch3_early_init_f();
+#ifdef CONFIG_FSL_QSPI
+ /* input clk: 1/2 platform clk, output: input/20 */
+ out_le32(SCFG_BASE + SCFG_QSPICLKCTLR, SCFG_QSPICLKCTRL_DIV_20);
+#endif
+ return 0;
+}
+
+int misc_init_r(void)
+{
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ puts("\nDDR ");
+ print_size(gd->bd->bi_dram[0].size + gd->bd->bi_dram[1].size, "");
+ print_ddr_info(0);
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ if (soc_has_dp_ddr() && gd->bd->bi_dram[2].size) {
+ puts("\nDP-DDR ");
+ print_size(gd->bd->bi_dram[2].size, "");
+ print_ddr_info(CONFIG_DP_DDR_CTRL);
+ }
+#endif
+}
+
+#if defined(CONFIG_FSL_MC_ENET) && !defined(CONFIG_SPL_BUILD)
+void fdt_fixup_board_enet(void *fdt)
+{
+ int offset;
+
+ offset = fdt_path_offset(fdt, "/soc/fsl-mc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/fsl-mc");
+
+ if (offset < 0) {
+ printf("%s: ERROR: fsl-mc node not found in device tree (error %d)\n",
+ __func__, offset);
+ return;
+ }
+
+ if (get_mc_boot_status() == 0 &&
+ (is_lazy_dpl_addr_valid() || get_dpl_apply_status() == 0))
+ fdt_status_okay(fdt, offset);
+ else
+ fdt_status_fail(fdt, offset);
+}
+
+void board_quiesce_devices(void)
+{
+ fsl_mc_ldpaa_exit(gd->bd);
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ u64 base[CONFIG_NR_DRAM_BANKS];
+ u64 size[CONFIG_NR_DRAM_BANKS];
+
+ ft_cpu_setup(blob, bd);
+
+ /* fixup DT for the two GPP DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+#endif
+
+ fdt_fixup_memory_banks(blob, base, size, 2);
+
+ fdt_fsl_mc_fixup_iommu_map_entry(blob);
+
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+#if defined(CONFIG_FSL_MC_ENET) && !defined(CONFIG_SPL_BUILD)
+ fdt_fixup_board_enet(blob);
+ fdt_reserve_mc_mem(blob, 0x300);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ return 0;
+}
+#endif
+
+void qixis_dump_switch(void)
+{
+ int i, nr_of_cfgsw;
+
+ QIXIS_WRITE(cms[0], 0x00);
+ nr_of_cfgsw = QIXIS_READ(cms[1]);
+
+ puts("DIP switch settings dump:\n");
+ for (i = 1; i <= nr_of_cfgsw; i++) {
+ QIXIS_WRITE(cms[0], i);
+ printf("SW%d = (0x%02x)\n", i, QIXIS_READ(cms[1]));
+ }
+}
diff --git a/board/freescale/ls2080aqds/ls2080aqds_qixis.h b/board/freescale/ls2080aqds/ls2080aqds_qixis.h
new file mode 100644
index 00000000000..7b2607b8daa
--- /dev/null
+++ b/board/freescale/ls2080aqds/ls2080aqds_qixis.h
@@ -0,0 +1,29 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS2_QDS_QIXIS_H__
+#define __LS2_QDS_QIXIS_H__
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+#define BRDCFG4_EMISEL_MASK 0xE0
+#define BRDCFG4_EMISEL_SHIFT 5
+#define BRDCFG9_SFPTX_MASK 0x10
+#define BRDCFG9_SFPTX_SHIFT 4
+#endif /*__LS2_QDS_QIXIS_H__*/
diff --git a/board/freescale/ls2080ardb/Kconfig b/board/freescale/ls2080ardb/Kconfig
new file mode 100644
index 00000000000..671eead5f7f
--- /dev/null
+++ b/board/freescale/ls2080ardb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_LS2080ARDB || TARGET_LS2081ARDB
+
+config SYS_BOARD
+ default "ls2080ardb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "ls2080ardb"
+
+endif
diff --git a/board/freescale/ls2080ardb/MAINTAINERS b/board/freescale/ls2080ardb/MAINTAINERS
new file mode 100644
index 00000000000..f2f834ffbd9
--- /dev/null
+++ b/board/freescale/ls2080ardb/MAINTAINERS
@@ -0,0 +1,32 @@
+LS2080A BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: board/freescale/ls2080ardb/
+F: board/freescale/ls2080a/ls2080ardb.c
+F: include/configs/ls2080ardb.h
+F: configs/ls2080ardb_defconfig
+F: configs/ls2080ardb_nand_defconfig
+
+LS2088A_QSPI-boot BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: configs/ls2088ardb_qspi_defconfig
+F: configs/ls2088ardb_tfa_defconfig
+F: configs/ls2088ardb_tfa_SECURE_BOOT_defconfig
+
+LS2081ARDB BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: configs/ls2081ardb_defconfig
+
+LS2080A_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls2080ardb_SECURE_BOOT_defconfig
+
+LS2088A_QSPI_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/ls2088ardb_qspi_SECURE_BOOT_defconfig
diff --git a/board/freescale/ls2080ardb/Makefile b/board/freescale/ls2080ardb/Makefile
new file mode 100644
index 00000000000..ed44d459f01
--- /dev/null
+++ b/board/freescale/ls2080ardb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2015 Freescale Semiconductor
+
+obj-y += ls2080ardb.o eth_ls2080rdb.o
+obj-y += ddr.o
diff --git a/board/freescale/ls2080ardb/README b/board/freescale/ls2080ardb/README
new file mode 100644
index 00000000000..4c1c36ea3a5
--- /dev/null
+++ b/board/freescale/ls2080ardb/README
@@ -0,0 +1,134 @@
+Overview
+--------
+The LS2080A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS2080A, LS2088A
+Layerscape Architecture processor.
+
+The LS2081A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LS2081A
+Layerscape Architecture processor.More details in below sections
+
+LS2080A, LS2088A, LS2081A SoC Overview
+--------------------------------------
+Please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc for LS2080A,
+LS2081A, LS2088A SoC overview.
+
+ LS2080ARDB board Overview
+ -----------------------
+ - SERDES Connections, 16 lanes supporting:
+ - PCI Express - 3.0
+ - SATA 3.0
+ - 10GBase-R
+ - DDR Controller
+ - Two ports of 72-bits (8-bits ECC) DDR4. Each port supports four
+ chip-selects and two DIMM connectors. Support is up to 2133MT/s.
+ - One port of 40-bits (8-bits ECC) DDR4 which supports four chip-selects
+ and two DIMM connectors. Support is up to 1600MT/s.
+ -IFC/Local Bus
+ - IFC rev. 2.0 implementation supporting Little Endian connection scheme.
+ - 128 MB NOR flash 16-bit data bus
+ - One 2 GB NAND flash with ECC support
+ - CPLD connection
+ - USB 3.0
+ - Two high speed USB 3.0 ports
+ - First USB 3.0 port configured as Host with Type-A connector
+ - Second USB 3.0 port configured as OTG with micro-AB connector
+ - SDHC adapter
+ - SD Card Rev 2.0 and Rev 3.0
+ - DSPI
+ - 128 MB high-speed flash Memory for boot code and storage (up to 108MHz)
+ - 4 I2C controllers
+ - Two SATA onboard connectors
+ - UART
+ - ARM JTAG support
+
+ LS2081ARDB board Overview
+ -------------------------
+ LS2081ARDB board is similar to LS2080ARDB board
+ with few differences like
+ - Hosts LS2081A SoC
+ - Default boot source is QSPI-boot
+ - Does not have IFC interface
+ - RTC and QSPI flash devices are different
+ - Provides QIXIS access via I2C
+
+Memory map from core's view
+----------------------------
+0x00_0000_0000 .. 0x00_000F_FFFF Boot Rom
+0x00_0100_0000 .. 0x00_0FFF_FFFF CCSR
+0x00_1800_0000 .. 0x00_181F_FFFF OCRAM
+0x00_2000_0000 .. 0x00_2FFF_FFFF QSPI region #1
+0x00_3000_0000 .. 0x00_3FFF_FFFF IFC region #1
+0x00_8000_0000 .. 0x00_FFFF_FFFF DDR region #1
+0x05_1000_0000 .. 0x05_FFFF_FFFF IFC region #2
+0x80_8000_0000 .. 0xFF_FFFF_FFFF DDR region #2
+
+Other addresses are either reserved, or not used directly by U-Boot.
+This list should be updated when more addresses are used.
+
+IFC region map from core's view
+-------------------------------
+During boot i.e. IFC Region #1:-
+ 0x30000000 - 0x37ffffff : 128MB : NOR flash
+ 0x3C000000 - 0x40000000 : 64MB : CPLD
+
+After relocate to DDR i.e. IFC Region #2:-
+ 0x5_1000_0000..0x5_1fff_ffff Memory Hole
+ 0x5_2000_0000..0x5_3fff_ffff IFC CSx (CPLD, NAND and others 512MB)
+ 0x5_4000_0000..0x5_7fff_ffff ASIC or others 1GB
+ 0x5_8000_0000..0x5_bfff_ffff IFC CS0 1GB (NOR/Promjet)
+ 0x5_C000_0000..0x5_ffff_ffff IFC CS1 1GB (NOR/Promjet)
+
+Booting Options
+---------------
+a) NOR boot
+b) NAND boot
+c) QSPI boot
+
+Memory map for NOR boot
+-------------------------
+Image Flash Offset
+RCW+PBI 0x00000000
+Boot firmware (U-Boot) 0x00100000
+Boot firmware Environment 0x00300000
+PPA firmware 0x00400000
+Secure Headers 0x00600000
+Cortina PHY firmware 0x00980000
+DPAA2 MC 0x00A00000
+DPAA2 DPL 0x00D00000
+DPAA2 DPC 0x00E00000
+Kernel.itb 0x01000000
+
+cfg_rcw_src switches needs to be changed for booting from different option.
+Refer to board documentation for correct switch setting.
+
+QSPI boot details
+===================
+Supported only for
+ LS2088ARDB RevF board with LS2088A SoC.
+
+Images needs to be copied to QSPI flash
+as per memory map given below.
+
+Memory map for QSPI flash
+-------------------------
+Image Flash Offset
+RCW+PBI 0x00000000
+Boot firmware (U-Boot) 0x00100000
+Boot firmware Environment 0x00300000
+PPA firmware 0x00400000
+Cortina PHY firmware 0x00980000
+DPAA2 MC 0x00A00000
+DPAA2 DPL 0x00D00000
+DPAA2 DPC 0x00E00000
+Kernel.itb 0x01000000
+
+Booting Linux flavors which do not support 48-bit VA (< Linux 3.18)
+-------------------------------------------------------------------
+One needs to use appropriate bootargs to boot Linux flavors which do
+not support 48-bit VA (for e.g. < Linux 3.18) by appending mem=2048M, as shown
+below:
+
+=> setenv bootargs 'console=ttyS1,115200 root=/dev/ram
+ earlycon=uart8250,mmio,0x21c0600,115200 default_hugepagesz=2m hugepagesz=2m
+ hugepages=16 mem=2048M'
diff --git a/board/freescale/ls2080ardb/ddr.c b/board/freescale/ls2080ardb/ddr.c
new file mode 100644
index 00000000000..ec34b42e619
--- /dev/null
+++ b/board/freescale/ls2080ardb/ddr.c
@@ -0,0 +1,187 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <log.h>
+#include <asm/arch/soc.h>
+#include <asm/arch/clock.h>
+#include <asm/global_data.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ u8 dq_mapping_0, dq_mapping_2, dq_mapping_3;
+#endif
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+ int slot;
+
+ if (ctrl_num > 2) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+
+ for (slot = 0; slot < CONFIG_DIMM_SLOTS_PER_CTLR; slot++) {
+ if (pdimm[slot].n_ranks)
+ break;
+ }
+
+ if (slot >= CONFIG_DIMM_SLOTS_PER_CTLR)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ if (popts->registered_dimm_en)
+ pbsp = rdimms[ctrl_num];
+ else
+ pbsp = udimms[ctrl_num];
+
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(ctrl_num) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm[slot].n_ranks &&
+ (pdimm[slot].rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for data rate %lu MT/s\n"
+ "Trying to use the highest speed (%u) parameters\n",
+ ddr_freq, pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ if (ctrl_num == CONFIG_DP_DDR_CTRL) {
+ if (popts->registered_dimm_en)
+ printf("WARN: RDIMM not supported.\n");
+ /* force DDR bus width to 32 bits */
+ popts->data_bus_width = 1;
+ popts->otf_burst_chop_en = 0;
+ popts->burst_length = DDR_BL8;
+ popts->bstopre = 0; /* enable auto precharge */
+ /*
+ * Layout optimization results byte mapping
+ * Byte 0 -> Byte ECC
+ * Byte 1 -> Byte 3
+ * Byte 2 -> Byte 2
+ * Byte 3 -> Byte 1
+ * Byte ECC -> Byte 0
+ */
+ dq_mapping_0 = pdimm[slot].dq_mapping[0];
+ dq_mapping_2 = pdimm[slot].dq_mapping[2];
+ dq_mapping_3 = pdimm[slot].dq_mapping[3];
+ pdimm[slot].dq_mapping[0] = pdimm[slot].dq_mapping[8];
+ pdimm[slot].dq_mapping[1] = pdimm[slot].dq_mapping[9];
+ pdimm[slot].dq_mapping[2] = pdimm[slot].dq_mapping[6];
+ pdimm[slot].dq_mapping[3] = pdimm[slot].dq_mapping[7];
+ pdimm[slot].dq_mapping[6] = dq_mapping_2;
+ pdimm[slot].dq_mapping[7] = dq_mapping_3;
+ pdimm[slot].dq_mapping[8] = dq_mapping_0;
+ pdimm[slot].dq_mapping[9] = 0;
+ pdimm[slot].dq_mapping[10] = 0;
+ pdimm[slot].dq_mapping[11] = 0;
+ pdimm[slot].dq_mapping[12] = 0;
+ pdimm[slot].dq_mapping[13] = 0;
+ pdimm[slot].dq_mapping[14] = 0;
+ pdimm[slot].dq_mapping[15] = 0;
+ pdimm[slot].dq_mapping[16] = 0;
+ pdimm[slot].dq_mapping[17] = 0;
+ }
+#endif
+ /* To work at higher than 1333MT/s */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0x0; /* 32 clocks */
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x6e;
+
+ if (ddr_freq < 2350) {
+ if (pdimm[0].n_ranks == 2 && pdimm[1].n_ranks == 2) {
+ /* four chip-selects */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_80ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_80ohm);
+ popts->twot_en = 1; /* enable 2T timing */
+ } else {
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_60ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_60ohm) |
+ DDR_CDR2_VREF_RANGE_2;
+ }
+ } else {
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN |
+ DDR_CDR1_ODT(DDR_CDR_ODT_100ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_100ohm) |
+ DDR_CDR2_VREF_RANGE_2;
+ }
+}
+
+#ifdef CONFIG_TFABOOT
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
+#else
+int fsl_initdram(void)
+{
+#if defined(CONFIG_SPL) && !defined(CONFIG_SPL_BUILD)
+ gd->ram_size = fsl_ddr_sdram_size();
+#else
+ puts("Initializing DDR....using SPD\n");
+
+ gd->ram_size = fsl_ddr_sdram();
+#endif
+
+ return 0;
+}
+#endif /* CONFIG_TFABOOT */
diff --git a/board/freescale/ls2080ardb/ddr.h b/board/freescale/ls2080ardb/ddr.h
new file mode 100644
index 00000000000..c5f2a95211b
--- /dev/null
+++ b/board/freescale/ls2080ardb/ddr.h
@@ -0,0 +1,76 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 6, 0x0708090B, 0x0C0D0E09,},
+ {2, 1666, 0, 10, 9, 0x090A0B0E, 0x0F11110C,},
+ {2, 1900, 0, 12, 0xA, 0x0B0C0E11, 0x1214140F,},
+ {2, 2300, 0, 12, 0xB, 0x0C0D0F12, 0x14161610,},
+ {}
+};
+
+/* DP-DDR DIMM */
+static const struct board_specific_parameters udimm2[] = {
+ /*
+ * memory controller 2
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 0, 8, 0xd, 0x0C0A0A00, 0x00000009,},
+ {2, 1666, 0, 8, 0xd, 0x0C0A0A00, 0x00000009,},
+ {2, 1900, 0, 8, 0xe, 0x0D0C0B00, 0x0000000A,},
+ {2, 2200, 0, 8, 0xe, 0x0D0C0B00, 0x0000000A,},
+ {}
+};
+
+static const struct board_specific_parameters rdimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1666, 0, 8, 0x0F, 0x0D0C0A09, 0x0B0C0E08,},
+ {2, 1900, 0, 8, 0x10, 0x0F0D0B0A, 0x0B0E0F09,},
+ {2, 2200, 0, 8, 0x13, 0x120F0E0B, 0x0D10110B,},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+ udimm0,
+ udimm2,
+};
+
+static const struct board_specific_parameters *rdimms[] = {
+ rdimm0,
+ rdimm0,
+ udimm2, /* DP-DDR doesn't support RDIMM */
+};
+
+
+#endif
diff --git a/board/freescale/ls2080ardb/eth_ls2080rdb.c b/board/freescale/ls2080ardb/eth_ls2080rdb.c
new file mode 100644
index 00000000000..44d9782d729
--- /dev/null
+++ b/board/freescale/ls2080ardb/eth_ls2080rdb.c
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ *
+ */
+
+#include <exports.h>
+#include <fsl-mc/fsl_mc.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_eth_init(struct bd_info *bis)
+{
+
+#ifdef CONFIG_PHY_AQUANTIA
+ /*
+ * Export functions to be used by AQ firmware
+ * upload application
+ */
+ gd->jt->strcpy = strcpy;
+ gd->jt->mdelay = mdelay;
+ gd->jt->mdio_get_current_dev = mdio_get_current_dev;
+ gd->jt->phy_find_by_mask = phy_find_by_mask;
+ gd->jt->mdio_phydev_for_ethname = mdio_phydev_for_ethname;
+ gd->jt->miiphy_set_current_dev = miiphy_set_current_dev;
+#endif
+
+ return 0;
+}
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+ mc_env_boot();
+}
+#endif /* CONFIG_RESET_PHY_R */
diff --git a/board/freescale/ls2080ardb/ls2080ardb.c b/board/freescale/ls2080ardb/ls2080ardb.c
new file mode 100644
index 00000000000..6f824f57c47
--- /dev/null
+++ b/board/freescale/ls2080ardb/ls2080ardb.c
@@ -0,0 +1,571 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor
+ * Copyright 2017, 2021 NXP
+ */
+#include <config.h>
+#include <clock_legacy.h>
+#include <display_options.h>
+#include <env.h>
+#include <init.h>
+#include <malloc.h>
+#include <errno.h>
+#include <netdev.h>
+#include <fsl_ifc.h>
+#include <fsl_ddr.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <hwconfig.h>
+#include <fdt_support.h>
+#include <linux/libfdt.h>
+#include <fsl-mc/fsl_mc.h>
+#include <env_internal.h>
+#include <efi_loader.h>
+#include <i2c.h>
+#include <asm/arch/mmu.h>
+#include <asm/arch/soc.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include "../common/i2c_mux.h"
+
+#ifdef CONFIG_FSL_QIXIS
+#include "../common/qixis.h"
+#include "ls2080ardb_qixis.h"
+#endif
+#include "../common/vid.h"
+
+#define CORTINA_FW_ADDR_IFCNOR 0x580980000
+#define CORTINA_FW_ADDR_IFCNOR_ALTBANK 0x584980000
+#define CORTINA_FW_ADDR_QSPI 0x980000
+#define PIN_MUX_SEL_SDHC 0x00
+#define PIN_MUX_SEL_DSPI 0x0a
+
+#define SET_SDHC_MUX_SEL(reg, value) ((reg & 0xf0) | value)
+DECLARE_GLOBAL_DATA_PTR;
+
+enum {
+ MUX_TYPE_SDHC,
+ MUX_TYPE_DSPI,
+};
+
+#ifdef CONFIG_VID
+u16 soc_get_fuse_vid(int vid_index)
+{
+ static const u16 vdd[32] = {
+ 10500,
+ 0, /* reserved */
+ 9750,
+ 0, /* reserved */
+ 9500,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 9000, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 10000, /* 1.0000V */
+ 0, /* reserved */
+ 10250,
+ 0, /* reserved */
+ 10500,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ };
+
+ return vdd[vid_index];
+};
+#endif
+
+unsigned long long get_qixis_addr(void)
+{
+ unsigned long long addr;
+
+ if (gd->flags & GD_FLG_RELOC)
+ addr = QIXIS_BASE_PHYS;
+ else
+ addr = QIXIS_BASE_PHYS_EARLY;
+
+ /*
+ * IFC address under 256MB is mapped to 0x30000000, any address above
+ * is mapped to 0x5_10000000 up to 4GB.
+ */
+ addr = addr > 0x10000000 ? addr + 0x500000000ULL : addr + 0x30000000;
+
+ return addr;
+}
+
+int checkboard(void)
+{
+#ifdef CONFIG_FSL_QIXIS
+ u8 sw;
+#endif
+ char buf[15];
+
+ cpu_name(buf);
+ printf("Board: %s-RDB, ", buf);
+
+#ifdef CONFIG_TARGET_LS2081ARDB
+#ifdef CONFIG_FSL_QIXIS
+ sw = QIXIS_READ(arch);
+ printf("Board version: %c, ", (sw & 0xf) + 'A');
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw >> QIXIS_QMAP_SHIFT) & QIXIS_QMAP_MASK;
+ switch (sw) {
+ case 0:
+ puts("boot from QSPI DEV#0\n");
+ puts("QSPI_CSA_1 mapped to QSPI DEV#1\n");
+ break;
+ case 1:
+ puts("boot from QSPI DEV#1\n");
+ puts("QSPI_CSA_1 mapped to QSPI DEV#0\n");
+ break;
+ case 2:
+ puts("boot from QSPI EMU\n");
+ puts("QSPI_CSA_1 mapped to QSPI DEV#0\n");
+ break;
+ case 3:
+ puts("boot from QSPI EMU\n");
+ puts("QSPI_CSA_1 mapped to QSPI DEV#1\n");
+ break;
+ case 4:
+ puts("boot from QSPI DEV#0\n");
+ puts("QSPI_CSA_1 mapped to QSPI EMU\n");
+ break;
+ default:
+ printf("invalid setting of SW%u\n", sw);
+ break;
+ }
+ printf("FPGA: v%d.%d\n", QIXIS_READ(scver), QIXIS_READ(tagdata));
+#endif
+ puts("SERDES1 Reference : ");
+ printf("Clock1 = 100MHz ");
+ printf("Clock2 = 161.13MHz");
+#else
+#ifdef CONFIG_FSL_QIXIS
+ sw = QIXIS_READ(arch);
+ printf("Board Arch: V%d, ", sw >> 4);
+ printf("Board version: %c, boot from ", (sw & 0xf) + 'A');
+
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank: %d\n", sw);
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+
+ printf("FPGA: v%d.%d\n", QIXIS_READ(scver), QIXIS_READ(tagdata));
+#endif
+ puts("SERDES1 Reference : ");
+ printf("Clock1 = 156.25MHz ");
+ printf("Clock2 = 156.25MHz");
+#endif
+
+ puts("\nSERDES2 Reference : ");
+ printf("Clock1 = 100MHz ");
+ printf("Clock2 = 100MHz\n");
+
+ return 0;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+#ifdef CONFIG_FSL_QIXIS
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0F) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+#endif
+ return 100000000;
+}
+
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+int config_board_mux(int ctrl_type)
+{
+#ifdef CONFIG_FSL_QIXIS
+ u8 reg5;
+
+ reg5 = QIXIS_READ(brdcfg[5]);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_SDHC:
+ reg5 = SET_SDHC_MUX_SEL(reg5, PIN_MUX_SEL_SDHC);
+ break;
+ case MUX_TYPE_DSPI:
+ reg5 = SET_SDHC_MUX_SEL(reg5, PIN_MUX_SEL_DSPI);
+ break;
+ default:
+ printf("Wrong mux interface type\n");
+ return -1;
+ }
+
+ QIXIS_WRITE(brdcfg[5], reg5);
+#endif
+ return 0;
+}
+
+ulong *cs4340_get_fw_addr(void)
+{
+#ifdef CONFIG_TFABOOT
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 svr = gur_in32(&gur->svr);
+#endif
+ ulong cortina_fw_addr = CONFIG_CORTINA_FW_ADDR;
+
+#ifdef CONFIG_TFABOOT
+ /* LS2088A TFA boot */
+ if (SVR_SOC_VER(svr) == SVR_LS2088A) {
+ enum boot_src src = get_boot_src();
+ u8 sw;
+
+ switch (src) {
+ case BOOT_SOURCE_IFC_NOR:
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & 0x0f);
+ if (sw == 0)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR;
+ else if (sw == 4)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR_ALTBANK;
+ break;
+ case BOOT_SOURCE_QSPI_NOR:
+ /* Only one bank in QSPI */
+ cortina_fw_addr = CORTINA_FW_ADDR_QSPI;
+ break;
+ default:
+ printf("WARNING: Boot source not found\n");
+ }
+ }
+#endif
+ return (ulong *)cortina_fw_addr;
+}
+
+int board_init(void)
+{
+#ifdef CONFIG_FSL_MC_ENET
+ u32 __iomem *irq_ccsr = (u32 __iomem *)ISC_BASE;
+#endif
+
+ init_final_memctl_regs();
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+
+#ifdef CONFIG_FSL_QIXIS
+ QIXIS_WRITE(rst_ctl, QIXIS_RST_CTL_RESET_EN);
+#endif
+
+#ifdef CONFIG_FSL_MC_ENET
+ /* invert AQR405 IRQ pins polarity */
+ out_le32(irq_ccsr + IRQCR_OFFSET / 4, AQR405_IRQ_MASK);
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT)
+ pci_init();
+#endif
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_SYS_I2C_EARLY_INIT)
+ i2c_early_init_f();
+#endif
+ fsl_lsch3_early_init_f();
+ return 0;
+}
+
+int misc_init_r(void)
+{
+ char *env_hwconfig;
+ u32 __iomem *dcfg_ccsr = (u32 __iomem *)DCFG_BASE;
+ u32 val;
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 svr = gur_in32(&gur->svr);
+
+ val = in_le32(dcfg_ccsr + DCFG_RCWSR13 / 4);
+
+ env_hwconfig = env_get("hwconfig");
+
+ if (hwconfig_f("dspi", env_hwconfig) &&
+ DCFG_RCWSR13_DSPI == (val & (u32)(0xf << 8)))
+ config_board_mux(MUX_TYPE_DSPI);
+ else
+ config_board_mux(MUX_TYPE_SDHC);
+
+ /*
+ * LS2081ARDB RevF board has smart voltage translator
+ * which needs to be programmed to enable high speed SD interface
+ * by setting GPIO4_10 output to zero
+ */
+#ifdef CONFIG_TARGET_LS2081ARDB
+ out_le32(GPIO4_GPDIR_ADDR, (1 << 21 |
+ in_le32(GPIO4_GPDIR_ADDR)));
+ out_le32(GPIO4_GPDAT_ADDR, (~(1 << 21) &
+ in_le32(GPIO4_GPDAT_ADDR)));
+#endif
+ if (hwconfig("sdhc"))
+ config_board_mux(MUX_TYPE_SDHC);
+
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+ /*
+ * Default value of board env is based on filename which is
+ * ls2080ardb. Modify board env for other supported SoCs
+ */
+ if ((SVR_SOC_VER(svr) == SVR_LS2088A) ||
+ (SVR_SOC_VER(svr) == SVR_LS2048A))
+ env_set("board", "ls2088ardb");
+ else if ((SVR_SOC_VER(svr) == SVR_LS2081A) ||
+ (SVR_SOC_VER(svr) == SVR_LS2041A))
+ env_set("board", "ls2081ardb");
+
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ puts("\nDDR ");
+ print_size(gd->bd->bi_dram[0].size + gd->bd->bi_dram[1].size, "");
+ print_ddr_info(0);
+#ifdef CONFIG_SYS_FSL_HAS_DP_DDR
+ if (soc_has_dp_ddr() && gd->bd->bi_dram[2].size) {
+ puts("\nDP-DDR ");
+ print_size(gd->bd->bi_dram[2].size, "");
+ print_ddr_info(CONFIG_DP_DDR_CTRL);
+ }
+#endif
+}
+
+#ifdef CONFIG_FSL_MC_ENET
+void fdt_fixup_board_enet(void *fdt)
+{
+ int offset;
+
+ offset = fdt_path_offset(fdt, "/soc/fsl-mc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/fsl-mc");
+
+ if (offset < 0) {
+ printf("%s: ERROR: fsl-mc node not found in device tree (error %d)\n",
+ __func__, offset);
+ return;
+ }
+
+ if (get_mc_boot_status() == 0 &&
+ (is_lazy_dpl_addr_valid() || get_dpl_apply_status() == 0))
+ fdt_status_okay(fdt, offset);
+ else
+ fdt_status_fail(fdt, offset);
+}
+
+void board_quiesce_devices(void)
+{
+ fsl_mc_ldpaa_exit(gd->bd);
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+void fsl_fdt_fixup_flash(void *fdt)
+{
+ int offset;
+#ifdef CONFIG_TFABOOT
+ u32 __iomem *dcfg_ccsr = (u32 __iomem *)DCFG_BASE;
+ u32 val;
+#endif
+
+/*
+ * IFC and QSPI are muxed on board.
+ * So disable IFC node in dts if QSPI is enabled or
+ * disable QSPI node in dts in case QSPI is not enabled.
+ */
+#ifdef CONFIG_TFABOOT
+ enum boot_src src = get_boot_src();
+ bool disable_ifc = false;
+
+ switch (src) {
+ case BOOT_SOURCE_IFC_NOR:
+ disable_ifc = false;
+ break;
+ case BOOT_SOURCE_QSPI_NOR:
+ disable_ifc = true;
+ break;
+ default:
+ val = in_le32(dcfg_ccsr + DCFG_RCWSR15 / 4);
+ if (DCFG_RCWSR15_IFCGRPABASE_QSPI == (val & (u32)0x3))
+ disable_ifc = true;
+ break;
+ }
+
+ if (disable_ifc) {
+ offset = fdt_path_offset(fdt, "/soc/ifc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/ifc");
+ } else {
+ offset = fdt_path_offset(fdt, "/soc/quadspi");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/quadspi");
+ }
+
+#else
+#ifdef CONFIG_FSL_QSPI
+ offset = fdt_path_offset(fdt, "/soc/ifc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/ifc");
+#else
+ offset = fdt_path_offset(fdt, "/soc/quadspi");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/quadspi");
+#endif
+#endif
+
+ if (offset < 0)
+ return;
+
+ fdt_status_disabled(fdt, offset);
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ int i;
+ u16 mc_memory_bank = 0;
+
+ u64 *base;
+ u64 *size;
+ u64 mc_memory_base = 0;
+ u64 mc_memory_size = 0;
+ u16 total_memory_banks;
+
+ ft_cpu_setup(blob, bd);
+
+ fdt_fixup_mc_ddr(&mc_memory_base, &mc_memory_size);
+
+ if (mc_memory_base != 0)
+ mc_memory_bank++;
+
+ total_memory_banks = CONFIG_NR_DRAM_BANKS + mc_memory_bank;
+
+ base = calloc(total_memory_banks, sizeof(u64));
+ size = calloc(total_memory_banks, sizeof(u64));
+
+ /* fixup DT for the two GPP DDR banks */
+ base[0] = gd->bd->bi_dram[0].start;
+ size[0] = gd->bd->bi_dram[0].size;
+ base[1] = gd->bd->bi_dram[1].start;
+ size[1] = gd->bd->bi_dram[1].size;
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+#endif
+
+ if (mc_memory_base != 0) {
+ for (i = 0; i <= total_memory_banks; i++) {
+ if (base[i] == 0 && size[i] == 0) {
+ base[i] = mc_memory_base;
+ size[i] = mc_memory_size;
+ break;
+ }
+ }
+ }
+
+ fdt_fixup_memory_banks(blob, base, size, total_memory_banks);
+
+ fdt_fsl_mc_fixup_iommu_map_entry(blob);
+
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+ fsl_fdt_fixup_flash(blob);
+
+#ifdef CONFIG_FSL_MC_ENET
+ fdt_fixup_board_enet(blob);
+ fdt_reserve_mc_mem(blob, 0x300);
+#endif
+
+ fdt_fixup_icid(blob);
+
+ return 0;
+}
+#endif
+
+void qixis_dump_switch(void)
+{
+#ifdef CONFIG_FSL_QIXIS
+ int i, nr_of_cfgsw;
+
+ QIXIS_WRITE(cms[0], 0x00);
+ nr_of_cfgsw = QIXIS_READ(cms[1]);
+
+ puts("DIP switch settings dump:\n");
+ for (i = 1; i <= nr_of_cfgsw; i++) {
+ QIXIS_WRITE(cms[0], i);
+ printf("SW%d = (0x%02x)\n", i, QIXIS_READ(cms[1]));
+ }
+#endif
+}
+
+/*
+ * Board rev C and earlier has duplicated I2C addresses for 2nd controller.
+ * Both slots has 0x54, resulting 2nd slot unusable.
+ */
+void update_spd_address(unsigned int ctrl_num,
+ unsigned int slot,
+ unsigned int *addr)
+{
+#ifndef CONFIG_TARGET_LS2081ARDB
+#ifdef CONFIG_FSL_QIXIS
+ u8 sw;
+
+ sw = QIXIS_READ(arch);
+ if ((sw & 0xf) < 0x3) {
+ if (ctrl_num == 1 && slot == 0)
+ *addr = SPD_EEPROM_ADDRESS4;
+ else if (ctrl_num == 1 && slot == 1)
+ *addr = SPD_EEPROM_ADDRESS3;
+ }
+#endif
+#endif
+}
diff --git a/board/freescale/ls2080ardb/ls2080ardb_qixis.h b/board/freescale/ls2080ardb/ls2080ardb_qixis.h
new file mode 100644
index 00000000000..db3c6dc2a2a
--- /dev/null
+++ b/board/freescale/ls2080ardb/ls2080ardb_qixis.h
@@ -0,0 +1,19 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __LS2_RDB_QIXIS_H__
+#define __LS2_RDB_QIXIS_H__
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+
+#endif /*__LS2_RDB_QIXIS_H__*/
diff --git a/board/freescale/lx2160a/Kconfig b/board/freescale/lx2160a/Kconfig
new file mode 100644
index 00000000000..0e4b4158a7f
--- /dev/null
+++ b/board/freescale/lx2160a/Kconfig
@@ -0,0 +1,47 @@
+if TARGET_LX2160ARDB
+
+config SYS_BOARD
+ default "lx2160a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "lx2160ardb"
+
+endif
+
+if TARGET_LX2160AQDS
+
+config SYS_BOARD
+ default "lx2160a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "lx2160aqds"
+
+endif
+
+if TARGET_LX2162AQDS
+
+config SYS_BOARD
+ default "lx2160a"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "fsl-layerscape"
+
+config SYS_CONFIG_NAME
+ default "lx2162aqds"
+
+endif
diff --git a/board/freescale/lx2160a/MAINTAINERS b/board/freescale/lx2160a/MAINTAINERS
new file mode 100644
index 00000000000..c60b2af6e42
--- /dev/null
+++ b/board/freescale/lx2160a/MAINTAINERS
@@ -0,0 +1,55 @@
+LX2160ARDB BOARD
+M: Meenakshi Aggarwal <meenakshi.aggarwal@nxp.com>
+M: Priyanka Jain <priyanka.jain@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: board/freescale/lx2160a/
+F: include/configs/lx2160a_common.h
+F: include/configs/lx2160ardb.h
+F: configs/lx2160ardb_tfa_defconfig
+F: configs/lx2160ardb_tfa_stmm_defconfig
+F: arch/arm/dts/fsl-lx2160a-rdb.dts
+
+LX2160ARDB_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/lx2160ardb_tfa_SECURE_BOOT_defconfig
+
+LX2160AQDS BOARD
+M: Meenakshi Aggarwal <meenakshi.aggarwal@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: board/freescale/lx2160a/eth_lx2160aqds.h
+F: include/configs/lx2160aqds.h
+F: configs/lx2160aqds_tfa_defconfig
+F: arch/arm/dts/fsl-lx2160a-qds.dts
+
+LX2160AQDS_SECURE_BOOT BOARD
+M: Udit Agarwal <udit.agarwal@nxp.com>
+S: Maintained
+F: configs/lx2160aqds_tfa_SECURE_BOOT_defconfig
+
+LX2162AQDS BOARD
+M: Meenakshi Aggarwal <meenakshi.aggarwal@nxp.com>
+M: Wasim Khan <wasim.khan@nxp.com>
+S: Maintained
+F: board/freescale/lx2160a/eth_lx2162aqds.h
+F: include/configs/lx2162aqds.h
+F: configs/lx2162aqds_tfa_defconfig
+F: arch/arm/dts/fsl-lx2162a-qds.dts
+F: arch/arm/dts/fsl-lx2162a-qds-17-x.dts
+F: arch/arm/dts/fsl-lx2162a-qds-18-x.dts
+F: arch/arm/dts/fsl-lx2162a-qds-20-x.dts
+F: arch/arm/dts/fsl-lx2162a-qds-sd1-17.dtsi
+F: arch/arm/dts/fsl-lx2162a-qds-sd1-18.dtsi
+F: arch/arm/dts/fsl-lx2162a-qds-sd1-20.dtsi
+
+LX2162AQDS_SECURE_BOOT BOARD
+M: Manish Tomar <Manish.Tomar@nxp.com>
+S: Maintained
+F: configs/lx2162aqds_tfa_SECURE_BOOT_defconfig
+
+LX2162AQDS_VERIFIED_BOOT BOARD
+M: Manish Tomar <Manish.Tomar@nxp.com>
+S: Maintained
+F: configs/lx2162aqds_tfa_verified_boot_defconfig
diff --git a/board/freescale/lx2160a/Makefile b/board/freescale/lx2160a/Makefile
new file mode 100644
index 00000000000..c9561bfadea
--- /dev/null
+++ b/board/freescale/lx2160a/Makefile
@@ -0,0 +1,11 @@
+#
+# Copyright 2018 Freescale Semiconductor
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+obj-y += lx2160a.o
+obj-y += ddr.o
+obj-$(CONFIG_TARGET_LX2160ARDB) += eth_lx2160ardb.o
+obj-$(CONFIG_TARGET_LX2160AQDS) += eth_lx2160aqds.o
+obj-$(CONFIG_TARGET_LX2162AQDS) += eth_lx2162aqds.o
diff --git a/board/freescale/lx2160a/README b/board/freescale/lx2160a/README
new file mode 100644
index 00000000000..7bca98dd3d7
--- /dev/null
+++ b/board/freescale/lx2160a/README
@@ -0,0 +1,329 @@
+Overview
+--------
+The LX2160A Reference Design (RDB) is a high-performance computing,
+evaluation, and development platform that supports the QorIQ LX2160A
+Layerscape Architecture processor and its personalities.
+
+LX2160A SoC Overview
+--------------------------------------
+For details, please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc
+
+LX2160ARDB board Overview
+----------------------
+DDR Memory
+ Two ports of 72-bits (8-bits ECC) DDR4.
+ Each port supports four chip-selects and two DIMM
+ connectors. Data rate upto 3.2 GT/s.
+
+SERDES ports
+ Thress serdes controllers (24 lanes)
+ Serdes1: Supports two USXGMII connectors, each connected through
+ Aquantia AQR107 phy, two 25GbE SFP+ modules connected through an Inphi
+ IN112525 phy and one 40 GbE QSFP+ module connected through an Inphi
+ CS4223 phy.
+
+ Serdes2: Supports one PCIe x4 (Gen1/2/3/4) connector, four SATA 3.0
+ connectors
+
+ Serdes3: Supports one PCIe x8 (Gen1/2/3/4) connector
+
+eSDHC
+ eSDHC1: Supports a SD connector for connecting SD cards
+ eSDHC2: Supports 128GB Micron MTFC128GAJAECE-IT eMMC
+
+Octal SPI (XSPI)
+ Supports two 64 MB onbpard octal SPI flash memories, one SPI emulator
+ for off-board emulation
+
+I2C All system devices on I2C1 multiplexed using PCA9547 multiplexer
+ Serial Ports
+
+USB 3.0
+ Two high speed USB 3.0 ports. First USB 3.0 port configured as
+ Host with Type-A connector, second USB 3.0 port configured as OTG
+ with micro-AB connector
+
+Serial Ports Two UART ports
+Ethernet Two RGMII interfaces
+Debug ARM JTAG support
+
+Booting Options
+---------------
+a) Flexspi boot
+b) SD boot
+
+Memory map for Flexspi flash
+----------------------------
+Image Flash Offset
+bl2_flexspi_nor.pbl (RCW+PBI+bl2.pbl) 0x00000000
+fip.bin (bl31 + bl33(u-boot) +
+ header for Secure-boot(secure-boot only)) 0x00100000
+Boot firmware Environment 0x00500000
+DDR PHY Firmware (fip_ddr_all.bin) 0x00800000
+DPAA2 MC Firmware 0x00A00000
+DPAA2 DPL 0x00D00000
+DPAA2 DPC 0x00E00000
+Kernel.itb 0x01000000
+
+Memory map for sd card
+----------------------------
+Image SD card Offset
+bl2_sd.pbl (RCW+PBI+bl2.pbl) 0x00008
+fip.bin (bl31 + bl33(u-boot) +
+ header for Secure-boot(secure-boot only)) 0x00800
+Boot firmware Environment 0x02800
+DDR PHY Firmware (fip_ddr_all.bin) 0x04000
+DPAA2 MC Firmware 0x05000
+DPAA2 DPL 0x06800
+DPAA2 DPC 0x07000
+Kernel.itb 0x08000
+
+LX2160AQDS board Overview
+----------------------
+Various Mezzanine cards and their connection for different SERDES protocols is
+as below:
+
+SERDES1 |CARDS
+-----------------------------------------------------------------------
+1 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+3 |Mezzanine:X-M11-USXGMII (29828)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+7 |Mezzanine:X-M11-USXGMII (29828)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+8 |Mezzanine:X-M12-XFI (29829)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M12-XFI (29829)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+13 |Mezzanine:X-M8-100G (29734)
+ |Connect Hydra Cable (HDR-198816-XX-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M8-100G (29734)
+ |Connect Hydra Cable (HDR-198816-XX-ECUE) to SD_SLOT2(J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+15 |Mezzanine:X-M8-100G (29734)
+ |Connect Hydra Cable (HDR-198816-XX-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+17 |Mezzanine:X-M13-25G (32133)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+19 |Mezzanine:X-M11-USXGMII (29828), X-M13-25G (32133)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect M11 I/O cable to IO_SLOT1(J110), M13 I/O cable to IO_SLOT6(J125)
+ |Mezzanine:X-M7-40G (29738)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+20 |Mezzanine:X-M7-40G (29738)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J108)
+ |Mezzanine:X-M7-40G (29738)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT2 (J111)
+ |Connect I/O cable to IO_SLOT2(J113)
+------------------------------------------------------------------------
+
+
+SERDES2 |CARDS
+-----------------------------------------------------------------------
+2 |Mezzanine:X-M6-PCIE-X8 (29737) *
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT3(J116)
+------------------------------------------------------------------------
+3 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT3(J116)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT4(J119)
+------------------------------------------------------------------------
+5 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT3(J116)
+ |Mezzanine:X-M5-SATA (29687)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT4(J119)
+------------------------------------------------------------------------
+11 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT7(J127)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT8(J131)
+------------------------------------------------------------------------
+
+
+SERDES3 |CARDS
+-----------------------------------------------------------------------
+2 |Mezzanine:X-M6-PCIE-X8 (29737) *
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT5 (J120)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT6 (J123)
+ |Connect I/O cable to IO_SLOT5(J122)
+-------------------------------------------------------------------------
+3 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT5 (J120)
+ |Connect I/O cable to IO_SLOT5(J122)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT6 (J123)
+ |Connect I/O cable to IO_SLOT6(J125)
+-------------------------------------------------------------------------
+
+LX2162A SoC Overview
+--------------------------------------
+For details, please refer arch/arm/cpu/armv8/fsl-layerscape/doc/README.soc
+
+LX2162AQDS board Overview
+----------------------
+DDR Memory
+ One ports of 72-bits (8-bits ECC) DDR4.
+ Each port supports four chip-selects and two DIMM
+ connectors. Data rate upto 2.9 GT/s.
+
+SERDES ports
+ Two serdes controllers (12 lanes)
+ Serdes1: Supports two USXGMII connectors, each connected through
+ Aquantia AQR107 phy, two 25GbE SFP+ modules connected through an Inphi
+ IN112525 phy and one 40 GbE QSFP+ module connected through an Inphi
+ CS4223 phy.
+
+ Serdes2: Supports two PCIe x4 (Gen3) and one PCIe x8 (Gen3) connector,
+ four SATA 3.0 connectors
+
+eSDHC
+ eSDHC1: Supports a SD connector for connecting SD cards
+ eSDHC2: Supports 128GB Micron MTFC128GAJAECE-IT eMMC
+
+Octal SPI (XSPI)
+ Supports two 64 MB onbpard octal SPI flash memories, one SPI emulator
+ for off-board emulation
+
+I2C All system devices on I2C1 multiplexed using PCA9547 multiplexer
+ Serial Ports
+
+USB 3.0
+ One high speed USB 3.0 ports. First USB 3.0 port configured as Host
+ with Type-A connector, second USB 3.0 port configured as OTG with
+ micro-AB connector
+
+Serial Ports Two UART ports
+Ethernet Two RGMII interfaces
+Debug ARM JTAG support
+
+Booting Options
+---------------
+a) Flexspi boot
+b) SD boot
+c) eMMC boot
+
+Memory map for Flexspi flash
+----------------------------
+Image Flash Offset
+bl2_flexspi_nor.pbl (RCW+PBI+bl2.pbl) 0x00000000
+fip.bin (bl31 + bl33(u-boot) +
+ header for Secure-boot(secure-boot only)) 0x00100000
+Boot firmware Environment 0x00500000
+DDR PHY Firmware (fip_ddr_all.bin) 0x00800000
+DPAA2 MC Firmware 0x00A00000
+DPAA2 DPL 0x00D00000
+DPAA2 DPC 0x00E00000
+Kernel.itb 0x01000000
+
+Memory map for sd/eMMC card
+----------------------------
+Image SD/eMMC card Offset
+bl2_sd.pbl (RCW+PBI+bl2.pbl) 0x00008
+fip.bin (bl31 + bl33(u-boot) +
+ header for Secure-boot(secure-boot only)) 0x00800
+Boot firmware Environment 0x02800
+DDR PHY Firmware (fip_ddr_all.bin) 0x04000
+DPAA2 MC Firmware 0x05000
+DPAA2 DPL 0x06800
+DPAA2 DPC 0x07000
+Kernel.itb 0x08000
+
+Various Mezzanine cards and their connection for different SERDES protocols is
+as below:
+
+SERDES1 |CARDS
+-----------------------------------------------------------------------
+1 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+------------------------------------------------------------------------
+3 |Mezzanine:X-M11-USXGMII (29828)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+------------------------------------------------------------------------
+15 |Mezzanine:X-M8-50G (29734)
+ |Connect Hydra Cable (HDR-198816-XX-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+------------------------------------------------------------------------
+17 |Mezzanine:X-M13-25G (32133)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J110)
+------------------------------------------------------------------------
+18 |Mezzanine:X-M11-USXGMII (29828), X-M13-25G (32133)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT1 (J108)
+ |Connect M11 I/O cable to IO_SLOT1(J110), M13 I/O cable to IO_SLOT6(J125)
+------------------------------------------------------------------------
+20 |Mezzanine:X-M7-40G (29738)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT1 (J108)
+ |Connect I/O cable to IO_SLOT1(J108)
+------------------------------------------------------------------------
+
+
+SERDES2 |CARDS
+-----------------------------------------------------------------------
+2 |Mezzanine:X-M6-PCIE-X8 (29737) *
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect Straight Cable (HDR-198816-XX-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT3(J116)
+------------------------------------------------------------------------
+3 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT3(J116)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT4(J119)
+------------------------------------------------------------------------
+5 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT3(J116)
+ |Mezzanine:X-M5-SATA (29687)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT4(J119)
+------------------------------------------------------------------------
+11 |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT3 (J114)
+ |Connect I/O cable to IO_SLOT7(J127)
+ |Mezzanine:X-M4-PCIE-SGMII (29733)
+ |Connect Hydra Cable (HDR-198564-01-ECUE) to SD_SLOT4 (J117)
+ |Connect I/O cable to IO_SLOT8(J131)
+------------------------------------------------------------------------
diff --git a/board/freescale/lx2160a/ddr.c b/board/freescale/lx2160a/ddr.c
new file mode 100644
index 00000000000..637e43a22be
--- /dev/null
+++ b/board/freescale/lx2160a/ddr.c
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018 NXP
+ */
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int fsl_initdram(void)
+{
+ gd->ram_size = tfa_get_dram_size();
+
+ if (!gd->ram_size)
+ gd->ram_size = fsl_ddr_sdram_size();
+
+ return 0;
+}
diff --git a/board/freescale/lx2160a/eth_lx2160aqds.c b/board/freescale/lx2160a/eth_lx2160aqds.c
new file mode 100644
index 00000000000..9939bb6f89e
--- /dev/null
+++ b/board/freescale/lx2160a/eth_lx2160aqds.c
@@ -0,0 +1,148 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018-2020 NXP
+ *
+ */
+
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <exports.h>
+#include <fsl-mc/fsl_mc.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_PHY_AQUANTIA
+ /*
+ * Export functions to be used by AQ firmware
+ * upload application
+ */
+ gd->jt->strcpy = strcpy;
+ gd->jt->mdelay = mdelay;
+ gd->jt->mdio_get_current_dev = mdio_get_current_dev;
+ gd->jt->phy_find_by_mask = phy_find_by_mask;
+ gd->jt->mdio_phydev_for_ethname = mdio_phydev_for_ethname;
+ gd->jt->miiphy_set_current_dev = miiphy_set_current_dev;
+#endif
+
+ return 0;
+}
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+#if defined(CONFIG_FSL_MC_ENET)
+ mc_env_boot();
+#endif
+}
+#endif /* CONFIG_RESET_PHY_R */
+
+#if defined(CONFIG_MULTI_DTB_FIT)
+
+/* Structure to hold SERDES protocols supported (network interfaces are
+ * described in the DTS).
+ *
+ * @serdes_block: the index of the SERDES block
+ * @serdes_protocol: the decimal value of the protocol supported
+ * @dts_needed: DTS notes describing the current configuration are needed
+ *
+ * When dts_needed is true, the board_fit_config_name_match() function
+ * will try to exactly match the current configuration of the block with a DTS
+ * name provided.
+ */
+static struct serdes_configuration {
+ u8 serdes_block;
+ u32 serdes_protocol;
+ bool dts_needed;
+} supported_protocols[] = {
+ /* Serdes block #1 */
+ {1, 3, true},
+ {1, 7, true},
+ {1, 19, true},
+ {1, 20, true},
+
+ /* Serdes block #2 */
+ {2, 2, false},
+ {2, 3, false},
+ {2, 5, false},
+ {2, 11, true},
+
+ /* Serdes block #3 */
+ {3, 2, false},
+ {3, 3, false},
+};
+
+#define SUPPORTED_SERDES_PROTOCOLS ARRAY_SIZE(supported_protocols)
+
+static bool protocol_supported(u8 serdes_block, u32 protocol)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol)
+ return true;
+ }
+
+ return false;
+}
+
+static void get_str_protocol(u8 serdes_block, u32 protocol, char *str)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol) {
+ if (serdes_conf.dts_needed == true)
+ sprintf(str, "%u", protocol);
+ else
+ sprintf(str, "x");
+ return;
+ }
+ }
+}
+
+int board_fit_config_name_match(const char *name)
+{
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 rcw_status = in_le32(&gur->rcwsr[28]);
+ char srds_s1_str[2], srds_s2_str[2], srds_s3_str[2];
+ u32 srds_s1, srds_s2, srds_s3;
+ char expected_dts[100];
+
+ srds_s1 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_SHIFT;
+
+ srds_s2 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_MASK;
+ srds_s2 >>= FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_SHIFT;
+
+ srds_s3 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS3_PRTCL_MASK;
+ srds_s3 >>= FSL_CHASSIS3_RCWSR28_SRDS3_PRTCL_SHIFT;
+
+ /* Check for supported protocols. The default DTS will be used
+ * in this case
+ */
+ if (!protocol_supported(1, srds_s1) ||
+ !protocol_supported(2, srds_s2) ||
+ !protocol_supported(3, srds_s3))
+ return -1;
+
+ get_str_protocol(1, srds_s1, srds_s1_str);
+ get_str_protocol(2, srds_s2, srds_s2_str);
+ get_str_protocol(3, srds_s3, srds_s3_str);
+
+ sprintf(expected_dts, "fsl-lx2160a-qds-%s-%s-%s",
+ srds_s1_str, srds_s2_str, srds_s3_str);
+
+ if (!strcmp(name, expected_dts))
+ return 0;
+
+ return -1;
+}
+#endif
diff --git a/board/freescale/lx2160a/eth_lx2160ardb.c b/board/freescale/lx2160a/eth_lx2160ardb.c
new file mode 100644
index 00000000000..90e7c9100e1
--- /dev/null
+++ b/board/freescale/lx2160a/eth_lx2160ardb.c
@@ -0,0 +1,144 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018, 2020 NXP
+ *
+ */
+
+#include <netdev.h>
+#include <exports.h>
+#include <fsl-mc/fsl_mc.h>
+#include "lx2160a.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_PHY_AQUANTIA
+ /*
+ * Export functions to be used by AQ firmware
+ * upload application
+ */
+ gd->jt->strcpy = strcpy;
+ gd->jt->mdelay = mdelay;
+ gd->jt->mdio_get_current_dev = mdio_get_current_dev;
+ gd->jt->phy_find_by_mask = phy_find_by_mask;
+ gd->jt->mdio_phydev_for_ethname = mdio_phydev_for_ethname;
+ gd->jt->miiphy_set_current_dev = miiphy_set_current_dev;
+#endif
+ return pci_eth_init(bis);
+}
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+#if defined(CONFIG_FSL_MC_ENET)
+ mc_env_boot();
+#endif
+}
+#endif /* CONFIG_RESET_PHY_R */
+
+static int fdt_get_dpmac_node(void *fdt, int dpmac_id)
+{
+ char dpmac_str[11] = "dpmacs@00";
+ int offset, dpmacs_offset;
+
+ /* get the dpmac offset */
+ dpmacs_offset = fdt_path_offset(fdt, "/soc/fsl-mc/dpmacs");
+ if (dpmacs_offset < 0)
+ dpmacs_offset = fdt_path_offset(fdt, "/fsl-mc/dpmacs");
+
+ if (dpmacs_offset < 0) {
+ printf("dpmacs node not found in device tree\n");
+ return dpmacs_offset;
+ }
+
+ sprintf(dpmac_str, "dpmac@%x", dpmac_id);
+ offset = fdt_subnode_offset(fdt, dpmacs_offset, dpmac_str);
+ if (offset < 0) {
+ sprintf(dpmac_str, "ethernet@%x", dpmac_id);
+ offset = fdt_subnode_offset(fdt, dpmacs_offset, dpmac_str);
+ if (offset < 0) {
+ printf("dpmac@%x/ethernet@%x node not found in device tree\n",
+ dpmac_id, dpmac_id);
+ return offset;
+ }
+ }
+
+ return offset;
+}
+
+static int fdt_update_phy_addr(void *fdt, int dpmac_id, int phy_addr)
+{
+ char dpmac_str[] = "dpmacs@00";
+ const u32 *phyhandle;
+ int offset;
+ int err;
+
+ /* get the dpmac offset */
+ offset = fdt_get_dpmac_node(fdt, dpmac_id);
+ if (offset < 0)
+ return offset;
+
+ /* get dpmac phy-handle */
+ sprintf(dpmac_str, "dpmac@%x", dpmac_id);
+ phyhandle = (u32 *)fdt_getprop(fdt, offset, "phy-handle", NULL);
+ if (!phyhandle) {
+ printf("%s node not found in device tree\n", dpmac_str);
+ return offset;
+ }
+
+ offset = fdt_node_offset_by_phandle(fdt, fdt32_to_cpu(*phyhandle));
+ if (offset < 0) {
+ printf("Could not get the ph node offset for dpmac %d\n",
+ dpmac_id);
+ return offset;
+ }
+
+ phy_addr = cpu_to_fdt32(phy_addr);
+ err = fdt_setprop(fdt, offset, "reg", &phy_addr, sizeof(phy_addr));
+ if (err < 0) {
+ printf("Could not set phy node's reg for dpmac %d: %s.\n",
+ dpmac_id, fdt_strerror(err));
+ return err;
+ }
+
+ return 0;
+}
+
+static int fdt_delete_phy_handle(void *fdt, int dpmac_id)
+{
+ const u32 *phyhandle;
+ int offset;
+
+ /* get the dpmac offset */
+ offset = fdt_get_dpmac_node(fdt, dpmac_id);
+ if (offset < 0)
+ return offset;
+
+ /* verify if the node has a phy-handle */
+ phyhandle = (u32 *)fdt_getprop(fdt, offset, "phy-handle", NULL);
+ if (!phyhandle)
+ return 0;
+
+ return fdt_delprop(fdt, offset, "phy-handle");
+}
+
+int fdt_fixup_board_phy_revc(void *fdt)
+{
+ int ret;
+
+ if (get_board_rev() < 'C')
+ return 0;
+
+ /* DPMACs 3,4 have their Aquantia PHYs at new addresses */
+ ret = fdt_update_phy_addr(fdt, 3, AQR113C_PHY_ADDR1);
+ if (ret)
+ return ret;
+
+ ret = fdt_update_phy_addr(fdt, 4, AQR113C_PHY_ADDR2);
+ if (ret)
+ return ret;
+
+ /* There is no PHY for the DPMAC2, so remove the phy-handle */
+ return fdt_delete_phy_handle(fdt, 2);
+}
diff --git a/board/freescale/lx2160a/eth_lx2162aqds.c b/board/freescale/lx2160a/eth_lx2162aqds.c
new file mode 100644
index 00000000000..805aa705be9
--- /dev/null
+++ b/board/freescale/lx2160a/eth_lx2162aqds.c
@@ -0,0 +1,143 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2020 NXP
+ *
+ */
+
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <exports.h>
+#include <fsl-mc/fsl_mc.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_PHY_AQUANTIA
+ /*
+ * Export functions to be used by AQ firmware
+ * upload application
+ */
+ gd->jt->strcpy = strcpy;
+ gd->jt->mdelay = mdelay;
+ gd->jt->mdio_get_current_dev = mdio_get_current_dev;
+ gd->jt->phy_find_by_mask = phy_find_by_mask;
+ gd->jt->mdio_phydev_for_ethname = mdio_phydev_for_ethname;
+ gd->jt->miiphy_set_current_dev = miiphy_set_current_dev;
+#endif
+
+ return 0;
+}
+
+#if defined(CONFIG_RESET_PHY_R)
+void reset_phy(void)
+{
+#if defined(CONFIG_FSL_MC_ENET)
+ mc_env_boot();
+#endif
+}
+#endif /* CONFIG_RESET_PHY_R */
+
+#if defined(CONFIG_MULTI_DTB_FIT)
+
+/* Structure to hold SERDES protocols supported (network interfaces are
+ * described in the DTS).
+ *
+ * @serdes_block: the index of the SERDES block
+ * @serdes_protocol: the decimal value of the protocol supported
+ * @dts_needed: DTS notes describing the current configuration are needed
+ *
+ * When dts_needed is true, the board_fit_config_name_match() function
+ * will try to exactly match the current configuration of the block with a DTS
+ * name provided.
+ */
+static struct serdes_configuration {
+ u8 serdes_block;
+ u32 serdes_protocol;
+ bool dts_needed;
+} supported_protocols[] = {
+ /* Serdes block #1 */
+ {1, 2, true},
+ {1, 3, true},
+ {1, 15, true},
+ {1, 17, true},
+ {1, 18, true},
+ {1, 20, true},
+
+ /* Serdes block #2 */
+ {2, 2, false},
+ {2, 3, false},
+ {2, 5, false},
+ {2, 10, false},
+ {2, 11, true},
+ {2, 12, true},
+};
+
+#define SUPPORTED_SERDES_PROTOCOLS ARRAY_SIZE(supported_protocols)
+
+static bool protocol_supported(u8 serdes_block, u32 protocol)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol)
+ return true;
+ }
+
+ return false;
+}
+
+static void get_str_protocol(u8 serdes_block, u32 protocol, char *str)
+{
+ struct serdes_configuration serdes_conf;
+ int i;
+
+ for (i = 0; i < SUPPORTED_SERDES_PROTOCOLS; i++) {
+ serdes_conf = supported_protocols[i];
+ if (serdes_conf.serdes_block == serdes_block &&
+ serdes_conf.serdes_protocol == protocol) {
+ if (serdes_conf.dts_needed == true)
+ sprintf(str, "%u", protocol);
+ else
+ sprintf(str, "x");
+ return;
+ }
+ }
+}
+
+int board_fit_config_name_match(const char *name)
+{
+ struct ccsr_gur *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 rcw_status = in_le32(&gur->rcwsr[28]);
+ char srds_s1_str[2], srds_s2_str[2];
+ u32 srds_s1, srds_s2;
+ char expected_dts[100];
+
+ srds_s1 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_MASK;
+ srds_s1 >>= FSL_CHASSIS3_RCWSR28_SRDS1_PRTCL_SHIFT;
+
+ srds_s2 = rcw_status & FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_MASK;
+ srds_s2 >>= FSL_CHASSIS3_RCWSR28_SRDS2_PRTCL_SHIFT;
+
+ /* Check for supported protocols. The default DTS will be used
+ * in this case
+ */
+ if (!protocol_supported(1, srds_s1) ||
+ !protocol_supported(2, srds_s2))
+ return -1;
+
+ get_str_protocol(1, srds_s1, srds_s1_str);
+ get_str_protocol(2, srds_s2, srds_s2_str);
+
+ sprintf(expected_dts, "fsl-lx2160a-qds-%s-%s",
+ srds_s1_str, srds_s2_str);
+
+ if (!strcmp(name, expected_dts))
+ return 0;
+
+ return -1;
+}
+#endif
diff --git a/board/freescale/lx2160a/lx2160a.c b/board/freescale/lx2160a/lx2160a.c
new file mode 100644
index 00000000000..3aa984dab8e
--- /dev/null
+++ b/board/freescale/lx2160a/lx2160a.c
@@ -0,0 +1,864 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2018-2021 NXP
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <display_options.h>
+#include <dm.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <dm/platform_data/serial_pl01x.h>
+#include <i2c.h>
+#include <malloc.h>
+#include <errno.h>
+#include <event.h>
+#include <netdev.h>
+#include <fsl_ddr.h>
+#include <asm/io.h>
+#include <fdt_support.h>
+#include <linux/bitops.h>
+#include <linux/libfdt.h>
+#include <linux/delay.h>
+#include <fsl-mc/fsl_mc.h>
+#include <env_internal.h>
+#include <efi_loader.h>
+#include <asm/arch/mmu.h>
+#include <hwconfig.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/config.h>
+#include <asm/arch/fsl_serdes.h>
+#include <asm/arch/soc.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/qixis.h"
+#include "../common/vid.h"
+#include <fsl_immap.h>
+#include <asm/arch-fsl-layerscape/fsl_icid.h>
+#include "lx2160a.h"
+
+#ifdef CONFIG_EMC2305
+#include "../common/emc2305.h"
+#endif
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+#define CFG_MUX_I2C_SDHC(reg, value) ((reg & 0x3f) | value)
+#define SET_CFG_MUX1_SDHC1_SDHC(reg) (reg & 0x3f)
+#define SET_CFG_MUX2_SDHC1_SPI(reg, value) ((reg & 0xcf) | value)
+#define SET_CFG_MUX3_SDHC1_SPI(reg, value) ((reg & 0xf8) | value)
+#define SET_CFG_MUX_SDHC2_DSPI(reg, value) ((reg & 0xf8) | value)
+#define SET_CFG_MUX1_SDHC1_DSPI(reg, value) ((reg & 0x3f) | value)
+#define SDHC1_BASE_PMUX_DSPI 2
+#define SDHC2_BASE_PMUX_DSPI 2
+#define IIC5_PMUX_SPI3 3
+#endif /* CONFIG_TARGET_LX2160AQDS or CONFIG_TARGET_LX2162AQDS */
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_SYS_I2C_EARLY_INIT) && defined(CONFIG_SPL_BUILD)
+ i2c_early_init_f();
+#endif
+
+#ifdef CONFIG_EMC2305
+ select_i2c_ch_pca9547(I2C_MUX_CH_EMC2305, 0);
+ emc2305_init(I2C_EMC2305_ADDR);
+ set_fan_speed(I2C_EMC2305_PWM, I2C_EMC2305_ADDR);
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+#endif
+
+ fsl_lsch3_early_init_f();
+ return 0;
+}
+
+#ifdef CONFIG_OF_BOARD_FIXUP
+int board_fix_fdt(void *fdt)
+{
+ char *reg_names, *reg_name;
+ int names_len, old_name_len, new_name_len, remaining_names_len;
+ struct str_map {
+ char *old_str;
+ char *new_str;
+ } reg_names_map[] = {
+ { "ccsr", "dbi" },
+ { "pf_ctrl", "ctrl" }
+ };
+ int off = -1, i = 0;
+
+ if (IS_SVR_REV(get_svr(), 1, 0))
+ return 0;
+
+ fdt_for_each_node_by_compatible(off, fdt, -1, "fsl,lx2160a-pcie") {
+ fdt_setprop(fdt, off, "compatible", "fsl,ls-pcie",
+ strlen("fsl,ls-pcie") + 1);
+
+ reg_names = (char *)fdt_getprop(fdt, off, "reg-names",
+ &names_len);
+ if (!reg_names)
+ continue;
+
+ reg_name = reg_names;
+ remaining_names_len = names_len - (reg_name - reg_names);
+ i = 0;
+ while ((i < ARRAY_SIZE(reg_names_map)) && remaining_names_len) {
+ old_name_len = strlen(reg_names_map[i].old_str);
+ new_name_len = strlen(reg_names_map[i].new_str);
+ if (memcmp(reg_name, reg_names_map[i].old_str,
+ old_name_len) == 0) {
+ /* first only leave required bytes for new_str
+ * and copy rest of the string after it
+ */
+ memcpy(reg_name + new_name_len,
+ reg_name + old_name_len,
+ remaining_names_len - old_name_len);
+ /* Now copy new_str */
+ memcpy(reg_name, reg_names_map[i].new_str,
+ new_name_len);
+ names_len -= old_name_len;
+ names_len += new_name_len;
+ i++;
+ }
+
+ reg_name = memchr(reg_name, '\0', remaining_names_len);
+ if (!reg_name)
+ break;
+
+ reg_name += 1;
+
+ remaining_names_len = names_len -
+ (reg_name - reg_names);
+ }
+
+ fdt_setprop(fdt, off, "reg-names", reg_names, names_len);
+ }
+
+ /* Fixup u-boot's DTS in case this is a revC board and
+ * we're using DM_ETH.
+ */
+ if (IS_ENABLED(CONFIG_TARGET_LX2160ARDB) && IS_ENABLED(CONFIG_DM_ETH))
+ fdt_fixup_board_phy_revc(fdt);
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+void esdhc_dspi_status_fixup(void *blob)
+{
+ const char esdhc0_path[] = "/soc/esdhc@2140000";
+ const char esdhc1_path[] = "/soc/esdhc@2150000";
+ const char dspi0_path[] = "/soc/spi@2100000";
+ const char dspi1_path[] = "/soc/spi@2110000";
+ const char dspi2_path[] = "/soc/spi@2120000";
+
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 sdhc1_base_pmux;
+ u32 sdhc2_base_pmux;
+ u32 iic5_pmux;
+
+ /* Check RCW field sdhc1_base_pmux to enable/disable
+ * esdhc0/dspi0 DT node
+ */
+ sdhc1_base_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR12_REGSR - 1])
+ & FSL_CHASSIS3_SDHC1_BASE_PMUX_MASK;
+ sdhc1_base_pmux >>= FSL_CHASSIS3_SDHC1_BASE_PMUX_SHIFT;
+
+ if (sdhc1_base_pmux == SDHC1_BASE_PMUX_DSPI) {
+ do_fixup_by_path(blob, dspi0_path, "status", "okay",
+ sizeof("okay"), 1);
+ do_fixup_by_path(blob, esdhc0_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ } else {
+ do_fixup_by_path(blob, esdhc0_path, "status", "okay",
+ sizeof("okay"), 1);
+ do_fixup_by_path(blob, dspi0_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ }
+
+ /* Check RCW field sdhc2_base_pmux to enable/disable
+ * esdhc1/dspi1 DT node
+ */
+ sdhc2_base_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR13_REGSR - 1])
+ & FSL_CHASSIS3_SDHC2_BASE_PMUX_MASK;
+ sdhc2_base_pmux >>= FSL_CHASSIS3_SDHC2_BASE_PMUX_SHIFT;
+
+ if (sdhc2_base_pmux == SDHC2_BASE_PMUX_DSPI) {
+ do_fixup_by_path(blob, dspi1_path, "status", "okay",
+ sizeof("okay"), 1);
+ do_fixup_by_path(blob, esdhc1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ } else {
+ do_fixup_by_path(blob, esdhc1_path, "status", "okay",
+ sizeof("okay"), 1);
+ do_fixup_by_path(blob, dspi1_path, "status", "disabled",
+ sizeof("disabled"), 1);
+ }
+
+ /* Check RCW field IIC5 to enable dspi2 DT node */
+ iic5_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR12_REGSR - 1])
+ & FSL_CHASSIS3_IIC5_PMUX_MASK;
+ iic5_pmux >>= FSL_CHASSIS3_IIC5_PMUX_SHIFT;
+
+ if (iic5_pmux == IIC5_PMUX_SPI3)
+ do_fixup_by_path(blob, dspi2_path, "status", "okay",
+ sizeof("okay"), 1);
+ else
+ do_fixup_by_path(blob, dspi2_path, "status", "disabled",
+ sizeof("disabled"), 1);
+}
+#endif
+
+int esdhc_status_fixup(void *blob, const char *compat)
+{
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+ /* Enable esdhc and dspi DT nodes based on RCW fields */
+ esdhc_dspi_status_fixup(blob);
+#else
+ /* Enable both esdhc DT nodes for LX2160ARDB */
+ do_fixup_by_compat(blob, compat, "status", "okay",
+ sizeof("okay"), 1);
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_VID)
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+int init_func_vid(void)
+{
+ int set_vid;
+
+ if (IS_SVR_REV(get_svr(), 1, 0))
+ set_vid = adjust_vdd(800);
+ else
+ set_vid = adjust_vdd(0);
+
+ if (set_vid < 0)
+ printf("core voltage not adjusted\n");
+
+ return 0;
+}
+#endif
+EVENT_SPY_SIMPLE(EVT_MISC_INIT_F, init_func_vid);
+
+int checkboard(void)
+{
+ enum boot_src src = get_boot_src();
+ char buf[64];
+ u8 sw;
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+ int clock;
+ static const char *const freq[] = {"100", "125", "156.25",
+ "161.13", "322.26", "", "", "",
+ "", "", "", "", "", "", "",
+ "100 separate SSCG"};
+#endif
+
+ cpu_name(buf);
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+ printf("Board: %s-QDS, ", buf);
+#else
+ printf("Board: %s-RDB, ", buf);
+#endif
+
+ sw = QIXIS_READ(arch);
+ printf("Board version: %c, boot from ", (sw & 0xf) - 1 + 'A');
+
+ if (src == BOOT_SOURCE_SD_MMC) {
+ puts("SD\n");
+ } else if (src == BOOT_SOURCE_SD_MMC2) {
+ puts("eMMC\n");
+ } else {
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw >> QIXIS_XMAP_SHIFT) & QIXIS_XMAP_MASK;
+ switch (sw) {
+ case 0:
+ case 4:
+ puts("FlexSPI DEV#0\n");
+ break;
+ case 1:
+ puts("FlexSPI DEV#1\n");
+ break;
+ case 2:
+ case 3:
+ puts("FlexSPI EMU\n");
+ break;
+ default:
+ printf("invalid setting, xmap: %d\n", sw);
+ break;
+ }
+ }
+#if defined(CONFIG_TARGET_LX2160ARDB)
+ printf("FPGA: v%d.%d\n", QIXIS_READ(scver), QIXIS_READ(tagdata));
+
+ puts("SERDES1 Reference: Clock1 = 161.13MHz Clock2 = 161.13MHz\n");
+ puts("SERDES2 Reference: Clock1 = 100MHz Clock2 = 100MHz\n");
+ puts("SERDES3 Reference: Clock1 = 100MHz Clock2 = 100MHz\n");
+#else
+ printf("FPGA: v%d (%s), build %d",
+ (int)QIXIS_READ(scver), qixis_read_tag(buf),
+ (int)qixis_read_minor());
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+
+ puts("SERDES1 Reference : ");
+ sw = QIXIS_READ(brdcfg[2]);
+ clock = sw >> 4;
+ printf("Clock1 = %sMHz ", freq[clock]);
+#if defined(CONFIG_TARGET_LX2160AQDS)
+ clock = sw & 0x0f;
+ printf("Clock2 = %sMHz", freq[clock]);
+#endif
+ sw = QIXIS_READ(brdcfg[3]);
+ puts("\nSERDES2 Reference : ");
+ clock = sw >> 4;
+ printf("Clock1 = %sMHz ", freq[clock]);
+ clock = sw & 0x0f;
+ printf("Clock2 = %sMHz\n", freq[clock]);
+#if defined(CONFIG_TARGET_LX2160AQDS)
+ sw = QIXIS_READ(brdcfg[12]);
+ puts("SERDES3 Reference : ");
+ clock = sw >> 4;
+ printf("Clock1 = %sMHz Clock2 = %sMHz\n", freq[clock], freq[clock]);
+#endif
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+static void esdhc_adapter_card_ident(void)
+{
+ u8 card_id, val;
+
+ val = QIXIS_READ(sdhc1);
+ card_id = val & QIXIS_SDID_MASK;
+
+ switch (card_id) {
+ case QIXIS_ESDHC_ADAPTER_TYPE_SD:
+ /* Power cycle to card */
+ val &= ~QIXIS_SDHC1_S1V3;
+ QIXIS_WRITE(sdhc1, val);
+ mdelay(1);
+ val |= QIXIS_SDHC1_S1V3;
+ QIXIS_WRITE(sdhc1, val);
+ /* Route to SDHC1_VS */
+ val = QIXIS_READ(brdcfg[11]);
+ val |= QIXIS_SDHC1_VS;
+ QIXIS_WRITE(brdcfg[11], val);
+ break;
+ default:
+ break;
+ }
+}
+
+int config_board_mux(void)
+{
+ u8 reg11, reg5, reg13;
+ struct ccsr_gur __iomem *gur = (void *)(CFG_SYS_FSL_GUTS_ADDR);
+ u32 sdhc1_base_pmux;
+ u32 sdhc2_base_pmux;
+ u32 iic5_pmux;
+
+ /* Routes {I2C2_SCL, I2C2_SDA} to SDHC1 as {SDHC1_CD_B, SDHC1_WP}.
+ * Routes {I2C3_SCL, I2C3_SDA} to CAN transceiver as {CAN1_TX,CAN1_RX}.
+ * Routes {I2C4_SCL, I2C4_SDA} to CAN transceiver as {CAN2_TX,CAN2_RX}.
+ * Qixis and remote systems are isolated from the I2C1 bus.
+ * Processor connections are still available.
+ * SPI2 CS2_B controls EN25S64 SPI memory device.
+ * SPI3 CS2_B controls EN25S64 SPI memory device.
+ * EC2 connects to PHY #2 using RGMII protocol.
+ * CLK_OUT connects to FPGA for clock measurement.
+ */
+
+ reg5 = QIXIS_READ(brdcfg[5]);
+ reg5 = CFG_MUX_I2C_SDHC(reg5, 0x40);
+ QIXIS_WRITE(brdcfg[5], reg5);
+
+ /* Check RCW field sdhc1_base_pmux
+ * esdhc0 : sdhc1_base_pmux = 0
+ * dspi0 : sdhc1_base_pmux = 2
+ */
+ sdhc1_base_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR12_REGSR - 1])
+ & FSL_CHASSIS3_SDHC1_BASE_PMUX_MASK;
+ sdhc1_base_pmux >>= FSL_CHASSIS3_SDHC1_BASE_PMUX_SHIFT;
+
+ if (sdhc1_base_pmux == SDHC1_BASE_PMUX_DSPI) {
+ reg11 = QIXIS_READ(brdcfg[11]);
+ reg11 = SET_CFG_MUX1_SDHC1_DSPI(reg11, 0x40);
+ QIXIS_WRITE(brdcfg[11], reg11);
+ } else {
+ /* - Routes {SDHC1_CMD, SDHC1_CLK } to SDHC1 adapter slot.
+ * {SDHC1_DAT3, SDHC1_DAT2} to SDHC1 adapter slot.
+ * {SDHC1_DAT1, SDHC1_DAT0} to SDHC1 adapter slot.
+ */
+ reg11 = QIXIS_READ(brdcfg[11]);
+ reg11 = SET_CFG_MUX1_SDHC1_SDHC(reg11);
+ QIXIS_WRITE(brdcfg[11], reg11);
+ }
+
+ /* Check RCW field sdhc2_base_pmux
+ * esdhc1 : sdhc2_base_pmux = 0 (default)
+ * dspi1 : sdhc2_base_pmux = 2
+ */
+ sdhc2_base_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR13_REGSR - 1])
+ & FSL_CHASSIS3_SDHC2_BASE_PMUX_MASK;
+ sdhc2_base_pmux >>= FSL_CHASSIS3_SDHC2_BASE_PMUX_SHIFT;
+
+ if (sdhc2_base_pmux == SDHC2_BASE_PMUX_DSPI) {
+ reg13 = QIXIS_READ(brdcfg[13]);
+ reg13 = SET_CFG_MUX_SDHC2_DSPI(reg13, 0x01);
+ QIXIS_WRITE(brdcfg[13], reg13);
+ } else {
+ reg13 = QIXIS_READ(brdcfg[13]);
+ reg13 = SET_CFG_MUX_SDHC2_DSPI(reg13, 0x00);
+ QIXIS_WRITE(brdcfg[13], reg13);
+ }
+
+ /* Check RCW field IIC5 to enable dspi2 DT nodei
+ * dspi2: IIC5 = 3
+ */
+ iic5_pmux = gur_in32(&gur->rcwsr[FSL_CHASSIS3_RCWSR12_REGSR - 1])
+ & FSL_CHASSIS3_IIC5_PMUX_MASK;
+ iic5_pmux >>= FSL_CHASSIS3_IIC5_PMUX_SHIFT;
+
+ if (iic5_pmux == IIC5_PMUX_SPI3) {
+ /* - Routes {SDHC1_DAT4} to SPI3 devices as {SPI3_M_CS0_B}. */
+ reg11 = QIXIS_READ(brdcfg[11]);
+ reg11 = SET_CFG_MUX2_SDHC1_SPI(reg11, 0x10);
+ QIXIS_WRITE(brdcfg[11], reg11);
+
+ /* - Routes {SDHC1_DAT5, SDHC1_DAT6} nowhere.
+ * {SDHC1_DAT7, SDHC1_DS } to {nothing, SPI3_M0_CLK }.
+ * {I2C5_SCL, I2C5_SDA } to {SPI3_M0_MOSI, SPI3_M0_MISO}.
+ */
+ reg11 = QIXIS_READ(brdcfg[11]);
+ reg11 = SET_CFG_MUX3_SDHC1_SPI(reg11, 0x01);
+ QIXIS_WRITE(brdcfg[11], reg11);
+ } else {
+ /*
+ * If {SDHC1_DAT4} has been configured to route to SDHC1_VS,
+ * do not change it.
+ * Otherwise route {SDHC1_DAT4} to SDHC1 adapter slot.
+ */
+ reg11 = QIXIS_READ(brdcfg[11]);
+ if ((reg11 & 0x30) != 0x30) {
+ reg11 = SET_CFG_MUX2_SDHC1_SPI(reg11, 0x00);
+ QIXIS_WRITE(brdcfg[11], reg11);
+ }
+
+ /* - Routes {SDHC1_DAT5, SDHC1_DAT6} to SDHC1 adapter slot.
+ * {SDHC1_DAT7, SDHC1_DS } to SDHC1 adapter slot.
+ * {I2C5_SCL, I2C5_SDA } to SDHC1 adapter slot.
+ */
+ reg11 = QIXIS_READ(brdcfg[11]);
+ reg11 = SET_CFG_MUX3_SDHC1_SPI(reg11, 0x00);
+ QIXIS_WRITE(brdcfg[11], reg11);
+ }
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+ esdhc_adapter_card_ident();
+ return 0;
+}
+#elif defined(CONFIG_TARGET_LX2160ARDB)
+int config_board_mux(void)
+{
+ u8 brdcfg;
+
+ brdcfg = QIXIS_READ(brdcfg[4]);
+ /* The BRDCFG4 register controls general board configuration.
+ *|-------------------------------------------|
+ *|Field | Function |
+ *|-------------------------------------------|
+ *|5 | CAN I/O Enable (net CFG_CAN_EN_B):|
+ *|CAN_EN | 0= CAN transceivers are disabled. |
+ *| | 1= CAN transceivers are enabled. |
+ *|-------------------------------------------|
+ */
+ brdcfg |= BIT_MASK(5);
+ QIXIS_WRITE(brdcfg[4], brdcfg);
+
+ return 0;
+}
+#else
+int config_board_mux(void)
+{
+ return 0;
+}
+#endif
+
+#if IS_ENABLED(CONFIG_TARGET_LX2160ARDB)
+u8 get_board_rev(void)
+{
+ u8 board_rev = (QIXIS_READ(arch) & 0xf) - 1 + 'A';
+
+ return board_rev;
+}
+#endif
+
+unsigned long get_board_sys_clk(void)
+{
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x03) {
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ }
+ return 100000000;
+#else
+ return 100000000;
+#endif
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+ return 100000000;
+#else
+ return 100000000;
+#endif
+}
+
+int board_init(void)
+{
+#if defined(CONFIG_FSL_MC_ENET) && defined(CONFIG_TARGET_LX2160ARDB)
+ u32 __iomem *irq_ccsr = (u32 __iomem *)ISC_BASE;
+#endif
+
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+
+#if defined(CONFIG_FSL_MC_ENET) && defined(CONFIG_TARGET_LX2160ARDB)
+ /* invert AQR107 IRQ pins polarity */
+ out_le32(irq_ccsr + IRQCR_OFFSET / 4, AQR107_IRQ_MASK);
+#endif
+
+#if !defined(CONFIG_SYS_EARLY_PCI_INIT)
+ pci_init();
+#endif
+ return 0;
+}
+
+void detail_board_ddr_info(void)
+{
+ int i;
+ u64 ddr_size = 0;
+
+ puts("\nDDR ");
+ for (i = 0; i < CONFIG_NR_DRAM_BANKS; i++)
+ ddr_size += gd->bd->bi_dram[i].size;
+ print_size(ddr_size, "");
+ print_ddr_info(0);
+}
+
+#ifdef CONFIG_MISC_INIT_R
+int misc_init_r(void)
+{
+ config_board_mux();
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_VID
+u16 soc_get_fuse_vid(int vid_index)
+{
+ static const u16 vdd[32] = {
+ 8250,
+ 7875,
+ 7750,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 8000,
+ 8125,
+ 8250,
+ 0, /* reserved */
+ 8500,
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ 0, /* reserved */
+ };
+
+ return vdd[vid_index];
+};
+#endif
+
+#ifdef CONFIG_FSL_MC_ENET
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ int offset;
+
+ offset = fdt_path_offset(fdt, "/soc/fsl-mc");
+
+ if (offset < 0)
+ offset = fdt_path_offset(fdt, "/fsl-mc");
+
+ if (offset < 0) {
+ printf("%s: fsl-mc node not found in device tree (error %d)\n",
+ __func__, offset);
+ return;
+ }
+
+ if (get_mc_boot_status() == 0 &&
+ (is_lazy_dpl_addr_valid() || get_dpl_apply_status() == 0)) {
+ fdt_status_okay(fdt, offset);
+ if (IS_ENABLED(CONFIG_TARGET_LX2160ARDB))
+ fdt_fixup_board_phy_revc(fdt);
+ } else {
+ fdt_status_fail(fdt, offset);
+ }
+}
+
+void board_quiesce_devices(void)
+{
+ fsl_mc_ldpaa_exit(gd->bd);
+}
+#endif
+
+#if IS_ENABLED(CONFIG_TARGET_LX2160ARDB)
+int fdt_fixup_add_thermal(void *blob, int mux_node, int channel, int reg)
+{
+ int err;
+ int noff;
+ int offset;
+ char channel_node_name[50];
+ char thermal_node_name[50];
+ u32 phandle;
+
+ snprintf(channel_node_name, sizeof(channel_node_name),
+ "i2c@%x", channel);
+ debug("channel_node_name = %s\n", channel_node_name);
+
+ snprintf(thermal_node_name, sizeof(thermal_node_name),
+ "temperature-sensor@%x", reg);
+ debug("thermal_node_name = %s\n", thermal_node_name);
+
+ err = fdt_increase_size(blob, 200);
+ if (err) {
+ printf("fdt_increase_size: err=%s\n", fdt_strerror(err));
+ return err;
+ }
+
+ noff = fdt_subnode_offset(blob, mux_node, (const char *)
+ channel_node_name);
+ if (noff < 0) {
+ /* channel node not found - create it */
+ noff = fdt_add_subnode(blob, mux_node, channel_node_name);
+ if (noff < 0) {
+ printf("fdt_add_subnode: err=%s\n", fdt_strerror(err));
+ return err;
+ }
+ fdt_setprop_u32 (blob, noff, "#address-cells", 1);
+ fdt_setprop_u32 (blob, noff, "#size-cells", 0);
+ fdt_setprop_u32 (blob, noff, "reg", channel);
+ }
+
+ /* Create thermal node*/
+ offset = fdt_add_subnode(blob, noff, thermal_node_name);
+ fdt_setprop(blob, offset, "compatible", "nxp,sa56004",
+ strlen("nxp,sa56004") + 1);
+ fdt_setprop_u32 (blob, offset, "reg", reg);
+
+ /* fixup phandle*/
+ noff = fdt_node_offset_by_compatible(blob, -1, "regulator-fixed");
+ if (noff < 0) {
+ printf("%s : failed to get phandle\n", __func__);
+ return noff;
+ }
+ phandle = fdt_get_phandle(blob, noff);
+ fdt_setprop_u32 (blob, offset, "vcc-supply", phandle);
+
+ return 0;
+}
+
+void fdt_fixup_delete_thermal(void *blob, int mux_node, int channel, int reg)
+{
+ int node;
+ int value;
+ int err;
+ int subnode;
+
+ fdt_for_each_subnode(subnode, blob, mux_node) {
+ value = fdtdec_get_uint(blob, subnode, "reg", -1);
+ if (value == channel) {
+ /* delete thermal node */
+ fdt_for_each_subnode(node, blob, subnode) {
+ value = fdtdec_get_uint(blob, node, "reg", -1);
+ err = fdt_node_check_compatible(blob, node,
+ "nxp,sa56004");
+ if (!err && value == reg) {
+ fdt_del_node(blob, node);
+ break;
+ }
+ }
+ }
+ }
+}
+
+void fdt_fixup_i2c_thermal_node(void *blob)
+{
+ int i2coffset;
+ int mux_node;
+ int reg;
+ int err;
+
+ i2coffset = fdt_node_offset_by_compat_reg(blob, "fsl,vf610-i2c",
+ 0x2000000);
+ if (i2coffset != -FDT_ERR_NOTFOUND) {
+ fdt_for_each_subnode(mux_node, blob, i2coffset) {
+ reg = fdtdec_get_uint(blob, mux_node, "reg", -1);
+ err = fdt_node_check_compatible(blob, mux_node,
+ "nxp,pca9547");
+ if (!err && reg == 0x77) {
+ fdt_fixup_delete_thermal(blob, mux_node,
+ 0x3, 0x4d);
+ err = fdt_fixup_add_thermal(blob, mux_node,
+ 0x3, 0x48);
+ if (err)
+ printf("%s: Add thermal node failed\n",
+ __func__);
+ }
+ }
+ } else {
+ printf("%s: i2c node not found\n", __func__);
+ }
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ int i;
+ u16 mc_memory_bank = 0;
+
+ u64 *base;
+ u64 *size;
+ u64 mc_memory_base = 0;
+ u64 mc_memory_size = 0;
+ u16 total_memory_banks;
+ int err;
+
+ err = fdt_increase_size(blob, 512);
+ if (err) {
+ printf("%s fdt_increase_size: err=%s\n", __func__,
+ fdt_strerror(err));
+ return err;
+ }
+
+ ft_cpu_setup(blob, bd);
+
+ fdt_fixup_mc_ddr(&mc_memory_base, &mc_memory_size);
+
+ if (mc_memory_base != 0)
+ mc_memory_bank++;
+
+ total_memory_banks = CONFIG_NR_DRAM_BANKS + mc_memory_bank;
+
+ base = calloc(total_memory_banks, sizeof(u64));
+ size = calloc(total_memory_banks, sizeof(u64));
+
+ /* fixup DT for the three GPP DDR banks */
+ for (i = 0; i < CONFIG_NR_DRAM_BANKS; i++) {
+ base[i] = gd->bd->bi_dram[i].start;
+ size[i] = gd->bd->bi_dram[i].size;
+ }
+
+#ifdef CONFIG_RESV_RAM
+ /* reduce size if reserved memory is within this bank */
+ if (gd->arch.resv_ram >= base[0] &&
+ gd->arch.resv_ram < base[0] + size[0])
+ size[0] = gd->arch.resv_ram - base[0];
+ else if (gd->arch.resv_ram >= base[1] &&
+ gd->arch.resv_ram < base[1] + size[1])
+ size[1] = gd->arch.resv_ram - base[1];
+ else if (gd->arch.resv_ram >= base[2] &&
+ gd->arch.resv_ram < base[2] + size[2])
+ size[2] = gd->arch.resv_ram - base[2];
+#endif
+
+ if (mc_memory_base != 0) {
+ for (i = 0; i <= total_memory_banks; i++) {
+ if (base[i] == 0 && size[i] == 0) {
+ base[i] = mc_memory_base;
+ size[i] = mc_memory_size;
+ break;
+ }
+ }
+ }
+
+ fdt_fixup_memory_banks(blob, base, size, total_memory_banks);
+
+#ifdef CONFIG_USB_HOST
+ fsl_fdt_fixup_dr_usb(blob, bd);
+#endif
+
+#ifdef CONFIG_FSL_MC_ENET
+ fdt_fsl_mc_fixup_iommu_map_entry(blob);
+ fdt_fixup_board_enet(blob);
+ fdt_reserve_mc_mem(blob, 0x4000);
+#endif
+ fdt_fixup_icid(blob);
+
+#if IS_ENABLED(CONFIG_TARGET_LX2160ARDB)
+ if (get_board_rev() == 'C')
+ fdt_fixup_i2c_thermal_node(blob);
+#endif
+
+ return 0;
+}
+#endif
+
+void qixis_dump_switch(void)
+{
+ int i, nr_of_cfgsw;
+
+ QIXIS_WRITE(cms[0], 0x00);
+ nr_of_cfgsw = QIXIS_READ(cms[1]);
+
+ puts("DIP switch settings dump:\n");
+ for (i = 1; i <= nr_of_cfgsw; i++) {
+ QIXIS_WRITE(cms[0], i);
+ printf("SW%d = (0x%02x)\n", i, QIXIS_READ(cms[1]));
+ }
+}
diff --git a/board/freescale/lx2160a/lx2160a.h b/board/freescale/lx2160a/lx2160a.h
new file mode 100644
index 00000000000..61a8bb95906
--- /dev/null
+++ b/board/freescale/lx2160a/lx2160a.h
@@ -0,0 +1,76 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2020 NXP
+ */
+
+#ifndef __LX2160_H
+#define __LX2160_H
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+/* SYSCLK */
+#define QIXIS_SYSCLK_100 0x0
+#define QIXIS_SYSCLK_125 0x1
+#define QIXIS_SYSCLK_133 0x2
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_100 0x0
+#define QIXIS_DDRCLK_125 0x1
+#define QIXIS_DDRCLK_133 0x2
+
+#define BRDCFG4_EMI1SEL_MASK 0xF8
+#define BRDCFG4_EMI1SEL_SHIFT 3
+#define BRDCFG4_EMI2SEL_MASK 0x07
+#define BRDCFG4_EMI2SEL_SHIFT 0
+#endif
+
+#define QIXIS_XMAP_SHIFT 5
+
+/* RTC */
+#define I2C_MUX_CH_RTC 0xB
+
+/* MAC/PHY configuration */
+#if defined(CONFIG_FSL_MC_ENET)
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+#define AQ_PHY_ADDR1 0x00
+#define AQ_PHY_ADDR2 0x01
+#define AQ_PHY_ADDR3 0x02
+#define AQ_PHY_ADDR4 0x03
+#endif
+
+#ifdef CONFIG_TARGET_LX2160ARDB
+#define AQR107_PHY_ADDR1 0x04
+#define AQR107_PHY_ADDR2 0x05
+#define AQR107_IRQ_MASK 0x0C
+#endif
+
+#define CORTINA_PHY_ADDR1 0x0
+#define INPHI_PHY_ADDR1 0x0
+
+#define RGMII_PHY_ADDR1 0x01
+#define RGMII_PHY_ADDR2 0x02
+
+#if defined(CONFIG_TARGET_LX2160AQDS) || defined(CONFIG_TARGET_LX2162AQDS)
+#define INPHI_PHY_ADDR2 0x1
+#define SGMII_CARD_PORT1_PHY_ADDR 0x1C
+#define SGMII_CARD_PORT2_PHY_ADDR 0x1D
+#define SGMII_CARD_PORT3_PHY_ADDR 0x1E
+#define SGMII_CARD_PORT4_PHY_ADDR 0x1F
+#endif
+#endif
+
+#if IS_ENABLED(CONFIG_TARGET_LX2160ARDB)
+u8 get_board_rev(void);
+int fdt_fixup_board_phy_revc(void *fdt);
+#else
+static inline u8 get_board_rev(void)
+{
+ return 0;
+}
+
+static inline int fdt_fixup_board_phy_revc(void *fdt)
+{
+ return 0;
+}
+#endif
+
+#endif /* __LX2160_H */
diff --git a/board/freescale/m5208evbe/Kconfig b/board/freescale/m5208evbe/Kconfig
new file mode 100644
index 00000000000..9b416afbdc7
--- /dev/null
+++ b/board/freescale/m5208evbe/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5208EVBE
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5208evbe"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5208EVBE"
+
+endif
diff --git a/board/freescale/m5208evbe/MAINTAINERS b/board/freescale/m5208evbe/MAINTAINERS
new file mode 100644
index 00000000000..ff153034a4f
--- /dev/null
+++ b/board/freescale/m5208evbe/MAINTAINERS
@@ -0,0 +1,6 @@
+M5208EVBE BOARD
+M: Angelo Dureghello <angelo@kernel-space.org>
+S: Maintained
+F: board/freescale/m5208evbe/
+F: include/configs/M5208EVBE.h
+F: configs/M5208EVBE_defconfig
diff --git a/board/freescale/m5208evbe/Makefile b/board/freescale/m5208evbe/Makefile
new file mode 100644
index 00000000000..b7a7c3e6471
--- /dev/null
+++ b/board/freescale/m5208evbe/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5208evbe.o
diff --git a/board/freescale/m5208evbe/m5208evbe.c b/board/freescale/m5208evbe/m5208evbe.c
new file mode 100644
index 00000000000..b202b8094d9
--- /dev/null
+++ b/board/freescale/m5208evbe/m5208evbe.c
@@ -0,0 +1,83 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2008, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale M5208EVBe\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdram_t *sdram = (sdram_t *)(MMAP_SDRAM);
+ u32 dramsize, i;
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ out_be32(&sdram->cs0, CFG_SYS_SDRAM_BASE | i);
+#ifdef CFG_SYS_SDRAM_BASE1
+ out_be32(&sdram->cs1, CFG_SYS_SDRAM_BASE | i);
+#endif
+ out_be32(&sdram->cfg1, CFG_SYS_SDRAM_CFG1);
+ out_be32(&sdram->cfg2, CFG_SYS_SDRAM_CFG2);
+
+ udelay(500);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+ asm("nop");
+
+ /* Perform two refresh cycles */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ asm("nop");
+
+ /* Issue LEMR */
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE);
+ asm("nop");
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_EMOD);
+ asm("nop");
+
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+ asm("nop");
+
+ out_be32(&sdram->ctrl,
+ (CFG_SYS_SDRAM_CTRL & ~0x80000000) | 0x10000F00);
+ asm("nop");
+
+ udelay(100);
+
+ gd->ram_size = dramsize;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5235evb/Kconfig b/board/freescale/m5235evb/Kconfig
new file mode 100644
index 00000000000..f0d4c8c7964
--- /dev/null
+++ b/board/freescale/m5235evb/Kconfig
@@ -0,0 +1,18 @@
+if TARGET_M5235EVB
+
+config SYS_CPU
+ default "mcf523x"
+
+config SYS_BOARD
+ default "m5235evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5235EVB"
+
+config NORFLASH_PS32BIT
+ bool "Board has 32bit CFI flash"
+
+endif
diff --git a/board/freescale/m5235evb/MAINTAINERS b/board/freescale/m5235evb/MAINTAINERS
new file mode 100644
index 00000000000..b15ac5f14ab
--- /dev/null
+++ b/board/freescale/m5235evb/MAINTAINERS
@@ -0,0 +1,7 @@
+M5235EVB BOARD
+M: TsiChung Liew <Tsi-Chung.Liew@nxp.com>
+S: Maintained
+F: board/freescale/m5235evb/
+F: include/configs/M5235EVB.h
+F: configs/M5235EVB_defconfig
+F: configs/M5235EVB_Flash32_defconfig
diff --git a/board/freescale/m5235evb/Makefile b/board/freescale/m5235evb/Makefile
new file mode 100644
index 00000000000..b7067e4581b
--- /dev/null
+++ b/board/freescale/m5235evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5235evb.o
diff --git a/board/freescale/m5235evb/m5235evb.c b/board/freescale/m5235evb/m5235evb.c
new file mode 100644
index 00000000000..65cde56fb2d
--- /dev/null
+++ b/board/freescale/m5235evb/m5235evb.c
@@ -0,0 +1,111 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale M5235 EVB\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdram_t *sdram = (sdram_t *)(MMAP_SDRAM);
+ gpio_t *gpio = (gpio_t *)(MMAP_GPIO);
+ u32 dramsize, i, dramclk;
+
+ /*
+ * When booting from external Flash, the port-size is less than
+ * the port-size of SDRAM. In this case it is necessary to enable
+ * Data[15:0] on Port Address/Data.
+ */
+ out_8(&gpio->par_ad,
+ GPIO_PAR_AD_ADDR23 | GPIO_PAR_AD_ADDR22 | GPIO_PAR_AD_ADDR21 |
+ GPIO_PAR_AD_DATAL);
+
+ /* Initialize PAR to enable SDRAM signals */
+ out_8(&gpio->par_sdram,
+ GPIO_PAR_SDRAM_SDWE | GPIO_PAR_SDRAM_SCAS |
+ GPIO_PAR_SDRAM_SRAS | GPIO_PAR_SDRAM_SCKE |
+ GPIO_PAR_SDRAM_SDCS(3));
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ if (!(in_be32(&sdram->dacr0) & SDRAMC_DARCn_RE)) {
+ dramclk = gd->bus_clk / (CONFIG_SYS_HZ * CONFIG_SYS_HZ);
+
+ /* Initialize DRAM Control Register: DCR */
+ out_be16(&sdram->dcr, SDRAMC_DCR_RTIM_9CLKS |
+ SDRAMC_DCR_RTIM_6CLKS |
+ SDRAMC_DCR_RC((15 * dramclk) >> 4));
+
+ /* Initialize DACR0 */
+ out_be32(&sdram->dacr0,
+ SDRAMC_DARCn_BA(CFG_SYS_SDRAM_BASE) |
+ SDRAMC_DARCn_CASL_C1 | SDRAMC_DARCn_CBM_CMD20 |
+ SDRAMC_DARCn_PS_32);
+ asm("nop");
+
+ /* Initialize DMR0 */
+ out_be32(&sdram->dmr0,
+ ((dramsize - 1) & 0xFFFC0000) | SDRAMC_DMRn_V);
+ asm("nop");
+
+ /* Set IP (bit 3) in DACR */
+ setbits_be32(&sdram->dacr0, SDRAMC_DARCn_IP);
+
+ /* Wait 30ns to allow banks to precharge */
+ for (i = 0; i < 5; i++) {
+ asm("nop");
+ }
+
+ /* Write to this block to initiate precharge */
+ *(u32 *) (CFG_SYS_SDRAM_BASE) = 0xA5A59696;
+
+ /* Set RE (bit 15) in DACR */
+ setbits_be32(&sdram->dacr0, SDRAMC_DARCn_RE);
+
+ /* Wait for at least 8 auto refresh cycles to occur */
+ for (i = 0; i < 0x2000; i++) {
+ asm("nop");
+ }
+
+ /* Finish the configuration by issuing the MRS. */
+ setbits_be32(&sdram->dacr0, SDRAMC_DARCn_IMRS);
+ asm("nop");
+
+ /* Write to the SDRAM Mode Register */
+ *(u32 *) (CFG_SYS_SDRAM_BASE + 0x400) = 0xA5A59696;
+ }
+
+ gd->ram_size = dramsize;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5249evb/Kconfig b/board/freescale/m5249evb/Kconfig
new file mode 100644
index 00000000000..0f624776b55
--- /dev/null
+++ b/board/freescale/m5249evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5249EVB
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5249evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5249EVB"
+
+endif
diff --git a/board/freescale/m5249evb/MAINTAINERS b/board/freescale/m5249evb/MAINTAINERS
new file mode 100644
index 00000000000..619e0cd20da
--- /dev/null
+++ b/board/freescale/m5249evb/MAINTAINERS
@@ -0,0 +1,6 @@
+M5249EVB BOARD
+M: Angelo Dureghello <angelo@kernel-space.org>
+S: Maintained
+F: board/freescale/m5249evb/
+F: include/configs/M5249EVB.h
+F: configs/M5249EVB_defconfig
diff --git a/board/freescale/m5249evb/Makefile b/board/freescale/m5249evb/Makefile
new file mode 100644
index 00000000000..497bc722908
--- /dev/null
+++ b/board/freescale/m5249evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5249evb.o
diff --git a/board/freescale/m5249evb/m5249evb.c b/board/freescale/m5249evb/m5249evb.c
new file mode 100644
index 00000000000..717dc087e02
--- /dev/null
+++ b/board/freescale/m5249evb/m5249evb.c
@@ -0,0 +1,101 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <command.h>
+#include <init.h>
+#include <malloc.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard (void) {
+ ulong val;
+ uchar val8;
+
+ puts ("Board: ");
+ puts("Freescale M5249EVB");
+ val8 = ((uchar)~((uchar)mbar2_readLong(MCFSIM_GPIO1_READ) >> 4)) & 0xf;
+ printf(" (Switch=%1X)\n", val8);
+
+ /*
+ * Set LED on
+ */
+ val = mbar2_readLong(MCFSIM_GPIO1_OUT) & ~CFG_SYS_GPIO1_LED;
+ mbar2_writeLong(MCFSIM_GPIO1_OUT, val); /* Set LED on */
+
+ return 0;
+};
+
+
+int dram_init(void)
+{
+ unsigned long junk = 0xa5a59696;
+
+ /*
+ * Note:
+ * RC = ([(RefreshTime/#rows) / (1/BusClk)] / 16) - 1
+ */
+
+#ifdef CFG_SYS_FAST_CLK
+ /*
+ * Busclk=70MHz, RefreshTime=64ms, #rows=4096 (4K)
+ * SO=1, NAM=0, COC=0, RTIM=01 (6clk refresh), RC=39
+ */
+ mbar_writeShort(MCFSIM_DCR, 0x8239);
+#elif CFG_SYS_PLL_BYPASS
+ /*
+ * Busclk=5.6448MHz, RefreshTime=64ms, #rows=8192 (8K)
+ * SO=1, NAM=0, COC=0, RTIM=01 (6clk refresh), RC=02
+ */
+ mbar_writeShort(MCFSIM_DCR, 0x8202);
+#else
+ /*
+ * Busclk=36MHz, RefreshTime=64ms, #rows=4096 (4K)
+ * SO=1, NAM=0, COC=0, RTIM=01 (6clk refresh), RC=22 (562 bus clock cycles)
+ */
+ mbar_writeShort(MCFSIM_DCR, 0x8222);
+#endif
+
+ /*
+ * SDRAM starts at 0x0000_0000, CASL=10, CBM=010, PS=10 (16bit port),
+ * PM=1 (continuous page mode)
+ */
+
+ /* RE=0 (keep auto-refresh disabled while setting up registers) */
+ mbar_writeLong(MCFSIM_DACR0, 0x00003324);
+
+ /* BAM=007c (bits 22,21 are bank selects; 256kB blocks) */
+ mbar_writeLong(MCFSIM_DMR0, 0x01fc0001);
+
+ /** Precharge sequence **/
+ mbar_writeLong(MCFSIM_DACR0, 0x0000332c); /* Set DACR0[IP] (bit 3) */
+ *((volatile unsigned long *) 0x00) = junk; /* write to a memory location to init. precharge */
+ udelay(0x10); /* Allow several Precharge cycles */
+
+ /** Refresh Sequence **/
+ mbar_writeLong(MCFSIM_DACR0, 0x0000b324); /* Enable the refresh bit, DACR0[RE] (bit 15) */
+ udelay(0x7d0); /* Allow gobs of refresh cycles */
+
+ /** Mode Register initialization **/
+ mbar_writeLong(MCFSIM_DACR0, 0x0000b364); /* Enable DACR0[IMRS] (bit 6); RE remains enabled */
+ *((volatile unsigned long *) 0x800) = junk; /* Access RAM to initialize the mode register */
+
+ gd->ram_size = CFG_SYS_SDRAM_SIZE * 1024 * 1024;
+
+ return 0;
+};
+
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf ("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5253demo/Kconfig b/board/freescale/m5253demo/Kconfig
new file mode 100644
index 00000000000..0ecce875d14
--- /dev/null
+++ b/board/freescale/m5253demo/Kconfig
@@ -0,0 +1,19 @@
+if TARGET_M5253DEMO
+
+config FLASH_CFI_LEGACY
+ depends on SYS_FLASH_CFI
+ def_bool y
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5253demo"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5253DEMO"
+
+endif
diff --git a/board/freescale/m5253demo/MAINTAINERS b/board/freescale/m5253demo/MAINTAINERS
new file mode 100644
index 00000000000..9b27f4382ea
--- /dev/null
+++ b/board/freescale/m5253demo/MAINTAINERS
@@ -0,0 +1,6 @@
+M5253DEMO BOARD
+M: TsiChung Liew <Tsi-Chung.Liew@nxp.com>
+S: Maintained
+F: board/freescale/m5253demo/
+F: include/configs/M5253DEMO.h
+F: configs/M5253DEMO_defconfig
diff --git a/board/freescale/m5253demo/Makefile b/board/freescale/m5253demo/Makefile
new file mode 100644
index 00000000000..00d395d1a3c
--- /dev/null
+++ b/board/freescale/m5253demo/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5253demo.o flash.o
diff --git a/board/freescale/m5253demo/flash.c b/board/freescale/m5253demo/flash.c
new file mode 100644
index 00000000000..334518a4bc9
--- /dev/null
+++ b/board/freescale/m5253demo/flash.c
@@ -0,0 +1,440 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <flash.h>
+#include <init.h>
+#include <irq_func.h>
+#include <time.h>
+
+#include <asm/immap.h>
+
+#ifndef CONFIG_SYS_FLASH_CFI
+typedef unsigned short FLASH_PORT_WIDTH;
+typedef volatile unsigned short FLASH_PORT_WIDTHV;
+
+#define FPW FLASH_PORT_WIDTH
+#define FPWV FLASH_PORT_WIDTHV
+
+#define FLASH_CYCLE1 0x5555
+#define FLASH_CYCLE2 0x2aaa
+
+#define SYNC __asm__("nop")
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+
+ulong flash_get_size(FPWV * addr, flash_info_t * info);
+int flash_get_offsets(ulong base, flash_info_t * info);
+int write_word(flash_info_t * info, FPWV * dest, u16 data);
+static inline void spin_wheel(void);
+
+flash_info_t flash_info[CONFIG_SYS_MAX_FLASH_BANKS];
+
+ulong flash_init(void)
+{
+ ulong size = 0;
+ ulong fbase = 0;
+
+ fbase = (ulong) CFG_SYS_FLASH_BASE;
+ flash_get_size((FPWV *) fbase, &flash_info[0]);
+ flash_get_offsets((ulong) fbase, &flash_info[0]);
+ fbase += flash_info[0].size;
+ size += flash_info[0].size;
+
+ /* Protect monitor and environment sectors */
+ flash_protect(FLAG_PROTECT_SET,
+ CONFIG_SYS_MONITOR_BASE,
+ CONFIG_SYS_MONITOR_BASE + monitor_flash_len - 1, &flash_info[0]);
+
+ return size;
+}
+
+int flash_get_offsets(ulong base, flash_info_t * info)
+{
+ int i;
+
+ if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_SST) {
+
+ info->start[0] = base;
+ info->protect[0] = 0;
+ for (i = 1; i < CFG_SYS_SST_SECT; i++) {
+ info->start[i] = info->start[i - 1]
+ + CFG_SYS_SST_SECTSZ;
+ info->protect[i] = 0;
+ }
+ }
+
+ return ERR_OK;
+}
+
+void flash_print_info(flash_info_t * info)
+{
+ int i;
+
+ switch (info->flash_id & FLASH_VENDMASK) {
+ case FLASH_MAN_SST:
+ printf("SST ");
+ break;
+ default:
+ printf("Unknown Vendor ");
+ break;
+ }
+
+ switch (info->flash_id & FLASH_TYPEMASK) {
+ case FLASH_SST6401B:
+ printf("SST39VF6401B\n");
+ break;
+ default:
+ printf("Unknown Chip Type\n");
+ return;
+ }
+
+ printf(" Size: %ld KB in %d Sectors\n",
+ info->size >> 10, info->sector_count);
+
+ printf(" Sector Start Addresses:");
+ for (i = 0; i < info->sector_count; ++i) {
+ if ((i % 5) == 0)
+ printf("\n ");
+ printf(" %08lX%s",
+ info->start[i], info->protect[i] ? " (RO)" : " ");
+ }
+ printf("\n");
+}
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+ulong flash_get_size(FPWV * addr, flash_info_t * info)
+{
+ u16 value;
+
+ addr[FLASH_CYCLE1] = (FPWV) 0x00AA00AA; /* for Atmel, Intel ignores this */
+ addr[FLASH_CYCLE2] = (FPWV) 0x00550055; /* for Atmel, Intel ignores this */
+ addr[FLASH_CYCLE1] = (FPWV) 0x00900090; /* selects Intel or Atmel */
+
+ switch (addr[0] & 0xffff) {
+ case (u8) SST_MANUFACT:
+ info->flash_id = FLASH_MAN_SST;
+ value = addr[1];
+ break;
+ default:
+ printf("Unknown Flash\n");
+ info->flash_id = FLASH_UNKNOWN;
+ info->sector_count = 0;
+ info->size = 0;
+
+ *addr = (FPW) 0x00F000F0;
+ return (0); /* no or unknown flash */
+ }
+
+ switch (value) {
+ case (u16) SST_ID_xF6401B:
+ info->flash_id += FLASH_SST6401B;
+ break;
+ default:
+ info->flash_id = FLASH_UNKNOWN;
+ break;
+ }
+
+ info->sector_count = 0;
+ info->size = 0;
+ info->sector_count = CFG_SYS_SST_SECT;
+ info->size = CFG_SYS_SST_SECT * CFG_SYS_SST_SECTSZ;
+
+ /* reset ID mode */
+ *addr = (FPWV) 0x00F000F0;
+
+ if (info->sector_count > CONFIG_SYS_MAX_FLASH_SECT) {
+ printf("** ERROR: sector count %d > max (%d) **\n",
+ info->sector_count, CONFIG_SYS_MAX_FLASH_SECT);
+ info->sector_count = CONFIG_SYS_MAX_FLASH_SECT;
+ }
+
+ return (info->size);
+}
+
+int flash_erase(flash_info_t * info, int s_first, int s_last)
+{
+ FPWV *addr;
+ int flag, prot, sect, count;
+ ulong type, start;
+ int rcode = 0, flashtype = 0;
+
+ if ((s_first < 0) || (s_first > s_last)) {
+ if (info->flash_id == FLASH_UNKNOWN)
+ printf("- missing\n");
+ else
+ printf("- no sectors to erase\n");
+ return 1;
+ }
+
+ type = (info->flash_id & FLASH_VENDMASK);
+
+ switch (type) {
+ case FLASH_MAN_SST:
+ flashtype = 1;
+ break;
+ default:
+ type = (info->flash_id & FLASH_VENDMASK);
+ printf("Can't erase unknown flash type %08lx - aborted\n",
+ info->flash_id);
+ return 1;
+ }
+
+ prot = 0;
+ for (sect = s_first; sect <= s_last; ++sect) {
+ if (info->protect[sect]) {
+ prot++;
+ }
+ }
+
+ if (prot)
+ printf("- Warning: %d protected sectors will not be erased!\n",
+ prot);
+ else
+ printf("\n");
+
+ flag = disable_interrupts();
+
+ start = get_timer(0);
+
+ if ((s_last - s_first) == (CFG_SYS_SST_SECT - 1)) {
+ if (prot == 0) {
+ addr = (FPWV *) info->start[0];
+
+ addr[FLASH_CYCLE1] = 0x00AA; /* unlock */
+ addr[FLASH_CYCLE2] = 0x0055; /* unlock */
+ addr[FLASH_CYCLE1] = 0x0080; /* erase mode */
+ addr[FLASH_CYCLE1] = 0x00AA; /* unlock */
+ addr[FLASH_CYCLE2] = 0x0055; /* unlock */
+ *addr = 0x0030; /* erase chip */
+
+ count = 0;
+ start = get_timer(0);
+
+ while ((*addr & 0x0080) != 0x0080) {
+ if (count++ > 0x10000) {
+ spin_wheel();
+ count = 0;
+ }
+
+ /* check timeout, 1000ms */
+ if (get_timer(start) > 1000) {
+ printf("Timeout\n");
+ *addr = 0x00F0; /* reset to read mode */
+
+ return 1;
+ }
+ }
+
+ *addr = 0x00F0; /* reset to read mode */
+
+ printf("\b. done\n");
+
+ if (flag)
+ enable_interrupts();
+
+ return 0;
+ } else if (prot == CFG_SYS_SST_SECT) {
+ return 1;
+ }
+ }
+
+ /* Start erase on unprotected sectors */
+ for (sect = s_first; sect <= s_last; sect++) {
+ if (info->protect[sect] == 0) { /* not protected */
+
+ addr = (FPWV *) (info->start[sect]);
+
+ printf(".");
+
+ /* arm simple, non interrupt dependent timer */
+ start = get_timer(0);
+
+ switch (flashtype) {
+ case 1:
+ {
+ FPWV *base; /* first address in bank */
+
+ flag = disable_interrupts();
+
+ base = (FPWV *) (CFG_SYS_FLASH_BASE); /* First sector */
+
+ base[FLASH_CYCLE1] = 0x00AA; /* unlock */
+ base[FLASH_CYCLE2] = 0x0055; /* unlock */
+ base[FLASH_CYCLE1] = 0x0080; /* erase mode */
+ base[FLASH_CYCLE1] = 0x00AA; /* unlock */
+ base[FLASH_CYCLE2] = 0x0055; /* unlock */
+ *addr = 0x0050; /* erase sector */
+
+ if (flag)
+ enable_interrupts();
+
+ while ((*addr & 0x0080) != 0x0080) {
+ /* check timeout, 1000ms */
+ if (get_timer(start) > 1000) {
+ printf("Timeout\n");
+ *addr = 0x00F0; /* reset to read mode */
+
+ rcode = 1;
+ break;
+ }
+ }
+
+ *addr = 0x00F0; /* reset to read mode */
+ break;
+ }
+ } /* switch (flashtype) */
+ }
+ }
+ printf(" done\n");
+
+ if (flag)
+ enable_interrupts();
+
+ return rcode;
+}
+
+int write_buff(flash_info_t * info, uchar * src, ulong addr, ulong cnt)
+{
+ ulong wp, count;
+ u16 data;
+ int rc;
+
+ if (info->flash_id == FLASH_UNKNOWN)
+ return 4;
+
+ /* get lower word aligned address */
+ wp = addr;
+
+ /* handle unaligned start bytes */
+ if (wp & 1) {
+ data = *((FPWV *) wp);
+ data = (data << 8) | *src;
+
+ if ((rc = write_word(info, (FPWV *) wp, data)) != 0)
+ return (rc);
+
+ wp++;
+ cnt -= 1;
+ src++;
+ }
+
+ while (cnt >= 2) {
+ /*
+ * handle word aligned part
+ */
+ count = 0;
+ data = *((FPWV *) src);
+
+ if ((rc = write_word(info, (FPWV *) wp, data)) != 0)
+ return (rc);
+
+ wp += 2;
+ src += 2;
+ cnt -= 2;
+
+ if (count++ > 0x800) {
+ spin_wheel();
+ count = 0;
+ }
+ }
+ /* handle word aligned part */
+ if (cnt) {
+ /* handle word aligned part */
+ count = 0;
+ data = *((FPWV *) wp);
+
+ data = (data & 0x00FF) | (*src << 8);
+
+ if ((rc = write_word(info, (FPWV *) wp, data)) != 0)
+ return (rc);
+
+ wp++;
+ src++;
+ cnt -= 1;
+ if (count++ > 0x800) {
+ spin_wheel();
+ count = 0;
+ }
+ }
+
+ if (cnt == 0)
+ return ERR_OK;
+
+ return ERR_OK;
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash
+ * A word is 16 bits, whichever the bus width of the flash bank
+ * (not an individual chip) is.
+ *
+ * returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+int write_word(flash_info_t * info, FPWV * dest, u16 data)
+{
+ ulong start;
+ int flag;
+ int res = 0; /* result, assume success */
+ FPWV *base; /* first address in flash bank */
+
+ /* Check if Flash is (sufficiently) erased */
+ if ((*dest & (u8) data) != (u8) data) {
+ return (2);
+ }
+
+ base = (FPWV *) (CFG_SYS_FLASH_BASE);
+
+ /* Disable interrupts which might cause a timeout here */
+ flag = disable_interrupts();
+
+ base[FLASH_CYCLE1] = (u8) 0x00AA00AA; /* unlock */
+ base[FLASH_CYCLE2] = (u8) 0x00550055; /* unlock */
+ base[FLASH_CYCLE1] = (u8) 0x00A000A0; /* selects program mode */
+
+ *dest = data; /* start programming the data */
+
+ /* re-enable interrupts if necessary */
+ if (flag)
+ enable_interrupts();
+
+ start = get_timer(0);
+
+ /* data polling for D7 */
+ while (res == 0
+ && (*dest & (u8) 0x00800080) != (data & (u8) 0x00800080)) {
+ /* check timeout, 500ms */
+ if (get_timer(start) > 500) {
+ *dest = (u8) 0x00F000F0; /* reset bank */
+ res = 1;
+ }
+ }
+
+ *dest++ = (u8) 0x00F000F0; /* reset bank */
+
+ return (res);
+}
+
+static inline void spin_wheel(void)
+{
+ static int p = 0;
+ static char w[] = "\\/-";
+
+ printf("\010%c", w[p]);
+ (++p == 3) ? (p = 0) : 0;
+}
+
+#endif
diff --git a/board/freescale/m5253demo/m5253demo.c b/board/freescale/m5253demo/m5253demo.c
new file mode 100644
index 00000000000..d0b01f81745
--- /dev/null
+++ b/board/freescale/m5253demo/m5253demo.c
@@ -0,0 +1,142 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * Hayden Fraser (Hayden.Fraser@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <netdev.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale MCF5253 DEMO\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ u32 dramsize = 0;
+
+ /*
+ * Check to see if the SDRAM has already been initialized
+ * by a run control tool
+ */
+ if (!(mbar_readLong(MCFSIM_DCR) & 0x8000)) {
+ u32 RC, temp;
+
+ RC = (CFG_SYS_CLK / 1000000) >> 1;
+ RC = (RC * 15) >> 4;
+
+ /* Initialize DRAM Control Register: DCR */
+ mbar_writeShort(MCFSIM_DCR, (0x8400 | RC));
+ __asm__("nop");
+
+ mbar_writeLong(MCFSIM_DACR0, 0x00003224);
+ __asm__("nop");
+
+ /* Initialize DMR0 */
+ dramsize = (CFG_SYS_SDRAM_SIZE << 20);
+ temp = (dramsize - 1) & 0xFFFC0000;
+ mbar_writeLong(MCFSIM_DMR0, temp | 1);
+ __asm__("nop");
+
+ mbar_writeLong(MCFSIM_DACR0, 0x0000322c);
+ mb();
+ __asm__("nop");
+
+ /* Write to this block to initiate precharge */
+ *(u32 *) (CFG_SYS_SDRAM_BASE) = 0xa5a5a5a5;
+ mb();
+ __asm__("nop");
+
+ /* Set RE bit in DACR */
+ mbar_writeLong(MCFSIM_DACR0,
+ mbar_readLong(MCFSIM_DACR0) | 0x8000);
+ __asm__("nop");
+
+ /* Wait for at least 8 auto refresh cycles to occur */
+ udelay(500);
+
+ /* Finish the configuration by issuing the MRS */
+ mbar_writeLong(MCFSIM_DACR0,
+ mbar_readLong(MCFSIM_DACR0) | 0x0040);
+ __asm__("nop");
+
+ *(u32 *) (CFG_SYS_SDRAM_BASE + 0x800) = 0xa5a5a5a5;
+ mb();
+ }
+
+ gd->ram_size = dramsize;
+
+ return 0;
+}
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
+
+#ifdef CONFIG_IDE
+#include <ata.h>
+void ide_set_reset(int idereset)
+{
+ atac_t *ata = (atac_t *) CONFIG_SYS_ATA_BASE_ADDR;
+ long period;
+ /* t1, t2, t3, t4, t5, t6, t9, tRD, tA */
+ int piotms[5][9] = { {70, 165, 60, 30, 50, 5, 20, 0, 35}, /* PIO 0 */
+ {50, 125, 45, 20, 35, 5, 15, 0, 35}, /* PIO 1 */
+ {30, 100, 30, 15, 20, 5, 10, 0, 35}, /* PIO 2 */
+ {30, 80, 30, 10, 20, 5, 10, 0, 35}, /* PIO 3 */
+ {25, 70, 20, 10, 20, 5, 10, 0, 35} /* PIO 4 */
+ };
+
+ if (idereset) {
+ /* control reset */
+ out_8(&ata->cr, 0);
+ udelay(100);
+ } else {
+ mbar2_writeLong(CIM_MISCCR, CIM_MISCCR_CPUEND);
+
+#define CALC_TIMING(t) (t + period - 1) / period
+ period = 1000000000 / (CFG_SYS_CLK / 2); /* period in ns */
+
+ /*ata->ton = CALC_TIMING (180); */
+ out_8(&ata->t1, CALC_TIMING(piotms[2][0]));
+ out_8(&ata->t2w, CALC_TIMING(piotms[2][1]));
+ out_8(&ata->t2r, CALC_TIMING(piotms[2][1]));
+ out_8(&ata->ta, CALC_TIMING(piotms[2][8]));
+ out_8(&ata->trd, CALC_TIMING(piotms[2][7]));
+ out_8(&ata->t4, CALC_TIMING(piotms[2][3]));
+ out_8(&ata->t9, CALC_TIMING(piotms[2][6]));
+
+ /* IORDY enable */
+ out_8(&ata->cr, 0x40);
+ udelay(2000);
+ /* IORDY enable */
+ setbits_8(&ata->cr, 0x01);
+ }
+}
+#endif /* CONFIG_IDE */
+
+
+#ifdef CONFIG_DRIVER_DM9000
+int board_eth_init(struct bd_info *bis)
+{
+ return dm9000_initialize(bis);
+}
+#endif
diff --git a/board/freescale/m5272c3/Kconfig b/board/freescale/m5272c3/Kconfig
new file mode 100644
index 00000000000..aee0b239b3b
--- /dev/null
+++ b/board/freescale/m5272c3/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5272C3
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5272c3"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5272C3"
+
+endif
diff --git a/board/freescale/m5272c3/MAINTAINERS b/board/freescale/m5272c3/MAINTAINERS
new file mode 100644
index 00000000000..692ab5b5829
--- /dev/null
+++ b/board/freescale/m5272c3/MAINTAINERS
@@ -0,0 +1,6 @@
+M5272C3 BOARD
+M: Angelo Dureghello <angelo@kernel-space.org>
+S: Maintained
+F: board/freescale/m5272c3/
+F: include/configs/M5272C3.h
+F: configs/M5272C3_defconfig
diff --git a/board/freescale/m5272c3/Makefile b/board/freescale/m5272c3/Makefile
new file mode 100644
index 00000000000..1df8f7003e4
--- /dev/null
+++ b/board/freescale/m5272c3/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5272c3.o
diff --git a/board/freescale/m5272c3/m5272c3.c b/board/freescale/m5272c3/m5272c3.c
new file mode 100644
index 00000000000..d1286badc61
--- /dev/null
+++ b/board/freescale/m5272c3/m5272c3.c
@@ -0,0 +1,44 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2012 Freescale Semiconductor, Inc. All Rights Reserved.
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard (void) {
+ puts ("Board: ");
+ puts ("Freescale MCF5272C3 EVB\n");
+ return 0;
+ };
+
+int dram_init(void)
+{
+ sdramctrl_t * sdp = (sdramctrl_t *)(MMAP_SDRAM);
+
+ out_be16(&sdp->sdram_sdtr, 0xf539);
+ out_be16(&sdp->sdram_sdcr, 0x4211);
+
+ /* Dummy write to start SDRAM */
+ *((volatile unsigned long *)0) = 0;
+
+ gd->ram_size = CFG_SYS_SDRAM_SIZE * 1024 * 1024;
+
+ return 0;
+ };
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf ("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5275evb/Kconfig b/board/freescale/m5275evb/Kconfig
new file mode 100644
index 00000000000..5a6de9c1c9e
--- /dev/null
+++ b/board/freescale/m5275evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5275EVB
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5275evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5275EVB"
+
+endif
diff --git a/board/freescale/m5275evb/MAINTAINERS b/board/freescale/m5275evb/MAINTAINERS
new file mode 100644
index 00000000000..065ae7bb1df
--- /dev/null
+++ b/board/freescale/m5275evb/MAINTAINERS
@@ -0,0 +1,6 @@
+M5275EVB BOARD
+M: Angelo Dureghello <angelo@kernel-space.org>
+S: Maintained
+F: board/freescale/m5275evb/
+F: include/configs/M5275EVB.h
+F: configs/M5275EVB_defconfig
diff --git a/board/freescale/m5275evb/Makefile b/board/freescale/m5275evb/Makefile
new file mode 100644
index 00000000000..83e3b10f0ed
--- /dev/null
+++ b/board/freescale/m5275evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5275evb.o
diff --git a/board/freescale/m5275evb/m5275evb.c b/board/freescale/m5275evb/m5275evb.c
new file mode 100644
index 00000000000..e1d94fc9a3e
--- /dev/null
+++ b/board/freescale/m5275evb/m5275evb.c
@@ -0,0 +1,105 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2005-2008 Arthur Shipkowski (art@videon-central.com)
+ *
+ * Copyright (C) 2012 Freescale Semiconductor, Inc. All Rights Reserved.
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define PERIOD 13 /* system bus period in ns */
+#define SDRAM_TREFI 7800 /* in ns */
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale MCF5275 EVB\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdramctrl_t *sdp = (sdramctrl_t *)(MMAP_SDRAM);
+ gpio_t *gpio_reg = (gpio_t *)(MMAP_GPIO);
+
+ /* Enable SDRAM */
+ out_be16(&gpio_reg->par_sdram, 0x3FF);
+
+ /* Set up chip select */
+ out_be32(&sdp->sdbar0, CFG_SYS_SDRAM_BASE);
+ out_be32(&sdp->sdbmr0, MCF_SDRAMC_SDMRn_BAM_32M | MCF_SDRAMC_SDMRn_V);
+
+ /* Set up timing */
+ out_be32(&sdp->sdcfg1, 0x83711630);
+ out_be32(&sdp->sdcfg2, 0x46770000);
+
+ /* Enable clock */
+ out_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_MODE_EN | MCF_SDRAMC_SDCR_CKE);
+
+ /* Set precharge */
+ setbits_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_IPALL);
+
+ /* Dummy write to start SDRAM */
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+ /* Send LEMR */
+ setbits_be32(&sdp->sdmr,
+ MCF_SDRAMC_SDMR_BNKAD_LEMR | MCF_SDRAMC_SDMR_AD(0x0) |
+ MCF_SDRAMC_SDMR_CMD);
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+ /* Send LMR */
+ out_be32(&sdp->sdmr, 0x058d0000);
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+ /* Stop sending commands */
+ clrbits_be32(&sdp->sdmr, MCF_SDRAMC_SDMR_CMD);
+
+ /* Set precharge */
+ setbits_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_IPALL);
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+ /* Stop manual precharge, send 2 IREF */
+ clrbits_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_IPALL);
+ setbits_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_IREF);
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+
+ out_be32(&sdp->sdmr, 0x018d0000);
+ *((volatile unsigned long *)CFG_SYS_SDRAM_BASE) = 0xa5a59696;
+
+ /* Stop sending commands */
+ clrbits_be32(&sdp->sdmr, MCF_SDRAMC_SDMR_CMD);
+ clrbits_be32(&sdp->sdcr, MCF_SDRAMC_SDCR_MODE_EN);
+
+ /* Turn on auto refresh, lock SDMR */
+ out_be32(&sdp->sdcr,
+ MCF_SDRAMC_SDCR_CKE
+ | MCF_SDRAMC_SDCR_REF
+ | MCF_SDRAMC_SDCR_MUX(1)
+ /* 1 added to round up */
+ | MCF_SDRAMC_SDCR_RCNT((SDRAM_TREFI/(PERIOD*64)) - 1 + 1)
+ | MCF_SDRAMC_SDCR_DQS_OE(0x3));
+
+ gd->ram_size = CFG_SYS_SDRAM_SIZE * 1024 * 1024;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5282evb/Kconfig b/board/freescale/m5282evb/Kconfig
new file mode 100644
index 00000000000..2ffdd528f63
--- /dev/null
+++ b/board/freescale/m5282evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5282EVB
+
+config SYS_CPU
+ default "mcf52x2"
+
+config SYS_BOARD
+ default "m5282evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5282EVB"
+
+endif
diff --git a/board/freescale/m5282evb/MAINTAINERS b/board/freescale/m5282evb/MAINTAINERS
new file mode 100644
index 00000000000..f141c89c3a5
--- /dev/null
+++ b/board/freescale/m5282evb/MAINTAINERS
@@ -0,0 +1,6 @@
+M5282EVB BOARD
+M: Angelo Dureghello <angelo@kernel-space.org>
+S: Maintained
+F: board/freescale/m5282evb/
+F: include/configs/M5282EVB.h
+F: configs/M5282EVB_defconfig
diff --git a/board/freescale/m5282evb/Makefile b/board/freescale/m5282evb/Makefile
new file mode 100644
index 00000000000..e898f39330b
--- /dev/null
+++ b/board/freescale/m5282evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5282evb.o
diff --git a/board/freescale/m5282evb/m5282evb.c b/board/freescale/m5282evb/m5282evb.c
new file mode 100644
index 00000000000..81da6e2abd4
--- /dev/null
+++ b/board/freescale/m5282evb/m5282evb.c
@@ -0,0 +1,87 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard (void)
+{
+ puts ("Board: Freescale M5282EVB Evaluation Board\n");
+ return 0;
+}
+
+int dram_init(void)
+{
+ u32 dramsize, i, dramclk;
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ if (!(MCFSDRAMC_DACR0 & MCFSDRAMC_DACR_RE))
+ {
+ dramclk = gd->bus_clk / (CONFIG_SYS_HZ * CONFIG_SYS_HZ);
+
+ /* Initialize DRAM Control Register: DCR */
+ MCFSDRAMC_DCR = (0
+ | MCFSDRAMC_DCR_RTIM_6
+ | MCFSDRAMC_DCR_RC((15 * dramclk)>>4));
+ asm("nop");
+
+ /* Initialize DACR0 */
+ MCFSDRAMC_DACR0 = (0
+ | MCFSDRAMC_DACR_BASE(CFG_SYS_SDRAM_BASE)
+ | MCFSDRAMC_DACR_CASL(1)
+ | MCFSDRAMC_DACR_CBM(3)
+ | MCFSDRAMC_DACR_PS_32);
+ asm("nop");
+
+ /* Initialize DMR0 */
+ MCFSDRAMC_DMR0 = (0
+ | ((dramsize - 1) & 0xFFFC0000)
+ | MCFSDRAMC_DMR_V);
+ asm("nop");
+
+ /* Set IP (bit 3) in DACR */
+ MCFSDRAMC_DACR0 |= MCFSDRAMC_DACR_IP;
+ asm("nop");
+
+ /* Wait 30ns to allow banks to precharge */
+ for (i = 0; i < 5; i++) {
+ asm ("nop");
+ }
+
+ /* Write to this block to initiate precharge */
+ *(u32 *)(CFG_SYS_SDRAM_BASE) = 0xA5A59696;
+ asm("nop");
+
+ /* Set RE (bit 15) in DACR */
+ MCFSDRAMC_DACR0 |= MCFSDRAMC_DACR_RE;
+ asm("nop");
+
+ /* Wait for at least 8 auto refresh cycles to occur */
+ for (i = 0; i < 2000; i++) {
+ asm(" nop");
+ }
+
+ /* Finish the configuration by issuing the IMRS. */
+ MCFSDRAMC_DACR0 |= MCFSDRAMC_DACR_IMRS;
+ asm("nop");
+
+ /* Write to the SDRAM Mode Register */
+ *(u32 *)(CFG_SYS_SDRAM_BASE + 0x400) = 0xA5A59696;
+ }
+ gd->ram_size = dramsize;
+
+ return 0;
+}
diff --git a/board/freescale/m53017evb/Kconfig b/board/freescale/m53017evb/Kconfig
new file mode 100644
index 00000000000..8ab89e52b2e
--- /dev/null
+++ b/board/freescale/m53017evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M53017EVB
+
+config SYS_CPU
+ default "mcf532x"
+
+config SYS_BOARD
+ default "m53017evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M53017EVB"
+
+endif
diff --git a/board/freescale/m53017evb/MAINTAINERS b/board/freescale/m53017evb/MAINTAINERS
new file mode 100644
index 00000000000..ad5f0cea664
--- /dev/null
+++ b/board/freescale/m53017evb/MAINTAINERS
@@ -0,0 +1,6 @@
+M53017EVB BOARD
+M: TsiChung Liew <Tsi-Chung.Liew@nxp.com>
+S: Maintained
+F: board/freescale/m53017evb/
+F: include/configs/M53017EVB.h
+F: configs/M53017EVB_defconfig
diff --git a/board/freescale/m53017evb/Makefile b/board/freescale/m53017evb/Makefile
new file mode 100644
index 00000000000..4eeb3a860b9
--- /dev/null
+++ b/board/freescale/m53017evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m53017evb.o
diff --git a/board/freescale/m53017evb/README b/board/freescale/m53017evb/README
new file mode 100644
index 00000000000..34f05f3fdc7
--- /dev/null
+++ b/board/freescale/m53017evb/README
@@ -0,0 +1,178 @@
+Freescale MCF53017EVB ColdFire Development Board
+================================================
+
+TsiChung Liew(Tsi-Chung.Liew@freescale.com)
+Created 10/22/08
+===========================================
+
+
+Changed files:
+==============
+
+- board/freescale/m53017evb/m53017evb.c Dram setup
+- board/freescale/m53017evb/mii.c Mii access
+- board/freescale/m53017evb/Makefile Makefile
+- board/freescale/m53017evb/config.mk config make
+- board/freescale/m53017evb/u-boot.lds Linker description
+
+- arch/m68k/cpu/mcf532x/cpu.c cpu specific code
+- arch/m68k/cpu/mcf532x/cpu_init.c FBCS, Mux pins, icache and RTC extra regs
+- arch/m68k/cpu/mcf532x/interrupts.c cpu specific interrupt support
+- arch/m68k/cpu/mcf532x/speed.c system, flexbus, and cpu clock
+- arch/m68k/cpu/mcf532x/Makefile Makefile
+- arch/m68k/cpu/mcf532x/config.mk config make
+- arch/m68k/cpu/mcf532x/start.S start up assembly code
+
+- board/freescale/m53017evb/README his readme file
+
+- drivers/net/mcffec.c ColdFire common FEC driver
+- drivers/net/mcfmii.c ColdFire common Mii driver
+- drivers/serial/mcfuart.c ColdFire common UART driver
+- drivers/rtc/mcfrtc.c Realtime clock Driver
+
+- include/asm-m68k/bitops.h Bit operation function export
+- include/asm-m68k/byteorder.h Byte order functions
+- include/asm-m68k/fec.h FEC structure and definition
+- include/asm-m68k/fsl_i2c.h I2C structure and definition
+- include/asm-m68k/global_data.h Global data structure
+- include/asm-m68k/immap.h ColdFire specific header file and driver macros
+- include/asm-m68k/immap_5301x.h mcf5301x specific header file
+- include/asm-m68k/io.h io functions
+- include/asm-m68k/m532x.h mcf5301x specific header file
+- include/asm-m68k/posix_types.h Posix
+- include/asm-m68k/processor.h header file
+- include/asm-m68k/ptrace.h Exception structure
+- include/asm-m68k/rtc.h Realtime clock header file
+- include/asm-m68k/string.h String function export
+- include/asm-m68k/timer.h Timer structure and definition
+- include/asm-m68k/types.h Data types definition
+- include/asm-m68k/uart.h Uart structure and definition
+- include/asm-m68k/u-boot.h U-Boot structure
+
+- include/configs/M53017EVB.h Board specific configuration file
+
+- arch/m68k/lib/board.c board init function
+- arch/m68k/lib/cache.c
+- arch/m68k/lib/interrupts Coldfire common interrupt functions
+- arch/m68k/lib/m68k_linux.c
+- arch/m68k/lib/time.c Timer functions (Dma timer and PIT)
+- arch/m68k/lib/traps.c Exception init code
+
+1 MCF5301x specific Options/Settings
+====================================
+1.1 pre-loader is no longer suppoer in thie coldfire family
+
+1.2 Configuration settings for M53017EVB Development Board
+CONFIG_MCF5301x -- define for all MCF5301x CPUs
+CONFIG_M53015 -- define for MCF53015 CPUs
+CONFIG_M53017EVB -- define for M53017EVB board
+
+CONFIG_MCFUART -- define to use common CF Uart driver
+CFG_SYS_UART_PORT -- define UART port number, start with 0, 1 and 2
+CONFIG_BAUDRATE -- define UART baudrate
+
+CONFIG_MCFRTC -- define to use common CF RTC driver
+CONFIG_SYS_MCFRTC_BASE -- provide base address for RTC in immap.h
+CONFIG_SYS_RTC_OSCILLATOR -- define RTC clock frequency
+RTC_DEBUG -- define to show RTC debug message
+CONFIG_CMD_DATE -- enable to use date feature in U-Boot
+
+CONFIG_MCFFEC -- define to use common CF FEC driver
+CONFIG_MII -- enable to use MII driver
+CONFIG_CF_DOMII -- enable to use MII feature in cmd_mii.c
+CONFIG_SYS_DISCOVER_PHY -- enable PHY discovery
+CONFIG_SYS_RX_ETH_BUFFER -- Set FEC Receive buffer
+CONFIG_SYS_FAULT_ECHO_LINK_DOWN --
+CONFIG_SYS_FEC0_PINMUX -- Set FEC0 Pin configuration
+CONFIG_SYS_FEC0_MIIBASE -- Set FEC0 MII base register
+MCFFEC_TOUT_LOOP -- set FEC timeout loop
+
+CONFIG_MCFTMR -- define to use DMA timer
+
+CONFIG_SYS_I2C_FSL -- define to use FSL common I2C driver
+CONFIG_SYS_I2C_SOFT -- define for I2C bit-banged
+CONFIG_SYS_I2C_SPEED -- define for I2C speed
+CONFIG_SYS_I2C_SLAVE -- define for I2C slave address
+CONFIG_SYS_I2C_OFFSET -- define for I2C base address offset
+CONFIG_SYS_IMMR -- define for MBAR offset
+
+CFG_SYS_MBAR -- define MBAR offset
+
+CONFIG_MONITOR_IS_IN_RAM -- Not support
+
+CFG_SYS_INIT_RAM_ADDR -- defines the base address of the MCF5301x internal SRAM
+
+CONFIG_SYS_CSn_BASE -- defines the Chip Select Base register
+CONFIG_SYS_CSn_MASK -- defines the Chip Select Mask register
+CONFIG_SYS_CSn_CTRL -- defines the Chip Select Control register
+
+CFG_SYS_SDRAM_BASE -- defines the DRAM Base
+
+2. MEMORY MAP UNDER U-BOOT AND LINUX KERNEL
+===========================================
+2.1. System memory map:
+ Flash: 0x00000000-0x3FFFFFFF (1024MB)
+ DDR: 0x40000000-0x7FFFFFFF (1024MB)
+ SRAM: 0x80000000-0x8FFFFFFF (256MB)
+ IP: 0xFC000000-0xFFFFFFFF (256MB)
+
+2.2. For the initial bringup, we adopted a consistent memory scheme between U-Boot and
+ linux kernel, you can customize it based on your system requirements:
+ Flash0: 0x00000000-0x00FFFFFF (16MB)
+ DDR: 0x40000000-0x4FFFFFFF (256MB)
+ SRAM: 0x80000000-0x80007FFF (32KB)
+ IP: 0xFC000000-0xFC0FFFFF (64KB)
+
+3. COMPILATION
+==============
+3.1 To create U-Boot the gcc-4.x-xx compiler set (ColdFire ELF or
+uClinux version) from codesourcery.com was used. Download it from:
+http://www.codesourcery.com/gnu_toolchains/coldfire/download.html
+
+3.2 Compilation
+ export CROSS_COMPILE=cross-compile-prefix
+ cd u-boot
+ make distclean
+ make M53017EVB_config
+ make
+
+4. SCREEN DUMP
+==============
+4.1 M53017EVB Development board
+ (NOTE: May not show exactly the same)
+
+U-Boot 2008.10 (Oct 22 2007 - 11:07:57)
+
+CPU: Freescale MCF53015 (Mask:76 Version:0)
+ CPU CLK 240 Mhz BUS CLK 80 Mhz
+Board: Freescale M53017EVB
+I2C: ready
+DRAM: 64 MB
+FLASH: 16 MB
+In: serial
+Out: serial
+Err: serial
+NAND: 16 MiB
+Net: FEC0, FEC1
+-> print
+bootdelay=1
+baudrate=115200
+ethaddr=00:e0:0c:bc:e5:60
+hostname=M53017EVB
+netdev=eth0
+loadaddr=40010000
+u-boot=u-boot.bin
+load=tftp ${loadaddr) ${u-boot}
+upd=run load; run prog
+prog=prot off 0 3ffff;era 0 3ffff;cp.b ${loadaddr} 0 ${filesize};save
+gatewayip=192.168.1.1
+netmask=255.255.255.0
+ipaddr=192.168.1.3
+serverip=192.168.1.2
+stdin=serial
+stdout=serial
+stderr=serial
+mem=65024k
+
+Environment size: 437/4092 bytes
+->
diff --git a/board/freescale/m53017evb/m53017evb.c b/board/freescale/m53017evb/m53017evb.c
new file mode 100644
index 00000000000..196d56dc17d
--- /dev/null
+++ b/board/freescale/m53017evb/m53017evb.c
@@ -0,0 +1,83 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2008, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale M53017EVB\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdram_t *sdram = (sdram_t *)(MMAP_SDRAM);
+ u32 dramsize, i;
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ out_be32(&sdram->cs0, CFG_SYS_SDRAM_BASE | i);
+#ifdef CFG_SYS_SDRAM_BASE1
+ out_be32(&sdram->cs1, CFG_SYS_SDRAM_BASE | i);
+#endif
+ out_be32(&sdram->cfg1, CFG_SYS_SDRAM_CFG1);
+ out_be32(&sdram->cfg2, CFG_SYS_SDRAM_CFG2);
+
+ udelay(500);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+ asm("nop");
+
+ /* Perform two refresh cycles */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ asm("nop");
+
+ /* Issue LEMR */
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE);
+ asm("nop");
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_EMOD);
+ asm("nop");
+
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+ asm("nop");
+
+ out_be32(&sdram->ctrl,
+ (CFG_SYS_SDRAM_CTRL & ~0x80000000) | 0x10000c00);
+ asm("nop");
+
+ udelay(100);
+
+ gd->ram_size = dramsize;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5329evb/Kconfig b/board/freescale/m5329evb/Kconfig
new file mode 100644
index 00000000000..930fbba246d
--- /dev/null
+++ b/board/freescale/m5329evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5329EVB
+
+config SYS_CPU
+ default "mcf532x"
+
+config SYS_BOARD
+ default "m5329evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5329EVB"
+
+endif
diff --git a/board/freescale/m5329evb/MAINTAINERS b/board/freescale/m5329evb/MAINTAINERS
new file mode 100644
index 00000000000..2f7dd2d4560
--- /dev/null
+++ b/board/freescale/m5329evb/MAINTAINERS
@@ -0,0 +1,7 @@
+M5329EVB BOARD
+M: TsiChung Liew <Tsi-Chung.Liew@nxp.com>
+S: Maintained
+F: board/freescale/m5329evb/
+F: include/configs/M5329EVB.h
+F: configs/M5329AFEE_defconfig
+F: configs/M5329BFEE_defconfig
diff --git a/board/freescale/m5329evb/Makefile b/board/freescale/m5329evb/Makefile
new file mode 100644
index 00000000000..19796c213fb
--- /dev/null
+++ b/board/freescale/m5329evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5329evb.o nand.o
diff --git a/board/freescale/m5329evb/m5329evb.c b/board/freescale/m5329evb/m5329evb.c
new file mode 100644
index 00000000000..26d5f3bf58c
--- /dev/null
+++ b/board/freescale/m5329evb/m5329evb.c
@@ -0,0 +1,77 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale FireEngine 5329 EVB\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdram_t *sdram = (sdram_t *)(MMAP_SDRAM);
+ u32 dramsize, i;
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ out_be32(&sdram->cs0, CFG_SYS_SDRAM_BASE | i);
+ out_be32(&sdram->cfg1, CFG_SYS_SDRAM_CFG1);
+ out_be32(&sdram->cfg2, CFG_SYS_SDRAM_CFG2);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+
+ /* Issue LEMR */
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_EMOD);
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE | 0x04000000);
+
+ udelay(500);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+
+ /* Perform two refresh cycles */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE);
+
+ out_be32(&sdram->ctrl,
+ (CFG_SYS_SDRAM_CTRL & ~0x80000000) | 0x10000c00);
+
+ udelay(100);
+
+ gd->ram_size = dramsize;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5329evb/nand.c b/board/freescale/m5329evb/nand.c
new file mode 100644
index 00000000000..a250d61ef36
--- /dev/null
+++ b/board/freescale/m5329evb/nand.c
@@ -0,0 +1,70 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <asm/io.h>
+#include <asm/immap.h>
+
+#if defined(CONFIG_CMD_NAND)
+#include <nand.h>
+#include <linux/mtd/mtd.h>
+#include <linux/mtd/rawnand.h>
+
+#define SET_CLE 0x10
+#define SET_ALE 0x08
+
+static void nand_hwcontrol(struct mtd_info *mtdinfo, int cmd, unsigned int ctrl)
+{
+ struct nand_chip *this = mtd_to_nand(mtdinfo);
+ volatile u16 *nCE = (u16 *) CFG_SYS_LATCH_ADDR;
+
+ if (ctrl & NAND_CTRL_CHANGE) {
+ ulong IO_ADDR_W = (ulong) this->IO_ADDR_W;
+
+ IO_ADDR_W &= ~(SET_ALE | SET_CLE);
+
+ if (ctrl & NAND_NCE)
+ *nCE &= 0xFFFB;
+ else
+ *nCE |= 0x0004;
+
+ if (ctrl & NAND_CLE)
+ IO_ADDR_W |= SET_CLE;
+ if (ctrl & NAND_ALE)
+ IO_ADDR_W |= SET_ALE;
+
+ this->IO_ADDR_W = (void *)IO_ADDR_W;
+ }
+
+ if (cmd != NAND_CMD_NONE)
+ writeb(cmd, this->IO_ADDR_W);
+}
+
+int board_nand_init(struct nand_chip *nand)
+{
+ gpio_t *gpio = (gpio_t *) MMAP_GPIO;
+
+ /*
+ * set up pin configuration - enabled 2nd output buffer's signals
+ * (nand_ngpio - nCE USB1/2_PWR_EN, LATCH_GPIOs, LCD_VEEEN, etc)
+ * to use nCE signal
+ */
+ clrbits_8(&gpio->par_timer, GPIO_PAR_TIN3_TIN3);
+ setbits_8(&gpio->pddr_timer, 0x08);
+ setbits_8(&gpio->ppd_timer, 0x08);
+ out_8(&gpio->pclrr_timer, 0);
+ out_8(&gpio->podr_timer, 0);
+
+ nand->chip_delay = 60;
+ nand->ecc.mode = NAND_ECC_SOFT;
+ nand->cmd_ctrl = nand_hwcontrol;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/m5373evb/Kconfig b/board/freescale/m5373evb/Kconfig
new file mode 100644
index 00000000000..67d049d79eb
--- /dev/null
+++ b/board/freescale/m5373evb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_M5373EVB
+
+config SYS_CPU
+ default "mcf532x"
+
+config SYS_BOARD
+ default "m5373evb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "M5373EVB"
+
+endif
diff --git a/board/freescale/m5373evb/MAINTAINERS b/board/freescale/m5373evb/MAINTAINERS
new file mode 100644
index 00000000000..acb7a43ed64
--- /dev/null
+++ b/board/freescale/m5373evb/MAINTAINERS
@@ -0,0 +1,6 @@
+M5373EVB BOARD
+M: TsiChung Liew <Tsi-Chung.Liew@nxp.com>
+S: Maintained
+F: board/freescale/m5373evb/
+F: include/configs/M5373EVB.h
+F: configs/M5373EVB_defconfig
diff --git a/board/freescale/m5373evb/Makefile b/board/freescale/m5373evb/Makefile
new file mode 100644
index 00000000000..20efa7b8432
--- /dev/null
+++ b/board/freescale/m5373evb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y = m5373evb.o nand.o
diff --git a/board/freescale/m5373evb/README b/board/freescale/m5373evb/README
new file mode 100644
index 00000000000..7240648796b
--- /dev/null
+++ b/board/freescale/m5373evb/README
@@ -0,0 +1,324 @@
+Freescale MCF5373EVB ColdFire Development Board
+================================================
+
+TsiChung Liew(Tsi-Chung.Liew@freescale.com)
+Created 11/08/07
+===========================================
+
+
+Changed files:
+==============
+
+- board/freescale/m5373evb/m5373evb.c Dram setup
+- board/freescale/m5373evb/mii.c Mii access
+- board/freescale/m5373evb/Makefile Makefile
+- board/freescale/m5373evb/config.mk config make
+- board/freescale/m5373evb/u-boot.lds Linker description
+
+- arch/m68k/cpu/mcf532x/cpu.c cpu specific code
+- arch/m68k/cpu/mcf532x/cpu_init.c FBCS, Mux pins, icache and RTC extra regs
+- arch/m68k/cpu/mcf532x/interrupts.c cpu specific interrupt support
+- arch/m68k/cpu/mcf532x/speed.c system, pci, flexbus, and cpu clock
+- arch/m68k/cpu/mcf532x/Makefile Makefile
+- arch/m68k/cpu/mcf532x/config.mk config make
+- arch/m68k/cpu/mcf532x/start.S start up assembly code
+
+- board/freescale/m5373evb/README This readme file
+
+- drivers/net/mcffec.c ColdFire common FEC driver
+- drivers/serial/mcfuart.c ColdFire common UART driver
+- drivers/rtc/mcfrtc.c Realtime clock Driver
+
+- include/asm-m68k/bitops.h Bit operation function export
+- include/asm-m68k/byteorder.h Byte order functions
+- include/asm-m68k/fec.h FEC structure and definition
+- include/asm-m68k/fsl_i2c.h I2C structure and definition
+- include/asm-m68k/global_data.h Global data structure
+- include/asm-m68k/immap.h ColdFire specific header file and driver macros
+- include/asm-m68k/immap_532x.h mcf532x specific header file
+- include/asm-m68k/io.h io functions
+- include/asm-m68k/m532x.h mcf532x specific header file
+- include/asm-m68k/posix_types.h Posix
+- include/asm-m68k/processor.h header file
+- include/asm-m68k/ptrace.h Exception structure
+- include/asm-m68k/rtc.h Realtime clock header file
+- include/asm-m68k/string.h String function export
+- include/asm-m68k/timer.h Timer structure and definition
+- include/asm-m68k/types.h Data types definition
+- include/asm-m68k/uart.h Uart structure and definition
+- include/asm-m68k/u-boot.h U-Boot structure
+
+- include/configs/M5373EVB.h Board specific configuration file
+
+- arch/m68k/lib/board.c board init function
+- arch/m68k/lib/cache.c
+- arch/m68k/lib/interrupts Coldfire common interrupt functions
+- arch/m68k/lib/m68k_linux.c
+- arch/m68k/lib/time.c Timer functions (Dma timer and PIT)
+- arch/m68k/lib/traps.c Exception init code
+
+1 MCF5373 specific Options/Settings
+====================================
+1.1 pre-loader is no longer suppoer in thie coldfire family
+
+1.2 Configuration settings for M5373EVB Development Board
+CONFIG_MCF532x -- define for all MCF532x CPUs
+CONFIG_M5373 -- define for all Freescale MCF5373 CPUs
+CONFIG_M5373EVB -- define for M5373EVB board
+
+CONFIG_MCFUART -- define to use common CF Uart driver
+CFG_SYS_UART_PORT -- define UART port number, start with 0, 1 and 2
+CONFIG_BAUDRATE -- define UART baudrate
+
+CONFIG_MCFRTC -- define to use common CF RTC driver
+CONFIG_SYS_MCFRTC_BASE -- provide base address for RTC in immap.h
+CONFIG_SYS_RTC_OSCILLATOR -- define RTC clock frequency
+RTC_DEBUG -- define to show RTC debug message
+CONFIG_CMD_DATE -- enable to use date feature in U-Boot
+
+CONFIG_MCFFEC -- define to use common CF FEC driver
+CONFIG_MII -- enable to use MII driver
+CONFIG_CF_DOMII -- enable to use MII feature in cmd_mii.c
+CONFIG_SYS_DISCOVER_PHY -- enable PHY discovery
+CONFIG_SYS_RX_ETH_BUFFER -- Set FEC Receive buffer
+CONFIG_SYS_FAULT_ECHO_LINK_DOWN--
+CONFIG_SYS_FEC0_PINMUX -- Set FEC0 Pin configuration
+CONFIG_SYS_FEC0_MIIBASE -- Set FEC0 MII base register
+MCFFEC_TOUT_LOOP -- set FEC timeout loop
+
+CONFIG_MCFTMR -- define to use DMA timer
+
+CONFIG_SYS_I2C_FSL -- define to use FSL common I2C driver
+CONFIG_SYS_I2C_SOFT -- define for I2C bit-banged
+CONFIG_SYS_I2C_SPEED -- define for I2C speed
+CONFIG_SYS_I2C_SLAVE -- define for I2C slave address
+CONFIG_SYS_I2C_OFFSET -- define for I2C base address offset
+CONFIG_SYS_IMMR -- define for MBAR offset
+
+CFG_SYS_MBAR -- define MBAR offset
+
+CONFIG_MONITOR_IS_IN_RAM -- Not support
+
+CFG_SYS_INIT_RAM_ADDR -- defines the base address of the MCF5373 internal SRAM
+
+CONFIG_SYS_CSn_BASE -- defines the Chip Select Base register
+CONFIG_SYS_CSn_MASK -- defines the Chip Select Mask register
+CONFIG_SYS_CSn_CTRL -- defines the Chip Select Control register
+
+CFG_SYS_SDRAM_BASE -- defines the DRAM Base
+
+2. MEMORY MAP UNDER U-BOOT AND LINUX KERNEL
+===========================================
+2.1. System memory map:
+ Flash: 0x00000000-0x3FFFFFFF (1024MB)
+ DDR: 0x40000000-0x7FFFFFFF (1024MB)
+ SRAM: 0x80000000-0x8FFFFFFF (256MB)
+ IP: 0xF0000000-0xFFFFFFFF (256MB)
+
+2.2. For the initial bringup, we adopted a consistent memory scheme between U-Boot and
+ linux kernel, you can customize it based on your system requirements:
+ Flash0: 0x00000000-0x00FFFFFF (16MB)
+
+ DDR: 0x40000000-0x4FFFFFFF (256MB)
+ SRAM: 0x80000000-0x80007FFF (32KB)
+ IP: 0xFC000000-0xFC0FFFFF (64KB)
+
+3. COMPILATION
+==============
+3.1 To create U-Boot the gcc-4.1-xx compiler set (ColdFire ELF or
+uClinux version) from codesourcery.com was used. Download it from:
+http://www.codesourcery.com/gnu_toolchains/coldfire/download.html
+
+3.2 Compilation
+ export CROSS_COMPILE=cross-compile-prefix
+ cd u-boot-1.x.x
+ make distclean
+ make M5373EVB_config
+ make
+
+4. SCREEN DUMP
+==============
+4.1 M5373EVB Development board
+ (NOTE: May not show exactly the same)
+
+U-Boot 1.3.0 (Nov 8 2007 - 12:44:08)
+
+CPU: Freescale MCF5373 (Mask:65 Version:1)
+ CPU CLK 240 Mhz BUS CLK 80 Mhz
+Board: Freescale FireEngine 5373 EVB
+I2C: ready
+DRAM: 32 MB
+FLASH: 2 MB
+In: serial
+Out: serial
+Err: serial
+NAND: 16 MiB
+Net: FEC0
+-> print
+bootdelay=1
+baudrate=115200
+ethaddr=00:e0:0c:bc:e5:60
+hostname=M5373EVB
+netdev=eth0
+loadaddr=40010000
+load=tftp ${loadaddr) ${u-boot}
+upd=run load; run prog
+prog=prot off 0 2ffff;era 0 2ffff;cp.b ${loadaddr} 0 ${filesize};save
+ethact=FEC0
+u-boot=u-boot.bin
+gatewayip=192.168.1.1
+netmask=255.255.255.0
+ipaddr=192.168.1.3
+serverip=192.168.1.2
+stdin=serial
+stdout=serial
+stderr=serial
+mem=261632k
+
+Environment size: 401/8188 bytes
+-> bdinfo
+memstart = 0x40000000
+memsize = 0x02000000
+flashstart = 0x00000000
+flashsize = 0x00200000
+flashoffset = 0x00000000
+sramstart = 0x80000000
+sramsize = 0x00008000
+mbar = 0xFC000000
+busfreq = 80 MHz
+ethaddr = 00:E0:0C:BC:E5:60
+ip_addr = 192.168.1.3
+baudrate = 115200 bps
+->
+-> help
+? - alias for 'help'
+base - print or set address offset
+bdinfo - print Board Info structure
+boot - boot default, i.e., run 'bootcmd'
+bootd - boot default, i.e., run 'bootcmd'
+bootelf - Boot from an ELF image in memory
+bootm - boot application image from memory
+bootp - boot image via network using BootP/TFTP protocol
+bootvx - Boot vxWorks from an ELF image
+cmp - memory compare
+coninfo - print console devices and information
+cp - memory copy
+crc32 - checksum calculation
+date - get/set/reset date & time
+dcache - enable or disable data cache
+echo - echo args to console
+erase - erase FLASH memory
+flinfo - print FLASH memory information
+go - start application at address 'addr'
+help - print online help
+i2c - I2C sub-system
+icache - enable or disable instruction cache
+iminfo - print header information for application image
+imls - list all images found in flash
+itest - return true/false on integer compare
+loadb - load binary file over serial line (kermit mode)
+loads - load S-Record file over serial line
+loady - load binary file over serial line (ymodem mode)
+loop - infinite loop on address range
+ls - list files in a directory (default /)
+md - memory display
+mii - MII utility commands
+mm - memory modify (auto-incrementing)
+mtest - simple RAM test
+mw - memory write (fill)
+nand - NAND sub-system
+nboot - boot from NAND device
+nfs - boot image via network using NFS protocol
+nm - memory modify (constant address)
+ping - send ICMP ECHO_REQUEST to network host
+printenv- print environment variables
+protect - enable or disable FLASH write protection
+rarpboot- boot image via network using RARP/TFTP protocol
+reset - Perform RESET of the CPU
+run - run commands in an environment variable
+saveenv - save environment variables to persistent storage
+setenv - set environment variables
+sleep - delay execution for some time
+source - run script from memory
+tftpboot- boot image via network using TFTP protocol
+version - print monitor version
+-> tftp 0x40800000 uImage
+Using FEC0 device
+TFTP from server 192.168.1.3; our IP address is 192.168.1.3 Filename 'uImage'.
+Load address: 0x40800000
+Loading: #################################################################
+ #################################################################
+ ##########
+done
+Bytes transferred = 2053270 (1f5496 hex)
+-> bootm 0x40800000
+## Booting image at 40800000 ...
+ Image Name: Linux Kernel Image
+ Created: 2007-11-07 20:33:08 UTC
+ Image Type: M68K Linux Kernel Image (gzip compressed)
+ Data Size: 2053206 Bytes = 2 MB
+ Load Address: 40020000
+ Entry Point: 40020000
+ Verifying Checksum ... OK
+ Uncompressing Kernel Image ... OK
+Linux version 2.6.22-uc1 (mattw@loa) (gcc version 4.2.1 (Sourcery G++ Lite 4.2-7
+
+
+uClinux/COLDFIRE(m537x)
+COLDFIRE port done by Greg Ungerer, gerg@snapgear.com Flat model support (C) 1998,1999 Kenneth Albanowski, D. Jeff Dionne Built 1 zonelists. Total pages: 8128 Kernel command line: rootfstype=romfs PID hash table entries: 128 (order: 7, 512 bytes) Dentry cache hash table entries: 4096 (order: 2, 16384 bytes) Inode-cache hash table entries: 2048 (order: 1, 8192 bytes) Memory available: 28092k/32768k RAM, (1788k kernel code, 244k data) Mount-cache hash table entries: 512
+NET: Registered protocol family 16
+USB-MCF537x: (HOST module) EHCI device is registered
+USB-MCF537x: (OTG module) EHCI device is registered
+USB-MCF537x: (OTG module) UDC device is registered
+usbcore: registered new interface driver usbfs
+usbcore: registered new interface driver hub
+usbcore: registered new device driver usb
+NET: Registered protocol family 2
+IP route cache hash table entries: 1024 (order: 0, 4096 bytes) TCP established hash table entries: 1024 (order: 1, 8192 bytes) TCP bind hash table entries: 1024 (order: 0, 4096 bytes)
+TCP: Hash tables configured (established 1024 bind 1024) TCP reno registered
+JFFS2 version 2.2. (NAND) © 2001-2006 Red Hat, Inc.
+io scheduler noop registered
+io scheduler cfq registered (default)
+ColdFire internal UART serial driver version 1.00 ttyS0 at 0xfc060000 (irq = 90) is a builtin ColdFire UART
+ttyS1 at 0xfc064000 (irq = 91) is a builtin ColdFire UART
+ttyS2 at 0xfc068000 (irq = 92) is a builtin ColdFire UART RAMDISK driver initialized: 16 RAM disks of 4096K size 1024 blocksize
+loop: module loaded
+nbd: registered device at major 43
+usbcore: registered new interface driver ub FEC ENET Version 0.2
+fec: PHY @ 0x1, ID 0x20005c90 -- DP83848
+eth0: ethernet 00:e0:0c:bc:e5:60
+uclinux[mtd]: RAM probe address=0x4021c22c size=0x22b000 Creating 1 MTD partitions on "RAM":
+0x00000000-0x0022b000 : "ROMfs"
+uclinux[mtd]: set ROMfs to be root filesystem NAND device: Manufacturer ID: 0x20, Chip ID: 0x73 (ST Micro NAND 16MiB 3,3V 8-b) Scanning device for bad blocks Creating 1 MTD partitions on "NAND 16MiB 3,3V 8-bit":
+0x00000000-0x01000000 : "M53xx flash partition 1"
+QSPI: spi->max_speed_hz 300000
+QSPI: Baud set to 255
+SPI: Coldfire master initialized
+M537x - Disable UART1 when using Audio
+udc: Freescale MCF53xx UDC driver version 27 October 2006 init
+udc: MCF53xx USB Device is found. ID=0x5 Rev=0x41 i2c /dev entries driver
+usbcore: registered new interface driver usbhid
+drivers/hid/usbhid/hid-core.c: v2.6:USB HID core driver TCP cubic registered
+NET: Registered protocol family 1
+NET: Registered protocol family 17
+VFS: Mounted root (romfs filesystem) readonly.
+Freeing unused kernel memory: 64k freed (0x401f5000 - 0x40204000) init started: BusyBox v1.00 (2007.11.07-19:57+0000) multi-call binary?Setting e Mounting filesystems
+mount: Mounting devpts on /dev/pts failed: No such device
+mount: Mounting usbfs on /proc/bus/usb failed: No such file or directory Starting syslogd and klogd Setting up networking on loopback device:
+Setting up networking on eth0:
+info, udhcpc (v0.9.9-pre) started
+eth0: config: auto-negotiation on, 100FDX, 100HDX, 10FDX, 10HDX.
+debug, Sending discover...
+debug, Sending discover...
+debug, Sending select for 172.27.0.130...
+info, Lease of 172.27.0.130 obtained, lease time 43200 deleting routers
+route: SIOC[ADD|DEL]RT: No such process
+adding dns 172.27.0.1
+Starting the boa webserver:
+Setting time from ntp server: ntp.cs.strath.ac.uk
+ntp.cs.strath.ac.uk: Unknown host
+
+
+BusyBox v1.00 (2007.11.07-19:57+0000) Built-in shell (msh) Enter 'help' for a list of built-in commands.
+
+#
diff --git a/board/freescale/m5373evb/m5373evb.c b/board/freescale/m5373evb/m5373evb.c
new file mode 100644
index 00000000000..d6fdf41bab4
--- /dev/null
+++ b/board/freescale/m5373evb/m5373evb.c
@@ -0,0 +1,77 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/immap.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ puts("Board: ");
+ puts("Freescale FireEngine 5373 EVB\n");
+ return 0;
+};
+
+int dram_init(void)
+{
+ sdram_t *sdram = (sdram_t *)(MMAP_SDRAM);
+ u32 dramsize, i;
+
+ dramsize = CFG_SYS_SDRAM_SIZE * 0x100000;
+
+ for (i = 0x13; i < 0x20; i++) {
+ if (dramsize == (1 << i))
+ break;
+ }
+ i--;
+
+ out_be32(&sdram->cs0, CFG_SYS_SDRAM_BASE | i);
+ out_be32(&sdram->cfg1, CFG_SYS_SDRAM_CFG1);
+ out_be32(&sdram->cfg2, CFG_SYS_SDRAM_CFG2);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+
+ /* Issue LEMR */
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_EMOD);
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE | 0x04000000);
+
+ udelay(500);
+
+ /* Issue PALL */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 2);
+
+ /* Perform two refresh cycles */
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+ out_be32(&sdram->ctrl, CFG_SYS_SDRAM_CTRL | 4);
+
+ out_be32(&sdram->mode, CFG_SYS_SDRAM_MODE);
+
+ out_be32(&sdram->ctrl,
+ (CFG_SYS_SDRAM_CTRL & ~0x80000000) | 0x10000c00);
+
+ udelay(100);
+
+ gd->ram_size = dramsize;
+
+ return 0;
+};
+
+int testdram(void)
+{
+ /* TODO: XXX XXX XXX */
+ printf("DRAM test not implemented!\n");
+
+ return (0);
+}
diff --git a/board/freescale/m5373evb/nand.c b/board/freescale/m5373evb/nand.c
new file mode 100644
index 00000000000..e7c08d22e6b
--- /dev/null
+++ b/board/freescale/m5373evb/nand.c
@@ -0,0 +1,74 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Copyright (C) 2004-2007, 2012 Freescale Semiconductor, Inc.
+ * TsiChung Liew (Tsi-Chung.Liew@freescale.com)
+ */
+
+#include <config.h>
+#include <asm/io.h>
+#include <asm/immap.h>
+
+#if defined(CONFIG_CMD_NAND)
+#include <nand.h>
+#include <linux/mtd/mtd.h>
+#include <linux/mtd/rawnand.h>
+
+#define SET_CLE 0x10
+#define SET_ALE 0x08
+
+static void nand_hwcontrol(struct mtd_info *mtdinfo, int cmd, unsigned int ctrl)
+{
+ struct nand_chip *this = mtd_to_nand(mtdinfo);
+ volatile u16 *nCE = (u16 *) CFG_SYS_LATCH_ADDR;
+
+ if (ctrl & NAND_CTRL_CHANGE) {
+ ulong IO_ADDR_W = (ulong) this->IO_ADDR_W;
+
+ IO_ADDR_W &= ~(SET_ALE | SET_CLE);
+
+ if (ctrl & NAND_NCE)
+ *nCE &= 0xFFFB;
+ else
+ *nCE |= 0x0004;
+
+ if (ctrl & NAND_CLE)
+ IO_ADDR_W |= SET_CLE;
+ if (ctrl & NAND_ALE)
+ IO_ADDR_W |= SET_ALE;
+
+ this->IO_ADDR_W = (void *)IO_ADDR_W;
+
+ }
+
+ if (cmd != NAND_CMD_NONE)
+ writeb(cmd, this->IO_ADDR_W);
+}
+
+int board_nand_init(struct nand_chip *nand)
+{
+ gpio_t *gpio = (gpio_t *) MMAP_GPIO;
+ fbcs_t *fbcs = (fbcs_t *) MMAP_FBCS;
+
+ clrbits_be32(&fbcs->csmr2, FBCS_CSMR_WP);
+
+ /*
+ * set up pin configuration - enabled 2nd output buffer's signals
+ * (nand_ngpio - nCE USB1/2_PWR_EN, LATCH_GPIOs, LCD_VEEEN, etc)
+ * to use nCE signal
+ */
+ clrbits_8(&gpio->par_timer, GPIO_PAR_TIN3_TIN3);
+ setbits_8(&gpio->pddr_timer, 0x08);
+ setbits_8(&gpio->ppd_timer, 0x08);
+ out_8(&gpio->pclrr_timer, 0);
+ out_8(&gpio->podr_timer, 0);
+
+ nand->chip_delay = 60;
+ nand->ecc.mode = NAND_ECC_SOFT;
+ nand->cmd_ctrl = nand_hwcontrol;
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/mpc837xerdb/Kconfig b/board/freescale/mpc837xerdb/Kconfig
new file mode 100644
index 00000000000..3779625edd5
--- /dev/null
+++ b/board/freescale/mpc837xerdb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MPC837XERDB
+
+config PCIE
+ def_bool y
+
+config SYS_BOARD
+ default "mpc837xerdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "MPC837XERDB"
+
+endif
diff --git a/board/freescale/mpc837xerdb/MAINTAINERS b/board/freescale/mpc837xerdb/MAINTAINERS
new file mode 100644
index 00000000000..9f44a37a0d9
--- /dev/null
+++ b/board/freescale/mpc837xerdb/MAINTAINERS
@@ -0,0 +1,7 @@
+MPC837XERDB BOARD
+M: Sinan Akman <sinan@writeme.com>
+S: Maintained
+F: board/freescale/mpc837xerdb/
+F: include/configs/MPC837XERDB.h
+F: configs/MPC837XERDB_defconfig
+F: configs/MPC837XERDB_SLAVE_defconfig
diff --git a/board/freescale/mpc837xerdb/Makefile b/board/freescale/mpc837xerdb/Makefile
new file mode 100644
index 00000000000..4661e4cf232
--- /dev/null
+++ b/board/freescale/mpc837xerdb/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y += mpc837xerdb.o
diff --git a/board/freescale/mpc837xerdb/README b/board/freescale/mpc837xerdb/README
new file mode 100644
index 00000000000..12df2f2e756
--- /dev/null
+++ b/board/freescale/mpc837xerdb/README
@@ -0,0 +1,97 @@
+Freescale MPC837xE-RDB Board
+-----------------------------------------
+
+1. Board Description
+
+ The MPC837xE-RDB are reference boards featuring the Freescale MPC8377E,
+ MPC8378E, and the MPC8379E processors in a Mini-ITX form factor.
+
+ The MPC837xE-RDB's have the following common features:
+
+ A) 256-MBytes on-board DDR2 unbuffered SDRAM
+ B) 8-Mbytes NOR Flash
+ C) 32-MBytes NAND Flash
+ D) 1 Secure Digital High Speed Card (SDHC) Interface
+ E) 1 Gigabit Ethernet
+ F) 5-port Ethernet switch (Vitesse 7385)
+ G) 1 32-bit, 3.3 V, PCI slot
+ H) 1 32-bit, 3.3 V, Mini-PCI slot
+ I) 4-port USB 2.0 Hub
+ J) 1-port OTG USB
+ K) 2 serial ports (top main console)
+ L) on board Oscillator: 66M
+
+ The MPC837xE-RDB's have the following differences:
+
+ MPC8377E-RDB MPC8378E-RDB MPC8379E-RDB
+ SATA controllers 2 0 4
+ PCI-Express (mini) 2 2 0
+ SGMII Ports 0 2 0
+
+
+2. Memory Map
+
+2.1. The memory map should look pretty much like this:
+
+ Address Range Device Size Port Size
+ (Bytes) (Bits)
+ =========================== ================= ======= =========
+ 0x0000_0000 0x0fff_ffff DDR 256M 64
+ 0x1000_0000 0x7fff_ffff Empty 1.75G -
+ 0x8000_0000 0x8fff_ffff PCI MEM prefetch 256M 32
+ 0x9000_0000 0x9fff_ffff PCI MEM non-prefetch 256M 32
+ 0xe030_0000 0xe03f_ffff PCI I/O space 1M 32
+ 0xe000_0000 0xe00f_ffff Int Mem Reg Space 1M -
+ 0xe060_0000 0xe060_7fff NAND Flash 32K 8
+ 0xfe00_0000 0xfe7f_ffff NOR Flash on CS0 8M 16
+
+
+3. Definitions
+
+3.1 Explanation of NEW definitions in:
+
+ include/configs/MPC837XERDB.h
+
+ CONFIG_MPC83xx MPC83xx family for both MPC8349 and MPC8360
+ CONFIG_MPC837x MPC837x specific
+ CONFIG_MPC837XERDB MPC837xE-RDB board specific
+
+
+4. Compilation
+
+ Assuming you're using BASH shell:
+
+ export CROSS_COMPILE=your-cross-compile-prefix
+ cd u-boot
+ make distclean
+ make MPC837XERDB_config
+ make
+
+
+5. Downloading and Flashing Images
+
+5.0 Download over serial line using Kermit:
+
+ loadb $loadaddr
+ [Drop to kermit:
+ ^\c
+ send <u-boot-bin-image>
+ c
+ ]
+
+
+ Or via tftp:
+
+ tftp $loadaddr u-boot.bin
+
+5.1 Reflash U-Boot Image using U-Boot
+
+ tftp $loadaddr u-boot.bin
+ protect off fe000000 fe0fffff
+ erase fe000000 fe0fffff
+ cp.b $loadaddr fe000000 $filesize
+
+
+6. Additional Notes:
+ 1) The console is connected to the top RS-232 connector and the
+ baudrate for MPC837XE-RDB is 115200bps.
diff --git a/board/freescale/mpc837xerdb/mpc837xerdb.c b/board/freescale/mpc837xerdb/mpc837xerdb.c
new file mode 100644
index 00000000000..55299745a3c
--- /dev/null
+++ b/board/freescale/mpc837xerdb/mpc837xerdb.c
@@ -0,0 +1,242 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2007 Freescale Semiconductor, Inc.
+ * Kevin Lam <kevin.lam@freescale.com>
+ * Joe D'Abbraccio <joe.d'abbraccio@freescale.com>
+ */
+
+#include <config.h>
+#include <env.h>
+#include <hwconfig.h>
+#include <i2c.h>
+#include <init.h>
+#include <asm/bitops.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/fsl_mpc83xx_serdes.h>
+#include <fdt_support.h>
+#include <spd_sdram.h>
+#include <vsc7385.h>
+#include <fsl_esdhc.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if defined(CFG_SYS_DRAM_TEST)
+int
+testdram(void)
+{
+ uint *pstart = (uint *) CONFIG_SYS_MEMTEST_START;
+ uint *pend = (uint *) CONFIG_SYS_MEMTEST_END;
+ uint *p;
+
+ printf("Testing DRAM from 0x%08x to 0x%08x\n",
+ CONFIG_SYS_MEMTEST_START,
+ CONFIG_SYS_MEMTEST_END);
+
+ printf("DRAM test phase 1:\n");
+ for (p = pstart; p < pend; p++)
+ *p = 0xaaaaaaaa;
+
+ for (p = pstart; p < pend; p++) {
+ if (*p != 0xaaaaaaaa) {
+ printf("DRAM test fails at: %08x\n", (uint) p);
+ return 1;
+ }
+ }
+
+ printf("DRAM test phase 2:\n");
+ for (p = pstart; p < pend; p++)
+ *p = 0x55555555;
+
+ for (p = pstart; p < pend; p++) {
+ if (*p != 0x55555555) {
+ printf("DRAM test fails at: %08x\n", (uint) p);
+ return 1;
+ }
+ }
+
+ printf("DRAM test passed.\n");
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER)
+void ddr_enable_ecc(unsigned int dram_size);
+#endif
+int fixed_sdram(void);
+
+int dram_init(void)
+{
+ immap_t *im = (immap_t *) CONFIG_SYS_IMMR;
+ u32 msize = 0;
+
+ if ((im->sysconf.immrbar & IMMRBAR_BASE_ADDR) != (u32) im)
+ return -ENXIO;
+
+#if defined(CONFIG_SPD_EEPROM)
+ msize = spd_sdram();
+#else
+ msize = fixed_sdram();
+#endif
+
+#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER)
+ /* Initialize DDR ECC byte */
+ ddr_enable_ecc(msize * 1024 * 1024);
+#endif
+ /* return total bus DDR size(bytes) */
+ gd->ram_size = msize * 1024 * 1024;
+
+ return 0;
+}
+
+#if !defined(CONFIG_SPD_EEPROM)
+/*************************************************************************
+ * fixed sdram init -- doesn't use serial presence detect.
+ ************************************************************************/
+int fixed_sdram(void)
+{
+ immap_t *im = (immap_t *) CONFIG_SYS_IMMR;
+ u32 msize = CFG_SYS_SDRAM_SIZE;
+ u32 msize_log2 = __ilog2(msize);
+
+ im->sysconf.ddrlaw[0].bar = CFG_SYS_SDRAM_BASE & 0xfffff000;
+ im->sysconf.ddrlaw[0].ar = LBLAWAR_EN | (msize_log2 - 1);
+
+ im->sysconf.ddrcdr = CFG_SYS_DDRCDR_VALUE;
+ udelay(50000);
+
+ im->ddr.sdram_clk_cntl = CFG_SYS_DDR_SDRAM_CLK_CNTL;
+ udelay(1000);
+
+ im->ddr.csbnds[0].csbnds = CFG_SYS_DDR_CS0_BNDS;
+ im->ddr.cs_config[0] = CFG_SYS_DDR_CS0_CONFIG;
+ udelay(1000);
+
+ im->ddr.timing_cfg_0 = CFG_SYS_DDR_TIMING_0;
+ im->ddr.timing_cfg_1 = CFG_SYS_DDR_TIMING_1;
+ im->ddr.timing_cfg_2 = CFG_SYS_DDR_TIMING_2;
+ im->ddr.timing_cfg_3 = CFG_SYS_DDR_TIMING_3;
+ im->ddr.sdram_cfg = CFG_SYS_DDR_SDRAM_CFG;
+ im->ddr.sdram_cfg2 = CFG_SYS_DDR_SDRAM_CFG2;
+ im->ddr.sdram_mode = CFG_SYS_DDR_MODE;
+ im->ddr.sdram_mode2 = CFG_SYS_DDR_MODE2;
+ im->ddr.sdram_interval = CFG_SYS_DDR_INTERVAL;
+ sync();
+ udelay(1000);
+
+ im->ddr.sdram_cfg |= SDRAM_CFG_MEM_EN;
+ udelay(2000);
+ return CFG_SYS_SDRAM_SIZE >> 20;
+}
+#endif /*!CONFIG_SYS_SPD_EEPROM */
+
+int checkboard(void)
+{
+ puts("Board: Freescale MPC837xERDB\n");
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ immap_t *immr = (immap_t *)CONFIG_SYS_IMMR;
+#ifdef CONFIG_FSL_SERDES
+ u32 spridr = in_be32(&immr->sysconf.spridr);
+
+ /* we check only part num, and don't look for CPU revisions */
+ switch (PARTID_NO_E(spridr)) {
+ case SPR_8377:
+ fsl_setup_serdes(CFG_FSL_SERDES1, FSL_SERDES_PROTO_SATA,
+ FSL_SERDES_CLK_100, FSL_SERDES_VDD_1V);
+ fsl_setup_serdes(CFG_FSL_SERDES2, FSL_SERDES_PROTO_PEX,
+ FSL_SERDES_CLK_100, FSL_SERDES_VDD_1V);
+ break;
+ case SPR_8378:
+ fsl_setup_serdes(CFG_FSL_SERDES2, FSL_SERDES_PROTO_PEX,
+ FSL_SERDES_CLK_100, FSL_SERDES_VDD_1V);
+ break;
+ case SPR_8379:
+ fsl_setup_serdes(CFG_FSL_SERDES1, FSL_SERDES_PROTO_SATA,
+ FSL_SERDES_CLK_100, FSL_SERDES_VDD_1V);
+ fsl_setup_serdes(CFG_FSL_SERDES2, FSL_SERDES_PROTO_SATA,
+ FSL_SERDES_CLK_100, FSL_SERDES_VDD_1V);
+ break;
+ default:
+ printf("serdes not configured: unknown CPU part number: "
+ "%04x\n", spridr >> 16);
+ break;
+ }
+#endif /* CONFIG_FSL_SERDES */
+
+#ifdef CONFIG_FSL_ESDHC
+ clrsetbits_be32(&immr->sysconf.sicrl, SICRL_USB_B, SICRL_USB_B_SD);
+ clrsetbits_be32(&immr->sysconf.sicrh, SICRH_SPI, SICRH_SPI_SD);
+#endif
+ return 0;
+}
+
+#ifdef CONFIG_FSL_ESDHC
+#if !(CONFIG_IS_ENABLED(DM_MMC) || CONFIG_IS_ENABLED(DM_USB))
+int board_mmc_init(struct bd_info *bd)
+{
+ struct immap __iomem *im = (struct immap __iomem *)CONFIG_SYS_IMMR;
+ char buffer[HWCONFIG_BUFFER_SIZE] = {0};
+ int esdhc_hwconfig_enabled = 0;
+
+ if (env_get_f("hwconfig", buffer, sizeof(buffer)) > 0)
+ esdhc_hwconfig_enabled = hwconfig_f("esdhc", buffer);
+
+ if (esdhc_hwconfig_enabled == 0)
+ return 0;
+
+ clrsetbits_be32(&im->sysconf.sicrl, SICRL_USB_B, SICRL_USB_B_SD);
+ clrsetbits_be32(&im->sysconf.sicrh, SICRH_SPI, SICRH_SPI_SD);
+
+ return fsl_esdhc_mmc_init(bd);
+}
+#endif
+#endif
+
+/*
+ * Miscellaneous late-boot configurations
+ *
+ * If a VSC7385 microcode image is present, then upload it.
+*/
+int misc_init_r(void)
+{
+ int rc = 0;
+
+#ifdef CFG_VSC7385_IMAGE
+ if (vsc7385_upload_firmware((void *) CFG_VSC7385_IMAGE,
+ CFG_VSC7385_IMAGE_SIZE)) {
+ puts("Failure uploading VSC7385 microcode.\n");
+ rc = 1;
+ }
+#endif
+
+ return rc;
+}
+
+int board_late_init(void)
+{
+ volatile immap_t *immap = (immap_t *) CONFIG_SYS_IMMR;
+#ifdef CONFIG_USB_HOST
+ clrsetbits_be32(&immap->sysconf.sicrl, SICRL_USB_A, 0x40000000);
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_OF_BOARD_SETUP)
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+#ifdef CONFIG_PCI
+ ft_pci_setup(blob, bd);
+#endif
+ ft_cpu_setup(blob, bd);
+ fsl_fdt_fixup_dr_usb(blob, bd);
+ fdt_fixup_esdhc(blob, bd);
+
+ return 0;
+}
+#endif /* CONFIG_OF_BOARD_SETUP */
diff --git a/board/freescale/mpc8548cds/Kconfig b/board/freescale/mpc8548cds/Kconfig
new file mode 100644
index 00000000000..bb0a0758964
--- /dev/null
+++ b/board/freescale/mpc8548cds/Kconfig
@@ -0,0 +1,24 @@
+if TARGET_MPC8548CDS
+
+config PCI1
+ def_bool y
+
+config FSL_CADMUS
+ def_bool y
+
+config INTERRUPTS
+ def_bool y
+
+config SYS_BOARD
+ default "mpc8548cds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "MPC8548CDS"
+
+config TARGET_MPC8548CDS_LEGACY
+ bool "Legacy platform support"
+
+endif
diff --git a/board/freescale/mpc8548cds/MAINTAINERS b/board/freescale/mpc8548cds/MAINTAINERS
new file mode 100644
index 00000000000..fbbedb1d1d1
--- /dev/null
+++ b/board/freescale/mpc8548cds/MAINTAINERS
@@ -0,0 +1,8 @@
+MPC8548CDS BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/mpc8548cds/
+F: include/configs/MPC8548CDS.h
+F: configs/MPC8548CDS_defconfig
+F: configs/MPC8548CDS_36BIT_defconfig
+F: configs/MPC8548CDS_legacy_defconfig
diff --git a/board/freescale/mpc8548cds/Makefile b/board/freescale/mpc8548cds/Makefile
new file mode 100644
index 00000000000..5ed40e92eb9
--- /dev/null
+++ b/board/freescale/mpc8548cds/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2004 Freescale Semiconductor.
+# (C) Copyright 2001-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y += mpc8548cds.o
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/mpc8548cds/ddr.c b/board/freescale/mpc8548cds/ddr.c
new file mode 100644
index 00000000000..14202cd5a78
--- /dev/null
+++ b/board/freescale/mpc8548cds/ddr.c
@@ -0,0 +1,52 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Copyright 2008 Freescale Semiconductor, Inc.
+ */
+
+
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ /*
+ * Factors to consider for clock adjust:
+ * - number of chips on bus
+ * - position of slot
+ * - DDR1 vs. DDR2?
+ * - ???
+ *
+ * This needs to be determined on a board-by-board basis.
+ * 0110 3/4 cycle late
+ * 0111 7/8 cycle late
+ */
+ popts->clk_adjust = 7;
+
+ /*
+ * Factors to consider for CPO:
+ * - frequency
+ * - ddr1 vs. ddr2
+ */
+ popts->cpo_override = 10;
+
+ /*
+ * Factors to consider for write data delay:
+ * - number of DIMMs
+ *
+ * 1 = 1/4 clock delay
+ * 2 = 1/2 clock delay
+ * 3 = 3/4 clock delay
+ * 4 = 1 clock delay
+ * 5 = 5/4 clock delay
+ * 6 = 3/2 clock delay
+ */
+ popts->write_data_delay = 3;
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+}
diff --git a/board/freescale/mpc8548cds/law.c b/board/freescale/mpc8548cds/law.c
new file mode 100644
index 00000000000..2334870fda0
--- /dev/null
+++ b/board/freescale/mpc8548cds/law.c
@@ -0,0 +1,18 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008,2010-2011 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ /* LBC window - maps 256M */
+ SET_LAW(CFG_SYS_LBC_SDRAM_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_LBC),
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/mpc8548cds/mpc8548cds.c b/board/freescale/mpc8548cds/mpc8548cds.c
new file mode 100644
index 00000000000..7810010fd04
--- /dev/null
+++ b/board/freescale/mpc8548cds/mpc8548cds.c
@@ -0,0 +1,170 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2004, 2007, 2009-2011 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2002 Scott McNutt <smcnutt@artesyncp.com>
+ */
+
+#include <config.h>
+#include <display_options.h>
+#include <init.h>
+#include <net.h>
+#include <pci.h>
+#include <vsprintf.h>
+#include <asm/processor.h>
+#include <asm/mmu.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_pci.h>
+#include <fsl_ddr_sdram.h>
+#include <asm/fsl_serdes.h>
+#include <miiphy.h>
+#include <linux/delay.h>
+#include <linux/libfdt.h>
+#include <fdt_support.h>
+#include <tsec.h>
+#include <fsl_mdio.h>
+#include <netdev.h>
+
+#include "../common/cadmus.h"
+#include "../common/eeprom.h"
+#include "../common/via.h"
+
+void local_bus_init(void);
+
+int checkboard (void)
+{
+ volatile ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ volatile ccsr_local_ecm_t *ecm = (void *)(CFG_SYS_MPC85xx_ECM_ADDR);
+
+ /* PCI slot in USER bits CSR[6:7] by convention. */
+ uint pci_slot = get_pci_slot ();
+
+ uint cpu_board_rev = get_cpu_board_revision ();
+
+ puts("Board: MPC8548CDS");
+ printf(" Carrier Rev: 0x%02x, PCI Slot %d\n",
+ get_board_version(), pci_slot);
+ printf(" Daughtercard Rev: %d.%d (0x%04x)\n",
+ MPC85XX_CPU_BOARD_MAJOR (cpu_board_rev),
+ MPC85XX_CPU_BOARD_MINOR (cpu_board_rev), cpu_board_rev);
+ /*
+ * Initialize local bus.
+ */
+ local_bus_init ();
+
+ /*
+ * Hack TSEC 3 and 4 IO voltages.
+ */
+ gur->tsec34ioovcr = 0xe7e0; /* 1110 0111 1110 0xxx */
+
+ ecm->eedr = 0xffffffff; /* clear ecm errors */
+ ecm->eeer = 0xffffffff; /* enable ecm errors */
+ return 0;
+}
+
+/*
+ * Initialize Local Bus
+ */
+void
+local_bus_init(void)
+{
+ volatile ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ volatile fsl_lbc_t *lbc = LBC_BASE_ADDR;
+
+ uint clkdiv;
+ sys_info_t sysinfo;
+
+ get_sys_info(&sysinfo);
+ clkdiv = (lbc->lcrr & LCRR_CLKDIV) * 2;
+
+ gur->lbiuiplldcr1 = 0x00078080;
+ if (clkdiv == 16) {
+ gur->lbiuiplldcr0 = 0x7c0f1bf0;
+ } else if (clkdiv == 8) {
+ gur->lbiuiplldcr0 = 0x6c0f1bf0;
+ } else if (clkdiv == 4) {
+ gur->lbiuiplldcr0 = 0x5c0f1bf0;
+ }
+
+ lbc->lcrr |= 0x00030000;
+
+ asm("sync;isync;msync");
+
+ lbc->ltesr = 0xffffffff; /* Clear LBC error interrupts */
+ lbc->lteir = 0xffffffff; /* Enable LBC error interrupts */
+}
+
+/*
+ * Initialize SDRAM memory on the Local Bus.
+ */
+void lbc_sdram_init(void)
+{
+#if defined(CONFIG_SYS_OR2_PRELIM) && defined(CONFIG_SYS_BR2_PRELIM)
+
+ uint idx;
+ volatile fsl_lbc_t *lbc = LBC_BASE_ADDR;
+ uint *sdram_addr = (uint *)CFG_SYS_LBC_SDRAM_BASE;
+ uint lsdmr_common;
+
+ puts("LBC SDRAM: ");
+ print_size(CFG_SYS_LBC_SDRAM_SIZE * 1024 * 1024,
+ "\n");
+
+ /*
+ * Setup SDRAM Base and Option Registers
+ */
+ set_lbc_or(2, CONFIG_SYS_OR2_PRELIM);
+ set_lbc_br(2, CONFIG_SYS_BR2_PRELIM);
+ lbc->lbcr = CFG_SYS_LBC_LBCR;
+ asm("msync");
+
+ lbc->lsrt = CFG_SYS_LBC_LSRT;
+ lbc->mrtpr = CFG_SYS_LBC_MRTPR;
+ asm("msync");
+
+ /*
+ * MPC8548 uses "new" 15-16 style addressing.
+ */
+ lsdmr_common = CFG_SYS_LBC_LSDMR_COMMON;
+ lsdmr_common |= LSDMR_BSMA1516;
+
+ /*
+ * Issue PRECHARGE ALL command.
+ */
+ lbc->lsdmr = lsdmr_common | LSDMR_OP_PCHALL;
+ asm("sync;msync");
+ *sdram_addr = 0xff;
+ ppcDcbf((unsigned long) sdram_addr);
+ udelay(100);
+
+ /*
+ * Issue 8 AUTO REFRESH commands.
+ */
+ for (idx = 0; idx < 8; idx++) {
+ lbc->lsdmr = lsdmr_common | LSDMR_OP_ARFRSH;
+ asm("sync;msync");
+ *sdram_addr = 0xff;
+ ppcDcbf((unsigned long) sdram_addr);
+ udelay(100);
+ }
+
+ /*
+ * Issue 8 MODE-set command.
+ */
+ lbc->lsdmr = lsdmr_common | LSDMR_OP_MRW;
+ asm("sync;msync");
+ *sdram_addr = 0xff;
+ ppcDcbf((unsigned long) sdram_addr);
+ udelay(100);
+
+ /*
+ * Issue NORMAL OP command.
+ */
+ lbc->lsdmr = lsdmr_common | LSDMR_OP_NORMAL;
+ asm("sync;msync");
+ *sdram_addr = 0xff;
+ ppcDcbf((unsigned long) sdram_addr);
+ udelay(200); /* Overkill. Must wait > 200 bus cycles */
+
+#endif /* enable SDRAM init */
+}
diff --git a/board/freescale/mpc8548cds/tlb.c b/board/freescale/mpc8548cds/tlb.c
new file mode 100644
index 00000000000..0b2afa8054d
--- /dev/null
+++ b/board/freescale/mpc8548cds/tlb.c
@@ -0,0 +1,87 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008, 2011 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR, CFG_SYS_INIT_RAM_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024 , CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024 , CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024 , CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /*
+ * Entry 0:
+ * FLASH(cover boot page) 16M Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_16M, 1),
+
+ /*
+ * Entry 1:
+ * CCSRBAR 1M Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_1M, 1),
+
+ /*
+ * Entry 2:
+ * LBC SDRAM 64M Cacheable, non-guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_LBC_SDRAM_BASE,
+ CFG_SYS_LBC_SDRAM_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 2, BOOKE_PAGESZ_64M, 1),
+
+ /*
+ * Entry 3:
+ * CADMUS registers 1M Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CADMUS_BASE_ADDR, CADMUS_BASE_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1M, 1),
+
+ /*
+ * Entry 4:
+ * PCI and PCIe MEM 1G Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_PCI1_MEM_VIRT, CFG_SYS_PCI1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_1G, 1),
+
+ /*
+ * Entry 5:
+ * PCI1 IO 1M Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_PCI1_IO_VIRT, CFG_SYS_PCI1_IO_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_1M, 1),
+
+ /*
+ * Entry 6:
+ * PCIe IO 1M Non-cacheable, guarded
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_1M, 1),
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/mx23evk/Kconfig b/board/freescale/mx23evk/Kconfig
new file mode 100644
index 00000000000..51a8f9f773c
--- /dev/null
+++ b/board/freescale/mx23evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX23EVK
+
+config SYS_BOARD
+ default "mx23evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "mxs"
+
+config SYS_CONFIG_NAME
+ default "mx23evk"
+
+endif
diff --git a/board/freescale/mx23evk/MAINTAINERS b/board/freescale/mx23evk/MAINTAINERS
new file mode 100644
index 00000000000..122b70cd719
--- /dev/null
+++ b/board/freescale/mx23evk/MAINTAINERS
@@ -0,0 +1,8 @@
+MX23EVK BOARD
+M: Fabio Estevam <festevam@gmail.com>
+M: Otavio Salvador <otavio@ossystems.com.br>
+S: Maintained
+F: board/freescale/mx23evk/
+F: arch/arm/dts/imx23-evk.dts
+F: include/configs/mx23evk.h
+F: configs/mx23evk_defconfig
diff --git a/board/freescale/mx23evk/Makefile b/board/freescale/mx23evk/Makefile
new file mode 100644
index 00000000000..6fe6992a5fc
--- /dev/null
+++ b/board/freescale/mx23evk/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+ifndef CONFIG_SPL_BUILD
+obj-y := mx23evk.o
+else
+obj-y := spl_boot.o
+endif
diff --git a/board/freescale/mx23evk/mx23evk.c b/board/freescale/mx23evk/mx23evk.c
new file mode 100644
index 00000000000..fbc8fbdbf59
--- /dev/null
+++ b/board/freescale/mx23evk/mx23evk.c
@@ -0,0 +1,55 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Freescale MX23EVK board
+ *
+ * (C) Copyright 2013 O.S. Systems Software LTDA.
+ *
+ * Author: Otavio Salvador <otavio@ossystems.com.br>
+ *
+ * Based on m28evk.c:
+ * Copyright (C) 2011 Marek Vasut <marek.vasut@gmail.com>
+ * on behalf of DENX Software Engineering GmbH
+ */
+
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/iomux-mx23.h>
+#include <asm/arch/sys_proto.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+/*
+ * Functions
+ */
+int board_early_init_f(void)
+{
+ /* IO0 clock at 480MHz */
+ mxs_set_ioclk(MXC_IOCLK0, 480000);
+
+ /* SSP0 clock at 96MHz */
+ mxs_set_sspclk(MXC_SSPCLK0, 96000, 0);
+
+ /* Power on LCD */
+ gpio_direction_output(MX23_PAD_LCD_RESET__GPIO_1_18, 1);
+
+ /* Set contrast to maximum */
+ gpio_direction_output(MX23_PAD_PWM2__GPIO_1_28, 1);
+
+ return 0;
+}
+
+int dram_init(void)
+{
+ return mxs_dram_init();
+}
+
+int board_init(void)
+{
+ /* Adress of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM_1 + 0x100;
+
+ return 0;
+}
diff --git a/board/freescale/mx23evk/spl_boot.c b/board/freescale/mx23evk/spl_boot.c
new file mode 100644
index 00000000000..a4c39a35221
--- /dev/null
+++ b/board/freescale/mx23evk/spl_boot.c
@@ -0,0 +1,133 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Freescale MX23EVK Boot setup
+ *
+ * Copyright (C) 2011 Marek Vasut <marek.vasut@gmail.com>
+ * on behalf of DENX Software Engineering GmbH
+ */
+
+#include <config.h>
+#include <asm/io.h>
+#include <asm/arch/iomux-mx23.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/sys_proto.h>
+
+#define MUX_CONFIG_SSP1 (MXS_PAD_8MA | MXS_PAD_PULLUP)
+#define MUX_CONFIG_EMI (MXS_PAD_3V3 | MXS_PAD_12MA | MXS_PAD_PULLUP)
+#define MUX_CONFIG_LCD (MXS_PAD_4MA | MXS_PAD_NOPULL)
+
+const iomux_cfg_t iomux_setup[] = {
+ /* DUART */
+ MX23_PAD_PWM0__DUART_RX,
+ MX23_PAD_PWM1__DUART_TX,
+
+ /* EMI */
+ MX23_PAD_EMI_D00__EMI_D00 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D01__EMI_D01 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D02__EMI_D02 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D03__EMI_D03 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D04__EMI_D04 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D05__EMI_D05 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D06__EMI_D06 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D07__EMI_D07 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D08__EMI_D08 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D09__EMI_D09 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D10__EMI_D10 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D11__EMI_D11 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D12__EMI_D12 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D13__EMI_D13 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D14__EMI_D14 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_D15__EMI_D15 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_DQM0__EMI_DQM0 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_DQM1__EMI_DQM1 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_DQS0__EMI_DQS0 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_DQS1__EMI_DQS1 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_CLK__EMI_CLK | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_CLKN__EMI_CLKN | MUX_CONFIG_EMI,
+
+ MX23_PAD_EMI_A00__EMI_A00 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A01__EMI_A01 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A02__EMI_A02 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A03__EMI_A03 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A04__EMI_A04 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A05__EMI_A05 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A06__EMI_A06 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A07__EMI_A07 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A08__EMI_A08 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A09__EMI_A09 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A10__EMI_A10 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A11__EMI_A11 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_A12__EMI_A12 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_BA0__EMI_BA0 | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_BA1__EMI_BA1 | MUX_CONFIG_EMI,
+
+ MX23_PAD_EMI_CASN__EMI_CASN | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_CE0N__EMI_CE0N | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_CE1N__EMI_CE1N | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_CKE__EMI_CKE | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_RASN__EMI_RASN | MUX_CONFIG_EMI,
+ MX23_PAD_EMI_WEN__EMI_WEN | MUX_CONFIG_EMI,
+
+ /* MMC 0 */
+ MX23_PAD_SSP1_DATA0__SSP1_DATA0 | MUX_CONFIG_SSP1,
+ MX23_PAD_SSP1_DATA1__SSP1_DATA1 | MUX_CONFIG_SSP1,
+ MX23_PAD_SSP1_DATA2__SSP1_DATA2 | MUX_CONFIG_SSP1,
+ MX23_PAD_SSP1_DATA3__SSP1_DATA3 | MUX_CONFIG_SSP1,
+ MX23_PAD_SSP1_CMD__SSP1_CMD | MUX_CONFIG_SSP1,
+ MX23_PAD_SSP1_DETECT__SSP1_DETECT | MUX_CONFIG_SSP1,
+ (MXS_PAD_8MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ MX23_PAD_SSP1_SCK__SSP1_SCK |
+ (MXS_PAD_8MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ /* Write Protect Pin */
+ MX23_PAD_PWM4__GPIO_1_30 |
+ (MXS_PAD_4MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ /* Slot Power Enable */
+ MX23_PAD_PWM3__GPIO_1_29 |
+ (MXS_PAD_4MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ /* LCD */
+ MX23_PAD_LCD_D00__LCD_D00 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D01__LCD_D01 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D02__LCD_D02 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D03__LCD_D03 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D04__LCD_D04 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D05__LCD_D05 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D06__LCD_D06 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D07__LCD_D07 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D08__LCD_D08 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D09__LCD_D09 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D10__LCD_D10 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D11__LCD_D11 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D12__LCD_D12 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D13__LCD_D13 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D14__LCD_D14 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D15__LCD_D15 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D16__LCD_D16 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_D17__LCD_D17 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D08__LCD_D18 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D09__LCD_D19 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D10__LCD_D20 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D11__LCD_D21 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D12__LCD_D22 | MUX_CONFIG_LCD,
+ MX23_PAD_GPMI_D13__LCD_D23 | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_DOTCK__LCD_DOTCK | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_ENABLE__LCD_ENABLE | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_HSYNC__LCD_HSYNC | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_VSYNC__LCD_VSYNC | MUX_CONFIG_LCD,
+ MX23_PAD_LCD_RESET__GPIO_1_18 | MUX_CONFIG_LCD, /* LCD power */
+ MX23_PAD_PWM2__GPIO_1_28 | MUX_CONFIG_LCD, /* LCD contrast */
+};
+
+#define HW_DRAM_CTL14 (0x38 >> 2)
+#define CS_MAP 0x3
+#define INTAREF 0x2
+#define HW_DRAM_CTL14_CONFIG (INTAREF << 8 | CS_MAP)
+
+void mxs_adjust_memory_params(uint32_t *dram_vals)
+{
+ dram_vals[HW_DRAM_CTL14] = HW_DRAM_CTL14_CONFIG;
+}
+
+void board_init_ll(const uint32_t arg, const uint32_t *resptr)
+{
+ mxs_common_spl_init(arg, resptr, iomux_setup, ARRAY_SIZE(iomux_setup));
+}
diff --git a/board/freescale/mx28evk/Kconfig b/board/freescale/mx28evk/Kconfig
new file mode 100644
index 00000000000..39777bd70fa
--- /dev/null
+++ b/board/freescale/mx28evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX28EVK
+
+config SYS_BOARD
+ default "mx28evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "mxs"
+
+config SYS_CONFIG_NAME
+ default "mx28evk"
+
+endif
diff --git a/board/freescale/mx28evk/MAINTAINERS b/board/freescale/mx28evk/MAINTAINERS
new file mode 100644
index 00000000000..f20baa91c67
--- /dev/null
+++ b/board/freescale/mx28evk/MAINTAINERS
@@ -0,0 +1,7 @@
+MX28EVK BOARD
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/mx28evk/
+F: arch/arm/dts/imx28-evk.dts
+F: include/configs/mx28evk.h
+F: configs/mx28evk_defconfig
diff --git a/board/freescale/mx28evk/Makefile b/board/freescale/mx28evk/Makefile
new file mode 100644
index 00000000000..057760433da
--- /dev/null
+++ b/board/freescale/mx28evk/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2000-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+ifndef CONFIG_SPL_BUILD
+obj-y := mx28evk.o
+else
+obj-y := iomux.o
+endif
diff --git a/board/freescale/mx28evk/README b/board/freescale/mx28evk/README
new file mode 100644
index 00000000000..d32f0efb332
--- /dev/null
+++ b/board/freescale/mx28evk/README
@@ -0,0 +1,62 @@
+FREESCALE MX28EVK
+==================
+
+Supported hardware: MX28EVK rev C and D are supported in U-Boot.
+
+Files of the MX28EVK port
+--------------------------
+
+arch/arm/cpu/arm926ejs/mxs/ - The CPU support code for the Freescale i.MX28
+arch/arm/include/asm/arch-mxs/ - Header files for the Freescale i.MX28
+board/freescale/mx28evk/ - MX28EVK board specific files
+include/configs/mx28evk.h - MX28EVK configuration file
+
+Jumper configuration
+---------------------
+
+To boot MX28EVK from an SD card, set the boot mode DIP switches as:
+
+ * Boot Mode Select: 1 0 0 1 (Boot from SD card Slot 0 - U42)
+ * JTAG PSWITCH RESET: To the right (reset disabled)
+ * Battery Source: Down
+ * Wall 5V: Up
+ * VDD 5V: To the left (off)
+ * Hold Button: Down (off)
+
+To boot MX28EVK from SPI NOR flash, set the boot mode DIP switches as:
+
+ * Boot Mode Select: 0 0 1 0 (Boot from SSP2)
+ * JTAG PSWITCH RESET: To the right (reset disabled)
+ * Battery Source: Down
+ * Wall 5V: Up
+ * VDD 5V: To the left (off)
+ * Hold Button: Down (off)
+
+Environment Storage
+-------------------
+
+There are three targets for mx28evk:
+
+"make mx28evk_config" - store environment variables into MMC
+
+or
+
+"make mx28evk_nand_config" - store environment variables into NAND flash
+
+or
+
+"make mx28evk_spi_config" - store environment variables into SPI NOR flash
+
+Choose the target accordingly.
+
+Note: The mx28evk board does not come with a NAND flash populated from the
+factory. It comes with an empty slot (U23), which allows the insertion of a
+48-pin TSOP flash device.
+
+mx28evk does not come with SPI NOR flash populated from the factory either.
+It is possible to solder a SOIC memory on U49 or use a DIP8 on J89.
+To get SPI communication to work R320, R321,R322 and C178 need to be populated.
+Look in the schematics for the proper component values.
+
+Follow the instructions from doc/imx/common/mxs.txt to generate a bootable
+SD card or to generate a binary to be flashed into SPI NOR.
diff --git a/board/freescale/mx28evk/iomux.c b/board/freescale/mx28evk/iomux.c
new file mode 100644
index 00000000000..b84b045bd1f
--- /dev/null
+++ b/board/freescale/mx28evk/iomux.c
@@ -0,0 +1,204 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Freescale MX28EVK IOMUX setup
+ *
+ * Copyright (C) 2011 Marek Vasut <marek.vasut@gmail.com>
+ * on behalf of DENX Software Engineering GmbH
+ */
+
+#include <config.h>
+#include <asm/io.h>
+#include <asm/arch/iomux-mx28.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/sys_proto.h>
+
+#define MUX_CONFIG_SSP0 (MXS_PAD_3V3 | MXS_PAD_8MA | MXS_PAD_PULLUP)
+#define MUX_CONFIG_GPMI (MXS_PAD_3V3 | MXS_PAD_4MA | MXS_PAD_NOPULL)
+#define MUX_CONFIG_ENET (MXS_PAD_3V3 | MXS_PAD_8MA | MXS_PAD_PULLUP)
+#define MUX_CONFIG_EMI (MXS_PAD_3V3 | MXS_PAD_12MA | MXS_PAD_NOPULL)
+#define MUX_CONFIG_SSP2 (MXS_PAD_3V3 | MXS_PAD_4MA | MXS_PAD_PULLUP)
+#define MUX_CONFIG_LCD (MXS_PAD_3V3 | MXS_PAD_4MA | MXS_PAD_NOPULL)
+
+const iomux_cfg_t iomux_setup[] = {
+ /* DUART */
+ MX28_PAD_PWM0__DUART_RX,
+ MX28_PAD_PWM1__DUART_TX,
+
+ /* MMC0 */
+ MX28_PAD_SSP0_DATA0__SSP0_D0 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA1__SSP0_D1 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA2__SSP0_D2 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA3__SSP0_D3 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA4__SSP0_D4 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA5__SSP0_D5 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA6__SSP0_D6 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DATA7__SSP0_D7 | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_CMD__SSP0_CMD | MUX_CONFIG_SSP0,
+ MX28_PAD_SSP0_DETECT__SSP0_CARD_DETECT |
+ (MXS_PAD_8MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ MX28_PAD_SSP0_SCK__SSP0_SCK |
+ (MXS_PAD_12MA | MXS_PAD_3V3 | MXS_PAD_NOPULL),
+ /* write protect */
+ MX28_PAD_SSP1_SCK__GPIO_2_12,
+ /* MMC0 slot power enable */
+ MX28_PAD_PWM3__GPIO_3_28 |
+ (MXS_PAD_12MA | MXS_PAD_3V3 | MXS_PAD_PULLUP),
+
+#ifdef CONFIG_NAND_MXS
+ /* GPMI NAND */
+ MX28_PAD_GPMI_D00__GPMI_D0 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D01__GPMI_D1 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D02__GPMI_D2 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D03__GPMI_D3 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D04__GPMI_D4 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D05__GPMI_D5 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D06__GPMI_D6 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_D07__GPMI_D7 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_CE0N__GPMI_CE0N | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_RDY0__GPMI_READY0 | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_RDN__GPMI_RDN |
+ (MXS_PAD_3V3 | MXS_PAD_8MA | MXS_PAD_PULLUP),
+ MX28_PAD_GPMI_WRN__GPMI_WRN | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_ALE__GPMI_ALE | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_CLE__GPMI_CLE | MUX_CONFIG_GPMI,
+ MX28_PAD_GPMI_RESETN__GPMI_RESETN | MUX_CONFIG_GPMI,
+#endif
+
+ /* FEC0 */
+ MX28_PAD_ENET0_MDC__ENET0_MDC | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_MDIO__ENET0_MDIO | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_RX_EN__ENET0_RX_EN | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_TX_EN__ENET0_TX_EN | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_RXD0__ENET0_RXD0 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_RXD1__ENET0_RXD1 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_TXD0__ENET0_TXD0 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_TXD1__ENET0_TXD1 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET_CLK__CLKCTRL_ENET | MUX_CONFIG_ENET,
+ /* FEC0 Enable */
+ MX28_PAD_SSP1_DATA3__GPIO_2_15 |
+ (MXS_PAD_12MA | MXS_PAD_3V3),
+ /* FEC0 Reset */
+ MX28_PAD_ENET0_RX_CLK__GPIO_4_13 |
+ (MXS_PAD_12MA | MXS_PAD_3V3 | MXS_PAD_PULLUP),
+
+ /* FEC1 */
+ MX28_PAD_ENET0_COL__ENET1_TX_EN | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_CRS__ENET1_RX_EN | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_RXD2__ENET1_RXD0 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_RXD3__ENET1_RXD1 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_TXD2__ENET1_TXD0 | MUX_CONFIG_ENET,
+ MX28_PAD_ENET0_TXD3__ENET1_TXD1 | MUX_CONFIG_ENET,
+
+ /* EMI */
+ MX28_PAD_EMI_D00__EMI_DATA0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D01__EMI_DATA1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D02__EMI_DATA2 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D03__EMI_DATA3 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D04__EMI_DATA4 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D05__EMI_DATA5 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D06__EMI_DATA6 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D07__EMI_DATA7 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D08__EMI_DATA8 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D09__EMI_DATA9 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D10__EMI_DATA10 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D11__EMI_DATA11 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D12__EMI_DATA12 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D13__EMI_DATA13 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D14__EMI_DATA14 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_D15__EMI_DATA15 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_ODT0__EMI_ODT0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DQM0__EMI_DQM0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_ODT1__EMI_ODT1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DQM1__EMI_DQM1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DDR_OPEN_FB__EMI_DDR_OPEN_FEEDBACK | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_CLK__EMI_CLK | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DQS0__EMI_DQS0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DQS1__EMI_DQS1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_DDR_OPEN__EMI_DDR_OPEN | MUX_CONFIG_EMI,
+
+ MX28_PAD_EMI_A00__EMI_ADDR0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A01__EMI_ADDR1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A02__EMI_ADDR2 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A03__EMI_ADDR3 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A04__EMI_ADDR4 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A05__EMI_ADDR5 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A06__EMI_ADDR6 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A07__EMI_ADDR7 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A08__EMI_ADDR8 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A09__EMI_ADDR9 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A10__EMI_ADDR10 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A11__EMI_ADDR11 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A12__EMI_ADDR12 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A13__EMI_ADDR13 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_A14__EMI_ADDR14 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_BA0__EMI_BA0 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_BA1__EMI_BA1 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_BA2__EMI_BA2 | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_CASN__EMI_CASN | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_RASN__EMI_RASN | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_WEN__EMI_WEN | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_CE0N__EMI_CE0N | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_CE1N__EMI_CE1N | MUX_CONFIG_EMI,
+ MX28_PAD_EMI_CKE__EMI_CKE | MUX_CONFIG_EMI,
+
+ /* SPI2 (for SPI flash) */
+ MX28_PAD_SSP2_SCK__SSP2_SCK | MUX_CONFIG_SSP2,
+ MX28_PAD_SSP2_MOSI__SSP2_CMD | MUX_CONFIG_SSP2,
+ MX28_PAD_SSP2_MISO__SSP2_D0 | MUX_CONFIG_SSP2,
+ MX28_PAD_SSP2_SS0__SSP2_D3 |
+ (MXS_PAD_3V3 | MXS_PAD_8MA | MXS_PAD_PULLUP),
+ /* I2C */
+ MX28_PAD_I2C0_SCL__I2C0_SCL,
+ MX28_PAD_I2C0_SDA__I2C0_SDA,
+
+ /* LCD */
+ MX28_PAD_LCD_D00__LCD_D0 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D01__LCD_D1 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D02__LCD_D2 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D03__LCD_D3 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D04__LCD_D4 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D05__LCD_D5 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D06__LCD_D6 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D07__LCD_D7 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D08__LCD_D8 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D09__LCD_D9 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D10__LCD_D10 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D11__LCD_D11 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D12__LCD_D12 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D13__LCD_D13 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D14__LCD_D14 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D15__LCD_D15 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D16__LCD_D16 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D17__LCD_D17 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D18__LCD_D18 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D19__LCD_D19 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D20__LCD_D20 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D21__LCD_D21 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D22__LCD_D22 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_D23__LCD_D23 | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_RD_E__LCD_VSYNC | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_WR_RWN__LCD_HSYNC | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_RS__LCD_DOTCLK | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_CS__LCD_ENABLE | MUX_CONFIG_LCD,
+ MX28_PAD_LCD_RESET__GPIO_3_30 | MUX_CONFIG_LCD, /* LCD power */
+ MX28_PAD_PWM2__GPIO_3_18 | MUX_CONFIG_LCD, /* LCD contrast */
+};
+
+#define HW_DRAM_CTL29 (0x74 >> 2)
+#define CS_MAP 0xf
+#define COLUMN_SIZE 0x2
+#define ADDR_PINS 0x1
+#define APREBIT 0xa
+
+#define HW_DRAM_CTL29_CONFIG (CS_MAP << 24 | COLUMN_SIZE << 16 | \
+ ADDR_PINS << 8 | APREBIT)
+
+void mxs_adjust_memory_params(uint32_t *dram_vals)
+{
+ dram_vals[HW_DRAM_CTL29] = HW_DRAM_CTL29_CONFIG;
+}
+
+void board_init_ll(const uint32_t arg, const uint32_t *resptr)
+{
+ mxs_common_spl_init(arg, resptr, iomux_setup, ARRAY_SIZE(iomux_setup));
+}
diff --git a/board/freescale/mx28evk/mx28evk.c b/board/freescale/mx28evk/mx28evk.c
new file mode 100644
index 00000000000..ada572912da
--- /dev/null
+++ b/board/freescale/mx28evk/mx28evk.c
@@ -0,0 +1,73 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Freescale MX28EVK board
+ *
+ * (C) Copyright 2011 Freescale Semiconductor, Inc.
+ *
+ * Author: Fabio Estevam <fabio.estevam@freescale.com>
+ *
+ * Based on m28evk.c:
+ * Copyright (C) 2011 Marek Vasut <marek.vasut@gmail.com>
+ * on behalf of DENX Software Engineering GmbH
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/io.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/iomux-mx28.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/sys_proto.h>
+#include <linux/delay.h>
+#include <linux/mii.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <errno.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+/*
+ * Functions
+ */
+int board_early_init_f(void)
+{
+ /* IO0 clock at 480MHz */
+ mxs_set_ioclk(MXC_IOCLK0, 480000);
+ /* IO1 clock at 480MHz */
+ mxs_set_ioclk(MXC_IOCLK1, 480000);
+
+ /* SSP0 clock at 96MHz */
+ mxs_set_sspclk(MXC_SSPCLK0, 96000, 0);
+ /* SSP2 clock at 160MHz */
+ mxs_set_sspclk(MXC_SSPCLK2, 160000, 0);
+
+#ifdef CONFIG_CMD_USB
+ mxs_iomux_setup_pad(MX28_PAD_SSP2_SS1__USB1_OVERCURRENT);
+ mxs_iomux_setup_pad(MX28_PAD_AUART2_RX__GPIO_3_8 |
+ MXS_PAD_4MA | MXS_PAD_3V3 | MXS_PAD_NOPULL);
+ gpio_direction_output(MX28_PAD_AUART2_RX__GPIO_3_8, 1);
+#endif
+
+ /* Power on LCD */
+ gpio_direction_output(MX28_PAD_LCD_RESET__GPIO_3_30, 1);
+
+ /* Set contrast to maximum */
+ gpio_direction_output(MX28_PAD_PWM2__GPIO_3_18, 1);
+
+ return 0;
+}
+
+int dram_init(void)
+{
+ return mxs_dram_init();
+}
+
+int board_init(void)
+{
+ /* Adress of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM_1 + 0x100;
+
+ return 0;
+}
diff --git a/board/freescale/mx51evk/Kconfig b/board/freescale/mx51evk/Kconfig
new file mode 100644
index 00000000000..a26b539536e
--- /dev/null
+++ b/board/freescale/mx51evk/Kconfig
@@ -0,0 +1,18 @@
+if TARGET_MX51EVK
+
+config SYS_BOARD
+ default "mx51evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "mx5"
+
+config SYS_CONFIG_NAME
+ default "mx51evk"
+
+config IMX_CONFIG
+ default "board/freescale/mx51evk/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx51evk/MAINTAINERS b/board/freescale/mx51evk/MAINTAINERS
new file mode 100644
index 00000000000..1ca55f7d14e
--- /dev/null
+++ b/board/freescale/mx51evk/MAINTAINERS
@@ -0,0 +1,7 @@
+MX51EVK BOARD
+M: Fabio Estevam <festevam@gmail.com>
+M: Stefano Babic <sbabic@denx.de>
+S: Maintained
+F: board/freescale/mx51evk/
+F: include/configs/mx51evk.h
+F: configs/mx51evk_defconfig
diff --git a/board/freescale/mx51evk/Makefile b/board/freescale/mx51evk/Makefile
new file mode 100644
index 00000000000..808e35015e8
--- /dev/null
+++ b/board/freescale/mx51evk/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2007, Guennadi Liakhovetski <lg@denx.de>
+#
+# (C) Copyright 2009 Freescale Semiconductor, Inc.
+
+obj-y += mx51evk.o
diff --git a/board/freescale/mx51evk/imximage.cfg b/board/freescale/mx51evk/imximage.cfg
new file mode 100644
index 00000000000..ff2ec4aa273
--- /dev/null
+++ b/board/freescale/mx51evk/imximage.cfg
@@ -0,0 +1,108 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * (C Copyright 2009
+ * Stefano Babic DENX Software Engineering sbabic@denx.de.
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+/*
+ * Boot Device : one of
+ * spi, sd (the board has no nand neither onenand)
+ */
+BOOT_FROM spi
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Setting IOMUXC */
+DATA 4 0x73FA88a0 0x200
+DATA 4 0x73FA850c 0x20c5
+DATA 4 0x73FA8510 0x20c5
+DATA 4 0x73FA883c 0x2
+DATA 4 0x73FA8848 0x2
+DATA 4 0x73FA84b8 0xe7
+DATA 4 0x73FA84bc 0x45
+DATA 4 0x73FA84c0 0x45
+DATA 4 0x73FA84c4 0x45
+DATA 4 0x73FA84c8 0x45
+DATA 4 0x73FA8820 0x0
+DATA 4 0x73FA84a4 0x3
+DATA 4 0x73FA84a8 0x3
+DATA 4 0x73FA84ac 0xe3
+DATA 4 0x73FA84b0 0xe3
+DATA 4 0x73FA84b4 0xe3
+DATA 4 0x73FA84cc 0xe3
+DATA 4 0x73FA84d0 0xe2
+
+DATA 4 0x73FA882c 0x6
+DATA 4 0x73FA88a4 0x6
+DATA 4 0x73FA88ac 0x6
+DATA 4 0x73FA88b8 0x6
+
+/*
+ * Setting DDR for micron
+ * 13 Rows, 10 Cols, 32 bit, SREF=4 Micron Model
+ * CAS=3 BL=4
+ */
+/* ESDCTL_ESDCTL0 */
+DATA 4 0x83FD9000 0x82a20000
+/* ESDCTL_ESDCTL1 */
+DATA 4 0x83FD9008 0x82a20000
+/* ESDCTL_ESDMISC */
+DATA 4 0x83FD9010 0x000ad0d0
+/* ESDCTL_ESDCFG0 */
+DATA 4 0x83FD9004 0x333574aa
+/* ESDCTL_ESDCFG1 */
+DATA 4 0x83FD900C 0x333574aa
+
+/* Init DRAM on CS0 */
+/* ESDCTL_ESDSCR */
+DATA 4 0x83FD9014 0x04008008
+DATA 4 0x83FD9014 0x0000801a
+DATA 4 0x83FD9014 0x0000801b
+DATA 4 0x83FD9014 0x00448019
+DATA 4 0x83FD9014 0x07328018
+DATA 4 0x83FD9014 0x04008008
+DATA 4 0x83FD9014 0x00008010
+DATA 4 0x83FD9014 0x00008010
+DATA 4 0x83FD9014 0x06328018
+DATA 4 0x83FD9014 0x03808019
+DATA 4 0x83FD9014 0x00408019
+DATA 4 0x83FD9014 0x00008000
+
+/* Init DRAM on CS1 */
+DATA 4 0x83FD9014 0x0400800c
+DATA 4 0x83FD9014 0x0000801e
+DATA 4 0x83FD9014 0x0000801f
+DATA 4 0x83FD9014 0x0000801d
+DATA 4 0x83FD9014 0x0732801c
+DATA 4 0x83FD9014 0x0400800c
+DATA 4 0x83FD9014 0x00008014
+DATA 4 0x83FD9014 0x00008014
+DATA 4 0x83FD9014 0x0632801c
+DATA 4 0x83FD9014 0x0380801d
+DATA 4 0x83FD9014 0x0040801d
+DATA 4 0x83FD9014 0x00008004
+
+/* Write to CTL0 */
+DATA 4 0x83FD9000 0xb2a20000
+/* Write to CTL1 */
+DATA 4 0x83FD9008 0xb2a20000
+/* ESDMISC */
+DATA 4 0x83FD9010 0x000ad6d0
+/* ESDCTL_ESDCDLYGD */
+DATA 4 0x83FD9034 0x90000000
+DATA 4 0x83FD9014 0x00000000
diff --git a/board/freescale/mx51evk/mx51evk.c b/board/freescale/mx51evk/mx51evk.c
new file mode 100644
index 00000000000..69456842302
--- /dev/null
+++ b/board/freescale/mx51evk/mx51evk.c
@@ -0,0 +1,220 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * (C) Copyright 2009 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/gpio.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/iomux-mx51.h>
+#include <linux/delay.h>
+#include <linux/errno.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/clock.h>
+#include <asm/mach-imx/mx5_video.h>
+#include <i2c.h>
+#include <input.h>
+#include <mmc.h>
+#include <fsl_esdhc_imx.h>
+#include <power/pmic.h>
+#include <fsl_pmic.h>
+#include <mc13892.h>
+#include <usb/ehci-ci.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+ /* dram_init must store complete ramsize in gd->ram_size */
+ gd->ram_size = get_ram_size((void *)CFG_SYS_SDRAM_BASE,
+ PHYS_SDRAM_1_SIZE);
+ return 0;
+}
+
+#ifdef CONFIG_REVISION_TAG
+u32 get_board_rev(void)
+{
+ u32 rev = get_cpu_rev();
+ if (!gpio_get_value(IMX_GPIO_NR(1, 22)))
+ rev |= BOARD_REV_2_0 << BOARD_VER_OFFSET;
+ return rev;
+}
+#endif
+
+#define UART_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_PUS_100K_DOWN | PAD_CTL_DSE_HIGH)
+
+static void setup_iomux_uart(void)
+{
+ static const iomux_v3_cfg_t uart_pads[] = {
+ MX51_PAD_UART1_RXD__UART1_RXD,
+ MX51_PAD_UART1_TXD__UART1_TXD,
+ NEW_PAD_CTRL(MX51_PAD_UART1_RTS__UART1_RTS, UART_PAD_CTRL),
+ NEW_PAD_CTRL(MX51_PAD_UART1_CTS__UART1_CTS, UART_PAD_CTRL),
+ };
+
+ imx_iomux_v3_setup_multiple_pads(uart_pads, ARRAY_SIZE(uart_pads));
+}
+
+#ifdef CONFIG_MXC_SPI
+static void setup_iomux_spi(void)
+{
+ static const iomux_v3_cfg_t spi_pads[] = {
+ NEW_PAD_CTRL(MX51_PAD_CSPI1_MOSI__ECSPI1_MOSI, PAD_CTL_HYS |
+ PAD_CTL_DSE_HIGH | PAD_CTL_SRE_FAST),
+ NEW_PAD_CTRL(MX51_PAD_CSPI1_MISO__ECSPI1_MISO, PAD_CTL_HYS |
+ PAD_CTL_DSE_HIGH | PAD_CTL_SRE_FAST),
+ NEW_PAD_CTRL(MX51_PAD_CSPI1_SS1__ECSPI1_SS1,
+ MX51_GPIO_PAD_CTRL),
+ MX51_PAD_CSPI1_SS0__ECSPI1_SS0,
+ NEW_PAD_CTRL(MX51_PAD_CSPI1_RDY__ECSPI1_RDY, MX51_PAD_CTRL_2),
+ NEW_PAD_CTRL(MX51_PAD_CSPI1_SCLK__ECSPI1_SCLK, PAD_CTL_HYS |
+ PAD_CTL_DSE_HIGH | PAD_CTL_SRE_FAST),
+ };
+
+ imx_iomux_v3_setup_multiple_pads(spi_pads, ARRAY_SIZE(spi_pads));
+}
+#endif
+
+static void power_init(void)
+{
+ unsigned int val;
+ struct mxc_ccm_reg *mxc_ccm = (struct mxc_ccm_reg *)MXC_CCM_BASE;
+ struct pmic *p;
+ int ret;
+
+ ret = pmic_init(CFG_FSL_PMIC_BUS);
+ if (ret)
+ return;
+
+ p = pmic_get("FSL_PMIC");
+ if (!p)
+ return;
+
+ /* Write needed to Power Gate 2 register */
+ pmic_reg_read(p, REG_POWER_MISC, &val);
+ val &= ~PWGT2SPIEN;
+ pmic_reg_write(p, REG_POWER_MISC, val);
+
+ /* Externally powered */
+ pmic_reg_read(p, REG_CHARGE, &val);
+ val |= ICHRG0 | ICHRG1 | ICHRG2 | ICHRG3 | CHGAUTOB;
+ pmic_reg_write(p, REG_CHARGE, val);
+
+ /* power up the system first */
+ pmic_reg_write(p, REG_POWER_MISC, PWUP);
+
+ /* Set core voltage to 1.1V */
+ pmic_reg_read(p, REG_SW_0, &val);
+ val = (val & ~SWx_VOLT_MASK) | SWx_1_100V;
+ pmic_reg_write(p, REG_SW_0, val);
+
+ /* Setup VCC (SW2) to 1.25 */
+ pmic_reg_read(p, REG_SW_1, &val);
+ val = (val & ~SWx_VOLT_MASK) | SWx_1_250V;
+ pmic_reg_write(p, REG_SW_1, val);
+
+ /* Setup 1V2_DIG1 (SW3) to 1.25 */
+ pmic_reg_read(p, REG_SW_2, &val);
+ val = (val & ~SWx_VOLT_MASK) | SWx_1_250V;
+ pmic_reg_write(p, REG_SW_2, val);
+ udelay(50);
+
+ /* Raise the core frequency to 800MHz */
+ writel(0x0, &mxc_ccm->cacrr);
+
+ /* Set switchers in Auto in NORMAL mode & STANDBY mode */
+ /* Setup the switcher mode for SW1 & SW2*/
+ pmic_reg_read(p, REG_SW_4, &val);
+ val = (val & ~((SWMODE_MASK << SWMODE1_SHIFT) |
+ (SWMODE_MASK << SWMODE2_SHIFT)));
+ val |= (SWMODE_AUTO_AUTO << SWMODE1_SHIFT) |
+ (SWMODE_AUTO_AUTO << SWMODE2_SHIFT);
+ pmic_reg_write(p, REG_SW_4, val);
+
+ /* Setup the switcher mode for SW3 & SW4 */
+ pmic_reg_read(p, REG_SW_5, &val);
+ val = (val & ~((SWMODE_MASK << SWMODE3_SHIFT) |
+ (SWMODE_MASK << SWMODE4_SHIFT)));
+ val |= (SWMODE_AUTO_AUTO << SWMODE3_SHIFT) |
+ (SWMODE_AUTO_AUTO << SWMODE4_SHIFT);
+ pmic_reg_write(p, REG_SW_5, val);
+
+ /* Set VDIG to 1.65V, VGEN3 to 1.8V, VCAM to 2.6V */
+ pmic_reg_read(p, REG_SETTING_0, &val);
+ val &= ~(VCAM_MASK | VGEN3_MASK | VDIG_MASK);
+ val |= VDIG_1_65 | VGEN3_1_8 | VCAM_2_6;
+ pmic_reg_write(p, REG_SETTING_0, val);
+
+ /* Set VVIDEO to 2.775V, VAUDIO to 3V, VSD to 3.15V */
+ pmic_reg_read(p, REG_SETTING_1, &val);
+ val &= ~(VVIDEO_MASK | VSD_MASK | VAUDIO_MASK);
+ val |= VSD_3_15 | VAUDIO_3_0 | VVIDEO_2_775;
+ pmic_reg_write(p, REG_SETTING_1, val);
+
+ /* Configure VGEN3 and VCAM regulators to use external PNP */
+ val = VGEN3CONFIG | VCAMCONFIG;
+ pmic_reg_write(p, REG_MODE_1, val);
+ udelay(200);
+
+ /* Enable VGEN3, VCAM, VAUDIO, VVIDEO, VSD regulators */
+ val = VGEN3EN | VGEN3CONFIG | VCAMEN | VCAMCONFIG |
+ VVIDEOEN | VAUDIOEN | VSDEN;
+ pmic_reg_write(p, REG_MODE_1, val);
+
+ imx_iomux_v3_setup_pad(NEW_PAD_CTRL(MX51_PAD_EIM_A20__GPIO2_14,
+ NO_PAD_CTRL));
+ gpio_request(IMX_GPIO_NR(2, 14), "gpio2_14");
+ gpio_direction_output(IMX_GPIO_NR(2, 14), 0);
+
+ udelay(500);
+
+ gpio_set_value(IMX_GPIO_NR(2, 14), 1);
+}
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+ setup_iomux_lcd();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM_1 + 0x100;
+
+ return 0;
+}
+
+#ifdef CONFIG_BOARD_LATE_INIT
+int board_late_init(void)
+{
+#ifdef CONFIG_MXC_SPI
+ setup_iomux_spi();
+ power_init();
+#endif
+
+ return 0;
+}
+#endif
+
+/*
+ * Do not overwrite the console
+ * Use always serial for U-Boot console
+ */
+int overwrite_console(void)
+{
+ return 1;
+}
+
+int checkboard(void)
+{
+ puts("Board: MX51EVK\n");
+
+ return 0;
+}
diff --git a/board/freescale/mx53loco/Kconfig b/board/freescale/mx53loco/Kconfig
new file mode 100644
index 00000000000..5dcdcd9f725
--- /dev/null
+++ b/board/freescale/mx53loco/Kconfig
@@ -0,0 +1,21 @@
+if TARGET_MX53LOCO
+
+config DIALOG_POWER
+ def_bool y
+
+config SYS_BOARD
+ default "mx53loco"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_SOC
+ default "mx5"
+
+config SYS_CONFIG_NAME
+ default "mx53loco"
+
+config IMX_CONFIG
+ default "board/freescale/mx53loco/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx53loco/MAINTAINERS b/board/freescale/mx53loco/MAINTAINERS
new file mode 100644
index 00000000000..6c237518773
--- /dev/null
+++ b/board/freescale/mx53loco/MAINTAINERS
@@ -0,0 +1,7 @@
+MX53LOCO BOARD
+M: Fabio Estevam <festevam@gmail.com>
+M: Jason Liu <jason.hui.liu@nxp.com>
+S: Maintained
+F: board/freescale/mx53loco/
+F: include/configs/mx53loco.h
+F: configs/mx53loco_defconfig
diff --git a/board/freescale/mx53loco/Makefile b/board/freescale/mx53loco/Makefile
new file mode 100644
index 00000000000..9befe426957
--- /dev/null
+++ b/board/freescale/mx53loco/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# (C) Copyright 2011 Freescale Semiconductor, Inc.
+# Jason Liu <r64343@freescale.com>
+
+obj-y += mx53loco.o
diff --git a/board/freescale/mx53loco/imximage.cfg b/board/freescale/mx53loco/imximage.cfg
new file mode 100644
index 00000000000..d12801d19f2
--- /dev/null
+++ b/board/freescale/mx53loco/imximage.cfg
@@ -0,0 +1,83 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2011 Freescale Semiconductor, Inc.
+ * Jason Liu <r64343@freescale.com>
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+/* image version */
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi, sd (the board has no nand neither onenand)
+ */
+BOOT_FROM sd
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+DATA 4 0x53fa8554 0x00300000
+DATA 4 0x53fa8558 0x00300040
+DATA 4 0x53fa8560 0x00300000
+DATA 4 0x53fa8564 0x00300040
+DATA 4 0x53fa8568 0x00300040
+DATA 4 0x53fa8570 0x00300000
+DATA 4 0x53fa8574 0x00300000
+DATA 4 0x53fa8578 0x00300000
+DATA 4 0x53fa857c 0x00300040
+DATA 4 0x53fa8580 0x00300040
+DATA 4 0x53fa8584 0x00300000
+DATA 4 0x53fa8588 0x00300000
+DATA 4 0x53fa8590 0x00300040
+DATA 4 0x53fa8594 0x00300000
+DATA 4 0x53fa86f0 0x00300000
+DATA 4 0x53fa86f4 0x00000000
+DATA 4 0x53fa86fc 0x00000000
+DATA 4 0x53fa8714 0x00000000
+DATA 4 0x53fa8718 0x00300000
+DATA 4 0x53fa871c 0x00300000
+DATA 4 0x53fa8720 0x00300000
+DATA 4 0x53fa8724 0x04000000
+DATA 4 0x53fa8728 0x00300000
+DATA 4 0x53fa872c 0x00300000
+DATA 4 0x63fd9088 0x35343535
+DATA 4 0x63fd9090 0x4d444c44
+DATA 4 0x63fd907c 0x01370138
+DATA 4 0x63fd9080 0x013b013c
+DATA 4 0x63fd9018 0x00011740
+DATA 4 0x63fd9000 0x83190000
+DATA 4 0x63fd900c 0x9f5152e3
+DATA 4 0x63fd9010 0xb68e8a63
+DATA 4 0x63fd9014 0x01ff00db
+DATA 4 0x63fd902c 0x000026d2
+DATA 4 0x63fd9030 0x009f0e21
+DATA 4 0x63fd9008 0x12273030
+DATA 4 0x63fd9004 0x0002002d
+DATA 4 0x63fd901c 0x00008032
+DATA 4 0x63fd901c 0x00008033
+DATA 4 0x63fd901c 0x00028031
+DATA 4 0x63fd901c 0x052080b0
+DATA 4 0x63fd901c 0x04008040
+DATA 4 0x63fd9000 0xc3190000
+DATA 4 0x63fd901c 0x0000803a
+DATA 4 0x63fd901c 0x0000803b
+DATA 4 0x63fd901c 0x00028039
+DATA 4 0x63fd901c 0x05208138
+DATA 4 0x63fd901c 0x04008048
+DATA 4 0x63fd9020 0x00005800
+DATA 4 0x63fd9040 0x05380003
+DATA 4 0x63fd9058 0x00022227
+DATA 4 0x63fd901c 0x00000000
diff --git a/board/freescale/mx53loco/mx53loco.c b/board/freescale/mx53loco/mx53loco.c
new file mode 100644
index 00000000000..2d8f5da9906
--- /dev/null
+++ b/board/freescale/mx53loco/mx53loco.c
@@ -0,0 +1,246 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2011 Freescale Semiconductor, Inc.
+ * Jason Liu <r64343@freescale.com>
+ */
+
+#include <config.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/iomux-mx53.h>
+#include <asm/arch/clock.h>
+#include <env.h>
+#include <linux/errno.h>
+#include <asm/mach-imx/mx5_video.h>
+#include <i2c.h>
+#include <input.h>
+#include <fsl_esdhc_imx.h>
+#include <asm/gpio.h>
+#include <power/pmic.h>
+#include <dialog_pmic.h>
+#include <fsl_pmic.h>
+#include <linux/fb.h>
+#include <ipu_pixfmt.h>
+#include <dm/uclass.h>
+#include <dm/device.h>
+
+#define MX53LOCO_LCD_POWER IMX_GPIO_NR(3, 24)
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_REVISION_TAG
+u32 get_board_rev(void)
+{
+ struct iim_regs *iim = (struct iim_regs *)IMX_IIM_BASE;
+ struct fuse_bank *bank = &iim->bank[0];
+ struct fuse_bank0_regs *fuse =
+ (struct fuse_bank0_regs *)bank->fuse_regs;
+ struct udevice *bus;
+ struct udevice *dev;
+
+ int rev = readl(&fuse->gp[6]);
+
+ ret = uclass_get_device_by_seq(UCLASS_I2C, 0, &bus);
+ if (ret)
+ return ret;
+
+ if (!dm_i2c_probe(bus, CFG_SYS_DIALOG_PMIC_I2C_ADDR, 0, &dev))
+ rev = 0;
+
+ return (get_cpu_rev() & ~(0xF << 8)) | (rev & 0xF) << 8;
+}
+#endif
+
+#define UART_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_DSE_HIGH | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_ODE)
+
+static void setup_iomux_uart(void)
+{
+ static const iomux_v3_cfg_t uart_pads[] = {
+ NEW_PAD_CTRL(MX53_PAD_CSI0_DAT11__UART1_RXD_MUX, UART_PAD_CTRL),
+ NEW_PAD_CTRL(MX53_PAD_CSI0_DAT10__UART1_TXD_MUX, UART_PAD_CTRL),
+ };
+
+ imx_iomux_v3_setup_multiple_pads(uart_pads, ARRAY_SIZE(uart_pads));
+}
+
+static int power_init(void)
+{
+ unsigned int val;
+ int ret;
+ struct pmic *p;
+ struct udevice *bus;
+ struct udevice *dev;
+
+ ret = uclass_get_device_by_seq(UCLASS_I2C, 0, &bus);
+ if (ret)
+ return ret;
+
+ if (!dm_i2c_probe(bus, CFG_SYS_DIALOG_PMIC_I2C_ADDR, 0, &dev)) {
+ ret = pmic_dialog_init(I2C_PMIC);
+ if (ret)
+ return ret;
+
+ p = pmic_get("DIALOG_PMIC");
+ if (!p)
+ return -ENODEV;
+
+ env_set("fdt_file", "imx53-qsb.dtb");
+
+ /* Set VDDA to 1.25V */
+ val = DA9052_BUCKCORE_BCOREEN | DA_BUCKCORE_VBCORE_1_250V;
+ ret = pmic_reg_write(p, DA9053_BUCKCORE_REG, val);
+ if (ret) {
+ printf("Writing to BUCKCORE_REG failed: %d\n", ret);
+ return ret;
+ }
+
+ pmic_reg_read(p, DA9053_SUPPLY_REG, &val);
+ val |= DA9052_SUPPLY_VBCOREGO;
+ ret = pmic_reg_write(p, DA9053_SUPPLY_REG, val);
+ if (ret) {
+ printf("Writing to SUPPLY_REG failed: %d\n", ret);
+ return ret;
+ }
+
+ /* Set Vcc peripheral to 1.30V */
+ ret = pmic_reg_write(p, DA9053_BUCKPRO_REG, 0x62);
+ if (ret) {
+ printf("Writing to BUCKPRO_REG failed: %d\n", ret);
+ return ret;
+ }
+
+ ret = pmic_reg_write(p, DA9053_SUPPLY_REG, 0x62);
+ if (ret) {
+ printf("Writing to SUPPLY_REG failed: %d\n", ret);
+ return ret;
+ }
+
+ return ret;
+ }
+
+ if (!dm_i2c_probe(bus, CFG_SYS_FSL_PMIC_I2C_ADDR, 0, &dev)) {
+ ret = pmic_init(0);
+ if (ret)
+ return ret;
+
+ p = pmic_get("FSL_PMIC");
+ if (!p)
+ return -ENODEV;
+
+ env_set("fdt_file", "imx53-qsrb.dtb");
+
+ /* Set VDDGP to 1.25V for 1GHz on SW1 */
+ pmic_reg_read(p, REG_SW_0, &val);
+ val = (val & ~SWx_VOLT_MASK_MC34708) | SWx_1_250V_MC34708;
+ ret = pmic_reg_write(p, REG_SW_0, val);
+ if (ret) {
+ printf("Writing to REG_SW_0 failed: %d\n", ret);
+ return ret;
+ }
+
+ /* Set VCC as 1.30V on SW2 */
+ pmic_reg_read(p, REG_SW_1, &val);
+ val = (val & ~SWx_VOLT_MASK_MC34708) | SWx_1_300V_MC34708;
+ ret = pmic_reg_write(p, REG_SW_1, val);
+ if (ret) {
+ printf("Writing to REG_SW_1 failed: %d\n", ret);
+ return ret;
+ }
+
+ /* Set global reset timer to 4s */
+ pmic_reg_read(p, REG_POWER_CTL2, &val);
+ val = (val & ~TIMER_MASK_MC34708) | TIMER_4S_MC34708;
+ ret = pmic_reg_write(p, REG_POWER_CTL2, val);
+ if (ret) {
+ printf("Writing to REG_POWER_CTL2 failed: %d\n", ret);
+ return ret;
+ }
+
+ /* Set VUSBSEL and VUSBEN for USB PHY supply*/
+ pmic_reg_read(p, REG_MODE_0, &val);
+ val |= (VUSBSEL_MC34708 | VUSBEN_MC34708);
+ ret = pmic_reg_write(p, REG_MODE_0, val);
+ if (ret) {
+ printf("Writing to REG_MODE_0 failed: %d\n", ret);
+ return ret;
+ }
+
+ /* Set SWBST to 5V in auto mode */
+ val = SWBST_AUTO;
+ ret = pmic_reg_write(p, SWBST_CTRL, val);
+ if (ret) {
+ printf("Writing to SWBST_CTRL failed: %d\n", ret);
+ return ret;
+ }
+
+ return ret;
+ }
+
+ return -1;
+}
+
+static void clock_1GHz(void)
+{
+ int ret;
+ u32 ref_clk = MXC_HCLK;
+ /*
+ * After increasing voltage to 1.25V, we can switch
+ * CPU clock to 1GHz and DDR to 400MHz safely
+ */
+ ret = mxc_set_clock(ref_clk, 1000, MXC_ARM_CLK);
+ if (ret)
+ printf("CPU: Switch CPU clock to 1GHZ failed\n");
+
+ ret = mxc_set_clock(ref_clk, 400, MXC_PERIPH_CLK);
+ ret |= mxc_set_clock(ref_clk, 400, MXC_DDR_CLK);
+ if (ret)
+ printf("CPU: Switch DDR clock to 400MHz failed\n");
+}
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+ setup_iomux_lcd();
+
+ return 0;
+}
+
+/*
+ * Do not overwrite the console
+ * Use always serial for U-Boot console
+ */
+int overwrite_console(void)
+{
+ return 1;
+}
+
+int board_init(void)
+{
+ gd->bd->bi_boot_params = PHYS_SDRAM_1 + 0x100;
+
+ mxc_set_sata_internal_clock();
+
+ return 0;
+}
+
+int board_late_init(void)
+{
+ if (!power_init())
+ clock_1GHz();
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: MX53 LOCO\n");
+
+ return 0;
+}
diff --git a/board/freescale/mx6memcal/Kconfig b/board/freescale/mx6memcal/Kconfig
new file mode 100644
index 00000000000..2d5c206ae45
--- /dev/null
+++ b/board/freescale/mx6memcal/Kconfig
@@ -0,0 +1,230 @@
+if TARGET_MX6MEMCAL
+
+config SYS_BOARD
+ default "mx6memcal"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6memcal"
+
+menu "mx6memcal specifics"
+choice
+ prompt "Serial console"
+ help
+ Either UART1 or UART2 will be used as the console for
+ displaying the calibration values or errors.
+
+config SERIAL_CONSOLE_UART1
+ bool "UART1"
+ help
+ Select this if your board uses UART1 for its' console.
+
+config SERIAL_CONSOLE_UART2
+ bool "UART2"
+ help
+ Select this if your board uses UART2 for its' console.
+
+endchoice
+
+choice
+ prompt "UART pads"
+ help
+ Select the RX and TX pads used for your serial console.
+ The choices below reflect the most commonly used options
+ for your UART.
+
+ config UART2_EIM_D26_27
+ bool "UART2 on EIM_D26/27 (SabreLite, Nitrogen6x)"
+ depends on SERIAL_CONSOLE_UART2
+ help
+ Choose this configuration if you're using pads
+ EIM_D26 and D27 for a console on UART2.
+ This is typical for designs that are based on the
+ NXP SABRELite.
+
+ config UART1_CSI0_DAT10_11
+ bool "UART1 on CSI0_DAT10/11 (Wand, SabreSD)"
+ depends on SERIAL_CONSOLE_UART1
+ help
+ Choose this configuration if you're using pads
+ CSI0_DAT10 and DAT11 for a console on UART1 as
+ is done on the i.MX6 Wand board and i.MX6 SabreSD.
+
+ config UART1_UART1
+ bool "UART1 on UART1 (i.MX6SL EVK, WaRP)"
+ depends on SERIAL_CONSOLE_UART1
+ help
+ Choose this configuration if you're using pads
+ UART1_TXD/RXD for a console on UART1 as is done
+ on most i.MX6SL designs.
+
+endchoice
+
+config IMXIMAGE_OUTPUT
+ bool "Include output for imximage .cfg files"
+ default y
+ help
+ Say "Y" if you want output formatted for use in non-SPL
+ (DCD-style) configuration files.
+
+config DDRWIDTH
+ int "DDR bus width"
+ default 64
+ help
+ Select either 32 or 64 to reflect the DDR bus width.
+
+config DDRCS
+ int "DDR chip selects"
+ default 2
+ range 1 2
+ help
+ Select the number of chip selects used in your board design
+
+choice
+ prompt "Memory type"
+ help
+ Select the type of DDR (DDR3 or LPDDR2) used on your design
+
+config DDR3
+ bool "DDR3"
+ help
+ Select this if your board design uses DDR3.
+
+config LPDDR2
+ bool "LPDDR2"
+ help
+ Select this if your board design uses LPDDR2.
+
+endchoice
+
+choice
+ prompt "Memory device"
+
+config MT41K512M16TNA
+ bool "Micron MT41K512M16TNA 512Mx16 (1GiB/chip)"
+ depends on DDR3
+
+config MT41K128M16JT
+ bool "Micron MT41K128M16JT 128Mx16 (256 MiB/chip)"
+ depends on DDR3
+
+config H5TQ4G63AFR
+ bool "Hynix H5TQ4G63AFR 256Mx16 (512 MiB/chip)"
+ depends on DDR3
+
+config H5TQ2G63DFR
+ bool "Hynix H5TQ2G63DFR 128Mx16 (256 MiB/chip)"
+ depends on DDR3
+
+config MT42L256M32D2LG
+ bool "Micron MT42L256M32D2LG LPDDR2 256Mx32 (1GiB/chip)"
+ depends on LPDDR2
+
+config MT29PZZZ4D4BKESK
+ bool "Micron MT29PZZZ4D4BKESK multi-chip 512MiB LPDDR2/4GiB eMMC"
+ depends on LPDDR2
+
+endchoice
+
+config DDR_ODT
+ int "DDR On-die-termination"
+ default 2
+ range 0 7
+ help
+ Enter the on-die termination value as an index defined for
+ IOMUX settings for PAD_DRAM_SDCLK0_P and others.
+ 0 == Disabled
+ 1 == 120 Ohm
+ 2 == 60 Ohm
+ 3 == 40 Ohm
+ 4 == 30 Ohm
+ 5 == 24 Ohm
+ 6 == 20 Ohm
+ 7 == 17 Ohm
+ Value will be applied to all clock and data lines
+
+
+config DRAM_DRIVE_STRENGTH
+ int "DRAM Drive strength"
+ default 6
+ range 0 7
+ help
+ Enter drive strength as an index defined for IOMUX settings
+ for GRP_B1DS and others.
+ 0 == Hi Z
+ 6 == 40 Ohm (default)
+ 7 == 34 Ohm
+ Value will be applied to all clock and data lines
+
+config RTT_NOM
+ int "RTT_NOM"
+ default 1
+ range 1 2
+ help
+ Enter the RTT_NOM selector
+ 1 == RZQ/4 (60ohm)
+ 2 == RZQ/2 (120ohm)
+
+config RTT_WR
+ int "RTT_WR"
+ default 1
+ range 0 2
+ help
+ Enter the RTT_WR selector for MR2
+ 0 == Dynamic ODT disabled
+ 1 == RZQ/4 (60ohm)
+ 2 == RZQ/2 (120ohm)
+
+config RALAT
+ int "Read additional latency"
+ default 5
+ range 0 7
+ help
+ Enter a latency in number of cycles. This will be added to
+ CAS and internal delays for which the MMDC will retrieve the
+ read data from the internal FIFO.
+ This is used to compensate for board/chip delays.
+
+config WALAT
+ int "Write additional latency"
+ default 0
+ range 0 7
+ help
+ Enter a latency in number of cycles. This will be added to
+ CAS and internal delays for which the MMDC will retrieve the
+ read data from the internal FIFO
+ This is used to compensate for board/chip delays.
+
+config REFSEL
+ int "Refresh period"
+ range 0 3
+ default 1
+ help
+ Select the DDR refresh period.
+ See the description of bitfield REF_SEL in the reference manual
+ for details.
+ 0 == disabled
+ 1 == 32 kHz
+ 2 == 64 kHz
+ 3 == fast counter
+
+config REFR
+ int "Number of refreshes"
+ range 0 7
+ default 7
+ help
+ This selects the number of refreshes (-1) during each period.
+ i.e.:
+ 0 == 1 refresh (tRFC)
+ 7 == 8 refreshes (tRFC*8)
+ See the description of MDREF[REFR] in the reference manual for
+ details.
+
+endmenu
+
+config IMX_CONFIG
+ default "arch/arm/mach-imx/spl_sd.cfg"
+
+endif
diff --git a/board/freescale/mx6memcal/MAINTAINERS b/board/freescale/mx6memcal/MAINTAINERS
new file mode 100644
index 00000000000..5da38f7109b
--- /dev/null
+++ b/board/freescale/mx6memcal/MAINTAINERS
@@ -0,0 +1,7 @@
+MX6MEMCAL BOARD
+M: Eric Nelson <eric@nelint.com>
+S: Maintained
+F: board/freescale/mx6memcal/
+F: include/configs/mx6memcal.h
+F: configs/mx6memcal_defconfig
+
diff --git a/board/freescale/mx6memcal/Makefile b/board/freescale/mx6memcal/Makefile
new file mode 100644
index 00000000000..fc2d3eb9e10
--- /dev/null
+++ b/board/freescale/mx6memcal/Makefile
@@ -0,0 +1,11 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2007, Guennadi Liakhovetski <lg@denx.de>
+#
+# (C) Copyright 2011 Freescale Semiconductor, Inc.
+
+ifdef CONFIG_SPL_BUILD
+obj-y := spl.o
+else
+obj-y := mx6memcal.o
+endif
diff --git a/board/freescale/mx6memcal/README b/board/freescale/mx6memcal/README
new file mode 100644
index 00000000000..9fe2fe2d043
--- /dev/null
+++ b/board/freescale/mx6memcal/README
@@ -0,0 +1,49 @@
+mx6memcal - a tool for calibrating DDR on i.MX6 boards.
+
+The mx6memcal board isn't a real board, but a tool for use in bring-up of
+new i.MX6 board designs.
+
+It provides a similar function to the tool from NXP([1]) with a number
+of advantages:
+
+1. It's open-source, so it's easier to change if needed.
+ Typical reasons for needing to change include the use of alternate
+ UARTs and PMIC initialization.
+2. It produces an image that's directly loadable with imx_usb [2] or
+ SB_LOADER.exe [3].
+ The NXP tool requires either a cumbersome JTAG connection that
+ makes running the DDR very slow or a working U-Boot image that
+ suffers from a chicken-and-egg problem (i.e. where do you get the
+ DDR parameters for U-Boot?).
+3. It doesn't prompt for parameters, so it's much faster to gather
+ data from multiple boards.
+4. Parameters to the calibration process can be chosen through
+ 'make menuconfig'.
+
+When booted, the mx6memcal board will run the DDR calibration
+routines and display the result in a form suitable for cut and
+paste into struct mx6_mmdc_calibration. It can also optionally
+produce output in a form usable in a DCD-style .cfg file.
+
+Selections in Kconfig allow most system design settings to be chosen:
+
+1. The UART number and pad configuration for the UART. Options
+ include support for the most frequent reference designs on
+ i.MX6DQ/SDL (SABRE Lite and SABRESD designs).
+2. The memory bus width (64 and 32-bit)
+3. The number of chip-selects in use
+4. The type of DDR (DDR3 or LPDDR2). Note that LPDDR2 support
+ is incomplete as of this writing.
+5. The type of DDR chips in use. This selection allows re-use of common
+ parts and four DDR3 and two LPDDR2 parts are currently defined
+6. The On-die termination value for the DRAM lines
+7. The DRAM drive strength
+8. The RTT_NOM and RTT_WR termination settings
+9. RALAT/WALAT latency values
+
+References:
+[1] - NXP DDR Stress Test Tool - https://community.nxp.com/docs/DOC-105652
+[2] - Boundary Devices imx_usb_loader
+ https://github.com/boundarydevices/imx_usb_loader
+[3] - Use of SB_Loader.exe
+ https://boundarydevices.com/windows-users-and-unbricking
diff --git a/board/freescale/mx6memcal/mx6memcal.c b/board/freescale/mx6memcal/mx6memcal.c
new file mode 100644
index 00000000000..17095c34e92
--- /dev/null
+++ b/board/freescale/mx6memcal/mx6memcal.c
@@ -0,0 +1,31 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * mx6memcal board support - provides a minimal, UART-only
+ * U-Boot that's capable of running a memory test.
+ *
+ * Copyright (C) 2016 Nelson Integration, LLC
+ * Author: Eric Nelson <eric@nelint.com>
+ */
+
+#include <init.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int board_init(void)
+{
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: mx6memcal\n");
+ return 0;
+}
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+ return 0;
+}
diff --git a/board/freescale/mx6memcal/spl.c b/board/freescale/mx6memcal/spl.c
new file mode 100644
index 00000000000..bc9c4259f07
--- /dev/null
+++ b/board/freescale/mx6memcal/spl.c
@@ -0,0 +1,457 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2016 Nelson Integration, LLC
+ * Author: Eric Nelson <eric@nelint.com>
+ */
+
+#include <cpu_func.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/mx6-ddr.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <spl.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
+ PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+static iomux_v3_cfg_t const uart_pads[] = {
+#ifdef CONFIG_UART2_EIM_D26_27
+ IOMUX_PADS(PAD_EIM_D26__UART2_TX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D27__UART2_RX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+#elif defined(CONFIG_UART1_CSI0_DAT10_11)
+ IOMUX_PADS(PAD_CSI0_DAT10__UART1_TX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+ IOMUX_PADS(PAD_CSI0_DAT11__UART1_RX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+#elif defined(CONFIG_UART1_SD3_DAT6_7)
+ IOMUX_PADS(PAD_SD3_DAT6__UART1_RX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT7__UART1_TX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+#elif defined(CONFIG_UART1_UART1)
+ MX6_PAD_UART1_TXD__UART1_TXD | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX6_PAD_UART1_RXD__UART1_RXD | MUX_PAD_CTRL(UART_PAD_CTRL),
+#else
+#error select UART console pads
+#endif
+};
+
+#ifdef CONFIG_DDR3
+#define GRP_DDRTYPE 0x000C0000
+#else
+#define GRP_DDRTYPE 0x00080000
+#endif
+
+/* all existing designs have this disabled */
+#define DDR_PKE 0
+
+/* use Kconfig for ODT and DRIVE_STRENGTH */
+#define DDR_ODT \
+ (CONFIG_DDR_ODT << 8)
+#define DRAM_DRIVE_STRENGTH \
+ (CONFIG_DRAM_DRIVE_STRENGTH << 3)
+
+/* configure MX6Q/DUAL mmdc DDR io registers */
+static struct mx6dq_iomux_ddr_regs const mx6dq_ddr_ioregs = {
+ /* SDCLK[0:1], CAS, RAS, Reset: Differential input, 40ohm */
+ .dram_sdclk_0 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_sdclk_1 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_cas = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_ras = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_reset = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ /* SDCKE[0:1]: 100k pull-up */
+ .dram_sdcke0 = 0x00003000,
+ .dram_sdcke1 = 0x00003000,
+ /* SDBA2: pull-up disabled */
+ .dram_sdba2 = 0x00000000,
+ /* SDODT[0:1]: 100k pull-up, 40 ohm */
+ .dram_sdodt0 = 0x00003000 + DRAM_DRIVE_STRENGTH,
+ .dram_sdodt1 = 0x00003000 + DRAM_DRIVE_STRENGTH,
+ /* SDQS[0:7]: Differential input, 40 ohm */
+ .dram_sdqs0 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs1 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs2 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs3 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs4 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs5 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs6 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs7 = DRAM_DRIVE_STRENGTH,
+
+ /* DQM[0:7]: Differential input, 40 ohm */
+ .dram_dqm0 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm1 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm2 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm3 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm4 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm5 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm6 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm7 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+};
+
+/* configure MX6Q/DUAL mmdc GRP io registers */
+static struct mx6dq_iomux_grp_regs const mx6dq_grp_ioregs = {
+ /* DDR3 */
+ .grp_ddr_type = GRP_DDRTYPE,
+ .grp_ddrmode_ctl = DDR_ODT,
+ /* disable DDR pullups */
+ .grp_ddrpke = DDR_PKE,
+ /* ADDR[00:16], SDBA[0:1]: 40 ohm */
+ .grp_addds = DRAM_DRIVE_STRENGTH,
+ /* CS0/CS1/SDBA2/CKE0/CKE1/SDWE: 40 ohm */
+ .grp_ctlds = DRAM_DRIVE_STRENGTH,
+ /* DATA[00:63]: Differential input, 40 ohm */
+ .grp_ddrmode = DDR_ODT,
+ .grp_b0ds = DRAM_DRIVE_STRENGTH,
+ .grp_b1ds = DRAM_DRIVE_STRENGTH,
+ .grp_b2ds = DRAM_DRIVE_STRENGTH,
+ .grp_b3ds = DRAM_DRIVE_STRENGTH,
+ .grp_b4ds = DRAM_DRIVE_STRENGTH,
+ .grp_b5ds = DRAM_DRIVE_STRENGTH,
+ .grp_b6ds = DRAM_DRIVE_STRENGTH,
+ .grp_b7ds = DRAM_DRIVE_STRENGTH,
+};
+
+static struct mx6sdl_iomux_ddr_regs const mx6sdl_ddr_ioregs = {
+ /* SDCLK[0:1], CAS, RAS, Reset: Differential input, 40ohm */
+ .dram_sdclk_0 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_sdclk_1 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_cas = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_ras = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_reset = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ /* SDCKE[0:1]: 100k pull-up */
+ .dram_sdcke0 = 0x00003000,
+ .dram_sdcke1 = 0x00003000,
+ /* SDBA2: pull-up disabled */
+ .dram_sdba2 = 0x00000000,
+ /* SDODT[0:1]: 100k pull-up, 40 ohm */
+ .dram_sdodt0 = 0x00003000 + DRAM_DRIVE_STRENGTH,
+ .dram_sdodt1 = 0x00003000 + DRAM_DRIVE_STRENGTH,
+ /* SDQS[0:7]: Differential input, 40 ohm */
+ .dram_sdqs0 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs1 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs2 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs3 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs4 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs5 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs6 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs7 = DRAM_DRIVE_STRENGTH,
+
+ /* DQM[0:7]: Differential input, 40 ohm */
+ .dram_dqm0 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm1 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm2 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm3 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm4 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm5 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm6 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+ .dram_dqm7 = DDR_ODT + DRAM_DRIVE_STRENGTH,
+};
+
+/* configure MX6SOLO/DUALLITE mmdc GRP io registers */
+static struct mx6sdl_iomux_grp_regs const mx6sdl_grp_ioregs = {
+ /* DDR3 */
+ .grp_ddr_type = GRP_DDRTYPE,
+ /* SDQS[0:7]: Differential input, 40 ohm */
+ .grp_ddrmode_ctl = DDR_ODT,
+ /* disable DDR pullups */
+ .grp_ddrpke = DDR_PKE,
+ /* ADDR[00:16], SDBA[0:1]: 40 ohm */
+ .grp_addds = DRAM_DRIVE_STRENGTH,
+ /* CS0/CS1/SDBA2/CKE0/CKE1/SDWE: 40 ohm */
+ .grp_ctlds = DRAM_DRIVE_STRENGTH,
+ /* DATA[00:63]: Differential input, 40 ohm */
+ .grp_ddrmode = DDR_ODT,
+ .grp_b0ds = DRAM_DRIVE_STRENGTH,
+ .grp_b1ds = DRAM_DRIVE_STRENGTH,
+ .grp_b2ds = DRAM_DRIVE_STRENGTH,
+ .grp_b3ds = DRAM_DRIVE_STRENGTH,
+ .grp_b4ds = DRAM_DRIVE_STRENGTH,
+ .grp_b5ds = DRAM_DRIVE_STRENGTH,
+ .grp_b6ds = DRAM_DRIVE_STRENGTH,
+ .grp_b7ds = DRAM_DRIVE_STRENGTH,
+};
+
+const struct mx6sl_iomux_ddr_regs mx6sl_ddr_ioregs = {
+ .dram_sdqs0 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs1 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs2 = DRAM_DRIVE_STRENGTH,
+ .dram_sdqs3 = DRAM_DRIVE_STRENGTH,
+ .dram_dqm0 = DRAM_DRIVE_STRENGTH,
+ .dram_dqm1 = DRAM_DRIVE_STRENGTH,
+ .dram_dqm2 = DRAM_DRIVE_STRENGTH,
+ .dram_dqm3 = DRAM_DRIVE_STRENGTH,
+ .dram_cas = DRAM_DRIVE_STRENGTH,
+ .dram_ras = DRAM_DRIVE_STRENGTH,
+ .dram_sdclk_0 = DRAM_DRIVE_STRENGTH,
+ .dram_reset = DRAM_DRIVE_STRENGTH,
+ .dram_sdba2 = 0x00020000,
+ .dram_odt0 = 0x00030000 + DRAM_DRIVE_STRENGTH,
+ .dram_odt1 = 0x00030000 + DRAM_DRIVE_STRENGTH,
+};
+
+const struct mx6sl_iomux_grp_regs mx6sl_grp_ioregs = {
+ .grp_b0ds = DRAM_DRIVE_STRENGTH,
+ .grp_b1ds = DRAM_DRIVE_STRENGTH,
+ .grp_b2ds = DRAM_DRIVE_STRENGTH,
+ .grp_b3ds = DRAM_DRIVE_STRENGTH,
+ .grp_addds = DRAM_DRIVE_STRENGTH,
+ .grp_ctlds = DRAM_DRIVE_STRENGTH,
+ .grp_ddrmode_ctl = DDR_ODT,
+ .grp_ddrpke = DDR_PKE,
+ .grp_ddrmode = DDR_ODT,
+ .grp_ddr_type = GRP_DDRTYPE,
+};
+
+static struct mx6_ddr_sysinfo const sysinfo = {
+ /* width of data bus:0=16,1=32,2=64 */
+#if CONFIG_DDRWIDTH == 32
+ .dsize = 1,
+#elif CONFIG_DDRWIDTH == 64
+ .dsize = 2,
+#else
+#error missing CONFIG_DDRWIDTH
+#endif
+ /* config for full 4GB range so that get_mem_size() works */
+ .cs_density = 32, /* 32Gb per CS */
+
+ /* # of chip selects */
+ .ncs = CONFIG_DDRCS,
+ .cs1_mirror = 0,
+ .bi_on = 1, /* Bank interleaving enabled */
+ .rtt_nom = CONFIG_RTT_NOM,
+ .rtt_wr = CONFIG_RTT_WR,
+ .ralat = CONFIG_RALAT, /* Read additional latency */
+ .walat = CONFIG_WALAT, /* Write additional latency */
+ .mif3_mode = 3, /* Command prediction working mode */
+#ifdef CONFIG_DDR3
+ .rst_to_cke = 0x23, /* 33 cycles, 500us (JEDEC default) */
+ .sde_to_rst = 0x10, /* JEDEC value for LPDDR2 - 200us */
+ .pd_fast_exit = 0, /* immaterial for calibration */
+ .ddr_type = DDR_TYPE_DDR3,
+#else
+ .rst_to_cke = 0x10, /* JEDEC value for LPDDR2: 200us */
+ .sde_to_rst = 0, /* LPDDR2 does not need this field */
+ .pd_fast_exit = 0, /* immaterial for calibration */
+ .ddr_type = DDR_TYPE_LPDDR2,
+#endif
+ .refsel = CONFIG_REFSEL,
+ .refr = CONFIG_REFR,
+};
+
+#ifdef CONFIG_MT41K512M16TNA
+/* Micron MT41K512M16TNA-125 */
+static struct mx6_ddr3_cfg const ddrtype = {
+ .mem_speed = 1600,
+ .density = 8,
+ .width = 16,
+ .banks = 8,
+ .rowaddr = 15,
+ .coladdr = 10,
+ .pagesz = 1,
+ .trcd = 1375,
+ .trcmin = 5062,
+ .trasmin = 3750,
+};
+#elif defined(CONFIG_MT41K128M16JT)
+/* Micron MT41K128M16JT-125 */
+static struct mx6_ddr3_cfg const ddrtype = {
+ .mem_speed = 1600,
+ .density = 2,
+ .width = 16,
+ .banks = 8,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .pagesz = 2,
+ .trcd = 1375,
+ .trcmin = 4875,
+ .trasmin = 3500,
+};
+#elif defined(CONFIG_H5TQ4G63AFR)
+/* Hynix H5TQ4G63AFR */
+static struct mx6_ddr3_cfg const ddrtype = {
+ .mem_speed = 1600,
+ .density = 4,
+ .width = 16,
+ .banks = 8,
+ .rowaddr = 15,
+ .coladdr = 10,
+ .pagesz = 2,
+ .trcd = 1375,
+ .trcmin = 4875,
+ .trasmin = 3500,
+};
+#elif defined CONFIG_H5TQ2G63DFR
+/* Hynix H5TQ2G63DFR */
+static struct mx6_ddr3_cfg const ddrtype = {
+ .mem_speed = 1333,
+ .density = 2,
+ .width = 16,
+ .banks = 8,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .pagesz = 2,
+ .trcd = 1350,
+ .trcmin = 4950,
+ .trasmin = 3600,
+};
+#elif defined(CONFIG_MT42L256M32D2LG)
+/* Micron MT42L256M32D2LG */
+static struct mx6_lpddr2_cfg ddrtype = {
+ .mem_speed = 800,
+ .density = 4,
+ .width = 32,
+ .banks = 8,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .trcd_lp = 2000,
+ .trppb_lp = 2000,
+ .trpab_lp = 2250,
+ .trasmin = 4200,
+};
+#elif defined(CONFIG_MT29PZZZ4D4BKESK)
+/* Micron MT29PZZZ4D4BKESK */
+static struct mx6_lpddr2_cfg ddrtype = {
+ .mem_speed = 800,
+ .density = 4,
+ .width = 32,
+ .banks = 8,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .trcd_lp = 2000,
+ .trppb_lp = 2000,
+ .trpab_lp = 2250,
+ .trasmin = 4200,
+};
+#else
+#error please select DDR type using menuconfig
+#endif
+
+static void ccgr_init(void)
+{
+ struct mxc_ccm_reg *ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ /* FIXME: these should probably be checked, especially
+ * for i.MX6SL, UL, ULL
+ */
+ writel(0x00C03F3F, &ccm->CCGR0);
+ writel(0x0030FC03, &ccm->CCGR1);
+ writel(0x0FFFC000, &ccm->CCGR2);
+ writel(0x3FF00000, &ccm->CCGR3);
+ writel(0x00FFF300, &ccm->CCGR4);
+ writel(0x0F0000C3, &ccm->CCGR5);
+ writel(0x000003FF, &ccm->CCGR6);
+}
+
+static void display_calibration(struct mx6_mmdc_calibration *calib)
+{
+ printf(".p0_mpdgctrl0\t= 0x%08X\n", calib->p0_mpdgctrl0);
+ printf(".p0_mpdgctrl1\t= 0x%08X\n", calib->p0_mpdgctrl1);
+ printf(".p0_mprddlctl\t= 0x%08X\n", calib->p0_mprddlctl);
+ printf(".p0_mpwrdlctl\t= 0x%08X\n", calib->p0_mpwrdlctl);
+ printf(".p0_mpwldectrl0\t= 0x%08X\n", calib->p0_mpwldectrl0);
+ printf(".p0_mpwldectrl1\t= 0x%08X\n", calib->p0_mpwldectrl1);
+ if (sysinfo.dsize == 2) {
+ printf(".p1_mpdgctrl0\t= 0x%08X\n", calib->p1_mpdgctrl0);
+ printf(".p1_mpdgctrl1\t= 0x%08X\n", calib->p1_mpdgctrl1);
+ printf(".p1_mprddlctl\t= 0x%08X\n", calib->p1_mprddlctl);
+ printf(".p1_mpwrdlctl\t= 0x%08X\n", calib->p1_mpwrdlctl);
+ printf(".p1_mpwldectrl0\t= 0x%08X\n", calib->p1_mpwldectrl0);
+ printf(".p1_mpwldectrl1\t= 0x%08X\n", calib->p1_mpwldectrl1);
+ }
+#ifdef CONFIG_IMXIMAGE_OUTPUT
+ printf("DATA 4 MX6_MMDC_P0_MPDGCTRL0\t= 0x%08X\n", calib->p0_mpdgctrl0);
+ printf("DATA 4 MX6_MMDC_P0_MPDGCTRL1\t= 0x%08X\n", calib->p0_mpdgctrl1);
+ printf("DATA 4 MX6_MMDC_P0_MPRDDLCTL\t= 0x%08X\n", calib->p0_mprddlctl);
+ printf("DATA 4 MX6_MMDC_P0_MPWRDLCTL\t= 0x%08X\n", calib->p0_mpwrdlctl);
+ printf("DATA 4 MX6_MMDC_P0_MPWLDECTRL0\t= 0x%08X\n",
+ calib->p0_mpwldectrl0);
+ printf("DATA 4 MX6_MMDC_P0_MPWLDECTRL1\t= 0x%08X\n",
+ calib->p0_mpwldectrl1);
+ if (sysinfo.dsize == 2) {
+ printf("DATA 4 MX6_MMDC_P1_MPDGCTRL0\t= 0x%08X\n",
+ calib->p1_mpdgctrl0);
+ printf("DATA 4 MX6_MMDC_P1_MPDGCTRL1\t= 0x%08X\n",
+ calib->p1_mpdgctrl1);
+ printf("DATA 4 MX6_MMDC_P1_MPRDDLCTL\t= 0x%08X\n",
+ calib->p1_mprddlctl);
+ printf("DATA 4 MX6_MMDC_P1_MPWRDLCTL\t= 0x%08X\n",
+ calib->p1_mpwrdlctl);
+ printf("DATA 4 MX6_MMDC_P1_MPWLDECTRL0\t= 0x%08X\n",
+ calib->p1_mpwldectrl0);
+ printf("DATA 4 MX6_MMDC_P1_MPWLDECTRL1\t= 0x%08X\n",
+ calib->p1_mpwldectrl1);
+ }
+#endif
+}
+
+/*
+ * called from C runtime startup code (arch/arm/lib/crt0.S:_main)
+ * - we have a stack and a place to store GD, both in SRAM
+ * - no variable global data is available
+ */
+void board_init_f(ulong dummy)
+{
+ int errs;
+ struct mx6_mmdc_calibration calibration = {0};
+
+ memset((void *)gd, 0, sizeof(struct global_data));
+
+ /* write leveling calibration defaults */
+ calibration.p0_mpwrdlctl = 0x40404040;
+ calibration.p1_mpwrdlctl = 0x40404040;
+
+ /* setup AIPS and disable watchdog */
+ arch_cpu_init();
+
+ ccgr_init();
+
+ SETUP_IOMUX_PADS(uart_pads);
+
+ /* setup GP timer */
+ timer_init();
+
+ /* UART clocks enabled and gd valid - init serial console */
+ preloader_console_init();
+
+ if (sysinfo.dsize != 1) {
+ if (is_cpu_type(MXC_CPU_MX6SX) ||
+ is_cpu_type(MXC_CPU_MX6UL) ||
+ is_cpu_type(MXC_CPU_MX6ULL) ||
+ is_cpu_type(MXC_CPU_MX6SL)) {
+ printf("cpu type 0x%x doesn't support 64-bit bus\n",
+ get_cpu_type());
+ reset_cpu();
+ }
+ }
+#ifdef CONFIG_MX6SL
+ mx6sl_dram_iocfg(CONFIG_DDRWIDTH, &mx6sl_ddr_ioregs,
+ &mx6sl_grp_ioregs);
+#else
+ if (is_cpu_type(MXC_CPU_MX6Q)) {
+ mx6dq_dram_iocfg(CONFIG_DDRWIDTH, &mx6dq_ddr_ioregs,
+ &mx6dq_grp_ioregs);
+ } else {
+ mx6sdl_dram_iocfg(CONFIG_DDRWIDTH, &mx6sdl_ddr_ioregs,
+ &mx6sdl_grp_ioregs);
+ }
+#endif
+ mx6_dram_cfg(&sysinfo, &calibration, &ddrtype);
+
+ errs = mmdc_do_write_level_calibration(&sysinfo);
+ if (errs) {
+ printf("error %d from write level calibration\n", errs);
+ } else {
+ errs = mmdc_do_dqs_calibration(&sysinfo);
+ if (errs) {
+ printf("error %d from dqs calibration\n", errs);
+ } else {
+ printf("completed successfully\n");
+ mmdc_read_calibration(&sysinfo, &calibration);
+ display_calibration(&calibration);
+ }
+ }
+}
diff --git a/board/freescale/mx6sabreauto/Kconfig b/board/freescale/mx6sabreauto/Kconfig
new file mode 100644
index 00000000000..5b4faf6d5fd
--- /dev/null
+++ b/board/freescale/mx6sabreauto/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_MX6SABREAUTO
+
+config SYS_BOARD
+ default "mx6sabreauto"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6sabreauto"
+
+endif
diff --git a/board/freescale/mx6sabreauto/MAINTAINERS b/board/freescale/mx6sabreauto/MAINTAINERS
new file mode 100644
index 00000000000..6179d672c39
--- /dev/null
+++ b/board/freescale/mx6sabreauto/MAINTAINERS
@@ -0,0 +1,7 @@
+MX6SABREAUTO BOARD
+M: Fabio Estevam <festevam@gmail.com>
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6sabreauto/
+F: include/configs/mx6sabreauto.h
+F: configs/mx6sabreauto_defconfig
diff --git a/board/freescale/mx6sabreauto/Makefile b/board/freescale/mx6sabreauto/Makefile
new file mode 100644
index 00000000000..7ecdb6b4ad2
--- /dev/null
+++ b/board/freescale/mx6sabreauto/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2007, Guennadi Liakhovetski <lg@denx.de>
+#
+# (C) Copyright 2011 Freescale Semiconductor, Inc.
+
+obj-y := mx6sabreauto.o
diff --git a/board/freescale/mx6sabreauto/mx6sabreauto.c b/board/freescale/mx6sabreauto/mx6sabreauto.c
new file mode 100644
index 00000000000..e782543c0fa
--- /dev/null
+++ b/board/freescale/mx6sabreauto/mx6sabreauto.c
@@ -0,0 +1,934 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2012 Freescale Semiconductor, Inc.
+ *
+ * Author: Fabio Estevam <fabio.estevam@freescale.com>
+ */
+
+#include <image.h>
+#include <init.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/sections.h>
+#include <env.h>
+#include <linux/errno.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/mach-imx/spi.h>
+#include <mmc.h>
+#include <fsl_esdhc_imx.h>
+#include <miiphy.h>
+#include <asm/arch/sys_proto.h>
+#include <input.h>
+#include <asm/arch/mxc_hdmi.h>
+#include <asm/mach-imx/video.h>
+#include <asm/arch/crm_regs.h>
+#include <pca953x.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
+ PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define USDHC_PAD_CTRL (PAD_CTL_PUS_47K_UP | \
+ PAD_CTL_SPEED_LOW | PAD_CTL_DSE_80ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define ENET_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
+ PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | PAD_CTL_HYS)
+
+#define GPMI_PAD_CTRL0 (PAD_CTL_PKE | PAD_CTL_PUE | PAD_CTL_PUS_100K_UP)
+#define GPMI_PAD_CTRL1 (PAD_CTL_DSE_40ohm | PAD_CTL_SPEED_MED | \
+ PAD_CTL_SRE_FAST)
+#define GPMI_PAD_CTRL2 (GPMI_PAD_CTRL0 | GPMI_PAD_CTRL1)
+
+#define WEIM_NOR_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_SRE_FAST)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const uart4_pads[] = {
+ IOMUX_PADS(PAD_KEY_COL0__UART4_TX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+ IOMUX_PADS(PAD_KEY_ROW0__UART4_RX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+};
+
+static iomux_v3_cfg_t const port_exp[] = {
+ IOMUX_PADS(PAD_SD2_DAT0__GPIO1_IO15 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+#ifdef CONFIG_MTD_NOR_FLASH
+static iomux_v3_cfg_t const eimnor_pads[] = {
+ IOMUX_PADS(PAD_EIM_D16__EIM_DATA16 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D17__EIM_DATA17 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D18__EIM_DATA18 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D19__EIM_DATA19 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D20__EIM_DATA20 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D21__EIM_DATA21 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D22__EIM_DATA22 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D23__EIM_DATA23 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D24__EIM_DATA24 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D25__EIM_DATA25 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D26__EIM_DATA26 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D27__EIM_DATA27 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D28__EIM_DATA28 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D29__EIM_DATA29 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D30__EIM_DATA30 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_D31__EIM_DATA31 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA0__EIM_AD00 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA1__EIM_AD01 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA2__EIM_AD02 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA3__EIM_AD03 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA4__EIM_AD04 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA5__EIM_AD05 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA6__EIM_AD06 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA7__EIM_AD07 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA8__EIM_AD08 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA9__EIM_AD09 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA10__EIM_AD10 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA11__EIM_AD11 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA12__EIM_AD12 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA13__EIM_AD13 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA14__EIM_AD14 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_DA15__EIM_AD15 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A16__EIM_ADDR16 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A17__EIM_ADDR17 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A18__EIM_ADDR18 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A19__EIM_ADDR19 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A20__EIM_ADDR20 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A21__EIM_ADDR21 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A22__EIM_ADDR22 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_A23__EIM_ADDR23 | MUX_PAD_CTRL(WEIM_NOR_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_OE__EIM_OE_B | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_RW__EIM_RW | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_EIM_CS0__EIM_CS0_B | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+static void eimnor_cs_setup(void)
+{
+ struct weim *weim_regs = (struct weim *)WEIM_BASE_ADDR;
+
+ writel(0x00020181, &weim_regs->cs0gcr1);
+ writel(0x00000001, &weim_regs->cs0gcr2);
+ writel(0x0a020000, &weim_regs->cs0rcr1);
+ writel(0x0000c000, &weim_regs->cs0rcr2);
+ writel(0x0804a240, &weim_regs->cs0wcr1);
+ writel(0x00000120, &weim_regs->wcr);
+
+ set_chipselect_size(CS0_128);
+}
+
+static void eim_clk_setup(void)
+{
+ struct mxc_ccm_reg *imx_ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+ int cscmr1, ccgr6;
+
+
+ /* Turn off EIM clock */
+ ccgr6 = readl(&imx_ccm->CCGR6);
+ ccgr6 &= ~(0x3 << 10);
+ writel(ccgr6, &imx_ccm->CCGR6);
+
+ /*
+ * Configure clk_eim_slow_sel = 00 --> derive clock from AXI clk root
+ * and aclk_eim_slow_podf = 01 --> divide by 2
+ * so that we can have EIM at the maximum clock of 132MHz
+ */
+ cscmr1 = readl(&imx_ccm->cscmr1);
+ cscmr1 &= ~(MXC_CCM_CSCMR1_ACLK_EMI_SLOW_MASK |
+ MXC_CCM_CSCMR1_ACLK_EMI_SLOW_PODF_MASK);
+ cscmr1 |= (1 << MXC_CCM_CSCMR1_ACLK_EMI_SLOW_PODF_OFFSET);
+ writel(cscmr1, &imx_ccm->cscmr1);
+
+ /* Turn on EIM clock */
+ ccgr6 |= (0x3 << 10);
+ writel(ccgr6, &imx_ccm->CCGR6);
+}
+
+static void setup_iomux_eimnor(void)
+{
+ SETUP_IOMUX_PADS(eimnor_pads);
+
+ gpio_direction_output(IMX_GPIO_NR(5, 4), 0);
+
+ eimnor_cs_setup();
+}
+#endif
+
+
+static iomux_v3_cfg_t const usdhc3_pads[] = {
+ IOMUX_PADS(PAD_SD3_CLK__SD3_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_CMD__SD3_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT0__SD3_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT1__SD3_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT2__SD3_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT3__SD3_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT4__SD3_DATA4 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT5__SD3_DATA5 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT6__SD3_DATA6 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT7__SD3_DATA7 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_GPIO_18__SD3_VSELECT | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_CS2__GPIO6_IO15 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+static void setup_iomux_uart(void)
+{
+ SETUP_IOMUX_PADS(uart4_pads);
+}
+
+#ifdef CONFIG_FSL_ESDHC_IMX
+static struct fsl_esdhc_cfg usdhc_cfg[1] = {
+ {USDHC3_BASE_ADDR},
+};
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ gpio_direction_input(IMX_GPIO_NR(6, 15));
+ return !gpio_get_value(IMX_GPIO_NR(6, 15));
+}
+
+int board_mmc_init(struct bd_info *bis)
+{
+ SETUP_IOMUX_PADS(usdhc3_pads);
+
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC3_CLK);
+ return fsl_esdhc_initialize(bis, &usdhc_cfg[0]);
+}
+#endif
+
+#ifdef CONFIG_NAND_MXS
+static iomux_v3_cfg_t gpmi_pads[] = {
+ IOMUX_PADS(PAD_NANDF_CLE__NAND_CLE | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_ALE__NAND_ALE | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_WP_B__NAND_WP_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_RB0__NAND_READY_B | MUX_PAD_CTRL(GPMI_PAD_CTRL0)),
+ IOMUX_PADS(PAD_NANDF_CS0__NAND_CE0_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_SD4_CMD__NAND_RE_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_SD4_CLK__NAND_WE_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D0__NAND_DATA00 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D1__NAND_DATA01 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D2__NAND_DATA02 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D3__NAND_DATA03 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D4__NAND_DATA04 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D5__NAND_DATA05 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D6__NAND_DATA06 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_NANDF_D7__NAND_DATA07 | MUX_PAD_CTRL(GPMI_PAD_CTRL2)),
+ IOMUX_PADS(PAD_SD4_DAT0__NAND_DQS | MUX_PAD_CTRL(GPMI_PAD_CTRL1)),
+};
+
+static void setup_gpmi_nand(void)
+{
+ struct mxc_ccm_reg *mxc_ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ /* config gpmi nand iomux */
+ SETUP_IOMUX_PADS(gpmi_pads);
+
+ setup_gpmi_io_clk((MXC_CCM_CS2CDR_ENFC_CLK_PODF(0) |
+ MXC_CCM_CS2CDR_ENFC_CLK_PRED(3) |
+ MXC_CCM_CS2CDR_ENFC_CLK_SEL(3)));
+
+ /* enable apbh clock gating */
+ setbits_le32(&mxc_ccm->CCGR0, MXC_CCM_CCGR0_APBHDMA_MASK);
+}
+#endif
+
+#ifdef CONFIG_REVISION_TAG
+u32 get_board_rev(void)
+{
+ int rev = nxp_board_rev();
+
+ return (get_cpu_rev() & ~(0xF << 8)) | rev;
+}
+#endif
+
+static int ar8031_phy_fixup(struct phy_device *phydev)
+{
+ unsigned short val;
+
+ /* To enable AR8031 ouput a 125MHz clk from CLK_25M */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0xd, 0x7);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0xe, 0x8016);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0xd, 0x4007);
+
+ val = phy_read(phydev, MDIO_DEVAD_NONE, 0xe);
+ val &= 0xffe3;
+ val |= 0x18;
+ phy_write(phydev, MDIO_DEVAD_NONE, 0xe, val);
+
+ /* introduce tx clock delay */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x5);
+ val = phy_read(phydev, MDIO_DEVAD_NONE, 0x1e);
+ val |= 0x0100;
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, val);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ ar8031_phy_fixup(phydev);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+
+#if defined(CONFIG_VIDEO_IPUV3)
+static void disable_lvds(struct display_info_t const *dev)
+{
+ struct iomuxc *iomux = (struct iomuxc *)IOMUXC_BASE_ADDR;
+
+ clrbits_le32(&iomux->gpr[2],
+ IOMUXC_GPR2_LVDS_CH0_MODE_MASK |
+ IOMUXC_GPR2_LVDS_CH1_MODE_MASK);
+}
+
+static void do_enable_hdmi(struct display_info_t const *dev)
+{
+ disable_lvds(dev);
+ imx_enable_hdmi_phy();
+}
+
+struct display_info_t const displays[] = {{
+ .bus = -1,
+ .addr = 0,
+ .pixfmt = IPU_PIX_FMT_RGB666,
+ .detect = NULL,
+ .enable = NULL,
+ .mode = {
+ .name = "Hannstar-XGA",
+ .refresh = 60,
+ .xres = 1024,
+ .yres = 768,
+ .pixclock = 15385,
+ .left_margin = 220,
+ .right_margin = 40,
+ .upper_margin = 21,
+ .lower_margin = 7,
+ .hsync_len = 60,
+ .vsync_len = 10,
+ .sync = FB_SYNC_EXT,
+ .vmode = FB_VMODE_NONINTERLACED
+} }, {
+ .bus = -1,
+ .addr = 0,
+ .pixfmt = IPU_PIX_FMT_RGB24,
+ .detect = detect_hdmi,
+ .enable = do_enable_hdmi,
+ .mode = {
+ .name = "HDMI",
+ .refresh = 60,
+ .xres = 1024,
+ .yres = 768,
+ .pixclock = 15385,
+ .left_margin = 220,
+ .right_margin = 40,
+ .upper_margin = 21,
+ .lower_margin = 7,
+ .hsync_len = 60,
+ .vsync_len = 10,
+ .sync = FB_SYNC_EXT,
+ .vmode = FB_VMODE_NONINTERLACED,
+} } };
+size_t display_count = ARRAY_SIZE(displays);
+
+iomux_v3_cfg_t const backlight_pads[] = {
+ IOMUX_PADS(PAD_SD4_DAT1__GPIO2_IO09 | MUX_PAD_CTRL(ENET_PAD_CTRL)),
+};
+
+static void setup_iomux_backlight(void)
+{
+ gpio_request(IMX_GPIO_NR(2, 9), "backlight");
+ gpio_direction_output(IMX_GPIO_NR(2, 9), 1);
+ SETUP_IOMUX_PADS(backlight_pads);
+}
+
+static void setup_display(void)
+{
+ struct mxc_ccm_reg *mxc_ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+ struct iomuxc *iomux = (struct iomuxc *)IOMUXC_BASE_ADDR;
+ int reg;
+
+ setup_iomux_backlight();
+ enable_ipu_clock();
+ imx_setup_hdmi();
+
+ /* Turn on LDB_DI0 and LDB_DI1 clocks */
+ reg = readl(&mxc_ccm->CCGR3);
+ reg |= MXC_CCM_CCGR3_LDB_DI0_MASK | MXC_CCM_CCGR3_LDB_DI1_MASK;
+ writel(reg, &mxc_ccm->CCGR3);
+
+ /* Set LDB_DI0 and LDB_DI1 clk select to 3b'011 */
+ reg = readl(&mxc_ccm->cs2cdr);
+ reg &= ~(MXC_CCM_CS2CDR_LDB_DI0_CLK_SEL_MASK |
+ MXC_CCM_CS2CDR_LDB_DI1_CLK_SEL_MASK);
+ reg |= (3 << MXC_CCM_CS2CDR_LDB_DI0_CLK_SEL_OFFSET) |
+ (3 << MXC_CCM_CS2CDR_LDB_DI1_CLK_SEL_OFFSET);
+ writel(reg, &mxc_ccm->cs2cdr);
+
+ reg = readl(&mxc_ccm->cscmr2);
+ reg |= MXC_CCM_CSCMR2_LDB_DI0_IPU_DIV | MXC_CCM_CSCMR2_LDB_DI1_IPU_DIV;
+ writel(reg, &mxc_ccm->cscmr2);
+
+ reg = readl(&mxc_ccm->chsccdr);
+ reg |= (CHSCCDR_CLK_SEL_LDB_DI0
+ << MXC_CCM_CHSCCDR_IPU1_DI0_CLK_SEL_OFFSET);
+ reg |= (CHSCCDR_CLK_SEL_LDB_DI0 <<
+ MXC_CCM_CHSCCDR_IPU1_DI1_CLK_SEL_OFFSET);
+ writel(reg, &mxc_ccm->chsccdr);
+
+ reg = IOMUXC_GPR2_DI1_VS_POLARITY_ACTIVE_LOW |
+ IOMUXC_GPR2_DI0_VS_POLARITY_ACTIVE_LOW |
+ IOMUXC_GPR2_BIT_MAPPING_CH1_SPWG |
+ IOMUXC_GPR2_DATA_WIDTH_CH1_18BIT |
+ IOMUXC_GPR2_BIT_MAPPING_CH0_SPWG |
+ IOMUXC_GPR2_DATA_WIDTH_CH0_18BIT |
+ IOMUXC_GPR2_LVDS_CH0_MODE_ENABLED_DI0 |
+ IOMUXC_GPR2_LVDS_CH1_MODE_DISABLED;
+ writel(reg, &iomux->gpr[2]);
+
+ reg = readl(&iomux->gpr[3]);
+ reg &= ~(IOMUXC_GPR3_LVDS0_MUX_CTL_MASK |
+ IOMUXC_GPR3_HDMI_MUX_CTL_MASK);
+ reg |= (IOMUXC_GPR3_MUX_SRC_IPU1_DI0 <<
+ IOMUXC_GPR3_LVDS0_MUX_CTL_OFFSET) |
+ (IOMUXC_GPR3_MUX_SRC_IPU1_DI0 <<
+ IOMUXC_GPR3_HDMI_MUX_CTL_OFFSET);
+ writel(reg, &iomux->gpr[3]);
+}
+#endif /* CONFIG_VIDEO_IPUV3 */
+
+/*
+ * Do not overwrite the console
+ * Use always serial for U-Boot console
+ */
+int overwrite_console(void)
+{
+ return 1;
+}
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+#ifdef CONFIG_NAND_MXS
+ setup_gpmi_nand();
+#endif
+
+#ifdef CONFIG_MTD_NOR_FLASH
+ eim_clk_setup();
+#endif
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ /* I2C 3 Steer */
+ gpio_request(IMX_GPIO_NR(5, 4), "steer logic");
+ gpio_direction_output(IMX_GPIO_NR(5, 4), 1);
+
+ gpio_request(IMX_GPIO_NR(1, 15), "expander en");
+ gpio_direction_output(IMX_GPIO_NR(1, 15), 1);
+ SETUP_IOMUX_PADS(port_exp);
+
+#ifdef CONFIG_VIDEO_IPUV3
+ setup_display();
+#endif
+
+#ifdef CONFIG_MTD_NOR_FLASH
+ setup_iomux_eimnor();
+#endif
+ return 0;
+}
+
+#ifdef CONFIG_MXC_SPI
+int board_spi_cs_gpio(unsigned bus, unsigned cs)
+{
+ return (bus == 0 && cs == 0) ? (IMX_GPIO_NR(4, 9)) : -1;
+}
+#endif
+
+int power_init_board(void)
+{
+ struct udevice *dev;
+ unsigned int value;
+ int ret;
+
+ ret = pmic_get("pfuze100@8", &dev);
+ if (ret == -ENODEV)
+ return 0;
+
+ if (ret != 0)
+ return ret;
+
+
+ if (is_mx6dqp()) {
+ /* set SW2 staby volatage 0.975V*/
+ value = pmic_reg_read(dev, PFUZE100_SW2STBY);
+ value &= ~0x3f;
+ value |= 0x17;
+ pmic_reg_write(dev, PFUZE100_SW2STBY, value);
+ }
+
+ return pfuze_mode_init(dev, APS_PFM);
+}
+
+#ifdef CONFIG_CMD_BMODE
+static const struct boot_mode board_boot_modes[] = {
+ /* 4 bit bus width */
+ {"mmc0", MAKE_CFGVAL(0x40, 0x30, 0x00, 0x00)},
+ {NULL, 0},
+};
+#endif
+
+int board_late_init(void)
+{
+#ifdef CONFIG_CMD_BMODE
+ add_board_boot_modes(board_boot_modes);
+#endif
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "SABREAUTO");
+
+ if (is_mx6dqp())
+ env_set("board_rev", "MX6QP");
+ else if (is_mx6dq())
+ env_set("board_rev", "MX6Q");
+ else if (is_mx6sdl())
+ env_set("board_rev", "MX6DL");
+#endif
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ printf("Board: MX6Q-Sabreauto rev%c\n", nxp_board_rev_string());
+
+ return 0;
+}
+
+#ifdef CONFIG_USB_EHCI_MX6
+int board_ehci_hcd_init(int port)
+{
+ switch (port) {
+ case 0:
+ /*
+ * Set daisy chain for otg_pin_id on 6q.
+ * For 6dl, this bit is reserved.
+ */
+ imx_iomux_set_gpr_register(1, 13, 1, 0);
+ break;
+ case 1:
+ break;
+ default:
+ printf("MXC USB port %d not yet supported\n", port);
+ return -EINVAL;
+ }
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SPL_BUILD
+#include <asm/arch/mx6-ddr.h>
+#include <spl.h>
+#include <linux/libfdt.h>
+
+#ifdef CONFIG_SPL_OS_BOOT
+int spl_start_uboot(void)
+{
+ return 0;
+}
+#endif
+
+static void ccgr_init(void)
+{
+ struct mxc_ccm_reg *ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ writel(0x00C03F3F, &ccm->CCGR0);
+ writel(0x0030FC03, &ccm->CCGR1);
+ writel(0x0FFFC000, &ccm->CCGR2);
+ writel(0x3FF00000, &ccm->CCGR3);
+ writel(0x00FFF300, &ccm->CCGR4);
+ writel(0x0F0000C3, &ccm->CCGR5);
+ writel(0x000003FF, &ccm->CCGR6);
+}
+
+static int mx6q_dcd_table[] = {
+ 0x020e0798, 0x000C0000,
+ 0x020e0758, 0x00000000,
+ 0x020e0588, 0x00000030,
+ 0x020e0594, 0x00000030,
+ 0x020e056c, 0x00000030,
+ 0x020e0578, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e057c, 0x00000030,
+ 0x020e058c, 0x00000000,
+ 0x020e059c, 0x00000030,
+ 0x020e05a0, 0x00000030,
+ 0x020e078c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e05a8, 0x00000028,
+ 0x020e05b0, 0x00000028,
+ 0x020e0524, 0x00000028,
+ 0x020e051c, 0x00000028,
+ 0x020e0518, 0x00000028,
+ 0x020e050c, 0x00000028,
+ 0x020e05b8, 0x00000028,
+ 0x020e05c0, 0x00000028,
+ 0x020e0774, 0x00020000,
+ 0x020e0784, 0x00000028,
+ 0x020e0788, 0x00000028,
+ 0x020e0794, 0x00000028,
+ 0x020e079c, 0x00000028,
+ 0x020e07a0, 0x00000028,
+ 0x020e07a4, 0x00000028,
+ 0x020e07a8, 0x00000028,
+ 0x020e0748, 0x00000028,
+ 0x020e05ac, 0x00000028,
+ 0x020e05b4, 0x00000028,
+ 0x020e0528, 0x00000028,
+ 0x020e0520, 0x00000028,
+ 0x020e0514, 0x00000028,
+ 0x020e0510, 0x00000028,
+ 0x020e05bc, 0x00000028,
+ 0x020e05c4, 0x00000028,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001F001F,
+ 0x021b0810, 0x001F001F,
+ 0x021b480c, 0x001F001F,
+ 0x021b4810, 0x001F001F,
+ 0x021b083c, 0x43260335,
+ 0x021b0840, 0x031A030B,
+ 0x021b483c, 0x4323033B,
+ 0x021b4840, 0x0323026F,
+ 0x021b0848, 0x483D4545,
+ 0x021b4848, 0x44433E48,
+ 0x021b0850, 0x41444840,
+ 0x021b4850, 0x4835483E,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x00020036,
+ 0x021b0008, 0x09444040,
+ 0x021b000c, 0x8A8F7955,
+ 0x021b0010, 0xFF328F64,
+ 0x021b0014, 0x01FF00DB,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x008F1023,
+ 0x021b0040, 0x00000047,
+ 0x021b0000, 0x841A0000,
+ 0x021b001c, 0x04088032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x09408030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x00025576,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+ 0x020c4068, 0x00C03F3F,
+ 0x020c406c, 0x0030FC03,
+ 0x020c4070, 0x0FFFC000,
+ 0x020c4074, 0x3FF00000,
+ 0x020c4078, 0xFFFFF300,
+ 0x020c407c, 0x0F0000F3,
+ 0x020c4080, 0x00000FFF,
+ 0x020e0010, 0xF00000CF,
+ 0x020e0018, 0x007F007F,
+ 0x020e001c, 0x007F007F,
+};
+
+static int mx6qp_dcd_table[] = {
+ 0x020e0798, 0x000C0000,
+ 0x020e0758, 0x00000000,
+ 0x020e0588, 0x00000030,
+ 0x020e0594, 0x00000030,
+ 0x020e056c, 0x00000030,
+ 0x020e0578, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e057c, 0x00000030,
+ 0x020e058c, 0x00000000,
+ 0x020e059c, 0x00000030,
+ 0x020e05a0, 0x00000030,
+ 0x020e078c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e05a8, 0x00000030,
+ 0x020e05b0, 0x00000030,
+ 0x020e0524, 0x00000030,
+ 0x020e051c, 0x00000030,
+ 0x020e0518, 0x00000030,
+ 0x020e050c, 0x00000030,
+ 0x020e05b8, 0x00000030,
+ 0x020e05c0, 0x00000030,
+ 0x020e0774, 0x00020000,
+ 0x020e0784, 0x00000030,
+ 0x020e0788, 0x00000030,
+ 0x020e0794, 0x00000030,
+ 0x020e079c, 0x00000030,
+ 0x020e07a0, 0x00000030,
+ 0x020e07a4, 0x00000030,
+ 0x020e07a8, 0x00000030,
+ 0x020e0748, 0x00000030,
+ 0x020e05ac, 0x00000030,
+ 0x020e05b4, 0x00000030,
+ 0x020e0528, 0x00000030,
+ 0x020e0520, 0x00000030,
+ 0x020e0514, 0x00000030,
+ 0x020e0510, 0x00000030,
+ 0x020e05bc, 0x00000030,
+ 0x020e05c4, 0x00000030,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001b001e,
+ 0x021b0810, 0x002e0029,
+ 0x021b480c, 0x001b002a,
+ 0x021b4810, 0x0019002c,
+ 0x021b083c, 0x43240334,
+ 0x021b0840, 0x0324031a,
+ 0x021b483c, 0x43340344,
+ 0x021b4840, 0x03280276,
+ 0x021b0848, 0x44383A3E,
+ 0x021b4848, 0x3C3C3846,
+ 0x021b0850, 0x2e303230,
+ 0x021b4850, 0x38283E34,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08c0, 0x24912492,
+ 0x021b48c0, 0x24912492,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x00020036,
+ 0x021b0008, 0x09444040,
+ 0x021b000c, 0x898E7955,
+ 0x021b0010, 0xFF328F64,
+ 0x021b0014, 0x01FF00DB,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x008E1023,
+ 0x021b0040, 0x00000047,
+ 0x021b0400, 0x14420000,
+ 0x021b0000, 0x841A0000,
+ 0x00bb0008, 0x00000004,
+ 0x00bb000c, 0x2891E41A,
+ 0x00bb0038, 0x00000564,
+ 0x00bb0014, 0x00000040,
+ 0x00bb0028, 0x00000020,
+ 0x00bb002c, 0x00000020,
+ 0x021b001c, 0x04088032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x09408030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x00025576,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+ 0x020c4068, 0x00C03F3F,
+ 0x020c406c, 0x0030FC03,
+ 0x020c4070, 0x0FFFC000,
+ 0x020c4074, 0x3FF00000,
+ 0x020c4078, 0xFFFFF300,
+ 0x020c407c, 0x0F0000F3,
+ 0x020c4080, 0x00000FFF,
+ 0x020e0010, 0xF00000CF,
+ 0x020e0018, 0x77177717,
+ 0x020e001c, 0x77177717,
+};
+
+static int mx6dl_dcd_table[] = {
+ 0x020e0774, 0x000C0000,
+ 0x020e0754, 0x00000000,
+ 0x020e04ac, 0x00000030,
+ 0x020e04b0, 0x00000030,
+ 0x020e0464, 0x00000030,
+ 0x020e0490, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e0494, 0x00000030,
+ 0x020e04a0, 0x00000000,
+ 0x020e04b4, 0x00000030,
+ 0x020e04b8, 0x00000030,
+ 0x020e076c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e04bc, 0x00000028,
+ 0x020e04c0, 0x00000028,
+ 0x020e04c4, 0x00000028,
+ 0x020e04c8, 0x00000028,
+ 0x020e04cc, 0x00000028,
+ 0x020e04d0, 0x00000028,
+ 0x020e04d4, 0x00000028,
+ 0x020e04d8, 0x00000028,
+ 0x020e0760, 0x00020000,
+ 0x020e0764, 0x00000028,
+ 0x020e0770, 0x00000028,
+ 0x020e0778, 0x00000028,
+ 0x020e077c, 0x00000028,
+ 0x020e0780, 0x00000028,
+ 0x020e0784, 0x00000028,
+ 0x020e078c, 0x00000028,
+ 0x020e0748, 0x00000028,
+ 0x020e0470, 0x00000028,
+ 0x020e0474, 0x00000028,
+ 0x020e0478, 0x00000028,
+ 0x020e047c, 0x00000028,
+ 0x020e0480, 0x00000028,
+ 0x020e0484, 0x00000028,
+ 0x020e0488, 0x00000028,
+ 0x020e048c, 0x00000028,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001F001F,
+ 0x021b0810, 0x001F001F,
+ 0x021b480c, 0x001F001F,
+ 0x021b4810, 0x001F001F,
+ 0x021b083c, 0x42190217,
+ 0x021b0840, 0x017B017B,
+ 0x021b483c, 0x4176017B,
+ 0x021b4840, 0x015F016C,
+ 0x021b0848, 0x4C4C4D4C,
+ 0x021b4848, 0x4A4D4C48,
+ 0x021b0850, 0x3F3F3F40,
+ 0x021b4850, 0x3538382E,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x00020025,
+ 0x021b0008, 0x00333030,
+ 0x021b000c, 0x676B5313,
+ 0x021b0010, 0xB66E8B63,
+ 0x021b0014, 0x01FF00DB,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x006B1023,
+ 0x021b0040, 0x00000047,
+ 0x021b0000, 0x841A0000,
+ 0x021b001c, 0x04008032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x05208030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x00025565,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+ 0x020c4068, 0x00C03F3F,
+ 0x020c406c, 0x0030FC03,
+ 0x020c4070, 0x0FFFC000,
+ 0x020c4074, 0x3FF00000,
+ 0x020c4078, 0xFFFFF300,
+ 0x020c407c, 0x0F0000C3,
+ 0x020c4080, 0x00000FFF,
+ 0x020e0010, 0xF00000CF,
+ 0x020e0018, 0x007F007F,
+ 0x020e001c, 0x007F007F,
+};
+
+static void ddr_init(int *table, int size)
+{
+ int i;
+
+ for (i = 0; i < size / 2 ; i++)
+ writel(table[2 * i + 1], table[2 * i]);
+}
+
+static void spl_dram_init(void)
+{
+ if (is_mx6dq())
+ ddr_init(mx6q_dcd_table, ARRAY_SIZE(mx6q_dcd_table));
+ else if (is_mx6dqp())
+ ddr_init(mx6qp_dcd_table, ARRAY_SIZE(mx6qp_dcd_table));
+ else if (is_mx6sdl())
+ ddr_init(mx6dl_dcd_table, ARRAY_SIZE(mx6dl_dcd_table));
+}
+
+void board_init_f(ulong dummy)
+{
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* setup AIPS and disable watchdog */
+ arch_cpu_init();
+
+ ccgr_init();
+ gpr_init();
+
+ board_early_init_f();
+
+ /* setup GP timer */
+ timer_init();
+
+ /* UART clocks enabled and gd valid - init serial console */
+ preloader_console_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ /* load/boot image from boot device */
+ board_init_r(NULL, 0);
+}
+#endif
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ if (is_mx6dq()) {
+ if (!strcmp(name, "imx6q-sabreauto"))
+ return 0;
+ } else if (is_mx6dqp()) {
+ if (!strcmp(name, "imx6qp-sabreauto"))
+ return 0;
+ } else if (is_mx6dl()) {
+ if (!strcmp(name, "imx6dl-sabreauto"))
+ return 0;
+ }
+
+ return -1;
+}
+#endif
diff --git a/board/freescale/mx6sabresd/Kconfig b/board/freescale/mx6sabresd/Kconfig
new file mode 100644
index 00000000000..e87dea0d7a2
--- /dev/null
+++ b/board/freescale/mx6sabresd/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_MX6SABRESD
+
+config SYS_BOARD
+ default "mx6sabresd"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6sabresd"
+
+endif
diff --git a/board/freescale/mx6sabresd/MAINTAINERS b/board/freescale/mx6sabresd/MAINTAINERS
new file mode 100644
index 00000000000..5e256ef163e
--- /dev/null
+++ b/board/freescale/mx6sabresd/MAINTAINERS
@@ -0,0 +1,6 @@
+MX6SABRESD BOARD
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/mx6sabresd/
+F: include/configs/mx6sabresd.h
+F: configs/mx6sabresd_defconfig
diff --git a/board/freescale/mx6sabresd/Makefile b/board/freescale/mx6sabresd/Makefile
new file mode 100644
index 00000000000..92e1ff72a4f
--- /dev/null
+++ b/board/freescale/mx6sabresd/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright (C) 2007, Guennadi Liakhovetski <lg@denx.de>
+#
+# (C) Copyright 2011 Freescale Semiconductor, Inc.
+
+obj-y := mx6sabresd.o
diff --git a/board/freescale/mx6sabresd/mx6sabresd.c b/board/freescale/mx6sabresd/mx6sabresd.c
new file mode 100644
index 00000000000..bb066a5d36c
--- /dev/null
+++ b/board/freescale/mx6sabresd/mx6sabresd.c
@@ -0,0 +1,868 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2012 Freescale Semiconductor, Inc.
+ *
+ * Author: Fabio Estevam <fabio.estevam@freescale.com>
+ */
+
+#include <image.h>
+#include <init.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/global_data.h>
+#include <asm/mach-imx/spi.h>
+#include <asm/sections.h>
+#include <env.h>
+#include <linux/errno.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/mach-imx/video.h>
+#include <mmc.h>
+#include <fsl_esdhc_imx.h>
+#include <miiphy.h>
+#include <asm/arch/mxc_hdmi.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/io.h>
+#include <asm/arch/sys_proto.h>
+#include <input.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+#include <usb.h>
+#include <usb/ehci-ci.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
+ PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define USDHC_PAD_CTRL (PAD_CTL_PUS_47K_UP | \
+ PAD_CTL_SPEED_LOW | PAD_CTL_DSE_80ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define SPI_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_SRE_FAST)
+
+#define DISP0_PWR_EN IMX_GPIO_NR(1, 21)
+
+#define KEY_VOL_UP IMX_GPIO_NR(1, 4)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+ return 0;
+}
+
+static iomux_v3_cfg_t const uart1_pads[] = {
+ IOMUX_PADS(PAD_CSI0_DAT10__UART1_TX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+ IOMUX_PADS(PAD_CSI0_DAT11__UART1_RX_DATA | MUX_PAD_CTRL(UART_PAD_CTRL)),
+};
+
+static iomux_v3_cfg_t const usdhc2_pads[] = {
+ IOMUX_PADS(PAD_SD2_CLK__SD2_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD2_CMD__SD2_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD2_DAT0__SD2_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD2_DAT1__SD2_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD2_DAT2__SD2_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD2_DAT3__SD2_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D4__SD2_DATA4 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D5__SD2_DATA5 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D6__SD2_DATA6 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D7__SD2_DATA7 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D2__GPIO2_IO02 | MUX_PAD_CTRL(NO_PAD_CTRL)), /* CD */
+};
+
+static iomux_v3_cfg_t const usdhc3_pads[] = {
+ IOMUX_PADS(PAD_SD3_CLK__SD3_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_CMD__SD3_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT0__SD3_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT1__SD3_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT2__SD3_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT3__SD3_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT4__SD3_DATA4 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT5__SD3_DATA5 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT6__SD3_DATA6 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD3_DAT7__SD3_DATA7 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_NANDF_D0__GPIO2_IO00 | MUX_PAD_CTRL(NO_PAD_CTRL)), /* CD */
+};
+
+static iomux_v3_cfg_t const usdhc4_pads[] = {
+ IOMUX_PADS(PAD_SD4_CLK__SD4_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_CMD__SD4_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT0__SD4_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT1__SD4_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT2__SD4_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT3__SD4_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT4__SD4_DATA4 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT5__SD4_DATA5 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT6__SD4_DATA6 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+ IOMUX_PADS(PAD_SD4_DAT7__SD4_DATA7 | MUX_PAD_CTRL(USDHC_PAD_CTRL)),
+};
+
+static iomux_v3_cfg_t const ecspi1_pads[] = {
+ IOMUX_PADS(PAD_KEY_COL0__ECSPI1_SCLK | MUX_PAD_CTRL(SPI_PAD_CTRL)),
+ IOMUX_PADS(PAD_KEY_COL1__ECSPI1_MISO | MUX_PAD_CTRL(SPI_PAD_CTRL)),
+ IOMUX_PADS(PAD_KEY_ROW0__ECSPI1_MOSI | MUX_PAD_CTRL(SPI_PAD_CTRL)),
+ IOMUX_PADS(PAD_KEY_ROW1__GPIO4_IO09 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+static iomux_v3_cfg_t const rgb_pads[] = {
+ IOMUX_PADS(PAD_DI0_DISP_CLK__IPU1_DI0_DISP_CLK | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DI0_PIN15__IPU1_DI0_PIN15 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DI0_PIN2__IPU1_DI0_PIN02 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DI0_PIN3__IPU1_DI0_PIN03 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DI0_PIN4__IPU1_DI0_PIN04 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT0__IPU1_DISP0_DATA00 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT1__IPU1_DISP0_DATA01 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT2__IPU1_DISP0_DATA02 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT3__IPU1_DISP0_DATA03 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT4__IPU1_DISP0_DATA04 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT5__IPU1_DISP0_DATA05 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT6__IPU1_DISP0_DATA06 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT7__IPU1_DISP0_DATA07 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT8__IPU1_DISP0_DATA08 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT9__IPU1_DISP0_DATA09 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT10__IPU1_DISP0_DATA10 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT11__IPU1_DISP0_DATA11 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT12__IPU1_DISP0_DATA12 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT13__IPU1_DISP0_DATA13 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT14__IPU1_DISP0_DATA14 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT15__IPU1_DISP0_DATA15 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT16__IPU1_DISP0_DATA16 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT17__IPU1_DISP0_DATA17 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT18__IPU1_DISP0_DATA18 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT19__IPU1_DISP0_DATA19 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT20__IPU1_DISP0_DATA20 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT21__IPU1_DISP0_DATA21 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT22__IPU1_DISP0_DATA22 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+ IOMUX_PADS(PAD_DISP0_DAT23__IPU1_DISP0_DATA23 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+static iomux_v3_cfg_t const bl_pads[] = {
+ IOMUX_PADS(PAD_SD1_DAT3__GPIO1_IO21 | MUX_PAD_CTRL(NO_PAD_CTRL)),
+};
+
+static void enable_backlight(void)
+{
+ SETUP_IOMUX_PADS(bl_pads);
+ gpio_request(DISP0_PWR_EN, "Display Power Enable");
+ gpio_direction_output(DISP0_PWR_EN, 1);
+}
+
+static void enable_rgb(struct display_info_t const *dev)
+{
+ SETUP_IOMUX_PADS(rgb_pads);
+ enable_backlight();
+}
+
+static void enable_lvds(struct display_info_t const *dev)
+{
+ enable_backlight();
+}
+
+static void setup_spi(void)
+{
+ SETUP_IOMUX_PADS(ecspi1_pads);
+}
+
+iomux_v3_cfg_t const di0_pads[] = {
+ IOMUX_PADS(PAD_DI0_DISP_CLK__IPU1_DI0_DISP_CLK), /* DISP0_CLK */
+ IOMUX_PADS(PAD_DI0_PIN2__IPU1_DI0_PIN02), /* DISP0_HSYNC */
+ IOMUX_PADS(PAD_DI0_PIN3__IPU1_DI0_PIN03), /* DISP0_VSYNC */
+};
+
+static void setup_iomux_uart(void)
+{
+ SETUP_IOMUX_PADS(uart1_pads);
+}
+
+#ifdef CONFIG_FSL_ESDHC_IMX
+struct fsl_esdhc_cfg usdhc_cfg[3] = {
+ {USDHC2_BASE_ADDR},
+ {USDHC3_BASE_ADDR},
+ {USDHC4_BASE_ADDR},
+};
+
+#define USDHC2_CD_GPIO IMX_GPIO_NR(2, 2)
+#define USDHC3_CD_GPIO IMX_GPIO_NR(2, 0)
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno - 1;
+}
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ struct fsl_esdhc_cfg *cfg = (struct fsl_esdhc_cfg *)mmc->priv;
+ int ret = 0;
+
+ switch (cfg->esdhc_base) {
+ case USDHC2_BASE_ADDR:
+ ret = !gpio_get_value(USDHC2_CD_GPIO);
+ break;
+ case USDHC3_BASE_ADDR:
+ ret = !gpio_get_value(USDHC3_CD_GPIO);
+ break;
+ case USDHC4_BASE_ADDR:
+ ret = 1; /* eMMC/uSDHC4 is always present */
+ break;
+ }
+
+ return ret;
+}
+
+int board_mmc_init(struct bd_info *bis)
+{
+ struct src *psrc = (struct src *)SRC_BASE_ADDR;
+ unsigned reg = readl(&psrc->sbmr1) >> 11;
+ /*
+ * Upon reading BOOT_CFG register the following map is done:
+ * Bit 11 and 12 of BOOT_CFG register can determine the current
+ * mmc port
+ * 0x1 SD1
+ * 0x2 SD2
+ * 0x3 SD4
+ */
+
+ switch (reg & 0x3) {
+ case 0x1:
+ SETUP_IOMUX_PADS(usdhc2_pads);
+ usdhc_cfg[0].esdhc_base = USDHC2_BASE_ADDR;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC2_CLK);
+ gd->arch.sdhc_clk = usdhc_cfg[0].sdhc_clk;
+ break;
+ case 0x2:
+ SETUP_IOMUX_PADS(usdhc3_pads);
+ usdhc_cfg[0].esdhc_base = USDHC3_BASE_ADDR;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC3_CLK);
+ gd->arch.sdhc_clk = usdhc_cfg[0].sdhc_clk;
+ break;
+ case 0x3:
+ SETUP_IOMUX_PADS(usdhc4_pads);
+ usdhc_cfg[0].esdhc_base = USDHC4_BASE_ADDR;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC4_CLK);
+ gd->arch.sdhc_clk = usdhc_cfg[0].sdhc_clk;
+ break;
+ }
+
+ return fsl_esdhc_initialize(bis, &usdhc_cfg[0]);
+}
+#endif
+
+#if defined(CONFIG_VIDEO_IPUV3)
+static void disable_lvds(struct display_info_t const *dev)
+{
+ struct iomuxc *iomux = (struct iomuxc *)IOMUXC_BASE_ADDR;
+
+ int reg = readl(&iomux->gpr[2]);
+
+ reg &= ~(IOMUXC_GPR2_LVDS_CH0_MODE_MASK |
+ IOMUXC_GPR2_LVDS_CH1_MODE_MASK);
+
+ writel(reg, &iomux->gpr[2]);
+}
+
+static void do_enable_hdmi(struct display_info_t const *dev)
+{
+ disable_lvds(dev);
+ imx_enable_hdmi_phy();
+}
+
+struct display_info_t const displays[] = {{
+ .bus = -1,
+ .addr = 0,
+ .pixfmt = IPU_PIX_FMT_RGB666,
+ .detect = NULL,
+ .enable = enable_lvds,
+ .mode = {
+ .name = "Hannstar-XGA",
+ .refresh = 60,
+ .xres = 1024,
+ .yres = 768,
+ .pixclock = 15384,
+ .left_margin = 160,
+ .right_margin = 24,
+ .upper_margin = 29,
+ .lower_margin = 3,
+ .hsync_len = 136,
+ .vsync_len = 6,
+ .sync = FB_SYNC_EXT,
+ .vmode = FB_VMODE_NONINTERLACED
+} }, {
+ .bus = -1,
+ .addr = 0,
+ .pixfmt = IPU_PIX_FMT_RGB24,
+ .detect = detect_hdmi,
+ .enable = do_enable_hdmi,
+ .mode = {
+ .name = "HDMI",
+ .refresh = 60,
+ .xres = 1024,
+ .yres = 768,
+ .pixclock = 15384,
+ .left_margin = 160,
+ .right_margin = 24,
+ .upper_margin = 29,
+ .lower_margin = 3,
+ .hsync_len = 136,
+ .vsync_len = 6,
+ .sync = FB_SYNC_EXT,
+ .vmode = FB_VMODE_NONINTERLACED
+} }, {
+ .bus = 0,
+ .addr = 0,
+ .pixfmt = IPU_PIX_FMT_RGB24,
+ .detect = NULL,
+ .enable = enable_rgb,
+ .mode = {
+ .name = "SEIKO-WVGA",
+ .refresh = 60,
+ .xres = 800,
+ .yres = 480,
+ .pixclock = 29850,
+ .left_margin = 89,
+ .right_margin = 164,
+ .upper_margin = 23,
+ .lower_margin = 10,
+ .hsync_len = 10,
+ .vsync_len = 10,
+ .sync = 0,
+ .vmode = FB_VMODE_NONINTERLACED
+} } };
+size_t display_count = ARRAY_SIZE(displays);
+
+static void setup_display(void)
+{
+ struct mxc_ccm_reg *mxc_ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+ struct iomuxc *iomux = (struct iomuxc *)IOMUXC_BASE_ADDR;
+ int reg;
+
+ /* Setup HSYNC, VSYNC, DISP_CLK for debugging purposes */
+ SETUP_IOMUX_PADS(di0_pads);
+
+ enable_ipu_clock();
+ imx_setup_hdmi();
+
+ /* Turn on LDB0, LDB1, IPU,IPU DI0 clocks */
+ reg = readl(&mxc_ccm->CCGR3);
+ reg |= MXC_CCM_CCGR3_LDB_DI0_MASK | MXC_CCM_CCGR3_LDB_DI1_MASK;
+ writel(reg, &mxc_ccm->CCGR3);
+
+ /* set LDB0, LDB1 clk select to 011/011 */
+ reg = readl(&mxc_ccm->cs2cdr);
+ reg &= ~(MXC_CCM_CS2CDR_LDB_DI0_CLK_SEL_MASK
+ | MXC_CCM_CS2CDR_LDB_DI1_CLK_SEL_MASK);
+ reg |= (3 << MXC_CCM_CS2CDR_LDB_DI0_CLK_SEL_OFFSET)
+ | (3 << MXC_CCM_CS2CDR_LDB_DI1_CLK_SEL_OFFSET);
+ writel(reg, &mxc_ccm->cs2cdr);
+
+ reg = readl(&mxc_ccm->cscmr2);
+ reg |= MXC_CCM_CSCMR2_LDB_DI0_IPU_DIV | MXC_CCM_CSCMR2_LDB_DI1_IPU_DIV;
+ writel(reg, &mxc_ccm->cscmr2);
+
+ reg = readl(&mxc_ccm->chsccdr);
+ reg |= (CHSCCDR_CLK_SEL_LDB_DI0
+ << MXC_CCM_CHSCCDR_IPU1_DI0_CLK_SEL_OFFSET);
+ reg |= (CHSCCDR_CLK_SEL_LDB_DI0
+ << MXC_CCM_CHSCCDR_IPU1_DI1_CLK_SEL_OFFSET);
+ writel(reg, &mxc_ccm->chsccdr);
+
+ reg = IOMUXC_GPR2_BGREF_RRMODE_EXTERNAL_RES
+ | IOMUXC_GPR2_DI1_VS_POLARITY_ACTIVE_LOW
+ | IOMUXC_GPR2_DI0_VS_POLARITY_ACTIVE_LOW
+ | IOMUXC_GPR2_BIT_MAPPING_CH1_SPWG
+ | IOMUXC_GPR2_DATA_WIDTH_CH1_18BIT
+ | IOMUXC_GPR2_BIT_MAPPING_CH0_SPWG
+ | IOMUXC_GPR2_DATA_WIDTH_CH0_18BIT
+ | IOMUXC_GPR2_LVDS_CH0_MODE_DISABLED
+ | IOMUXC_GPR2_LVDS_CH1_MODE_ENABLED_DI0;
+ writel(reg, &iomux->gpr[2]);
+
+ reg = readl(&iomux->gpr[3]);
+ reg = (reg & ~(IOMUXC_GPR3_LVDS1_MUX_CTL_MASK
+ | IOMUXC_GPR3_HDMI_MUX_CTL_MASK))
+ | (IOMUXC_GPR3_MUX_SRC_IPU1_DI0
+ << IOMUXC_GPR3_LVDS1_MUX_CTL_OFFSET);
+ writel(reg, &iomux->gpr[3]);
+}
+#endif /* CONFIG_VIDEO_IPUV3 */
+
+/*
+ * Do not overwrite the console
+ * Use always serial for U-Boot console
+ */
+int overwrite_console(void)
+{
+ return 1;
+}
+
+#ifdef CONFIG_USB_EHCI_MX6
+static void setup_usb(void)
+{
+ /*
+ * set daisy chain for otg_pin_id on 6q.
+ * for 6dl, this bit is reserved
+ */
+ imx_iomux_set_gpr_register(1, 13, 1, 0);
+}
+#endif
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+#ifdef CONFIG_MXC_SPI
+ setup_spi();
+#endif
+
+#if defined(CONFIG_VIDEO_IPUV3)
+ setup_display();
+#endif
+#ifdef CONFIG_USB_EHCI_MX6
+ setup_usb();
+#endif
+
+ return 0;
+}
+
+int power_init_board(void)
+{
+ struct udevice *dev;
+ unsigned int reg;
+ int ret;
+
+ ret = pmic_get("pfuze100@8", &dev);
+ if (ret == -ENODEV)
+ return 0;
+
+ if (ret != 0)
+ return ret;
+
+ ret = pfuze_mode_init(dev, APS_PFM);
+ if (ret < 0)
+ return ret;
+
+ /* Increase VGEN3 from 2.5 to 2.8V */
+ reg = pmic_reg_read(dev, PFUZE100_VGEN3VOL);
+ reg &= ~LDO_VOL_MASK;
+ reg |= LDOB_2_80V;
+ pmic_reg_write(dev, PFUZE100_VGEN3VOL, reg);
+
+ /* Increase VGEN5 from 2.8 to 3V */
+ reg = pmic_reg_read(dev, PFUZE100_VGEN5VOL);
+ reg &= ~LDO_VOL_MASK;
+ reg |= LDOB_3_00V;
+ pmic_reg_write(dev, PFUZE100_VGEN5VOL, reg);
+
+ return 0;
+}
+
+#ifdef CONFIG_MXC_SPI
+int board_spi_cs_gpio(unsigned bus, unsigned cs)
+{
+ return (bus == 0 && cs == 0) ? (IMX_GPIO_NR(4, 9)) : -1;
+}
+#endif
+
+#ifdef CONFIG_CMD_BMODE
+static const struct boot_mode board_boot_modes[] = {
+ /* 4 bit bus width */
+ {"sd2", MAKE_CFGVAL(0x40, 0x28, 0x00, 0x00)},
+ {"sd3", MAKE_CFGVAL(0x40, 0x30, 0x00, 0x00)},
+ /* 8 bit bus width */
+ {"emmc", MAKE_CFGVAL(0x60, 0x58, 0x00, 0x00)},
+ {NULL, 0},
+};
+#endif
+
+int board_late_init(void)
+{
+#ifdef CONFIG_CMD_BMODE
+ add_board_boot_modes(board_boot_modes);
+#endif
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "SABRESD");
+
+ if (is_mx6dqp())
+ env_set("board_rev", "MX6QP");
+ else if (is_mx6dq())
+ env_set("board_rev", "MX6Q");
+ else if (is_mx6sdl())
+ env_set("board_rev", "MX6DL");
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+#include <asm/arch/mx6-ddr.h>
+#include <spl.h>
+#include <linux/libfdt.h>
+
+#ifdef CONFIG_SPL_OS_BOOT
+int spl_start_uboot(void)
+{
+ gpio_request(KEY_VOL_UP, "KEY Volume UP");
+ gpio_direction_input(KEY_VOL_UP);
+
+ /* Only enter in Falcon mode if KEY_VOL_UP is pressed */
+ return gpio_get_value(KEY_VOL_UP);
+}
+#endif
+
+static void ccgr_init(void)
+{
+ struct mxc_ccm_reg *ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ writel(0x00C03F3F, &ccm->CCGR0);
+ writel(0x0030FC03, &ccm->CCGR1);
+ writel(0x0FFFC000, &ccm->CCGR2);
+ writel(0x3FF00000, &ccm->CCGR3);
+ writel(0x00FFF300, &ccm->CCGR4);
+ writel(0x0F0000C3, &ccm->CCGR5);
+ writel(0x000003FF, &ccm->CCGR6);
+}
+
+static int mx6q_dcd_table[] = {
+ 0x020e0798, 0x000C0000,
+ 0x020e0758, 0x00000000,
+ 0x020e0588, 0x00000030,
+ 0x020e0594, 0x00000030,
+ 0x020e056c, 0x00000030,
+ 0x020e0578, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e057c, 0x00000030,
+ 0x020e058c, 0x00000000,
+ 0x020e059c, 0x00000030,
+ 0x020e05a0, 0x00000030,
+ 0x020e078c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e05a8, 0x00000030,
+ 0x020e05b0, 0x00000030,
+ 0x020e0524, 0x00000030,
+ 0x020e051c, 0x00000030,
+ 0x020e0518, 0x00000030,
+ 0x020e050c, 0x00000030,
+ 0x020e05b8, 0x00000030,
+ 0x020e05c0, 0x00000030,
+ 0x020e0774, 0x00020000,
+ 0x020e0784, 0x00000030,
+ 0x020e0788, 0x00000030,
+ 0x020e0794, 0x00000030,
+ 0x020e079c, 0x00000030,
+ 0x020e07a0, 0x00000030,
+ 0x020e07a4, 0x00000030,
+ 0x020e07a8, 0x00000030,
+ 0x020e0748, 0x00000030,
+ 0x020e05ac, 0x00000030,
+ 0x020e05b4, 0x00000030,
+ 0x020e0528, 0x00000030,
+ 0x020e0520, 0x00000030,
+ 0x020e0514, 0x00000030,
+ 0x020e0510, 0x00000030,
+ 0x020e05bc, 0x00000030,
+ 0x020e05c4, 0x00000030,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001F001F,
+ 0x021b0810, 0x001F001F,
+ 0x021b480c, 0x001F001F,
+ 0x021b4810, 0x001F001F,
+ 0x021b083c, 0x43270338,
+ 0x021b0840, 0x03200314,
+ 0x021b483c, 0x431A032F,
+ 0x021b4840, 0x03200263,
+ 0x021b0848, 0x4B434748,
+ 0x021b4848, 0x4445404C,
+ 0x021b0850, 0x38444542,
+ 0x021b4850, 0x4935493A,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x00020036,
+ 0x021b0008, 0x09444040,
+ 0x021b000c, 0x555A7975,
+ 0x021b0010, 0xFF538F64,
+ 0x021b0014, 0x01FF00DB,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x005A1023,
+ 0x021b0040, 0x00000027,
+ 0x021b0000, 0x831A0000,
+ 0x021b001c, 0x04088032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x09408030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x00025576,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+};
+
+static int mx6qp_dcd_table[] = {
+ 0x020e0798, 0x000c0000,
+ 0x020e0758, 0x00000000,
+ 0x020e0588, 0x00000030,
+ 0x020e0594, 0x00000030,
+ 0x020e056c, 0x00000030,
+ 0x020e0578, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e057c, 0x00000030,
+ 0x020e058c, 0x00000000,
+ 0x020e059c, 0x00000030,
+ 0x020e05a0, 0x00000030,
+ 0x020e078c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e05a8, 0x00000030,
+ 0x020e05b0, 0x00000030,
+ 0x020e0524, 0x00000030,
+ 0x020e051c, 0x00000030,
+ 0x020e0518, 0x00000030,
+ 0x020e050c, 0x00000030,
+ 0x020e05b8, 0x00000030,
+ 0x020e05c0, 0x00000030,
+ 0x020e0774, 0x00020000,
+ 0x020e0784, 0x00000030,
+ 0x020e0788, 0x00000030,
+ 0x020e0794, 0x00000030,
+ 0x020e079c, 0x00000030,
+ 0x020e07a0, 0x00000030,
+ 0x020e07a4, 0x00000030,
+ 0x020e07a8, 0x00000030,
+ 0x020e0748, 0x00000030,
+ 0x020e05ac, 0x00000030,
+ 0x020e05b4, 0x00000030,
+ 0x020e0528, 0x00000030,
+ 0x020e0520, 0x00000030,
+ 0x020e0514, 0x00000030,
+ 0x020e0510, 0x00000030,
+ 0x020e05bc, 0x00000030,
+ 0x020e05c4, 0x00000030,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001b001e,
+ 0x021b0810, 0x002e0029,
+ 0x021b480c, 0x001b002a,
+ 0x021b4810, 0x0019002c,
+ 0x021b083c, 0x43240334,
+ 0x021b0840, 0x0324031a,
+ 0x021b483c, 0x43340344,
+ 0x021b4840, 0x03280276,
+ 0x021b0848, 0x44383A3E,
+ 0x021b4848, 0x3C3C3846,
+ 0x021b0850, 0x2e303230,
+ 0x021b4850, 0x38283E34,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08c0, 0x24912249,
+ 0x021b48c0, 0x24914289,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x00020036,
+ 0x021b0008, 0x24444040,
+ 0x021b000c, 0x555A7955,
+ 0x021b0010, 0xFF320F64,
+ 0x021b0014, 0x01ff00db,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x005A1023,
+ 0x021b0040, 0x00000027,
+ 0x021b0400, 0x14420000,
+ 0x021b0000, 0x831A0000,
+ 0x021b0890, 0x00400C58,
+ 0x00bb0008, 0x00000000,
+ 0x00bb000c, 0x2891E41A,
+ 0x00bb0038, 0x00000564,
+ 0x00bb0014, 0x00000040,
+ 0x00bb0028, 0x00000020,
+ 0x00bb002c, 0x00000020,
+ 0x021b001c, 0x04088032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x09408030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x00025576,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+};
+
+static int mx6dl_dcd_table[] = {
+ 0x020e0774, 0x000C0000,
+ 0x020e0754, 0x00000000,
+ 0x020e04ac, 0x00000030,
+ 0x020e04b0, 0x00000030,
+ 0x020e0464, 0x00000030,
+ 0x020e0490, 0x00000030,
+ 0x020e074c, 0x00000030,
+ 0x020e0494, 0x00000030,
+ 0x020e04a0, 0x00000000,
+ 0x020e04b4, 0x00000030,
+ 0x020e04b8, 0x00000030,
+ 0x020e076c, 0x00000030,
+ 0x020e0750, 0x00020000,
+ 0x020e04bc, 0x00000030,
+ 0x020e04c0, 0x00000030,
+ 0x020e04c4, 0x00000030,
+ 0x020e04c8, 0x00000030,
+ 0x020e04cc, 0x00000030,
+ 0x020e04d0, 0x00000030,
+ 0x020e04d4, 0x00000030,
+ 0x020e04d8, 0x00000030,
+ 0x020e0760, 0x00020000,
+ 0x020e0764, 0x00000030,
+ 0x020e0770, 0x00000030,
+ 0x020e0778, 0x00000030,
+ 0x020e077c, 0x00000030,
+ 0x020e0780, 0x00000030,
+ 0x020e0784, 0x00000030,
+ 0x020e078c, 0x00000030,
+ 0x020e0748, 0x00000030,
+ 0x020e0470, 0x00000030,
+ 0x020e0474, 0x00000030,
+ 0x020e0478, 0x00000030,
+ 0x020e047c, 0x00000030,
+ 0x020e0480, 0x00000030,
+ 0x020e0484, 0x00000030,
+ 0x020e0488, 0x00000030,
+ 0x020e048c, 0x00000030,
+ 0x021b0800, 0xa1390003,
+ 0x021b080c, 0x001F001F,
+ 0x021b0810, 0x001F001F,
+ 0x021b480c, 0x001F001F,
+ 0x021b4810, 0x001F001F,
+ 0x021b083c, 0x4220021F,
+ 0x021b0840, 0x0207017E,
+ 0x021b483c, 0x4201020C,
+ 0x021b4840, 0x01660172,
+ 0x021b0848, 0x4A4D4E4D,
+ 0x021b4848, 0x4A4F5049,
+ 0x021b0850, 0x3F3C3D31,
+ 0x021b4850, 0x3238372B,
+ 0x021b081c, 0x33333333,
+ 0x021b0820, 0x33333333,
+ 0x021b0824, 0x33333333,
+ 0x021b0828, 0x33333333,
+ 0x021b481c, 0x33333333,
+ 0x021b4820, 0x33333333,
+ 0x021b4824, 0x33333333,
+ 0x021b4828, 0x33333333,
+ 0x021b08b8, 0x00000800,
+ 0x021b48b8, 0x00000800,
+ 0x021b0004, 0x0002002D,
+ 0x021b0008, 0x00333030,
+ 0x021b000c, 0x3F435313,
+ 0x021b0010, 0xB66E8B63,
+ 0x021b0014, 0x01FF00DB,
+ 0x021b0018, 0x00001740,
+ 0x021b001c, 0x00008000,
+ 0x021b002c, 0x000026d2,
+ 0x021b0030, 0x00431023,
+ 0x021b0040, 0x00000027,
+ 0x021b0000, 0x831A0000,
+ 0x021b001c, 0x04008032,
+ 0x021b001c, 0x00008033,
+ 0x021b001c, 0x00048031,
+ 0x021b001c, 0x05208030,
+ 0x021b001c, 0x04008040,
+ 0x021b0020, 0x00005800,
+ 0x021b0818, 0x00011117,
+ 0x021b4818, 0x00011117,
+ 0x021b0004, 0x0002556D,
+ 0x021b0404, 0x00011006,
+ 0x021b001c, 0x00000000,
+};
+
+static void ddr_init(int *table, int size)
+{
+ int i;
+
+ for (i = 0; i < size / 2 ; i++)
+ writel(table[2 * i + 1], table[2 * i]);
+}
+
+static void spl_dram_init(void)
+{
+ if (is_mx6dq())
+ ddr_init(mx6q_dcd_table, ARRAY_SIZE(mx6q_dcd_table));
+ else if (is_mx6dqp())
+ ddr_init(mx6qp_dcd_table, ARRAY_SIZE(mx6qp_dcd_table));
+ else if (is_mx6sdl())
+ ddr_init(mx6dl_dcd_table, ARRAY_SIZE(mx6dl_dcd_table));
+}
+
+void board_init_f(ulong dummy)
+{
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* setup AIPS and disable watchdog */
+ arch_cpu_init();
+
+ ccgr_init();
+ gpr_init();
+
+ board_early_init_f();
+
+ /* setup GP timer */
+ timer_init();
+
+ /* UART clocks enabled and gd valid - init serial console */
+ preloader_console_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ /* load/boot image from boot device */
+ board_init_r(NULL, 0);
+}
+#endif
+
+#ifdef CONFIG_SPL_LOAD_FIT
+int board_fit_config_name_match(const char *name)
+{
+ if (is_mx6dq()) {
+ if (!strcmp(name, "imx6q-sabresd"))
+ return 0;
+ } else if (is_mx6dqp()) {
+ if (!strcmp(name, "imx6qp-sabresd"))
+ return 0;
+ } else if (is_mx6dl()) {
+ if (!strcmp(name, "imx6dl-sabresd"))
+ return 0;
+ }
+
+ return -1;
+}
+#endif
diff --git a/board/freescale/mx6slevk/Kconfig b/board/freescale/mx6slevk/Kconfig
new file mode 100644
index 00000000000..e6bbb4194f4
--- /dev/null
+++ b/board/freescale/mx6slevk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX6SLEVK
+
+config SYS_BOARD
+ default "mx6slevk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6slevk"
+
+config IMX_CONFIG
+ default "board/freescale/mx6slevk/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx6slevk/MAINTAINERS b/board/freescale/mx6slevk/MAINTAINERS
new file mode 100644
index 00000000000..ae87fe472bc
--- /dev/null
+++ b/board/freescale/mx6slevk/MAINTAINERS
@@ -0,0 +1,9 @@
+MX6SLEVK BOARD
+M: Fabio Estevam <festevam@gmail.com>
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6slevk/
+F: include/configs/mx6slevk.h
+F: configs/mx6slevk_defconfig
+F: configs/mx6slevk_spl_defconfig
+F: configs/mx6slevk_spinor_defconfig
diff --git a/board/freescale/mx6slevk/Makefile b/board/freescale/mx6slevk/Makefile
new file mode 100644
index 00000000000..770f7aac6b9
--- /dev/null
+++ b/board/freescale/mx6slevk/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2013 Freescale Semiconductor, Inc.
+
+obj-y := mx6slevk.o
diff --git a/board/freescale/mx6slevk/imximage.cfg b/board/freescale/mx6slevk/imximage.cfg
new file mode 100644
index 00000000000..64be101d6ec
--- /dev/null
+++ b/board/freescale/mx6slevk/imximage.cfg
@@ -0,0 +1,122 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2013 Freescale Semiconductor, Inc.
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi, sd (the board has no nand neither onenand)
+ */
+
+BOOT_FROM sd
+
+/*
+ * Secure boot support
+ */
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+DATA 4 0x020c4018 0x00260324
+
+DATA 4 0x020c4068 0xffffffff
+DATA 4 0x020c406c 0xffffffff
+DATA 4 0x020c4070 0xffffffff
+DATA 4 0x020c4074 0xffffffff
+DATA 4 0x020c4078 0xffffffff
+DATA 4 0x020c407c 0xffffffff
+DATA 4 0x020c4080 0xffffffff
+
+DATA 4 0x020e0344 0x00003030
+DATA 4 0x020e0348 0x00003030
+DATA 4 0x020e034c 0x00003030
+DATA 4 0x020e0350 0x00003030
+DATA 4 0x020e030c 0x00000030
+DATA 4 0x020e0310 0x00000030
+DATA 4 0x020e0314 0x00000030
+DATA 4 0x020e0318 0x00000030
+DATA 4 0x020e0300 0x00000030
+DATA 4 0x020e031c 0x00000030
+DATA 4 0x020e0338 0x00000028
+DATA 4 0x020e0320 0x00000030
+DATA 4 0x020e032c 0x00000000
+DATA 4 0x020e033c 0x00000008
+DATA 4 0x020e0340 0x00000008
+DATA 4 0x020e05c4 0x00000030
+DATA 4 0x020e05cc 0x00000030
+DATA 4 0x020e05d4 0x00000030
+DATA 4 0x020e05d8 0x00000030
+DATA 4 0x020e05ac 0x00000030
+DATA 4 0x020e05c8 0x00000030
+DATA 4 0x020e05b0 0x00020000
+DATA 4 0x020e05b4 0x00000000
+DATA 4 0x020e05c0 0x00020000
+DATA 4 0x020e05d0 0x00080000
+
+DATA 4 0x021b001c 0x00008000
+DATA 4 0x021b085c 0x1b4700c7
+DATA 4 0x021b0800 0xa1390003
+DATA 4 0x021b0890 0x00400000
+DATA 4 0x021b08b8 0x00000800
+DATA 4 0x021b081c 0x33333333
+DATA 4 0x021b0820 0x33333333
+DATA 4 0x021b0824 0x33333333
+DATA 4 0x021b0828 0x33333333
+DATA 4 0x021b082c 0xf3333333
+DATA 4 0x021b0830 0xf3333333
+DATA 4 0x021b0834 0xf3333333
+DATA 4 0x021b0838 0xf3333333
+DATA 4 0x021b0848 0x4241444a
+DATA 4 0x021b0850 0x3030312b
+DATA 4 0x021b083c 0x20000000
+DATA 4 0x021b0840 0x00000000
+DATA 4 0x021b08c0 0x24911492
+DATA 4 0x021b08b8 0x00000800
+DATA 4 0x021b000c 0x33374133
+DATA 4 0x021b0004 0x00020024
+DATA 4 0x021b0010 0x00100A82
+DATA 4 0x021b0014 0x00000093
+DATA 4 0x021b0018 0x00001688
+DATA 4 0x021b002c 0x0f9f26d2
+DATA 4 0x021b0030 0x009f0e10
+DATA 4 0x021b0038 0x00190778
+DATA 4 0x021b0008 0x00000000
+DATA 4 0x021b0040 0x0000004f
+DATA 4 0x021b0000 0xc3110000
+DATA 4 0x021b001c 0x003f8030
+DATA 4 0x021b001c 0xff0a8030
+DATA 4 0x021b001c 0x82018030
+DATA 4 0x021b001c 0x04028030
+DATA 4 0x021b001c 0x02038030
+DATA 4 0x021b001c 0xff0a8038
+DATA 4 0x021b001c 0x82018038
+DATA 4 0x021b001c 0x04028038
+DATA 4 0x021b001c 0x02038038
+DATA 4 0x021b0800 0xa1310003
+DATA 4 0x021b0020 0x00001800
+DATA 4 0x021b0818 0x00000000
+DATA 4 0x021b08b8 0x00000800
+DATA 4 0x021b0004 0x00025564
+DATA 4 0x021b0404 0x00011006
+DATA 4 0x021b001c 0x00000000
diff --git a/board/freescale/mx6slevk/mx6slevk.c b/board/freescale/mx6slevk/mx6slevk.c
new file mode 100644
index 00000000000..d37d8a4136f
--- /dev/null
+++ b/board/freescale/mx6slevk/mx6slevk.c
@@ -0,0 +1,390 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2013 Freescale Semiconductor, Inc.
+ *
+ * Author: Fabio Estevam <fabio.estevam@freescale.com>
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/mx6-ddr.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/io.h>
+#include <asm/sections.h>
+#include <linux/sizes.h>
+#include <fsl_esdhc_imx.h>
+#include <i2c.h>
+#include <mmc.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_100K_UP | \
+ PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define USDHC_PAD_CTRL (PAD_CTL_PUS_22K_UP | \
+ PAD_CTL_SPEED_LOW | PAD_CTL_DSE_80ohm | \
+ PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define ENET_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_HYS)
+
+#define OTGID_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_47K_UP | PAD_CTL_SPEED_LOW |\
+ PAD_CTL_DSE_80ohm | PAD_CTL_HYS | \
+ PAD_CTL_SRE_FAST)
+
+#define ETH_PHY_POWER IMX_GPIO_NR(4, 21)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const uart1_pads[] = {
+ MX6_PAD_UART1_TXD__UART1_TXD | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX6_PAD_UART1_RXD__UART1_RXD | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+#ifdef CONFIG_SPL_BUILD
+static iomux_v3_cfg_t const usdhc1_pads[] = {
+ /* 8 bit SD */
+ MX6_PAD_SD1_CLK__USDHC1_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_CMD__USDHC1_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT0__USDHC1_DAT0 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT1__USDHC1_DAT1 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT2__USDHC1_DAT2 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT3__USDHC1_DAT3 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT4__USDHC1_DAT4 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT5__USDHC1_DAT5 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT6__USDHC1_DAT6 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD1_DAT7__USDHC1_DAT7 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+
+ /*CD pin*/
+ MX6_PAD_KEY_ROW7__GPIO_4_7 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const usdhc2_pads[] = {
+ MX6_PAD_SD2_CLK__USDHC2_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD2_CMD__USDHC2_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD2_DAT0__USDHC2_DAT0 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD2_DAT1__USDHC2_DAT1 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD2_DAT2__USDHC2_DAT2 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD2_DAT3__USDHC2_DAT3 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+
+ /*CD pin*/
+ MX6_PAD_SD2_DAT7__GPIO_5_0 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const usdhc3_pads[] = {
+ MX6_PAD_SD3_CLK__USDHC3_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD3_CMD__USDHC3_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD3_DAT0__USDHC3_DAT0 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD3_DAT1__USDHC3_DAT1 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD3_DAT2__USDHC3_DAT2 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_SD3_DAT3__USDHC3_DAT3 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+
+ /*CD pin*/
+ MX6_PAD_REF_CLK_32K__GPIO_3_22 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+#endif
+
+static void setup_iomux_uart(void)
+{
+ imx_iomux_v3_setup_multiple_pads(uart1_pads, ARRAY_SIZE(uart1_pads));
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+#ifdef CONFIG_DM_PMIC_PFUZE100
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+ u32 dev_id, rev_id, i;
+ u32 switch_num = 6;
+ u32 offset = PFUZE100_SW1CMODE;
+
+ ret = pmic_get("pfuze100@08", &dev);
+ if (ret == -ENODEV)
+ return 0;
+
+ if (ret != 0)
+ return ret;
+
+ dev_id = pmic_reg_read(dev, PFUZE100_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE100_REVID);
+ printf("PMIC: PFUZE100! DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+ /* set SW1AB staby volatage 0.975V */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABSTBY, 0x3f, 0x1b);
+
+ /* set SW1AB/VDDARM step ramp up time from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABCONF, 0xc0, 0x40);
+
+ /* set SW1C staby volatage 0.975V */
+ pmic_clrsetbits(dev, PFUZE100_SW1CSTBY, 0x3f, 0x1b);
+
+ /* set SW1C/VDDSOC step ramp up time to from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1CCONF, 0xc0, 0x40);
+
+ /* Init mode to APS_PFM */
+ pmic_reg_write(dev, PFUZE100_SW1ABMODE, APS_PFM);
+
+ for (i = 0; i < switch_num - 1; i++)
+ pmic_reg_write(dev, offset + i * SWITCH_SIZE, APS_PFM);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_FEC_MXC
+
+static int setup_fec(void)
+{
+ struct iomuxc *iomuxc_regs = (struct iomuxc *)IOMUXC_BASE_ADDR;
+
+ /* clear gpr1[14], gpr1[18:17] to select anatop clock */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC_MASK, 0);
+
+ return enable_fec_anatop_clock(0, ENET_50MHZ);
+}
+#endif
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+#ifdef CONFIG_FEC_MXC
+ setup_fec();
+#endif
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: MX6SLEVK\n");
+
+ return 0;
+}
+
+#ifdef CONFIG_SPL_BUILD
+#include <spl.h>
+#include <linux/libfdt.h>
+
+#define USDHC1_CD_GPIO IMX_GPIO_NR(4, 7)
+#define USDHC2_CD_GPIO IMX_GPIO_NR(5, 0)
+#define USDHC3_CD_GPIO IMX_GPIO_NR(3, 22)
+
+static struct fsl_esdhc_cfg usdhc_cfg[3] = {
+ {USDHC1_BASE_ADDR},
+ {USDHC2_BASE_ADDR, 0, 4},
+ {USDHC3_BASE_ADDR, 0, 4},
+};
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ struct fsl_esdhc_cfg *cfg = (struct fsl_esdhc_cfg *)mmc->priv;
+ int ret = 0;
+
+ switch (cfg->esdhc_base) {
+ case USDHC1_BASE_ADDR:
+ gpio_request(USDHC1_CD_GPIO, "cd1_gpio");
+ ret = !gpio_get_value(USDHC1_CD_GPIO);
+ break;
+ case USDHC2_BASE_ADDR:
+ gpio_request(USDHC2_CD_GPIO, "cd2_gpio");
+ ret = !gpio_get_value(USDHC2_CD_GPIO);
+ break;
+ case USDHC3_BASE_ADDR:
+ gpio_request(USDHC3_CD_GPIO, "cd3_gpio");
+ ret = !gpio_get_value(USDHC3_CD_GPIO);
+ break;
+ }
+
+ return ret;
+}
+
+int board_mmc_init(struct bd_info *bis)
+{
+ struct src *src_regs = (struct src *)SRC_BASE_ADDR;
+ u32 val;
+ u32 port;
+
+ val = readl(&src_regs->sbmr1);
+
+ /* Boot from USDHC */
+ port = (val >> 11) & 0x3;
+ switch (port) {
+ case 0:
+ imx_iomux_v3_setup_multiple_pads(usdhc1_pads,
+ ARRAY_SIZE(usdhc1_pads));
+ gpio_direction_input(USDHC1_CD_GPIO);
+ usdhc_cfg[0].esdhc_base = USDHC1_BASE_ADDR;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC_CLK);
+ break;
+ case 1:
+ imx_iomux_v3_setup_multiple_pads(usdhc2_pads,
+ ARRAY_SIZE(usdhc2_pads));
+ gpio_direction_input(USDHC2_CD_GPIO);
+ usdhc_cfg[0].esdhc_base = USDHC2_BASE_ADDR;
+ usdhc_cfg[0].max_bus_width = 4;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC2_CLK);
+ break;
+ case 2:
+ imx_iomux_v3_setup_multiple_pads(usdhc3_pads,
+ ARRAY_SIZE(usdhc3_pads));
+ gpio_direction_input(USDHC3_CD_GPIO);
+ usdhc_cfg[0].esdhc_base = USDHC3_BASE_ADDR;
+ usdhc_cfg[0].max_bus_width = 4;
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC3_CLK);
+ break;
+ }
+
+ gd->arch.sdhc_clk = usdhc_cfg[0].sdhc_clk;
+ return fsl_esdhc_initialize(bis, &usdhc_cfg[0]);
+}
+
+const struct mx6sl_iomux_ddr_regs mx6_ddr_ioregs = {
+ .dram_sdqs0 = 0x00003030,
+ .dram_sdqs1 = 0x00003030,
+ .dram_sdqs2 = 0x00003030,
+ .dram_sdqs3 = 0x00003030,
+ .dram_dqm0 = 0x00000030,
+ .dram_dqm1 = 0x00000030,
+ .dram_dqm2 = 0x00000030,
+ .dram_dqm3 = 0x00000030,
+ .dram_cas = 0x00000030,
+ .dram_ras = 0x00000030,
+ .dram_sdclk_0 = 0x00000028,
+ .dram_reset = 0x00000030,
+ .dram_sdba2 = 0x00000000,
+ .dram_odt0 = 0x00000008,
+ .dram_odt1 = 0x00000008,
+};
+
+const struct mx6sl_iomux_grp_regs mx6_grp_ioregs = {
+ .grp_b0ds = 0x00000030,
+ .grp_b1ds = 0x00000030,
+ .grp_b2ds = 0x00000030,
+ .grp_b3ds = 0x00000030,
+ .grp_addds = 0x00000030,
+ .grp_ctlds = 0x00000030,
+ .grp_ddrmode_ctl = 0x00020000,
+ .grp_ddrpke = 0x00000000,
+ .grp_ddrmode = 0x00020000,
+ .grp_ddr_type = 0x00080000,
+};
+
+const struct mx6_mmdc_calibration mx6_mmcd_calib = {
+ .p0_mpdgctrl0 = 0x20000000,
+ .p0_mpdgctrl1 = 0x00000000,
+ .p0_mprddlctl = 0x4241444a,
+ .p0_mpwrdlctl = 0x3030312b,
+ .mpzqlp2ctl = 0x1b4700c7,
+};
+
+static struct mx6_lpddr2_cfg mem_ddr = {
+ .mem_speed = 800,
+ .density = 4,
+ .width = 32,
+ .banks = 8,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .trcd_lp = 2000,
+ .trppb_lp = 2000,
+ .trpab_lp = 2250,
+ .trasmin = 4200,
+};
+
+static void ccgr_init(void)
+{
+ struct mxc_ccm_reg *ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ writel(0xFFFFFFFF, &ccm->CCGR0);
+ writel(0xFFFFFFFF, &ccm->CCGR1);
+ writel(0xFFFFFFFF, &ccm->CCGR2);
+ writel(0xFFFFFFFF, &ccm->CCGR3);
+ writel(0xFFFFFFFF, &ccm->CCGR4);
+ writel(0xFFFFFFFF, &ccm->CCGR5);
+ writel(0xFFFFFFFF, &ccm->CCGR6);
+
+ writel(0x00260324, &ccm->cbcmr);
+}
+
+static void spl_dram_init(void)
+{
+ struct mx6_ddr_sysinfo sysinfo = {
+ .dsize = mem_ddr.width / 32,
+ .cs_density = 20,
+ .ncs = 2,
+ .cs1_mirror = 0,
+ .walat = 0,
+ .ralat = 2,
+ .mif3_mode = 3,
+ .bi_on = 1,
+ .rtt_wr = 0, /* LPDDR2 does not need rtt_wr rtt_nom */
+ .rtt_nom = 0,
+ .sde_to_rst = 0, /* LPDDR2 does not need this field */
+ .rst_to_cke = 0x10, /* JEDEC value for LPDDR2: 200us */
+ .ddr_type = DDR_TYPE_LPDDR2,
+ .refsel = 0, /* Refresh cycles at 64KHz */
+ .refr = 3, /* 4 refresh commands per refresh cycle */
+ };
+ mx6sl_dram_iocfg(32, &mx6_ddr_ioregs, &mx6_grp_ioregs);
+ mx6_dram_cfg(&sysinfo, &mx6_mmcd_calib, &mem_ddr);
+}
+
+void board_init_f(ulong dummy)
+{
+ /* setup AIPS and disable watchdog */
+ arch_cpu_init();
+
+ ccgr_init();
+
+ /* iomux and setup of i2c */
+ board_early_init_f();
+
+ /* setup GP timer */
+ timer_init();
+
+ /* UART clocks enabled and gd valid - init serial console */
+ preloader_console_init();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ /* load/boot image from boot device */
+ board_init_r(NULL, 0);
+}
+#endif
diff --git a/board/freescale/mx6sllevk/Kconfig b/board/freescale/mx6sllevk/Kconfig
new file mode 100644
index 00000000000..d47f1fa9096
--- /dev/null
+++ b/board/freescale/mx6sllevk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX6SLLEVK
+
+config SYS_BOARD
+ default "mx6sllevk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6sllevk"
+
+config IMX_CONFIG
+ default "board/freescale/mx6sllevk/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx6sllevk/MAINTAINERS b/board/freescale/mx6sllevk/MAINTAINERS
new file mode 100644
index 00000000000..b82273c0162
--- /dev/null
+++ b/board/freescale/mx6sllevk/MAINTAINERS
@@ -0,0 +1,7 @@
+MX6SLLEVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6sllevk/
+F: include/configs/mx6sllevk.h
+F: configs/mx6sllevk_defconfig
+F: configs/mx6sllevk_plugin_defconfig
diff --git a/board/freescale/mx6sllevk/Makefile b/board/freescale/mx6sllevk/Makefile
new file mode 100644
index 00000000000..8f724ccfc92
--- /dev/null
+++ b/board/freescale/mx6sllevk/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2016 Freescale Semiconductor, Inc.
+
+obj-y := mx6sllevk.o
diff --git a/board/freescale/mx6sllevk/imximage.cfg b/board/freescale/mx6sllevk/imximage.cfg
new file mode 100644
index 00000000000..550be3f6c12
--- /dev/null
+++ b/board/freescale/mx6sllevk/imximage.cfg
@@ -0,0 +1,125 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ *
+ * Refer docs/README.imxmage for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi, sd (the board has no nand neither onenand)
+ */
+
+BOOT_FROM sd
+
+#ifdef CONFIG_USE_IMXIMG_PLUGIN
+/*PLUGIN plugin-binary-file IRAM_FREE_START_ADDR*/
+PLUGIN board/freescale/mx6sllevk/plugin.bin 0x00907000
+#else
+
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Enable all clocks */
+DATA 4 0x020c4068 0xffffffff
+DATA 4 0x020c406c 0xffffffff
+DATA 4 0x020c4070 0xffffffff
+DATA 4 0x020c4074 0xffffffff
+DATA 4 0x020c4078 0xffffffff
+DATA 4 0x020c407c 0xffffffff
+DATA 4 0x020c4080 0xffffffff
+
+DATA 4 0x020E0550 0x00080000
+DATA 4 0x020E0534 0x00000000
+DATA 4 0x020E02AC 0x00000030
+DATA 4 0x020E0548 0x00000030
+DATA 4 0x020E052C 0x00000030
+DATA 4 0x020E0530 0x00020000
+DATA 4 0x020E02B0 0x00003030
+DATA 4 0x020E02B4 0x00003030
+DATA 4 0x020E02B8 0x00003030
+DATA 4 0x020E02BC 0x00003030
+DATA 4 0x020E0540 0x00020000
+DATA 4 0x020E0544 0x00000030
+DATA 4 0x020E054C 0x00000030
+DATA 4 0x020E0554 0x00000030
+DATA 4 0x020E0558 0x00000030
+DATA 4 0x020E0294 0x00000030
+DATA 4 0x020E0298 0x00000030
+DATA 4 0x020E029C 0x00000030
+DATA 4 0x020E02A0 0x00000030
+DATA 4 0x020E02C0 0x00082030
+
+DATA 4 0x021B001C 0x00008000
+
+DATA 4 0x021B0800 0xA1390003
+DATA 4 0x021B085c 0x084700C7
+DATA 4 0x021B0890 0x00400000
+DATA 4 0x021B0848 0x3F393B3C
+DATA 4 0x021B0850 0x262C3826
+DATA 4 0x021B081C 0x33333333
+DATA 4 0x021B0820 0x33333333
+DATA 4 0x021B0824 0x33333333
+DATA 4 0x021B0828 0x33333333
+
+DATA 4 0x021B082C 0xf3333333
+DATA 4 0x021B0830 0xf3333333
+DATA 4 0x021B0834 0xf3333333
+DATA 4 0x021B0838 0xf3333333
+DATA 4 0x021B08C0 0x24922492
+DATA 4 0x021B08b8 0x00000800
+
+DATA 4 0x021B0004 0x00020052
+DATA 4 0x021B000C 0x53574333
+DATA 4 0x021B0010 0x00100B22
+DATA 4 0x021B0038 0x00170778
+DATA 4 0x021B0014 0x00C700DB
+DATA 4 0x021B0018 0x00201718
+DATA 4 0x021B002C 0x0F9F26D2
+DATA 4 0x021B0030 0x009F0E10
+DATA 4 0x021B0040 0x0000005F
+DATA 4 0x021B0000 0xC4190000
+
+DATA 4 0x021B083C 0x20000000
+
+DATA 4 0x021B001C 0x00008050
+DATA 4 0x021B001C 0x00008058
+DATA 4 0x021B001C 0x003F8030
+DATA 4 0x021B001C 0x003F8038
+DATA 4 0x021B001C 0xFF0A8030
+DATA 4 0x021B001C 0xFF0A8038
+DATA 4 0x021B001C 0x04028030
+DATA 4 0x021B001C 0x04028038
+DATA 4 0x021B001C 0x83018030
+DATA 4 0x021B001C 0x83018038
+DATA 4 0x021B001C 0x01038030
+DATA 4 0x021B001C 0x01038038
+
+DATA 4 0x021B0020 0x00001800
+DATA 4 0x021B0800 0xA1390003
+DATA 4 0x021B0004 0x00020052
+DATA 4 0x021B0404 0x00011006
+DATA 4 0x021B001C 0x00000000
+#endif
diff --git a/board/freescale/mx6sllevk/mx6sllevk.c b/board/freescale/mx6sllevk/mx6sllevk.c
new file mode 100644
index 00000000000..7114444fc3e
--- /dev/null
+++ b/board/freescale/mx6sllevk/mx6sllevk.c
@@ -0,0 +1,115 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <init.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/io.h>
+#include <linux/sizes.h>
+#include <mmc.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const wdog_pads[] = {
+ MX6_PAD_WDOG_B__WDOG1_B | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+#ifdef CONFIG_DM_PMIC_PFUZE100
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+ u32 dev_id, rev_id, i;
+ u32 switch_num = 6;
+ u32 offset = PFUZE100_SW1CMODE;
+
+ ret = pmic_get("pfuze100@8", &dev);
+ if (ret == -ENODEV)
+ return 0;
+
+ if (ret != 0)
+ return ret;
+
+ dev_id = pmic_reg_read(dev, PFUZE100_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE100_REVID);
+ printf("PMIC: PFUZE100! DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+
+ /* Init mode to APS_PFM */
+ pmic_reg_write(dev, PFUZE100_SW1ABMODE, APS_PFM);
+
+ for (i = 0; i < switch_num - 1; i++)
+ pmic_reg_write(dev, offset + i * SWITCH_SIZE, APS_PFM);
+
+ /* set SW1AB staby volatage 0.975V */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABSTBY, 0x3f, 0x1b);
+
+ /* set SW1AB/VDDARM step ramp up time from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABCONF, 0xc0, 0x40);
+
+ /* set SW1C staby volatage 0.975V */
+ pmic_clrsetbits(dev, PFUZE100_SW1CSTBY, 0x3f, 0x1b);
+
+ /* set SW1C/VDDSOC step ramp up time to from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1CCONF, 0xc0, 0x40);
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ return 0;
+}
+
+int board_init(void)
+{
+ /* Address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ return 0;
+}
+
+int board_late_init(void)
+{
+ imx_iomux_v3_setup_multiple_pads(wdog_pads, ARRAY_SIZE(wdog_pads));
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: MX6SLL EVK\n");
+
+ return 0;
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int mmc_map_to_kernel_blk(int devno)
+{
+ return devno;
+}
diff --git a/board/freescale/mx6sllevk/plugin.S b/board/freescale/mx6sllevk/plugin.S
new file mode 100644
index 00000000000..dcf5e14d48a
--- /dev/null
+++ b/board/freescale/mx6sllevk/plugin.S
@@ -0,0 +1,154 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+
+/* DDR script */
+.macro imx6sll_evk_ddr_setting
+ ldr r0, =IOMUXC_BASE_ADDR
+ ldr r1, =0x00080000
+ str r1, [r0, #0x550]
+ ldr r1, =0x00000000
+ str r1, [r0, #0x534]
+ ldr r1, =0x00000030
+ str r1, [r0, #0x2AC]
+ str r1, [r0, #0x548]
+ str r1, [r0, #0x52C]
+ ldr r1, =0x00020000
+ str r1, [r0, #0x530]
+ ldr r1, =0x00003030
+ str r1, [r0, #0x2B0]
+ str r1, [r0, #0x2B4]
+ str r1, [r0, #0x2B8]
+ str r1, [r0, #0x2BC]
+
+ ldr r1, =0x00020000
+ str r1, [r0, #0x540]
+ ldr r1, =0x00000030
+ str r1, [r0, #0x544]
+ str r1, [r0, #0x54C]
+ str r1, [r0, #0x554]
+ str r1, [r0, #0x558]
+ str r1, [r0, #0x294]
+ str r1, [r0, #0x298]
+ str r1, [r0, #0x29C]
+ str r1, [r0, #0x2A0]
+
+ ldr r1, =0x00082030
+ str r1, [r0, #0x2C0]
+
+ ldr r0, =MMDC_P0_BASE_ADDR
+ ldr r1, =0x00008000
+ str r1, [r0, #0x1C]
+ ldr r1, =0xA1390003
+ str r1, [r0, #0x800]
+ ldr r1, =0x084700C7
+ str r1, [r0, #0x85C]
+ ldr r1, =0x00400000
+ str r1, [r0, #0x890]
+
+ ldr r1, =0x3F393B3C
+ str r1, [r0, #0x848]
+ ldr r1, =0x262C3826
+ str r1, [r0, #0x850]
+
+ ldr r1, =0x33333333
+ str r1, [r0, #0x81C]
+ str r1, [r0, #0x820]
+ str r1, [r0, #0x824]
+ str r1, [r0, #0x828]
+
+ ldr r1, =0xf3333333
+ str r1, [r0, #0x82C]
+ str r1, [r0, #0x830]
+ str r1, [r0, #0x834]
+ str r1, [r0, #0x838]
+
+ ldr r1, =0x24922492
+ str r1, [r0, #0x8C0]
+ ldr r1, =0x00000800
+ str r1, [r0, #0x8B8]
+
+ ldr r1, =0x00020052
+ str r1, [r0, #0x004]
+ ldr r1, =0x53574333
+ str r1, [r0, #0x00C]
+ ldr r1, =0x00100B22
+ str r1, [r0, #0x010]
+ ldr r1, =0x00170778
+ str r1, [r0, #0x038]
+ ldr r1, =0x00C700DB
+ str r1, [r0, #0x014]
+ ldr r1, =0x00201718
+ str r1, [r0, #0x018]
+ ldr r1, =0x0F9F26D2
+ str r1, [r0, #0x02C]
+ ldr r1, =0x009F0E10
+ str r1, [r0, #0x030]
+ ldr r1, =0x0000005F
+ str r1, [r0, #0x040]
+ ldr r1, =0xC4190000
+ str r1, [r0, #0x000]
+ ldr r1, =0x20000000
+ str r1, [r0, #0x83C]
+
+ ldr r1, =0x00008050
+ str r1, [r0, #0x01C]
+ ldr r1, =0x00008058
+ str r1, [r0, #0x01C]
+ ldr r1, =0x003F8030
+ str r1, [r0, #0x01C]
+ ldr r1, =0x003F8038
+ str r1, [r0, #0x01C]
+ ldr r1, =0xFF0A8030
+ str r1, [r0, #0x01C]
+ ldr r1, =0xFF0A8038
+ str r1, [r0, #0x01C]
+ ldr r1, =0x04028030
+ str r1, [r0, #0x01C]
+ ldr r1, =0x04028038
+ str r1, [r0, #0x01C]
+ ldr r1, =0x83018030
+ str r1, [r0, #0x01C]
+ ldr r1, =0x83018038
+ str r1, [r0, #0x01C]
+ ldr r1, =0x01038030
+ str r1, [r0, #0x01C]
+ ldr r1, =0x01038038
+ str r1, [r0, #0x01C]
+
+ ldr r1, =0x00001800
+ str r1, [r0, #0x020]
+ ldr r1, =0xA1390003
+ str r1, [r0, #0x800]
+ ldr r1, =0x00020052
+ str r1, [r0, #0x004]
+ ldr r1, =0x00011006
+ str r1, [r0, #0x404]
+ ldr r1, =0x00000000
+ str r1, [r0, #0x01C]
+.endm
+
+.macro imx6_clock_gating
+ ldr r0, =CCM_BASE_ADDR
+ ldr r1, =0xffffffff
+ str r1, [r0, #0x068]
+ str r1, [r0, #0x06c]
+ str r1, [r0, #0x070]
+ str r1, [r0, #0x074]
+ str r1, [r0, #0x078]
+ str r1, [r0, #0x07c]
+ str r1, [r0, #0x080]
+.endm
+
+.macro imx6_qos_setting
+.endm
+
+.macro imx6_ddr_setting
+ imx6sll_evk_ddr_setting
+.endm
+
+/* include the common plugin code here */
+#include <asm/arch/mx6_plugin.S>
diff --git a/board/freescale/mx6sxsabreauto/Kconfig b/board/freescale/mx6sxsabreauto/Kconfig
new file mode 100644
index 00000000000..e6da7b38f91
--- /dev/null
+++ b/board/freescale/mx6sxsabreauto/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX6SXSABREAUTO
+
+config SYS_BOARD
+ default "mx6sxsabreauto"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6sxsabreauto"
+
+config IMX_CONFIG
+ default "board/freescale/mx6sxsabreauto/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx6sxsabreauto/MAINTAINERS b/board/freescale/mx6sxsabreauto/MAINTAINERS
new file mode 100644
index 00000000000..8dc62e5e3e5
--- /dev/null
+++ b/board/freescale/mx6sxsabreauto/MAINTAINERS
@@ -0,0 +1,6 @@
+MX6SXSABREAUTO BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6sxsabreauto/
+F: include/configs/mx6sxsabreauto.h
+F: configs/mx6sxsabreauto_defconfig
diff --git a/board/freescale/mx6sxsabreauto/Makefile b/board/freescale/mx6sxsabreauto/Makefile
new file mode 100644
index 00000000000..50f29a9dd02
--- /dev/null
+++ b/board/freescale/mx6sxsabreauto/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2014 Freescale Semiconductor, Inc.
+
+obj-y := mx6sxsabreauto.o
diff --git a/board/freescale/mx6sxsabreauto/imximage.cfg b/board/freescale/mx6sxsabreauto/imximage.cfg
new file mode 100644
index 00000000000..da703093aa6
--- /dev/null
+++ b/board/freescale/mx6sxsabreauto/imximage.cfg
@@ -0,0 +1,134 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Enable all clocks */
+DATA 4 0x020c4068 0xffffffff
+DATA 4 0x020c406c 0xffffffff
+DATA 4 0x020c4070 0xffffffff
+DATA 4 0x020c4074 0xffffffff
+DATA 4 0x020c4078 0xffffffff
+DATA 4 0x020c407c 0xffffffff
+DATA 4 0x020c4080 0xffffffff
+DATA 4 0x020c4084 0xffffffff
+
+/* IOMUX - DDR IO Type */
+DATA 4 0x020e0618 0x000c0000
+DATA 4 0x020e05fc 0x00000000
+
+/* Clock */
+DATA 4 0x020e032c 0x00000030
+
+/* Address */
+DATA 4 0x020e0300 0x00000030
+DATA 4 0x020e02fc 0x00000030
+DATA 4 0x020e05f4 0x00000030
+
+/* Control */
+DATA 4 0x020e0340 0x00000030
+
+DATA 4 0x020e0320 0x00000000
+DATA 4 0x020e0310 0x00000030
+DATA 4 0x020e0314 0x00000030
+DATA 4 0x020e0614 0x00000030
+
+/* Data Strobe */
+DATA 4 0x020e05f8 0x00020000
+DATA 4 0x020e0330 0x00000030
+DATA 4 0x020e0334 0x00000030
+DATA 4 0x020e0338 0x00000030
+DATA 4 0x020e033c 0x00000030
+
+/* Data */
+DATA 4 0x020e0608 0x00020000
+DATA 4 0x020e060c 0x00000030
+DATA 4 0x020e0610 0x00000030
+DATA 4 0x020e061c 0x00000030
+DATA 4 0x020e0620 0x00000030
+DATA 4 0x020e02ec 0x00000030
+DATA 4 0x020e02f0 0x00000030
+DATA 4 0x020e02f4 0x00000030
+DATA 4 0x020e02f8 0x00000030
+
+/* Calibrations - ZQ */
+DATA 4 0x021b0800 0xa1390003
+
+/* Write leveling */
+DATA 4 0x021b080c 0x002C003D
+DATA 4 0x021b0810 0x00110046
+
+/* DQS Read Gate */
+DATA 4 0x021b083c 0x4160016C
+DATA 4 0x021b0840 0x013C016C
+
+/* Read/Write Delay */
+DATA 4 0x021b0848 0x46424446
+DATA 4 0x021b0850 0x3A3C3C3A
+
+DATA 4 0x021b08c0 0x2492244A
+
+/* read data bit delay */
+DATA 4 0x021b081c 0x33333333
+DATA 4 0x021b0820 0x33333333
+DATA 4 0x021b0824 0x33333333
+DATA 4 0x021b0828 0x33333333
+
+/* Complete calibration by forced measurement */
+DATA 4 0x021b08b8 0x00000800
+
+/* MMDC init - DDR3, 64-bit mode, only MMDC0 is initiated */
+DATA 4 0x021b0004 0x0002002d
+DATA 4 0x021b0008 0x00333030
+DATA 4 0x021b000c 0x676b52f3
+DATA 4 0x021b0010 0xb66d8b63
+DATA 4 0x021b0014 0x01ff00db
+DATA 4 0x021b0018 0x00011740
+DATA 4 0x021b001c 0x00008000
+DATA 4 0x021b002c 0x000026d2
+DATA 4 0x021b0030 0x006b1023
+DATA 4 0x021b0040 0x0000007f
+DATA 4 0x021b0000 0x85190000
+
+/* Initialize MT41K256M16HA-125 - MR2 */
+DATA 4 0x021b001c 0x04008032
+/* MR3 */
+DATA 4 0x021b001c 0x00008033
+/* MR1 */
+DATA 4 0x021b001c 0x00068031
+/* MR0 */
+DATA 4 0x021b001c 0x05208030
+/* DDR device ZQ calibration */
+DATA 4 0x021b001c 0x04008040
+
+/* Final DDR setup, before operation start */
+DATA 4 0x021b0020 0x00000800
+DATA 4 0x021b0818 0x00022227
+DATA 4 0x021b0004 0x0002556d
+DATA 4 0x021b0404 0x00011006
+DATA 4 0x021b001c 0x00000000
diff --git a/board/freescale/mx6sxsabreauto/mx6sxsabreauto.c b/board/freescale/mx6sxsabreauto/mx6sxsabreauto.c
new file mode 100644
index 00000000000..6176f738238
--- /dev/null
+++ b/board/freescale/mx6sxsabreauto/mx6sxsabreauto.c
@@ -0,0 +1,325 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2014 Freescale Semiconductor, Inc.
+ *
+ * Author: Ye Li <ye.li@nxp.com>
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+#include <linux/sizes.h>
+#include <config.h>
+#include <fsl_esdhc_imx.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+#include <usb.h>
+#include <usb/ehci-ci.h>
+#include <pca953x.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define ENET_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_SPEED_HIGH | \
+ PAD_CTL_DSE_48ohm | PAD_CTL_SRE_FAST)
+
+#define ENET_CLK_PAD_CTRL (PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_120ohm | PAD_CTL_SRE_FAST)
+
+#define ENET_RX_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_SPEED_HIGH | PAD_CTL_SRE_FAST)
+
+#define GPMI_PAD_CTRL0 (PAD_CTL_PKE | PAD_CTL_PUE | PAD_CTL_PUS_100K_UP)
+#define GPMI_PAD_CTRL1 (PAD_CTL_DSE_40ohm | PAD_CTL_SPEED_MED | \
+ PAD_CTL_SRE_FAST)
+#define GPMI_PAD_CTRL2 (GPMI_PAD_CTRL0 | GPMI_PAD_CTRL1)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const fec2_pads[] = {
+ MX6_PAD_ENET1_MDC__ENET2_MDC | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_ENET1_MDIO__ENET2_MDIO | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_RX_CTL__ENET2_RX_EN | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_RD0__ENET2_RX_DATA_0 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_RD1__ENET2_RX_DATA_1 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_RD2__ENET2_RX_DATA_2 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_RD3__ENET2_RX_DATA_3 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_RXC__ENET2_RX_CLK | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII2_TX_CTL__ENET2_TX_EN | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_TD0__ENET2_TX_DATA_0 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_TD1__ENET2_TX_DATA_1 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_TD2__ENET2_TX_DATA_2 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_TD3__ENET2_TX_DATA_3 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII2_TXC__ENET2_RGMII_TXC | MUX_PAD_CTRL(ENET_PAD_CTRL),
+};
+
+static int setup_fec(void)
+{
+ struct iomuxc *iomuxc_regs = (struct iomuxc *)IOMUXC_BASE_ADDR;
+
+ /* Use 125MHz anatop loopback REF_CLK1 for ENET2 */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC2_MASK, 0);
+
+ return enable_fec_anatop_clock(1, ENET_125MHZ);
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ int ret;
+
+ imx_iomux_v3_setup_multiple_pads(fec2_pads, ARRAY_SIZE(fec2_pads));
+ setup_fec();
+
+ ret = fecmxc_initialize_multi(bis, 1,
+ CFG_FEC_MXC_PHYADDR, IMX_FEC_BASE);
+ if (ret)
+ printf("FEC%d MXC: %s:failed\n", 1, __func__);
+
+ return ret;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ /*
+ * Enable 1.8V(SEL_1P5_1P8_POS_REG) on
+ * Phy control debug reg 0
+ */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x1f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x8);
+
+ /* rgmii tx clock delay enable */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x05);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x100);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret;
+ u32 dev_id, rev_id, i;
+ u32 switch_num = 6;
+ u32 offset = PFUZE100_SW1CMODE;
+
+ ret = pmic_get("pfuze100", &dev);
+ if (ret == -ENODEV)
+ return 0;
+
+ if (ret != 0)
+ return ret;
+
+ dev_id = pmic_reg_read(dev, PFUZE100_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE100_REVID);
+ printf("PMIC: PFUZE100! DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+
+ /* Init mode to APS_PFM */
+ pmic_reg_write(dev, PFUZE100_SW1ABMODE, APS_PFM);
+
+ for (i = 0; i < switch_num - 1; i++)
+ pmic_reg_write(dev, offset + i * SWITCH_SIZE, APS_PFM);
+
+ /* set SW1AB staby volatage 0.975V */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABSTBY, 0x3f, 0x1b);
+
+ /* set SW1AB/VDDARM step ramp up time from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1ABCONF, 0xc0, 0x40);
+
+ /* set SW1C staby volatage 1.10V */
+ pmic_clrsetbits(dev, PFUZE100_SW1CSTBY, 0x3f, 0x20);
+
+ /* set SW1C/VDDSOC step ramp up time to from 16us to 4us/25mV */
+ pmic_clrsetbits(dev, PFUZE100_SW1CCONF, 0xc0, 0x40);
+
+ return 0;
+}
+
+#ifdef CONFIG_USB_EHCI_MX6
+#define USB_OTHERREGS_OFFSET 0x800
+#define UCTRL_PWR_POL (1 << 9)
+
+static iomux_v3_cfg_t const usb_otg_pads[] = {
+ /* OGT1 */
+ MX6_PAD_GPIO1_IO09__USB_OTG1_PWR | MUX_PAD_CTRL(NO_PAD_CTRL),
+ MX6_PAD_GPIO1_IO10__ANATOP_OTG1_ID | MUX_PAD_CTRL(NO_PAD_CTRL),
+ /* OTG2 */
+ MX6_PAD_GPIO1_IO12__USB_OTG2_PWR | MUX_PAD_CTRL(NO_PAD_CTRL)
+};
+
+static void setup_usb(void)
+{
+ imx_iomux_v3_setup_multiple_pads(usb_otg_pads,
+ ARRAY_SIZE(usb_otg_pads));
+}
+
+int board_usb_phy_mode(int port)
+{
+ if (port == 1)
+ return USB_INIT_HOST;
+ else
+ return usb_phy_mode(port);
+}
+
+int board_ehci_hcd_init(int port)
+{
+ u32 *usbnc_usb_ctrl;
+
+ if (port > 1)
+ return -EINVAL;
+
+ usbnc_usb_ctrl = (u32 *)(USB_BASE_ADDR + USB_OTHERREGS_OFFSET +
+ port * 4);
+
+ /* Set Power polarity */
+ setbits_le32(usbnc_usb_ctrl, UCTRL_PWR_POL);
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ return 0;
+}
+
+#ifdef CONFIG_FSL_QSPI
+int board_qspi_init(void)
+{
+ /* Set the clock */
+ enable_qspi_clk(0);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_NAND_MXS
+iomux_v3_cfg_t gpmi_pads[] = {
+ MX6_PAD_NAND_CLE__RAWNAND_CLE | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_ALE__RAWNAND_ALE | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_WP_B__RAWNAND_WP_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_READY_B__RAWNAND_READY_B | MUX_PAD_CTRL(GPMI_PAD_CTRL0),
+ MX6_PAD_NAND_CE0_B__RAWNAND_CE0_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_RE_B__RAWNAND_RE_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_WE_B__RAWNAND_WE_B | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA00__RAWNAND_DATA00 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA01__RAWNAND_DATA01 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA02__RAWNAND_DATA02 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA03__RAWNAND_DATA03 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA04__RAWNAND_DATA04 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA05__RAWNAND_DATA05 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA06__RAWNAND_DATA06 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+ MX6_PAD_NAND_DATA07__RAWNAND_DATA07 | MUX_PAD_CTRL(GPMI_PAD_CTRL2),
+};
+
+static void setup_gpmi_nand(void)
+{
+ struct mxc_ccm_reg *mxc_ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ /* config gpmi nand iomux */
+ imx_iomux_v3_setup_multiple_pads(gpmi_pads, ARRAY_SIZE(gpmi_pads));
+
+ setup_gpmi_io_clk((MXC_CCM_CS2CDR_QSPI2_CLK_PODF(0) |
+ MXC_CCM_CS2CDR_QSPI2_CLK_PRED(3) |
+ MXC_CCM_CS2CDR_QSPI2_CLK_SEL(3)));
+
+ /* enable apbh clock gating */
+ setbits_le32(&mxc_ccm->CCGR0, MXC_CCM_CCGR0_APBHDMA_MASK);
+}
+#endif
+
+int board_init(void)
+{
+ struct gpio_desc desc;
+ int ret;
+
+ /* Address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ ret = dm_gpio_lookup_name("gpio@30_4", &desc);
+ if (ret)
+ return ret;
+
+ ret = dm_gpio_request(&desc, "cpu_per_rst_b");
+ if (ret)
+ return ret;
+ /* Reset CPU_PER_RST_B signal for enet phy and PCIE */
+ dm_gpio_set_dir_flags(&desc, GPIOD_IS_OUT);
+ udelay(500);
+ dm_gpio_set_value(&desc, 1);
+
+ ret = dm_gpio_lookup_name("gpio@32_2", &desc);
+ if (ret)
+ return ret;
+
+ ret = dm_gpio_request(&desc, "steer_enet");
+ if (ret)
+ return ret;
+
+ dm_gpio_set_dir_flags(&desc, GPIOD_IS_OUT);
+ udelay(500);
+ /* Set steering signal to L for selecting B0 */
+ dm_gpio_set_value(&desc, 0);
+
+#ifdef CONFIG_USB_EHCI_MX6
+ setup_usb();
+#endif
+
+#ifdef CONFIG_FSL_QSPI
+ board_qspi_init();
+#endif
+
+#ifdef CONFIG_NAND_MXS
+ setup_gpmi_nand();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_CMD_BMODE
+static const struct boot_mode board_boot_modes[] = {
+ {"sda", MAKE_CFGVAL(0x42, 0x30, 0x00, 0x00)},
+ {"sdb", MAKE_CFGVAL(0x40, 0x38, 0x00, 0x00)},
+ {"qspi1", MAKE_CFGVAL(0x10, 0x00, 0x00, 0x00)},
+ {"nand", MAKE_CFGVAL(0x82, 0x00, 0x00, 0x00)},
+ {NULL, 0},
+};
+#endif
+
+int board_late_init(void)
+{
+#ifdef CONFIG_CMD_BMODE
+ add_board_boot_modes(board_boot_modes);
+#endif
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: MX6SX SABRE AUTO\n");
+
+ return 0;
+}
diff --git a/board/freescale/mx6sxsabresd/Kconfig b/board/freescale/mx6sxsabresd/Kconfig
new file mode 100644
index 00000000000..88ac7ee8050
--- /dev/null
+++ b/board/freescale/mx6sxsabresd/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX6SXSABRESD
+
+config SYS_BOARD
+ default "mx6sxsabresd"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6sxsabresd"
+
+config IMX_CONFIG
+ default "board/freescale/mx6sxsabresd/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx6sxsabresd/MAINTAINERS b/board/freescale/mx6sxsabresd/MAINTAINERS
new file mode 100644
index 00000000000..b3c8b56f1f1
--- /dev/null
+++ b/board/freescale/mx6sxsabresd/MAINTAINERS
@@ -0,0 +1,6 @@
+MX6SXSABRESD BOARD
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/mx6sxsabresd/
+F: include/configs/mx6sxsabresd.h
+F: configs/mx6sxsabresd_defconfig
diff --git a/board/freescale/mx6sxsabresd/Makefile b/board/freescale/mx6sxsabresd/Makefile
new file mode 100644
index 00000000000..266bd4ac495
--- /dev/null
+++ b/board/freescale/mx6sxsabresd/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2014 Freescale Semiconductor, Inc.
+
+obj-y := mx6sxsabresd.o
diff --git a/board/freescale/mx6sxsabresd/imximage.cfg b/board/freescale/mx6sxsabresd/imximage.cfg
new file mode 100644
index 00000000000..313ab589505
--- /dev/null
+++ b/board/freescale/mx6sxsabresd/imximage.cfg
@@ -0,0 +1,137 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+/*
+ * Secure boot support
+ */
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Enable all clocks */
+DATA 4 0x020c4068 0xffffffff
+DATA 4 0x020c406c 0xffffffff
+DATA 4 0x020c4070 0xffffffff
+DATA 4 0x020c4074 0xffffffff
+DATA 4 0x020c4078 0xffffffff
+DATA 4 0x020c407c 0xffffffff
+DATA 4 0x020c4080 0xffffffff
+DATA 4 0x020c4084 0xffffffff
+
+/* IOMUX - DDR IO Type */
+DATA 4 0x020e0618 0x000c0000
+DATA 4 0x020e05fc 0x00000000
+
+/* Clock */
+DATA 4 0x020e032c 0x00000030
+
+/* Address */
+DATA 4 0x020e0300 0x00000020
+DATA 4 0x020e02fc 0x00000020
+DATA 4 0x020e05f4 0x00000020
+
+/* Control */
+DATA 4 0x020e0340 0x00000020
+
+DATA 4 0x020e0320 0x00000000
+DATA 4 0x020e0310 0x00000020
+DATA 4 0x020e0314 0x00000020
+DATA 4 0x020e0614 0x00000020
+
+/* Data Strobe */
+DATA 4 0x020e05f8 0x00020000
+DATA 4 0x020e0330 0x00000028
+DATA 4 0x020e0334 0x00000028
+DATA 4 0x020e0338 0x00000028
+DATA 4 0x020e033c 0x00000028
+
+/* Data */
+DATA 4 0x020e0608 0x00020000
+DATA 4 0x020e060c 0x00000028
+DATA 4 0x020e0610 0x00000028
+DATA 4 0x020e061c 0x00000028
+DATA 4 0x020e0620 0x00000028
+DATA 4 0x020e02ec 0x00000028
+DATA 4 0x020e02f0 0x00000028
+DATA 4 0x020e02f4 0x00000028
+DATA 4 0x020e02f8 0x00000028
+
+/* Calibrations - ZQ */
+DATA 4 0x021b0800 0xa1390003
+
+/* Write leveling */
+DATA 4 0x021b080c 0x00290025
+DATA 4 0x021b0810 0x00220022
+
+/* DQS Read Gate */
+DATA 4 0x021b083c 0x41480144
+DATA 4 0x021b0840 0x01340130
+
+/* Read/Write Delay */
+DATA 4 0x021b0848 0x3C3E4244
+DATA 4 0x021b0850 0x34363638
+
+/* Read data bit delay */
+DATA 4 0x021b081c 0x33333333
+DATA 4 0x021b0820 0x33333333
+DATA 4 0x021b0824 0x33333333
+DATA 4 0x021b0828 0x33333333
+
+/* Complete calibration by forced measurement */
+DATA 4 0x021b08b8 0x00000800
+
+/* MMDC init - DDR3, 64-bit mode, only MMDC0 is initiated */
+DATA 4 0x021b0004 0x0002002d
+DATA 4 0x021b0008 0x00333030
+DATA 4 0x021b000c 0x676b52f3
+DATA 4 0x021b0010 0xb66d8b63
+DATA 4 0x021b0014 0x01ff00db
+DATA 4 0x021b0018 0x00011740
+DATA 4 0x021b001c 0x00008000
+DATA 4 0x021b002c 0x000026d2
+DATA 4 0x021b0030 0x006b1023
+DATA 4 0x021b0040 0x0000005f
+DATA 4 0x021b0000 0x84190000
+
+/* Initialize MT41K256M16HA-125 - MR2 */
+DATA 4 0x021b001c 0x04008032
+/* MR3 */
+DATA 4 0x021b001c 0x00008033
+/* MR1 */
+DATA 4 0x021b001c 0x00048031
+/* MR0 */
+DATA 4 0x021b001c 0x05208030
+/* DDR device ZQ calibration */
+DATA 4 0x021b001c 0x04008040
+
+/* Final DDR setup, before operation start */
+DATA 4 0x021b0020 0x00000800
+DATA 4 0x021b0818 0x00011117
+DATA 4 0x021b001c 0x00000000
diff --git a/board/freescale/mx6sxsabresd/mx6sxsabresd.c b/board/freescale/mx6sxsabresd/mx6sxsabresd.c
new file mode 100644
index 00000000000..e3353feec68
--- /dev/null
+++ b/board/freescale/mx6sxsabresd/mx6sxsabresd.c
@@ -0,0 +1,328 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2014 Freescale Semiconductor, Inc.
+ *
+ * Author: Fabio Estevam <fabio.estevam@freescale.com>
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/io.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <env.h>
+#include <linux/delay.h>
+#include <linux/sizes.h>
+#include <fsl_esdhc_imx.h>
+#include <mmc.h>
+#include <i2c.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <power/pmic.h>
+#include <power/pfuze100_pmic.h>
+#include "../common/pfuze.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define USDHC_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_22K_UP | PAD_CTL_SPEED_LOW | \
+ PAD_CTL_DSE_80ohm | PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define ENET_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_SPEED_HIGH | \
+ PAD_CTL_DSE_48ohm | PAD_CTL_SRE_FAST)
+
+#define ENET_CLK_PAD_CTRL (PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_120ohm | PAD_CTL_SRE_FAST)
+
+#define ENET_RX_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_SPEED_HIGH | PAD_CTL_SRE_FAST)
+
+#define LCD_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_PKE | PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm)
+
+#define WDOG_PAD_CTRL (PAD_CTL_PUE | PAD_CTL_PKE | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const uart1_pads[] = {
+ MX6_PAD_GPIO1_IO04__UART1_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX6_PAD_GPIO1_IO05__UART1_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const wdog_b_pad = {
+ MX6_PAD_GPIO1_IO13__GPIO1_IO_13 | MUX_PAD_CTRL(WDOG_PAD_CTRL),
+};
+static iomux_v3_cfg_t const fec1_pads[] = {
+ MX6_PAD_ENET1_MDC__ENET1_MDC | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_ENET1_MDIO__ENET1_MDIO | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_RX_CTL__ENET1_RX_EN | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_RD0__ENET1_RX_DATA_0 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_RD1__ENET1_RX_DATA_1 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_RD2__ENET1_RX_DATA_2 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_RD3__ENET1_RX_DATA_3 | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_RXC__ENET1_RX_CLK | MUX_PAD_CTRL(ENET_RX_PAD_CTRL),
+ MX6_PAD_RGMII1_TX_CTL__ENET1_TX_EN | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_TD0__ENET1_TX_DATA_0 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_TD1__ENET1_TX_DATA_1 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_TD2__ENET1_TX_DATA_2 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_TD3__ENET1_TX_DATA_3 | MUX_PAD_CTRL(ENET_PAD_CTRL),
+ MX6_PAD_RGMII1_TXC__ENET1_RGMII_TXC | MUX_PAD_CTRL(ENET_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const peri_3v3_pads[] = {
+ MX6_PAD_QSPI1A_DATA0__GPIO4_IO_16 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const phy_control_pads[] = {
+ /* 25MHz Ethernet PHY Clock */
+ MX6_PAD_ENET2_RX_CLK__ENET2_REF_CLK_25M | MUX_PAD_CTRL(ENET_CLK_PAD_CTRL),
+
+ /* ENET PHY Power */
+ MX6_PAD_ENET2_COL__GPIO2_IO_6 | MUX_PAD_CTRL(NO_PAD_CTRL),
+
+ /* AR8031 PHY Reset */
+ MX6_PAD_ENET2_CRS__GPIO2_IO_7 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static void setup_iomux_uart(void)
+{
+ imx_iomux_v3_setup_multiple_pads(uart1_pads, ARRAY_SIZE(uart1_pads));
+}
+
+static int setup_fec(void)
+{
+ struct iomuxc *iomuxc_regs = (struct iomuxc *)IOMUXC_BASE_ADDR;
+ struct anatop_regs *anatop = (struct anatop_regs *)ANATOP_BASE_ADDR;
+ int reg, ret;
+
+ /* Use 125MHz anatop loopback REF_CLK1 for ENET1 */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC1_MASK, 0);
+
+ ret = enable_fec_anatop_clock(0, ENET_125MHZ);
+ if (ret)
+ return ret;
+
+ imx_iomux_v3_setup_multiple_pads(phy_control_pads,
+ ARRAY_SIZE(phy_control_pads));
+
+ /* Enable the ENET power, active low */
+ gpio_request(IMX_GPIO_NR(2, 6), "enet_rst");
+ gpio_direction_output(IMX_GPIO_NR(2, 6) , 0);
+
+ /* Reset AR8031 PHY */
+ gpio_request(IMX_GPIO_NR(2, 7), "phy_rst");
+ gpio_direction_output(IMX_GPIO_NR(2, 7) , 0);
+ mdelay(10);
+ gpio_set_value(IMX_GPIO_NR(2, 7), 1);
+
+ reg = readl(&anatop->pll_enet);
+ reg |= BM_ANADIG_PLL_ENET_REF_25M_ENABLE;
+ writel(reg, &anatop->pll_enet);
+
+ return 0;
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+ imx_iomux_v3_setup_multiple_pads(fec1_pads, ARRAY_SIZE(fec1_pads));
+ setup_fec();
+
+ return cpu_eth_init(bis);
+}
+
+int power_init_board(void)
+{
+ struct udevice *dev;
+ unsigned int reg;
+ int ret;
+
+ dev = pfuze_common_init();
+ if (!dev)
+ return -ENODEV;
+
+ ret = pfuze_mode_init(dev, APS_PFM);
+ if (ret < 0)
+ return ret;
+
+ /* Enable power of VGEN5 3V3, needed for SD3 */
+ reg = pmic_reg_read(dev, PFUZE100_VGEN5VOL);
+ reg &= ~LDO_VOL_MASK;
+ reg |= (LDOB_3_30V | (1 << LDO_EN));
+ pmic_reg_write(dev, PFUZE100_VGEN5VOL, reg);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ /*
+ * Enable 1.8V(SEL_1P5_1P8_POS_REG) on
+ * Phy control debug reg 0
+ */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x1f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x8);
+
+ /* rgmii tx clock delay enable */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1d, 0x05);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x100);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ /* Enable PERI_3V3, which is used by SD2, ENET, LVDS, BT */
+ imx_iomux_v3_setup_multiple_pads(peri_3v3_pads,
+ ARRAY_SIZE(peri_3v3_pads));
+
+ return 0;
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+#ifdef CONFIG_FSL_QSPI
+
+int board_qspi_init(void)
+{
+ /* Set the clock */
+ enable_qspi_clk(1);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_VIDEO_MXS
+static iomux_v3_cfg_t const lcd_pads[] = {
+ MX6_PAD_LCD1_CLK__LCDIF1_CLK | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_ENABLE__LCDIF1_ENABLE | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_HSYNC__LCDIF1_HSYNC | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_VSYNC__LCDIF1_VSYNC | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA00__LCDIF1_DATA_0 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA01__LCDIF1_DATA_1 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA02__LCDIF1_DATA_2 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA03__LCDIF1_DATA_3 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA04__LCDIF1_DATA_4 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA05__LCDIF1_DATA_5 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA06__LCDIF1_DATA_6 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA07__LCDIF1_DATA_7 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA08__LCDIF1_DATA_8 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA09__LCDIF1_DATA_9 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA10__LCDIF1_DATA_10 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA11__LCDIF1_DATA_11 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA12__LCDIF1_DATA_12 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA13__LCDIF1_DATA_13 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA14__LCDIF1_DATA_14 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA15__LCDIF1_DATA_15 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA16__LCDIF1_DATA_16 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA17__LCDIF1_DATA_17 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA18__LCDIF1_DATA_18 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA19__LCDIF1_DATA_19 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA20__LCDIF1_DATA_20 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA21__LCDIF1_DATA_21 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA22__LCDIF1_DATA_22 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_DATA23__LCDIF1_DATA_23 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX6_PAD_LCD1_RESET__GPIO3_IO_27 | MUX_PAD_CTRL(NO_PAD_CTRL),
+
+ /* Use GPIO for Brightness adjustment, duty cycle = period */
+ MX6_PAD_SD1_DATA2__GPIO6_IO_4 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static int setup_lcd(void)
+{
+ enable_lcdif_clock(LCDIF1_BASE_ADDR, 1);
+
+ imx_iomux_v3_setup_multiple_pads(lcd_pads, ARRAY_SIZE(lcd_pads));
+
+ /* Reset the LCD */
+ gpio_request(IMX_GPIO_NR(3, 27), "lcd_rst");
+ gpio_direction_output(IMX_GPIO_NR(3, 27) , 0);
+ udelay(500);
+ gpio_direction_output(IMX_GPIO_NR(3, 27) , 1);
+
+ /* Set Brightness to high */
+ gpio_request(IMX_GPIO_NR(6, 4), "lcd_bright");
+ gpio_direction_output(IMX_GPIO_NR(6, 4) , 1);
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ /* Address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ /*
+ * Because kernel set WDOG_B mux before pad with the common pinctrl
+ * framwork now and wdog reset will be triggered once set WDOG_B mux
+ * with default pad setting, we set pad setting here to workaround this.
+ * Since imx_iomux_v3_setup_pad also set mux before pad setting, we set
+ * as GPIO mux firstly here to workaround it.
+ */
+ imx_iomux_v3_setup_pad(wdog_b_pad);
+
+ /* Active high for ncp692 */
+ gpio_request(IMX_GPIO_NR(4, 16), "ncp692_en");
+ gpio_direction_output(IMX_GPIO_NR(4, 16), 1);
+
+#ifdef CONFIG_FSL_QSPI
+ board_qspi_init();
+#endif
+
+#ifdef CONFIG_VIDEO_MXS
+ setup_lcd();
+#endif
+
+ return 0;
+}
+
+static bool is_reva(void)
+{
+ return (nxp_board_rev() == 1);
+}
+
+int board_late_init(void)
+{
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ if (is_reva())
+ env_set("board_rev", "REVA");
+#endif
+ return 0;
+}
+
+int checkboard(void)
+{
+#ifdef CONFIG_NXP_BOARD_REVISION
+ printf("Board: MX6SX SABRE SDB rev%c\n", nxp_board_rev_string());
+#else
+ puts("Board: MX6SX SABRE SDB");
+#endif
+ return 0;
+}
diff --git a/board/freescale/mx6ul_14x14_evk/Kconfig b/board/freescale/mx6ul_14x14_evk/Kconfig
new file mode 100644
index 00000000000..8210cd3cb88
--- /dev/null
+++ b/board/freescale/mx6ul_14x14_evk/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_MX6UL_14X14_EVK || TARGET_MX6UL_9X9_EVK
+
+config SYS_BOARD
+ default "mx6ul_14x14_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6ul_14x14_evk"
+
+endif
diff --git a/board/freescale/mx6ul_14x14_evk/MAINTAINERS b/board/freescale/mx6ul_14x14_evk/MAINTAINERS
new file mode 100644
index 00000000000..7c7a196d22c
--- /dev/null
+++ b/board/freescale/mx6ul_14x14_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+MX6ULEVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6ul_14x14_evk/
+F: include/configs/mx6ul_14x14_evk.h
+F: configs/mx6ul_14x14_evk_defconfig
+F: configs/mx6ul_9x9_evk_defconfig
diff --git a/board/freescale/mx6ul_14x14_evk/Makefile b/board/freescale/mx6ul_14x14_evk/Makefile
new file mode 100644
index 00000000000..272ada720e1
--- /dev/null
+++ b/board/freescale/mx6ul_14x14_evk/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2015 Freescale Semiconductor, Inc.
+
+obj-y := mx6ul_14x14_evk.o
diff --git a/board/freescale/mx6ul_14x14_evk/mx6ul_14x14_evk.c b/board/freescale/mx6ul_14x14_evk/mx6ul_14x14_evk.c
new file mode 100644
index 00000000000..6b0665a1067
--- /dev/null
+++ b/board/freescale/mx6ul_14x14_evk/mx6ul_14x14_evk.c
@@ -0,0 +1,524 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/mx6ul_pins.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/io.h>
+#include <asm/sections.h>
+#include <config.h>
+#include <env.h>
+#include <fsl_esdhc_imx.h>
+#include <i2c.h>
+#include <miiphy.h>
+#include <linux/delay.h>
+#include <linux/sizes.h>
+#include <mmc.h>
+#include <netdev.h>
+#include <power/pmic.h>
+#include <power/pfuze3000_pmic.h>
+#include "../common/pfuze.h"
+#include <usb.h>
+#include <usb/ehci-ci.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#define I2C_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_40ohm | PAD_CTL_HYS | \
+ PAD_CTL_ODE)
+
+#define ENET_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_SPEED_HIGH | \
+ PAD_CTL_DSE_48ohm | PAD_CTL_SRE_FAST)
+
+#define LCD_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_PKE | PAD_CTL_SPEED_MED | PAD_CTL_DSE_40ohm)
+
+#define MDIO_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_PUE | \
+ PAD_CTL_DSE_48ohm | PAD_CTL_SRE_FAST | PAD_CTL_ODE)
+
+#define ENET_CLK_PAD_CTRL (PAD_CTL_DSE_40ohm | PAD_CTL_SRE_FAST)
+
+#define OTG_ID_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_47K_UP | PAD_CTL_SPEED_LOW | \
+ PAD_CTL_DSE_80ohm | PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+#ifdef CONFIG_DM_PMIC
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret, dev_id, rev_id;
+ unsigned int reg;
+
+ ret = pmic_get("pfuze3000", &dev);
+ if (ret == -ENODEV)
+ return 0;
+ if (ret != 0)
+ return ret;
+
+ dev_id = pmic_reg_read(dev, PFUZE3000_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE3000_REVID);
+ printf("PMIC: PFUZE3000 DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+ /* disable Low Power Mode during standby mode */
+ reg = pmic_reg_read(dev, PFUZE3000_LDOGCTL);
+ reg |= 0x1;
+ pmic_reg_write(dev, PFUZE3000_LDOGCTL, reg);
+
+ /* SW1B step ramp up time from 2us to 4us/25mV */
+ pmic_reg_write(dev, PFUZE3000_SW1BCONF, 0x40);
+
+ /* SW1B mode to APS/PFM */
+ pmic_reg_write(dev, PFUZE3000_SW1BMODE, 0xc);
+
+ /* SW1B standby voltage set to 0.975V */
+ pmic_reg_write(dev, PFUZE3000_SW1BSTBY, 0xb);
+
+ return 0;
+}
+#endif
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const uart1_pads[] = {
+ MX6_PAD_UART1_TX_DATA__UART1_DCE_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX6_PAD_UART1_RX_DATA__UART1_DCE_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+
+static void setup_iomux_uart(void)
+{
+ imx_iomux_v3_setup_multiple_pads(uart1_pads, ARRAY_SIZE(uart1_pads));
+}
+
+#ifdef CONFIG_FSL_QSPI
+static int board_qspi_init(void)
+{
+ /* Set the clock */
+ enable_qspi_clk(0);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SPL_BUILD
+
+#define USDHC_PAD_CTRL (PAD_CTL_PKE | PAD_CTL_PUE | \
+ PAD_CTL_PUS_22K_UP | PAD_CTL_SPEED_LOW | \
+ PAD_CTL_DSE_80ohm | PAD_CTL_SRE_FAST | PAD_CTL_HYS)
+
+static iomux_v3_cfg_t const usdhc2_pads[] = {
+ MX6_PAD_NAND_RE_B__USDHC2_CLK | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_NAND_WE_B__USDHC2_CMD | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_NAND_DATA00__USDHC2_DATA0 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_NAND_DATA01__USDHC2_DATA1 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_NAND_DATA02__USDHC2_DATA2 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+ MX6_PAD_NAND_DATA03__USDHC2_DATA3 | MUX_PAD_CTRL(USDHC_PAD_CTRL),
+};
+
+static struct fsl_esdhc_cfg usdhc_cfg[1] = {
+ {USDHC2_BASE_ADDR, 0, 4},
+};
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ return 1;
+}
+
+int board_mmc_init(struct bd_info *bis)
+{
+ imx_iomux_v3_setup_multiple_pads(usdhc2_pads, ARRAY_SIZE(usdhc2_pads));
+ usdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC2_CLK);
+ return fsl_esdhc_initialize(bis, &usdhc_cfg[0]);
+}
+#endif
+
+#ifdef CONFIG_USB_EHCI_MX6
+#ifndef CONFIG_DM_USB
+
+#define USB_OTHERREGS_OFFSET 0x800
+#define UCTRL_PWR_POL (1 << 9)
+
+static iomux_v3_cfg_t const usb_otg_pads[] = {
+ MX6_PAD_GPIO1_IO00__ANATOP_OTG1_ID | MUX_PAD_CTRL(OTG_ID_PAD_CTRL),
+};
+
+/* At default the 3v3 enables the MIC2026 for VBUS power */
+static void setup_usb(void)
+{
+ imx_iomux_v3_setup_multiple_pads(usb_otg_pads,
+ ARRAY_SIZE(usb_otg_pads));
+}
+
+int board_usb_phy_mode(int port)
+{
+ if (port == 1)
+ return USB_INIT_HOST;
+ else
+ return usb_phy_mode(port);
+}
+
+int board_ehci_hcd_init(int port)
+{
+ u32 *usbnc_usb_ctrl;
+
+ if (port > 1)
+ return -EINVAL;
+
+ usbnc_usb_ctrl = (u32 *)(USB_BASE_ADDR + USB_OTHERREGS_OFFSET +
+ port * 4);
+
+ /* Set Power polarity */
+ setbits_le32(usbnc_usb_ctrl, UCTRL_PWR_POL);
+
+ return 0;
+}
+#endif
+#endif
+
+#ifdef CONFIG_FEC_MXC
+static int setup_fec(int fec_id)
+{
+ struct iomuxc *const iomuxc_regs = (struct iomuxc *)IOMUXC_BASE_ADDR;
+ int ret;
+
+ if (fec_id == 0) {
+ /*
+ * Use 50M anatop loopback REF_CLK1 for ENET1,
+ * clear gpr1[13], set gpr1[17].
+ */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC1_MASK,
+ IOMUX_GPR1_FEC1_CLOCK_MUX1_SEL_MASK);
+ } else {
+ /*
+ * Use 50M anatop loopback REF_CLK2 for ENET2,
+ * clear gpr1[14], set gpr1[18].
+ */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC2_MASK,
+ IOMUX_GPR1_FEC2_CLOCK_MUX1_SEL_MASK);
+ }
+
+ ret = enable_fec_anatop_clock(fec_id, ENET_50MHZ);
+ if (ret)
+ return ret;
+
+ enable_enet_clk(1);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1f, 0x8190);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_VIDEO
+static iomux_v3_cfg_t const lcd_pads[] = {
+ /* Use GPIO for Brightness adjustment, duty cycle = period. */
+ MX6_PAD_GPIO1_IO08__GPIO1_IO08 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static int setup_lcd(void)
+{
+ enable_lcdif_clock(LCDIF1_BASE_ADDR, 1);
+
+ imx_iomux_v3_setup_multiple_pads(lcd_pads, ARRAY_SIZE(lcd_pads));
+
+ /* Reset the LCD */
+ gpio_request(IMX_GPIO_NR(5, 9), "lcd reset");
+ gpio_direction_output(IMX_GPIO_NR(5, 9) , 0);
+ udelay(500);
+ gpio_direction_output(IMX_GPIO_NR(5, 9) , 1);
+
+ /* Set Brightness to high */
+ gpio_request(IMX_GPIO_NR(1, 8), "backlight");
+ gpio_direction_output(IMX_GPIO_NR(1, 8) , 1);
+
+ return 0;
+}
+#else
+static inline int setup_lcd(void) { return 0; }
+#endif
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* Address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+#ifdef CONFIG_FEC_MXC
+ setup_fec(CFG_FEC_ENET_DEV);
+#endif
+
+#ifdef CONFIG_USB_EHCI_MX6
+#ifndef CONFIG_DM_USB
+ setup_usb();
+#endif
+#endif
+
+#ifdef CONFIG_FSL_QSPI
+ board_qspi_init();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_CMD_BMODE
+static const struct boot_mode board_boot_modes[] = {
+ /* 4 bit bus width */
+ {"sd1", MAKE_CFGVAL(0x42, 0x20, 0x00, 0x00)},
+ {"sd2", MAKE_CFGVAL(0x40, 0x28, 0x00, 0x00)},
+ {"qspi1", MAKE_CFGVAL(0x10, 0x00, 0x00, 0x00)},
+ {NULL, 0},
+};
+#endif
+
+int board_late_init(void)
+{
+#ifdef CONFIG_CMD_BMODE
+ add_board_boot_modes(board_boot_modes);
+#endif
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ env_set("board_name", "EVK");
+
+ if (is_mx6ul_9x9_evk())
+ env_set("board_rev", "9X9");
+ else
+ env_set("board_rev", "14X14");
+#endif
+
+ setup_lcd();
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ if (is_mx6ul_9x9_evk())
+ puts("Board: MX6UL 9x9 EVK\n");
+ else
+ puts("Board: MX6UL 14x14 EVK\n");
+
+ return 0;
+}
+
+/*
+ * Backlight off and reset LCD before OS handover
+ */
+void board_preboot_os(void)
+{
+ gpio_set_value(IMX_GPIO_NR(1, 8), 0);
+ gpio_set_value(IMX_GPIO_NR(5, 9), 0);
+}
+
+#ifdef CONFIG_SPL_BUILD
+#include <linux/libfdt.h>
+#include <spl.h>
+#include <asm/arch/mx6-ddr.h>
+
+
+static struct mx6ul_iomux_grp_regs mx6_grp_ioregs = {
+ .grp_addds = 0x00000030,
+ .grp_ddrmode_ctl = 0x00020000,
+ .grp_b0ds = 0x00000030,
+ .grp_ctlds = 0x00000030,
+ .grp_b1ds = 0x00000030,
+ .grp_ddrpke = 0x00000000,
+ .grp_ddrmode = 0x00020000,
+#ifdef CONFIG_TARGET_MX6UL_9X9_EVK
+ .grp_ddr_type = 0x00080000,
+#else
+ .grp_ddr_type = 0x000c0000,
+#endif
+};
+
+#ifdef CONFIG_TARGET_MX6UL_9X9_EVK
+static struct mx6ul_iomux_ddr_regs mx6_ddr_ioregs = {
+ .dram_dqm0 = 0x00000030,
+ .dram_dqm1 = 0x00000030,
+ .dram_ras = 0x00000030,
+ .dram_cas = 0x00000030,
+ .dram_odt0 = 0x00000000,
+ .dram_odt1 = 0x00000000,
+ .dram_sdba2 = 0x00000000,
+ .dram_sdclk_0 = 0x00000030,
+ .dram_sdqs0 = 0x00003030,
+ .dram_sdqs1 = 0x00003030,
+ .dram_reset = 0x00000030,
+};
+
+static struct mx6_mmdc_calibration mx6_mmcd_calib = {
+ .p0_mpwldectrl0 = 0x00000000,
+ .p0_mpdgctrl0 = 0x20000000,
+ .p0_mprddlctl = 0x4040484f,
+ .p0_mpwrdlctl = 0x40405247,
+ .mpzqlp2ctl = 0x1b4700c7,
+};
+
+static struct mx6_lpddr2_cfg mem_ddr = {
+ .mem_speed = 800,
+ .density = 2,
+ .width = 16,
+ .banks = 4,
+ .rowaddr = 14,
+ .coladdr = 10,
+ .trcd_lp = 1500,
+ .trppb_lp = 1500,
+ .trpab_lp = 2000,
+ .trasmin = 4250,
+};
+
+struct mx6_ddr_sysinfo ddr_sysinfo = {
+ .dsize = 0,
+ .cs_density = 18,
+ .ncs = 1,
+ .cs1_mirror = 0,
+ .walat = 0,
+ .ralat = 5,
+ .mif3_mode = 3,
+ .bi_on = 1,
+ .rtt_wr = 0, /* LPDDR2 does not need rtt_wr rtt_nom */
+ .rtt_nom = 0,
+ .sde_to_rst = 0, /* LPDDR2 does not need this field */
+ .rst_to_cke = 0x10, /* JEDEC value for LPDDR2: 200us */
+ .ddr_type = DDR_TYPE_LPDDR2,
+ .refsel = 0, /* Refresh cycles at 64KHz */
+ .refr = 3, /* 4 refresh commands per refresh cycle */
+};
+
+#else
+static struct mx6ul_iomux_ddr_regs mx6_ddr_ioregs = {
+ .dram_dqm0 = 0x00000030,
+ .dram_dqm1 = 0x00000030,
+ .dram_ras = 0x00000030,
+ .dram_cas = 0x00000030,
+ .dram_odt0 = 0x00000030,
+ .dram_odt1 = 0x00000030,
+ .dram_sdba2 = 0x00000000,
+ .dram_sdclk_0 = 0x00000030,
+ .dram_sdqs0 = 0x00000030,
+ .dram_sdqs1 = 0x00000030,
+ .dram_reset = 0x00000030,
+};
+
+static struct mx6_mmdc_calibration mx6_mmcd_calib = {
+ .p0_mpwldectrl0 = 0x00000000,
+ .p0_mpdgctrl0 = 0x41570155,
+ .p0_mprddlctl = 0x4040474A,
+ .p0_mpwrdlctl = 0x40405550,
+};
+
+struct mx6_ddr_sysinfo ddr_sysinfo = {
+ .dsize = 0,
+ .cs_density = 20,
+ .ncs = 1,
+ .cs1_mirror = 0,
+ .rtt_wr = 2,
+ .rtt_nom = 1, /* RTT_Nom = RZQ/2 */
+ .walat = 0, /* Write additional latency */
+ .ralat = 5, /* Read additional latency */
+ .mif3_mode = 3, /* Command prediction working mode */
+ .bi_on = 1, /* Bank interleaving enabled */
+ .sde_to_rst = 0x10, /* 14 cycles, 200us (JEDEC default) */
+ .rst_to_cke = 0x23, /* 33 cycles, 500us (JEDEC default) */
+ .ddr_type = DDR_TYPE_DDR3,
+ .refsel = 0, /* Refresh cycles at 64KHz */
+ .refr = 1, /* 2 refresh commands per refresh cycle */
+};
+
+static struct mx6_ddr3_cfg mem_ddr = {
+ .mem_speed = 800,
+ .density = 4,
+ .width = 16,
+ .banks = 8,
+ .rowaddr = 15,
+ .coladdr = 10,
+ .pagesz = 2,
+ .trcd = 1375,
+ .trcmin = 4875,
+ .trasmin = 3500,
+};
+#endif
+
+static void ccgr_init(void)
+{
+ struct mxc_ccm_reg *ccm = (struct mxc_ccm_reg *)CCM_BASE_ADDR;
+
+ writel(0xFFFFFFFF, &ccm->CCGR0);
+ writel(0xFFFFFFFF, &ccm->CCGR1);
+ writel(0xFFFFFFFF, &ccm->CCGR2);
+ writel(0xFFFFFFFF, &ccm->CCGR3);
+ writel(0xFFFFFFFF, &ccm->CCGR4);
+ writel(0xFFFFFFFF, &ccm->CCGR5);
+ writel(0xFFFFFFFF, &ccm->CCGR6);
+ writel(0xFFFFFFFF, &ccm->CCGR7);
+}
+
+static void spl_dram_init(void)
+{
+ mx6ul_dram_iocfg(mem_ddr.width, &mx6_ddr_ioregs, &mx6_grp_ioregs);
+ mx6_dram_cfg(&ddr_sysinfo, &mx6_mmcd_calib, &mem_ddr);
+}
+
+void board_init_f(ulong dummy)
+{
+ ccgr_init();
+
+ /* setup AIPS and disable watchdog */
+ arch_cpu_init();
+
+ /* iomux and setup of i2c */
+ board_early_init_f();
+
+ /* setup GP timer */
+ timer_init();
+
+ /* UART clocks enabled and gd valid - init serial console */
+ preloader_console_init();
+
+ /* DDR initialization */
+ spl_dram_init();
+
+ /* Clear the BSS. */
+ memset(__bss_start, 0, __bss_end - __bss_start);
+
+ /* load/boot image from boot device */
+ board_init_r(NULL, 0);
+}
+#endif
diff --git a/board/freescale/mx6ullevk/Kconfig b/board/freescale/mx6ullevk/Kconfig
new file mode 100644
index 00000000000..49aa302553e
--- /dev/null
+++ b/board/freescale/mx6ullevk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX6ULL_14X14_EVK
+
+config SYS_BOARD
+ default "mx6ullevk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx6ullevk"
+
+config IMX_CONFIG
+ default "board/freescale/mx6ullevk/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx6ullevk/MAINTAINERS b/board/freescale/mx6ullevk/MAINTAINERS
new file mode 100644
index 00000000000..3d1b2560363
--- /dev/null
+++ b/board/freescale/mx6ullevk/MAINTAINERS
@@ -0,0 +1,8 @@
+MX6ULLEVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx6ullevk/
+F: include/configs/mx6ullevk.h
+F: configs/mx6ull_14x14_evk_defconfig
+F: configs/mx6ull_14x14_evk_plugin_defconfig
+F: configs/mx6ulz_14x14_evk_defconfig
diff --git a/board/freescale/mx6ullevk/Makefile b/board/freescale/mx6ullevk/Makefile
new file mode 100644
index 00000000000..1ff03b5f1cd
--- /dev/null
+++ b/board/freescale/mx6ullevk/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2016 Freescale Semiconductor, Inc.
+
+obj-y := mx6ullevk.o
diff --git a/board/freescale/mx6ullevk/imximage.cfg b/board/freescale/mx6ullevk/imximage.cfg
new file mode 100644
index 00000000000..0c6f444a7a3
--- /dev/null
+++ b/board/freescale/mx6ullevk/imximage.cfg
@@ -0,0 +1,114 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+#ifdef CONFIG_QSPI_BOOT
+BOOT_FROM qspi
+#elif defined(CONFIG_NOR_BOOT)
+BOOT_FROM nor
+#else
+BOOT_FROM sd
+#endif
+
+#ifdef CONFIG_USE_IMXIMG_PLUGIN
+/*PLUGIN plugin-binary-file IRAM_FREE_START_ADDR*/
+PLUGIN board/freescale/mx6ullevk/plugin.bin 0x00907000
+#else
+
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+/* Enable all clocks */
+DATA 4 0x020c4068 0xffffffff
+DATA 4 0x020c406c 0xffffffff
+DATA 4 0x020c4070 0xffffffff
+DATA 4 0x020c4074 0xffffffff
+DATA 4 0x020c4078 0xffffffff
+DATA 4 0x020c407c 0xffffffff
+DATA 4 0x020c4080 0xffffffff
+
+DATA 4 0x020E04B4 0x000C0000
+DATA 4 0x020E04AC 0x00000000
+DATA 4 0x020E027C 0x00000030
+DATA 4 0x020E0250 0x00000030
+DATA 4 0x020E024C 0x00000030
+DATA 4 0x020E0490 0x00000030
+DATA 4 0x020E0288 0x000C0030
+DATA 4 0x020E0270 0x00000000
+DATA 4 0x020E0260 0x00000030
+DATA 4 0x020E0264 0x00000030
+DATA 4 0x020E04A0 0x00000030
+DATA 4 0x020E0494 0x00020000
+DATA 4 0x020E0280 0x00000030
+DATA 4 0x020E0284 0x00000030
+DATA 4 0x020E04B0 0x00020000
+DATA 4 0x020E0498 0x00000030
+DATA 4 0x020E04A4 0x00000030
+DATA 4 0x020E0244 0x00000030
+DATA 4 0x020E0248 0x00000030
+DATA 4 0x021B001C 0x00008000
+DATA 4 0x021B0800 0xA1390003
+DATA 4 0x021B080C 0x00000004
+DATA 4 0x021B083C 0x41640158
+DATA 4 0x021B0848 0x40403237
+DATA 4 0x021B0850 0x40403C33
+DATA 4 0x021B081C 0x33333333
+DATA 4 0x021B0820 0x33333333
+DATA 4 0x021B082C 0xf3333333
+DATA 4 0x021B0830 0xf3333333
+DATA 4 0x021B08C0 0x00944009
+DATA 4 0x021B08b8 0x00000800
+DATA 4 0x021B0004 0x0002002D
+DATA 4 0x021B0008 0x1B333030
+DATA 4 0x021B000C 0x676B52F3
+DATA 4 0x021B0010 0xB66D0B63
+DATA 4 0x021B0014 0x01FF00DB
+DATA 4 0x021B0018 0x00201740
+DATA 4 0x021B001C 0x00008000
+DATA 4 0x021B002C 0x000026D2
+DATA 4 0x021B0030 0x006B1023
+DATA 4 0x021B0040 0x0000004F
+DATA 4 0x021B0000 0x84180000
+DATA 4 0x021B0890 0x00400000
+DATA 4 0x021B001C 0x02008032
+DATA 4 0x021B001C 0x00008033
+DATA 4 0x021B001C 0x00048031
+DATA 4 0x021B001C 0x15208030
+DATA 4 0x021B001C 0x04008040
+DATA 4 0x021B0020 0x00000800
+DATA 4 0x021B0818 0x00000227
+DATA 4 0x021B0004 0x0002552D
+DATA 4 0x021B0404 0x00011006
+DATA 4 0x021B001C 0x00000000
+
+#endif
diff --git a/board/freescale/mx6ullevk/mx6ullevk.c b/board/freescale/mx6ullevk/mx6ullevk.c
new file mode 100644
index 00000000000..189eddefea3
--- /dev/null
+++ b/board/freescale/mx6ullevk/mx6ullevk.c
@@ -0,0 +1,138 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <init.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/iomux.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/mx6-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/mach-imx/boot_mode.h>
+#include <asm/io.h>
+#include <config.h>
+#include <env.h>
+#include <fsl_esdhc_imx.h>
+#include <linux/sizes.h>
+#include <mmc.h>
+#include <miiphy.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ return devno;
+}
+
+int mmc_map_to_kernel_blk(int devno)
+{
+ return devno;
+}
+
+int board_early_init_f(void)
+{
+ return 0;
+}
+
+#ifdef CONFIG_FEC_MXC
+static int setup_fec(int fec_id)
+{
+ struct iomuxc *const iomuxc_regs = (struct iomuxc *)IOMUXC_BASE_ADDR;
+ int ret;
+
+ if (fec_id == 0) {
+ /*
+ * Use 50MHz anatop loopback REF_CLK1 for ENET1,
+ * clear gpr1[13], set gpr1[17].
+ */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC1_MASK,
+ IOMUX_GPR1_FEC1_CLOCK_MUX1_SEL_MASK);
+ } else {
+ /*
+ * Use 50MHz anatop loopback REF_CLK2 for ENET2,
+ * clear gpr1[14], set gpr1[18].
+ */
+ clrsetbits_le32(&iomuxc_regs->gpr[1], IOMUX_GPR1_FEC2_MASK,
+ IOMUX_GPR1_FEC2_CLOCK_MUX1_SEL_MASK);
+ }
+
+ ret = enable_fec_anatop_clock(fec_id, ENET_50MHZ);
+ if (ret)
+ return ret;
+
+ enable_enet_clk(1);
+
+ return 0;
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1f, 0x8190);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+#endif
+
+int board_init(void)
+{
+ /* Address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+#ifdef CONFIG_FEC_MXC
+ setup_fec(CFG_FEC_ENET_DEV);
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_CMD_BMODE
+static const struct boot_mode board_boot_modes[] = {
+ /* 4 bit bus width */
+ {"sd1", MAKE_CFGVAL(0x42, 0x20, 0x00, 0x00)},
+ {"sd2", MAKE_CFGVAL(0x40, 0x28, 0x00, 0x00)},
+ {"qspi1", MAKE_CFGVAL(0x10, 0x00, 0x00, 0x00)},
+ {NULL, 0},
+};
+#endif
+
+int board_late_init(void)
+{
+#ifdef CONFIG_CMD_BMODE
+ add_board_boot_modes(board_boot_modes);
+#endif
+
+#ifdef CONFIG_ENV_VARS_UBOOT_RUNTIME_CONFIG
+ if (is_cpu_type(MXC_CPU_MX6ULZ))
+ env_set("board_name", "ULZ-EVK");
+ else
+ env_set("board_name", "EVK");
+ env_set("board_rev", "14X14");
+#endif
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ if (is_cpu_type(MXC_CPU_MX6ULZ))
+ puts("Board: MX6ULZ 14x14 EVK\n");
+ else
+ puts("Board: MX6ULL 14x14 EVK\n");
+
+ return 0;
+}
diff --git a/board/freescale/mx6ullevk/plugin.S b/board/freescale/mx6ullevk/plugin.S
new file mode 100644
index 00000000000..1f631ff5e3e
--- /dev/null
+++ b/board/freescale/mx6ullevk/plugin.S
@@ -0,0 +1,138 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+
+/* DDR script */
+.macro imx6ull_ddr3_evk_setting
+ ldr r0, =IOMUXC_BASE_ADDR
+ ldr r1, =0x000C0000
+ str r1, [r0, #0x4B4]
+ ldr r1, =0x00000000
+ str r1, [r0, #0x4AC]
+ ldr r1, =0x00000030
+ str r1, [r0, #0x27C]
+ ldr r1, =0x00000030
+ str r1, [r0, #0x250]
+ str r1, [r0, #0x24C]
+ str r1, [r0, #0x490]
+ ldr r1, =0x000C0030
+ str r1, [r0, #0x288]
+
+ ldr r1, =0x00000000
+ str r1, [r0, #0x270]
+
+ ldr r1, =0x00000030
+ str r1, [r0, #0x260]
+ str r1, [r0, #0x264]
+ str r1, [r0, #0x4A0]
+
+ ldr r1, =0x00020000
+ str r1, [r0, #0x494]
+
+ ldr r1, =0x00000030
+ str r1, [r0, #0x280]
+ ldr r1, =0x00000030
+ str r1, [r0, #0x284]
+
+ ldr r1, =0x00020000
+ str r1, [r0, #0x4B0]
+
+ ldr r1, =0x00000030
+ str r1, [r0, #0x498]
+ str r1, [r0, #0x4A4]
+ str r1, [r0, #0x244]
+ str r1, [r0, #0x248]
+
+ ldr r0, =MMDC_P0_BASE_ADDR
+ ldr r1, =0x00008000
+ str r1, [r0, #0x1C]
+ ldr r1, =0xA1390003
+ str r1, [r0, #0x800]
+ ldr r1, =0x00000004
+ str r1, [r0, #0x80C]
+ ldr r1, =0x41640158
+ str r1, [r0, #0x83C]
+ ldr r1, =0x40403237
+ str r1, [r0, #0x848]
+ ldr r1, =0x40403C33
+ str r1, [r0, #0x850]
+ ldr r1, =0x33333333
+ str r1, [r0, #0x81C]
+ str r1, [r0, #0x820]
+ ldr r1, =0xF3333333
+ str r1, [r0, #0x82C]
+ str r1, [r0, #0x830]
+ ldr r1, =0x00944009
+ str r1, [r0, #0x8C0]
+ ldr r1, =0x00000800
+ str r1, [r0, #0x8B8]
+ ldr r1, =0x0002002D
+ str r1, [r0, #0x004]
+ ldr r1, =0x1B333030
+ str r1, [r0, #0x008]
+ ldr r1, =0x676B52F3
+ str r1, [r0, #0x00C]
+ ldr r1, =0xB66D0B63
+ str r1, [r0, #0x010]
+ ldr r1, =0x01FF00DB
+ str r1, [r0, #0x014]
+ ldr r1, =0x00201740
+ str r1, [r0, #0x018]
+ ldr r1, =0x00008000
+ str r1, [r0, #0x01C]
+ ldr r1, =0x000026D2
+ str r1, [r0, #0x02C]
+ ldr r1, =0x006B1023
+ str r1, [r0, #0x030]
+ ldr r1, =0x0000004F
+ str r1, [r0, #0x040]
+ ldr r1, =0x84180000
+ str r1, [r0, #0x000]
+ ldr r1, =0x00400000
+ str r1, [r0, #0x890]
+ ldr r1, =0x02008032
+ str r1, [r0, #0x01C]
+ ldr r1, =0x00008033
+ str r1, [r0, #0x01C]
+ ldr r1, =0x00048031
+ str r1, [r0, #0x01C]
+ ldr r1, =0x15208030
+ str r1, [r0, #0x01C]
+ ldr r1, =0x04008040
+ str r1, [r0, #0x01C]
+ ldr r1, =0x00000800
+ str r1, [r0, #0x020]
+ ldr r1, =0x00000227
+ str r1, [r0, #0x818]
+ ldr r1, =0x0002552D
+ str r1, [r0, #0x004]
+ ldr r1, =0x00011006
+ str r1, [r0, #0x404]
+ ldr r1, =0x00000000
+ str r1, [r0, #0x01C]
+.endm
+
+.macro imx6_clock_gating
+ ldr r0, =CCM_BASE_ADDR
+ ldr r1, =0xFFFFFFFF
+ str r1, [r0, #0x68]
+ str r1, [r0, #0x6C]
+ str r1, [r0, #0x70]
+ str r1, [r0, #0x74]
+ str r1, [r0, #0x78]
+ str r1, [r0, #0x7C]
+ str r1, [r0, #0x80]
+.endm
+
+.macro imx6_qos_setting
+.endm
+
+.macro imx6_ddr_setting
+ imx6ull_ddr3_evk_setting
+.endm
+
+/* include the common plugin code here */
+#include <asm/arch/mx6_plugin.S>
diff --git a/board/freescale/mx7dsabresd/Kconfig b/board/freescale/mx7dsabresd/Kconfig
new file mode 100644
index 00000000000..bf3ceafe2b4
--- /dev/null
+++ b/board/freescale/mx7dsabresd/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX7DSABRESD
+
+config SYS_BOARD
+ default "mx7dsabresd"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx7dsabresd"
+
+config IMX_CONFIG
+ default "board/freescale/mx7dsabresd/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx7dsabresd/MAINTAINERS b/board/freescale/mx7dsabresd/MAINTAINERS
new file mode 100644
index 00000000000..721321c9cca
--- /dev/null
+++ b/board/freescale/mx7dsabresd/MAINTAINERS
@@ -0,0 +1,8 @@
+MX7DSABRESD BOARD
+M: Adrian Alonso <adrian.alonso@nxp.com>
+M: Fabio Estevam <festevam@gmail.com>
+S: Maintained
+F: board/freescale/mx7dsabresd
+F: include/configs/mx7dsabresd.h
+F: configs/mx7dsabresd_defconfig
+F: configs/mx7dsabresd_qspi_defconfig
diff --git a/board/freescale/mx7dsabresd/Makefile b/board/freescale/mx7dsabresd/Makefile
new file mode 100644
index 00000000000..852b3d87ad5
--- /dev/null
+++ b/board/freescale/mx7dsabresd/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2015 Freescale Semiconductor, Inc.
+
+obj-y := mx7dsabresd.o
diff --git a/board/freescale/mx7dsabresd/imximage.cfg b/board/freescale/mx7dsabresd/imximage.cfg
new file mode 100644
index 00000000000..59e66fbda16
--- /dev/null
+++ b/board/freescale/mx7dsabresd/imximage.cfg
@@ -0,0 +1,99 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2015 Freescale Semiconductor, Inc.
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : sd
+ */
+
+BOOT_FROM sd
+
+/*
+ * Secure boot support
+ */
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+
+DATA 4 0x30340004 0x4F400005
+
+DATA 4 0x30391000 0x00000002
+DATA 4 0x307a0000 0x01040001
+DATA 4 0x307a01a0 0x80400003
+DATA 4 0x307a01a4 0x00100020
+DATA 4 0x307a01a8 0x80100004
+DATA 4 0x307a0064 0x00400046
+DATA 4 0x307a0490 0x00000001
+DATA 4 0x307a00d0 0x00020083
+DATA 4 0x307a00d4 0x00690000
+DATA 4 0x307a00dc 0x09300004
+DATA 4 0x307a00e0 0x04080000
+DATA 4 0x307a00e4 0x00100004
+DATA 4 0x307a00f4 0x0000033f
+DATA 4 0x307a0100 0x09081109
+DATA 4 0x307a0104 0x0007020d
+DATA 4 0x307a0108 0x03040407
+DATA 4 0x307a010c 0x00002006
+DATA 4 0x307a0110 0x04020205
+DATA 4 0x307a0114 0x03030202
+DATA 4 0x307a0120 0x00000803
+DATA 4 0x307a0180 0x00800020
+DATA 4 0x307a0184 0x02000100
+DATA 4 0x307a0190 0x02098204
+DATA 4 0x307a0194 0x00030303
+DATA 4 0x307a0200 0x00000016
+DATA 4 0x307a0204 0x00171717
+DATA 4 0x307a0214 0x04040404
+DATA 4 0x307a0218 0x0f040404
+DATA 4 0x307a0240 0x06000604
+DATA 4 0x307a0244 0x00000001
+DATA 4 0x30391000 0x00000000
+DATA 4 0x30790000 0x17420f40
+DATA 4 0x30790004 0x10210100
+DATA 4 0x30790010 0x00060807
+DATA 4 0x307900b0 0x1010007e
+DATA 4 0x3079009c 0x00000d6e
+DATA 4 0x30790020 0x08080808
+DATA 4 0x30790030 0x08080808
+DATA 4 0x30790050 0x01000010
+DATA 4 0x30790050 0x00000010
+
+DATA 4 0x307900c0 0x0e407304
+DATA 4 0x307900c0 0x0e447304
+DATA 4 0x307900c0 0x0e447306
+
+CHECK_BITS_SET 4 0x307900c4 0x1
+
+DATA 4 0x307900c0 0x0e447304
+DATA 4 0x307900c0 0x0e407304
+
+DATA 4 0x30384130 0x00000000
+DATA 4 0x30340020 0x00000178
+DATA 4 0x30384130 0x00000002
+DATA 4 0x30790018 0x0000000f
+
+CHECK_BITS_SET 4 0x307a0004 0x1
diff --git a/board/freescale/mx7dsabresd/mx7dsabresd.c b/board/freescale/mx7dsabresd/mx7dsabresd.c
new file mode 100644
index 00000000000..3db167c0dad
--- /dev/null
+++ b/board/freescale/mx7dsabresd/mx7dsabresd.c
@@ -0,0 +1,326 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2015 Freescale Semiconductor, Inc.
+ */
+
+#include <init.h>
+#include <net.h>
+#include <asm/arch/clock.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/mx7-pins.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/global_data.h>
+#include <asm/gpio.h>
+#include <asm/mach-imx/iomux-v3.h>
+#include <asm/io.h>
+#include <linux/delay.h>
+#include <linux/sizes.h>
+#include <fsl_esdhc_imx.h>
+#include <mmc.h>
+#include <miiphy.h>
+#include <power/pmic.h>
+#include <power/pfuze3000_pmic.h>
+#include "../common/pfuze.h"
+#include <i2c.h>
+#include <asm/mach-imx/mxc_i2c.h>
+#include <asm/arch/crm_regs.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_DSE_3P3V_49OHM | \
+ PAD_CTL_PUS_PU100KOHM | PAD_CTL_HYS)
+
+#define LCD_PAD_CTRL (PAD_CTL_HYS | PAD_CTL_PUS_PU100KOHM | \
+ PAD_CTL_DSE_3P3V_49OHM)
+
+#define NAND_PAD_CTRL (PAD_CTL_DSE_3P3V_49OHM | PAD_CTL_SRE_SLOW | PAD_CTL_HYS)
+
+#define SPI_PAD_CTRL \
+ (PAD_CTL_HYS | PAD_CTL_DSE_3P3V_49OHM | PAD_CTL_SRE_FAST)
+
+#define NAND_PAD_READY0_CTRL (PAD_CTL_DSE_3P3V_49OHM | PAD_CTL_PUS_PU5KOHM)
+
+#ifdef CONFIG_MXC_SPI
+static iomux_v3_cfg_t const ecspi3_pads[] = {
+ MX7D_PAD_SAI2_RX_DATA__ECSPI3_SCLK | MUX_PAD_CTRL(SPI_PAD_CTRL),
+ MX7D_PAD_SAI2_TX_SYNC__ECSPI3_MISO | MUX_PAD_CTRL(SPI_PAD_CTRL),
+ MX7D_PAD_SAI2_TX_BCLK__ECSPI3_MOSI | MUX_PAD_CTRL(SPI_PAD_CTRL),
+ MX7D_PAD_SAI2_TX_DATA__GPIO6_IO22 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+int board_spi_cs_gpio(unsigned bus, unsigned cs)
+{
+ return (bus == 2 && cs == 0) ? (IMX_GPIO_NR(6, 22)) : -1;
+}
+
+static void setup_spi(void)
+{
+ imx_iomux_v3_setup_multiple_pads(ecspi3_pads, ARRAY_SIZE(ecspi3_pads));
+}
+#endif
+
+int dram_init(void)
+{
+ gd->ram_size = PHYS_SDRAM_SIZE;
+
+ return 0;
+}
+
+static iomux_v3_cfg_t const wdog_pads[] = {
+ MX7D_PAD_GPIO1_IO00__WDOG1_WDOG_B | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const uart1_pads[] = {
+ MX7D_PAD_UART1_TX_DATA__UART1_DCE_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX7D_PAD_UART1_RX_DATA__UART1_DCE_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+#ifdef CONFIG_NAND_MXS
+static iomux_v3_cfg_t const gpmi_pads[] = {
+ MX7D_PAD_SD3_DATA0__NAND_DATA00 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA1__NAND_DATA01 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA2__NAND_DATA02 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA3__NAND_DATA03 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA4__NAND_DATA04 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA5__NAND_DATA05 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA6__NAND_DATA06 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_DATA7__NAND_DATA07 | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_CLK__NAND_CLE | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_CMD__NAND_ALE | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_STROBE__NAND_RE_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SD3_RESET_B__NAND_WE_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_MCLK__NAND_WP_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_RX_BCLK__NAND_CE3_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_RX_SYNC__NAND_CE2_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_RX_DATA__NAND_CE1_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_TX_BCLK__NAND_CE0_B | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_TX_SYNC__NAND_DQS | MUX_PAD_CTRL(NAND_PAD_CTRL),
+ MX7D_PAD_SAI1_TX_DATA__NAND_READY_B | MUX_PAD_CTRL(NAND_PAD_READY0_CTRL),
+};
+
+static void setup_gpmi_nand(void)
+{
+ imx_iomux_v3_setup_multiple_pads(gpmi_pads, ARRAY_SIZE(gpmi_pads));
+
+ /* NAND_USDHC_BUS_CLK is set in rom */
+ set_clk_nand();
+}
+#endif
+
+#ifdef CONFIG_VIDEO_MXS
+static iomux_v3_cfg_t const lcd_pads[] = {
+ MX7D_PAD_LCD_CLK__LCD_CLK | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_ENABLE__LCD_ENABLE | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_HSYNC__LCD_HSYNC | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_VSYNC__LCD_VSYNC | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA00__LCD_DATA0 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA01__LCD_DATA1 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA02__LCD_DATA2 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA03__LCD_DATA3 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA04__LCD_DATA4 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA05__LCD_DATA5 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA06__LCD_DATA6 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA07__LCD_DATA7 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA08__LCD_DATA8 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA09__LCD_DATA9 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA10__LCD_DATA10 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA11__LCD_DATA11 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA12__LCD_DATA12 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA13__LCD_DATA13 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA14__LCD_DATA14 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA15__LCD_DATA15 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA16__LCD_DATA16 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA17__LCD_DATA17 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA18__LCD_DATA18 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA19__LCD_DATA19 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA20__LCD_DATA20 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA21__LCD_DATA21 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA22__LCD_DATA22 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+ MX7D_PAD_LCD_DATA23__LCD_DATA23 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+
+ MX7D_PAD_LCD_RESET__GPIO3_IO4 | MUX_PAD_CTRL(LCD_PAD_CTRL),
+};
+
+static iomux_v3_cfg_t const pwm_pads[] = {
+ /* Use GPIO for Brightness adjustment, duty cycle = period */
+ MX7D_PAD_GPIO1_IO01__GPIO1_IO1 | MUX_PAD_CTRL(NO_PAD_CTRL),
+};
+
+static int setup_lcd(void)
+{
+ imx_iomux_v3_setup_multiple_pads(lcd_pads, ARRAY_SIZE(lcd_pads));
+
+ imx_iomux_v3_setup_multiple_pads(pwm_pads, ARRAY_SIZE(pwm_pads));
+
+ /* Reset LCD */
+ gpio_request(IMX_GPIO_NR(3, 4), "lcd reset");
+ gpio_direction_output(IMX_GPIO_NR(3, 4) , 0);
+ udelay(500);
+ gpio_direction_output(IMX_GPIO_NR(3, 4) , 1);
+
+ /* Set Brightness to high */
+ gpio_request(IMX_GPIO_NR(1, 1), "lcd backlight");
+ gpio_direction_output(IMX_GPIO_NR(1, 1) , 1);
+
+ return 0;
+}
+#endif
+
+static void setup_iomux_uart(void)
+{
+ imx_iomux_v3_setup_multiple_pads(uart1_pads, ARRAY_SIZE(uart1_pads));
+}
+
+int board_mmc_get_env_dev(int devno)
+{
+ if (devno == 2)
+ devno--;
+
+ return devno;
+}
+
+int mmc_map_to_kernel_blk(int dev_no)
+{
+ if (dev_no == 1)
+ dev_no++;
+
+ return dev_no;
+}
+
+#ifdef CONFIG_FEC_MXC
+static int setup_fec(void)
+{
+ struct iomuxc_gpr_base_regs *const iomuxc_gpr_regs
+ = (struct iomuxc_gpr_base_regs *) IOMUXC_GPR_BASE_ADDR;
+
+ /* Use 125M anatop REF_CLK1 for ENET1, clear gpr1[13], gpr1[17]*/
+ clrsetbits_le32(&iomuxc_gpr_regs->gpr[1],
+ (IOMUXC_GPR_GPR1_GPR_ENET1_TX_CLK_SEL_MASK |
+ IOMUXC_GPR_GPR1_GPR_ENET1_CLK_DIR_MASK), 0);
+
+ return set_clk_enet(ENET_125MHZ);
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ /* enable rgmii rxc skew and phy mode select to RGMII copper */
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x21);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1f, 0x7ea8);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1e, 0x2f);
+ phy_write(phydev, MDIO_DEVAD_NONE, 0x1f, 0x71b7);
+
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_FSL_QSPI
+int board_qspi_init(void)
+{
+ /* Set the clock */
+ set_clk_qspi();
+
+ return 0;
+}
+#endif
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+#ifdef CONFIG_FEC_MXC
+ setup_fec();
+#endif
+
+#ifdef CONFIG_NAND_MXS
+ setup_gpmi_nand();
+#endif
+
+#ifdef CONFIG_VIDEO_MXS
+ setup_lcd();
+#endif
+
+#ifdef CONFIG_FSL_QSPI
+ board_qspi_init();
+#endif
+
+#ifdef CONFIG_MXC_SPI
+ setup_spi();
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_DM_PMIC
+int power_init_board(void)
+{
+ struct udevice *dev;
+ int ret, dev_id, rev_id;
+
+ ret = pmic_get("pmic@8", &dev);
+ if (ret == -ENODEV)
+ return 0;
+ if (ret != 0)
+ return ret;
+
+ dev_id = pmic_reg_read(dev, PFUZE3000_DEVICEID);
+ rev_id = pmic_reg_read(dev, PFUZE3000_REVID);
+ printf("PMIC: PFUZE3000 DEV_ID=0x%x REV_ID=0x%x\n", dev_id, rev_id);
+
+ pmic_clrsetbits(dev, PFUZE3000_LDOGCTL, 0, 1);
+
+ /*
+ * Set the voltage of VLDO4 output to 2.8V which feeds
+ * the MIPI DSI and MIPI CSI inputs.
+ */
+ pmic_clrsetbits(dev, PFUZE3000_VLD4CTL, 0xF, 0xA);
+
+ return 0;
+}
+#endif
+
+int board_late_init(void)
+{
+ struct wdog_regs *wdog = (struct wdog_regs *)WDOG1_BASE_ADDR;
+ unsigned char eth1addr[6];
+
+ imx_iomux_v3_setup_multiple_pads(wdog_pads, ARRAY_SIZE(wdog_pads));
+
+ set_wdog_reset(wdog);
+
+ /*
+ * Do not assert internal WDOG_RESET_B_DEB(controlled by bit 4),
+ * since we use PMIC_PWRON to reset the board.
+ */
+ clrsetbits_le16(&wdog->wcr, 0, 0x10);
+
+ /* Get the second MAC address */
+ imx_get_mac_from_fuse(1, eth1addr);
+ if (!env_get("eth1addr") && is_valid_ethaddr(eth1addr))
+ eth_env_set_enetaddr("eth1addr", eth1addr);
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ char *mode;
+
+ if (IS_ENABLED(CONFIG_ARMV7_BOOT_SEC_DEFAULT))
+ mode = "secure";
+ else
+ mode = "non-secure";
+
+ printf("Board: i.MX7D SABRESD in %s mode\n", mode);
+
+ return 0;
+}
diff --git a/board/freescale/mx7ulp_evk/Kconfig b/board/freescale/mx7ulp_evk/Kconfig
new file mode 100644
index 00000000000..591697041dd
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_MX7ULP_EVK
+
+config SYS_BOARD
+ default "mx7ulp_evk"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "mx7ulp_evk"
+
+config IMX_CONFIG
+ default "board/freescale/mx7ulp_evk/imximage.cfg"
+
+endif
diff --git a/board/freescale/mx7ulp_evk/MAINTAINERS b/board/freescale/mx7ulp_evk/MAINTAINERS
new file mode 100644
index 00000000000..1aa26445632
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/MAINTAINERS
@@ -0,0 +1,7 @@
+MX7ULPEVK BOARD
+M: Peng Fan <peng.fan@nxp.com>
+S: Maintained
+F: board/freescale/mx7ulp_evk/
+F: include/configs/mx7ulp_evk.h
+F: configs/mx7ulp_evk_defconfig
+F: configs/mx7ulp_evk_plugin_defconfig
diff --git a/board/freescale/mx7ulp_evk/Makefile b/board/freescale/mx7ulp_evk/Makefile
new file mode 100644
index 00000000000..9f33c61f03b
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/Makefile
@@ -0,0 +1,4 @@
+# SPDX-License-Identifier: GPL-2.0+
+# (C) Copyright 2016 Freescale Semiconductor, Inc.
+
+obj-y := mx7ulp_evk.o
diff --git a/board/freescale/mx7ulp_evk/imximage.cfg b/board/freescale/mx7ulp_evk/imximage.cfg
new file mode 100644
index 00000000000..62fd79afd6c
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/imximage.cfg
@@ -0,0 +1,130 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ *
+ * Refer docs/README.imxmage for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+
+#include <config.h>
+
+/* image version */
+
+IMAGE_VERSION 2
+
+/*
+ * Boot Device : one of
+ * spi/sd/nand/onenand, qspi/nor
+ */
+
+BOOT_FROM sd
+
+#ifdef CONFIG_USE_IMXIMG_PLUGIN
+/*PLUGIN plugin-binary-file IRAM_FREE_START_ADDR*/
+PLUGIN board/freescale/mx7ulp_evk/plugin.bin 0x2F020000
+#else
+
+#ifdef CONFIG_IMX_HAB
+CSF CONFIG_CSF_SIZE
+#endif
+/*
+ * Device Configuration Data (DCD)
+ *
+ * Each entry must have the format:
+ * Addr-type Address Value
+ *
+ * where:
+ * Addr-type register length (1,2 or 4 bytes)
+ * Address absolute address of the register
+ * value value to be stored in the register
+ */
+DATA 4 0x403f00dc 0x00000000
+DATA 4 0x403e0040 0x01000020
+DATA 4 0x403e0500 0x01000000
+DATA 4 0x403e050c 0x80808080
+DATA 4 0x403e0508 0x00160002
+DATA 4 0x403E0510 0x00000001
+DATA 4 0x403E0514 0x00000014
+DATA 4 0x403e0500 0x00000001
+CHECK_BITS_SET 4 0x403e0500 0x01000000
+DATA 4 0x403e050c 0x8080801B
+CHECK_BITS_SET 4 0x403e050c 0x00000040
+DATA 4 0x403E0030 0x00000001
+DATA 4 0x403e0040 0x11000020
+DATA 4 0x403f00dc 0x42000000
+
+DATA 4 0x40B300AC 0x40000000
+
+DATA 4 0x40AD0128 0x00040000
+DATA 4 0x40AD00F8 0x00000000
+DATA 4 0x40AD00D8 0x00000180
+DATA 4 0x40AD0108 0x00000180
+DATA 4 0x40AD0104 0x00000180
+DATA 4 0x40AD0124 0x00010000
+DATA 4 0x40AD0080 0x0000018C
+DATA 4 0x40AD0084 0x0000018C
+DATA 4 0x40AD0088 0x0000018C
+DATA 4 0x40AD008C 0x0000018C
+
+DATA 4 0x40AD0120 0x00010000
+DATA 4 0x40AD010C 0x00000180
+DATA 4 0x40AD0110 0x00000180
+DATA 4 0x40AD0114 0x00000180
+DATA 4 0x40AD0118 0x00000180
+DATA 4 0x40AD0090 0x00000180
+DATA 4 0x40AD0094 0x00000180
+DATA 4 0x40AD0098 0x00000180
+DATA 4 0x40AD009C 0x00000180
+
+DATA 4 0x40AD00E0 0x00040000
+DATA 4 0x40AD00E4 0x00040000
+
+DATA 4 0x40AB001C 0x00008000
+DATA 4 0x40AB0800 0xA1390003
+DATA 4 0x40AB085C 0x0D3900A0
+DATA 4 0x40AB0890 0x00400000
+
+DATA 4 0x40AB0848 0x40404040
+DATA 4 0x40AB0850 0x40404040
+DATA 4 0x40AB081C 0x33333333
+DATA 4 0x40AB0820 0x33333333
+DATA 4 0x40AB0824 0x33333333
+DATA 4 0x40AB0828 0x33333333
+
+DATA 4 0x40AB08C0 0x24922492
+DATA 4 0x40AB08B8 0x00000800
+
+DATA 4 0x40AB0004 0x00020052
+DATA 4 0x40AB000C 0x292C42F3
+DATA 4 0x40AB0010 0x00100A22
+DATA 4 0x40AB0038 0x00120556
+DATA 4 0x40AB0014 0x00C700DB
+DATA 4 0x40AB0018 0x00211718
+DATA 4 0x40AB002C 0x0F9F26D2
+DATA 4 0x40AB0030 0x009F0E10
+DATA 4 0x40AB0040 0x0000003F
+DATA 4 0x40AB0000 0xC3190000
+
+DATA 4 0x40AB001C 0x00008010
+DATA 4 0x40AB001C 0x00008018
+DATA 4 0x40AB001C 0x003F8030
+DATA 4 0x40AB001C 0x003F8038
+DATA 4 0x40AB001C 0xFF0A8030
+DATA 4 0x40AB001C 0xFF0A8038
+DATA 4 0x40AB001C 0x04028030
+DATA 4 0x40AB001C 0x04028038
+DATA 4 0x40AB001C 0x83018030
+DATA 4 0x40AB001C 0x83018038
+DATA 4 0x40AB001C 0x01038030
+DATA 4 0x40AB001C 0x01038038
+
+DATA 4 0x40AB083C 0x20000000
+
+DATA 4 0x40AB0020 0x00001800
+DATA 4 0x40AB0800 0xA1310000
+DATA 4 0x40AB0004 0x00020052
+DATA 4 0x40AB0404 0x00011006
+DATA 4 0x40AB001C 0x00000000
+#endif
diff --git a/board/freescale/mx7ulp_evk/mx7ulp_evk.c b/board/freescale/mx7ulp_evk/mx7ulp_evk.c
new file mode 100644
index 00000000000..af68e57854e
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/mx7ulp_evk.c
@@ -0,0 +1,95 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ */
+
+#include <fdt_support.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/sys_proto.h>
+#include <asm/arch/mx7ulp-pins.h>
+#include <asm/arch/iomux.h>
+#include <asm/mach-imx/boot_mode.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_UP)
+
+int dram_init(void)
+{
+ gd->ram_size = imx_ddr_size();
+
+ return 0;
+}
+
+static iomux_cfg_t const lpuart4_pads[] = {
+ MX7ULP_PAD_PTC3__LPUART4_RX | MUX_PAD_CTRL(UART_PAD_CTRL),
+ MX7ULP_PAD_PTC2__LPUART4_TX | MUX_PAD_CTRL(UART_PAD_CTRL),
+};
+
+static void setup_iomux_uart(void)
+{
+ mx7ulp_iomux_setup_multiple_pads(lpuart4_pads,
+ ARRAY_SIZE(lpuart4_pads));
+}
+
+int board_early_init_f(void)
+{
+ setup_iomux_uart();
+
+ return 0;
+}
+
+int board_init(void)
+{
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ return 0;
+}
+
+#if IS_ENABLED(CONFIG_OF_BOARD_SETUP)
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ const char *path;
+ int rc, nodeoff;
+
+ if (get_boot_device() == USB_BOOT) {
+ path = fdt_get_alias(blob, "mmc0");
+ if (!path) {
+ puts("Not found mmc0\n");
+ return 0;
+ }
+
+ nodeoff = fdt_path_offset(blob, path);
+ if (nodeoff < 0)
+ return 0;
+
+ printf("Found usdhc0 node\n");
+ if (fdt_get_property(blob, nodeoff, "vqmmc-supply",
+ NULL) != NULL) {
+ rc = fdt_delprop(blob, nodeoff, "vqmmc-supply");
+ if (!rc) {
+ puts("Removed vqmmc-supply property\n");
+add:
+ rc = fdt_setprop(blob, nodeoff,
+ "no-1-8-v", NULL, 0);
+ if (rc == -FDT_ERR_NOSPACE) {
+ rc = fdt_increase_size(blob, 32);
+ if (!rc)
+ goto add;
+ } else if (rc) {
+ printf("Failed to add no-1-8-v property, %d\n", rc);
+ } else {
+ puts("Added no-1-8-v property\n");
+ }
+ } else {
+ printf("Failed to remove vqmmc-supply property, %d\n", rc);
+ }
+ }
+ }
+
+ return 0;
+}
+#endif
diff --git a/board/freescale/mx7ulp_evk/plugin.S b/board/freescale/mx7ulp_evk/plugin.S
new file mode 100644
index 00000000000..2cc93dbdd57
--- /dev/null
+++ b/board/freescale/mx7ulp_evk/plugin.S
@@ -0,0 +1,216 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright (C) 2016 Freescale Semiconductor, Inc.
+ * Copyright 2019 NXP
+ */
+
+#include <config.h>
+
+.macro imx7ulp_ddr_freq_decrease
+ ldr r2, =0x403f0000
+ ldr r3, =0x00000000
+ str r3, [r2, #0xdc]
+
+ ldr r2, =0x403e0000
+ ldr r3, =0x01000020
+ str r3, [r2, #0x40]
+ ldr r3, =0x01000000
+ str r3, [r2, #0x500]
+
+ ldr r3, =0x80808080
+ str r3, [r2, #0x50c]
+ ldr r3, =0x00160002
+ str r3, [r2, #0x508]
+ ldr r3, =0x00000001
+ str r3, [r2, #0x510]
+ ldr r3, =0x00000014
+ str r3, [r2, #0x514]
+ ldr r3, =0x00000001
+ str r3, [r2, #0x500]
+
+ ldr r3, =0x01000000
+wait1:
+ ldr r4, [r2, #0x500]
+ and r4, r3
+ cmp r4, r3
+ bne wait1
+
+ ldr r3, =0x8080801B
+ str r3, [r2, #0x50c]
+
+ ldr r3, =0x00000040
+wait2:
+ ldr r4, [r2, #0x50c]
+ and r4, r3
+ cmp r4, r3
+ bne wait2
+
+ ldr r3, =0x00000001
+ str r3, [r2, #0x30]
+ ldr r3, =0x11000020
+ str r3, [r2, #0x40]
+
+ ldr r2, =0x403f0000
+ ldr r3, =0x42000000
+ str r3, [r2, #0xdc]
+
+.endm
+
+.macro imx7ulp_evk_ddr_setting
+
+ imx7ulp_ddr_freq_decrease
+
+ /* Enable MMDC PCC clock */
+ ldr r2, =0x40b30000
+ ldr r3, =0x40000000
+ str r3, [r2, #0xac]
+
+ /* Configure DDR pad */
+ ldr r0, =0x40ad0000
+ ldr r1, =0x00040000
+ str r1, [r0, #0x128]
+ ldr r1, =0x0
+ str r1, [r0, #0xf8]
+ ldr r1, =0x00000180
+ str r1, [r0, #0xd8]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x108]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x104]
+ ldr r1, =0x00010000
+ str r1, [r0, #0x124]
+ ldr r1, =0x0000018C
+ str r1, [r0, #0x80]
+ ldr r1, =0x0000018C
+ str r1, [r0, #0x84]
+ ldr r1, =0x0000018C
+ str r1, [r0, #0x88]
+ ldr r1, =0x0000018C
+ str r1, [r0, #0x8c]
+
+ ldr r1, =0x00010000
+ str r1, [r0, #0x120]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x10c]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x110]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x114]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x118]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x90]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x94]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x98]
+ ldr r1, =0x00000180
+ str r1, [r0, #0x9c]
+ ldr r1, =0x00040000
+ str r1, [r0, #0xe0]
+ ldr r1, =0x00040000
+ str r1, [r0, #0xe4]
+
+ ldr r0, =0x40ab0000
+ ldr r1, =0x00008000
+ str r1, [r0, #0x1c]
+ ldr r1, =0xA1390003
+ str r1, [r0, #0x800]
+ ldr r1, =0x0D3900A0
+ str r1, [r0, #0x85c]
+ ldr r1, =0x00400000
+ str r1, [r0, #0x890]
+
+ ldr r1, =0x40404040
+ str r1, [r0, #0x848]
+ ldr r1, =0x40404040
+ str r1, [r0, #0x850]
+ ldr r1, =0x33333333
+ str r1, [r0, #0x81c]
+ ldr r1, =0x33333333
+ str r1, [r0, #0x820]
+ ldr r1, =0x33333333
+ str r1, [r0, #0x824]
+ ldr r1, =0x33333333
+ str r1, [r0, #0x828]
+
+ ldr r1, =0x24922492
+ str r1, [r0, #0x8c0]
+ ldr r1, =0x00000800
+ str r1, [r0, #0x8b8]
+
+ ldr r1, =0x00020052
+ str r1, [r0, #0x4]
+ ldr r1, =0x292C42F3
+ str r1, [r0, #0xc]
+ ldr r1, =0x00100A22
+ str r1, [r0, #0x10]
+ ldr r1, =0x00120556
+ str r1, [r0, #0x38]
+ ldr r1, =0x00C700DB
+ str r1, [r0, #0x14]
+ ldr r1, =0x00211718
+ str r1, [r0, #0x18]
+
+ ldr r1, =0x0F9F26D2
+ str r1, [r0, #0x2c]
+ ldr r1, =0x009F0E10
+ str r1, [r0, #0x30]
+ ldr r1, =0x0000003F
+ str r1, [r0, #0x40]
+ ldr r1, =0xC3190000
+ str r1, [r0, #0x0]
+
+ ldr r1, =0x00008010
+ str r1, [r0, #0x1c]
+ ldr r1, =0x00008018
+ str r1, [r0, #0x1c]
+ ldr r1, =0x003F8030
+ str r1, [r0, #0x1c]
+ ldr r1, =0x003F8038
+ str r1, [r0, #0x1c]
+ ldr r1, =0xFF0A8030
+ str r1, [r0, #0x1c]
+ ldr r1, =0xFF0A8038
+ str r1, [r0, #0x1c]
+ ldr r1, =0x04028030
+ str r1, [r0, #0x1c]
+ ldr r1, =0x04028038
+ str r1, [r0, #0x1c]
+ ldr r1, =0x83018030
+ str r1, [r0, #0x1c]
+ ldr r1, =0x83018038
+ str r1, [r0, #0x1c]
+ ldr r1, =0x01038030
+ str r1, [r0, #0x1c]
+ ldr r1, =0x01038038
+ str r1, [r0, #0x1c]
+
+ ldr r1, =0x20000000
+ str r1, [r0, #0x83c]
+
+ ldr r1, =0x00001800
+ str r1, [r0, #0x20]
+ ldr r1, =0xA1310000
+ str r1, [r0, #0x800]
+ ldr r1, =0x00020052
+ str r1, [r0, #0x4]
+ ldr r1, =0x00011006
+ str r1, [r0, #0x404]
+ ldr r1, =0x00000000
+ str r1, [r0, #0x1c]
+
+.endm
+
+.macro imx7ulp_clock_gating
+.endm
+
+.macro imx7ulp_qos_setting
+.endm
+
+.macro imx7ulp_ddr_setting
+ imx7ulp_evk_ddr_setting
+.endm
+
+/* include the common plugin code here */
+#include <asm/arch/mx7ulp_plugin.S>
diff --git a/board/freescale/p1010rdb/Kconfig b/board/freescale/p1010rdb/Kconfig
new file mode 100644
index 00000000000..159bcc4f54d
--- /dev/null
+++ b/board/freescale/p1010rdb/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_P1010RDB_PA || TARGET_P1010RDB_PB
+
+config SYS_BOARD
+ default "p1010rdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "P1010RDB"
+
+endif
diff --git a/board/freescale/p1010rdb/MAINTAINERS b/board/freescale/p1010rdb/MAINTAINERS
new file mode 100644
index 00000000000..6e940dd8759
--- /dev/null
+++ b/board/freescale/p1010rdb/MAINTAINERS
@@ -0,0 +1,21 @@
+P1010RDB BOARD
+M: Qiang Zhao <qiang.zhao@nxp.com>
+S: Maintained
+F: board/freescale/p1010rdb/
+F: include/configs/P1010RDB.h
+F: configs/P1010RDB-PA_36BIT_NAND_defconfig
+F: configs/P1010RDB-PA_36BIT_NOR_defconfig
+F: configs/P1010RDB-PA_36BIT_SDCARD_defconfig
+F: configs/P1010RDB-PA_36BIT_SPIFLASH_defconfig
+F: configs/P1010RDB-PA_NAND_defconfig
+F: configs/P1010RDB-PA_NOR_defconfig
+F: configs/P1010RDB-PA_SDCARD_defconfig
+F: configs/P1010RDB-PA_SPIFLASH_defconfig
+F: configs/P1010RDB-PB_36BIT_NAND_defconfig
+F: configs/P1010RDB-PB_36BIT_NOR_defconfig
+F: configs/P1010RDB-PB_36BIT_SDCARD_defconfig
+F: configs/P1010RDB-PB_36BIT_SPIFLASH_defconfig
+F: configs/P1010RDB-PB_NAND_defconfig
+F: configs/P1010RDB-PB_NOR_defconfig
+F: configs/P1010RDB-PB_SDCARD_defconfig
+F: configs/P1010RDB-PB_SPIFLASH_defconfig
diff --git a/board/freescale/p1010rdb/Makefile b/board/freescale/p1010rdb/Makefile
new file mode 100644
index 00000000000..a00806e6aae
--- /dev/null
+++ b/board/freescale/p1010rdb/Makefile
@@ -0,0 +1,26 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2010-2011 Freescale Semiconductor, Inc.
+
+MINIMAL=
+
+ifdef CONFIG_SPL_BUILD
+ifndef CONFIG_TPL_BUILD
+ifdef CONFIG_SPL_INIT_MINIMAL
+MINIMAL=y
+endif
+endif
+endif
+
+ifdef MINIMAL
+obj-y += spl_minimal.o
+else
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+endif
+obj-y += p1010rdb.o
+obj-y += ddr.o
+endif
+
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/p1010rdb/README.P1010RDB-PA b/board/freescale/p1010rdb/README.P1010RDB-PA
new file mode 100644
index 00000000000..0cb950d845e
--- /dev/null
+++ b/board/freescale/p1010rdb/README.P1010RDB-PA
@@ -0,0 +1,207 @@
+Overview
+=========
+The P1010RDB is a Freescale reference design board that hosts the P1010 SoC.
+
+The P1010 is a cost-effective, low-power, highly integrated host processor
+based on a Power Architecture e500v2 core (maximum core frequency 800/1000 MHz),
+that addresses the requirements of several routing, gateways, storage, consumer,
+and industrial applications. Applications of interest include the main CPUs and
+I/O processors in network attached storage (NAS), the voice over IP (VoIP)
+router/gateway, and wireless LAN (WLAN) and industrial controllers.
+
+The P1010RDB board features are as follows:
+Memory subsystem:
+ - 1Gbyte unbuffered DDR3 SDRAM discrete devices (32-bit bus)
+ - 32 Mbyte NOR flash single-chip memory
+ - 32 Mbyte NAND flash memory
+ - 256 Kbit M24256 I2C EEPROM
+ - 16 Mbyte SPI memory
+ - I2C Board EEPROM 128x8 bit memory
+ - SD/MMC connector to interface with the SD memory card
+Interfaces:
+ - PCIe:
+ - Lane0: x1 mini-PCIe slot
+ - Lane1: x1 PCIe standard slot
+ - SATA:
+ - 1 internal SATA connector to 2.5” 160G SATA2 HDD
+ - 1 eSATA connector to rear panel
+ - 10/100/1000 BaseT Ethernet ports:
+ - eTSEC1, RGMII: one 10/100/1000 port using Vitesse VSC8641XKO
+ - eTSEC2, SGMII: one 10/100/1000 port using Vitesse VSC8221
+ - eTSEC3, SGMII: one 10/100/1000 port using Vitesse VSC8221
+ - USB 2.0 port:
+ - x1 USB2.0 port via an external ULPI PHY to micro-AB connector
+ - x1 USB2.0 port via an internal UTMI PHY to micro-AB connector
+ - FlexCAN ports:
+ - 2 DB-9 female connectors for FlexCAN bus(revision 2.0B)
+ interface;
+ - DUART interface:
+ - DUART interface: supports two UARTs up to 115200 bps for
+ console display
+ - RJ45 connectors are used for these 2 UART ports.
+ - TDM
+ - 2 FXS ports connected via an external SLIC to the TDM interface.
+ SLIC is controllled via SPI.
+ - 1 FXO port connected via a relay to FXS for switchover to POTS
+Board connectors:
+ - Mini-ITX power supply connector
+ - JTAG/COP for debugging
+IEEE Std. 1588 signals for test and measurement
+Real-time clock on I2C bus
+POR
+ - support critical POR setting changed via switch on board
+PCB
+ - 6-layer routing (4-layer signals, 2-layer power and ground)
+
+
+Physical Memory Map on P1010RDB
+===============================
+Address Start Address End Memory type Attributes
+0x0000_0000 0x3fff_ffff DDR 1G Cacheable
+0xa000_0000 0xdfff_ffff PCI Express Mem 1G non-cacheable
+0xee00_0000 0xefff_ffff NOR Flash 32M non-cacheable
+0xffc2_0000 0xffc5_ffff PCI IO range 256K non-cacheable
+0xffa0_0000 0xffaf_ffff NAND Flash 1M cacheable
+0xffb0_0000 0xffbf_ffff Board CPLD 1M non-cacheable
+0xffd0_0000 0xffd0_3fff L1 for Stack 16K Cacheable TLB0
+0xffe0_0000 0xffef_ffff CCSR 1M non-cacheable
+
+
+Serial Port Configuration on P1010RDB
+=====================================
+Configure the serial port of the attached computer with the following values:
+ -Data rate: 115200 bps
+ -Number of data bits: 8
+ -Parity: None
+ -Number of Stop bits: 1
+ -Flow Control: Hardware/None
+
+
+Settings of DIP-switch
+======================
+ SW4[1:4]= 1111 and SW6[4]=0 for boot from 16bit NOR flash
+ SW4[1:4]= 1000 and SW6[4]=1 for boot from 8bit NAND flash
+ SW4[1:4]= 0110 and SW6[4]=0 for boot from SPI flash
+Note: 1 stands for 'on', 0 stands for 'off'
+
+
+Setting of hwconfig
+===================
+If FlexCAN or TDM is needed, please set "fsl_p1010mux:tdm_can=can" or
+"fsl_p1010mux:tdm_can=tdm" explicitly in u-boot prompt as below for example:
+setenv hwconfig "fsl_p1010mux:tdm_can=tdm;usb1:dr_mode=host,phy_type=utmi"
+By default, don't set fsl_p1010mux:tdm_can, in this case, spi chip selection
+is set to spi-flash instead of to SLIC/TDM/DAC and tdm_can_sel is set to TDM
+instead of to CAN/UART1.
+
+
+Build and burn U-Boot to NOR flash
+==================================
+1. Build u-boot.bin image
+ export CROSS_COMPILE=/your_path/powerpc-linux-gnu-
+ make P1010RDB_NOR
+
+2. Burn u-boot.bin into NOR flash
+ => tftp $loadaddr $uboot
+ => protect off eff40000 +$filesize
+ => erase eff40000 +$filesize
+ => cp.b $loadaddr eff40000 $filesize
+
+3. Check SW4[1:4]= 1111 and SW6[4]=0, then power on.
+
+
+Alternate NOR bank
+==================
+1. Burn u-boot.bin into alternate NOR bank
+ => tftp $loadaddr $uboot
+ => protect off eef40000 +$filesize
+ => erase eef40000 +$filesize
+ => cp.b $loadaddr eef40000 $filesize
+
+2. Switch to alternate NOR bank
+ => mw.b ffb00009 1
+ => reset
+ or set SW1[8]= ON
+
+SW1[8]= OFF: Upper bank used for booting start
+SW1[8]= ON: Lower bank used for booting start
+CPLD NOR bank selection register address 0xFFB00009 Bit[0]:
+0 - boot from upper 4 sectors
+1 - boot from lower 4 sectors
+
+
+Build and burn U-Boot to NAND flash
+===================================
+1. Build u-boot.bin image
+ export ARCH=powerpc
+ export CROSS_COMPILE=/your_path/powerpc-linux-gnu-
+ make P1010RDB_NAND
+
+2. Burn u-boot-nand.bin into NAND flash
+ => tftp $loadaddr $uboot-nand
+ => nand erase 0 $filesize
+ => nand write $loadaddr 0 $filesize
+
+3. Check SW4[1:4]= 1000 and SW6[4]=1, then power on.
+
+
+Build and burn U-Boot to SPI flash
+==================================
+1. Build u-boot-spi.bin image
+ make P1010RDB_SPIFLASH_config; make
+ Boot up kernel with rootfs.ext2.gz.uboot.p1010rdb
+ Download u-boot.bin to linux and you can find some config files
+ under /usr/share such as config_xx.dat. Do below command:
+ boot_format config_ddr3_1gb_p1010rdb_800M.dat u-boot.bin -spi \
+ u-boot-spi.bin
+ to generate u-boot-spi.bin.
+
+2. Burn u-boot-spi.bin into SPI flash
+ => tftp $loadaddr $uboot-spi
+ => sf erase 0 100000
+ => sf write $loadaddr 0 $filesize
+
+3. Check SW4[1:4]= 0110 and SW6[4]=0, then power on.
+
+
+CPLD POR setting registers
+==========================
+1. Set POR switch selection register (addr 0xFFB00011) to 0.
+2. Write CPLD POR registers (BCSR0~BCSR3, addr 0xFFB00014~0xFFB00017) with
+ proper values.
+ If change boot ROM location to NOR or NAND flash, need write the IFC_CS0
+ switch command by I2C.
+3. Send reset command.
+ After reset, the new POR setting will be implemented.
+
+Two examples are given in below:
+Switch from NOR to NAND boot with default frequency:
+ => i2c dev 0
+ => i2c mw 18 1 f9
+ => i2c mw 18 3 f0
+ => mw.b ffb00011 0
+ => mw.b ffb00017 1
+ => reset
+Switch from NAND to NOR boot with Core/CCB/DDR (800/400/667 MHz):
+ => i2c dev 0
+ => i2c mw 18 1 f1
+ => i2c mw 18 3 f0
+ => mw.b ffb00011 0
+ => mw.b ffb00014 2
+ => mw.b ffb00015 5
+ => mw.b ffb00016 3
+ => mw.b ffb00017 f
+ => reset
+
+
+Boot Linux from network using TFTP on P1010RDB
+==============================================
+Place uImage, p1010rdb.dtb and rootfs files in the TFTP disk area.
+ => tftp 1000000 uImage
+ => tftp 2000000 p1010rdb.dtb
+ => tftp 3000000 rootfs.ext2.gz.uboot.p1010rdb
+ => bootm 1000000 3000000 2000000
+
+
+For more details, please refer to P1010RDB User Guide and access website
+www.freescale.com
diff --git a/board/freescale/p1010rdb/README.P1010RDB-PB b/board/freescale/p1010rdb/README.P1010RDB-PB
new file mode 100644
index 00000000000..4a3b389877f
--- /dev/null
+++ b/board/freescale/p1010rdb/README.P1010RDB-PB
@@ -0,0 +1,187 @@
+Overview
+=========
+The P1010RDB-PB is a Freescale Reference Design Board that hosts the P1010 SoC.
+P1010RDB-PB is a variation of previous P1010RDB-PA board.
+
+The P1010 is a cost-effective, low-power, highly integrated host processor
+based on a Power Architecture e500v2 core (maximum core frequency 1GHz),that
+addresses the requirements of several routing, gateways, storage, consumer,
+and industrial applications. Applications of interest include the main CPUs and
+I/O processors in network attached storage (NAS), the voice over IP (VoIP)
+router/gateway, and wireless LAN (WLAN) and industrial controllers.
+
+The P1010RDB-PB board features are as following:
+Memory subsystem:
+ - 1G bytes unbuffered DDR3 SDRAM discrete devices (32-bit bus)
+ - 32M bytes NOR flash single-chip memory
+ - 2G bytes NAND flash memory
+ - 16M bytes SPI memory
+ - 256K bit M24256 I2C EEPROM
+ - I2C Board EEPROM 128x8 bit memory
+ - SD/MMC connector to interface with the SD memory card
+Interfaces:
+ - Three 10/100/1000 BaseT Ethernet ports (One RGMII and two SGMII)
+ - PCIe 2.0: two x1 mini-PCIe slots
+ - SATA 2.0: two SATA interfaces
+ - USB 2.0: one USB interface
+ - FlexCAN: two FlexCAN interfaces (revision 2.0B)
+ - UART: one USB-to-Serial interface
+ - TDM: 2 FXS ports connected via an external SLIC to the TDM interface.
+ 1 FXO port connected via a relay to FXS for switchover to POTS
+
+Board connectors:
+ - Mini-ITX power supply connector
+ - JTAG/COP for debugging
+
+POR: support critical POR setting changed via switch on board
+PCB: 6-layer routing (4-layer signals, 2-layer power and ground)
+
+Physical Memory Map on P1010RDB
+===============================
+Address Start Address End Memory type Attributes
+0x0000_0000 0x3fff_ffff DDR 1G Cacheable
+0xa000_0000 0xdfff_ffff PCI Express Mem 1G non-cacheable
+0xee00_0000 0xefff_ffff NOR Flash 32M non-cacheable
+0xffc2_0000 0xffc5_ffff PCI IO range 256K non-cacheable
+0xffa0_0000 0xffaf_ffff NAND Flash 1M cacheable
+0xffb0_0000 0xffbf_ffff Board CPLD 1M non-cacheable
+0xffd0_0000 0xffd0_3fff L1 for Stack 16K Cacheable TLB0
+0xffe0_0000 0xffef_ffff CCSR 1M non-cacheable
+
+
+Serial Port Configuration on P1010RDB
+=====================================
+Configure the serial port of the attached computer with the following values:
+ -Data rate: 115200 bps
+ -Number of data bits: 8
+ -Parity: None
+ -Number of Stop bits: 1
+ -Flow Control: Hardware/None
+
+
+P1010RDB-PB default DIP-switch settings
+=======================================
+SW1[1:8]= 10101010
+SW2[1:8]= 11011000
+SW3[1:8]= 10010000
+SW4[1:4]= 1010
+SW5[1:8]= 11111010
+
+
+P1010RDB-PB boot mode settings via DIP-switch
+=============================================
+SW4[1:4]= 1111 and SW3[3:4]= 00 for 16bit NOR boot
+SW4[1:4]= 1010 and SW3[3:4]= 01 for 8bit NAND boot
+SW4[1:4]= 0110 and SW3[3:4]= 00 for SPI boot
+SW4[1:4]= 0111 and SW3[3:4]= 10 for SD boot
+Note: 1 stands for 'on', 0 stands for 'off'
+
+
+Switch P1010RDB-PB boot mode via software without setting DIP-switch
+====================================================================
+=> run boot_bank0 (boot from NOR bank0)
+=> run boot_bank1 (boot from NOR bank1)
+=> run boot_nand (boot from NAND flash)
+=> run boot_spi (boot from SPI flash)
+=> run boot_sd (boot from SD card)
+
+
+Frequency combination support on P1010RDB-PB
+=============================================
+SW1[4:7] SW5[1] SW5[5:8] SW2[2] Core(MHz) Platform(MHz) DDR(MT/s)
+0101 1 1010 0 800 400 800
+1001 1 1010 0 800 400 667
+1010 1 1100 0 667 333 667
+1000 0 1010 0 533 266 667
+0101 1 1010 1 1000 400 800
+1001 1 1010 1 1000 400 667
+
+
+Setting of pin mux
+==================
+Since pins multiplexing, TDM and CAN are muxed with SPI flash.
+SDHC is muxed with IFC. IFC and SPI flash are enabled by default.
+
+To enable TDM:
+=> setenv hwconfig fsl_p1010mux:tdm_can=tdm
+=> save;reset
+
+To enable FlexCAN:
+=> setenv hwconfig fsl_p1010mux:tdm_can=can
+=> save;reset
+
+To enable SDHC in case of NOR/NAND/SPI boot
+ a) For temporary use case in runtime without reboot system
+ run 'mux sdhc' in U-Boot to validate SDHC with invalidating IFC.
+
+ b) For long-term use case
+ set 'esdhc' in hwconfig and save it.
+
+To enable IFC in case of SD boot
+ a) For temporary use case in runtime without reboot system
+ run 'mux ifc' in U-Boot to validate IFC with invalidating SDHC.
+
+ b) For long-term use case
+ set 'ifc' in hwconfig and save it.
+
+
+Build images for different boot mode
+====================================
+First setup cross compile environment on build host
+ $ export CROSS_COMPILE=<your-compiler-path>/powerpc-linux-gnu-
+
+1. For NOR boot
+ $ make P1010RDB-PB_NOR
+
+2. For NAND boot
+ $ make P1010RDB-PB_NAND
+
+3. For SPI boot
+ $ make P1010RDB-PB_SPIFLASH
+
+4. For SD boot
+ $ make P1010RDB-PB_SDCARD
+
+
+Steps to program images to flash for different boot mode
+========================================================
+1. NOR boot
+ => tftp 1000000 u-boot.bin
+ For bank0
+ => pro off all;era eff40000 efffffff;cp.b 1000000 eff40000 $filesize
+ set SW1[8]=0, SW4[1:4]= 1111 and SW3[3:4]= 00, then power on the board
+
+ For bank1
+ => pro off all;era eef40000 eeffffff;cp.b 1000000 eef40000 $filesize
+ set SW1[8]=1, SW4[1:4]= 1111 and SW3[3:4]= 00, then power on the board
+
+2. NAND boot
+ => tftp 1000000 u-boot-nand.bin
+ => nand erase 0 $filesize; nand write $loadaddr 0 $filesize
+ Set SW4[1:4]= 1010 and SW3[3:4]= 01, then power on the board
+
+3. SPI boot
+ 1) cat p1010rdb-config-header.bin u-boot.bin > u-boot-spi-combined.bin
+ 2) => tftp 1000000 u-boot-spi-combined.bin
+ 3) => sf probe 0; sf erase 0 100000; sf write 1000000 0 100000
+ set SW4[1:4]= 0110 and SW3[3:4]= 00, then power on the board
+
+4. SD boot
+ 1) cat p1010rdb-config-header.bin u-boot.bin > u-boot-sd-combined.bin
+ 2) => tftp 1000000 u-boot-sd-combined.bin
+ 3) => mux sdhc
+ 4) => mmc write 1000000 0 1050
+ set SW4[1:4]= 0111 and SW3[3:4]= 10, then power on the board
+
+
+Boot Linux from network using TFTP on P1010RDB-PB
+=================================================
+Place uImage, p1010rdb.dtb and rootfs files in the TFTP download path.
+ => tftp 1000000 uImage
+ => tftp 2000000 p1010rdb.dtb
+ => tftp 3000000 rootfs.ext2.gz.uboot.p1010rdb
+ => bootm 1000000 3000000 2000000
+
+
+For more details, please refer to P1010RDB-PB User Guide and access website
+www.freescale.com and Freescale QorIQ SDK Infocenter document.
diff --git a/board/freescale/p1010rdb/ddr.c b/board/freescale/p1010rdb/ddr.c
new file mode 100644
index 00000000000..43a0936bc9a
--- /dev/null
+++ b/board/freescale/p1010rdb/ddr.c
@@ -0,0 +1,97 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <vsprintf.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <asm/immap_85xx.h>
+#include <asm/processor.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/io.h>
+#include <asm/fsl_law.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+/*
+ * Samsung K4B2G0846C-HCF8
+ * The following timing are for "downshift"
+ * i.e. to use CL9 part as CL7
+ * otherwise, tAA, tRCD, tRP will be 13500ps
+ * and tRC will be 49500ps
+ */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1875,
+ .caslat_x = 0x1e << 4, /* 5,6,7,8 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 7500,
+ .trp_ps = 13125,
+ .tras_ps = 37500,
+ .trc_ps = 50625,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 37500,
+};
+
+int fsl_ddr_get_dimm_params(dimm_params_t *pdimm,
+ unsigned int controller_number,
+ unsigned int dimm_number)
+{
+ const char dimm_model[] = "Fixed DDR on board";
+
+ if ((controller_number == 0) && (dimm_number == 0)) {
+ memcpy(pdimm, &ddr_raw_timing, sizeof(dimm_params_t));
+ memset(pdimm->mpart, 0, sizeof(pdimm->mpart));
+ memcpy(pdimm->mpart, dimm_model, sizeof(dimm_model) - 1);
+ }
+
+ return 0;
+}
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ struct cpu_type *cpu;
+ int i;
+ popts->clk_adjust = 6;
+ popts->cpo_override = 0x1f;
+ popts->write_data_delay = 2;
+ popts->half_strength_driver_enable = 1;
+ /* Write leveling override */
+ popts->wrlvl_en = 1;
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+ popts->wrlvl_start = 0x8;
+ popts->trwt_override = 1;
+ popts->trwt = 0;
+
+ cpu = gd->arch.cpu;
+ /* P1014 and it's derivatives support max 16it DDR width */
+ if (cpu->soc_ver == SVR_P1014)
+ popts->data_bus_width = DDR_DATA_BUS_WIDTH_16;
+
+ for (i = 0; i < CONFIG_CHIP_SELECTS_PER_CTRL; i++) {
+ popts->cs_local_opts[i].odt_rd_cfg = FSL_DDR_ODT_NEVER;
+ popts->cs_local_opts[i].odt_wr_cfg = FSL_DDR_ODT_CS;
+ }
+}
diff --git a/board/freescale/p1010rdb/law.c b/board/freescale/p1010rdb/law.c
new file mode 100644
index 00000000000..a7d80f28521
--- /dev/null
+++ b/board/freescale/p1010rdb/law.c
@@ -0,0 +1,16 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_IFC),
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_128K, LAW_TRGT_IF_IFC),
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_IFC),
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/p1010rdb/p1010rdb.c b/board/freescale/p1010rdb/p1010rdb.c
new file mode 100644
index 00000000000..ab0031440ae
--- /dev/null
+++ b/board/freescale/p1010rdb/p1010rdb.c
@@ -0,0 +1,680 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ * Copyright 2020 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <image.h>
+#include <init.h>
+#include <net.h>
+#include <asm/global_data.h>
+#include <asm/processor.h>
+#include <asm/mmu.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/io.h>
+#include <env.h>
+#include <miiphy.h>
+#include <linux/libfdt.h>
+#include <fdt_support.h>
+#include <fsl_mdio.h>
+#include <tsec.h>
+#include <mmc.h>
+#include <netdev.h>
+#include <pci.h>
+#include <asm/fsl_serdes.h>
+#include <fsl_ifc.h>
+#include <asm/fsl_pci.h>
+#include <hwconfig.h>
+#include <i2c.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define GPIO4_PCIE_RESET_SET 0x08000000
+#define MUX_CPLD_CAN_UART 0x00
+#define MUX_CPLD_TDM 0x01
+#define MUX_CPLD_SPICS0_FLASH 0x00
+#define MUX_CPLD_SPICS0_SLIC 0x02
+#define PMUXCR1_IFC_MASK 0x00ffff00
+#define PMUXCR1_SDHC_MASK 0x00fff000
+#define PMUXCR1_SDHC_ENABLE 0x00555000
+
+enum {
+ MUX_TYPE_IFC,
+ MUX_TYPE_SDHC,
+ MUX_TYPE_SPIFLASH,
+ MUX_TYPE_TDM,
+ MUX_TYPE_CAN,
+ MUX_TYPE_CS0_NOR,
+ MUX_TYPE_CS0_NAND,
+};
+
+enum {
+ I2C_READ_BANK,
+ I2C_READ_PCB_VER,
+};
+
+static uint sd_ifc_mux;
+
+struct cpld_data {
+ u8 cpld_ver; /* cpld revision */
+#if defined(CONFIG_TARGET_P1010RDB_PA)
+ u8 pcba_ver; /* pcb revision number */
+ u8 twindie_ddr3;
+ u8 res1[6];
+ u8 bank_sel; /* NOR Flash bank */
+ u8 res2[5];
+ u8 usb2_sel;
+ u8 res3[1];
+ u8 porsw_sel;
+ u8 tdm_can_sel;
+ u8 spi_cs0_sel; /* SPI CS0 SLIC/SPI Flash */
+ u8 por0; /* POR Options */
+ u8 por1; /* POR Options */
+ u8 por2; /* POR Options */
+ u8 por3; /* POR Options */
+#elif defined(CONFIG_TARGET_P1010RDB_PB)
+ u8 rom_loc;
+#endif
+};
+
+int board_early_init_f(void)
+{
+ ccsr_gpio_t *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ struct fsl_ifc ifc = {(void *)CFG_SYS_IFC_ADDR, (void *)NULL};
+ /* Clock configuration to access CPLD using IFC(GPCM) */
+ setbits_be32(&ifc.gregs->ifc_gcr, 1 << IFC_GCR_TBCTL_TRN_TIME_SHIFT);
+ /*
+ * Reset PCIe slots via GPIO4
+ */
+ setbits_be32(&pgpio->gpdir, GPIO4_PCIE_RESET_SET);
+ setbits_be32(&pgpio->gpdat, GPIO4_PCIE_RESET_SET);
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+
+ /*
+ * Remap Boot flash region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_16M, 1);
+
+ set_tlb(1, flashbase + 0x1000000,
+ CFG_SYS_FLASH_BASE_PHYS + 0x1000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel+1, BOOKE_PAGESZ_16M, 1);
+ return 0;
+}
+
+int config_board_mux(int ctrl_type)
+{
+ ccsr_gur_t __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u8 tmp;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+#if defined(CONFIG_TARGET_P1010RDB_PA)
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ ret = i2c_get_chip_for_busnum(I2C_PCA9557_BUS_NUM,
+ I2C_PCA9557_ADDR1, 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n",
+ __func__, I2C_PCA9557_BUS_NUM);
+ return ret;
+ }
+ switch (ctrl_type) {
+ case MUX_TYPE_IFC:
+ tmp = 0xf0;
+ dm_i2c_write(dev, 3, &tmp, 1);
+ tmp = 0x01;
+ dm_i2c_write(dev, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_IFC;
+ clrbits_be32(&gur->pmuxcr, PMUXCR1_IFC_MASK);
+ break;
+ case MUX_TYPE_SDHC:
+ tmp = 0xf0;
+ dm_i2c_write(dev, 3, &tmp, 1);
+ tmp = 0x05;
+ dm_i2c_write(dev, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_SDHC;
+ clrsetbits_be32(&gur->pmuxcr, PMUXCR1_SDHC_MASK,
+ PMUXCR1_SDHC_ENABLE);
+ break;
+ case MUX_TYPE_SPIFLASH:
+ out_8(&cpld_data->spi_cs0_sel, MUX_CPLD_SPICS0_FLASH);
+ break;
+ case MUX_TYPE_TDM:
+ out_8(&cpld_data->tdm_can_sel, MUX_CPLD_TDM);
+ out_8(&cpld_data->spi_cs0_sel, MUX_CPLD_SPICS0_SLIC);
+ break;
+ case MUX_TYPE_CAN:
+ out_8(&cpld_data->tdm_can_sel, MUX_CPLD_CAN_UART);
+ break;
+ default:
+ break;
+ }
+#elif defined(CONFIG_TARGET_P1010RDB_PB)
+ ret = i2c_get_chip_for_busnum(I2C_PCA9557_BUS_NUM,
+ I2C_PCA9557_ADDR2, 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n",
+ __func__, I2C_PCA9557_BUS_NUM);
+ return ret;
+ }
+ switch (ctrl_type) {
+ case MUX_TYPE_IFC:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_IFC;
+ clrbits_be32(&gur->pmuxcr, PMUXCR1_IFC_MASK);
+ break;
+ case MUX_TYPE_SDHC:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ setbits_8(&tmp, 0x04);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_SDHC;
+ clrsetbits_be32(&gur->pmuxcr, PMUXCR1_SDHC_MASK,
+ PMUXCR1_SDHC_ENABLE);
+ break;
+ case MUX_TYPE_SPIFLASH:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ clrbits_8(&tmp, 0x80);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x80);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ break;
+ case MUX_TYPE_TDM:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ setbits_8(&tmp, 0x82);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x82);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ break;
+ case MUX_TYPE_CAN:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ clrbits_8(&tmp, 0x02);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x02);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ break;
+ case MUX_TYPE_CS0_NOR:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ break;
+ case MUX_TYPE_CS0_NAND:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ setbits_8(&tmp, 0x08);
+ dm_i2c_write(dev, 1, &tmp, 1);
+ dm_i2c_read(dev, 3, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ dm_i2c_write(dev, 3, &tmp, 1);
+ break;
+ default:
+ break;
+ }
+#endif
+#else
+#if defined(CONFIG_TARGET_P1010RDB_PA)
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_IFC:
+ i2c_set_bus_num(I2C_PCA9557_BUS_NUM);
+ tmp = 0xf0;
+ i2c_write(I2C_PCA9557_ADDR1, 3, 1, &tmp, 1);
+ tmp = 0x01;
+ i2c_write(I2C_PCA9557_ADDR1, 1, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_IFC;
+ clrbits_be32(&gur->pmuxcr, PMUXCR1_IFC_MASK);
+ break;
+ case MUX_TYPE_SDHC:
+ i2c_set_bus_num(I2C_PCA9557_BUS_NUM);
+ tmp = 0xf0;
+ i2c_write(I2C_PCA9557_ADDR1, 3, 1, &tmp, 1);
+ tmp = 0x05;
+ i2c_write(I2C_PCA9557_ADDR1, 1, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_SDHC;
+ clrsetbits_be32(&gur->pmuxcr, PMUXCR1_SDHC_MASK,
+ PMUXCR1_SDHC_ENABLE);
+ break;
+ case MUX_TYPE_SPIFLASH:
+ out_8(&cpld_data->spi_cs0_sel, MUX_CPLD_SPICS0_FLASH);
+ break;
+ case MUX_TYPE_TDM:
+ out_8(&cpld_data->tdm_can_sel, MUX_CPLD_TDM);
+ out_8(&cpld_data->spi_cs0_sel, MUX_CPLD_SPICS0_SLIC);
+ break;
+ case MUX_TYPE_CAN:
+ out_8(&cpld_data->tdm_can_sel, MUX_CPLD_CAN_UART);
+ break;
+ default:
+ break;
+ }
+#elif defined(CONFIG_TARGET_P1010RDB_PB)
+ uint orig_bus = i2c_get_bus_num();
+ i2c_set_bus_num(I2C_PCA9557_BUS_NUM);
+
+ switch (ctrl_type) {
+ case MUX_TYPE_IFC:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_IFC;
+ clrbits_be32(&gur->pmuxcr, PMUXCR1_IFC_MASK);
+ break;
+ case MUX_TYPE_SDHC:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ setbits_8(&tmp, 0x04);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x04);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ sd_ifc_mux = MUX_TYPE_SDHC;
+ clrsetbits_be32(&gur->pmuxcr, PMUXCR1_SDHC_MASK,
+ PMUXCR1_SDHC_ENABLE);
+ break;
+ case MUX_TYPE_SPIFLASH:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x80);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x80);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ break;
+ case MUX_TYPE_TDM:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ setbits_8(&tmp, 0x82);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x82);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ break;
+ case MUX_TYPE_CAN:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x02);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x02);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ break;
+ case MUX_TYPE_CS0_NOR:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ break;
+ case MUX_TYPE_CS0_NAND:
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &tmp, 1);
+ setbits_8(&tmp, 0x08);
+ i2c_write(I2C_PCA9557_ADDR2, 1, 1, &tmp, 1);
+ i2c_read(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ clrbits_8(&tmp, 0x08);
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &tmp, 1);
+ break;
+ default:
+ break;
+ }
+ i2c_set_bus_num(orig_bus);
+#endif
+#endif
+ return 0;
+}
+
+#ifdef CONFIG_TARGET_P1010RDB_PB
+int i2c_pca9557_read(int type)
+{
+ u8 val;
+ int bus_num = I2C_PCA9557_BUS_NUM;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_PCA9557_ADDR2, 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n",
+ __func__, bus_num);
+ return ret;
+ }
+ dm_i2c_read(dev, 0, &val, 1);
+#else
+ i2c_set_bus_num(bus_num);
+ i2c_read(I2C_PCA9557_ADDR2, 0, 1, &val, 1);
+#endif
+
+ switch (type) {
+ case I2C_READ_BANK:
+ val = (val & 0x10) >> 4;
+ break;
+ case I2C_READ_PCB_VER:
+ val = ((val & 0x60) >> 5) + 1;
+ break;
+ default:
+ break;
+ }
+
+ return val;
+}
+#endif
+
+int checkboard(void)
+{
+ struct cpu_type *cpu;
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ u8 val;
+
+ cpu = gd->arch.cpu;
+#if defined(CONFIG_TARGET_P1010RDB_PA)
+ printf("Board: %sRDB-PA, ", cpu->name);
+#elif defined(CONFIG_TARGET_P1010RDB_PB)
+ printf("Board: %sRDB-PB, ", cpu->name);
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(I2C_PCA9557_BUS_NUM, I2C_PCA9557_ADDR2,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ I2C_PCA9557_BUS_NUM);
+ return ret;
+ }
+ val = 0x0; /* no polarity inversion */
+ dm_i2c_write(dev, 2, &val, 1);
+#else
+ i2c_set_bus_num(I2C_PCA9557_BUS_NUM);
+ i2c_init(CONFIG_SYS_I2C_SPEED, CONFIG_SYS_I2C_SLAVE);
+ val = 0x0; /* no polarity inversion */
+ i2c_write(I2C_PCA9557_ADDR2, 2, 1, &val, 1);
+#endif
+#endif
+
+#ifdef CONFIG_SDCARD
+ /* switch to IFC to read info from CPLD */
+ config_board_mux(MUX_TYPE_IFC);
+#endif
+
+#if defined(CONFIG_TARGET_P1010RDB_PA)
+ val = (in_8(&cpld_data->pcba_ver) & 0xf);
+ printf("PCB: v%x.0\n", val);
+#elif defined(CONFIG_TARGET_P1010RDB_PB)
+ val = in_8(&cpld_data->cpld_ver);
+ printf("CPLD: v%x.%x, ", val >> 4, val & 0xf);
+ printf("PCB: v%x.0, ", i2c_pca9557_read(I2C_READ_PCB_VER));
+ val = in_8(&cpld_data->rom_loc) & 0xf;
+ puts("Boot from: ");
+ switch (val) {
+ case 0xf:
+ config_board_mux(MUX_TYPE_CS0_NOR);
+ printf("NOR vBank%d\n", i2c_pca9557_read(I2C_READ_BANK));
+ break;
+ case 0xe:
+ puts("SDHC\n");
+ val = 0x60; /* set pca9557 pin input/output */
+#if CONFIG_IS_ENABLED(DM_I2C)
+ dm_i2c_write(dev, 3, &val, 1);
+#else
+ i2c_write(I2C_PCA9557_ADDR2, 3, 1, &val, 1);
+#endif
+ break;
+ case 0x5:
+ config_board_mux(MUX_TYPE_IFC);
+ config_board_mux(MUX_TYPE_CS0_NAND);
+ puts("NAND\n");
+ break;
+ case 0x6:
+ config_board_mux(MUX_TYPE_IFC);
+ puts("SPI\n");
+ break;
+ default:
+ puts("unknown\n");
+ break;
+ }
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_OF_BOARD_SETUP)
+void fdt_del_flexcan(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "fsl,p1010-flexcan")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_del_spi_flash(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "spansion,s25sl12801")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_del_spi_slic(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "zarlink,le88266")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_del_tdm(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "fsl,starlite-tdm")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_del_sdhc(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "fsl,esdhc")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_del_ifc(void *blob)
+{
+ int nodeoff = 0;
+
+ while ((nodeoff = fdt_node_offset_by_compatible(blob, 0,
+ "fsl,ifc")) >= 0) {
+ fdt_del_node(blob, nodeoff);
+ }
+}
+
+void fdt_disable_uart1(void *blob)
+{
+ int nodeoff;
+
+ nodeoff = fdt_node_offset_by_compat_reg(blob, "fsl,ns16550",
+ CFG_SYS_NS16550_COM2);
+
+ if (nodeoff > 0) {
+ fdt_status_disabled(blob, nodeoff);
+ } else {
+ printf("WARNING unable to set status for fsl,ns16550 "
+ "uart1: %s\n", fdt_strerror(nodeoff));
+ }
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+ struct cpu_type *cpu;
+
+ cpu = gd->arch.cpu;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#if defined(CONFIG_HAS_FSL_DR_USB)
+ fsl_fdt_fixup_dr_usb(blob, bd);
+#endif
+
+ /* P1014 and it's derivatives don't support CAN and eTSEC3 */
+ if (cpu->soc_ver == SVR_P1014) {
+ fdt_del_flexcan(blob);
+ fdt_del_node_and_alias(blob, "ethernet2");
+ }
+
+ /* Delete IFC node as IFC pins are multiplexing with SDHC */
+ if (sd_ifc_mux != MUX_TYPE_IFC)
+ fdt_del_ifc(blob);
+ else
+ fdt_del_sdhc(blob);
+
+ if (hwconfig_subarg_cmp("fsl_p1010mux", "tdm_can", "can")) {
+ fdt_del_tdm(blob);
+ fdt_del_spi_slic(blob);
+ } else if (hwconfig_subarg_cmp("fsl_p1010mux", "tdm_can", "tdm")) {
+ fdt_del_flexcan(blob);
+ fdt_del_spi_flash(blob);
+ fdt_disable_uart1(blob);
+ } else {
+ /*
+ * If we don't set fsl_p1010mux:tdm_can to "can" or "tdm"
+ * explicitly, defaultly spi_cs_sel to spi-flash instead of
+ * to tdm/slic.
+ */
+ fdt_del_tdm(blob);
+ fdt_del_flexcan(blob);
+ fdt_disable_uart1(blob);
+ }
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_SDCARD
+int board_mmc_init(struct bd_info *bis)
+{
+ config_board_mux(MUX_TYPE_SDHC);
+ return -1;
+}
+#else
+void board_reset(void)
+{
+ /* mux to IFC to enable CPLD for reset */
+ if (sd_ifc_mux != MUX_TYPE_IFC)
+ config_board_mux(MUX_TYPE_IFC);
+}
+#endif
+
+
+int misc_init_r(void)
+{
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+
+ if (hwconfig_subarg_cmp("fsl_p1010mux", "tdm_can", "can")) {
+ clrbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_CAN1_TDM |
+ MPC85xx_PMUXCR_CAN1_UART |
+ MPC85xx_PMUXCR_CAN2_TDM |
+ MPC85xx_PMUXCR_CAN2_UART);
+ config_board_mux(MUX_TYPE_CAN);
+ } else if (hwconfig_subarg_cmp("fsl_p1010mux", "tdm_can", "tdm")) {
+ clrbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_CAN2_UART |
+ MPC85xx_PMUXCR_CAN1_UART);
+ setbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_CAN2_TDM |
+ MPC85xx_PMUXCR_CAN1_TDM);
+ clrbits_be32(&gur->pmuxcr2, MPC85xx_PMUXCR2_UART_GPIO);
+ setbits_be32(&gur->pmuxcr2, MPC85xx_PMUXCR2_UART_TDM);
+ config_board_mux(MUX_TYPE_TDM);
+ } else {
+ /* defaultly spi_cs_sel to flash */
+ config_board_mux(MUX_TYPE_SPIFLASH);
+ }
+
+ if (hwconfig("esdhc"))
+ config_board_mux(MUX_TYPE_SDHC);
+ else if (hwconfig("ifc"))
+ config_board_mux(MUX_TYPE_IFC);
+
+#ifdef CONFIG_TARGET_P1010RDB_PB
+ setbits_be32(&gur->pmuxcr2, MPC85xx_PMUXCR2_GPIO01_DRVVBUS);
+#endif
+ return 0;
+}
+
+#ifndef CONFIG_SPL_BUILD
+static int pin_mux_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc < 2)
+ return CMD_RET_USAGE;
+ if (strcmp(argv[1], "ifc") == 0)
+ config_board_mux(MUX_TYPE_IFC);
+ else if (strcmp(argv[1], "sdhc") == 0)
+ config_board_mux(MUX_TYPE_SDHC);
+ else
+ return CMD_RET_USAGE;
+ return 0;
+}
+
+U_BOOT_CMD(
+ mux, 2, 0, pin_mux_cmd,
+ "configure multiplexing pin for IFC/SDHC bus in runtime",
+ "bus_type (e.g. mux sdhc)"
+);
+#endif
diff --git a/board/freescale/p1010rdb/spl.c b/board/freescale/p1010rdb/spl.c
new file mode 100644
index 00000000000..fc26cef2cc8
--- /dev/null
+++ b/board/freescale/p1010rdb/spl.c
@@ -0,0 +1,113 @@
+// SPDX-License-Identifier: GPL-2.0+
+/* Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env.h>
+#include <env_internal.h>
+#include <init.h>
+#include <ns16550.h>
+#include <malloc.h>
+#include <mmc.h>
+#include <nand.h>
+#include <i2c.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L2_SIZE;
+}
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+ struct fsl_ifc ifc = {(void *)CFG_SYS_IFC_ADDR, (void *)NULL};
+
+ console_init_f();
+
+ /* Clock configuration to access CPLD using IFC(GPCM) */
+ setbits_be32(&ifc.gregs->ifc_gcr, 1 << IFC_GCR_TBCTL_TRN_TIME_SHIFT);
+
+#ifdef CONFIG_TARGET_P1010RDB_PB
+ setbits_be32(&gur->pmuxcr2, MPC85xx_PMUXCR2_GPIO01_DRVVBUS);
+#endif
+
+ /* initialize selected port with appropriate baud rate */
+ plat_ratio = in_be32(&gur->porpllsr) & MPC85xx_PORPLLSR_PLAT_RATIO;
+ plat_ratio >>= 1;
+ gd->bus_clk = get_board_sys_clk() * plat_ratio;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ gd->bus_clk / 16 / CONFIG_BAUDRATE);
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ puts("\nSD boot...\n");
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ puts("\nSPI Flash boot...\n");
+#endif
+ /* copy code to RAM and jump to it - this should not return */
+ /* NOTE - code has to be copied out of NAND buffer before
+ * other blocks can be read.
+ */
+ relocate_code(CONFIG_VAL(RELOC_STACK), 0, CONFIG_SPL_RELOC_TEXT_BASE);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ /* Pointer is writable since we allocated a register for it */
+ gd = (gd_t *)CONFIG_VAL(GD_ADDR);
+ struct bd_info *bd;
+
+ memset(gd, 0, sizeof(gd_t));
+ bd = (struct bd_info *)(CONFIG_VAL(GD_ADDR) + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_VAL(RELOC_MALLOC_ADDR),
+ CONFIG_VAL(RELOC_MALLOC_SIZE));
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifndef CONFIG_SPL_NAND_BOOT
+ env_init();
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+#endif
+
+ /* relocate environment function pointers etc. */
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+#else
+ env_relocate();
+#endif
+
+ i2c_init_all();
+
+ dram_init();
+#ifdef CONFIG_SPL_NAND_BOOT
+ puts("\nTertiary program loader running in sram...");
+#else
+ puts("\nSecond program loader running in sram...");
+#endif
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/p1010rdb/spl_minimal.c b/board/freescale/p1010rdb/spl_minimal.c
new file mode 100644
index 00000000000..8cd79c6fb5f
--- /dev/null
+++ b/board/freescale/p1010rdb/spl_minimal.c
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ */
+#include <config.h>
+#include <clock_legacy.h>
+#include <init.h>
+#include <mpc85xx.h>
+#include <asm/io.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <asm/mmu.h>
+#include <asm/immap_85xx.h>
+#include <fsl_ddr_sdram.h>
+#include <asm/fsl_law.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+#if defined(CFG_SYS_NAND_BR_PRELIM) && defined(CFG_SYS_NAND_OR_PRELIM)
+ set_lbc_br(0, CFG_SYS_NAND_BR_PRELIM);
+ set_lbc_or(0, CFG_SYS_NAND_OR_PRELIM);
+#endif
+
+ /* initialize selected port with appropriate baud rate */
+ plat_ratio = in_be32(&gur->porpllsr) & MPC85xx_PORPLLSR_PLAT_RATIO;
+ plat_ratio >>= 1;
+ gd->bus_clk = get_board_sys_clk() * plat_ratio;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ gd->bus_clk / 16 / CONFIG_BAUDRATE);
+
+ puts("\nNAND boot... ");
+
+ /* copy code to RAM and jump to it - this should not return */
+ /* NOTE - code has to be copied out of NAND buffer before
+ * other blocks can be read.
+ */
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, 0, CONFIG_SPL_RELOC_TEXT_BASE);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ puts("\nSecond program loader running in sram...");
+ nand_boot();
+}
+
+void putc(char c)
+{
+ if (c == '\n')
+ ns16550_putc((struct ns16550 *)CFG_SYS_NS16550_COM1, '\r');
+
+ ns16550_putc((struct ns16550 *)CFG_SYS_NS16550_COM1, c);
+}
+
+void puts(const char *str)
+{
+ while (*str)
+ putc(*str++);
+}
diff --git a/board/freescale/p1010rdb/tlb.c b/board/freescale/p1010rdb/tlb.c
new file mode 100644
index 00000000000..44acebaa2bb
--- /dev/null
+++ b/board/freescale/p1010rdb/tlb.c
@@ -0,0 +1,90 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR, CFG_SYS_INIT_RAM_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#ifdef CONFIG_SPL_NAND_BOOT
+ SET_TLB_ENTRY(1, 0xffffe000, 0xffffe000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_1M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_16M, 1),
+
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE + 0x1000000,
+ CFG_SYS_FLASH_BASE_PHYS + 0x1000000,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_16M, 1),
+
+#ifdef CONFIG_PCI
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_256K, 1),
+#endif
+#endif
+
+ /* *I*G - Board CPLD */
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_256K, 1),
+
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 7, BOOKE_PAGESZ_1M, 1),
+
+#if defined(CONFIG_SYS_RAMBOOT) || !CONFIG_IS_ENABLED(COMMON_INIT_DDR)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 8, BOOKE_PAGESZ_1G, 1),
+#endif
+
+#ifdef CFG_SYS_INIT_L2_ADDR
+ /* *I*G - L2SRAM */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L2_ADDR, CFG_SYS_INIT_L2_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 11, BOOKE_PAGESZ_256K, 1)
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/p1_p2_rdb_pc/Kconfig b/board/freescale/p1_p2_rdb_pc/Kconfig
new file mode 100644
index 00000000000..cd36150f637
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/Kconfig
@@ -0,0 +1,14 @@
+if TARGET_P1020RDB_PC || \
+ TARGET_P1020RDB_PD || \
+ TARGET_P2020RDB
+
+config SYS_BOARD
+ default "p1_p2_rdb_pc"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "p1_p2_rdb_pc"
+
+endif
diff --git a/board/freescale/p1_p2_rdb_pc/MAINTAINERS b/board/freescale/p1_p2_rdb_pc/MAINTAINERS
new file mode 100644
index 00000000000..0004d717d1d
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/MAINTAINERS
@@ -0,0 +1,25 @@
+P1_P2_RDB_PC BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/p1_p2_rdb_pc/
+F: include/configs/p1_p2_rdb_pc.h
+F: configs/P1020RDB-PC_defconfig
+F: configs/P1020RDB-PC_36BIT_defconfig
+F: configs/P1020RDB-PC_36BIT_NAND_defconfig
+F: configs/P1020RDB-PC_36BIT_SDCARD_defconfig
+F: configs/P1020RDB-PC_36BIT_SPIFLASH_defconfig
+F: configs/P1020RDB-PC_NAND_defconfig
+F: configs/P1020RDB-PC_SDCARD_defconfig
+F: configs/P1020RDB-PC_SPIFLASH_defconfig
+F: configs/P1020RDB-PD_defconfig
+F: configs/P1020RDB-PD_NAND_defconfig
+F: configs/P1020RDB-PD_SDCARD_defconfig
+F: configs/P1020RDB-PD_SPIFLASH_defconfig
+F: configs/P2020RDB-PC_defconfig
+F: configs/P2020RDB-PC_36BIT_defconfig
+F: configs/P2020RDB-PC_36BIT_NAND_defconfig
+F: configs/P2020RDB-PC_36BIT_SDCARD_defconfig
+F: configs/P2020RDB-PC_36BIT_SPIFLASH_defconfig
+F: configs/P2020RDB-PC_NAND_defconfig
+F: configs/P2020RDB-PC_SDCARD_defconfig
+F: configs/P2020RDB-PC_SPIFLASH_defconfig
diff --git a/board/freescale/p1_p2_rdb_pc/Makefile b/board/freescale/p1_p2_rdb_pc/Makefile
new file mode 100644
index 00000000000..cbdb2507e83
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/Makefile
@@ -0,0 +1,26 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2010-2011 Freescale Semiconductor, Inc.
+
+MINIMAL=
+
+ifdef CONFIG_SPL_BUILD
+ifndef CONFIG_TPL_BUILD
+ifdef CONFIG_SPL_INIT_MINIMAL
+MINIMAL=y
+endif
+endif
+endif
+
+ifdef MINIMAL
+obj-y += spl_minimal.o
+else
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+endif
+obj-y += p1_p2_rdb_pc.o
+obj-y += ddr.o
+endif
+
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/p1_p2_rdb_pc/README b/board/freescale/p1_p2_rdb_pc/README
new file mode 100644
index 00000000000..fd849bfc29a
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/README
@@ -0,0 +1,64 @@
+Overview
+--------
+P1_P2_RDB_PC represents a set of boards including
+ P1020MSBG-PC
+ P1020RDB-PC
+ P1020RDB-PD
+ P1021RDB-PC
+ P1024RDB
+ P2020RDB-PC
+
+They have similar design of P1020RDB but have DDR3 instead of DDR2. P2020RDB-PC
+has 64-bit DDR. All others have 32-bit DDR.
+
+Key features on these boards include:
+ * DDR3
+ * NOR flash
+ * NAND flash (on RDB's only)
+ * SPI flash (on RDB's only)
+ * SDHC/MMC card slot
+ * VSC7385 Ethernet switch (on P1020MBG, P1020RDB, & P1021RDB)
+ * PCIE slot and mini-PCIE slots
+
+As these boards use soldered DDR chips not regular DIMMs, an on-board EEPROM
+is used to store SPD data. In case of absent or corrupted SPD, falling back
+to timing data embedded in the source code will be used. Raw timing data is
+extracted from DDR chip datasheet. Different speeds of DDR are supported with
+this approach. ODT option is forced to fit this set of boards, again because
+they don't have regular DIMMs.
+
+CONFIG_SYS_EEPROM_PAGE_WRITE_DELAY_MS is defined as 5ms to meet specification
+for writing timing.
+
+VSC firmware Address is defined by default in config file for eTSEC1.
+
+SD width is based off DIP switch. DIP switch is detected on the
+board by reading i2c bus and setting the appropriate mux values.
+
+Some boards have QE module in the silicon (P1021 and P1025). QE and eLBC have
+pins multiplexing. QE function needs to be disabled to access Nor Flash and
+CPLD. QE-UEC and QE-UART can be enabled for linux kernel by setting "qe"
+in hwconfig. In addition, QE-UEC and QE-TDM also have pins multiplexing, to
+enable QE-TDM for linux kernel, set "qe;tdm" in hwconfig. Syntax is as below
+
+'setenv hwconfig qe' to enable QE UEC/UART and disable Nor-Flash/CPLD.
+'setenv hwconfig 'qe;tdm'' to enalbe QE TDM and disable Nor-Flash/CPLD.
+
+Device tree support and how to enable it for different configs
+--------------------------------------------------------------
+Device tree support is available for p1020rdb and p2020rdb for below mentioned boot,
+1. NOR Boot
+2. NAND Boot
+3. SD Boot
+4. SPIFLASH Boot
+
+To enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. CONFIG_DEFAULT_DEVICE_TREE="p1020rdb" (Change default device tree name if required)
+2. CONFIG_OF_CONTROL
+3. CONFIG_MPC85XX_HAVE_RESET_VECTOR if reset vector is located at
+ CFG_RESET_VECTOR_ADDRESS - 0xffc
+
+If device tree support is enabled in defconfig,
+1. use 'u-boot.bin' for NOR boot.
+2. use 'u-boot-with-spl.bin' for other boot.
diff --git a/board/freescale/p1_p2_rdb_pc/ddr.c b/board/freescale/p1_p2_rdb_pc/ddr.c
new file mode 100644
index 00000000000..8622a5a610a
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/ddr.c
@@ -0,0 +1,290 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <vsprintf.h>
+#include <linux/string.h>
+#include <asm/mmu.h>
+#include <asm/immap_85xx.h>
+#include <asm/ppc.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/io.h>
+#include <asm/fsl_law.h>
+
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+#if defined(CONFIG_P1020RDB_PROTO)
+/* Micron MT41J256M8_187E */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1870,
+ .caslat_x = 0x1e << 4, /* 5,6,7,8 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 7500,
+ .trp_ps = 13125,
+ .tras_ps = 37500,
+ .trc_ps = 50625,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 37500,
+};
+#elif defined(CONFIG_TARGET_P2020RDB)
+/* Micron MT41J128M16_15E */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 64,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 14,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1500,
+ .caslat_x = 0x7e << 4, /* 5,6,7,8,9,10 */
+ .taa_ps = 13500,
+ .twr_ps = 15000,
+ .trcd_ps = 13500,
+ .trrd_ps = 6000,
+ .trp_ps = 13500,
+ .tras_ps = 36000,
+ .trc_ps = 49500,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 30000,
+};
+#elif (defined(CONFIG_TARGET_P1020MBG) || defined(CONFIG_TARGET_P1020RDB_PD))
+/* Micron MT41J512M8_187E */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 2,
+ .rank_density = 1073741824u,
+ .capacity = 2147483648u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1870,
+ .caslat_x = 0x1e << 4, /* 5,6,7,8 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 7500,
+ .trp_ps = 13125,
+ .tras_ps = 37500,
+ .trc_ps = 50625,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 37500,
+};
+#elif defined(CONFIG_TARGET_P1020RDB_PC)
+/*
+ * Samsung K4B2G0846C-HCF8
+ * The following timing are for "downshift"
+ * i.e. to use CL9 part as CL7
+ * otherwise, tAA, tRCD, tRP will be 13500ps
+ * and tRC will be 49500ps
+ */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1875,
+ .caslat_x = 0x1e << 4, /* 5,6,7,8 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 7500,
+ .trp_ps = 13125,
+ .tras_ps = 37500,
+ .trc_ps = 50625,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 37500,
+};
+#elif defined(CONFIG_TARGET_P1024RDB)
+/*
+ * Samsung K4B2G0846C-HCH9
+ * The following timing are for "downshift"
+ * i.e. to use CL9 part as CL7
+ * otherwise, tAA, tRCD, tRP will be 13500ps
+ * and tRC will be 49500ps
+ */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 1073741824u,
+ .capacity = 1073741824u,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 0,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .n_banks_per_sdram_device = 8,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+
+ .tckmin_x_ps = 1500,
+ .caslat_x = 0x3e << 4, /* 5,6,7,8,9 */
+ .taa_ps = 13125,
+ .twr_ps = 15000,
+ .trcd_ps = 13125,
+ .trrd_ps = 6000,
+ .trp_ps = 13125,
+ .tras_ps = 36000,
+ .trc_ps = 49125,
+ .trfc_ps = 160000,
+ .twtr_ps = 7500,
+ .trtp_ps = 7500,
+ .refresh_rate_ps = 7800000,
+ .tfaw_ps = 30000,
+};
+#else
+#error Missing raw timing data for this board
+#endif
+
+int fsl_ddr_get_dimm_params(dimm_params_t *pdimm,
+ unsigned int controller_number,
+ unsigned int dimm_number)
+{
+ const char dimm_model[] = "Fixed DDR on board";
+
+ if ((controller_number == 0) && (dimm_number == 0)) {
+ memcpy(pdimm, &ddr_raw_timing, sizeof(dimm_params_t));
+ memset(pdimm->mpart, 0, sizeof(pdimm->mpart));
+ memcpy(pdimm->mpart, dimm_model, sizeof(dimm_model) - 1);
+ }
+
+ return 0;
+}
+#endif /* CONFIG_SYS_DDR_RAW_TIMING */
+
+#ifdef CFG_SYS_DDR_CS0_BNDS
+/* Fixed sdram init -- doesn't use serial presence detect. */
+phys_size_t fixed_sdram(void)
+{
+ sys_info_t sysinfo;
+ char buf[32];
+ size_t ddr_size;
+ fsl_ddr_cfg_regs_t ddr_cfg_regs = {
+ .cs[0].bnds = CFG_SYS_DDR_CS0_BNDS,
+ .cs[0].config = CFG_SYS_DDR_CS0_CONFIG,
+ .cs[0].config_2 = CFG_SYS_DDR_CS0_CONFIG_2,
+#if CONFIG_CHIP_SELECTS_PER_CTRL > 1
+ .cs[1].bnds = CFG_SYS_DDR_CS1_BNDS,
+ .cs[1].config = CFG_SYS_DDR_CS1_CONFIG,
+ .cs[1].config_2 = CFG_SYS_DDR_CS1_CONFIG_2,
+#endif
+ .timing_cfg_3 = CFG_SYS_DDR_TIMING_3,
+ .timing_cfg_0 = CFG_SYS_DDR_TIMING_0,
+ .timing_cfg_1 = CFG_SYS_DDR_TIMING_1,
+ .timing_cfg_2 = CFG_SYS_DDR_TIMING_2,
+ .ddr_sdram_cfg = CFG_SYS_DDR_CONTROL,
+ .ddr_sdram_cfg_2 = CFG_SYS_DDR_CONTROL_2,
+ .ddr_sdram_mode = CFG_SYS_DDR_MODE_1,
+ .ddr_sdram_mode_2 = CFG_SYS_DDR_MODE_2,
+ .ddr_sdram_md_cntl = CFG_SYS_DDR_MODE_CONTROL,
+ .ddr_sdram_interval = CFG_SYS_DDR_INTERVAL,
+ .ddr_data_init = 0xdeadbeef, /* Poison value */
+ .ddr_sdram_clk_cntl = CFG_SYS_DDR_CLK_CTRL,
+ .ddr_init_addr = CFG_SYS_DDR_INIT_ADDR,
+ .ddr_init_ext_addr = CFG_SYS_DDR_INIT_EXT_ADDR,
+ .timing_cfg_4 = CFG_SYS_DDR_TIMING_4,
+ .timing_cfg_5 = CFG_SYS_DDR_TIMING_5,
+ .ddr_zq_cntl = CFG_SYS_DDR_ZQ_CONTROL,
+ .ddr_wrlvl_cntl = CFG_SYS_DDR_WRLVL_CONTROL,
+ .ddr_sr_cntr = CFG_SYS_DDR_SR_CNTR,
+ .ddr_sdram_rcw_1 = CFG_SYS_DDR_RCW_1,
+ .ddr_sdram_rcw_2 = CFG_SYS_DDR_RCW_2
+ };
+
+ get_sys_info(&sysinfo);
+ printf("Configuring DDR for %s MT/s data rate\n",
+ strmhz(buf, sysinfo.freq_ddrbus));
+
+ ddr_size = CFG_SYS_SDRAM_SIZE * 1024 * 1024;
+
+ fsl_ddr_set_memctl_regs(&ddr_cfg_regs, 0, 0);
+
+ if (set_ddr_laws(CFG_SYS_DDR_SDRAM_BASE,
+ ddr_size, LAW_TRGT_IF_DDR_1) < 0) {
+ printf("ERROR setting Local Access Windows for DDR\n");
+ return 0;
+ };
+
+ return ddr_size;
+}
+#endif
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ int i;
+ popts->clk_adjust = 6;
+ popts->cpo_override = 0x1f;
+ popts->write_data_delay = 2;
+ popts->half_strength_driver_enable = 1;
+ /* Write leveling override */
+ popts->wrlvl_en = 1;
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+ popts->wrlvl_start = 0x8;
+ popts->trwt_override = 1;
+ popts->trwt = 0;
+
+ if (pdimm->primary_sdram_width == 64)
+ popts->data_bus_width = 0;
+ else if (pdimm->primary_sdram_width == 32)
+ popts->data_bus_width = 1;
+ else
+ printf("Error in DDR bus width configuration!\n");
+
+ for (i = 0; i < CONFIG_CHIP_SELECTS_PER_CTRL; i++) {
+ popts->cs_local_opts[i].odt_rd_cfg = FSL_DDR_ODT_NEVER;
+ popts->cs_local_opts[i].odt_wr_cfg = FSL_DDR_ODT_CS;
+ }
+}
diff --git a/board/freescale/p1_p2_rdb_pc/law.c b/board/freescale/p1_p2_rdb_pc/law.c
new file mode 100644
index 00000000000..49594070b83
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/law.c
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_LBC),
+#ifdef CONFIG_VSC7385_ENET
+ SET_LAW(CFG_SYS_VSC7385_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_LBC),
+#endif
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_64M, LAW_TRGT_IF_LBC),
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_32K, LAW_TRGT_IF_LBC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/p1_p2_rdb_pc/p1_p2_rdb_pc.c b/board/freescale/p1_p2_rdb_pc/p1_p2_rdb_pc.c
new file mode 100644
index 00000000000..399ff720722
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/p1_p2_rdb_pc.c
@@ -0,0 +1,470 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011, 2013 Freescale Semiconductor, Inc.
+ * Copyright 2020 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <hang.h>
+#include <hwconfig.h>
+#include <image.h>
+#include <init.h>
+#include <net.h>
+#include <pci.h>
+#include <i2c.h>
+#include <asm/processor.h>
+#include <asm/mmu.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_pci.h>
+#include <fsl_ddr_sdram.h>
+#include <asm/io.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_lbc.h>
+#include <asm/mp.h>
+#include <miiphy.h>
+#include <linux/delay.h>
+#include <linux/libfdt.h>
+#include <fdt_support.h>
+#include <fsl_mdio.h>
+#include <tsec.h>
+#include <vsc7385.h>
+#include <ioports.h>
+#include <asm/fsl_serdes.h>
+#include <netdev.h>
+
+#ifdef CONFIG_QE
+
+#define GPIO_GETH_SW_PORT 1
+#define GPIO_GETH_SW_PIN 29
+#define GPIO_GETH_SW_DATA (1 << (31 - GPIO_GETH_SW_PIN))
+
+#define GPIO_SLIC_PORT 1
+#define GPIO_SLIC_PIN 30
+#define GPIO_SLIC_DATA (1 << (31 - GPIO_SLIC_PIN))
+
+const qe_iop_conf_t qe_iop_conf_tab[] = {
+ /* GPIO */
+ {1, 1, 2, 0, 0}, /* GPIO7/PB1 - LOAD_DEFAULT_N */
+ {0, 15, 1, 0, 0}, /* GPIO11/A15 - WDI */
+ {GPIO_GETH_SW_PORT, GPIO_GETH_SW_PIN, 1, 0, 0}, /* RST_GETH_SW_N */
+ {GPIO_SLIC_PORT, GPIO_SLIC_PIN, 1, 0, 0}, /* RST_SLIC_N */
+ {0, 0, 0, 0, QE_IOP_TAB_END} /* END of table */
+};
+#endif
+
+struct cpld_data {
+ u8 cpld_rev_major;
+ u8 pcba_rev;
+ u8 wd_cfg;
+ u8 rst_bps_sw;
+ u8 load_default_n;
+ u8 rst_bps_wd;
+ u8 bypass_enable;
+ u8 bps_led;
+ u8 status_led; /* offset: 0x8 */
+ u8 fxo_led; /* offset: 0x9 */
+ u8 fxs_led; /* offset: 0xa */
+ u8 rev4[2];
+ u8 system_rst; /* offset: 0xd */
+ u8 bps_out;
+ u8 rev5[3];
+ u8 cpld_rev_minor;
+};
+
+#define CPLD_WD_CFG 0x03
+#define CPLD_RST_BSW 0x00
+#define CPLD_RST_BWD 0x00
+#define CPLD_BYPASS_EN 0x03
+#define CPLD_STATUS_LED 0x01
+#define CPLD_FXO_LED 0x01
+#define CPLD_FXS_LED 0x0F
+#define CPLD_SYS_RST 0x00
+
+void board_reset_prepare(void)
+{
+ /*
+ * During reset preparation, turn off external watchdog.
+ * This ensures that external watchdog does not trigger
+ * another reset or possible infinite reset loop.
+ */
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ out_8(&cpld_data->wd_cfg, CPLD_WD_CFG);
+ in_8(&cpld_data->wd_cfg); /* Read back to sync write */
+}
+
+void board_reset_last(void)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ out_8(&cpld_data->system_rst, 1);
+}
+
+void board_cpld_init(void)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ u8 prev_wd_cfg = in_8(&cpld_data->wd_cfg);
+
+ out_8(&cpld_data->wd_cfg, CPLD_WD_CFG);
+ out_8(&cpld_data->status_led, CPLD_STATUS_LED);
+ out_8(&cpld_data->fxo_led, CPLD_FXO_LED);
+ out_8(&cpld_data->fxs_led, CPLD_FXS_LED);
+
+ /*
+ * CPLD's system reset register on P1/P2 RDB boards is not autocleared
+ * after flipping it. If this register is set to one then CPLD triggers
+ * reset of CPU in few ms.
+ *
+ * CPLD does not trigger reset of CPU for 100ms after the last reset.
+ *
+ * This means that trying to reset board via CPLD system reset register
+ * cause reboot loop. To prevent this reboot loop, the only workaround
+ * is to try to clear CPLD's system reset register as early as possible
+ * and it has to be done in 100ms since the last start of reset.
+ */
+ out_8(&cpld_data->system_rst, CPLD_SYS_RST);
+
+ /*
+ * If watchdog timer was already set to non-disabled value then it means
+ * that watchdog timer was already activated, has already expired and
+ * caused CPU reset. If this happened then due to CPLD firmware bug,
+ * writing to wd_cfg register has no effect and therefore it is not
+ * possible to reactivate watchdog timer again. Also if CPU was reset
+ * via watchdog then some peripherals like i2c do not work. Watchdog and
+ * i2c start working again after CPU reset via non-watchdog method.
+ *
+ * So in case watchdog timer register in CPLD was already enabled then
+ * disable it in CPLD and reset CPU which cause new boot. Watchdog timer
+ * is disabled few lines above, after reading CPLD previous value.
+ * This logic (disabling timer before reset) prevents reboot loop.
+ */
+ if (prev_wd_cfg != CPLD_WD_CFG) {
+ eieio();
+ do_reset(NULL, 0, 0, NULL);
+ while (1); /* do_reset() does not occur immediately */
+ }
+}
+
+void board_gpio_init(void)
+{
+#ifdef CONFIG_QE
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ par_io_t *par_io = (par_io_t *) &(gur->qe_par_io);
+
+ /* Enable VSC7385 switch */
+ setbits_be32(&par_io[GPIO_GETH_SW_PORT].cpdat, GPIO_GETH_SW_DATA);
+
+ /* Enable SLIC */
+ setbits_be32(&par_io[GPIO_SLIC_PORT].cpdat, GPIO_SLIC_DATA);
+#else
+
+ ccsr_gpio_t *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+
+ /*
+ * GPIO10 DDR Reset, open drain
+ * GPIO7 LOAD_DEFAULT_N Input
+ * GPIO11 WDI (watchdog input)
+ * GPIO12 Ethernet Switch Reset
+ * GPIO13 SLIC Reset
+ */
+
+ setbits_be32(&pgpio->gpdir, 0x02130000);
+#if !defined(CONFIG_SYS_RAMBOOT) && !defined(CONFIG_SPL)
+ /* init DDR3 reset signal */
+ setbits_be32(&pgpio->gpdir, 0x00200000);
+ setbits_be32(&pgpio->gpodr, 0x00200000);
+ clrbits_be32(&pgpio->gpdat, 0x00200000);
+ udelay(1000);
+ setbits_be32(&pgpio->gpdat, 0x00200000);
+ udelay(1000);
+ clrbits_be32(&pgpio->gpdir, 0x00200000);
+#endif
+
+#ifdef CONFIG_VSC7385_ENET
+ /* reset VSC7385 Switch */
+ setbits_be32(&pgpio->gpdir, 0x00080000);
+ setbits_be32(&pgpio->gpdat, 0x00080000);
+#endif
+
+#ifdef CFG_SLIC
+ /* reset SLIC */
+ setbits_be32(&pgpio->gpdir, 0x00040000);
+ setbits_be32(&pgpio->gpdat, 0x00040000);
+#endif
+#endif
+}
+
+int board_early_init_f(void)
+{
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+
+ setbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_SDHC_CD);
+#ifndef SDHC_WP_IS_GPIO
+ setbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_SDHC_WP);
+#endif
+ clrbits_be32(&gur->sdhcdcr, SDHCDCR_CD_INV);
+
+ clrbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_SD_DATA);
+#if defined(CONFIG_TARGET_P1020RDB_PD) || defined(CONFIG_TARGET_P1020RDB_PC)
+ setbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_TDM_ENA);
+#endif
+
+ board_gpio_init();
+ board_cpld_init();
+
+ return 0;
+}
+
+#if defined(CONFIG_TARGET_P1020RDB_PC)
+#define BOARD_NAME "P1020RDB-PC"
+#elif defined(CONFIG_TARGET_P1020RDB_PD)
+#define BOARD_NAME "P1020RDB-PD"
+#elif defined(CONFIG_TARGET_P2020RDB)
+#define BOARD_NAME "P2020RDB-PC"
+#endif
+
+int checkboard(void)
+{
+ struct cpld_data *cpld_data = (void *)(CFG_SYS_CPLD_BASE);
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u8 in, out, invert, io_config, val;
+ int bus_num = CONFIG_SYS_SPD_BUS_NUM;
+
+ /* FIXME: This should just use the model from the device tree or similar */
+#ifdef BOARD_NAME
+ printf("Board: %s ", BOARD_NAME);
+#endif
+
+ printf("CPLD: V%d.%d PCBA: V%d.0\n",
+ in_8(&cpld_data->cpld_rev_major) & 0x0F,
+ in_8(&cpld_data->cpld_rev_minor) & 0x0F,
+ in_8(&cpld_data->pcba_rev) & 0x0F);
+
+ /* Initialize i2c early for rom_loc and flash bank information */
+ #if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(bus_num, CFG_SYS_I2C_PCA9557_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return 0; /* Don't want to hang() on this error */
+ }
+
+ if (dm_i2c_read(dev, 0, &in, 1) < 0 ||
+ dm_i2c_read(dev, 1, &out, 1) < 0 ||
+ dm_i2c_read(dev, 2, &invert, 1) < 0 ||
+ dm_i2c_read(dev, 3, &io_config, 1) < 0) {
+ printf("Error reading i2c boot information!\n");
+ return 0; /* Don't want to hang() on this error */
+ }
+ #else /* Non DM I2C support - will be removed */
+ i2c_set_bus_num(bus_num);
+
+ if (i2c_read(CFG_SYS_I2C_PCA9557_ADDR, 0, 1, &in, 1) < 0 ||
+ i2c_read(CFG_SYS_I2C_PCA9557_ADDR, 1, 1, &out, 1) < 0 ||
+ i2c_read(CFG_SYS_I2C_PCA9557_ADDR, 2, 1, &invert, 1) < 0 ||
+ i2c_read(CFG_SYS_I2C_PCA9557_ADDR, 3, 1, &io_config, 1) < 0) {
+ printf("Error reading i2c boot information!\n");
+ return 0; /* Don't want to hang() on this error */
+ }
+ #endif
+
+ val = ((in ^ invert) & io_config) | (out & (~io_config));
+
+ puts("rom_loc: ");
+ if (0) {
+#ifdef __SW_BOOT_SD
+ } else if ((val & (~__SW_BOOT_MASK)) == __SW_BOOT_SD) {
+ puts("sd");
+#endif
+#ifdef __SW_BOOT_SD2
+ } else if ((val & (~__SW_BOOT_MASK)) == __SW_BOOT_SD2) {
+ puts("sd");
+#endif
+#ifdef __SW_BOOT_SPI
+ } else if ((val & (~__SW_BOOT_MASK)) == __SW_BOOT_SPI) {
+ puts("spi");
+#endif
+#ifdef __SW_BOOT_NAND
+ } else if ((val & (~__SW_BOOT_MASK)) == __SW_BOOT_NAND) {
+ puts("nand");
+#endif
+#ifdef __SW_BOOT_PCIE
+ } else if ((val & (~__SW_BOOT_MASK)) == __SW_BOOT_PCIE) {
+ puts("pcie");
+#endif
+ } else {
+ if (val & 0x2)
+ puts("nor lower bank");
+ else
+ puts("nor upper bank");
+ }
+ puts("\n");
+
+ if (val & 0x1) {
+ setbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_SD_DATA);
+ puts("SD/MMC : 8-bit Mode\n");
+ puts("eSPI : Disabled\n");
+ } else {
+ puts("SD/MMC : 4-bit Mode\n");
+ puts("eSPI : Enabled\n");
+ }
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+#ifdef CONFIG_VSC7385_ENET
+ unsigned int vscfw_addr;
+ char *tmp;
+#endif
+
+ /*
+ * Remap Boot flash region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS, /* tlb, epn, rpn */
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,/* perms, wimge */
+ 0, flash_esel, BOOKE_PAGESZ_64M, 1);/* ts, esel, tsize, iprot */
+
+#ifdef CONFIG_VSC7385_ENET
+ /* If a VSC7385 microcode image is present, then upload it. */
+ tmp = env_get("vscfw_addr");
+ if (tmp) {
+ vscfw_addr = hextoul(tmp, NULL);
+ printf("uploading VSC7385 microcode from %x\n", vscfw_addr);
+ if (vsc7385_upload_firmware((void *)vscfw_addr,
+ CFG_VSC7385_IMAGE_SIZE))
+ puts("Failure uploading VSC7385 microcode.\n");
+ } else {
+ puts("No address specified for VSC7385 microcode.\n");
+ }
+#endif
+ return 0;
+}
+
+#if defined(CONFIG_OF_BOARD_SETUP) || defined(CONFIG_OF_BOARD_FIXUP)
+static void fix_max6370_watchdog(void *blob)
+{
+ int off = fdt_node_offset_by_compatible(blob, -1, "maxim,max6370");
+ ccsr_gpio_t *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ u32 gpioval = in_be32(&pgpio->gpdat);
+
+ /*
+ * Delete watchdog max6370 node in load_default mode (detected by
+ * GPIO7 - LOAD_DEFAULT_N) because CPLD in load_default mode ignores
+ * watchdog reset signal. CPLD in load_default mode does not reset
+ * board when watchdog triggers reset signal.
+ */
+ if (!(gpioval & BIT(31-7)) && off >= 0)
+ fdt_del_node(blob, off);
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_SETUP
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+#if defined(CONFIG_TARGET_P1020RDB_PD) || defined(CONFIG_TARGET_P1020RDB_PC)
+ const char *soc_usb_compat = "fsl-usb2-dr";
+ int usb_err, usb1_off, usb2_off;
+#if defined(CONFIG_SDCARD) || defined(CONFIG_SPIFLASH)
+ int err;
+#endif
+#endif
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_QE
+ do_fixup_by_compat(blob, "fsl,qe", "status", "okay",
+ sizeof("okay"), 0);
+#endif
+
+ fix_max6370_watchdog(blob);
+
+#if defined(CONFIG_HAS_FSL_DR_USB)
+ fsl_fdt_fixup_dr_usb(blob, bd);
+#endif
+
+#if defined(CONFIG_TARGET_P1020RDB_PD) || defined(CONFIG_TARGET_P1020RDB_PC)
+#if defined(CONFIG_SDCARD) || defined(CONFIG_SPIFLASH)
+ /* Delete eLBC node as it is muxed with USB2 controller */
+ if (hwconfig("usb2")) {
+ const char *soc_elbc_compat = "fsl,p1020-elbc";
+ int off = fdt_node_offset_by_compatible(blob, -1,
+ soc_elbc_compat);
+ if (off < 0) {
+ printf("WARNING: could not find compatible node %s\n",
+ soc_elbc_compat);
+ return off;
+ }
+ err = fdt_del_node(blob, off);
+ if (err < 0) {
+ printf("WARNING: could not remove %s\n",
+ soc_elbc_compat);
+ return err;
+ }
+ return 0;
+ }
+#endif
+
+/* Delete USB2 node as it is muxed with eLBC */
+ usb1_off = fdt_node_offset_by_compatible(blob, -1,
+ soc_usb_compat);
+ if (usb1_off < 0) {
+ printf("WARNING: could not find compatible node %s\n",
+ soc_usb_compat);
+ return usb1_off;
+ }
+ usb2_off = fdt_node_offset_by_compatible(blob, usb1_off,
+ soc_usb_compat);
+ if (usb2_off < 0) {
+ printf("WARNING: could not find compatible node %s\n",
+ soc_usb_compat);
+ return usb2_off;
+ }
+ usb_err = fdt_del_node(blob, usb2_off);
+ if (usb_err < 0) {
+ printf("WARNING: could not remove %s\n", soc_usb_compat);
+ return usb_err;
+ }
+#endif
+
+ return 0;
+}
+#endif
+
+#ifdef CONFIG_OF_BOARD_FIXUP
+int board_fix_fdt(void *blob)
+{
+ fix_max6370_watchdog(blob);
+ return 0;
+}
+#endif
diff --git a/board/freescale/p1_p2_rdb_pc/spl.c b/board/freescale/p1_p2_rdb_pc/spl.c
new file mode 100644
index 00000000000..b07f481fbf9
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/spl.c
@@ -0,0 +1,132 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env.h>
+#include <env_internal.h>
+#include <init.h>
+#include <ns16550.h>
+#include <malloc.h>
+#include <mmc.h>
+#include <nand.h>
+#include <i2c.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L2_SIZE;
+}
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, bus_clk;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ /*
+ * Call board_early_init_f() as early as possible as it workarounds
+ * reboot loop due to broken CPLD state machine for reset line.
+ */
+ board_early_init_f();
+
+ console_init_f();
+
+ /* Set pmuxcr to allow both i2c1 and i2c2 */
+ setbits_be32(&gur->pmuxcr, in_be32(&gur->pmuxcr) | 0x1000);
+ setbits_be32(&gur->pmuxcr,
+ in_be32(&gur->pmuxcr) | MPC85xx_PMUXCR_SD_DATA);
+
+ /* Read back the register to synchronize the write. */
+ in_be32(&gur->pmuxcr);
+
+#ifdef CONFIG_SPL_SPI_BOOT
+ clrbits_be32(&gur->pmuxcr, MPC85xx_PMUXCR_SD_DATA);
+#endif
+
+ /* initialize selected port with appropriate baud rate */
+ plat_ratio = in_be32(&gur->porpllsr) & MPC85xx_PORPLLSR_PLAT_RATIO;
+ plat_ratio >>= 1;
+ bus_clk = get_board_sys_clk() * plat_ratio;
+ gd->bus_clk = bus_clk;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ bus_clk / 16 / CONFIG_BAUDRATE);
+#ifdef CONFIG_SPL_MMC_BOOT
+ puts("\nSD boot...\n");
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ puts("\nSPI Flash boot...\n");
+#endif
+
+ /* copy code to RAM and jump to it - this should not return */
+ /* NOTE - code has to be copied out of NAND buffer before
+ * other blocks can be read.
+ */
+ relocate_code(CONFIG_VAL(RELOC_STACK), 0, CONFIG_SPL_RELOC_TEXT_BASE);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ /* Pointer is writable since we allocated a register for it */
+ gd = (gd_t *)CONFIG_VAL(GD_ADDR);
+ struct bd_info *bd;
+
+ memset(gd, 0, sizeof(gd_t));
+ bd = (struct bd_info *)(CONFIG_VAL(GD_ADDR) + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_VAL(RELOC_MALLOC_ADDR),
+ CONFIG_VAL(RELOC_MALLOC_SIZE));
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifdef CONFIG_SPL_ENV_SUPPORT
+#ifndef CONFIG_SPL_NAND_BOOT
+ env_init();
+#endif
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+#endif
+#ifdef CONFIG_SPL_ENV_SUPPORT
+ /* relocate environment function pointers etc. */
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+#else
+ env_relocate();
+#endif
+#endif
+
+#if CONFIG_IS_ENABLED(SYS_I2C_LEGACY)
+ i2c_init_all();
+#else
+ i2c_init(CONFIG_SYS_I2C_SPEED, CONFIG_SYS_I2C_SLAVE);
+#endif
+
+ dram_init();
+#ifdef CONFIG_SPL_NAND_BOOT
+ puts("Tertiary program loader running in sram...");
+#else
+ puts("Second program loader running in sram...\n");
+#endif
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/p1_p2_rdb_pc/spl_minimal.c b/board/freescale/p1_p2_rdb_pc/spl_minimal.c
new file mode 100644
index 00000000000..511bcf5506b
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/spl_minimal.c
@@ -0,0 +1,64 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <init.h>
+#include <ns16550.h>
+#include <asm/io.h>
+#include <nand.h>
+#include <linux/compiler.h>
+#include <asm/fsl_law.h>
+#include <fsl_ddr_sdram.h>
+#include <asm/global_data.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+#if defined(CFG_SYS_NAND_BR_PRELIM) && defined(CFG_SYS_NAND_OR_PRELIM)
+ set_lbc_br(0, CFG_SYS_NAND_BR_PRELIM);
+ set_lbc_or(0, CFG_SYS_NAND_OR_PRELIM);
+#endif
+
+ /* initialize selected port with appropriate baud rate */
+ plat_ratio = in_be32(&gur->porpllsr) & MPC85xx_PORPLLSR_PLAT_RATIO;
+ plat_ratio >>= 1;
+ gd->bus_clk = get_board_sys_clk() * plat_ratio;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ gd->bus_clk / 16 / CONFIG_BAUDRATE);
+
+ puts("\nNAND boot... ");
+
+ /* copy code to RAM and jump to it - this should not return */
+ /* NOTE - code has to be copied out of NAND buffer before
+ * other blocks can be read.
+ */
+ relocate_code(CONFIG_SPL_RELOC_STACK, 0, CONFIG_SPL_RELOC_TEXT_BASE);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ puts("\nSecond program loader running in sram...");
+ nand_boot();
+}
+
+void putc(char c)
+{
+ if (c == '\n')
+ ns16550_putc((struct ns16550 *)CFG_SYS_NS16550_COM1, '\r');
+
+ ns16550_putc((struct ns16550 *)CFG_SYS_NS16550_COM1, c);
+}
+
+void puts(const char *str)
+{
+ while (*str)
+ putc(*str++);
+}
diff --git a/board/freescale/p1_p2_rdb_pc/tlb.c b/board/freescale/p1_p2_rdb_pc/tlb.c
new file mode 100644
index 00000000000..ae0b7adbe54
--- /dev/null
+++ b/board/freescale/p1_p2_rdb_pc/tlb.c
@@ -0,0 +1,107 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2010-2011 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024 ,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_1M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* W**G* - Flash/promjet, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_64M, 1),
+
+#ifdef CONFIG_PCI
+ /* *I*G* - PCI memory 1.5G */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI I/O effective: 192K */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256K, 1),
+#endif
+
+#ifdef CONFIG_VSC7385_ENET
+ /* *I*G - VSC7385 Switch */
+ SET_TLB_ENTRY(1, CFG_SYS_VSC7385_BASE, CFG_SYS_VSC7385_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_1M, 1),
+#endif
+#endif /* not SPL */
+
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_1M, 1),
+
+#ifdef CFG_SYS_NAND_BASE
+ /* *I*G - NAND */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 7, BOOKE_PAGESZ_1M, 1),
+#endif
+
+#if defined(CONFIG_SYS_RAMBOOT) || !CONFIG_IS_ENABLED(COMMON_INIT_DDR)
+ /* **M** - 1G DDR for eSDHC/eSPI/NAND boot */
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 8, BOOKE_PAGESZ_1G, 1),
+
+#if defined(CONFIG_TARGET_P1020RDB_PD)
+ /* **M** - 2G DDR on P1020MBG, map the second 1G */
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 9, BOOKE_PAGESZ_1G, 1),
+#endif
+#endif /* RAMBOOT/SPL */
+
+#ifdef CFG_SYS_INIT_L2_ADDR
+ /* ***G - L2SRAM */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L2_ADDR, CFG_SYS_INIT_L2_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 11, BOOKE_PAGESZ_256K, 1),
+#if CONFIG_SYS_L2_SIZE >= (256 << 10)
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L2_ADDR + 0x40000,
+ CFG_SYS_INIT_L2_ADDR_PHYS + 0x40000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 12, BOOKE_PAGESZ_256K, 1)
+#endif
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/p2041rdb/Kconfig b/board/freescale/p2041rdb/Kconfig
new file mode 100644
index 00000000000..78e11214a5b
--- /dev/null
+++ b/board/freescale/p2041rdb/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_P2041RDB
+
+config SYS_BOARD
+ default "p2041rdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "P2041RDB"
+
+endif
diff --git a/board/freescale/p2041rdb/MAINTAINERS b/board/freescale/p2041rdb/MAINTAINERS
new file mode 100644
index 00000000000..2121243e148
--- /dev/null
+++ b/board/freescale/p2041rdb/MAINTAINERS
@@ -0,0 +1,11 @@
+P2041RDB BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/p2041rdb/
+F: include/configs/P2041RDB.h
+F: configs/P2041RDB_defconfig
+F: configs/P2041RDB_NAND_defconfig
+F: configs/P2041RDB_SDCARD_defconfig
+F: configs/P2041RDB_SECURE_BOOT_defconfig
+F: configs/P2041RDB_SPIFLASH_defconfig
+F: configs/P2041RDB_SRIO_PCIE_BOOT_defconfig
diff --git a/board/freescale/p2041rdb/Makefile b/board/freescale/p2041rdb/Makefile
new file mode 100644
index 00000000000..ebd0982b5db
--- /dev/null
+++ b/board/freescale/p2041rdb/Makefile
@@ -0,0 +1,10 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2011 Freescale Semiconductor, Inc.
+# (C) Copyright 2001-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+
+obj-y += p2041rdb.o
+obj-y += cpld.o
+obj-y += ddr.o
+obj-y += eth.o
diff --git a/board/freescale/p2041rdb/README b/board/freescale/p2041rdb/README
new file mode 100644
index 00000000000..ae770277372
--- /dev/null
+++ b/board/freescale/p2041rdb/README
@@ -0,0 +1,138 @@
+Overview
+=========
+The P2041 Processor combines four Power Architecture processor cores
+with high-performance datapath acceleration architecture(DPAA), CoreNet
+fabric infrastructure, as well as network and peripheral bus interfaces
+required for networking, telecom/datacom, wireless infrastructure, and
+military/aerospace applications.
+
+P2041RDB board is a quad core platform supporting the P2041 processor
+of QorIQ DPAA series.
+
+Boot from NOR flash
+===================
+1. Build image
+ make P2041RDB_config
+ make all
+
+2. Program image
+ => tftp 1000000 u-boot.bin
+ => protect off all
+ => erase eff40000 efffffff
+ => cp.b 1000000 eff40000 c0000
+
+3. Program RCW
+ => tftp 1000000 rcw.bin
+ => protect off all
+ => erase e8000000 e801ffff
+ => cp.b 1000000 e8000000 50
+
+4. Program FMAN Firmware ucode
+ => tftp 1000000 ucode.bin
+ => protect off all
+ => erase eff00000 eff3ffff
+ => cp.b 1000000 eff00000 2000
+
+5. Change DIP-switch
+ SW1[1-5] = 10110
+ Note: 1 stands for 'on', 0 stands for 'off'
+
+Boot from SDCard
+===================
+1. Build image
+ make P2041RDB_SDCARD_config
+ make all
+
+2. Generate PBL imge
+ Use PE tool to produce a image used to be programed to
+ SDCard which contains RCW and U-Boot image.
+
+3. Program the PBL image to SDCard
+ => tftp 1000000 pbl_sd.bin
+ => mmcinfo
+ => mmc write 1000000 8 672
+
+4. Program FMAN Firmware ucode
+ => tftp 1000000 ucode.bin
+ => mmc write 1000000 690 10
+
+5. Change DIP-switch
+ SW1[1-5] = 01100
+ Note: 1 stands for 'on', 0 stands for 'off'
+
+Boot from SPI flash
+===================
+1. Build image
+ make P2041RDB_SPIFLASH_config
+ make all
+
+2. Generate PBL imge
+ Use PE tool to produce a image used to be programed to
+ SPI flash which contains RCW and U-Boot image.
+
+3. Program the PBL image to SPI flash
+ => tftp 1000000 pbl_spi.bin
+ => spi probe 0
+ => sf erase 0 100000
+ => sf write 1000000 0 $filesize
+
+4. Program FMAN Firmware ucode
+ => tftp 1000000 ucode.bin
+ => sf erase 110000 10000
+ => sf write 1000000 110000 $filesize
+
+5. Change DIP-switch
+ SW1[1-5] = 10100
+ Note: 1 stands for 'on', 0 stands for 'off'
+
+Device tree support and how to enable it for different configs
+--------------------------------------------------------------
+Device tree support is available for p2041rdb for below mentioned boot,
+1. NOR Boot
+2. NAND Boot
+3. SD Boot
+4. SPIFLASH Boot
+
+To enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. CONFIG_DEFAULT_DEVICE_TREE="p2041rdb" (Change default device tree name if required)
+2. CONFIG_OF_CONTROL
+3. CONFIG_MPC85XX_HAVE_RESET_VECTOR if reset vector is located at
+ CFG_RESET_VECTOR_ADDRESS - 0xffc
+
+CPLD command
+============
+The CPLD is used to control the power sequence and some serdes lane
+mux function.
+
+cpld reset - hard reset to default bank
+cpld reset altbank - reset to alternate bank
+cpld lane_mux <lane> <mux_value> - set multiplexed lane pin
+ lane 6: 0 -> slot1 (Default)
+ 1 -> SGMII
+ lane a: 0 -> slot2 (Default)
+ 1 -> AURORA
+ lane c: 0 -> slot2 (Default)
+ 1 -> SATA0
+ lane d: 0 -> slot2 (Default)
+ 1 -> SATA1
+
+Using the Device Tree Source File
+=================================
+To create the DTB (Device Tree Binary) image file, use a command
+similar to this:
+ dtc -O dtb -b 0 -p 1024 p2041rdb.dts > p2041rdb.dtb
+
+Or use the following command:
+ {linux-2.6}/make p2041rdb.dtb ARCH=powerpc
+
+then the dtb file will be generated under the following directory:
+ {linux-2.6}/arch/powerpc/boot/p2041rdb.dtb
+
+Booting Linux
+=============
+Place a linux uImage in the TFTP disk area.
+ tftp 1000000 uImage
+ tftp 2000000 rootfs.ext2.gz.uboot
+ tftp 3000000 p2041rdb.dtb
+ bootm 1000000 2000000 3000000
diff --git a/board/freescale/p2041rdb/cpld.c b/board/freescale/p2041rdb/cpld.c
new file mode 100644
index 00000000000..915a8b994d5
--- /dev/null
+++ b/board/freescale/p2041rdb/cpld.c
@@ -0,0 +1,156 @@
+// SPDX-License-Identifier: GPL-2.0+
+/**
+ * Copyright 2011 Freescale Semiconductor
+ * Author: Mingkai Hu <Mingkai.hu@freescale.com>
+ *
+ * This file provides support for the board-specific CPLD used on some Freescale
+ * reference boards.
+ *
+ * The following macros need to be defined:
+ *
+ * CPLD_BASE - The virtual address of the base of the CPLD register map
+ */
+
+#include <command.h>
+#include <asm/io.h>
+
+#include "cpld.h"
+
+static u8 __cpld_read(unsigned int reg)
+{
+ void *p = (void *)CPLD_BASE;
+
+ return in_8(p + reg);
+}
+u8 cpld_read(unsigned int reg) __attribute__((weak, alias("__cpld_read")));
+
+static void __cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+void cpld_write(unsigned int reg, u8 value)
+ __attribute__((weak, alias("__cpld_write")));
+
+/*
+ * Reset the board. This honors the por_cfg registers.
+ */
+void __cpld_reset(void)
+{
+ CPLD_WRITE(system_rst, 1);
+}
+void cpld_reset(void) __attribute__((weak, alias("__cpld_reset")));
+
+/**
+ * Set the boot bank to the alternate bank
+ */
+void __cpld_set_altbank(void)
+{
+ u8 reg5 = CPLD_READ(sw_ctl_on);
+
+ CPLD_WRITE(sw_ctl_on, reg5 | CPLD_SWITCH_BANK_ENABLE);
+ CPLD_WRITE(fbank_sel, 1);
+ CPLD_WRITE(system_rst, 1);
+}
+void cpld_set_altbank(void)
+ __attribute__((weak, alias("__cpld_set_altbank")));
+
+/**
+ * Set the boot bank to the default bank
+ */
+void __cpld_set_defbank(void)
+{
+ CPLD_WRITE(system_rst_default, 1);
+}
+void cpld_set_defbank(void)
+ __attribute__((weak, alias("__cpld_set_defbank")));
+
+#ifdef DEBUG
+static void cpld_dump_regs(void)
+{
+ printf("cpld_ver = 0x%02x\n", CPLD_READ(cpld_ver));
+ printf("cpld_ver_sub = 0x%02x\n", CPLD_READ(cpld_ver_sub));
+ printf("pcba_ver = 0x%02x\n", CPLD_READ(pcba_ver));
+ printf("system_rst = 0x%02x\n", CPLD_READ(system_rst));
+ printf("sw_ctl_on = 0x%02x\n", CPLD_READ(sw_ctl_on));
+ printf("por_cfg = 0x%02x\n", CPLD_READ(por_cfg));
+ printf("switch_strobe = 0x%02x\n", CPLD_READ(switch_strobe));
+ printf("jtag_sel = 0x%02x\n", CPLD_READ(jtag_sel));
+ printf("sdbank1_clk = 0x%02x\n", CPLD_READ(sdbank1_clk));
+ printf("sdbank2_clk = 0x%02x\n", CPLD_READ(sdbank2_clk));
+ printf("fbank_sel = 0x%02x\n", CPLD_READ(fbank_sel));
+ printf("serdes_mux = 0x%02x\n", CPLD_READ(serdes_mux));
+ printf("SW[2] = 0x%02x\n", in_8(&CPLD_SW(2)));
+ putc('\n');
+}
+#endif
+
+int cpld_cmd(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else
+ cpld_set_defbank();
+ } else if (strcmp(argv[1], "lane_mux") == 0) {
+ u32 lane = hextoul(argv[2], NULL);
+ u8 val = (u8)hextoul(argv[3], NULL);
+ u8 reg = CPLD_READ(serdes_mux);
+
+ switch (lane) {
+ case 0x6:
+ reg &= ~SERDES_MUX_LANE_6_MASK;
+ reg |= val << SERDES_MUX_LANE_6_SHIFT;
+ break;
+ case 0xa:
+ reg &= ~SERDES_MUX_LANE_A_MASK;
+ reg |= val << SERDES_MUX_LANE_A_SHIFT;
+ break;
+ case 0xc:
+ reg &= ~SERDES_MUX_LANE_C_MASK;
+ reg |= val << SERDES_MUX_LANE_C_SHIFT;
+ break;
+ case 0xd:
+ reg &= ~SERDES_MUX_LANE_D_MASK;
+ reg |= val << SERDES_MUX_LANE_D_SHIFT;
+ break;
+ default:
+ printf("Invalid value\n");
+ break;
+ }
+
+ CPLD_WRITE(serdes_mux, reg);
+#ifdef DEBUG
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+#endif
+ } else
+ rc = cmd_usage(cmdtp);
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld_cmd, CONFIG_SYS_MAXARGS, 1, cpld_cmd,
+ "Reset the board or pin mulexing selection using the CPLD sequencer",
+ "reset - hard reset to default bank\n"
+ "cpld_cmd reset altbank - reset to alternate bank\n"
+ "cpld_cmd lane_mux <lane> <mux_value> - set multiplexed lane pin\n"
+ " lane 6: 0 -> slot1\n"
+ " 1 -> SGMII (Default)\n"
+ " lane a: 0 -> slot2\n"
+ " 1 -> AURORA (Default)\n"
+ " lane c: 0 -> slot2\n"
+ " 1 -> SATA0 (Default)\n"
+ " lane d: 0 -> slot2\n"
+ " 1 -> SATA1 (Default)\n"
+#ifdef DEBUG
+ "cpld_cmd dump - display the CPLD registers\n"
+#endif
+ );
diff --git a/board/freescale/p2041rdb/cpld.h b/board/freescale/p2041rdb/cpld.h
new file mode 100644
index 00000000000..8c90c1ccf32
--- /dev/null
+++ b/board/freescale/p2041rdb/cpld.h
@@ -0,0 +1,54 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/**
+ * Copyright 2011 Freescale Semiconductor
+ * Author: Mingkai Hu <Mingkai.hu@freescale.com>
+ *
+ * This file provides support for the ngPIXIS, a board-specific FPGA used on
+ * some Freescale reference boards.
+ */
+
+/*
+ * CPLD register set. Feel free to add board-specific #ifdefs where necessary.
+ */
+typedef struct cpld_data {
+ u8 cpld_ver; /* 0x0 - CPLD Major Revision Register */
+ u8 cpld_ver_sub; /* 0x1 - CPLD Minor Revision Register */
+ u8 pcba_ver; /* 0x2 - PCBA Revision Register */
+ u8 system_rst; /* 0x3 - system reset register */
+ u8 res0; /* 0x4 - not used */
+ u8 sw_ctl_on; /* 0x5 - Switch Control Enable Register */
+ u8 por_cfg; /* 0x6 - POR Control Register */
+ u8 switch_strobe; /* 0x7 - Multiplexed pin Select Register */
+ u8 jtag_sel; /* 0x8 - JTAG or AURORA Selection */
+ u8 sdbank1_clk; /* 0x9 - SerDes Bank1 Reference clock */
+ u8 sdbank2_clk; /* 0xa - SerDes Bank2 Reference clock */
+ u8 fbank_sel; /* 0xb - Flash bank selection */
+ u8 serdes_mux; /* 0xc - Multiplexed pin Select Register */
+ u8 sw[1]; /* 0xd - SW2 Status */
+ u8 system_rst_default; /* 0xe - system reset to default register */
+ u8 sysclk_sw1; /* 0xf - sysclk configuration register */
+} __attribute__ ((packed)) cpld_data_t;
+
+#define SERDES_MUX_LANE_6_MASK 0x2
+#define SERDES_MUX_LANE_6_SHIFT 1
+#define SERDES_MUX_LANE_A_MASK 0x1
+#define SERDES_MUX_LANE_A_SHIFT 0
+#define SERDES_MUX_LANE_C_MASK 0x4
+#define SERDES_MUX_LANE_C_SHIFT 2
+#define SERDES_MUX_LANE_D_MASK 0x8
+#define SERDES_MUX_LANE_D_SHIFT 3
+#define CPLD_SWITCH_BANK_ENABLE 0x40
+#define CPLD_SYSCLK_83 0x1 /* system clock 83.3MHz */
+#define CPLD_SYSCLK_100 0x2 /* system clock 100MHz */
+
+/* Pointer to the CPLD register set */
+#define cpld ((cpld_data_t *)CPLD_BASE)
+
+/* The CPLD SW register that corresponds to board switch X, where x >= 1 */
+#define CPLD_SW(x) (cpld->sw[(x) - 2])
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(cpld_data_t, reg))
+#define CPLD_WRITE(reg, value) cpld_write(offsetof(cpld_data_t, reg), value)
diff --git a/board/freescale/p2041rdb/ddr.c b/board/freescale/p2041rdb/ddr.c
new file mode 100644
index 00000000000..b8b765a85ef
--- /dev/null
+++ b/board/freescale/p2041rdb/ddr.c
@@ -0,0 +1,143 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ */
+
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 cpo;
+ u32 write_data_delay;
+ u32 force_2t;
+};
+
+/*
+ * This table contains all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ *
+ * ranges for parameters:
+ * wr_data_delay = 0-6
+ * clk adjust = 0-8
+ * cpo 2-0x1E (30)
+ */
+static const struct board_specific_parameters dimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| clk| wrlvl | cpo |wrdata|2T
+ * ranks| mhz|adjst| start | delay|
+ */
+ {2, 750, 3, 5, 0xff, 2, 0},
+ {2, 1250, 4, 6, 0xff, 2, 0},
+ {2, 1350, 5, 7, 0xff, 2, 0},
+ {2, 1666, 5, 8, 0xff, 2, 0},
+ {}
+};
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num) {
+ printf("Wrong parameter for controller number %d", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = dimm0;
+
+ /*
+ * Get clk_adjust, cpo, write_data_delay,2T, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->cpo_override = pbsp->cpo;
+ popts->write_data_delay =
+ pbsp->write_data_delay;
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->twot_en = pbsp->force_2t;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found "
+ "for data rate %lu MT/s!\n"
+ "Trying to use the highest speed (%u) parameters\n",
+ ddr_freq, pbsp_highest->datarate_mhz_high);
+ popts->cpo_override = pbsp_highest->cpo;
+ popts->write_data_delay = pbsp_highest->write_data_delay;
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->twot_en = pbsp_highest->force_2t;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+
+found:
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /* Write leveling override */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /* Rtt and Rtt_WR override */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 60 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN;
+}
+
+int dram_init(void)
+{
+ phys_size_t dram_size = 0;
+
+ puts("Initializing....");
+
+ if (fsl_use_spd()) {
+ puts("using SPD\n");
+ dram_size = fsl_ddr_sdram();
+ } else {
+ puts("no SPD and fixed parameters\n");
+ return -ENXIO;
+ }
+
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+ debug(" DDR: ");
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/p2041rdb/eth.c b/board/freescale/p2041rdb/eth.c
new file mode 100644
index 00000000000..65850866777
--- /dev/null
+++ b/board/freescale/p2041rdb/eth.c
@@ -0,0 +1,210 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011 Freescale Semiconductor, Inc.
+ * Author: Mingkai Hu <Mingkai.hu@freescale.com>
+ */
+
+/*
+ * The RGMII PHYs are provided by the two on-board PHY. The SGMII PHYs
+ * are provided by the three on-board PHY or by the standard Freescale
+ * four-port SGMII riser card. We need to change the phy-handle in the
+ * kernel dts file to point to the correct PHY according to serdes mux
+ * and serdes protocol selection.
+ */
+
+#include <config.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/fsl_serdes.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <fsl_dtsec.h>
+
+#include "cpld.h"
+#include "../common/fman.h"
+
+#ifdef CONFIG_FMAN_ENET
+/*
+ * Mapping of all 18 SERDES lanes to board slots. A value of '0' here means
+ * that the mapping must be determined dynamically, or that the lane maps to
+ * something other than a board slot
+ */
+static u8 lane_to_slot[] = {
+ 0, 0, 0, 0, 0, 0, 1, 1, 0, 0, 2, 2, 2, 2, 0, 0, 0, 0
+};
+
+static int riser_phy_addr[] = {
+ CFG_SYS_FM1_DTSEC1_RISER_PHY_ADDR,
+ CFG_SYS_FM1_DTSEC2_RISER_PHY_ADDR,
+ CFG_SYS_FM1_DTSEC3_RISER_PHY_ADDR,
+ CFG_SYS_FM1_DTSEC4_RISER_PHY_ADDR,
+};
+
+/*
+ * Initialize the lane_to_slot[] array.
+ *
+ * On the P2040RDB board the mapping is controlled by CPLD register.
+ */
+static void initialize_lane_to_slot(void)
+{
+ u8 mux = CPLD_READ(serdes_mux);
+
+ lane_to_slot[6] = (mux & SERDES_MUX_LANE_6_MASK) ? 0 : 1;
+ lane_to_slot[10] = (mux & SERDES_MUX_LANE_A_MASK) ? 0 : 2;
+ lane_to_slot[12] = (mux & SERDES_MUX_LANE_C_MASK) ? 0 : 2;
+ lane_to_slot[13] = (mux & SERDES_MUX_LANE_D_MASK) ? 0 : 2;
+}
+
+/*
+ * Given the following ...
+ *
+ * 1) A pointer to an Fman Ethernet node (as identified by the 'compat'
+ * compatible string and 'addr' physical address)
+ *
+ * 2) An Fman port
+ *
+ * ... update the phy-handle property of the Ethernet node to point to the
+ * right PHY. This assumes that we already know the PHY for each port.
+ *
+ * The offset of the Fman Ethernet node is also passed in for convenience, but
+ * it is not used, and we recalculate the offset anyway.
+ *
+ * Note that what we call "Fman ports" (enum fm_port) is really an Fman MAC.
+ * Inside the Fman, "ports" are things that connect to MACs. We only call them
+ * ports in U-Boot because on previous Ethernet devices (e.g. Gianfar), MACs
+ * and ports are the same thing.
+ *
+ */
+void board_ft_fman_fixup_port(void *fdt, char *compat, phys_addr_t addr,
+ enum fm_port port, int offset)
+{
+ phy_interface_t intf = fm_info_get_enet_if(port);
+ char phy[16];
+ int lane;
+ u8 slot;
+
+ switch (intf) {
+ /* The RGMII PHY is identified by the MAC connected to it */
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ sprintf(phy, "phy_rgmii_%u", port == FM1_DTSEC5 ? 0 : 1);
+ fdt_set_phy_handle(fdt, compat, addr, phy);
+ break;
+ /* The SGMII PHY is identified by the MAC connected to it */
+ case PHY_INTERFACE_MODE_SGMII:
+ lane = serdes_get_first_lane(SGMII_FM1_DTSEC1 + port);
+ if (lane < 0)
+ return;
+ slot = lane_to_slot[lane];
+ if (slot) {
+ sprintf(phy, "phy_sgmii_%x",
+ CFG_SYS_FM1_DTSEC1_RISER_PHY_ADDR
+ + (port - FM1_DTSEC1));
+ fdt_set_phy_handle(fdt, compat, addr, phy);
+ } else {
+ sprintf(phy, "phy_sgmii_%x",
+ CFG_SYS_FM1_DTSEC1_PHY_ADDR
+ + (port - FM1_DTSEC1));
+ fdt_set_phy_handle(fdt, compat, addr, phy);
+ }
+ break;
+ case PHY_INTERFACE_MODE_XGMII:
+ /* XAUI */
+ lane = serdes_get_first_lane(XAUI_FM1);
+ if (lane >= 0) {
+ /* The XAUI PHY is identified by the slot */
+ sprintf(phy, "phy_xgmii_%u", lane_to_slot[lane]);
+ fdt_set_phy_handle(fdt, compat, addr, phy);
+ }
+ break;
+ default:
+ break;
+ }
+}
+#endif /* #ifdef CONFIG_FMAN_ENET */
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_FMAN_ENET
+ struct fsl_pq_mdio_info dtsec_mdio_info;
+ struct tgec_mdio_info tgec_mdio_info;
+ unsigned int i, slot;
+ int lane;
+
+ printf("Initializing Fman\n");
+
+ initialize_lane_to_slot();
+
+ dtsec_mdio_info.regs =
+ (struct tsec_mii_mng *)CFG_SYS_FM1_DTSEC1_MDIO_ADDR;
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the real 1G MDIO bus */
+ fsl_pq_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct tgec_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the real 10G MDIO bus */
+ fm_tgec_mdio_init(bis, &tgec_mdio_info);
+
+ /*
+ * Program the three on-board SGMII PHY addresses. If the SGMII Riser
+ * card used, we'll override the PHY address later. For any DTSEC that
+ * is RGMII, we'll also override its PHY address later. We assume that
+ * DTSEC4 and DTSEC5 are used for RGMII.
+ */
+ fm_info_set_phy_address(FM1_DTSEC1, CFG_SYS_FM1_DTSEC1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, CFG_SYS_FM1_DTSEC2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC3, CFG_SYS_FM1_DTSEC3_PHY_ADDR);
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ int idx = i - FM1_DTSEC1;
+
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_SGMII:
+ lane = serdes_get_first_lane(SGMII_FM1_DTSEC1 + idx);
+ if (lane < 0)
+ break;
+ slot = lane_to_slot[lane];
+ if (slot)
+ fm_info_set_phy_address(i, riser_phy_addr[i]);
+ break;
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ /* Only DTSEC4 and DTSEC5 can be routed to RGMII */
+ fm_info_set_phy_address(i, i == FM1_DTSEC5 ?
+ CFG_SYS_FM1_DTSEC5_PHY_ADDR :
+ CFG_SYS_FM1_DTSEC4_PHY_ADDR);
+ break;
+ default:
+ printf("Fman1: DTSEC%u set to unknown interface %i\n",
+ idx + 1, fm_info_get_enet_if(i));
+ break;
+ }
+
+ fm_info_set_mdio(i,
+ miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME));
+ }
+
+ lane = serdes_get_first_lane(XAUI_FM1);
+ if (lane >= 0) {
+ slot = lane_to_slot[lane];
+ if (slot)
+ fm_info_set_phy_address(FM1_10GEC1,
+ CFG_SYS_FM1_10GEC1_PHY_ADDR);
+ }
+
+ fm_info_set_mdio(FM1_10GEC1,
+ miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME));
+ cpu_eth_init(bis);
+#endif
+
+ return pci_eth_init(bis);
+}
diff --git a/board/freescale/p2041rdb/p2041rdb.c b/board/freescale/p2041rdb/p2041rdb.c
new file mode 100644
index 00000000000..d5b71f78430
--- /dev/null
+++ b/board/freescale/p2041rdb/p2041rdb.c
@@ -0,0 +1,248 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2011,2012 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <image.h>
+#include <init.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <fm_eth.h>
+
+extern void pci_of_setup(void *blob, struct bd_info *bd);
+
+#include "cpld.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ u8 sw;
+ struct cpu_type *cpu = gd->arch.cpu;
+ unsigned int i;
+
+ printf("Board: %sRDB, ", cpu->name);
+ printf("CPLD version: %d.%d ", CPLD_READ(cpld_ver),
+ CPLD_READ(cpld_ver_sub));
+
+ sw = CPLD_READ(fbank_sel);
+ printf("vBank: %d\n", sw & 0x1);
+
+ /*
+ * Display the actual SERDES reference clocks as configured by the
+ * dip switches on the board. Note that the SWx registers could
+ * technically be set to force the reference clocks to match the
+ * values that the SERDES expects (or vice versa). For now, however,
+ * we just display both values and hope the user notices when they
+ * don't match.
+ */
+ puts("SERDES Reference Clocks: ");
+ sw = in_8(&CPLD_SW(2)) >> 2;
+ for (i = 0; i < 2; i++) {
+ static const char * const freq[][3] = {{"0", "100", "125"},
+ {"100", "156.25", "125"}
+ };
+ unsigned int clock = (sw >> (2 * i)) & 3;
+
+ printf("Bank%u=%sMhz ", i+1, freq[i][clock]);
+ }
+ puts("\n");
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+
+ /* board only uses the DDR_MCK0/1, so disable the DDR_MCK2/3 */
+ setbits_be32(&gur->ddrclkdr, 0x000f000f);
+
+ return 0;
+}
+
+#define CPLD_LANE_A_SEL 0x1
+#define CPLD_LANE_G_SEL 0x2
+#define CPLD_LANE_C_SEL 0x4
+#define CPLD_LANE_D_SEL 0x8
+
+void board_config_lanes_mux(void)
+{
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+ int srds_prtcl = (in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET_RCWSR4_SRDS_PRTCL) >> 26;
+
+ u8 mux = 0;
+ switch (srds_prtcl) {
+ case 0x2:
+ case 0x5:
+ case 0x9:
+ case 0xa:
+ case 0xf:
+ break;
+ case 0x8:
+ mux |= CPLD_LANE_C_SEL | CPLD_LANE_D_SEL;
+ break;
+ case 0x14:
+ mux |= CPLD_LANE_A_SEL;
+ break;
+ case 0x17:
+ mux |= CPLD_LANE_G_SEL;
+ break;
+ case 0x16:
+ case 0x19:
+ case 0x1a:
+ mux |= CPLD_LANE_G_SEL | CPLD_LANE_C_SEL | CPLD_LANE_D_SEL;
+ break;
+ case 0x1c:
+ mux |= CPLD_LANE_G_SEL | CPLD_LANE_A_SEL;
+ break;
+ default:
+ printf("Fman:Unsupported SerDes Protocol 0x%02x\n", srds_prtcl);
+ break;
+ }
+ CPLD_WRITE(serdes_mux, mux);
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+
+ /*
+ * Remap Boot flash + PROMJET region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash + promjet */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+
+ board_config_lanes_mux();
+
+ return 0;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = CPLD_READ(sysclk_sw1);
+
+ switch (sysclk_conf & 0x7) {
+ case CPLD_SYSCLK_83:
+ return 83333333;
+ case CPLD_SYSCLK_100:
+ return 100000000;
+ default:
+ return 66666666;
+ }
+}
+
+#define NUM_SRDS_BANKS 2
+
+int misc_init_r(void)
+{
+ serdes_corenet_t *regs = (void *)CFG_SYS_FSL_CORENET_SERDES_ADDR;
+ u32 actual[NUM_SRDS_BANKS];
+ unsigned int i;
+ u8 sw;
+ static const int freq[][3] = {
+ {0, SRDS_PLLCR0_RFCK_SEL_100, SRDS_PLLCR0_RFCK_SEL_125},
+ {SRDS_PLLCR0_RFCK_SEL_100, SRDS_PLLCR0_RFCK_SEL_156_25,
+ SRDS_PLLCR0_RFCK_SEL_125}
+ };
+
+ sw = in_8(&CPLD_SW(2)) >> 2;
+ for (i = 0; i < NUM_SRDS_BANKS; i++) {
+ unsigned int clock = (sw >> (2 * i)) & 3;
+ if (clock == 0x3) {
+ printf("Warning: SDREFCLK%u switch setting of '11' is "
+ "unsupported\n", i + 1);
+ break;
+ }
+ if (i == 0 && clock == 0)
+ puts("Warning: SDREFCLK1 switch setting of"
+ "'00' is unsupported\n");
+ else
+ actual[i] = freq[i][clock];
+
+ /*
+ * PC board uses a different CPLD with PB board, this CPLD
+ * has cpld_ver_sub = 1, and pcba_ver = 5. But CPLD on PB
+ * board has cpld_ver_sub = 0, and pcba_ver = 4.
+ */
+ if ((i == 1) && (CPLD_READ(cpld_ver_sub) == 1) &&
+ (CPLD_READ(pcba_ver) == 5)) {
+ /* PC board bank2 frequency */
+ actual[i] = freq[i-1][clock];
+ }
+ }
+
+ for (i = 0; i < NUM_SRDS_BANKS; i++) {
+ u32 expected = in_be32(&regs->bank[i].pllcr0);
+ expected &= SRDS_PLLCR0_RFCK_SEL_MASK;
+ if (expected != actual[i]) {
+ printf("Warning: SERDES bank %u expects reference clock"
+ " %sMHz, but actual is %sMHz\n", i + 1,
+ serdes_clock_to_string(expected),
+ serdes_clock_to_string(actual[i]));
+ }
+ }
+
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#if defined(CONFIG_HAS_FSL_DR_USB)
+ fsl_fdt_fixup_dr_usb(blob, bd);
+#endif
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+#endif
+
+ return 0;
+}
diff --git a/board/freescale/p2041rdb/pbi.cfg b/board/freescale/p2041rdb/pbi.cfg
new file mode 100644
index 00000000000..75dfc321626
--- /dev/null
+++ b/board/freescale/p2041rdb/pbi.cfg
@@ -0,0 +1,33 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2012 Freescale Semiconductor, Inc.
+# Refer doc/README.pblimage for more details about how-to configure
+# and create PBL boot image
+#
+
+#PBI commands
+#Initialize CPC1 as 1MB SRAM
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+09010100 00000000
+09010104 fff0000b
+09010f00 08000000
+09010000 80000000
+#Configure LAW for CPC1
+09000d00 00000000
+09000d04 fff00000
+09000d08 81000013
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Initialize eSPI controller, default configuration is slow for eSPI to
+#load data, this configuration comes from u-boot eSPI driver.
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Flush PBL data
+09138000 00000000
+091380c0 00000000
diff --git a/board/freescale/p2041rdb/rcw_p2041rdb.cfg b/board/freescale/p2041rdb/rcw_p2041rdb.cfg
new file mode 100644
index 00000000000..8df19dd3fe4
--- /dev/null
+++ b/board/freescale/p2041rdb/rcw_p2041rdb.cfg
@@ -0,0 +1,11 @@
+#
+# Default RCW for P2041RDB.
+#
+
+#PBL preamble and RCW header
+aa55aa55 010e0100
+#64 bytes RCW data
+12600000 00000000 241C0000 00000000
+649FA0C1 C3C02000 58000000 40000000
+00000000 00000000 00000000 D0030F07
+00000000 00000000 00000000 00000000
diff --git a/board/freescale/t102xrdb/Kconfig b/board/freescale/t102xrdb/Kconfig
new file mode 100644
index 00000000000..d538386d434
--- /dev/null
+++ b/board/freescale/t102xrdb/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_T1023RDB || TARGET_T1024RDB
+
+config SYS_BOARD
+ default "t102xrdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "T102xRDB"
+
+endif
diff --git a/board/freescale/t102xrdb/MAINTAINERS b/board/freescale/t102xrdb/MAINTAINERS
new file mode 100644
index 00000000000..df1f0bed939
--- /dev/null
+++ b/board/freescale/t102xrdb/MAINTAINERS
@@ -0,0 +1,9 @@
+T102XRDB BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/t102xrdb/
+F: include/configs/T102xRDB.h
+F: configs/T1024RDB_defconfig
+F: configs/T1024RDB_NAND_defconfig
+F: configs/T1024RDB_SDCARD_defconfig
+F: configs/T1024RDB_SPIFLASH_defconfig
diff --git a/board/freescale/t102xrdb/Makefile b/board/freescale/t102xrdb/Makefile
new file mode 100644
index 00000000000..e597486c940
--- /dev/null
+++ b/board/freescale/t102xrdb/Makefile
@@ -0,0 +1,16 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+else
+obj-y += t102xrdb.o
+obj-$(CONFIG_TARGET_T1024RDB) += cpld.o
+obj-y += eth_t102xrdb.o
+endif
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/t102xrdb/README b/board/freescale/t102xrdb/README
new file mode 100644
index 00000000000..de170f52b4d
--- /dev/null
+++ b/board/freescale/t102xrdb/README
@@ -0,0 +1,340 @@
+T1024 SoC Overview
+------------------
+The T1024/T1023 dual core and T1014/T1013 single core QorIQ communication processor
+combines two or one 64-bit Power Architecture e5500 core respectively with high
+performance datapath acceleration logic, and network peripheral bus interfaces
+required for networking and telecommunications. This processor can be used in
+applications such as enterprise WLAN access points, routers, switches, firewall
+and other packet processing intensive small enterprise and branch office appliances,
+and general-purpose embedded computing. Its high level of integration offers
+significant performance benefits and greatly helps to simplify board design.
+
+
+The T1024 SoC includes the following function and features:
+- two e5500 cores, each with a private 256 KB L2 cache
+ - Up to 1.4 GHz with 64-bit ISA support (Power Architecture v2.06-compliant)
+ - Three levels of instructions: User, supervisor, and hypervisor
+ - Independent boot and reset
+ - Secure boot capability
+- 256 KB shared L3 CoreNet platform cache (CPC)
+- Interconnect CoreNet platform
+ - CoreNet coherency manager supporting coherent and noncoherent transactions
+ with prioritization and bandwidth allocation amongst CoreNet endpoints
+ - 150 Gbps coherent read bandwidth
+- 32-/64-bit DDR3L/DDR4 SDRAM memory controller with ECC and interleaving support
+- Data Path Acceleration Architecture (DPAA) incorporating acceleration for the following functions:
+ - Packet parsing, classification, and distribution
+ - Queue management for scheduling, packet sequencing, and congestion management
+ - Cryptography Acceleration (SEC 5.x)
+ - IEEE 1588 support
+ - Hardware buffer management for buffer allocation and deallocation
+ - MACSEC on DPAA-based Ethernet ports
+- Ethernet interfaces
+ - Four 1 Gbps Ethernet controllers
+- Parallel Ethernet interfaces
+ - Two RGMII interfaces
+- High speed peripheral interfaces
+ - Three PCI Express 2.0 controllers/ports running at up to 5 GHz
+ - One SATA controller supporting 1.5 and 3.0 Gb/s operation
+ - One QSGMII interface
+ - Four SGMII interface supporting 1000 Mbps
+ - Three SGMII interfaces supporting up to 2500 Mbps
+ - 10GBase-R or 10Base-KR interface
+- Additional peripheral interfaces
+ - Two USB 2.0 controllers with integrated PHY
+ - SD/eSDHC/eMMC
+ - eSPI controller
+ - Four I2C controllers
+ - Four UARTs
+ - Four GPIO controllers
+ - Integrated flash controller (IFC)
+ - LCD interface (DIU) with 12 bit dual data rate
+- Multicore programmable interrupt controller (PIC)
+- Two 8-channel DMA engines
+- Single source clocking implementation
+- Deep Sleep power implementaion (wakeup from GPIO/Timer/Ethernet/USB)
+- QUICC Engine block
+ - 32-bit RISC controller for flexible support of the communications peripherals
+ - Serial DMA channel for receive and transmit on all serial channels
+ - Two universal communication controllers, supporting TDM, HDLC, and UART
+
+T1023 Personality
+------------------
+T1023 is a reduced personality of T1024 without QUICC Engine, DIU, and
+unavailable deep sleep. Rest of the blocks are almost same as T1024.
+Differences between T1024 and T1023
+Feature T1024 T1023
+QUICC Engine: yes no
+DIU: yes no
+Deep Sleep: yes no
+I2C controller: 4 3
+DDR: 64-bit 32-bit
+IFC: 32-bit 28-bit
+Package: 23x23 19x19
+
+
+T1024RDB board Overview
+-----------------------
+ - Ethernet
+ - Two on-board 10M/100M/1G bps RGMII ethernet ports
+ - One on-board 10G bps Base-T port.
+ - DDR Memory
+ - Supports 64-bit 4GB DDR3L DIMM
+ - PCIe
+ - One on-board PCIe slot.
+ - Two on-board PCIe Mini-PCIe connectors.
+ - IFC/Local Bus
+ - NOR: 128MB 16-bit NOR Flash
+ - NAND: 1GB 8-bit NAND flash
+ - CPLD: for system controlling with programable header on-board
+ - USB
+ - Supports two USB 2.0 ports with integrated PHYs
+ - Two type A ports with 5V@1.5A per port.
+ - SDHC
+ - one SD connector supporting 1.8V/3.3V via J53.
+ - SPI
+ - On-board 64MB SPI flash
+ - Other
+ - Two Serial ports
+ - Four I2C ports
+
+
+T1023RDB board Overview
+-----------------------
+- T1023 SoC integrating two 64-bit e5500 cores up to 1.4GHz
+- CoreNet fabric supporting coherent and noncoherent transactions with
+ prioritization and bandwidth allocation
+- SDRAM memory: 2GB Micron MT40A512M8HX unbuffered 32-bit DDR4 w/o ECC
+- Accelerator: DPAA components consist of FMan, BMan, QMan, DCE and SEC
+- Ethernet interfaces:
+ - one 1G RGMII port on-board(RTL8211FS PHY)
+ - one 1G SGMII port on-board(RTL8211FS PHY)
+ - one 2.5G SGMII port on-board(AQR105 PHY)
+- PCIe: Two Mini-PCIe connectors on-board.
+- SerDes: 4 lanes up to 10.3125GHz
+- NOR: 128MB S29GL01GS110TFIV10 Spansion NOR Flash
+- NAND: 512MB S34MS04G200BFI000 Spansion NAND Flash
+- eSPI: 64MB S25FL512SAGMFI010 Spansion SPI flash.
+- USB: one Type-A USB 2.0 port with internal PHY
+- eSDHC: support SD/MMC and eMMC card
+- 256Kbit M24256 I2C EEPROM
+- RTC: Real-time clock DS1339U on I2C bus
+- UART: one serial port on-board with RJ45 connector
+- Debugging: JTAG/COP for T1023 debugging
+
+
+Memory map on T1024RDB
+----------------------
+Start Address End Address Description Size
+0xF_FFDF_0000 0xF_FFDF_0FFF IFC - CPLD 4KB
+0xF_FF80_0000 0xF_FF80_FFFF IFC - NAND Flash 64KB
+0xF_FE00_0000 0xF_FEFF_FFFF CCSRBAR 16MB
+0xF_F802_0000 0xF_F802_FFFF PCI Express 3 I/O Space 64KB
+0xF_F801_0000 0xF_F801_FFFF PCI Express 2 I/O Space 64KB
+0xF_F800_0000 0xF_F800_FFFF PCI Express 1 I/O Space 64KB
+0xF_F600_0000 0xF_F7FF_FFFF Queue manager software portal 32MB
+0xF_F400_0000 0xF_F5FF_FFFF Buffer manager software portal 32MB
+0xF_E800_0000 0xF_EFFF_FFFF IFC - NOR Flash 128MB
+0xF_0000_0000 0xF_003F_FFFF DCSR 4MB
+0xC_2000_0000 0xC_2FFF_FFFF PCI Express 3 Mem Space 256MB
+0xC_1000_0000 0xC_1FFF_FFFF PCI Express 2 Mem Space 256MB
+0xC_0000_0000 0xC_0FFF_FFFF PCI Express 1 Mem Space 256MB
+0x0_0000_0000 0x0_ffff_ffff DDR 4GB
+
+
+128MB NOR Flash Memory Layout
+-----------------------------
+Start Address End Address Definition Max size
+0xEFF40000 0xEFFFFFFF U-Boot (current bank) 768KB
+0xEFF20000 0xEFF3FFFF U-Boot env (current bank) 128KB
+0xEFF00000 0xEFF1FFFF FMAN Ucode (current bank) 128KB
+0xEFE00000 0xEFE3FFFF QE firmware (current bank) 256KB
+0xED300000 0xEFDFFFFF rootfs (alt bank) 44MB
+0xED000000 0xED2FFFFF Guest image #3 (alternate bank) 3MB
+0xECD00000 0xECFFFFFF Guest image #2 (alternate bank) 3MB
+0xECA00000 0xECCFFFFF Guest image #1 (alternate bank) 3MB
+0xEC900000 0xEC9FFFFF HV config device tree(alt bank) 1MB
+0xEC800000 0xEC8FFFFF Hardware device tree (alt bank) 1MB
+0xEC700000 0xEC7FFFFF HV.uImage (alternate bank) 1MB
+0xEC020000 0xEC6FFFFF Linux.uImage (alt bank) ~7MB
+0xEC000000 0xEC01FFFF RCW (alt bank) 128KB
+0xEBF40000 0xEBFFFFFF U-Boot (alt bank) 768KB
+0xEBF20000 0xEBF3FFFF U-Boot env (alt bank) 128KB
+0xEBF00000 0xEBF1FFFF FMAN ucode (alt bank) 128KB
+0xEBE00000 0xEBE3FFFF QE firmware (alt bank) 256KB
+0xE9300000 0xEBDFFFFF rootfs (current bank) 44MB
+0xE9000000 0xE92FFFFF Guest image #3 (current bank) 3MB
+0xE8D00000 0xE8FFFFFF Guest image #2 (current bank) 3MB
+0xE8A00000 0xE8CFFFFF Guest image #1 (current bank) 3MB
+0xE8900000 0xE89FFFFF HV config device tree(cur bank) 1MB
+0xE8800000 0xE88FFFFF Hardware device tree (cur bank) 1MB
+0xE8700000 0xE87FFFFF HV.uImage (current bank) 1MB
+0xE8020000 0xE86FFFFF Linux.uImage (current bank) ~7MB
+0xE8000000 0xE801FFFF RCW (current bank) 128KB
+
+
+T1024/T1023 Clock frequency
+---------------------------
+BIN Core DDR Platform FMan
+Bin1: 1400MHz 1600MT/s 400MHz 700MHz
+Bin2: 1200MHz 1600MT/s 400MHz 600MHz
+Bin3: 1000MHz 1600MT/s 400MHz 500MHz
+
+
+Software configurations and board settings
+------------------------------------------
+1. NOR boot:
+ a. build NOR boot image
+ $ make T1024RDB_defconfig
+ $ make
+ b. program u-boot.bin image to NOR flash
+ => tftp 1000000 u-boot.bin
+ => pro off all;era eff40000 efffffff;cp.b 1000000 eff40000 $filesize
+ on T1024RDB:
+ set SW1[1:8] = '00010011', SW2[1] = '1', SW3[4] = '0' for NOR boot
+ on T1023RDB:
+ set SW1[1:8] = '00010111', SW2[1] = '1', SW3[4] = '0' for NOR boot
+
+ Switching between default bank0 and alternate bank4 on NOR flash
+ To change boot source to vbank4:
+ on T1024RDB:
+ via software: run command 'cpld reset altbank' in U-Boot.
+ via DIP-switch: set SW3[5:7] = '100'
+ on T1023RDB:
+ via software: run command 'switch bank4' in U-Boot.
+ via DIP-switch: set SW3[5:7] = '100'
+
+ To change boot source to vbank0:
+ on T1024RDB:
+ via software: run command 'cpld reset' in U-Boot.
+ via DIP-Switch: set SW3[5:7] = '000'
+ on T1023RDB:
+ via software: run command 'switch bank0' in U-Boot.
+ via DIP-switch: set SW3[5:7] = '000'
+
+2. NAND Boot:
+ a. build PBL image for NAND boot
+ $ make T1024RDB_NAND_defconfig
+ $ make
+ b. program u-boot-with-spl-pbl.bin to NAND flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => nand erase 0 $filesize
+ => nand write 1000000 0 $filesize
+ set SW1[1:8] = '10000010', SW2[1] = '1', SW3[4] = '1' for NAND boot
+
+3. SPI Boot:
+ a. build PBL image for SPI boot
+ $ make T1024RDB_SPIFLASH_defconfig
+ $ make
+ b. program u-boot-with-spl-pbl.bin to SPI flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => sf probe 0
+ => sf erase 0 100000
+ => sf write 1000000 0 $filesize
+ => tftp 1000000 fsl_fman_ucode_t1024_xx.bin
+ => sf erase 100000 100000
+ => sf write 1000000 110000 20000
+ set SW1[1:8] = '00100010', SW2[1] ='1' for SPI boot
+
+4. SD Boot:
+ a. build PBL image for SD boot
+ $ make T1024RDB_SDCARD_defconfig
+ $ make
+ b. program u-boot-with-spl-pbl.bin to SD/MMC card
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => mmc write 1000000 8 0x7f0
+ => tftp 1000000 fsl_fman_ucode_t1024_xx.bin
+ => mmc write 1000000 0x820 80
+ set SW1[1:8] = '00100000', SW2[1] = '0' for SD boot
+
+ SW3[3] = '1' for SD card(or 'switch sd' by software)
+ SW3[3] = '0' for eMMC (or 'switch emmc' by software)
+
+
+device tree support and how to enable it for different configs
+--------------------------------------------------------------
+device tree support is available for t1024rdb for below mentioned boot,
+1. nor boot
+2. nand boot
+3. sd boot
+4. spiflash boot
+
+to enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. config_default_device_tree="t1024rdb" (change default device tree name if required)
+2. config_of_control
+3. config_mpc85xx_have_reset_vector if reset vector is located at
+ config_reset_vector_address - 0xffc
+
+if device tree support is enabled in defconfig,
+1. use 'u-boot.bin' for nor boot.
+2. use 'u-boot-with-spl-pbl.bin' for other boot.
+
+2-stage NAND/SPI/SD boot loader
+-------------------------------
+PBL initializes the internal CPC-SRAM and copy SPL(160K) to SRAM.
+SPL further initializes DDR using SPD and environment variables
+and copy U-Boot(768 KB) from NAND/SPI/SD device to DDR.
+Finally SPL transers control to U-Boot for futher booting.
+
+SPL has following features:
+ - Executes within 256K
+ - No relocation required
+
+Run time view of SPL framework
+-------------------------------------------------
+|Area | Address |
+-------------------------------------------------
+|SecureBoot header | 0xFFFC0000 (32KB) |
+-------------------------------------------------
+|GD, BD | 0xFFFC8000 (4KB) |
+-------------------------------------------------
+|ENV | 0xFFFC9000 (8KB) |
+-------------------------------------------------
+|HEAP | 0xFFFCB000 (30KB) |
+-------------------------------------------------
+|STACK | 0xFFFD8000 (22KB) |
+-------------------------------------------------
+|U-Boot SPL | 0xFFFD8000 (160KB) |
+-------------------------------------------------
+
+NAND Flash memory Map on T1024RDB
+-------------------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot 1MB(2 block)
+0x100000 0x17FFFF U-Boot env 512KB(1 block)
+0x180000 0x1FFFFF FMAN Ucode 512KB(1 block)
+0x200000 0x27FFFF QE Firmware 512KB(1 block)
+
+
+NAND Flash memory Map on T1023RDB
+----------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot 1MB
+0x100000 0x15FFFF U-Boot env 8KB
+0x160000 0x17FFFF FMAN Ucode 128KB
+
+
+SD Card memory Map on T102xRDB
+----------------------------------------------------
+Block #blocks Definition Size
+0x008 2048 U-Boot img 1MB
+0x800 0016 U-Boot env 8KB
+0x820 0256 FMAN Ucode 128KB
+0x920 0256 QE Firmware 128KB(only T1024RDB)
+
+
+64MB SPI Flash memory Map on T102xRDB
+----------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot img 1MB
+0x100000 0x101FFF U-Boot env 8KB
+0x110000 0x12FFFF FMAN Ucode 128KB
+0x130000 0x14FFFF QE Firmware 128KB(only T1024RDB)
+0x300000 0x3FFFFF device tree 128KB
+0x400000 0x9FFFFF Linux kernel 6MB
+0xa00000 0x3FFFFFF rootfs 54MB
+
+
+For more details, please refer to T1024RDB/T1023RDB User Guide
+and Freescale QorIQ SDK Infocenter document.
diff --git a/board/freescale/t102xrdb/cpld.c b/board/freescale/t102xrdb/cpld.c
new file mode 100644
index 00000000000..cc933ccd544
--- /dev/null
+++ b/board/freescale/t102xrdb/cpld.c
@@ -0,0 +1,102 @@
+// SPDX-License-Identifier: GPL-2.0+
+/**
+ * Copyright 2014 Freescale Semiconductor
+ *
+ * Freescale T1024RDB board-specific CPLD controlling supports.
+ *
+ * The following macros need to be defined:
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/**
+ * Set the boot bank to the alternate bank
+ */
+void cpld_set_altbank(void)
+{
+ u8 reg = CPLD_READ(flash_csr);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_ALTBANK;
+
+ CPLD_WRITE(flash_csr, reg);
+ CPLD_WRITE(reset_ctl1, CPLD_LBMAP_RESET);
+}
+
+/**
+ * Set the boot bank to the default bank
+ */
+void cpld_set_defbank(void)
+{
+ u8 reg = CPLD_READ(flash_csr);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_DFLTBANK;
+
+ CPLD_WRITE(flash_csr, reg);
+ CPLD_WRITE(reset_ctl1, CPLD_LBMAP_RESET);
+}
+
+static void cpld_dump_regs(void)
+{
+ printf("cpld_ver = 0x%02x\n", CPLD_READ(cpld_ver));
+ printf("cpld_ver_sub = 0x%02x\n", CPLD_READ(cpld_ver_sub));
+ printf("hw_ver = 0x%02x\n", CPLD_READ(hw_ver));
+ printf("sw_ver = 0x%02x\n", CPLD_READ(sw_ver));
+ printf("reset_ctl1 = 0x%02x\n", CPLD_READ(reset_ctl1));
+ printf("reset_ctl2 = 0x%02x\n", CPLD_READ(reset_ctl2));
+ printf("int_status = 0x%02x\n", CPLD_READ(int_status));
+ printf("flash_csr = 0x%02x\n", CPLD_READ(flash_csr));
+ printf("fan_ctl_status = 0x%02x\n", CPLD_READ(fan_ctl_status));
+ printf("led_ctl_status = 0x%02x\n", CPLD_READ(led_ctl_status));
+ printf("sfp_ctl_status = 0x%02x\n", CPLD_READ(sfp_ctl_status));
+ printf("misc_ctl_status = 0x%02x\n", CPLD_READ(misc_ctl_status));
+ printf("boot_override = 0x%02x\n", CPLD_READ(boot_override));
+ printf("boot_config1 = 0x%02x\n", CPLD_READ(boot_config1));
+ printf("boot_config2 = 0x%02x\n", CPLD_READ(boot_config2));
+ putc('\n');
+}
+
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else
+ cpld_set_defbank();
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+ } else {
+ rc = cmd_usage(cmdtp);
+ }
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset - hard reset to default bank\n"
+ "cpld reset altbank - reset to alternate bank\n"
+ "cpld dump - display the CPLD registers\n"
+ );
diff --git a/board/freescale/t102xrdb/cpld.h b/board/freescale/t102xrdb/cpld.h
new file mode 100644
index 00000000000..bd40cc319a8
--- /dev/null
+++ b/board/freescale/t102xrdb/cpld.h
@@ -0,0 +1,48 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/**
+ * Copyright 2014 Freescale Semiconductor
+ *
+ */
+
+struct cpld_data {
+ u8 cpld_ver; /* 0x00 - CPLD Major Revision Register */
+ u8 cpld_ver_sub; /* 0x01 - CPLD Minor Revision Register */
+ u8 hw_ver; /* 0x02 - Hardware Revision Register */
+ u8 sw_ver; /* 0x03 - Software Revision register */
+ u8 res0[12]; /* 0x04 - 0x0F - not used */
+ u8 reset_ctl1; /* 0x10 - Reset control Register1 */
+ u8 reset_ctl2; /* 0x11 - Reset control Register2 */
+ u8 int_status; /* 0x12 - Interrupt status Register */
+ u8 flash_csr; /* 0x13 - Flash control and status register */
+ u8 fan_ctl_status; /* 0x14 - Fan control and status register */
+ u8 led_ctl_status; /* 0x15 - LED control and status register */
+ u8 sfp_ctl_status; /* 0x16 - SFP control and status register */
+ u8 misc_ctl_status; /* 0x17 - Miscellanies ctrl & status register*/
+ u8 boot_override; /* 0x18 - Boot override register */
+ u8 boot_config1; /* 0x19 - Boot config override register*/
+ u8 boot_config2; /* 0x1A - Boot config override register*/
+};
+
+
+/* Pointer to the CPLD register set */
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value)\
+ cpld_write(offsetof(struct cpld_data, reg), value)
+
+/* CPLD on IFC */
+#define CPLD_LBMAP_MASK 0x3F
+#define CPLD_BANK_SEL_MASK 0x07
+#define CPLD_BANK_OVERRIDE 0x40
+#define CPLD_LBMAP_ALTBANK 0x44 /* BANK OR | BANK 4 */
+#define CPLD_LBMAP_DFLTBANK 0x40 /* BANK OR | BANK 0 */
+#define CPLD_LBMAP_RESET 0xFF
+#define CPLD_LBMAP_SHIFT 0x03
+#define CPLD_BOOT_SEL 0x80
+
+#define CPLD_PCIE_SGMII_MUX 0x80
+#define CPLD_OVERRIDE_BOOT_EN 0x01
+#define CPLD_OVERRIDE_MUX_EN 0x02 /* PCIE/2.5G-SGMII mux override enable */
diff --git a/board/freescale/t102xrdb/ddr.c b/board/freescale/t102xrdb/ddr.c
new file mode 100644
index 00000000000..f8d504fb3c7
--- /dev/null
+++ b/board/freescale/t102xrdb/ddr.c
@@ -0,0 +1,258 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+#include <asm/mpc85xx_gpio.h>
+#include <linux/delay.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * datarate_mhz_high values need to be in ascending order
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl |
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 |
+ */
+ {2, 833, 0, 8, 6, 0x06060607, 0x08080807,},
+ {2, 1350, 0, 8, 7, 0x0708080A, 0x0A0B0C09,},
+ {2, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A,},
+ {1, 833, 0, 8, 6, 0x06060607, 0x08080807,},
+ {1, 1350, 0, 8, 7, 0x0708080A, 0x0A0B0C09,},
+ {1, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A,},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+ struct cpu_type *cpu = gd->arch.cpu;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust according to the board ddr freqency and n_banks
+ * specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks &&
+ (pdimm->rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found\n");
+ printf("for data rate %lu MT/s\n", ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb);
+ debug("\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, ",
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2);
+ debug("wrlvl_ctrl_3 0x%x\n", pbsp->wrlvl_ctl_3);
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * rtt and rtt_wr override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_OFF);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_OFF);
+
+ /* T1023 supports max DDR bus 32bit width, T1024 supports DDR 64bit,
+ * force DDR bus width to 32bit for T1023
+ */
+ if (cpu->soc_ver == SVR_T1023)
+ popts->data_bus_width = DDR_DATA_BUS_WIDTH_32;
+
+#ifdef CONFIG_FORCE_DDR_DATA_BUS_WIDTH_32
+ /* for DDR bus 32bit test on T1024 */
+ popts->data_bus_width = DDR_DATA_BUS_WIDTH_32;
+#endif
+
+#ifdef CONFIG_TARGET_T1023RDB
+ popts->wrlvl_ctl_2 = 0x07070606;
+ popts->half_strength_driver_enable = 1;
+ popts->cpo_sample = 0x43;
+#elif defined(CONFIG_TARGET_T1024RDB)
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x52;
+#endif
+}
+
+#ifdef CONFIG_SYS_DDR_RAW_TIMING
+/* 2GB discrete DDR4 MT40A512M8HX on T1023RDB */
+dimm_params_t ddr_raw_timing = {
+ .n_ranks = 1,
+ .rank_density = 0x80000000,
+ .capacity = 0x80000000,
+ .primary_sdram_width = 32,
+ .ec_sdram_width = 8,
+ .registered_dimm = 0,
+ .mirrored_dimm = 0,
+ .n_row_addr = 15,
+ .n_col_addr = 10,
+ .bank_addr_bits = 2,
+ .bank_group_bits = 2,
+ .edc_config = 0,
+ .burst_lengths_bitmask = 0x0c,
+ .tckmin_x_ps = 938,
+ .tckmax_ps = 1500,
+ .caslat_x = 0x000DFA00,
+ .taa_ps = 13500,
+ .trcd_ps = 13500,
+ .trp_ps = 13500,
+ .tras_ps = 33000,
+ .trc_ps = 46500,
+ .trfc1_ps = 260000,
+ .trfc2_ps = 160000,
+ .trfc4_ps = 110000,
+ .tfaw_ps = 25000,
+ .trrds_ps = 3700,
+ .trrdl_ps = 5300,
+ .tccdl_ps = 5355,
+ .refresh_rate_ps = 7800000,
+ .dq_mapping[0] = 0x0,
+ .dq_mapping[1] = 0x0,
+ .dq_mapping[2] = 0x0,
+ .dq_mapping[3] = 0x0,
+ .dq_mapping[4] = 0x0,
+ .dq_mapping[5] = 0x0,
+ .dq_mapping[6] = 0x0,
+ .dq_mapping[7] = 0x0,
+ .dq_mapping[8] = 0x0,
+ .dq_mapping[9] = 0x0,
+ .dq_mapping[10] = 0x0,
+ .dq_mapping[11] = 0x0,
+ .dq_mapping[12] = 0x0,
+ .dq_mapping[13] = 0x0,
+ .dq_mapping[14] = 0x0,
+ .dq_mapping[15] = 0x0,
+ .dq_mapping[16] = 0x0,
+ .dq_mapping[17] = 0x0,
+ .dq_mapping_ors = 1,
+};
+
+int fsl_ddr_get_dimm_params(dimm_params_t *pdimm,
+ unsigned int controller_number,
+ unsigned int dimm_number)
+{
+ const char dimm_model[] = "Fixed DDR4 on board";
+
+ if (((controller_number == 0) && (dimm_number == 0)) ||
+ ((controller_number == 1) && (dimm_number == 0))) {
+ memcpy(pdimm, &ddr_raw_timing, sizeof(dimm_params_t));
+ memset(pdimm->mpart, 0, sizeof(pdimm->mpart));
+ memcpy(pdimm->mpart, dimm_model, sizeof(dimm_model) - 1);
+ }
+
+ return 0;
+}
+#endif
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_mem_sleep_setup(void)
+{
+ void __iomem *cpld_base = (void *)CFG_SYS_CPLD_BASE;
+
+ /* does not provide HW signals for power management */
+ clrbits_8(cpld_base + 0x17, 0x40);
+ /* Disable MCKE isolation */
+ gpio_set_value(2, 0);
+ udelay(1);
+}
+#endif
+
+int dram_init(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_RAMBOOT_PBL)
+#ifndef CONFIG_SYS_DDR_RAW_TIMING
+ puts("Initializing....using SPD\n");
+#endif
+ dram_size = fsl_ddr_sdram();
+#else
+ /* DDR has been initialised by first stage boot loader */
+ dram_size = fsl_ddr_sdram_size();
+#endif
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+#if defined(CONFIG_DEEP_SLEEP) && !defined(CONFIG_SPL_BUILD)
+ fsl_dp_resume();
+#endif
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/t102xrdb/eth_t102xrdb.c b/board/freescale/t102xrdb/eth_t102xrdb.c
new file mode 100644
index 00000000000..7185a0abd52
--- /dev/null
+++ b/board/freescale/t102xrdb/eth_t102xrdb.c
@@ -0,0 +1,149 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ *
+ * Shengzhou Liu <Shengzhou.Liu@freescale.com>
+ */
+
+#include <config.h>
+#include <command.h>
+#include <fdt_support.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_portals.h>
+#include <asm/fsl_liodn.h>
+#include <malloc.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <miiphy.h>
+#include <phy.h>
+#include <fsl_dtsec.h>
+#include <asm/fsl_serdes.h>
+#include "../common/fman.h"
+
+int board_eth_init(struct bd_info *bis)
+{
+#if defined(CONFIG_FMAN_ENET)
+ int i, interface;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ struct mii_dev *dev;
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ /* Set the on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY1_ADDR);
+
+ switch (srds_s1) {
+#ifdef CONFIG_TARGET_T1024RDB
+ case 0x95:
+ /* set the on-board RGMII2 PHY */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY2_ADDR);
+
+ /* set 10GBase-R with Aquantia AQR105 PHY */
+ fm_info_set_phy_address(FM1_10GEC1, FM1_10GEC1_PHY_ADDR);
+ break;
+#endif
+ case 0x6a:
+ case 0x6b:
+ case 0x77:
+ case 0x135:
+ /* set the on-board 2.5G SGMII AQR105 PHY */
+ fm_info_set_phy_address(FM1_DTSEC3, SGMII_AQR_PHY_ADDR);
+#ifdef CONFIG_TARGET_T1023RDB
+ /* set the on-board 1G SGMII RTL8211F PHY */
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_RTK_PHY_ADDR);
+#endif
+ break;
+ default:
+ printf("SerDes protocol 0x%x is not supported on T102xRDB\n",
+ srds_s1);
+ break;
+ }
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ case PHY_INTERFACE_MODE_SGMII:
+#if defined(CONFIG_TARGET_T1023RDB)
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+#elif defined(CONFIG_TARGET_T1024RDB)
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+#endif
+ fm_info_set_mdio(i, dev);
+ break;
+ case PHY_INTERFACE_MODE_2500BASEX:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+ for (i = FM1_10GEC1; i < FM1_10GEC1 + CFG_SYS_NUM_FM1_10GEC; i++) {
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_XGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+ cpu_eth_init(bis);
+#endif /* CONFIG_FMAN_ENET */
+
+ return pci_eth_init(bis);
+}
+
+void board_ft_fman_fixup_port(void *fdt, char *compat, phys_addr_t addr,
+ enum fm_port port, int offset)
+{
+#if defined(CONFIG_TARGET_T1024RDB)
+ if (((fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_2500BASEX) ||
+ (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_SGMII)) &&
+ (port == FM1_DTSEC3)) {
+ fdt_set_phy_handle(fdt, compat, addr, "sg_2500_aqr105_phy4");
+ fdt_setprop_string(fdt, offset, "phy-connection-type",
+ "2500base-x");
+ fdt_status_disabled_by_alias(fdt, "xg_aqr105_phy3");
+ }
+#endif
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+}
diff --git a/board/freescale/t102xrdb/law.c b/board/freescale/t102xrdb/law.c
new file mode 100644
index 00000000000..81caa961897
--- /dev/null
+++ b/board/freescale/t102xrdb/law.c
@@ -0,0 +1,31 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+#ifdef CONFIG_MTD_NOR_FLASH
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef CFG_SYS_CPLD_BASE_PHYS
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_4M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_64K, LAW_TRGT_IF_IFC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/t102xrdb/spl.c b/board/freescale/t102xrdb/spl.c
new file mode 100644
index 00000000000..de6cdda194e
--- /dev/null
+++ b/board/freescale/t102xrdb/spl.c
@@ -0,0 +1,132 @@
+// SPDX-License-Identifier: GPL-2.0+
+/* Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env_internal.h>
+#include <init.h>
+#include <malloc.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <i2c.h>
+#include <mmc.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/sleep.h"
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L3_SIZE;
+}
+
+#if defined(CONFIG_SPL_MMC_BOOT)
+#define GPIO1_SD_SEL 0x00020000
+int board_mmc_getcd(struct mmc *mmc)
+{
+ ccsr_gpio_t __iomem *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ u32 val = in_be32(&pgpio->gpdat);
+
+ /* GPIO1_14, 0: eMMC, 1: SD */
+ val &= GPIO1_SD_SEL;
+
+ return val ? -1 : 1;
+}
+
+int board_mmc_getwp(struct mmc *mmc)
+{
+ ccsr_gpio_t __iomem *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ u32 val = in_be32(&pgpio->gpdat);
+
+ val &= GPIO1_SD_SEL;
+
+ return val ? -1 : 0;
+}
+#endif
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, sys_clk, ccb_clk;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ /* Memcpy existing GD at CONFIG_SPL_GD_ADDR */
+ memcpy((void *)CONFIG_SPL_GD_ADDR, (void *)gd, sizeof(gd_t));
+
+ /* Update GD pointer */
+ gd = (gd_t *)(CONFIG_SPL_GD_ADDR);
+
+ console_init_f();
+
+#ifdef CONFIG_DEEP_SLEEP
+ /* disable the console if boot from deep sleep */
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ /* initialize selected port with appropriate baud rate */
+ sys_clk = get_board_sys_clk();
+ plat_ratio = (in_be32(&gur->rcwsr[0]) >> 25) & 0x1f;
+ ccb_clk = sys_clk * plat_ratio / 2;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ ccb_clk / 16 / CONFIG_BAUDRATE);
+
+#if defined(CONFIG_SPL_MMC_BOOT)
+ puts("\nSD boot...\n");
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ puts("\nSPI boot...\n");
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ puts("\nNAND boot...\n");
+#endif
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, (gd_t *)CONFIG_SPL_GD_ADDR, 0x0);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ struct bd_info *bd;
+
+ bd = (struct bd_info *)(gd + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_SPL_RELOC_MALLOC_ADDR,
+ CONFIG_SPL_RELOC_MALLOC_SIZE);
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+ mmc_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_SPI_BOOT
+ fsl_spi_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+
+ i2c_init_all();
+
+ dram_init();
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/t102xrdb/t1023_nand_rcw.cfg b/board/freescale/t102xrdb/t1023_nand_rcw.cfg
new file mode 100644
index 00000000000..f8f72826b16
--- /dev/null
+++ b/board/freescale/t102xrdb/t1023_nand_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1023RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x77
+#Default Core=1200MHz, DDR=1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+3b800003 00000012 e8104000 21000000
+00000000 00000000 00000000 00022800
+00000130 04020200 00000000 00000006
diff --git a/board/freescale/t102xrdb/t1023_sd_rcw.cfg b/board/freescale/t102xrdb/t1023_sd_rcw.cfg
new file mode 100644
index 00000000000..dbf8fba5535
--- /dev/null
+++ b/board/freescale/t102xrdb/t1023_sd_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1023RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x77
+#Default Core=1200MHz, DDR=1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+3b800003 00000012 68104000 21000000
+00000000 00000000 00000000 00022800
+00000130 04020200 00000000 00000006
diff --git a/board/freescale/t102xrdb/t1023_spi_rcw.cfg b/board/freescale/t102xrdb/t1023_spi_rcw.cfg
new file mode 100644
index 00000000000..5edcdb50ea9
--- /dev/null
+++ b/board/freescale/t102xrdb/t1023_spi_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1023RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x77
+#Default Core=1200MHz, DDR=1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+3b800003 00000012 58104000 21000000
+00000000 00000000 00000000 00022800
+00000130 04020200 00000000 00000006
diff --git a/board/freescale/t102xrdb/t1024_nand_rcw.cfg b/board/freescale/t102xrdb/t1024_nand_rcw.cfg
new file mode 100644
index 00000000000..cd6f906396e
--- /dev/null
+++ b/board/freescale/t102xrdb/t1024_nand_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1024RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x95
+#Core/DDR: 1400Mhz/1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+4a800003 80000012 ec027000 21000000
+00000000 00000000 00000000 00030810
+00000000 0b005a08 00000000 00000006
diff --git a/board/freescale/t102xrdb/t1024_pbi.cfg b/board/freescale/t102xrdb/t1024_pbi.cfg
new file mode 100644
index 00000000000..98efca25a29
--- /dev/null
+++ b/board/freescale/t102xrdb/t1024_pbi.cfg
@@ -0,0 +1,26 @@
+#PBI commands
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#Configure CPC1 as 256KB SRAM
+09010100 00000000
+09010104 fffc0007
+09010f00 081e000d
+09010000 80000000
+#Configure LAW for CPC1
+09000cd0 00000000
+09000cd4 fffc0000
+09000cd8 81000011
+#Configure alternate space
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Configure SPI controller
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Flush PBL data
+091380c0 000FFFFF
diff --git a/board/freescale/t102xrdb/t1024_sd_rcw.cfg b/board/freescale/t102xrdb/t1024_sd_rcw.cfg
new file mode 100644
index 00000000000..05b3f377636
--- /dev/null
+++ b/board/freescale/t102xrdb/t1024_sd_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1024RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x95
+#Core/DDR: 1400Mhz/1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+4a800003 80000012 6c027000 21000000
+00000000 00000000 00000000 00030810
+00000000 0b005a08 00000000 00000006
diff --git a/board/freescale/t102xrdb/t1024_spi_rcw.cfg b/board/freescale/t102xrdb/t1024_spi_rcw.cfg
new file mode 100644
index 00000000000..8b695b4ab7b
--- /dev/null
+++ b/board/freescale/t102xrdb/t1024_spi_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header for T1024RDB
+aa55aa55 010e0100
+#SerDes Protocol: 0x95
+#Core/DDR: 1400Mhz/1600MT/s with single source clock
+0810000c 00000000 00000000 00000000
+4a800003 80000012 5c027000 21000000
+00000000 00000000 00000000 00030810
+00000000 0b005a08 00000000 00000006
diff --git a/board/freescale/t102xrdb/t102xrdb.c b/board/freescale/t102xrdb/t102xrdb.c
new file mode 100644
index 00000000000..0a29e27b42c
--- /dev/null
+++ b/board/freescale/t102xrdb/t102xrdb.c
@@ -0,0 +1,397 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2020-2023 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <image.h>
+#include <init.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <clock_legacy.h>
+#include <fm_eth.h>
+#include "t102xrdb.h"
+#ifdef CONFIG_TARGET_T1024RDB
+#include "cpld.h"
+#elif defined(CONFIG_TARGET_T1023RDB)
+#include <i2c.h>
+#include <mmc.h>
+#endif
+#include "../common/sleep.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_TARGET_T1023RDB
+enum {
+ GPIO1_SD_SEL = 0x00020000, /* GPIO1_14, 0: eMMC, 1:SD/MMC */
+ GPIO1_EMMC_SEL,
+ GPIO3_GET_VERSION, /* GPIO3_4/5, 00:RevB, 01: RevC */
+ GPIO3_BRD_VER_MASK = 0x0c000000,
+ GPIO3_OFFSET = 0x2000,
+ I2C_GET_BANK,
+ I2C_SET_BANK0,
+ I2C_SET_BANK4,
+};
+#endif
+
+#if CONFIG_IS_ENABLED(DM_SERIAL)
+int get_serial_clock(void)
+{
+ return get_bus_freq(0) / 2;
+}
+#endif
+
+int checkboard(void)
+{
+ struct cpu_type *cpu = gd->arch.cpu;
+ static const char *freq[3] = {"100.00MHZ", "125.00MHz", "156.25MHZ"};
+ ccsr_gur_t __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) & FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ printf("Board: %sRDB, ", cpu->name);
+#if defined(CONFIG_TARGET_T1024RDB)
+ printf("Board rev: 0x%02x CPLD ver: 0x%02x, ",
+ CPLD_READ(hw_ver), CPLD_READ(sw_ver));
+#elif defined(CONFIG_TARGET_T1023RDB)
+ printf("Rev%c, ", t1023rdb_ctrl(GPIO3_GET_VERSION) + 'B');
+#endif
+ printf("boot from ");
+
+#ifdef CONFIG_SDCARD
+ puts("SD/MMC\n");
+#elif CONFIG_SPIFLASH
+ puts("SPI\n");
+#elif defined(CONFIG_TARGET_T1024RDB)
+ u8 reg;
+
+ reg = CPLD_READ(flash_csr);
+
+ if (reg & CPLD_BOOT_SEL) {
+ puts("NAND\n");
+ } else {
+ reg = ((reg & CPLD_LBMAP_MASK) >> CPLD_LBMAP_SHIFT);
+ printf("NOR vBank%d\n", reg);
+ }
+#elif defined(CONFIG_TARGET_T1023RDB)
+#ifdef CONFIG_MTD_RAW_NAND
+ puts("NAND\n");
+#else
+ printf("NOR vBank%d\n", t1023rdb_ctrl(I2C_GET_BANK));
+#endif
+#endif
+
+ puts("SERDES Reference Clocks:\n");
+ if (srds_s1 == 0x95)
+ printf("SD1_CLK1=%s, SD1_CLK2=%s\n", freq[2], freq[0]);
+ else
+ printf("SD1_CLK1=%s, SD1_CLK2=%s\n", freq[0], freq[1]);
+
+ return 0;
+}
+
+#ifdef CONFIG_TARGET_T1024RDB
+static void board_mux_lane(void)
+{
+ ccsr_gur_t __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_prtcl_s1;
+ u8 reg = CPLD_READ(misc_ctl_status);
+
+ srds_prtcl_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_prtcl_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ if (srds_prtcl_s1 == 0x95) {
+ /* Route Lane B to PCIE */
+ CPLD_WRITE(misc_ctl_status, reg & ~CPLD_PCIE_SGMII_MUX);
+ } else {
+ /* Route Lane B to SGMII */
+ CPLD_WRITE(misc_ctl_status, reg | CPLD_PCIE_SGMII_MUX);
+ }
+ CPLD_WRITE(boot_override, CPLD_OVERRIDE_MUX_EN);
+}
+#endif
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+#ifdef CFG_SYS_FLASH_BASE
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+ /*
+ * Remap Boot flash region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash + promjet */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+#endif
+
+#ifdef CONFIG_TARGET_T1024RDB
+ board_mux_lane();
+#endif
+
+ pci_init();
+
+ return 0;
+}
+
+#ifdef CONFIG_TARGET_T1024RDB
+void board_reset(void)
+{
+ CPLD_WRITE(reset_ctl1, CPLD_LBMAP_RESET);
+}
+#endif
+
+int misc_init_r(void)
+{
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+ fdt_fixup_board_enet(blob);
+#endif
+
+#ifdef CONFIG_TARGET_T1023RDB
+ if (t1023rdb_ctrl(GPIO3_GET_VERSION) > 0)
+ fdt_enable_nor(blob);
+#endif
+
+ return 0;
+}
+
+#ifdef CONFIG_TARGET_T1023RDB
+/* Enable NOR flash for RevC */
+static void fdt_enable_nor(void *blob)
+{
+ int nodeoff = fdt_node_offset_by_compatible(blob, 0, "cfi-flash");
+
+ if (nodeoff >= 0)
+ fdt_status_okay(blob, nodeoff);
+ else
+ printf("WARNING unable to set status for NOR\n");
+}
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ ccsr_gpio_t __iomem *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ u32 val = in_be32(&pgpio->gpdat);
+
+ /* GPIO1_14, 0: eMMC, 1: SD/MMC */
+ val &= GPIO1_SD_SEL;
+
+ return val ? -1 : 1;
+}
+
+int board_mmc_getwp(struct mmc *mmc)
+{
+ ccsr_gpio_t __iomem *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ u32 val = in_be32(&pgpio->gpdat);
+
+ val &= GPIO1_SD_SEL;
+
+ return val ? -1 : 0;
+}
+
+static u32 t1023rdb_ctrl(u32 ctrl_type)
+{
+ ccsr_gpio_t __iomem *pgpio = (void *)(CFG_SYS_MPC85xx_GPIO_ADDR);
+ ccsr_gur_t __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 val;
+ u8 tmp;
+ int bus_num = I2C_PCA6408_BUS_NUM;
+
+#if CONFIG_IS_ENABLED(DM_I2C)
+ struct udevice *dev;
+ int ret;
+
+ ret = i2c_get_chip_for_busnum(bus_num, I2C_PCA6408_ADDR,
+ 1, &dev);
+ if (ret) {
+ printf("%s: Cannot find udev for a bus %d\n", __func__,
+ bus_num);
+ return ret;
+ }
+ switch (ctrl_type) {
+ case GPIO1_SD_SEL:
+ val = in_be32(&pgpio->gpdat);
+ val |= GPIO1_SD_SEL;
+ out_be32(&pgpio->gpdat, val);
+ setbits_be32(&pgpio->gpdir, GPIO1_SD_SEL);
+ break;
+ case GPIO1_EMMC_SEL:
+ val = in_be32(&pgpio->gpdat);
+ val &= ~GPIO1_SD_SEL;
+ out_be32(&pgpio->gpdat, val);
+ setbits_be32(&pgpio->gpdir, GPIO1_SD_SEL);
+ break;
+ case GPIO3_GET_VERSION:
+ pgpio = (ccsr_gpio_t *)(CFG_SYS_MPC85xx_GPIO_ADDR
+ + GPIO3_OFFSET);
+ val = in_be32(&pgpio->gpdat);
+ val = ((val & GPIO3_BRD_VER_MASK) >> 26) & 0x3;
+ if (val == 0x3) /* GPIO3_4/5 not used on RevB */
+ val = 0;
+ return val;
+ case I2C_GET_BANK:
+ dm_i2c_read(dev, 0, &tmp, 1);
+ tmp &= 0x7;
+ tmp = ((tmp & 1) << 2) | (tmp & 2) | ((tmp & 4) >> 2);
+ return tmp;
+ case I2C_SET_BANK0:
+ tmp = 0x0;
+ dm_i2c_write(dev, 1, &tmp, 1);
+ tmp = 0xf8;
+ dm_i2c_write(dev, 3, &tmp, 1);
+ /* asserting HRESET_REQ */
+ out_be32(&gur->rstcr, 0x2);
+ break;
+ case I2C_SET_BANK4:
+ tmp = 0x1;
+ dm_i2c_write(dev, 1, &tmp, 1);
+ tmp = 0xf8;
+ dm_i2c_write(dev, 3, &tmp, 1);
+ out_be32(&gur->rstcr, 0x2);
+ break;
+ default:
+ break;
+ }
+#else
+ u32 orig_bus;
+
+ orig_bus = i2c_get_bus_num();
+
+ switch (ctrl_type) {
+ case GPIO1_SD_SEL:
+ val = in_be32(&pgpio->gpdat);
+ val |= GPIO1_SD_SEL;
+ out_be32(&pgpio->gpdat, val);
+ setbits_be32(&pgpio->gpdir, GPIO1_SD_SEL);
+ break;
+ case GPIO1_EMMC_SEL:
+ val = in_be32(&pgpio->gpdat);
+ val &= ~GPIO1_SD_SEL;
+ out_be32(&pgpio->gpdat, val);
+ setbits_be32(&pgpio->gpdir, GPIO1_SD_SEL);
+ break;
+ case GPIO3_GET_VERSION:
+ pgpio = (ccsr_gpio_t *)(CFG_SYS_MPC85xx_GPIO_ADDR
+ + GPIO3_OFFSET);
+ val = in_be32(&pgpio->gpdat);
+ val = ((val & GPIO3_BRD_VER_MASK) >> 26) & 0x3;
+ if (val == 0x3) /* GPIO3_4/5 not used on RevB */
+ val = 0;
+ return val;
+ case I2C_GET_BANK:
+ i2c_set_bus_num(bus_num);
+ i2c_read(I2C_PCA6408_ADDR, 0, 1, &tmp, 1);
+ tmp &= 0x7;
+ tmp = ((tmp & 1) << 2) | (tmp & 2) | ((tmp & 4) >> 2);
+ i2c_set_bus_num(orig_bus);
+ return tmp;
+ case I2C_SET_BANK0:
+ i2c_set_bus_num(bus_num);
+ tmp = 0x0;
+ i2c_write(I2C_PCA6408_ADDR, 1, 1, &tmp, 1);
+ tmp = 0xf8;
+ i2c_write(I2C_PCA6408_ADDR, 3, 1, &tmp, 1);
+ /* asserting HRESET_REQ */
+ out_be32(&gur->rstcr, 0x2);
+ break;
+ case I2C_SET_BANK4:
+ i2c_set_bus_num(bus_num);
+ tmp = 0x1;
+ i2c_write(I2C_PCA6408_ADDR, 1, 1, &tmp, 1);
+ tmp = 0xf8;
+ i2c_write(I2C_PCA6408_ADDR, 3, 1, &tmp, 1);
+ out_be32(&gur->rstcr, 0x2);
+ break;
+ default:
+ break;
+ }
+#endif
+ return 0;
+}
+
+static int switch_cmd(struct cmd_tbl *cmdtp, int flag, int argc,
+ char *const argv[])
+{
+ if (argc < 2)
+ return CMD_RET_USAGE;
+ if (!strcmp(argv[1], "bank0"))
+ t1023rdb_ctrl(I2C_SET_BANK0);
+ else if (!strcmp(argv[1], "bank4") || !strcmp(argv[1], "altbank"))
+ t1023rdb_ctrl(I2C_SET_BANK4);
+ else if (!strcmp(argv[1], "sd"))
+ t1023rdb_ctrl(GPIO1_SD_SEL);
+ else if (!strcmp(argv[1], "emmc"))
+ t1023rdb_ctrl(GPIO1_EMMC_SEL);
+ else
+ return CMD_RET_USAGE;
+ return 0;
+}
+
+U_BOOT_CMD(
+ switch, 2, 0, switch_cmd,
+ "for bank0/bank4/sd/emmc switch control in runtime",
+ "command (e.g. switch bank4)"
+);
+#endif
diff --git a/board/freescale/t102xrdb/t102xrdb.h b/board/freescale/t102xrdb/t102xrdb.h
new file mode 100644
index 00000000000..33df0f24df8
--- /dev/null
+++ b/board/freescale/t102xrdb/t102xrdb.h
@@ -0,0 +1,15 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __T1024_RDB_H__
+#define __T1024_RDB_H__
+
+void fdt_fixup_board_enet(void *blob);
+void pci_of_setup(void *blob, struct bd_info *bd);
+#ifdef CONFIG_TARGET_T1023RDB
+static u32 t1023rdb_ctrl(u32 ctrl_type);
+static void fdt_enable_nor(void *blob);
+#endif
+#endif
diff --git a/board/freescale/t102xrdb/tlb.c b/board/freescale/t102xrdb/tlb.c
new file mode 100644
index 00000000000..008bd6e72b7
--- /dev/null
+++ b/board/freescale/t102xrdb/tlb.c
@@ -0,0 +1,117 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 256K SRAM, the address of the
+ * SRAM is at 0xfffc0000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_256K, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 5, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_16M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 7, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 8, BOOKE_PAGESZ_16M, 1),
+#endif
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 9, BOOKE_PAGESZ_4M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_64K, 1),
+#endif
+#ifdef CFG_SYS_CPLD_BASE
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 11, BOOKE_PAGESZ_256K, 1),
+#endif
+
+#if defined(CONFIG_RAMBOOT_PBL) && !defined(CONFIG_SPL_BUILD)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 12, BOOKE_PAGESZ_1G, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 13, BOOKE_PAGESZ_1G, 1)
+#endif
+ /* entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so if needed more, will use entry 16 later.
+ */
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/t104xrdb/Kconfig b/board/freescale/t104xrdb/Kconfig
new file mode 100644
index 00000000000..e4814915e33
--- /dev/null
+++ b/board/freescale/t104xrdb/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_T1042D4RDB
+
+config SYS_BOARD
+ default "t104xrdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "T104xRDB"
+
+endif
diff --git a/board/freescale/t104xrdb/MAINTAINERS b/board/freescale/t104xrdb/MAINTAINERS
new file mode 100644
index 00000000000..55fdb600a16
--- /dev/null
+++ b/board/freescale/t104xrdb/MAINTAINERS
@@ -0,0 +1,26 @@
+T104XRDB BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/t104xrdb/
+F: include/configs/T104xRDB.h
+F: configs/T1040RDB_defconfig
+F: configs/T1040RDB_NAND_defconfig
+F: configs/T1040RDB_SPIFLASH_defconfig
+F: configs/T1040D4RDB_defconfig
+F: configs/T1040D4RDB_NAND_defconfig
+F: configs/T1040D4RDB_SPIFLASH_defconfig
+F: configs/T1042RDB_defconfig
+F: configs/T1042D4RDB_defconfig
+F: configs/T1042D4RDB_NAND_defconfig
+F: configs/T1042D4RDB_SPIFLASH_defconfig
+F: configs/T1042RDB_PI_defconfig
+F: configs/T1042RDB_PI_NAND_defconfig
+F: configs/T1042RDB_PI_SPIFLASH_defconfig
+
+T1040RDB_SDCARD BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: configs/T1040RDB_SDCARD_defconfig
+F: configs/T1040D4RDB_SDCARD_defconfig
+F: configs/T1042D4RDB_SDCARD_defconfig
+F: configs/T1042RDB_PI_SDCARD_defconfig
diff --git a/board/freescale/t104xrdb/Makefile b/board/freescale/t104xrdb/Makefile
new file mode 100644
index 00000000000..a9495019430
--- /dev/null
+++ b/board/freescale/t104xrdb/Makefile
@@ -0,0 +1,14 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2013 Freescale Semiconductor, Inc.
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+else
+obj-y += t104xrdb.o
+obj-y += cpld.o
+obj-y += eth.o
+endif
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/t104xrdb/README b/board/freescale/t104xrdb/README
new file mode 100644
index 00000000000..f312e6a3e32
--- /dev/null
+++ b/board/freescale/t104xrdb/README
@@ -0,0 +1,386 @@
+Overview
+--------
+The T1040RDB is a Freescale reference board that hosts the T1040 SoC
+(and variants). Variants inclued T1042 presonality of T1040, in which
+case T1040RDB can also be called T1042RDB.
+
+The T1042RDB is a Freescale reference board that hosts the T1042 SoC
+(and variants). The board is similar to T1040RDB, T1040 is a reduced
+personality of T1040 SoC without Integrated 8-port Gigabit(L2 Switch).
+
+The T1042RDB_PI is a Freescale reference board that hosts the T1042 SoC.
+(a personality of T1040 SoC). The board is similar to T1040RDB but is
+designed specially with low power features targeted for Printing Image Market.
+
+The T1040D4RDB is a Freescale reference board that hosts the T1040 SoC.
+The board is re-designed T1040RDB board with following changes :
+ - Support of DDR4 memory and some enhancements
+
+The T1042D4RDB is a Freescale reference board that hosts the T1042 SoC.
+The board is re-designed T1040RDB board with following changes :
+ - Support of DDR4 memory
+ - Support for 0x86 serdes protocol which can support following interfaces
+ - 2 RGMII's on DTSEC4, DTSEC5
+ - 3 SGMII on DTSEC1, DTSEC2 & DTSEC3
+
+Basic difference's among T1040RDB, T1042RDB_PI, T1042RDB
+-------------------------------------------------------------------------
+Board Si Protocol Targeted Market
+-------------------------------------------------------------------------
+T1040RDB T1040 0x66 Networking
+T1040RDB T1042 0x86 Networking
+T1042RDB_PI T1042 0x06 Printing & Imaging
+T1040D4RDB T1040 0x66 Networking
+T1042D4RDB T1042 0x86 Networking
+
+
+T1040 SoC Overview
+------------------
+The QorIQ T1040/T1042 processor support four integrated 64-bit e5500 PA
+processor cores with high-performance data path acceleration architecture
+and network peripheral interfaces required for networking & telecommunications.
+
+The T1040/T1042 SoC includes the following function and features:
+
+ - Four e5500 cores, each with a private 256 KB L2 cache
+ - 256 KB shared L3 CoreNet platform cache (CPC)
+ - Interconnect CoreNet platform
+ - 32-/64-bit DDR3L/DDR4 SDRAM memory controller with ECC and interleaving
+ support
+ - Data Path Acceleration Architecture (DPAA) incorporating acceleration
+ for the following functions:
+ - Packet parsing, classification, and distribution
+ - Queue management for scheduling, packet sequencing, and congestion
+ management
+ - Cryptography Acceleration (SEC 5.0)
+ - RegEx Pattern Matching Acceleration (PME 2.2)
+ - IEEE Std 1588 support
+ - Hardware buffer management for buffer allocation and deallocation
+ - Ethernet interfaces
+ - Integrated 8-port Gigabit Ethernet switch (T1040 only)
+ - Four 1 Gbps Ethernet controllers
+ - Two RGMII interfaces or one RGMII and one MII interfaces
+ - High speed peripheral interfaces
+ - Four PCI Express 2.0 controllers running at up to 5 GHz
+ - Two SATA controllers supporting 1.5 and 3.0 Gb/s operation
+ - Upto two QSGMII interface
+ - Upto six SGMII interface supporting 1000 Mbps
+ - One SGMII interface supporting upto 2500 Mbps
+ - Additional peripheral interfaces
+ - Two USB 2.0 controllers with integrated PHY
+ - SD/eSDHC/eMMC
+ - eSPI controller
+ - Four I2C controllers
+ - Four UARTs
+ - Four GPIO controllers
+ - Integrated flash controller (IFC)
+ - LCD and HDMI interface (DIU) with 12 bit dual data rate
+ - TDM interface
+ - Multicore programmable interrupt controller (PIC)
+ - Two 8-channel DMA engines
+ - Single source clocking implementation
+ - Deep Sleep power implementaion (wakeup from GPIO/Timer/Ethernet/USB)
+
+T1040 SoC Personalities
+-------------------------
+T1022 Personality:
+T1022 is a reduced personality of T1040 with less core/clusters.
+
+T1042 Personality:
+T1042 is a reduced personality of T1040 without Integrated 8-port Gigabit
+Ethernet switch. Rest of the blocks are same as T1040
+
+
+T1040RDB board Overview
+-------------------------
+ - SERDES Connections, 8 lanes information:
+ 1: None
+ 2: SGMII
+ 3: QSGMII
+ 4: QSGMII
+ 5: PCIe1 x1 slot
+ 6: mini PCIe connector
+ 7: mini PCIe connector
+ 8: SATA connector
+ - DDR Controller
+ - Supports rates of up to 1600 MHz data-rate
+ - Supports one DDR3LP UDIMM/RDIMMs, of single-, dual- or quad-rank types.
+ - IFC/Local Bus
+ - NAND flash: 1GB 8-bit NAND flash
+ - NOR: 128MB 16-bit NOR Flash
+ - Ethernet
+ - Two on-board RGMII 10/100/1G ethernet ports.
+ - CPLD
+ - Clocks
+ - System and DDR clock (SYSCLK, “DDRCLK”)
+ - SERDES clocks
+ - Power Supplies
+ - USB
+ - Supports two USB 2.0 ports with integrated PHYs
+ - Two type A ports with 5V@1.5A per port.
+ - SDHC
+ - SDHC/SDXC connector
+ - SPI
+ - On-board 64MB SPI flash
+ - Other IO
+ - Two Serial ports
+ - Four I2C ports
+
+T1042RDB_PI board Overview
+-------------------------
+ - SERDES Connections, 8 lanes information:
+ 1, 2, 3, 4 : PCIe x4 slot
+ 5: mini PCIe connector
+ 6: mini PCIe connector
+ 7: NA
+ 8: SATA connector
+ - DDR Controller
+ - Supports rates of up to 1600 MHz data-rate
+ - Supports one DDR3LP UDIMM/RDIMMs, of single-, dual- or quad-rank types.
+ - IFC/Local Bus
+ - NAND flash: 1GB 8-bit NAND flash
+ - NOR: 128MB 16-bit NOR Flash
+ - Ethernet
+ - Two on-board RGMII 10/100/1G ethernet ports.
+ - CPLD
+ - Clocks
+ - System and DDR clock (SYSCLK, “DDRCLK”)
+ - SERDES clocks
+ - Video
+ - DIU supports video at up to 1280x1024x32bpp
+ - Power Supplies
+ - USB
+ - Supports two USB 2.0 ports with integrated PHYs
+ - Two type A ports with 5V@1.5A per port.
+ - SDHC
+ - SDHC/SDXC connector
+ - SPI
+ - On-board 64MB SPI flash
+ - Other IO
+ - Two Serial ports
+ - Four I2C ports
+
+Memory map
+-----------
+The addresses in brackets are physical addresses.
+
+Start Address End Address Description Size
+0xF_FFDF_0000 0xF_FFDF_0FFF IFC - CPLD 4KB
+0xF_FF80_0000 0xF_FF80_FFFF IFC - NAND Flash 64KB
+0xF_FE00_0000 0xF_FEFF_FFFF CCSRBAR 16MB
+0xF_F803_0000 0xF_F803_FFFF PCI Express 4 I/O Space 64KB
+0xF_F802_0000 0xF_F802_FFFF PCI Express 3 I/O Space 64KB
+0xF_F801_0000 0xF_F801_FFFF PCI Express 2 I/O Space 64KB
+0xF_F800_0000 0xF_F800_FFFF PCI Express 1 I/O Space 64KB
+0xF_F600_0000 0xF_F7FF_FFFF Queue manager software portal 32MB
+0xF_F400_0000 0xF_F5FF_FFFF Buffer manager software portal 32MB
+0xF_E800_0000 0xF_EFFF_FFFF IFC - NOR Flash 128MB
+0xF_0000_0000 0xF_003F_FFFF DCSR 4MB
+0xC_3000_0000 0xC_3FFF_FFFF PCI Express 4 Mem Space 256MB
+0xC_2000_0000 0xC_2FFF_FFFF PCI Express 3 Mem Space 256MB
+0xC_1000_0000 0xC_1FFF_FFFF PCI Express 2 Mem Space 256MB
+0xC_0000_0000 0xC_0FFF_FFFF PCI Express 1 Mem Space 256MB
+0x0_0000_0000 0x0_ffff_ffff DDR 2GB
+
+
+NOR Flash memory Map
+---------------------
+ Start End Definition Size
+0xEFF40000 0xEFFFFFFF U-Boot (current bank) 768KB
+0xEFF20000 0xEFF3FFFF U-Boot env (current bank) 128KB
+0xEFF00000 0xEFF1FFFF FMAN Ucode (current bank) 128KB
+0xED300000 0xEFEFFFFF rootfs (alt bank) 44MB
+0xEC800000 0xEC8FFFFF Hardware device tree (alt bank) 1MB
+0xEC020000 0xEC7FFFFF Linux.uImage (alt bank) 7MB + 875KB
+0xEC000000 0xEC01FFFF RCW (alt bank) 128KB
+0xEBF40000 0xEBFFFFFF U-Boot (alt bank) 768KB
+0xEBF20000 0xEBF3FFFF U-Boot env (alt bank) 128KB
+0xEBF00000 0xEBF1FFFF FMAN ucode (alt bank) 128KB
+0xE9300000 0xEBEFFFFF rootfs (current bank) 44MB
+0xE8800000 0xE88FFFFF Hardware device tree (cur bank) 11MB + 512KB
+0xE8020000 0xE86FFFFF Linux.uImage (current bank) 7MB + 875KB
+0xE8000000 0xE801FFFF RCW (current bank) 128KB
+
+
+Various Software configurations/environment variables/commands
+--------------------------------------------------------------
+The below commands apply to the board
+
+1. U-Boot environment variable hwconfig
+ The default hwconfig is:
+ hwconfig=fsl_ddr:ctlr_intlv=null,bank_intlv=cs0_cs1;usb1:
+ dr_mode=host,phy_type=utmi
+ Note: For USB gadget set "dr_mode=peripheral"
+
+2. FMAN Ucode versions
+ fsl_fman_ucode_t1040.bin
+
+3. Switching to alternate bank
+ Commands for switching to alternate bank.
+
+ 1. To change from vbank0 to vbank4
+ => cpld reset altbank (it will boot using vbank4)
+
+ 2.To change from vbank4 to vbank0
+ => cpld reset (it will boot using vbank0)
+
+NAND boot with 2 Stage boot loader
+----------------------------------
+PBL initialise the internal SRAM and copy SPL(160KB) in SRAM.
+SPL further initialise DDR using SPD and environment variables and copy
+U-Boot(768 KB) from flash to DDR.
+Finally SPL transer control to U-Boot for futher booting.
+
+SPL has following features:
+ - Executes within 256K
+ - No relocation required
+
+ Run time view of SPL framework during boot :-
+ -----------------------------------------------
+ Area | Address |
+-----------------------------------------------
+ Secure boot | 0xFFFC0000 (32KB) |
+ headers | |
+ -----------------------------------------------
+ GD, BD | 0xFFFC8000 (4KB) |
+ -----------------------------------------------
+ ENV | 0xFFFC9000 (8KB) |
+ -----------------------------------------------
+ HEAP | 0xFFFCB000 (30KB) |
+ -----------------------------------------------
+ STACK | 0xFFFD8000 (22KB) |
+ -----------------------------------------------
+ U-Boot SPL | 0xFFFD8000 (160KB) |
+ -----------------------------------------------
+
+NAND Flash memory Map on T104xRDB
+------------------------------------------
+ Start End Definition Size
+0x000000 0x0FFFFF U-Boot 1MB
+0x180000 0x19FFFF U-Boot env 128KB
+0x280000 0x29FFFF FMAN Ucode 128KB
+0x380000 0x39FFFF QE Firmware 128KB
+
+SD Card memory Map on T104xRDB
+------------------------------------------
+ Block #blocks Definition Size
+0x008 2048 U-Boot 1MB
+0x800 0024 U-Boot env 8KB
+0x820 0256 FMAN Ucode 128KB
+0x920 0256 QE Firmware 128KB
+
+SPI Flash memory Map on T104xRDB
+------------------------------------------
+ Start End Definition Size
+0x000000 0x0FFFFF U-Boot 1MB
+0x100000 0x101FFF U-Boot env 8KB
+0x110000 0x12FFFF FMAN Ucode 128KB
+0x130000 0x14FFFF QE Firmware 128KB
+
+Please note QE Firmware is only valid for T1040RDB
+
+
+Switch Settings for T104xRDB boards: (ON is 0, OFF is 1)
+==========================================================
+NOR boot SW setting:
+SW1: 00010011
+SW2: 10111011
+SW3: 11100001
+
+NAND boot SW setting:
+SW1: 10001000
+SW2: 00111011
+SW3: 11110001
+
+SPI boot SW setting:
+SW1: 00100010
+SW2: 10111011
+SW3: 11100001
+
+SD boot SW setting:
+SW1: 00100000
+SW2: 00111011
+SW3: 11100001
+
+Switch Settings for T104xD4RDB boards: (ON is 0, OFF is 1)
+=============================================================
+NOR boot SW setting:
+SW1: 00010011
+SW2: 10111001
+SW3: 11100001
+
+NAND boot SW setting:
+SW1: 10001000
+SW2: 00111001
+SW3: 11110001
+
+SPI boot SW setting:
+SW1: 00100010
+SW2: 10111001
+SW3: 11100001
+
+SD boot SW setting:
+SW1: 00100000
+SW2: 00111001
+SW3: 11100001
+
+PBL-based image generation
+==========================
+Changes only the required register bit in in PBI commands.
+
+Provides reference code which might needs some
+modification as per requirement.
+example:
+By default PBI_SRC=14 (which is for IFC-NAND/NOR) in rcw.cfg file
+which needs to be changed for SPI and SD.
+
+For SD-boot
+==============
+1. Set RCW[192:195], PBI_SRC bits as 6 in RCW file (t1040d4_rcw.cfg type files)
+
+example:
+ RCW file: board/freescale/t104xrdb/t1040d4_rcw.cfg
+
+Change
+66000002 40000002 ec027000 01000000
+to
+66000002 40000002 6c027000 01000000
+
+2. SD does not support flush so remove flush from pbl, make changes in
+ tools/pblimage.c file, Update value of pbl_end_cmd[0] = 0x09138000
+ with 0x091380c0
+
+For SPI-boot
+==============
+1. Set RCW[192:195], PBI_SRC bits as 5 in RCW file (t1040d4_rcw.cfg type files)
+
+example:
+ RCW file: board/freescale/t104xrdb/t1040d4_rcw.cfg
+
+Change
+66000002 40000002 ec027000 01000000
+to
+66000002 40000002 5c027000 01000000
+
+2. SPI does not support flush so remove flush from pbl, make changes in
+ tools/pblimage.c file, Update value of pbl_end_cmd[0] = 0x09138000
+ with 0x091380c0
+
+Device tree support and how to enable it for different configs
+--------------------------------------------------------------
+Device tree support is available for t1042d4rdb for below mentioned boot,
+1. NOR Boot
+2. NAND Boot
+3. SD Boot
+4. SPIFLASH Boot
+
+To enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. CONFIG_DEFAULT_DEVICE_TREE="t1042d4rdb" (Change default device tree name if required)
+2. CONFIG_OF_CONTROL
+3. CONFIG_MPC85XX_HAVE_RESET_VECTOR if reset vector is located at
+ CFG_RESET_VECTOR_ADDRESS - 0xffc
+
+If device tree support is enabled in defconfig,
+1. use 'u-boot.bin' for NOR boot.
+2. use 'u-boot-with-spl-pbl.bin' for other boot.
diff --git a/board/freescale/t104xrdb/cpld.c b/board/freescale/t104xrdb/cpld.c
new file mode 100644
index 00000000000..c2d526ae15a
--- /dev/null
+++ b/board/freescale/t104xrdb/cpld.c
@@ -0,0 +1,115 @@
+// SPDX-License-Identifier: GPL-2.0+
+/**
+ * Copyright 2014 Freescale Semiconductor
+ *
+ * This file provides support for the board-specific CPLD used on some Freescale
+ * reference boards.
+ *
+ * The following macros need to be defined:
+ *
+ * CFG_SYS_CPLD_BASE-The virtual address of the base of the CPLD register map
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/**
+ * Set the boot bank to the alternate bank
+ */
+void cpld_set_altbank(void)
+{
+ u8 reg = CPLD_READ(flash_ctl_status);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_ALTBANK;
+
+ CPLD_WRITE(flash_ctl_status, reg);
+ CPLD_WRITE(reset_ctl1, CPLD_LBMAP_RESET);
+}
+
+/**
+ * Set the boot bank to the default bank
+ */
+void cpld_set_defbank(void)
+{
+ u8 reg = CPLD_READ(flash_ctl_status);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_DFLTBANK;
+
+ CPLD_WRITE(flash_ctl_status, reg);
+ CPLD_WRITE(reset_ctl1, CPLD_LBMAP_RESET);
+}
+
+#ifdef DEBUG
+static void cpld_dump_regs(void)
+{
+ printf("cpld_ver = 0x%02x\n", CPLD_READ(cpld_ver));
+ printf("cpld_ver_sub = 0x%02x\n", CPLD_READ(cpld_ver_sub));
+ printf("hw_ver = 0x%02x\n", CPLD_READ(hw_ver));
+ printf("sw_ver = 0x%02x\n", CPLD_READ(sw_ver));
+ printf("reset_ctl1 = 0x%02x\n", CPLD_READ(reset_ctl1));
+ printf("reset_ctl2 = 0x%02x\n", CPLD_READ(reset_ctl2));
+ printf("int_status = 0x%02x\n", CPLD_READ(int_status));
+ printf("flash_ctl_status = 0x%02x\n", CPLD_READ(flash_ctl_status));
+ printf("fan_ctl_status = 0x%02x\n", CPLD_READ(fan_ctl_status));
+#if defined(CONFIG_TARGET_T1040D4D4RDB) || defined(CONFIG_TARGET_T1042D4RDB)
+ printf("int_mask = 0x%02x\n", CPLD_READ(int_mask));
+#else
+ printf("led_ctl_status = 0x%02x\n", CPLD_READ(led_ctl_status));
+#endif
+ printf("sfp_ctl_status = 0x%02x\n", CPLD_READ(sfp_ctl_status));
+ printf("misc_ctl_status = 0x%02x\n", CPLD_READ(misc_ctl_status));
+ printf("boot_override = 0x%02x\n", CPLD_READ(boot_override));
+ printf("boot_config1 = 0x%02x\n", CPLD_READ(boot_config1));
+ printf("boot_config2 = 0x%02x\n", CPLD_READ(boot_config2));
+ putc('\n');
+}
+#endif
+
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else
+ cpld_set_defbank();
+#ifdef DEBUG
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+#endif
+ } else
+ rc = cmd_usage(cmdtp);
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset - hard reset to default bank\n"
+ "cpld reset altbank - reset to alternate bank\n"
+#ifdef DEBUG
+ "cpld dump - display the CPLD registers\n"
+#endif
+ );
diff --git a/board/freescale/t104xrdb/cpld.h b/board/freescale/t104xrdb/cpld.h
new file mode 100644
index 00000000000..0384202fbcb
--- /dev/null
+++ b/board/freescale/t104xrdb/cpld.h
@@ -0,0 +1,45 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/**
+ * Copyright 2013 Freescale Semiconductor
+ *
+ * This file provides support for the ngPIXIS, a board-specific FPGA used on
+ * some Freescale reference boards.
+ */
+
+/*
+ * CPLD register set. Feel free to add board-specific #ifdefs where necessary.
+ */
+struct cpld_data {
+ u8 cpld_ver; /* 0x00 - CPLD Major Revision Register */
+ u8 cpld_ver_sub; /* 0x01 - CPLD Minor Revision Register */
+ u8 hw_ver; /* 0x02 - Hardware Revision Register */
+ u8 sw_ver; /* 0x03 - Software Revision register */
+ u8 res0[12]; /* 0x04 - 0x0F - not used */
+ u8 reset_ctl1; /* 0x10 - Reset control Register1 */
+ u8 reset_ctl2; /* 0x11 - Reset control Register2 */
+ u8 int_status; /* 0x12 - Interrupt status Register */
+ u8 flash_ctl_status; /* 0x13 - Flash control and status register */
+ u8 fan_ctl_status; /* 0x14 - Fan control and status register */
+#if defined(CONFIG_TARGET_T1042D4RDB)
+ u8 int_mask; /* 0x15 - Interrupt mask Register */
+#else
+ u8 led_ctl_status; /* 0x15 - LED control and status register */
+#endif
+ u8 sfp_ctl_status; /* 0x16 - SFP control and status register */
+ u8 misc_ctl_status; /* 0x17 - Miscellanies ctrl & status register*/
+ u8 boot_override; /* 0x18 - Boot override register */
+ u8 boot_config1; /* 0x19 - Boot config override register*/
+ u8 boot_config2; /* 0x1A - Boot config override register*/
+};
+
+/* Pointer to the CPLD register set */
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value)\
+ cpld_write(offsetof(struct cpld_data, reg), value)
+#define MISC_CTL_SG_SEL 0x80
+#define MISC_CTL_AURORA_SEL 0x02
+#define MISC_MUX_QE_TDM 0xc0
diff --git a/board/freescale/t104xrdb/ddr.c b/board/freescale/t104xrdb/ddr.c
new file mode 100644
index 00000000000..bab684860da
--- /dev/null
+++ b/board/freescale/t104xrdb/ddr.c
@@ -0,0 +1,148 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#include <config.h>
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+#include <asm/mpc85xx_gpio.h>
+#include <linux/delay.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks &&
+ (pdimm->rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found\n");
+ printf("for data rate %lu MT/s\n", ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, "
+ "wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+#ifdef CONFIG_SYS_FSL_DDR4
+ popts->half_strength_driver_enable = 1;
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x59;
+#else
+ popts->cpo_sample = 0x54;
+ popts->half_strength_driver_enable = 0;
+#endif
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * rtt and rtt_wr override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+#ifdef CONFIG_SYS_FSL_DDR4
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_120OHM);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_120OHM) |
+ DDR_CDR2_VREF_OVRD(70); /* Vref = 70% */
+#else
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+#endif
+}
+
+#if defined(CONFIG_DEEP_SLEEP)
+void board_mem_sleep_setup(void)
+{
+ void __iomem *cpld_base = (void *)CFG_SYS_CPLD_BASE;
+
+ /* does not provide HW signals for power management */
+ clrbits_8(cpld_base + 0x17, 0x40);
+ /* Disable MCKE isolation */
+ gpio_set_value(2, 0);
+ udelay(1);
+}
+#endif
+
+int dram_init(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_RAMBOOT_PBL)
+ puts("Initializing....using SPD\n");
+ dram_size = fsl_ddr_sdram();
+#else
+ dram_size = fsl_ddr_sdram_size();
+#endif
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+#if defined(CONFIG_DEEP_SLEEP) && !defined(CONFIG_SPL_BUILD)
+ fsl_dp_resume();
+#endif
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/t104xrdb/ddr.h b/board/freescale/t104xrdb/ddr.h
new file mode 100644
index 00000000000..f9d667f6174
--- /dev/null
+++ b/board/freescale/t104xrdb/ddr.h
@@ -0,0 +1,56 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2
+ */
+#ifdef CONFIG_SYS_FSL_DDR4
+ {2, 1600, 4, 8, 6, 0x07090A0c, 0x0e0f100a},
+ {1, 1600, 4, 8, 5, 0x0607080B, 0x0C0C0D09},
+#elif defined(CONFIG_SYS_FSL_DDR3)
+ {2, 833, 4, 8, 6, 0x06060607, 0x08080807},
+ {2, 833, 0, 8, 6, 0x06060607, 0x08080807},
+ {2, 1350, 4, 8, 7, 0x0708080A, 0x0A0B0C09},
+ {2, 1350, 0, 8, 7, 0x0708080A, 0x0A0B0C09},
+ {2, 1666, 4, 8, 7, 0x0808090B, 0x0C0D0E0A},
+ {2, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A},
+ {1, 833, 4, 8, 6, 0x06060607, 0x08080807},
+ {1, 833, 0, 8, 6, 0x06060607, 0x08080807},
+ {1, 1350, 4, 8, 7, 0x0708080A, 0x0A0B0C09},
+ {1, 1350, 0, 8, 7, 0x0708080A, 0x0A0B0C09},
+ {1, 1666, 4, 8, 7, 0x0808090B, 0x0C0D0E0A},
+ {1, 1666, 0, 8, 7, 0x0808090B, 0x0C0D0E0A},
+#else
+#error DDR type not defined
+#endif
+ {}
+};
+
+#endif
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
diff --git a/board/freescale/t104xrdb/eth.c b/board/freescale/t104xrdb/eth.c
new file mode 100644
index 00000000000..d5c084e319d
--- /dev/null
+++ b/board/freescale/t104xrdb/eth.c
@@ -0,0 +1,92 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/fsl_serdes.h>
+#include <asm/immap_85xx.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <malloc.h>
+#include <fsl_dtsec.h>
+#include <vsc9953.h>
+
+#include "../common/fman.h"
+
+int board_eth_init(struct bd_info *bis)
+{
+#ifdef CONFIG_FMAN_ENET
+ struct memac_mdio_info memac_mdio_info;
+ unsigned int i;
+ int phy_addr = 0;
+
+ printf("Initializing Fman\n");
+
+ memac_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+ memac_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the real 1G MDIO bus */
+ fm_memac_mdio_init(bis, &memac_mdio_info);
+
+ /*
+ * Program on board RGMII, SGMII PHY addresses.
+ */
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ int idx = i - FM1_DTSEC1;
+
+ switch (fm_info_get_enet_if(i)) {
+#ifdef CONFIG_TARGET_T1042D4RDB
+ case PHY_INTERFACE_MODE_SGMII:
+ /* T1042D4RDB supports SGMII on DTSEC1, DTSEC2
+ * & DTSEC3
+ */
+ if (FM1_DTSEC1 == i)
+ phy_addr = CFG_SYS_SGMII1_PHY_ADDR;
+ if (FM1_DTSEC2 == i)
+ phy_addr = CFG_SYS_SGMII2_PHY_ADDR;
+ if (FM1_DTSEC3 == i)
+ phy_addr = CFG_SYS_SGMII3_PHY_ADDR;
+ fm_info_set_phy_address(i, phy_addr);
+ break;
+#endif
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ if (FM1_DTSEC4 == i)
+ phy_addr = CFG_SYS_RGMII1_PHY_ADDR;
+ if (FM1_DTSEC5 == i)
+ phy_addr = CFG_SYS_RGMII2_PHY_ADDR;
+ fm_info_set_phy_address(i, phy_addr);
+ break;
+ case PHY_INTERFACE_MODE_QSGMII:
+ fm_info_set_phy_address(i, 0);
+ break;
+ case PHY_INTERFACE_MODE_NA:
+ fm_info_set_phy_address(i, 0);
+ break;
+ default:
+ printf("Fman1: DTSEC%u set to unknown interface %i\n",
+ idx + 1, fm_info_get_enet_if(i));
+ fm_info_set_phy_address(i, 0);
+ break;
+ }
+ if (fm_info_get_enet_if(i) == PHY_INTERFACE_MODE_QSGMII ||
+ fm_info_get_enet_if(i) == PHY_INTERFACE_MODE_NA)
+ fm_info_set_mdio(i, NULL);
+ else
+ fm_info_set_mdio(i,
+ miiphy_get_dev_by_name(
+ DEFAULT_FM_MDIO_NAME));
+ }
+
+
+ cpu_eth_init(bis);
+#endif
+
+ return pci_eth_init(bis);
+}
diff --git a/board/freescale/t104xrdb/law.c b/board/freescale/t104xrdb/law.c
new file mode 100644
index 00000000000..d34641c2397
--- /dev/null
+++ b/board/freescale/t104xrdb/law.c
@@ -0,0 +1,31 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+#ifdef CONFIG_MTD_NOR_FLASH
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef CFG_SYS_CPLD_BASE_PHYS
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_128K, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_4M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_64K, LAW_TRGT_IF_IFC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/t104xrdb/spl.c b/board/freescale/t104xrdb/spl.c
new file mode 100644
index 00000000000..e02a1f95d4c
--- /dev/null
+++ b/board/freescale/t104xrdb/spl.c
@@ -0,0 +1,131 @@
+// SPDX-License-Identifier: GPL-2.0+
+/* Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env_internal.h>
+#include <init.h>
+#include <malloc.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <i2c.h>
+#include <mmc.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/sleep.h"
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L3_SIZE;
+}
+
+#define FSL_CORENET_CCSR_PORSR1_RCW_MASK 0xFF800000
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, sys_clk, uart_clk;
+#if defined(CONFIG_SPL_NAND_BOOT) && defined(CONFIG_A008044_WORKAROUND)
+ u32 porsr1, pinctl;
+ u32 svr = get_svr();
+#endif
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+#if defined(CONFIG_SPL_NAND_BOOT) && defined(CONFIG_A008044_WORKAROUND)
+ if (IS_SVR_REV(svr, 1, 0)) {
+ /*
+ * There is T1040 SoC issue where NOR, FPGA are inaccessible
+ * during NAND boot because IFC signals > IFC_AD7 are not
+ * enabled. This workaround changes RCW source to make all
+ * signals enabled.
+ */
+ porsr1 = in_be32(&gur->porsr1);
+ pinctl = ((porsr1 & ~(FSL_CORENET_CCSR_PORSR1_RCW_MASK))
+ | 0x24800000);
+ out_be32((unsigned int *)(CFG_SYS_DCSRBAR + 0x20000),
+ pinctl);
+ }
+#endif
+
+ /* Memcpy existing GD at CONFIG_SPL_GD_ADDR */
+ memcpy((void *)CONFIG_SPL_GD_ADDR, (void *)gd, sizeof(gd_t));
+
+ /* Update GD pointer */
+ gd = (gd_t *)(CONFIG_SPL_GD_ADDR);
+
+#ifdef CONFIG_DEEP_SLEEP
+ /* disable the console if boot from deep sleep */
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+ /* compiler optimization barrier needed for GCC >= 3.4 */
+ __asm__ __volatile__("" : : : "memory");
+
+ console_init_f();
+
+ /* initialize selected port with appropriate baud rate */
+ sys_clk = get_board_sys_clk();
+ plat_ratio = (in_be32(&gur->rcwsr[0]) >> 25) & 0x1f;
+ uart_clk = sys_clk * plat_ratio / 2;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ uart_clk / 16 / CONFIG_BAUDRATE);
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, (gd_t *)CONFIG_SPL_GD_ADDR, 0x0);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ struct bd_info *bd;
+
+ bd = (struct bd_info *)(gd + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_SPL_RELOC_MALLOC_ADDR,
+ CONFIG_SPL_RELOC_MALLOC_SIZE);
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+#endif
+
+ /* relocate environment function pointers etc. */
+#if defined(CONFIG_ENV_IS_IN_NAND) || defined(CONFIG_ENV_IS_IN_MMC) || \
+ defined(CONFIG_ENV_IS_IN_SPI_FLASH)
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_SPI_BOOT
+ fsl_spi_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+#endif
+
+ i2c_init_all();
+
+ puts("\n\n");
+
+ dram_init();
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/t104xrdb/t1040_nand_rcw.cfg b/board/freescale/t104xrdb/t1040_nand_rcw.cfg
new file mode 100644
index 00000000000..3300c184a1a
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040_nand_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 80000002 e8106000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1040_sd_rcw.cfg b/board/freescale/t104xrdb/t1040_sd_rcw.cfg
new file mode 100644
index 00000000000..fd3e8c5bbf5
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 80000002 68106000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1040_spi_rcw.cfg b/board/freescale/t104xrdb/t1040_spi_rcw.cfg
new file mode 100644
index 00000000000..fccde5e01fe
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040_spi_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 80000002 58106000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1040d4_nand_rcw.cfg b/board/freescale/t104xrdb/t1040d4_nand_rcw.cfg
new file mode 100644
index 00000000000..c1034b3dfa3
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040d4_nand_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 40000002 ec027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342580f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1040d4_sd_rcw.cfg b/board/freescale/t104xrdb/t1040d4_sd_rcw.cfg
new file mode 100644
index 00000000000..e6f7585bb02
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040d4_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 40000002 6c027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342580f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1040d4_spi_rcw.cfg b/board/freescale/t104xrdb/t1040d4_spi_rcw.cfg
new file mode 100644
index 00000000000..cde862dff5c
--- /dev/null
+++ b/board/freescale/t104xrdb/t1040d4_spi_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x66
+0c18000e 0e000000 00000000 00000000
+66000002 40000002 5c027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342580f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_nand_rcw.cfg b/board/freescale/t104xrdb/t1042_nand_rcw.cfg
new file mode 100644
index 00000000000..db4d52f397d
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_nand_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 80000002 ec027000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_pi_nand_rcw.cfg b/board/freescale/t104xrdb/t1042_pi_nand_rcw.cfg
new file mode 100644
index 00000000000..57de89ad0e7
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_pi_nand_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x06
+0c18000e 0e000000 00000000 00000000
+06000002 00400002 e8106000 01000000
+00000000 00000000 00000000 00030810
+00000000 01fe0a06 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_pi_sd_rcw.cfg b/board/freescale/t104xrdb/t1042_pi_sd_rcw.cfg
new file mode 100644
index 00000000000..bbce9a36930
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_pi_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x06
+0c18000e 0e000000 00000000 00000000
+06000002 00400002 68106000 01000000
+00000000 00000000 00000000 00030810
+00000000 01fe0a06 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_pi_spi_rcw.cfg b/board/freescale/t104xrdb/t1042_pi_spi_rcw.cfg
new file mode 100644
index 00000000000..b1d8b4c65af
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_pi_spi_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x06
+0c18000e 0e000000 00000000 00000000
+06000002 00400002 58106000 01000000
+00000000 00000000 00000000 00030810
+00000000 01fe0a06 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_sd_rcw.cfg b/board/freescale/t104xrdb/t1042_sd_rcw.cfg
new file mode 100644
index 00000000000..d77bf189b22
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 80000002 6c027000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042_spi_rcw.cfg b/board/freescale/t104xrdb/t1042_spi_rcw.cfg
new file mode 100644
index 00000000000..e8a3ad12804
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042_spi_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 80000002 5c027000 01000000
+00000000 00000000 00000000 00032810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042d4_nand_rcw.cfg b/board/freescale/t104xrdb/t1042d4_nand_rcw.cfg
new file mode 100644
index 00000000000..9e0ee2795f8
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042d4_nand_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 40000002 ec027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042d4_sd_rcw.cfg b/board/freescale/t104xrdb/t1042d4_sd_rcw.cfg
new file mode 100644
index 00000000000..9d9046d6549
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042d4_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 40000002 6c027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t1042d4_spi_rcw.cfg b/board/freescale/t104xrdb/t1042d4_spi_rcw.cfg
new file mode 100644
index 00000000000..f1ec98932f8
--- /dev/null
+++ b/board/freescale/t104xrdb/t1042d4_spi_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+# serdes protocol 0x86
+0c18000e 0e000000 00000000 00000000
+86000002 40000002 5c027000 01000000
+00000000 00000000 00000000 00030810
+00000000 0342500f 00000000 00000000
diff --git a/board/freescale/t104xrdb/t104x_pbi.cfg b/board/freescale/t104xrdb/t104x_pbi.cfg
new file mode 100644
index 00000000000..51945b47489
--- /dev/null
+++ b/board/freescale/t104xrdb/t104x_pbi.cfg
@@ -0,0 +1,36 @@
+#PBI commands
+#Software Workaround for errata A-007662 to train PCIe2 controller in Gen2 speed
+09250100 00000400
+09250108 00002000
+#Software Workaround for errata A-008007 to reset PVR register
+09000010 0000000b
+09000014 c0000000
+09000018 81d00017
+89020400 a1000000
+091380c0 000f0000
+89020400 00000000
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#Configure CPC1 as 256KB SRAM
+09010100 00000000
+09010104 fffc0007
+09010f00 081e000d
+09010000 80000000
+#Configure LAW for CPC1
+09000cd0 00000000
+09000cd4 fffc0000
+09000cd8 81000011
+#Configure alternate space
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Configure SPI controller
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Flush PBL data
+091380c0 000FFFFF
diff --git a/board/freescale/t104xrdb/t104x_pbi_sb.cfg b/board/freescale/t104xrdb/t104x_pbi_sb.cfg
new file mode 100644
index 00000000000..98dc8e4c240
--- /dev/null
+++ b/board/freescale/t104xrdb/t104x_pbi_sb.cfg
@@ -0,0 +1,38 @@
+#PBI commands
+#Software Workaround for errata A-007662 to train PCIe2 controller in Gen2 speed
+09250100 00000400
+09250108 00002000
+#Software Workaround for errata A-008007 to reset PVR register
+09000010 0000000b
+09000014 c0000000
+09000018 81d00017
+89020400 a1000000
+091380c0 000f0000
+89020400 00000000
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#Configure CPC1 as 256KB SRAM
+09010100 00000000
+09010104 bffc0007
+09010f00 081e000d
+09010000 80000000
+#Configure LAW for CPC1
+09000cd0 00000000
+09000cd4 bffc0000
+09000cd8 81000011
+#Configure alternate space
+09000010 00000000
+09000014 bf000000
+09000018 81000000
+#Configure SPI controller
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Flush PBL data
+091380c0 000FFFFF
+090e0200 bffd0000
+091380c0 000FFFFF
diff --git a/board/freescale/t104xrdb/t104xrdb.c b/board/freescale/t104xrdb/t104xrdb.c
new file mode 100644
index 00000000000..ef4dfef4965
--- /dev/null
+++ b/board/freescale/t104xrdb/t104xrdb.c
@@ -0,0 +1,159 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ * Copyright 2023 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <hwconfig.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_fdt.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <clock_legacy.h>
+#include <fm_eth.h>
+#include "../common/sleep.h"
+#include "t104xrdb.h"
+#include "cpld.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if CONFIG_IS_ENABLED(DM_SERIAL)
+int get_serial_clock(void)
+{
+ return get_bus_freq(0) / 2;
+}
+#endif
+
+int checkboard(void)
+{
+ struct cpu_type *cpu = gd->arch.cpu;
+ u8 sw;
+
+#if defined(CONFIG_TARGET_T1042D4RDB)
+ printf("Board: %sD4RDB\n", cpu->name);
+#else
+ printf("Board: %sRDB\n", cpu->name);
+#endif
+ printf("Board rev: 0x%02x CPLD ver: 0x%02x, ",
+ CPLD_READ(hw_ver), CPLD_READ(sw_ver));
+
+ sw = CPLD_READ(flash_ctl_status);
+ sw = ((sw & CPLD_LBMAP_MASK) >> CPLD_LBMAP_SHIFT);
+
+ printf("vBank: %d\n", sw);
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+#if defined(CONFIG_DEEP_SLEEP)
+ if (is_warm_boot())
+ fsl_dp_disable_console();
+#endif
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+#ifdef CFG_SYS_FLASH_BASE
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+
+ /*
+ * Remap Boot flash region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+#endif
+
+ pci_init();
+
+ return 0;
+}
+
+int misc_init_r(void)
+{
+ ccsr_gur_t __iomem *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) >> 24;
+
+ printf("SERDES Reference : 0x%X\n", srds_s1);
+
+ /* select SGMII*/
+ if (srds_s1 == 0x86)
+ CPLD_WRITE(misc_ctl_status, CPLD_READ(misc_ctl_status) |
+ MISC_CTL_SG_SEL);
+
+ /* select SGMII and Aurora*/
+ if (srds_s1 == 0x8E)
+ CPLD_WRITE(misc_ctl_status, CPLD_READ(misc_ctl_status) |
+ MISC_CTL_SG_SEL | MISC_CTL_AURORA_SEL);
+
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+
+#ifdef CONFIG_HAS_FSL_DR_USB
+ fsl_fdt_fixup_dr_usb(blob, bd);
+#endif
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+#endif
+
+ if (hwconfig("qe-tdm"))
+ fdt_del_diu(blob);
+ return 0;
+}
diff --git a/board/freescale/t104xrdb/t104xrdb.h b/board/freescale/t104xrdb/t104xrdb.h
new file mode 100644
index 00000000000..678724c7e2b
--- /dev/null
+++ b/board/freescale/t104xrdb/t104xrdb.h
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __T104x_RDB_H__
+#define __T104x_RDB_H__
+
+void fdt_fixup_board_enet(void *blob);
+void pci_of_setup(void *blob, struct bd_info *bd);
+
+#endif
diff --git a/board/freescale/t104xrdb/tlb.c b/board/freescale/t104xrdb/tlb.c
new file mode 100644
index 00000000000..24bc83f756b
--- /dev/null
+++ b/board/freescale/t104xrdb/tlb.c
@@ -0,0 +1,132 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR) && \
+ !defined(CONFIG_NXP_ESBC)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 256K SRAM, the address of the
+ * SRAM is at 0xfffc0000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_256K, 1),
+
+#elif defined(CONFIG_NXP_ESBC) && defined(CONFIG_SPL_BUILD)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 256K SRAM, in case of Secure Boot
+ * the physical address of the SRAM is at 0xbffc0000,
+ * and virtual address is 0xfffc0000
+ */
+
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_VADDR,
+ CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_256K, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 5, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_16M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 7, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 8, BOOKE_PAGESZ_16M, 1),
+#endif
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 9, BOOKE_PAGESZ_4M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ /*
+ * *I*G - NAND
+ * entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so we use entry 16 for nand.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_64K, 1),
+#endif
+#ifdef CFG_SYS_CPLD_BASE
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 11, BOOKE_PAGESZ_256K, 1),
+#endif
+
+#if defined(CONFIG_RAMBOOT_PBL) && !defined(CONFIG_SPL_BUILD)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 12, BOOKE_PAGESZ_1G, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ CFG_SYS_DDR_SDRAM_BASE + 0x40000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 13, BOOKE_PAGESZ_1G, 1)
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/t208xqds/Kconfig b/board/freescale/t208xqds/Kconfig
new file mode 100644
index 00000000000..c419a59dbb6
--- /dev/null
+++ b/board/freescale/t208xqds/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_T2080QDS
+
+config SYS_BOARD
+ default "t208xqds"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "T208xQDS"
+
+config SRIO_PCIE_BOOT_SLAVE
+ bool "Boot as a SRIO PCIe slave device"
+
+endif
diff --git a/board/freescale/t208xqds/MAINTAINERS b/board/freescale/t208xqds/MAINTAINERS
new file mode 100644
index 00000000000..790b009c516
--- /dev/null
+++ b/board/freescale/t208xqds/MAINTAINERS
@@ -0,0 +1,20 @@
+T208XQDS BOARD
+M: Shengzhou Liu <Shengzhou.Liu@nxp.com>
+S: Maintained
+F: board/freescale/t208xqds/
+F: include/configs/T208xQDS.h
+F: configs/T2080QDS_defconfig
+F: configs/T2080QDS_NAND_defconfig
+F: configs/T2080QDS_SDCARD_defconfig
+F: configs/T2080QDS_SPIFLASH_defconfig
+F: configs/T2080QDS_SRIO_PCIE_BOOT_defconfig
+F: configs/T2081QDS_defconfig
+F: configs/T2081QDS_NAND_defconfig
+F: configs/T2081QDS_SDCARD_defconfig
+F: configs/T2081QDS_SPIFLASH_defconfig
+F: configs/T2081QDS_SRIO_PCIE_BOOT_defconfig
+
+T2080QDS_SECURE_BOOT BOARD
+M: Ruchika Gupta <ruchika.gupta@nxp.com>
+S: Maintained
+F: configs/T2080QDS_SECURE_BOOT_defconfig
diff --git a/board/freescale/t208xqds/Makefile b/board/freescale/t208xqds/Makefile
new file mode 100644
index 00000000000..de8613058de
--- /dev/null
+++ b/board/freescale/t208xqds/Makefile
@@ -0,0 +1,15 @@
+#
+# Copyright 2013 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+else
+obj-$(CONFIG_TARGET_T2080QDS) += t208xqds.o eth_t208xqds.o
+endif
+
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/t208xqds/README b/board/freescale/t208xqds/README
new file mode 100755
index 00000000000..0d80c6901fb
--- /dev/null
+++ b/board/freescale/t208xqds/README
@@ -0,0 +1,292 @@
+The T2080QDS is a high-performance computing evaluation, development and
+test platform supporting the T2080 QorIQ Power Architecture processor.
+
+T2080 SoC Overview
+------------------
+The T2080 QorIQ multicore processor combines four dual-threaded e6500 Power
+Architecture processor cores with high-performance datapath acceleration
+logic and network and peripheral bus interfaces required for networking,
+telecom/datacom, wireless infrastructure, and mil/aerospace applications.
+
+T2080 includes the following functions and features:
+ - Four dual-threads 64-bit Power architecture e6500 cores, up to 1.8GHz
+ - 2MB L2 cache and 512KB CoreNet platform cache (CPC)
+ - Hierarchical interconnect fabric
+ - One 32-/64-bit DDR3/3L SDRAM memory controllers with ECC and interleaving
+ - Data Path Acceleration Architecture (DPAA) incorporating acceleration
+ - 16 SerDes lanes up to 10.3125 GHz
+ - 8 Ethernet interfaces, supporting combinations of the following:
+ - Up to four 10 Gbps Ethernet MACs
+ - Up to eight 1 Gbps Ethernet MACs
+ - Up to four 2.5 Gbps Ethernet MACs
+ - High-speed peripheral interfaces
+ - Four PCI Express controllers (two PCIe 2.0 and two PCIe 3.0 with SR-IOV)
+ - Two Serial RapidIO 2.0 controllers/ports running at up to 5 GHz
+ - Additional peripheral interfaces
+ - Two serial ATA (SATA 2.0) controllers
+ - Two high-speed USB 2.0 controllers with integrated PHY
+ - Enhanced secure digital host controller (SD/SDHC/SDXC/eMMC)
+ - Enhanced serial peripheral interface (eSPI)
+ - Four I2C controllers
+ - Four 2-pin UARTs or two 4-pin UARTs
+ - Integrated Flash Controller supporting NAND and NOR flash
+ - Three eight-channel DMA engines
+ - Support for hardware virtualization and partitioning enforcement
+ - QorIQ Platform's Trust Architecture 2.0
+
+Differences between T2080 and T2081
+-----------------------------------
+ Feature T2080 T2081
+ 1G Ethernet numbers: 8 6
+ 10G Ethernet numbers: 4 2
+ SerDes lanes: 16 8
+ Serial RapidIO,RMan: 2 no
+ SATA Controller: 2 no
+ Aurora: yes no
+ SoC Package: 896-pins 780-pins
+
+
+T2080QDS feature overview
+-------------------------
+Processor:
+ - T2080 SoC integrating four 64-bit dual-threads e6500 cores up to 1.8GHz
+Memory:
+ - Single memory controller capable of supporting DDR3 and DDR3-LV devices
+ - Two DDR3 DIMMs up to 4GB, Dual rank @ 2133MT/s and ECC support
+Ethernet interfaces:
+ - Two 1Gbps RGMII on-board ports
+ - Four 10GBase-R on-board cages
+ - 1Gbps/2.5Gbps SGMII Riser card
+ - 10Gbps XAUI Riser card
+Accelerator:
+ - DPAA components consist of FMan, BMan, QMan, PME, DCE and SEC
+SerDes:
+ - 16 lanes up to 10.3125GHz
+ - Supports Aurora debug, PEX, SATA, SGMII, sRIO, HiGig, 10GBase-R and XAUI
+IFC:
+ - 128MB NOR Flash, 512MB NAND Flash, PromJet debug port and FPGA
+eSPI:
+ - Three SPI flash (16MB N25Q128A + 16MB EN25S64 + 512KB SST25WF040)
+USB:
+ - Two USB2.0 ports with internal PHY (one Type-A + one micro Type-AB)
+PCIE:
+ - Four PCI Express controllers (two PCIe 2.0 and two PCIe 3.0 with SR-IOV)
+SATA:
+ - Two SATA 2.0 ports on-board
+SRIO:
+ - Two Serial RapidIO 2.0 ports up to 5 GHz
+eSDHC:
+ - Supports SD/SDHC/SDXC/eMMC Card
+I2C:
+ - Four I2C controllers.
+UART:
+ - Dual 4-pins UART serial ports
+System Logic:
+ - QIXIS-II FPGA system controll
+Debug Features:
+ - Support Legacy, COP/JTAG, Aurora, Event and EVT
+10GBase-R:
+ - 10GBase-R is supported on T2080QDS through Lane A/B/C/D on Serdes 1 routed to
+ a on-board SFP+ cages, which to house optical module (fiber cable) or
+ direct attach cable(copper), the copper cable is used to emulate
+ 10GBASE-KR scenario.
+ So, for 10GBase-R usage, there are two scenarios, one will use fiber cable,
+ another will use copper cable. An hwconfig env "fsl_10gkr_copper" is
+ introduced to indicate a 10GBase-R port will use copper cable, and U-Boot
+ will fixup the dtb accordingly.
+ It's used as: fsl_10gkr_copper:<10g_mac_name>
+ The <10g_mac_name> can be fm1_10g1, fm1_10g2, fm1_10g3, fm1_10g4, they
+ do not have to be coexist in hwconfig. If a MAC is listed in the env
+ "fsl_10gkr_copper", it will use copper cable, otherwise, fiber cable
+ will be used by default.
+ for ex. set "fsl_10gkr_copper:fm1_10g1,fm1_10g2,fm1_10g3,fm1_10g4" in
+ hwconfig, then both four 10GBase-R ports will use copper cable.
+ set "fsl_10gkr_copper:fm1_10g1,fm1_10g2" in hwconfig, then first two
+ 10GBase-R ports will use copper cable, the other two 10GBase-R ports will use
+ fiber cable.
+1000BASE-KX(1G-KX):
+ - T2080QDS can support 1G-KX by using SGMII protocol, but serdes lane
+ runs in 1G-KX mode. By default, the lane runs in SGMII mode, to set a lane
+ in 1G-KX mode, need to set corresponding bit in SerDes Protocol Configuration
+ Register 1 (PCCR1), and U-Boot fixup the dtb for kernel to do proper
+ initialization.
+ Hwconfig "fsl_1gkx" is used to indicate a lane runs in 1G-KX mode, MAC
+ 1/2/5/6/9/10 are available for 1G-KX, MAC 3/4 run in RGMII mode. To set a
+ MAC to use 1G-KX mode, set its' corresponding env in "fsl_1gkx", 'fm1_1g1'
+ stands for MAC 1, 'fm1_1g2' stands for MAC 2, etc.
+ For ex. set "fsl_1gkx:fm1_1g1,fm1_1g2,fm1_1g5,fm1_1g6,fm1_1g9,fm1_1g10" in
+ hwconfig, MAC 1/2/5/6/9/10 will use 1G-KX mode.
+
+System Memory map
+----------------
+
+Start Address End Address Description Size
+0xF_FFDF_0000 0xF_FFDF_0FFF IFC - CPLD 4KB
+0xF_FF80_0000 0xF_FF80_FFFF IFC - NAND Flash 64KB
+0xF_FE00_0000 0xF_FEFF_FFFF CCSRBAR 16MB
+0xF_F803_0000 0xF_F803_FFFF PCI Express 4 I/O Space 64KB
+0xF_F802_0000 0xF_F802_FFFF PCI Express 3 I/O Space 64KB
+0xF_F801_0000 0xF_F801_FFFF PCI Express 2 I/O Space 64KB
+0xF_F800_0000 0xF_F800_FFFF PCI Express 1 I/O Space 64KB
+0xF_F600_0000 0xF_F7FF_FFFF Queue manager software portal 32MB
+0xF_F400_0000 0xF_F5FF_FFFF Buffer manager software portal 32MB
+0xF_E800_0000 0xF_EFFF_FFFF IFC - NOR Flash 128MB
+0xF_0000_0000 0xF_003F_FFFF DCSR 4MB
+0xC_4000_0000 0xC_4FFF_FFFF PCI Express 4 Mem Space 256MB
+0xC_3000_0000 0xC_3FFF_FFFF PCI Express 3 Mem Space 256MB
+0xC_2000_0000 0xC_2FFF_FFFF PCI Express 2 Mem Space 256MB
+0xC_0000_0000 0xC_1FFF_FFFF PCI Express 1 Mem Space 512MB
+0x0_0000_0000 0x0_ffff_ffff DDR 4GB
+
+
+128M NOR Flash memory Map
+-------------------------
+Start Address End Address Definition Max size
+0xEFF40000 0xEFFFFFFF U-Boot (current bank) 768KB
+0xEFF20000 0xEFF3FFFF U-Boot env (current bank) 128KB
+0xEFF00000 0xEFF1FFFF FMAN Ucode (current bank) 128KB
+0xED300000 0xEFEFFFFF rootfs (alt bank) 44MB
+0xEC800000 0xEC8FFFFF Hardware device tree (alt bank) 1MB
+0xEC020000 0xEC7FFFFF Linux.uImage (alt bank) 7MB + 875KB
+0xEC000000 0xEC01FFFF RCW (alt bank) 128KB
+0xEBF40000 0xEBFFFFFF U-Boot (alt bank) 768KB
+0xEBF20000 0xEBF3FFFF U-Boot env (alt bank) 128KB
+0xEBF00000 0xEBF1FFFF FMAN ucode (alt bank) 128KB
+0xE9300000 0xEBEFFFFF rootfs (current bank) 44MB
+0xE8800000 0xE88FFFFF Hardware device tree (cur bank) 1MB
+0xE8020000 0xE86FFFFF Linux.uImage (current bank) 7MB + 875KB
+0xE8000000 0xE801FFFF RCW (current bank) 128KB
+
+
+Software configurations and board settings
+------------------------------------------
+1. NOR boot:
+ a. build NOR boot image
+ $ make T2080QDS_config
+ $ make
+ b. program u-boot.bin image to NOR flash
+ => tftp 1000000 u-boot.bin
+ => pro off all;era eff40000 efffffff;cp.b 1000000 eff40000 $filesize
+ set SW1[1:8] = '00010011', SW2[1] = '1', SW6[1:4] = '0000' for NOR boot
+
+ Switching between default bank0 and alternate bank4 on NOR flash
+ To change boot source to vbank4:
+ by software: run command 'qixis_reset altbank' in U-Boot.
+ by DIP-switch: set SW6[1:4] = '0100'
+
+ To change boot source to vbank0:
+ by software: run command 'qixis_reset' in U-Boot.
+ by DIP-Switch: set SW6[1:4] = '0000'
+
+2. NAND Boot:
+ a. build PBL image for NAND boot
+ $ make T2080QDS_NAND_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to NAND flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => nand erase 0 $filesize
+ => nand write 1000000 0 $filesize
+ set SW1[1:8] = '10000010', SW2[1] = '0' and SW6[1:4] = '1001' for NAND boot
+
+3. SPI Boot:
+ a. build PBL image for SPI boot
+ $ make T2080QDS_SPIFLASH_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to SPI flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => sf probe 0
+ => sf erase 0 f0000
+ => sf write 1000000 0 $filesize
+ set SW1[1:8] = '00100010', SW2[1] ='1' for SPI boot
+
+4. SD Boot:
+ a. build PBL image for SD boot
+ $ make T2080QDS_SDCARD_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to SD/MMC card
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => mmc write 1000000 8 0x800
+ => tftp 1000000 fsl_fman_ucode_T2080_xx.bin
+ => mmc write 1000000 0x820 80
+ set SW1[1:8] = '00100000', SW2[1] = '0' for SD boot
+
+
+2-stage NAND/SPI/SD boot loader
+-------------------------------
+PBL initializes the internal CPC-SRAM and copy SPL(160K) to SRAM.
+SPL further initializes DDR using SPD and environment variables
+and copy U-Boot(768 KB) from NAND/SPI/SD device to DDR.
+Finally SPL transers control to U-Boot for futher booting.
+
+SPL has following features:
+ - Executes within 256K
+ - No relocation required
+
+Run time view of SPL framework
+-------------------------------------------------
+|Area | Address |
+-------------------------------------------------
+|SecureBoot header | 0xFFFC0000 (32KB) |
+-------------------------------------------------
+|GD, BD | 0xFFFC8000 (4KB) |
+-------------------------------------------------
+|ENV | 0xFFFC9000 (8KB) |
+-------------------------------------------------
+|HEAP | 0xFFFCB000 (50KB) |
+-------------------------------------------------
+|STACK | 0xFFFD8000 (22KB) |
+-------------------------------------------------
+|U-Boot SPL | 0xFFFD8000 (160KB) |
+-------------------------------------------------
+
+NAND Flash memory Map on T2080QDS
+--------------------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot img 1MB (2 blocks)
+0x100000 0x17FFFF U-Boot env 512KB (1 block)
+0x180000 0x1FFFFF FMAN ucode 512KB (1 block)
+
+
+Micro SD Card memory Map on T2080QDS
+----------------------------------------------------
+Block #blocks Definition Size
+0x008 2048 U-Boot img 1MB
+0x800 0016 U-Boot env 8KB
+0x820 0128 FMAN ucode 64KB
+
+
+SPI Flash memory Map on T2080QDS
+----------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot img 1MB
+0x100000 0x101FFF U-Boot env 8KB
+0x110000 0x11FFFF FMAN ucode 64KB
+
+
+How to update the ucode of Freescale FMAN
+-----------------------------------------
+=> tftp 1000000 fsl_fman_ucode_t2080_xx.bin
+=> pro off all;erase 0xeff00000 0xeff1ffff;cp 1000000 0xeff00000 $filesize
+
+
+For more details, please refer to T2080QDS User Guide and access
+website www.freescale.com and Freescale QorIQ SDK Infocenter document.
+
+Device tree support and how to enable it for different configs
+--------------------------------------------------------------
+Device tree support is available for t2080qds for below mentioned boot,
+1. NOR Boot
+2. NAND Boot
+3. SD Boot
+4. SPIFLASH Boot
+
+To enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. CONFIG_DEFAULT_DEVICE_TREE="t2080qds" (Change default device tree name if required)
+2. CONFIG_OF_CONTROL
+3. CONFIG_MPC85XX_HAVE_RESET_VECTOR if reset vector is located at
+ CFG_RESET_VECTOR_ADDRESS - 0xffc
+
+If device tree support is enabled in defconfig,
+1. use 'u-boot.bin' for NOR boot.
+2. use 'u-boot-with-spl-pbl.bin' for other boot.
diff --git a/board/freescale/t208xqds/ddr.c b/board/freescale/t208xqds/ddr.c
new file mode 100644
index 00000000000..9076fbba10a
--- /dev/null
+++ b/board/freescale/t208xqds/ddr.c
@@ -0,0 +1,125 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ if (popts->registered_dimm_en)
+ pbsp = rdimms[0];
+ else
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks &&
+ (pdimm->rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found");
+ printf("for data rate %lu MT/s\n", ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, "
+ "wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x64;
+}
+
+int dram_init(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_RAMBOOT_PBL)
+ puts("Initializing....using SPD\n");
+ dram_size = fsl_ddr_sdram();
+#else
+ /* DDR has been initialised by first stage boot loader */
+ dram_size = fsl_ddr_sdram_size();
+#endif
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/t208xqds/ddr.h b/board/freescale/t208xqds/ddr.h
new file mode 100644
index 00000000000..9dd39813bf0
--- /dev/null
+++ b/board/freescale/t208xqds/ddr.h
@@ -0,0 +1,70 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl |
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 |
+ */
+ {2, 1200, 0, 10, 7, 0x0708090a, 0x0b0c0d09},
+ {2, 1400, 0, 10, 7, 0x08090a0c, 0x0d0e0f0a},
+ {2, 1700, 0, 10, 8, 0x090a0b0c, 0x0e10110c},
+ {2, 1900, 0, 10, 8, 0x090b0c0f, 0x1012130d},
+ {2, 2140, 0, 10, 8, 0x090b0c0f, 0x1012130d},
+ {1, 1200, 0, 10, 7, 0x0808090a, 0x0b0c0c0a},
+ {1, 1500, 0, 10, 6, 0x07070809, 0x0a0b0b09},
+ {1, 1600, 0, 10, 8, 0x090b0b0d, 0x0d0e0f0b},
+ {1, 1700, 0, 8, 8, 0x080a0a0c, 0x0c0d0e0a},
+ {1, 1900, 0, 10, 8, 0x090a0c0d, 0x0e0f110c},
+ {1, 2140, 0, 8, 8, 0x090a0b0d, 0x0e0f110b},
+ {}
+};
+
+static const struct board_specific_parameters rdimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl |
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 |
+ */
+ /* TODO: need tuning these parameters if RDIMM is used */
+ {4, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {4, 1666, 0, 10, 11, 0x0a080706, 0x07090906},
+ {4, 2140, 0, 10, 12, 0x0b090807, 0x080a0b07},
+ {2, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {2, 1666, 0, 10, 11, 0x0a090806, 0x08090a06},
+ {2, 2140, 0, 10, 12, 0x0b090807, 0x080a0b07},
+ {1, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {1, 1666, 0, 10, 11, 0x0a090806, 0x08090a06},
+ {1, 2140, 0, 8, 12, 0x0b090807, 0x080a0b07},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+static const struct board_specific_parameters *rdimms[] = {
+ rdimm0,
+};
+#endif
diff --git a/board/freescale/t208xqds/eth_t208xqds.c b/board/freescale/t208xqds/eth_t208xqds.c
new file mode 100644
index 00000000000..9f299227e29
--- /dev/null
+++ b/board/freescale/t208xqds/eth_t208xqds.c
@@ -0,0 +1,723 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ * Copyright 2020 NXP
+ *
+ * Shengzhou Liu <Shengzhou.Liu@freescale.com>
+ */
+
+#include <config.h>
+#include <command.h>
+#include <fdt_support.h>
+#include <log.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_portals.h>
+#include <asm/fsl_liodn.h>
+#include <malloc.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <miiphy.h>
+#include <phy.h>
+#include <fsl_dtsec.h>
+#include <asm/fsl_serdes.h>
+#include <hwconfig.h>
+#include "../common/qixis.h"
+#include "../common/fman.h"
+#include "t208xqds_qixis.h"
+#include <linux/libfdt.h>
+
+#define EMI_NONE 0xFFFFFFFF
+#define EMI1_RGMII1 0
+#define EMI1_RGMII2 1
+#define EMI1_SLOT1 2
+#if defined(CONFIG_TARGET_T2080QDS)
+#define EMI1_SLOT2 6
+#define EMI1_SLOT3 3
+#define EMI1_SLOT4 4
+#define EMI1_SLOT5 5
+#define EMI2 7
+#endif
+
+#define PCCR1_SGMIIA_KX_MASK 0x00008000
+#define PCCR1_SGMIIB_KX_MASK 0x00004000
+#define PCCR1_SGMIIC_KX_MASK 0x00002000
+#define PCCR1_SGMIID_KX_MASK 0x00001000
+#define PCCR1_SGMIIE_KX_MASK 0x00000800
+#define PCCR1_SGMIIF_KX_MASK 0x00000400
+#define PCCR1_SGMIIG_KX_MASK 0x00000200
+#define PCCR1_SGMIIH_KX_MASK 0x00000100
+
+static int mdio_mux[NUM_FM_PORTS];
+
+static const char * const mdio_names[] = {
+#if defined(CONFIG_TARGET_T2080QDS)
+ "T2080QDS_MDIO_RGMII1",
+ "T2080QDS_MDIO_RGMII2",
+ "T2080QDS_MDIO_SLOT1",
+ "T2080QDS_MDIO_SLOT3",
+ "T2080QDS_MDIO_SLOT4",
+ "T2080QDS_MDIO_SLOT5",
+ "T2080QDS_MDIO_SLOT2",
+ "T2080QDS_MDIO_10GC",
+#endif
+};
+
+/* Map SerDes1 8 lanes to default slot, will be initialized dynamically */
+#if defined(CONFIG_TARGET_T2080QDS)
+static u8 lane_to_slot[] = {3, 3, 3, 3, 1, 1, 1, 1};
+#endif
+
+static const char *t208xqds_mdio_name_for_muxval(u8 muxval)
+{
+ return mdio_names[muxval];
+}
+
+struct mii_dev *mii_dev_for_muxval(u8 muxval)
+{
+ struct mii_dev *bus;
+ const char *name = t208xqds_mdio_name_for_muxval(muxval);
+
+ if (!name) {
+ printf("No bus for muxval %x\n", muxval);
+ return NULL;
+ }
+
+ bus = miiphy_get_dev_by_name(name);
+
+ if (!bus) {
+ printf("No bus by name %s\n", name);
+ return NULL;
+ }
+
+ return bus;
+}
+
+struct t208xqds_mdio {
+ u8 muxval;
+ struct mii_dev *realbus;
+};
+
+static void t208xqds_mux_mdio(u8 muxval)
+{
+ u8 brdcfg4;
+ if (muxval < 8) {
+ brdcfg4 = QIXIS_READ(brdcfg[4]);
+ brdcfg4 &= ~BRDCFG4_EMISEL_MASK;
+ brdcfg4 |= (muxval << BRDCFG4_EMISEL_SHIFT);
+ QIXIS_WRITE(brdcfg[4], brdcfg4);
+ }
+}
+
+static int t208xqds_mdio_read(struct mii_dev *bus, int addr, int devad,
+ int regnum)
+{
+ struct t208xqds_mdio *priv = bus->priv;
+
+ t208xqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->read(priv->realbus, addr, devad, regnum);
+}
+
+static int t208xqds_mdio_write(struct mii_dev *bus, int addr, int devad,
+ int regnum, u16 value)
+{
+ struct t208xqds_mdio *priv = bus->priv;
+
+ t208xqds_mux_mdio(priv->muxval);
+
+ return priv->realbus->write(priv->realbus, addr, devad, regnum, value);
+}
+
+static int t208xqds_mdio_reset(struct mii_dev *bus)
+{
+ struct t208xqds_mdio *priv = bus->priv;
+
+ return priv->realbus->reset(priv->realbus);
+}
+
+static int t208xqds_mdio_init(char *realbusname, u8 muxval)
+{
+ struct t208xqds_mdio *pmdio;
+ struct mii_dev *bus = mdio_alloc();
+
+ if (!bus) {
+ printf("Failed to allocate t208xqds MDIO bus\n");
+ return -1;
+ }
+
+ pmdio = malloc(sizeof(*pmdio));
+ if (!pmdio) {
+ printf("Failed to allocate t208xqds private data\n");
+ free(bus);
+ return -1;
+ }
+
+ bus->read = t208xqds_mdio_read;
+ bus->write = t208xqds_mdio_write;
+ bus->reset = t208xqds_mdio_reset;
+ strcpy(bus->name, t208xqds_mdio_name_for_muxval(muxval));
+
+ pmdio->realbus = miiphy_get_dev_by_name(realbusname);
+
+ if (!pmdio->realbus) {
+ printf("No bus with name %s\n", realbusname);
+ free(bus);
+ free(pmdio);
+ return -1;
+ }
+
+ pmdio->muxval = muxval;
+ bus->priv = pmdio;
+ return mdio_register(bus);
+}
+
+void board_ft_fman_fixup_port(void *fdt, char *compat, phys_addr_t addr,
+ enum fm_port port, int offset)
+{
+ int phy;
+ char alias[20];
+ char lane_mode[2][20] = {"1000BASE-KX", "10GBASE-KR"};
+ char buf[32] = "serdes-1,";
+ struct fixed_link f_link;
+ int media_type = 0;
+ const char *phyconn;
+ int off;
+
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+#ifdef CONFIG_TARGET_T2080QDS
+ serdes_corenet_t *srds_regs =
+ (void *)CFG_SYS_FSL_CORENET_SERDES_ADDR;
+ u32 srds1_pccr1 = in_be32(&srds_regs->srdspccr1);
+#endif
+ u32 srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+
+ srds_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_SGMII) {
+ phy = fm_info_get_phy_address(port);
+ switch (port) {
+#if defined(CONFIG_TARGET_T2080QDS)
+ case FM1_DTSEC1:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g1")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx1");
+ fdt_status_okay_by_alias(fdt, "1gkx_pcs_mdio1");
+ sprintf(buf, "%s%s%s", buf, "lane-c,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIIH_KX_MASK);
+ break;
+ }
+ case FM1_DTSEC2:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g2")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx2");
+ fdt_status_okay_by_alias(fdt, "1gkx_pcs_mdio2");
+ sprintf(buf, "%s%s%s", buf, "lane-d,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIIG_KX_MASK);
+ break;
+ }
+ case FM1_DTSEC9:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g9")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx9");
+ fdt_status_okay_by_alias(fdt, "1gkx_pcs_mdio9");
+ sprintf(buf, "%s%s%s", buf, "lane-a,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIIE_KX_MASK);
+ break;
+ }
+ case FM1_DTSEC10:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g10")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx10");
+ fdt_status_okay_by_alias(fdt,
+ "1gkx_pcs_mdio10");
+ sprintf(buf, "%s%s%s", buf, "lane-b,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIIF_KX_MASK);
+ break;
+ }
+ if (mdio_mux[port] == EMI1_SLOT2) {
+ sprintf(alias, "phy_sgmii_s2_%x", phy);
+ fdt_set_phy_handle(fdt, compat, addr, alias);
+ fdt_status_okay_by_alias(fdt, "emi1_slot2");
+ } else if (mdio_mux[port] == EMI1_SLOT3) {
+ sprintf(alias, "phy_sgmii_s3_%x", phy);
+ fdt_set_phy_handle(fdt, compat, addr, alias);
+ fdt_status_okay_by_alias(fdt, "emi1_slot3");
+ }
+ break;
+ case FM1_DTSEC5:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g5")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx5");
+ fdt_status_okay_by_alias(fdt, "1gkx_pcs_mdio5");
+ sprintf(buf, "%s%s%s", buf, "lane-g,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIIC_KX_MASK);
+ break;
+ }
+ case FM1_DTSEC6:
+ if (hwconfig_sub("fsl_1gkx", "fm1_1g6")) {
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_1gkx6");
+ fdt_status_okay_by_alias(fdt, "1gkx_pcs_mdio6");
+ sprintf(buf, "%s%s%s", buf, "lane-h,",
+ (char *)lane_mode[0]);
+ out_be32(&srds_regs->srdspccr1, srds1_pccr1 |
+ PCCR1_SGMIID_KX_MASK);
+ break;
+ }
+ if (mdio_mux[port] == EMI1_SLOT1) {
+ sprintf(alias, "phy_sgmii_s1_%x", phy);
+ fdt_set_phy_handle(fdt, compat, addr, alias);
+ fdt_status_okay_by_alias(fdt, "emi1_slot1");
+ } else if (mdio_mux[port] == EMI1_SLOT2) {
+ sprintf(alias, "phy_sgmii_s2_%x", phy);
+ fdt_set_phy_handle(fdt, compat, addr, alias);
+ fdt_status_okay_by_alias(fdt, "emi1_slot2");
+ }
+ break;
+#endif
+ default:
+ break;
+ }
+ if (media_type) {
+ /* set property for 1000BASE-KX in dtb */
+ off = fdt_node_offset_by_compat_reg(fdt,
+ "fsl,fman-memac-mdio", addr + 0x1000);
+ fdt_setprop_string(fdt, off, "lane-instance", buf);
+ }
+
+ } else if (fm_info_get_enet_if(port) == PHY_INTERFACE_MODE_XGMII) {
+ switch (srds_s1) {
+ case 0x66: /* 10GBase-R interface */
+ case 0x6b:
+ case 0x6c:
+ case 0x6d:
+ case 0x71:
+ /*
+ * Check hwconfig to see what is the media type, there
+ * are two types, fiber or copper, fix the dtb
+ * accordingly.
+ */
+ switch (port) {
+ case FM1_10GEC1:
+ if (hwconfig_sub("fsl_10gkr_copper", "fm1_10g1")) {
+ /* it's MAC9 */
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_xfi9");
+ fdt_status_okay_by_alias(fdt, "xfi_pcs_mdio9");
+ sprintf(buf, "%s%s%s", buf, "lane-a,",
+ (char *)lane_mode[1]);
+ }
+ break;
+ case FM1_10GEC2:
+ if (hwconfig_sub("fsl_10gkr_copper", "fm1_10g2")) {
+ /* it's MAC10 */
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_xfi10");
+ fdt_status_okay_by_alias(fdt, "xfi_pcs_mdio10");
+ sprintf(buf, "%s%s%s", buf, "lane-b,",
+ (char *)lane_mode[1]);
+ }
+ break;
+ case FM1_10GEC3:
+ if (hwconfig_sub("fsl_10gkr_copper", "fm1_10g3")) {
+ /* it's MAC1 */
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_xfi1");
+ fdt_status_okay_by_alias(fdt, "xfi_pcs_mdio1");
+ sprintf(buf, "%s%s%s", buf, "lane-c,",
+ (char *)lane_mode[1]);
+ }
+ break;
+ case FM1_10GEC4:
+ if (hwconfig_sub("fsl_10gkr_copper", "fm1_10g4")) {
+ /* it's MAC2 */
+ media_type = 1;
+ fdt_set_phy_handle(fdt, compat, addr,
+ "phy_xfi2");
+ fdt_status_okay_by_alias(fdt, "xfi_pcs_mdio2");
+ sprintf(buf, "%s%s%s", buf, "lane-d,",
+ (char *)lane_mode[1]);
+ }
+ break;
+ default:
+ return;
+ }
+
+ if (!media_type) {
+ phyconn = fdt_getprop(fdt, offset,
+ "phy-connection-type",
+ NULL);
+ if (is_backplane_mode(phyconn)) {
+ /* Backplane KR mode: skip fixups */
+ printf("Interface %d in backplane KR mode\n",
+ port);
+ } else {
+ /* fixed-link for 10GBase-R fiber cable */
+ f_link.phy_id = port;
+ f_link.duplex = 1;
+ f_link.link_speed = 10000;
+ f_link.pause = 0;
+ f_link.asym_pause = 0;
+ fdt_delprop(fdt, offset, "phy-handle");
+ fdt_setprop(fdt, offset, "fixed-link",
+ &f_link, sizeof(f_link));
+ }
+ } else {
+ /* set property for copper cable */
+ off = fdt_node_offset_by_compat_reg(fdt,
+ "fsl,fman-memac-mdio", addr + 0x1000);
+ fdt_setprop_string(fdt, off,
+ "lane-instance", buf);
+ }
+ break;
+ default:
+ break;
+ }
+ }
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ return;
+}
+
+/*
+ * This function reads RCW to check if Serdes1{A:H} is configured
+ * to slot 1/2/3/4/5/6/7 and update the lane_to_slot[] array accordingly
+ */
+static void initialize_lane_to_slot(void)
+{
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+
+ srds_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ switch (srds_s1) {
+#if defined(CONFIG_TARGET_T2080QDS)
+ case 0x51:
+ case 0x5f:
+ case 0x65:
+ case 0x6b:
+ case 0x71:
+ lane_to_slot[5] = 2;
+ lane_to_slot[6] = 2;
+ lane_to_slot[7] = 2;
+ break;
+ case 0xa6:
+ case 0x8e:
+ case 0x8f:
+ case 0x82:
+ case 0x83:
+ case 0xd3:
+ case 0xd9:
+ case 0xcb:
+ lane_to_slot[6] = 2;
+ lane_to_slot[7] = 2;
+ break;
+ case 0xda:
+ lane_to_slot[4] = 3;
+ lane_to_slot[5] = 3;
+ lane_to_slot[6] = 3;
+ lane_to_slot[7] = 3;
+ break;
+#endif
+ default:
+ break;
+ }
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+#if defined(CONFIG_FMAN_ENET)
+ int i, idx, lane, slot, interface;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 rcwsr13 = in_be32(&gur->rcwsr[13]);
+ u32 srds_s1;
+
+ srds_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+
+ initialize_lane_to_slot();
+
+ /* Initialize the mdio_mux array so we can recognize empty elements */
+ for (i = 0; i < NUM_FM_PORTS; i++)
+ mdio_mux[i] = EMI_NONE;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM1_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ /* Register the muxing front-ends to the MDIO buses */
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII1);
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_RGMII2);
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT1);
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT2);
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT3);
+#if defined(CONFIG_TARGET_T2080QDS)
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT4);
+#endif
+ t208xqds_mdio_init(DEFAULT_FM_MDIO_NAME, EMI1_SLOT5);
+ t208xqds_mdio_init(DEFAULT_FM_TGEC_MDIO_NAME, EMI2);
+
+ /* Set the two on-board RGMII PHY address */
+ fm_info_set_phy_address(FM1_DTSEC3, RGMII_PHY1_ADDR);
+ if ((rcwsr13 & FSL_CORENET_RCWSR13_EC2) ==
+ FSL_CORENET_RCWSR13_EC2_DTSEC4_RGMII)
+ fm_info_set_phy_address(FM1_DTSEC4, RGMII_PHY2_ADDR);
+ else
+ fm_info_set_phy_address(FM1_DTSEC10, RGMII_PHY2_ADDR);
+
+ switch (srds_s1) {
+ case 0x1b:
+ case 0x1c:
+ case 0x95:
+ case 0xa2:
+ case 0x94:
+ /* T2080QDS: SGMII in Slot3; T2081QDS: SGMII in Slot2 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ /* T2080QDS: SGMII in Slot2; T2081QDS: SGMII in Slot1 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ case 0x50:
+ case 0x51:
+ case 0x5e:
+ case 0x5f:
+ case 0x64:
+ case 0x65:
+ /* T2080QDS: XAUI/HiGig in Slot3; T2081QDS: in Slot2 */
+ fm_info_set_phy_address(FM1_10GEC1, FM1_10GEC1_PHY_ADDR);
+ /* T2080QDS: SGMII in Slot2; T2081QDS: in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ case 0x66:
+ case 0x67:
+ /*
+ * 10GBase-R does not need a PHY to work, but to avoid U-Boot
+ * use default PHY address which is zero to a MAC when it found
+ * a MAC has no PHY address, we give a PHY address to 10GBase-R
+ * MAC, and should not use a real XAUI PHY address, since
+ * MDIO can access it successfully, and then MDIO thinks
+ * the XAUI card is used for the 10GBase-R MAC, which will cause
+ * error.
+ */
+ fm_info_set_phy_address(FM1_10GEC1, 4);
+ fm_info_set_phy_address(FM1_10GEC2, 5);
+ fm_info_set_phy_address(FM1_10GEC3, 6);
+ fm_info_set_phy_address(FM1_10GEC4, 7);
+ break;
+ case 0x6a:
+ case 0x6b:
+ fm_info_set_phy_address(FM1_10GEC1, 4);
+ fm_info_set_phy_address(FM1_10GEC2, 5);
+ fm_info_set_phy_address(FM1_10GEC3, 6);
+ fm_info_set_phy_address(FM1_10GEC4, 7);
+ /* T2080QDS: SGMII in Slot2; T2081QDS: in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT2_PHY_ADDR);
+ break;
+ case 0x6c:
+ case 0x6d:
+ fm_info_set_phy_address(FM1_10GEC1, 4);
+ fm_info_set_phy_address(FM1_10GEC2, 5);
+ /* T2080QDS: SGMII in Slot3; T2081QDS: in Slot2 */
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ case 0x70:
+ case 0x71:
+ /* SGMII in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ /* SGMII in Slot2 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT2_PHY_ADDR);
+ break;
+ case 0xa6:
+ case 0x8e:
+ case 0x8f:
+ case 0x82:
+ case 0x83:
+ /* SGMII in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ /* SGMII in Slot2 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT2_PHY_ADDR);
+ break;
+ case 0xa4:
+ case 0x96:
+ case 0x8a:
+ /* SGMII in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC9, SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+#if defined(CONFIG_TARGET_T2080QDS)
+ case 0xd9:
+ case 0xd3:
+ case 0xcb:
+ /* SGMII in Slot3 */
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT4_PHY_ADDR);
+ /* SGMII in Slot2 */
+ fm_info_set_phy_address(FM1_DTSEC5, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT2_PHY_ADDR);
+ break;
+#endif
+ case 0xf2:
+ /* T2080QDS: SGMII in Slot3; T2081QDS: SGMII in Slot7 */
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_CARD_PORT1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_CARD_PORT2_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC10, SGMII_CARD_PORT3_PHY_ADDR);
+ fm_info_set_phy_address(FM1_DTSEC6, SGMII_CARD_PORT4_PHY_ADDR);
+ break;
+ default:
+ break;
+ }
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ idx = i - FM1_DTSEC1;
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_SGMII:
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ SGMII_FM1_DTSEC1 + idx);
+ if (lane < 0)
+ break;
+ slot = lane_to_slot[lane];
+ debug("FM1@DTSEC%u expects SGMII in slot %u\n",
+ idx + 1, slot);
+ if (QIXIS_READ(present2) & (1 << (slot - 1)))
+ fm_disable_port(i);
+
+ switch (slot) {
+ case 1:
+ mdio_mux[i] = EMI1_SLOT1;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 2:
+ mdio_mux[i] = EMI1_SLOT2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ case 3:
+ mdio_mux[i] = EMI1_SLOT3;
+ fm_info_set_mdio(i, mii_dev_for_muxval(
+ mdio_mux[i]));
+ break;
+ }
+ break;
+ case PHY_INTERFACE_MODE_RGMII:
+ case PHY_INTERFACE_MODE_RGMII_TXID:
+ case PHY_INTERFACE_MODE_RGMII_RXID:
+ case PHY_INTERFACE_MODE_RGMII_ID:
+ if (i == FM1_DTSEC3)
+ mdio_mux[i] = EMI1_RGMII1;
+ else if (i == FM1_DTSEC4 || FM1_DTSEC10)
+ mdio_mux[i] = EMI1_RGMII2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(mdio_mux[i]));
+ break;
+ default:
+ break;
+ }
+ }
+
+ for (i = FM1_10GEC1; i < FM1_10GEC1 + CFG_SYS_NUM_FM1_10GEC; i++) {
+ idx = i - FM1_10GEC1;
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_XGMII:
+ if (srds_s1 == 0x51) {
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ XAUI_FM1_MAC9 + idx);
+ } else if ((srds_s1 == 0x5f) || (srds_s1 == 0x65)) {
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ HIGIG_FM1_MAC9 + idx);
+ } else {
+ if (i == FM1_10GEC1 || i == FM1_10GEC2)
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ XFI_FM1_MAC9 + idx);
+ else
+ lane = serdes_get_first_lane(FSL_SRDS_1,
+ XFI_FM1_MAC1 + idx);
+ }
+
+ if (lane < 0)
+ break;
+ mdio_mux[i] = EMI2;
+ fm_info_set_mdio(i, mii_dev_for_muxval(mdio_mux[i]));
+
+ if ((srds_s1 == 0x66) || (srds_s1 == 0x6b) ||
+ (srds_s1 == 0x6a) || (srds_s1 == 0x70) ||
+ (srds_s1 == 0x6c) || (srds_s1 == 0x6d) ||
+ (srds_s1 == 0x71)) {
+ /* As 10GBase-R is in cage intead of a slot, so
+ * ensure doesn't disable the corresponding port
+ */
+ break;
+ }
+
+ slot = lane_to_slot[lane];
+ if (QIXIS_READ(present2) & (1 << (slot - 1)))
+ fm_disable_port(i);
+ break;
+ default:
+ break;
+ }
+ }
+
+ cpu_eth_init(bis);
+#endif /* CONFIG_FMAN_ENET */
+
+ return pci_eth_init(bis);
+}
diff --git a/board/freescale/t208xqds/law.c b/board/freescale/t208xqds/law.c
new file mode 100644
index 00000000000..287f4650e05
--- /dev/null
+++ b/board/freescale/t208xqds/law.c
@@ -0,0 +1,33 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2012 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_IFC),
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef QIXIS_BASE_PHYS
+ SET_LAW(QIXIS_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ /* Limit DCSR to 32M to access NPC Trace Buffer */
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_IFC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/t208xqds/spl.c b/board/freescale/t208xqds/spl.c
new file mode 100644
index 00000000000..44ad4e68d9f
--- /dev/null
+++ b/board/freescale/t208xqds/spl.c
@@ -0,0 +1,141 @@
+// SPDX-License-Identifier: GPL-2.0+
+/* Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env_internal.h>
+#include <init.h>
+#include <malloc.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <i2c.h>
+#include <mmc.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/qixis.h"
+#include "t208xqds_qixis.h"
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L3_SIZE;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch (sysclk_conf & 0x0F) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+ return 66666666;
+}
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, sys_clk, ccb_clk;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ /* Memcpy existing GD at CONFIG_SPL_GD_ADDR */
+ memcpy((void *)CONFIG_SPL_GD_ADDR, (void *)gd, sizeof(gd_t));
+
+ /* Update GD pointer */
+ gd = (gd_t *)(CONFIG_SPL_GD_ADDR);
+
+ console_init_f();
+
+ /* initialize selected port with appropriate baud rate */
+ sys_clk = get_board_sys_clk();
+ plat_ratio = (in_be32(&gur->rcwsr[0]) >> 25) & 0x1f;
+ ccb_clk = sys_clk * plat_ratio / 2;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ ccb_clk / 16 / CONFIG_BAUDRATE);
+
+#if defined(CONFIG_SPL_MMC_BOOT)
+ puts("\nSD boot...\n");
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ puts("\nSPI boot...\n");
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ puts("\nNAND boot...\n");
+#endif
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, (gd_t *)CONFIG_SPL_GD_ADDR, 0x0);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ struct bd_info *bd;
+
+ bd = (struct bd_info *)(gd + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_SPL_RELOC_MALLOC_ADDR,
+ CONFIG_SPL_RELOC_MALLOC_SIZE);
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+ mmc_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_SPI_BOOT
+ fsl_spi_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+
+ i2c_init_all();
+
+ dram_init();
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/t208xqds/t2080_nand_rcw.cfg b/board/freescale/t208xqds/t2080_nand_rcw.cfg
new file mode 100644
index 00000000000..52a1652a222
--- /dev/null
+++ b/board/freescale/t208xqds/t2080_nand_rcw.cfg
@@ -0,0 +1,16 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=2133MT/s
+#12100017 15000000 00000000 00000000
+#66150002 00008400 e8104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core=1800MHz, DDR=1867MT/s
+0c070012 0e000000 00000000 00000000
+66150002 00000000 e8104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t2080_sd_rcw.cfg b/board/freescale/t208xqds/t2080_sd_rcw.cfg
new file mode 100644
index 00000000000..73f53faa259
--- /dev/null
+++ b/board/freescale/t208xqds/t2080_sd_rcw.cfg
@@ -0,0 +1,16 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=2133MT/s
+#12100017 15000000 00000000 00000000
+#66150002 00008400 e8104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core=1800MHz, DDR=1867MT/s
+0c070012 0e000000 00000000 00000000
+66150002 00000000 68104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t2080_spi_rcw.cfg b/board/freescale/t208xqds/t2080_spi_rcw.cfg
new file mode 100644
index 00000000000..8474c8ef7ce
--- /dev/null
+++ b/board/freescale/t208xqds/t2080_spi_rcw.cfg
@@ -0,0 +1,16 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=2133MT/s
+#12100017 15000000 00000000 00000000
+#66150002 00008400 e8104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core=1800MHz, DDR=1867MT/s
+0c070012 0e000000 00000000 00000000
+66150002 00000000 58104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t2081_nand_rcw.cfg b/board/freescale/t208xqds/t2081_nand_rcw.cfg
new file mode 100644
index 00000000000..a2d5ecf4adc
--- /dev/null
+++ b/board/freescale/t208xqds/t2081_nand_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+#Default SerDes Protocol: 0x6C
+#Core/DDR: 1533Mhz/2133MT/s
+12100017 15000000 00000000 00000000
+6c000002 00008000 e8104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t2081_sd_rcw.cfg b/board/freescale/t208xqds/t2081_sd_rcw.cfg
new file mode 100644
index 00000000000..daced6796ba
--- /dev/null
+++ b/board/freescale/t208xqds/t2081_sd_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+#Default SerDes Protocol: 0x6C
+#Core/DDR: 1533Mhz/2133MT/s
+12100017 15000000 00000000 00000000
+6c000002 00008000 68104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t2081_spi_rcw.cfg b/board/freescale/t208xqds/t2081_spi_rcw.cfg
new file mode 100644
index 00000000000..79ba1f1ab77
--- /dev/null
+++ b/board/freescale/t208xqds/t2081_spi_rcw.cfg
@@ -0,0 +1,8 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+#Default SerDes Protocol: 0x6C
+#Core/DDR: 1533Mhz/2133MT/s
+12100017 15000000 00000000 00000000
+6c000002 00008000 58104000 c1000000
+00000000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xqds/t208x_pbi.cfg b/board/freescale/t208xqds/t208x_pbi.cfg
new file mode 100644
index 00000000000..43be8a864e3
--- /dev/null
+++ b/board/freescale/t208xqds/t208x_pbi.cfg
@@ -0,0 +1,40 @@
+#
+# Copyright 2013 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Refer doc/README.pblimage for more details about how-to configure
+# and create PBL boot image
+#
+
+#PBI commands
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#512KB SRAM
+09010100 00000000
+09010104 fff80009
+09010f00 08000000
+#enable CPC1
+09010000 80000000
+#Configure LAW for CPC1
+09000d00 00000000
+09000d04 fff80000
+09000d08 81000012
+#Initialize eSPI controller, default configuration is slow for eSPI to
+#load data, this configuration comes from u-boot eSPI driver.
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Errata for slowing down the MDC clock to make it <= 2.5 MHZ
+094fc030 00008148
+094fd030 00008148
+#Configure alternate space
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Flush PBL data
+091380c0 00100000
diff --git a/board/freescale/t208xqds/t208xqds.c b/board/freescale/t208xqds/t208xqds.c
new file mode 100644
index 00000000000..5e71da0e163
--- /dev/null
+++ b/board/freescale/t208xqds/t208xqds.c
@@ -0,0 +1,426 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2009-2013 Freescale Semiconductor, Inc.
+ * Copyright 2020 NXP
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <image.h>
+#include <init.h>
+#include <log.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <fm_eth.h>
+#include "../common/i2c_mux.h"
+
+#include "../common/qixis.h"
+#include "../common/vsc3316_3308.h"
+#include "../common/vid.h"
+#include "t208xqds.h"
+#include "t208xqds_qixis.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+int checkboard(void)
+{
+ char buf[64];
+ u8 sw;
+ struct cpu_type *cpu = gd->arch.cpu;
+ static const char *freq[4] = {
+ "100.00MHZ(from 8T49N222A)", "125.00MHz",
+ "156.25MHZ", "100.00MHz"
+ };
+
+ printf("Board: %sQDS, ", cpu->name);
+ sw = QIXIS_READ(arch);
+ printf("Sys ID: 0x%02x, Board Arch: V%d, ", QIXIS_READ(id), sw >> 4);
+ printf("Board Version: %c, boot from ", (sw & 0xf) + 'A' - 1);
+
+#ifdef CONFIG_SDCARD
+ puts("SD/MMC\n");
+#elif CONFIG_SPIFLASH
+ puts("SPI\n");
+#else
+ sw = QIXIS_READ(brdcfg[0]);
+ sw = (sw & QIXIS_LBMAP_MASK) >> QIXIS_LBMAP_SHIFT;
+
+ if (sw < 0x8)
+ printf("vBank%d\n", sw);
+ else if (sw == 0x8)
+ puts("Promjet\n");
+ else if (sw == 0x9)
+ puts("NAND\n");
+ else
+ printf("invalid setting of SW%u\n", QIXIS_LBMAP_SWITCH);
+#endif
+
+ printf("FPGA: v%d (%s), build %d", (int)QIXIS_READ(scver),
+ qixis_read_tag(buf), (int)qixis_read_minor());
+ /* the timestamp string contains "\n" at the end */
+ printf(" on %s", qixis_read_time(buf));
+
+ puts("SERDES Reference Clocks:\n");
+ sw = QIXIS_READ(brdcfg[2]);
+ printf("SD1_CLK1=%s, SD1_CLK2=%s\n", freq[sw >> 6],
+ freq[(sw >> 4) & 0x3]);
+ printf("SD2_CLK1=%s, SD2_CLK2=%s\n", freq[(sw & 0xf) >> 2],
+ freq[sw & 0x3]);
+
+ return 0;
+}
+
+int i2c_multiplexer_select_vid_channel(u8 channel)
+{
+ return select_i2c_ch_pca9547(channel, 0);
+}
+
+int brd_mux_lane_to_slot(void)
+{
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_prtcl_s1;
+
+ srds_prtcl_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_prtcl_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+#if defined(CONFIG_TARGET_T2080QDS)
+ u32 srds_prtcl_s2 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS2_PRTCL;
+ srds_prtcl_s2 >>= FSL_CORENET2_RCWSR4_SRDS2_PRTCL_SHIFT;
+#endif
+
+ switch (srds_prtcl_s1) {
+ case 0:
+ /* SerDes1 is not enabled */
+ break;
+#if defined(CONFIG_TARGET_T2080QDS)
+ case 0x1b:
+ case 0x1c:
+ case 0xa2:
+ /* SD1(A:D) => SLOT3 SGMII
+ * SD1(G:H) => SLOT1 SGMII
+ */
+ QIXIS_WRITE(brdcfg[12], 0x1a);
+ break;
+ case 0x94:
+ case 0x95:
+ /* SD1(A:B) => SLOT3 SGMII@1.25bps
+ * SD1(C:D) => SFP Module, SGMII@3.125bps
+ * SD1(E:H) => SLOT1 SGMII@1.25bps
+ */
+ case 0x96:
+ /* SD1(A:B) => SLOT3 SGMII@1.25bps
+ * SD1(C) => SFP Module, SGMII@3.125bps
+ * SD1(D) => SFP Module, SGMII@1.25bps
+ * SD1(E:H) => SLOT1 PCIe4 x4
+ */
+ QIXIS_WRITE(brdcfg[12], 0x3a);
+ break;
+ case 0x50:
+ case 0x51:
+ /* SD1(A:D) => SLOT3 XAUI
+ * SD1(E) => SLOT1 PCIe4
+ * SD1(F:H) => SLOT2 SGMII
+ */
+ QIXIS_WRITE(brdcfg[12], 0x15);
+ break;
+ case 0x66:
+ case 0x67:
+ /* SD1(A:D) => 10GBase-R cage
+ * SD1(E:H) => SLOT1 PCIe4
+ */
+ QIXIS_WRITE(brdcfg[12], 0xfe);
+ break;
+ case 0x6a:
+ case 0x6b:
+ /* SD1(A:D) => 10GBase-R cage
+ * SD1(E) => SLOT1 PCIe4
+ * SD1(F:H) => SLOT2 SGMII
+ */
+ QIXIS_WRITE(brdcfg[12], 0xf1);
+ break;
+ case 0x6c:
+ case 0x6d:
+ /* SD1(A:B) => 10GBase-R cage
+ * SD1(C:D) => SLOT3 SGMII
+ * SD1(E:H) => SLOT1 PCIe4
+ */
+ QIXIS_WRITE(brdcfg[12], 0xda);
+ break;
+ case 0x6e:
+ /* SD1(A:B) => SFP Module, 10GBase-R
+ * SD1(C:D) => SLOT3 SGMII
+ * SD1(E:F) => SLOT1 PCIe4 x2
+ * SD1(G:H) => SLOT2 SGMII
+ */
+ QIXIS_WRITE(brdcfg[12], 0xd9);
+ break;
+ case 0xda:
+ /* SD1(A:H) => SLOT3 PCIe3 x8
+ */
+ QIXIS_WRITE(brdcfg[12], 0x0);
+ break;
+ case 0xc8:
+ /* SD1(A) => SLOT3 PCIe3 x1
+ * SD1(B) => SFP Module, SGMII@1.25bps
+ * SD1(C:D) => SFP Module, SGMII@3.125bps
+ * SD1(E:F) => SLOT1 PCIe4 x2
+ * SD1(G:H) => SLOT2 SGMII
+ */
+ QIXIS_WRITE(brdcfg[12], 0x79);
+ break;
+ case 0xab:
+ /* SD1(A:D) => SLOT3 PCIe3 x4
+ * SD1(E:H) => SLOT1 PCIe4 x4
+ */
+ QIXIS_WRITE(brdcfg[12], 0x1a);
+ break;
+#endif
+ default:
+ printf("WARNING: unsupported for SerDes1 Protocol %d\n",
+ srds_prtcl_s1);
+ return -1;
+ }
+
+#ifdef CONFIG_TARGET_T2080QDS
+ switch (srds_prtcl_s2) {
+ case 0:
+ /* SerDes2 is not enabled */
+ break;
+ case 0x01:
+ case 0x02:
+ /* SD2(A:H) => SLOT4 PCIe1 */
+ QIXIS_WRITE(brdcfg[13], 0x10);
+ break;
+ case 0x15:
+ case 0x16:
+ /*
+ * SD2(A:D) => SLOT4 PCIe1
+ * SD2(E:F) => SLOT5 PCIe2
+ * SD2(G:H) => SATA1,SATA2
+ */
+ QIXIS_WRITE(brdcfg[13], 0xb0);
+ break;
+ case 0x18:
+ /*
+ * SD2(A:D) => SLOT4 PCIe1
+ * SD2(E:F) => SLOT5 Aurora
+ * SD2(G:H) => SATA1,SATA2
+ */
+ QIXIS_WRITE(brdcfg[13], 0x78);
+ break;
+ case 0x1f:
+ /*
+ * SD2(A:D) => SLOT4 PCIe1
+ * SD2(E:H) => SLOT5 PCIe2
+ */
+ QIXIS_WRITE(brdcfg[13], 0xa0);
+ break;
+ case 0x29:
+ case 0x2d:
+ case 0x2e:
+ /*
+ * SD2(A:D) => SLOT4 SRIO2
+ * SD2(E:H) => SLOT5 SRIO1
+ */
+ QIXIS_WRITE(brdcfg[13], 0xa0);
+ break;
+ case 0x36:
+ /*
+ * SD2(A:D) => SLOT4 SRIO2
+ * SD2(E:F) => Aurora
+ * SD2(G:H) => SATA1,SATA2
+ */
+ QIXIS_WRITE(brdcfg[13], 0x78);
+ break;
+ default:
+ printf("WARNING: unsupported for SerDes2 Protocol %d\n",
+ srds_prtcl_s2);
+ return -1;
+ }
+#endif
+ return 0;
+}
+
+static void esdhc_adapter_card_ident(void)
+{
+ u8 card_id, value;
+
+ card_id = QIXIS_READ(present) & QIXIS_SDID_MASK;
+
+ switch (card_id) {
+ case QIXIS_ESDHC_ADAPTER_TYPE_EMMC45:
+ value = QIXIS_READ(brdcfg[5]);
+ value |= (QIXIS_DAT4 | QIXIS_DAT5_6_7);
+ QIXIS_WRITE(brdcfg[5], value);
+ break;
+ case QIXIS_ESDHC_ADAPTER_TYPE_SDMMC_LEGACY:
+ value = QIXIS_READ(pwr_ctl[1]);
+ value |= QIXIS_EVDD_BY_SDHC_VS;
+ QIXIS_WRITE(pwr_ctl[1], value);
+ break;
+ case QIXIS_ESDHC_ADAPTER_TYPE_EMMC44:
+ value = QIXIS_READ(brdcfg[5]);
+ value |= (QIXIS_SDCLKIN | QIXIS_SDCLKOUT);
+ QIXIS_WRITE(brdcfg[5], value);
+ break;
+ default:
+ break;
+ }
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+
+ /*
+ * Remap Boot flash + PROMJET region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash + promjet */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+
+ /* Disable remote I2C connection to qixis fpga */
+ QIXIS_WRITE(brdcfg[5], QIXIS_READ(brdcfg[5]) & ~BRDCFG5_IRE);
+
+ /*
+ * Adjust core voltage according to voltage ID
+ * This function changes I2C mux to channel 2.
+ */
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+
+ brd_mux_lane_to_slot();
+ select_i2c_ch_pca9547(I2C_MUX_CH_DEFAULT, 0);
+ esdhc_adapter_card_ident();
+ return 0;
+}
+
+unsigned long get_board_sys_clk(void)
+{
+ u8 sysclk_conf = QIXIS_READ(brdcfg[1]);
+#ifdef CONFIG_FSL_QIXIS_CLOCK_MEASUREMENT
+ /* use accurate clock measurement */
+ int freq = QIXIS_READ(clk_freq[0]) << 8 | QIXIS_READ(clk_freq[1]);
+ int base = QIXIS_READ(clk_base[0]) << 8 | QIXIS_READ(clk_base[1]);
+ u32 val;
+
+ val = freq * base;
+ if (val) {
+ debug("SYS Clock measurement is: %d\n", val);
+ return val;
+ } else {
+ printf("Warning: SYS clock measurement is invalid, ");
+ printf("using value from brdcfg1.\n");
+ }
+#endif
+
+ switch (sysclk_conf & 0x0F) {
+ case QIXIS_SYSCLK_83:
+ return 83333333;
+ case QIXIS_SYSCLK_100:
+ return 100000000;
+ case QIXIS_SYSCLK_125:
+ return 125000000;
+ case QIXIS_SYSCLK_133:
+ return 133333333;
+ case QIXIS_SYSCLK_150:
+ return 150000000;
+ case QIXIS_SYSCLK_160:
+ return 160000000;
+ case QIXIS_SYSCLK_166:
+ return 166666666;
+ }
+ return 66666666;
+}
+
+unsigned long get_board_ddr_clk(void)
+{
+ u8 ddrclk_conf = QIXIS_READ(brdcfg[1]);
+#ifdef CONFIG_FSL_QIXIS_CLOCK_MEASUREMENT
+ /* use accurate clock measurement */
+ int freq = QIXIS_READ(clk_freq[2]) << 8 | QIXIS_READ(clk_freq[3]);
+ int base = QIXIS_READ(clk_base[0]) << 8 | QIXIS_READ(clk_base[1]);
+ u32 val;
+
+ val = freq * base;
+ if (val) {
+ debug("DDR Clock measurement is: %d\n", val);
+ return val;
+ } else {
+ printf("Warning: DDR clock measurement is invalid, ");
+ printf("using value from brdcfg1.\n");
+ }
+#endif
+
+ switch ((ddrclk_conf & 0x30) >> 4) {
+ case QIXIS_DDRCLK_100:
+ return 100000000;
+ case QIXIS_DDRCLK_125:
+ return 125000000;
+ case QIXIS_DDRCLK_133:
+ return 133333333;
+ }
+ return 66666666;
+}
+
+int misc_init_r(void)
+{
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+ fdt_fixup_board_enet(blob);
+#endif
+
+ return 0;
+}
diff --git a/board/freescale/t208xqds/t208xqds.h b/board/freescale/t208xqds/t208xqds.h
new file mode 100644
index 00000000000..50ebb6f6f98
--- /dev/null
+++ b/board/freescale/t208xqds/t208xqds.h
@@ -0,0 +1,12 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2011-2013 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __CORENET_DS_H__
+#define __CORENET_DS_H__
+
+void fdt_fixup_board_enet(void *blob);
+void pci_of_setup(void *blob, struct bd_info *bd);
+
+#endif
diff --git a/board/freescale/t208xqds/t208xqds_qixis.h b/board/freescale/t208xqds/t208xqds_qixis.h
new file mode 100644
index 00000000000..0f9a45a6fd4
--- /dev/null
+++ b/board/freescale/t208xqds/t208xqds_qixis.h
@@ -0,0 +1,48 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __T208xQDS_QIXIS_H__
+#define __T208xQDS_QIXIS_H__
+
+/* Definitions of QIXIS Registers for T208xQDS */
+
+#define QIXIS_SRDS1CLK_122 0x5a
+#define QIXIS_SRDS1CLK_125 0x5e
+
+
+/* BRDCFG4[4:7]] select EC1 and EC2 as a pair */
+#define BRDCFG4_EMISEL_MASK 0xE0
+#define BRDCFG4_EMISEL_SHIFT 5
+
+/* SYSCLK */
+#define QIXIS_SYSCLK_66 0x0
+#define QIXIS_SYSCLK_83 0x1
+#define QIXIS_SYSCLK_100 0x2
+#define QIXIS_SYSCLK_125 0x3
+#define QIXIS_SYSCLK_133 0x4
+#define QIXIS_SYSCLK_150 0x5
+#define QIXIS_SYSCLK_160 0x6
+#define QIXIS_SYSCLK_166 0x7
+
+/* DDRCLK */
+#define QIXIS_DDRCLK_66 0x0
+#define QIXIS_DDRCLK_100 0x1
+#define QIXIS_DDRCLK_125 0x2
+#define QIXIS_DDRCLK_133 0x3
+
+#define BRDCFG5_IRE 0x20 /* i2c Remote i2c1 enable */
+
+#define BRDCFG9_SFP_TX_EN 0x10
+
+#define BRDCFG12_SD3EN_MASK 0x20
+#define BRDCFG12_SD3MX_MASK 0x08
+#define BRDCFG12_SD3MX_SLOT5 0x08
+#define BRDCFG12_SD3MX_SLOT6 0x00
+#define BRDCFG12_SD4EN_MASK 0x04
+#define BRDCFG12_SD4MX_MASK 0x03
+#define BRDCFG12_SD4MX_SLOT7 0x02
+#define BRDCFG12_SD4MX_SLOT8 0x01
+#define BRDCFG12_SD4MX_AURO_SATA 0x00
+#endif
diff --git a/board/freescale/t208xqds/tlb.c b/board/freescale/t208xqds/tlb.c
new file mode 100644
index 00000000000..f99d51c8cd7
--- /dev/null
+++ b/board/freescale/t208xqds/tlb.c
@@ -0,0 +1,153 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2013 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 1M SRAM, the address of the
+ * SRAM is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#elif defined(CONFIG_SRIO_PCIE_BOOT_SLAVE)
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. When slave boot, the address of the
+ * space is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* *I*G* - PCIe 1, 0x80000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_512M, 1),
+
+ /* *I*G* - PCIe 2, 0xa0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE2_MEM_VIRT, CFG_SYS_PCIE2_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCIe 3, 0xb0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE3_MEM_VIRT, CFG_SYS_PCIE3_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_256M, 1),
+
+
+ /* *I*G* - PCIe 4, 0xc0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE4_MEM_VIRT, CFG_SYS_PCIE4_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 7, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 9, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_16M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 11, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 12, BOOKE_PAGESZ_16M, 1),
+#endif
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 13, BOOKE_PAGESZ_32M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ /*
+ * *I*G - NAND
+ * entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so we use entry 16 for nand.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 16, BOOKE_PAGESZ_64K, 1),
+#endif
+#ifdef QIXIS_BASE_PHYS
+ SET_TLB_ENTRY(1, QIXIS_BASE, QIXIS_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 17, BOOKE_PAGESZ_4K, 1),
+#endif
+#ifdef CONFIG_SRIO_PCIE_BOOT_SLAVE
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. 1M space from 0xffe00000 for
+ * fetching ucode and ENV from master
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 18, BOOKE_PAGESZ_1M, 1),
+#endif
+
+#if defined(CONFIG_RAMBOOT_PBL) && !defined(CONFIG_SPL_BUILD)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 19, BOOKE_PAGESZ_2G, 1)
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/t208xrdb/Kconfig b/board/freescale/t208xrdb/Kconfig
new file mode 100644
index 00000000000..35d884e6ccb
--- /dev/null
+++ b/board/freescale/t208xrdb/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_T2080RDB
+
+config SYS_BOARD
+ default "t208xrdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "T208xRDB"
+
+config T2080RDB_REV_D
+ bool "Support for T2080RDB revisions D and up"
+
+endif
diff --git a/board/freescale/t208xrdb/MAINTAINERS b/board/freescale/t208xrdb/MAINTAINERS
new file mode 100644
index 00000000000..5be7a25c03b
--- /dev/null
+++ b/board/freescale/t208xrdb/MAINTAINERS
@@ -0,0 +1,14 @@
+T208XRDB BOARD
+M: Shengzhou Liu <Shengzhou.Liu@nxp.com>
+S: Maintained
+F: board/freescale/t208xrdb/
+F: include/configs/T208xRDB.h
+F: configs/T2080RDB_defconfig
+F: configs/T2080RDB_NAND_defconfig
+F: configs/T2080RDB_SDCARD_defconfig
+F: configs/T2080RDB_SPIFLASH_defconfig
+F: configs/T2080RDB_SRIO_PCIE_BOOT_defconfig
+F: configs/T2080RDB_revD_defconfig
+F: configs/T2080RDB_revD_NAND_defconfig
+F: configs/T2080RDB_revD_SDCARD_defconfig
+F: configs/T2080RDB_revD_SPIFLASH_defconfig
diff --git a/board/freescale/t208xrdb/Makefile b/board/freescale/t208xrdb/Makefile
new file mode 100644
index 00000000000..7af3cd0ac4c
--- /dev/null
+++ b/board/freescale/t208xrdb/Makefile
@@ -0,0 +1,15 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+else
+obj-$(CONFIG_TARGET_T2080RDB) += t208xrdb.o eth_t208xrdb.o cpld.o
+endif
+
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/t208xrdb/README b/board/freescale/t208xrdb/README
new file mode 100644
index 00000000000..533054bfe19
--- /dev/null
+++ b/board/freescale/t208xrdb/README
@@ -0,0 +1,288 @@
+T2080PCIe-RDB is a Freescale Reference Design Board that hosts the T2080 SoC.
+It can work in two mode: standalone mode and PCIe endpoint mode.
+
+T2080 SoC Overview
+------------------
+The T2080 QorIQ multicore processor combines four dual-threaded e6500 Power
+Architecture processor cores with high-performance datapath acceleration
+logic and network and peripheral bus interfaces required for networking,
+telecom/datacom, wireless infrastructure, and mil/aerospace applications.
+
+T2080 includes the following functions and features:
+ - Four dual-threads 64-bit Power architecture e6500 cores, up to 1.8GHz
+ - 2MB L2 cache and 512KB CoreNet platform cache (CPC)
+ - Hierarchical interconnect fabric
+ - One 32-/64-bit DDR3/3L SDRAM memory controllers with ECC and interleaving
+ - Data Path Acceleration Architecture (DPAA) incorporating acceleration
+ - 16 SerDes lanes up to 10.3125 GHz
+ - 8 Ethernet interfaces, supporting combinations of the following:
+ - Up to four 10 Gbps Ethernet MACs
+ - Up to eight 1 Gbps Ethernet MACs
+ - Up to four 2.5 Gbps Ethernet MACs
+ - High-speed peripheral interfaces
+ - Four PCI Express controllers (two PCIe 2.0 and two PCIe 3.0 with SR-IOV)
+ - Two Serial RapidIO 2.0 controllers/ports running at up to 5 GHz
+ - Additional peripheral interfaces
+ - Two serial ATA (SATA 2.0) controllers
+ - Two high-speed USB 2.0 controllers with integrated PHY
+ - Enhanced secure digital host controller (SD/SDHC/SDXC/eMMC)
+ - Enhanced serial peripheral interface (eSPI)
+ - Four I2C controllers
+ - Four 2-pin UARTs or two 4-pin UARTs
+ - Integrated Flash Controller supporting NAND and NOR flash
+ - Three eight-channel DMA engines
+ - Support for hardware virtualization and partitioning enforcement
+ - QorIQ Platform's Trust Architecture 2.0
+
+User Guide
+----------
+The T2080RDB User Guide is available on the web at
+https://www.nxp.com/docs/en/user-guide/T2080RDBPCUG.pdf
+
+Differences between T2080 and T2081
+-----------------------------------
+ Feature T2080 T2081
+ 1G Ethernet numbers: 8 6
+ 10G Ethernet numbers: 4 2
+ SerDes lanes: 16 8
+ Serial RapidIO,RMan: 2 no
+ SATA Controller: 2 no
+ Aurora: yes no
+ SoC Package: 896-pins 780-pins
+
+
+T2080PCIe-RDB board Overview
+----------------------------
+ - SERDES Configuration
+ - SerDes-1 Lane A-B: to two 10GBase-R fiber (MAC9 & MAC10)
+ - SerDes-1 Lane C-D: to two 10G Base-T (MAC1 & MAC2)
+ - SerDes-1 Lane E-H: to PCIe Goldfinger (PCIe4 x4, Gen3)
+ - SerDes-2 Lane A-D: to PCIe Slot (PCIe1 x4, Gen2)
+ - SerDes-2 Lane E-F: to C293 secure co-processor (PCIe2 x2)
+ - SerDes-2 Lane G-H: to SATA1 & SATA2
+ - Ethernet
+ - Two on-board 10M/100M/1G RGMII ethernet ports
+ - Two on-board 10GBase-R fiber ports
+ - Two on-board 10Gbps Base-T copper ports
+ - DDR Memory
+ - Supports 72bit 4GB DDR3-LP SODIMM
+ - PCIe
+ - One PCIe x4 gold-finger
+ - One PCIe x4 connector
+ - One PCIe x2 end-point device (C293 Crypto co-processor)
+ - IFC/Local Bus
+ - NOR: 128MB 16-bit NOR Flash
+ - NAND: 1GB 8-bit NAND flash
+ - CPLD: for system controlling with programable header on-board
+ - SATA
+ - Two SATA 2.0 onnectors on-board
+ - USB
+ - Supports two USB 2.0 ports with integrated PHYs
+ - Two type A ports with 5V@1.5A per port.
+ - SDHC
+ - one TF-card connector on-board
+ - SPI
+ - On-board 64MB SPI flash
+ - Other
+ - Two Serial ports
+ - Four I2C ports
+
+
+System Memory map
+-----------------
+Start Address End Address Description Size
+0xF_FFDF_0000 0xF_FFDF_0FFF IFC - CPLD 4KB
+0xF_FF80_0000 0xF_FF80_FFFF IFC - NAND Flash 64KB
+0xF_FE00_0000 0xF_FEFF_FFFF CCSRBAR 16MB
+0xF_F803_0000 0xF_F803_FFFF PCI Express 4 I/O Space 64KB
+0xF_F802_0000 0xF_F802_FFFF PCI Express 3 I/O Space 64KB
+0xF_F801_0000 0xF_F801_FFFF PCI Express 2 I/O Space 64KB
+0xF_F800_0000 0xF_F800_FFFF PCI Express 1 I/O Space 64KB
+0xF_F600_0000 0xF_F7FF_FFFF Queue manager software portal 32MB
+0xF_F400_0000 0xF_F5FF_FFFF Buffer manager software portal 32MB
+0xF_E800_0000 0xF_EFFF_FFFF IFC - NOR Flash 128MB
+0xF_0000_0000 0xF_003F_FFFF DCSR 4MB
+0xC_4000_0000 0xC_4FFF_FFFF PCI Express 4 Mem Space 256MB
+0xC_3000_0000 0xC_3FFF_FFFF PCI Express 3 Mem Space 256MB
+0xC_2000_0000 0xC_2FFF_FFFF PCI Express 2 Mem Space 256MB
+0xC_0000_0000 0xC_1FFF_FFFF PCI Express 1 Mem Space 512MB
+0x0_0000_0000 0x0_ffff_ffff DDR 4GB
+
+
+128M NOR Flash memory Map
+-------------------------
+Start Address End Address Definition Max size
+0xEFF40000 0xEFFFFFFF U-Boot (current bank) 768KB
+0xEFF20000 0xEFF3FFFF U-Boot env (current bank) 128KB
+0xEFF00000 0xEFF1FFFF FMAN Ucode (current bank) 128KB
+0xEFE00000 0xEFE3FFFF PHY CS4315 firmware 256KB
+0xED300000 0xEFEFFFFF rootfs (alt bank) 44MB
+0xEC800000 0xEC8FFFFF Hardware device tree (alt bank) 1MB
+0xEC020000 0xEC7FFFFF Linux.uImage (alt bank) 7MB + 875KB
+0xEC000000 0xEC01FFFF RCW (alt bank) 128KB
+0xEBF40000 0xEBFFFFFF U-Boot (alt bank) 768KB
+0xEBF20000 0xEBF3FFFF U-Boot env (alt bank) 128KB
+0xEBF00000 0xEBF1FFFF FMAN ucode (alt bank) 128KB
+0xEBE00000 0xEBE3FFFF PHY CS4315 firmware (alt bank) 256KB
+0xE9300000 0xEBEFFFFF rootfs (current bank) 44MB
+0xE8800000 0xE88FFFFF Hardware device tree (cur bank) 1MB
+0xE8020000 0xE86FFFFF Linux.uImage (current bank) 7MB + 875KB
+0xE8000000 0xE801FFFF RCW (current bank) 128KB
+
+
+T2080PCIe-RDB Ethernet Port Map
+-------------------------------
+Label In Uboot In Linux FMan Address Comments PHY
+ETH0 FM1@GTEC1 fm1-mac9 0xfe4f0000 10G SFP+ (CS4315)
+ETH1 FM1@GTEC2 fm1-mac10 0xfe4f2000 10G SFP+ (CS4315)
+ETH2 FM1@GTEC3 fm1-mac1 0xfe4e0000 10G Base-T (AQ1202)
+ETH3 FM1@GTEC4 fm1-mac2 0xfe4e2000 10G Base-T (AQ1202)
+ETH4 FM1@DTSEC3 fm1-mac3 0xfe4e4000 1G RGMII (RTL8211E)
+ETH5 FM1@DTSEC4 fm1-mac4 0xfe4e6000 1G RGMII (RTL8211E)
+
+
+T2080PCIe-RDB Default DIP-Switch setting
+----------------------------------------
+SW1[1:8] = '00010011'
+SW2[1:8] = '10111111'
+SW3[1:8] = '11100001'
+
+Software configurations and board settings
+------------------------------------------
+1. NOR boot:
+ a. build NOR boot image
+ $ make T2080RDB_config
+ $ make
+ b. program u-boot.bin image to NOR flash
+ => tftp 1000000 u-boot.bin
+ => pro off all;era eff40000 efffffff;cp.b 1000000 eff40000 $filesize
+ set SW1[1:8] = '00010011', SW2[1] = '1', SW3[4] = '0' for NOR boot
+
+ Switching between default bank and alternate bank on NOR flash
+ To change boot source to vbank4:
+ via software: run command 'cpld reset altbank' in U-Boot.
+ via DIP-switch: set SW3[5:7] = '100'
+
+ To change boot source to vbank0:
+ via software: run command 'cpld reset' in U-Boot.
+ via DIP-Switch: set SW3[5:7] = '000'
+
+2. NAND Boot:
+ a. build PBL image for NAND boot
+ $ make T2080RDB_NAND_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to NAND flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => nand erase 0 d0000
+ => nand write 1000000 0 $filesize
+ set SW1[1:8] = '10000010', SW2[1] = '1', SW3[4] = '1' for NAND boot
+
+3. SPI Boot:
+ a. build PBL image for SPI boot
+ $ make T2080RDB_SPIFLASH_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to SPI flash
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => sf probe 0
+ => sf erase 0 d0000
+ => sf write 1000000 0 $filesize
+ set SW1[1:8] = '00100010', SW2[1] ='1' for SPI boot
+
+4. SD Boot:
+ a. build PBL image for SD boot
+ $ make T2080RDB_SDCARD_config
+ $ make
+ b. program u-boot-with-spl-pbl.bin to micro-SD/TF card
+ => tftp 1000000 u-boot-with-spl-pbl.bin
+ => mmc write 1000000 8 0x800
+ set SW1[1:8] = '00100000', SW2[1] = '0' for SD boot
+
+
+2-stage NAND/SPI/SD boot loader
+-------------------------------
+PBL initializes the internal CPC-SRAM and copy SPL(160K) to SRAM.
+SPL further initializes DDR using SPD and environment variables
+and copy U-Boot(768 KB) from NAND/SPI/SD device to DDR.
+Finally SPL transers control to U-Boot for futher booting.
+
+SPL has following features:
+ - Executes within 256K
+ - No relocation required
+
+Run time view of SPL framework
+-------------------------------------------------
+|Area | Address |
+-------------------------------------------------
+|SecureBoot header | 0xFFFC0000 (32KB) |
+-------------------------------------------------
+|GD, BD | 0xFFFC8000 (4KB) |
+-------------------------------------------------
+|ENV | 0xFFFC9000 (8KB) |
+-------------------------------------------------
+|HEAP | 0xFFFCB000 (50KB) |
+-------------------------------------------------
+|STACK | 0xFFFD8000 (22KB) |
+-------------------------------------------------
+|U-Boot SPL | 0xFFFD8000 (160KB) |
+-------------------------------------------------
+
+NAND Flash memory Map on T2080RDB
+--------------------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot img 1MB (2 blocks)
+0x100000 0x17FFFF U-Boot env 512KB (1 block)
+0x180000 0x1FFFFF FMAN ucode 512KB (1 block)
+0x200000 0x27FFFF CS4315 ucode 512KB (1 block)
+
+
+Micro SD Card memory Map on T2080RDB
+----------------------------------------------------
+Block #blocks Definition Size
+0x008 2048 U-Boot img 1MB
+0x800 0016 U-Boot env 8KB
+0x820 0128 FMAN ucode 64KB
+0x8a0 0512 CS4315 ucode 256KB
+
+
+SPI Flash memory Map on T2080RDB
+----------------------------------------------------
+Start End Definition Size
+0x000000 0x0FFFFF U-Boot img 1MB
+0x100000 0x101FFF U-Boot env 8KB
+0x110000 0x11FFFF FMAN ucode 64KB
+0x120000 0x15FFFF CS4315 ucode 256KB
+
+
+How to update the ucode of Cortina CS4315/CS4340 10G PHY
+--------------------------------------------------------
+=> tftp 1000000 CS4315-CS4340-PHY-ucode.txt
+=> pro off all;era 0xefe00000 0xefefffff;cp.b 1000000 0xefe00000 $filesize
+
+
+How to update the ucode of Freescale FMAN
+-----------------------------------------
+=> tftp 1000000 fsl_fman_ucode_t2080_r1.0.bin
+=> pro off all;erase 0xeff00000 0xeff1ffff;cp 1000000 0xeff00000 $filesize
+
+
+For more details, please refer to T2080PCIe-RDB User Guide and access
+website www.freescale.com and Freescale QorIQ SDK Infocenter document.
+
+Device tree support and how to enable it for different configs
+--------------------------------------------------------------
+Device tree support is available for t2080rdb for below mentioned boot,
+1. NOR Boot
+2. NAND Boot
+3. SD Boot
+4. SPIFLASH Boot
+
+To enable device tree support for other boot, below configs need to be
+enabled in relative defconfig file,
+1. CONFIG_DEFAULT_DEVICE_TREE="t2080rdb" (Change default device tree name if required)
+2. CONFIG_OF_CONTROL
+3. CONFIG_MPC85XX_HAVE_RESET_VECTOR if reset vector is located at
+ CFG_RESET_VECTOR_ADDRESS - 0xffc
+
+If device tree support is enabled in defconfig,
+1. use 'u-boot.bin' for NOR boot.
+2. use 'u-boot-with-spl-pbl.bin' for other boot.
diff --git a/board/freescale/t208xrdb/cpld.c b/board/freescale/t208xrdb/cpld.c
new file mode 100644
index 00000000000..d2226af6278
--- /dev/null
+++ b/board/freescale/t208xrdb/cpld.c
@@ -0,0 +1,71 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor
+ *
+ * Freescale T2080RDB board-specific CPLD controlling supports.
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/* Set the boot bank to the alternate bank */
+void cpld_set_altbank(void)
+{
+ u8 reg = CPLD_READ(flash_csr);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_ALTBANK;
+ CPLD_WRITE(flash_csr, reg);
+ CPLD_WRITE(reset_ctl, CPLD_LBMAP_RESET);
+}
+
+/* Set the boot bank to the default bank */
+void cpld_set_defbank(void)
+{
+ u8 reg = CPLD_READ(flash_csr);
+
+ reg = (reg & ~CPLD_BANK_SEL_MASK) | CPLD_LBMAP_DFLTBANK;
+ CPLD_WRITE(flash_csr, reg);
+ CPLD_WRITE(reset_ctl, CPLD_LBMAP_RESET);
+}
+
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else
+ cpld_set_defbank();
+ } else {
+ rc = cmd_usage(cmdtp);
+ }
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset: reset to default bank\n"
+ "cpld reset altbank: reset to alternate bank\n"
+);
diff --git a/board/freescale/t208xrdb/cpld.h b/board/freescale/t208xrdb/cpld.h
new file mode 100644
index 00000000000..3139c2b85fd
--- /dev/null
+++ b/board/freescale/t208xrdb/cpld.h
@@ -0,0 +1,48 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor
+ * Copyright 2021 NXP
+ */
+
+/*
+ * CPLD register set of T2080RDB board-specific.
+ */
+struct cpld_data {
+ u8 chip_id1; /* 0x00 - Chip ID1 register */
+ u8 chip_id2; /* 0x01 - Chip ID2 register */
+ u8 hw_ver; /* 0x02 - Hardware Revision Register */
+ u8 sw_ver; /* 0x03 - Software Revision register */
+ u8 res0[12]; /* 0x04 - 0x0F - not used */
+ u8 reset_ctl; /* 0x10 - Reset control Register */
+ u8 flash_csr; /* 0x11 - Flash control and status register */
+ u8 thermal_csr; /* 0x12 - Thermal control and status register */
+ u8 led_csr; /* 0x13 - LED control and status register */
+ u8 sfp_csr; /* 0x14 - SFP+ control and status register */
+ u8 misc_csr; /* 0x15 - Misc control and status register */
+ u8 boot_or; /* 0x16 - Boot config override register */
+ u8 boot_cfg1; /* 0x17 - Boot configuration register 1 */
+ u8 boot_cfg2; /* 0x18 - Boot configuration register 2 */
+};
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value) \
+ cpld_write(offsetof(struct cpld_data, reg), value)
+
+/* CPLD on IFC */
+#define CPLD_LBMAP_MASK 0x3F
+#define CPLD_BANK_SEL_MASK 0x07
+#define CPLD_BANK_OVERRIDE 0x40
+#define CPLD_LBMAP_ALTBANK 0x44 /* BANK OR | BANK 4 */
+#define CPLD_LBMAP_DFLTBANK 0x40 /* BANK OR | BANK 0 */
+#define CPLD_LBMAP_RESET 0xFF
+#define CPLD_LBMAP_SHIFT 0x03
+#define CPLD_BOOT_SEL 0x80
+
+/* RSTCON Register */
+#define CPLD_RSTCON_EDC_RST 0x04
+
+/* MISCCSR Register */
+#define CPLD_MISC_POR_EN 0x30
diff --git a/board/freescale/t208xrdb/ddr.c b/board/freescale/t208xrdb/ddr.c
new file mode 100644
index 00000000000..fe98f62668a
--- /dev/null
+++ b/board/freescale/t208xrdb/ddr.c
@@ -0,0 +1,118 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 1) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ pbsp = udimms[0];
+
+ /* Get clk_adjust, wrlvl_start, wrlvl_ctl, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks &&
+ (pdimm->rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found");
+ printf("for data rate %lu MT/s\n", ddr_freq);
+ printf("Trying to use the highest speed (%u) parameters\n",
+ pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x, "
+ "wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x54;
+}
+
+int dram_init(void)
+{
+ phys_size_t dram_size;
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_RAMBOOT_PBL)
+ puts("Initializing....using SPD\n");
+ dram_size = fsl_ddr_sdram();
+#else
+ /* DDR has been initialised by first stage boot loader */
+ dram_size = fsl_ddr_sdram_size();
+#endif
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/t208xrdb/ddr.h b/board/freescale/t208xrdb/ddr.h
new file mode 100644
index 00000000000..c00f1781667
--- /dev/null
+++ b/board/freescale/t208xrdb/ddr.h
@@ -0,0 +1,46 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl |
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3 |
+ */
+ {2, 1200, 2, 10, 7, 0x0808090a, 0x0b0c0c0a},
+ {2, 1500, 2, 10, 6, 0x07070809, 0x0a0b0b09},
+ {2, 1600, 2, 10, 8, 0x0808070b, 0x0c0d0e0a},
+ {2, 1700, 2, 8, 7, 0x080a0a0c, 0x0c0d0e0a},
+ {2, 1900, 0, 10, 7, 0x0808080c, 0x0b0c0c09},
+ {1, 1200, 2, 10, 7, 0x0808090a, 0x0b0c0c0a},
+ {1, 1500, 2, 10, 6, 0x07070809, 0x0a0b0b09},
+ {1, 1600, 2, 10, 8, 0x0808070b, 0x0c0d0e0a},
+ {1, 1700, 2, 8, 7, 0x080a0a0c, 0x0c0d0e0a},
+ {1, 1900, 0, 10, 7, 0x0808080c, 0x0b0c0c09},
+ {}
+};
+
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+#endif
diff --git a/board/freescale/t208xrdb/eth_t208xrdb.c b/board/freescale/t208xrdb/eth_t208xrdb.c
new file mode 100644
index 00000000000..5223eccb280
--- /dev/null
+++ b/board/freescale/t208xrdb/eth_t208xrdb.c
@@ -0,0 +1,100 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ *
+ * Shengzhou Liu <Shengzhou.Liu@freescale.com>
+ */
+
+#include <command.h>
+#include <fdt_support.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_portals.h>
+#include <asm/fsl_liodn.h>
+#include <malloc.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <miiphy.h>
+#include <phy.h>
+#include <fsl_dtsec.h>
+#include <asm/fsl_serdes.h>
+
+extern u8 get_hw_revision(void);
+
+/* Disable the MAC5 and MAC6 "fsl,fman-memac" nodes and the two
+ * "fsl,dpa-ethernet" nodes that reference them.
+ */
+void fdt_fixup_board_fman_ethernet(void *fdt)
+{
+ int mac_off, eth_off, i;
+ char mac_path[2][42] = {
+ "/soc@ffe000000/fman@400000/ethernet@e8000",
+ "/soc@ffe000000/fman@400000/ethernet@ea000",
+ };
+ u32 eth_ph;
+
+ for (i = 0; i < 2; i++) {
+ /* Disable the MAC node */
+ mac_off = fdt_path_offset(fdt, mac_path[i]);
+ if (mac_off < 0)
+ continue;
+ fdt_status_disabled(fdt, mac_off);
+
+ /* Disable the fsl,dpa-ethernet node that points to the MAC.
+ * The fsl,fman-mac property refers to the MAC's phandle.
+ */
+ eth_ph = fdt_get_phandle(fdt, mac_off);
+ if (eth_ph <= 0)
+ continue;
+
+ eth_off = fdt_node_offset_by_prop_value(fdt, -1, "fsl,fman-mac",
+ &eth_ph,
+ sizeof(eth_ph));
+ if (eth_off >= 0)
+ fdt_status_disabled(fdt, eth_off);
+ }
+}
+
+/* Update the address of the second Aquantia PHY on boards revision D and up.
+ * Also rename the PHY node to align with the address change.
+ */
+void fdt_fixup_board_phy(void *fdt)
+{
+ const char phy_path[] =
+ "/soc@ffe000000/fman@400000/mdio@fd000/ethernet-phy@1";
+ int ret, offset, new_addr = AQR113C_PHY_ADDR2;
+ char new_name[] = "ethernet-phy@00";
+
+ if (get_hw_revision() == 'C')
+ return;
+
+ offset = fdt_path_offset(fdt, phy_path);
+ if (offset < 0) {
+ printf("ethernet-phy@1 node not found in the dts\n");
+ return;
+ }
+
+ ret = fdt_setprop(fdt, offset, "reg", &new_addr, sizeof(new_addr));
+ if (ret < 0) {
+ printf("Unable to set 'reg' for node ethernet-phy@1: %s\n",
+ fdt_strerror(ret));
+ return;
+ }
+
+ sprintf(new_name, "ethernet-phy@%x", new_addr);
+ ret = fdt_set_name(fdt, offset, new_name);
+ if (ret < 0)
+ printf("Unable to rename node ethernet-phy@1: %s\n",
+ fdt_strerror(ret));
+}
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ return;
+}
diff --git a/board/freescale/t208xrdb/law.c b/board/freescale/t208xrdb/law.c
new file mode 100644
index 00000000000..e1f570a8935
--- /dev/null
+++ b/board/freescale/t208xrdb/law.c
@@ -0,0 +1,33 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2014 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_IFC),
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef CFG_SYS_CPLD_BASE_PHYS
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ /* Limit DCSR to 32M to access NPC Trace Buffer */
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_1M, LAW_TRGT_IF_IFC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/t208xrdb/spl.c b/board/freescale/t208xrdb/spl.c
new file mode 100644
index 00000000000..df3b9c6fe40
--- /dev/null
+++ b/board/freescale/t208xrdb/spl.c
@@ -0,0 +1,101 @@
+// SPDX-License-Identifier: GPL-2.0+
+/* Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env_internal.h>
+#include <init.h>
+#include <malloc.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <i2c.h>
+#include <mmc.h>
+#include <fsl_esdhc.h>
+#include <spi_flash.h>
+#include <asm/global_data.h>
+#include "../common/spl.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L3_SIZE;
+}
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, sys_clk, ccb_clk;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ /* Memcpy existing GD at CONFIG_SPL_GD_ADDR */
+ memcpy((void *)CONFIG_SPL_GD_ADDR, (void *)gd, sizeof(gd_t));
+
+ /* Update GD pointer */
+ gd = (gd_t *)(CONFIG_SPL_GD_ADDR);
+
+ console_init_f();
+
+ /* initialize selected port with appropriate baud rate */
+ sys_clk = get_board_sys_clk();
+ plat_ratio = (in_be32(&gur->rcwsr[0]) >> 25) & 0x1f;
+ ccb_clk = sys_clk * plat_ratio / 2;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ ccb_clk / 16 / CONFIG_BAUDRATE);
+
+#if defined(CONFIG_SPL_MMC_BOOT)
+ puts("\nSD boot...\n");
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ puts("\nSPI boot...\n");
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ puts("\nNAND boot...\n");
+#endif
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, (gd_t *)CONFIG_SPL_GD_ADDR, 0x0);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ struct bd_info *bd;
+
+ bd = (struct bd_info *)(gd + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_SPL_RELOC_MALLOC_ADDR,
+ CONFIG_SPL_RELOC_MALLOC_SIZE);
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+#ifdef CONFIG_SPL_NAND_BOOT
+ nand_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_initialize(bd);
+ mmc_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+#ifdef CONFIG_SPL_SPI_BOOT
+ fsl_spi_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+#endif
+
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+
+ i2c_init_all();
+
+ dram_init();
+
+#ifdef CONFIG_SPL_MMC_BOOT
+ mmc_boot();
+#elif defined(CONFIG_SPL_SPI_BOOT)
+ fsl_spi_boot();
+#elif defined(CONFIG_SPL_NAND_BOOT)
+ nand_boot();
+#endif
+}
diff --git a/board/freescale/t208xrdb/t2080_nand_rcw.cfg b/board/freescale/t208xrdb/t2080_nand_rcw.cfg
new file mode 100644
index 00000000000..8096ff9f372
--- /dev/null
+++ b/board/freescale/t208xrdb/t2080_nand_rcw.cfg
@@ -0,0 +1,19 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=1600MT/s
+#120c0017 15000000 00000000 00000000
+#66150002 00008400 ec104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1600MT/s
+#1206001b 15000000 00000000 00000000
+
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1867MT/s
+1207001b 15000000 00000000 00000000
+66150002 00000000 e8104000 c1000000
+00800000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xrdb/t2080_pbi.cfg b/board/freescale/t208xrdb/t2080_pbi.cfg
new file mode 100644
index 00000000000..43be8a864e3
--- /dev/null
+++ b/board/freescale/t208xrdb/t2080_pbi.cfg
@@ -0,0 +1,40 @@
+#
+# Copyright 2013 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Refer doc/README.pblimage for more details about how-to configure
+# and create PBL boot image
+#
+
+#PBI commands
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#512KB SRAM
+09010100 00000000
+09010104 fff80009
+09010f00 08000000
+#enable CPC1
+09010000 80000000
+#Configure LAW for CPC1
+09000d00 00000000
+09000d04 fff80000
+09000d08 81000012
+#Initialize eSPI controller, default configuration is slow for eSPI to
+#load data, this configuration comes from u-boot eSPI driver.
+09110000 80000403
+09110020 2d170008
+09110024 00100008
+09110028 00100008
+0911002c 00100008
+#Errata for slowing down the MDC clock to make it <= 2.5 MHZ
+094fc030 00008148
+094fd030 00008148
+#Configure alternate space
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Flush PBL data
+091380c0 00100000
diff --git a/board/freescale/t208xrdb/t2080_sd_rcw.cfg b/board/freescale/t208xrdb/t2080_sd_rcw.cfg
new file mode 100644
index 00000000000..6309b1d2200
--- /dev/null
+++ b/board/freescale/t208xrdb/t2080_sd_rcw.cfg
@@ -0,0 +1,19 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=1600MT/s
+#120c0017 15000000 00000000 00000000
+#66150002 00008400 ec104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1600MT/s
+#1206001b 15000000 00000000 00000000
+
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1867MT/s
+1207001b 15000000 00000000 00000000
+66150002 00000000 68104000 c1000000
+00800000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xrdb/t2080_spi_rcw.cfg b/board/freescale/t208xrdb/t2080_spi_rcw.cfg
new file mode 100644
index 00000000000..f1674958870
--- /dev/null
+++ b/board/freescale/t208xrdb/t2080_spi_rcw.cfg
@@ -0,0 +1,19 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+
+#For T2080 v1.0
+#SerDes=0x66_0x16, Core=1533MHz, DDR=1600MT/s
+#120c0017 15000000 00000000 00000000
+#66150002 00008400 ec104000 c1000000
+#00000000 00000000 00000000 000307fc
+#00000000 00000000 00000000 00000004
+
+#For T2080 v1.1
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1600MT/s
+#1206001b 15000000 00000000 00000000
+
+#SerDes=0x66_0x15, Core:1800MHz, DDR:1867MT/s
+1207001b 15000000 00000000 00000000
+66150002 00000000 58104000 c1000000
+00800000 00000000 00000000 000307fc
+00000000 00000000 00000000 00000004
diff --git a/board/freescale/t208xrdb/t208xrdb.c b/board/freescale/t208xrdb/t208xrdb.c
new file mode 100644
index 00000000000..d93edf007ad
--- /dev/null
+++ b/board/freescale/t208xrdb/t208xrdb.c
@@ -0,0 +1,188 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2009-2013 Freescale Semiconductor, Inc.
+ * Copyright 2021-2023 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <image.h>
+#include <init.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <clock_legacy.h>
+#include <fm_eth.h>
+#include "t208xrdb.h"
+#include "cpld.h"
+#include "../common/vid.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+u8 get_hw_revision(void)
+{
+ u8 ver = CPLD_READ(hw_ver);
+
+ switch (ver) {
+ default:
+ case 0x1:
+ return 'C';
+ case 0x0:
+ return 'D';
+ case 0x2:
+ return 'E';
+ }
+}
+
+#if CONFIG_IS_ENABLED(DM_SERIAL)
+int get_serial_clock(void)
+{
+ return get_bus_freq(0) / 2;
+}
+#endif
+
+int checkboard(void)
+{
+ struct cpu_type *cpu = gd->arch.cpu;
+ static const char *freq[3] = {"100.00MHZ", "125.00MHz", "156.25MHZ"};
+
+ printf("Board: %sRDB, ", cpu->name);
+ printf("Board rev: %c CPLD ver: 0x%02x, boot from ",
+ get_hw_revision(), CPLD_READ(sw_ver));
+
+#ifdef CONFIG_SDCARD
+ puts("SD/MMC\n");
+#elif CONFIG_SPIFLASH
+ puts("SPI\n");
+#else
+ u8 reg;
+
+ reg = CPLD_READ(flash_csr);
+
+ if (reg & CPLD_BOOT_SEL) {
+ puts("NAND\n");
+ } else {
+ reg = ((reg & CPLD_LBMAP_MASK) >> CPLD_LBMAP_SHIFT);
+ printf("NOR vBank%d\n", reg);
+ }
+#endif
+
+ puts("SERDES Reference Clocks:\n");
+ printf("SD1_CLK1=%s, SD1_CLK2=%s\n", freq[2], freq[0]);
+ printf("SD2_CLK1=%s, SD2_CLK2=%s\n", freq[0], freq[0]);
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+ /*
+ * Remap Boot flash + PROMJET region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash + promjet */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+
+ /*
+ * Adjust core voltage according to voltage ID
+ * This function changes I2C mux to channel 2.
+ */
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+
+ pci_init();
+
+ return 0;
+}
+
+int misc_init_r(void)
+{
+ u8 reg;
+
+ /* Reset CS4315 PHY */
+ reg = CPLD_READ(reset_ctl);
+ reg |= CPLD_RSTCON_EDC_RST;
+ CPLD_WRITE(reset_ctl, reg);
+
+ /* Enable POR for boards revisions D and up */
+ if (get_hw_revision() >= 'D') {
+ reg = CPLD_READ(misc_csr);
+ reg |= CPLD_MISC_POR_EN;
+ CPLD_WRITE(misc_csr, reg);
+ }
+
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+ fdt_fixup_board_fman_ethernet(blob);
+ fdt_fixup_board_enet(blob);
+ fdt_fixup_board_phy(blob);
+#endif
+
+ return 0;
+}
+
+ulong *cs4340_get_fw_addr(void)
+{
+ ulong cortina_fw_addr = CONFIG_CORTINA_FW_ADDR;
+
+#ifdef CONFIG_SYS_CORTINA_FW_IN_NOR
+ u8 reg;
+
+ reg = CPLD_READ(flash_csr);
+ if (!(reg & CPLD_BOOT_SEL)) {
+ reg = ((reg & CPLD_LBMAP_MASK) >> CPLD_LBMAP_SHIFT);
+ if (reg == 0)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR;
+ else if (reg == 4)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR_ALTBANK;
+ }
+#endif
+
+ return (ulong *)cortina_fw_addr;
+}
diff --git a/board/freescale/t208xrdb/t208xrdb.h b/board/freescale/t208xrdb/t208xrdb.h
new file mode 100644
index 00000000000..26998898e82
--- /dev/null
+++ b/board/freescale/t208xrdb/t208xrdb.h
@@ -0,0 +1,18 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2021 NXP
+ */
+
+#ifndef __CORENET_DS_H__
+#define __CORENET_DS_H__
+
+#define CORTINA_FW_ADDR_IFCNOR 0xefe00000
+#define CORTINA_FW_ADDR_IFCNOR_ALTBANK 0xebe00000
+
+void fdt_fixup_board_enet(void *blob);
+void pci_of_setup(void *blob, struct bd_info *bd);
+void fdt_fixup_board_fman_ethernet(void *blob);
+void fdt_fixup_board_phy(void *blob);
+
+#endif
diff --git a/board/freescale/t208xrdb/tlb.c b/board/freescale/t208xrdb/tlb.c
new file mode 100644
index 00000000000..df5831541f3
--- /dev/null
+++ b/board/freescale/t208xrdb/tlb.c
@@ -0,0 +1,153 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2008-2014 Freescale Semiconductor, Inc.
+ *
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 1M SRAM, the address of the
+ * SRAM is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#elif defined(CONFIG_SRIO_PCIE_BOOT_SLAVE)
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. When slave boot, the address of the
+ * space is at 0xfff00000, it covered the 0xfffff000.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_SLAVE_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_1M, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* *I*G* - PCIe 1, 0x80000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_512M, 1),
+
+ /* *I*G* - PCIe 2, 0xa0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE2_MEM_VIRT, CFG_SYS_PCIE2_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCIe 3, 0xb0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE3_MEM_VIRT, CFG_SYS_PCIE3_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_256M, 1),
+
+
+ /* *I*G* - PCIe 4, 0xc0000000 */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE4_MEM_VIRT, CFG_SYS_PCIE4_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 7, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 9, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_16M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 11, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 12, BOOKE_PAGESZ_16M, 1),
+#endif
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 13, BOOKE_PAGESZ_32M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ /*
+ * *I*G - NAND
+ * entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so we use entry 16 for nand.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 16, BOOKE_PAGESZ_64K, 1),
+#endif
+#ifdef CFG_SYS_CPLD_BASE
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 17, BOOKE_PAGESZ_4K, 1),
+#endif
+#ifdef CONFIG_SRIO_PCIE_BOOT_SLAVE
+ /*
+ * SRIO_PCIE_BOOT-SLAVE. 1M space from 0xffe00000 for
+ * fetching ucode and ENV from master
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR,
+ CFG_SYS_SRIO_PCIE_BOOT_UCODE_ENV_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_G,
+ 0, 18, BOOKE_PAGESZ_1M, 1),
+#endif
+#if defined(CONFIG_RAMBOOT_PBL) && !defined(CONFIG_SPL_BUILD)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 19, BOOKE_PAGESZ_2G, 1)
+#endif
+
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/t4rdb/Kconfig b/board/freescale/t4rdb/Kconfig
new file mode 100644
index 00000000000..d93e4532ac4
--- /dev/null
+++ b/board/freescale/t4rdb/Kconfig
@@ -0,0 +1,12 @@
+if TARGET_T4240RDB
+
+config SYS_BOARD
+ default "t4rdb"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "T4240RDB"
+
+endif
diff --git a/board/freescale/t4rdb/MAINTAINERS b/board/freescale/t4rdb/MAINTAINERS
new file mode 100644
index 00000000000..844a15259c0
--- /dev/null
+++ b/board/freescale/t4rdb/MAINTAINERS
@@ -0,0 +1,7 @@
+T4RDB BOARD
+M: Priyanka Jain <priyanka.jain@nxp.com>
+S: Maintained
+F: board/freescale/t4rdb/
+F: include/configs/T4240RDB.h
+F: configs/T4240RDB_defconfig
+F: configs/T4240RDB_SDCARD_defconfig
diff --git a/board/freescale/t4rdb/Makefile b/board/freescale/t4rdb/Makefile
new file mode 100644
index 00000000000..3106848639c
--- /dev/null
+++ b/board/freescale/t4rdb/Makefile
@@ -0,0 +1,17 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+ifdef CONFIG_SPL_BUILD
+obj-y += spl.o
+else
+obj-$(CONFIG_TARGET_T4240RDB) += t4240rdb.o
+obj-y += cpld.o
+obj-y += eth.o
+endif
+
+obj-y += ddr.o
+obj-y += law.o
+obj-y += tlb.o
diff --git a/board/freescale/t4rdb/cpld.c b/board/freescale/t4rdb/cpld.c
new file mode 100644
index 00000000000..cd14d5895f5
--- /dev/null
+++ b/board/freescale/t4rdb/cpld.c
@@ -0,0 +1,129 @@
+// SPDX-License-Identifier: GPL-2.0+
+/**
+ * Copyright 2014 Freescale Semiconductor
+ *
+ * Author: Chunhe Lan <Chunhe.Lan@freescale.com>
+ *
+ * This file provides support for the board-specific CPLD used on some Freescale
+ * reference boards.
+ *
+ * The following macros need to be defined:
+ *
+ * CFG_SYS_CPLD_BASE - The virtual address of the base of the
+ * CPLD register map
+ *
+ */
+
+#include <config.h>
+#include <command.h>
+#include <asm/io.h>
+
+#include "cpld.h"
+
+u8 cpld_read(unsigned int reg)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ return in_8(p + reg);
+}
+
+void cpld_write(unsigned int reg, u8 value)
+{
+ void *p = (void *)CFG_SYS_CPLD_BASE;
+
+ out_8(p + reg, value);
+}
+
+/**
+ * Set the boot bank to the alternate bank
+ */
+void cpld_set_altbank(void)
+{
+ u8 val, curbank, altbank, override;
+
+ val = CPLD_READ(vbank);
+ curbank = val & CPLD_BANK_SEL_MASK;
+
+ switch (curbank) {
+ case CPLD_SELECT_BANK0:
+ case CPLD_SELECT_BANK4:
+ altbank = CPLD_SELECT_BANK4;
+ CPLD_WRITE(vbank, altbank);
+ override = CPLD_READ(software_on);
+ CPLD_WRITE(software_on, override | CPLD_BANK_SEL_EN);
+ CPLD_WRITE(sys_reset, CPLD_SYSTEM_RESET);
+ break;
+ default:
+ printf("CPLD Altbank Fail: Invalid value!\n");
+ return;
+ }
+}
+
+/**
+ * Set the boot bank to the default bank
+ */
+void cpld_set_defbank(void)
+{
+ u8 val;
+
+ val = CPLD_DEFAULT_BANK;
+
+ CPLD_WRITE(global_reset, val);
+}
+
+#ifdef DEBUG
+static void cpld_dump_regs(void)
+{
+ printf("chip_id1 = 0x%02x\n", CPLD_READ(chip_id1));
+ printf("chip_id2 = 0x%02x\n", CPLD_READ(chip_id2));
+ printf("sw_maj_ver = 0x%02x\n", CPLD_READ(sw_maj_ver));
+ printf("sw_min_ver = 0x%02x\n", CPLD_READ(sw_min_ver));
+ printf("hw_ver = 0x%02x\n", CPLD_READ(hw_ver));
+ printf("software_on = 0x%02x\n", CPLD_READ(software_on));
+ printf("cfg_rcw_src = 0x%02x\n", CPLD_READ(cfg_rcw_src));
+ printf("res0 = 0x%02x\n", CPLD_READ(res0));
+ printf("vbank = 0x%02x\n", CPLD_READ(vbank));
+ printf("sw1_sysclk = 0x%02x\n", CPLD_READ(sw1_sysclk));
+ printf("sw2_status = 0x%02x\n", CPLD_READ(sw2_status));
+ printf("sw3_status = 0x%02x\n", CPLD_READ(sw3_status));
+ printf("sw4_status = 0x%02x\n", CPLD_READ(sw4_status));
+ printf("sys_reset = 0x%02x\n", CPLD_READ(sys_reset));
+ printf("global_reset = 0x%02x\n", CPLD_READ(global_reset));
+ printf("res1 = 0x%02x\n", CPLD_READ(res1));
+ putc('\n');
+}
+#endif
+
+#ifndef CONFIG_SPL_BUILD
+int do_cpld(struct cmd_tbl *cmdtp, int flag, int argc, char *const argv[])
+{
+ int rc = 0;
+
+ if (argc <= 1)
+ return cmd_usage(cmdtp);
+
+ if (strcmp(argv[1], "reset") == 0) {
+ if (strcmp(argv[2], "altbank") == 0)
+ cpld_set_altbank();
+ else
+ cpld_set_defbank();
+#ifdef DEBUG
+ } else if (strcmp(argv[1], "dump") == 0) {
+ cpld_dump_regs();
+#endif
+ } else
+ rc = cmd_usage(cmdtp);
+
+ return rc;
+}
+
+U_BOOT_CMD(
+ cpld, CONFIG_SYS_MAXARGS, 1, do_cpld,
+ "Reset the board or alternate bank",
+ "reset - reset to default bank\n"
+ "cpld reset altbank - reset to alternate bank\n"
+#ifdef DEBUG
+ "cpld dump - display the CPLD registers\n"
+#endif
+ );
+#endif
diff --git a/board/freescale/t4rdb/cpld.h b/board/freescale/t4rdb/cpld.h
new file mode 100644
index 00000000000..fcac9244c8a
--- /dev/null
+++ b/board/freescale/t4rdb/cpld.h
@@ -0,0 +1,47 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/**
+ * Copyright 2014 Freescale Semiconductor
+ *
+ * Author: Chunhe Lan <Chunhe.Lan@freescale.com>
+ *
+ * This file provides support for the ngPIXIS, a board-specific FPGA used on
+ * some Freescale reference boards.
+ */
+
+/*
+ * CPLD register set. Feel free to add board-specific #ifdefs where necessary.
+ */
+struct cpld_data {
+ u8 chip_id1; /* 0x00 - CPLD Chip ID1 Register */
+ u8 chip_id2; /* 0x01 - CPLD Chip ID2 Register */
+ u8 sw_maj_ver; /* 0x02 - CPLD Code Major Version Register */
+ u8 sw_min_ver; /* 0x03 - CPLD Code Minor Version Register */
+ u8 hw_ver; /* 0x04 - PCBA Version Register */
+ u8 software_on; /* 0x05 - Override Physical Switch Enable Register */
+ u8 cfg_rcw_src; /* 0x06 - RCW Source Location Control Register */
+ u8 res0; /* 0x07 - not used */
+ u8 vbank; /* 0x08 - Flash Bank Selection Control Register */
+ u8 sw1_sysclk; /* 0x09 - SW1 Status Read Back Register */
+ u8 sw2_status; /* 0x0a - SW2 Status Read Back Register */
+ u8 sw3_status; /* 0x0b - SW3 Status Read Back Register */
+ u8 sw4_status; /* 0x0c - SW4 Status Read Back Register */
+ u8 sys_reset; /* 0x0d - Reset System With Reserving Registers Value*/
+ u8 global_reset;/* 0x0e - Reset System With Default Registers Value */
+ u8 res1; /* 0x0f - not used */
+};
+
+#define CPLD_BANK_SEL_MASK 0x07
+#define CPLD_BANK_SEL_EN 0x04
+#define CPLD_SYSTEM_RESET 0x01
+#define CPLD_SELECT_BANK0 0x00
+#define CPLD_SELECT_BANK4 0x04
+#define CPLD_DEFAULT_BANK 0x01
+
+/* Pointer to the CPLD register set */
+
+u8 cpld_read(unsigned int reg);
+void cpld_write(unsigned int reg, u8 value);
+
+#define CPLD_READ(reg) cpld_read(offsetof(struct cpld_data, reg))
+#define CPLD_WRITE(reg, value) \
+ cpld_write(offsetof(struct cpld_data, reg), value)
diff --git a/board/freescale/t4rdb/ddr.c b/board/freescale/t4rdb/ddr.c
new file mode 100644
index 00000000000..5b60b50c672
--- /dev/null
+++ b/board/freescale/t4rdb/ddr.c
@@ -0,0 +1,127 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <i2c.h>
+#include <hwconfig.h>
+#include <init.h>
+#include <log.h>
+#include <asm/global_data.h>
+#include <asm/mmu.h>
+#include <fsl_ddr_sdram.h>
+#include <fsl_ddr_dimm_params.h>
+#include <asm/fsl_law.h>
+#include "ddr.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+void fsl_ddr_board_options(memctl_options_t *popts,
+ dimm_params_t *pdimm,
+ unsigned int ctrl_num)
+{
+ const struct board_specific_parameters *pbsp, *pbsp_highest = NULL;
+ ulong ddr_freq;
+
+ if (ctrl_num > 2) {
+ printf("Not supported controller number %d\n", ctrl_num);
+ return;
+ }
+ if (!pdimm->n_ranks)
+ return;
+
+ /*
+ * we use identical timing for all slots. If needed, change the code
+ * to pbsp = rdimms[ctrl_num] or pbsp = udimms[ctrl_num];
+ */
+ if (popts->registered_dimm_en)
+ pbsp = rdimms[0];
+ else
+ pbsp = udimms[0];
+
+
+ /* Get clk_adjust, cpo, write_data_delay,2T, according to the board ddr
+ * freqency and n_banks specified in board_specific_parameters table.
+ */
+ ddr_freq = get_ddr_freq(0) / 1000000;
+ while (pbsp->datarate_mhz_high) {
+ if (pbsp->n_ranks == pdimm->n_ranks &&
+ (pdimm->rank_density >> 30) >= pbsp->rank_gb) {
+ if (ddr_freq <= pbsp->datarate_mhz_high) {
+ popts->clk_adjust = pbsp->clk_adjust;
+ popts->wrlvl_start = pbsp->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ goto found;
+ }
+ pbsp_highest = pbsp;
+ }
+ pbsp++;
+ }
+
+ if (pbsp_highest) {
+ printf("Error: board specific timing not found for data\n"
+ "rate %lu MT/s\n"
+ "Trying to use the highest speed (%u) parameters\n",
+ ddr_freq, pbsp_highest->datarate_mhz_high);
+ popts->clk_adjust = pbsp_highest->clk_adjust;
+ popts->wrlvl_start = pbsp_highest->wrlvl_start;
+ popts->wrlvl_ctl_2 = pbsp->wrlvl_ctl_2;
+ popts->wrlvl_ctl_3 = pbsp->wrlvl_ctl_3;
+ } else {
+ panic("DIMM is not supported by this board");
+ }
+found:
+ debug("Found timing match: n_ranks %d, data rate %d, rank_gb %d\n"
+ "\tclk_adjust %d, wrlvl_start %d, wrlvl_ctrl_2 0x%x,\n"
+ "wrlvl_ctrl_3 0x%x\n",
+ pbsp->n_ranks, pbsp->datarate_mhz_high, pbsp->rank_gb,
+ pbsp->clk_adjust, pbsp->wrlvl_start, pbsp->wrlvl_ctl_2,
+ pbsp->wrlvl_ctl_3);
+
+ /*
+ * Factors to consider for half-strength driver enable:
+ * - number of DIMMs installed
+ */
+ popts->half_strength_driver_enable = 0;
+ /*
+ * Write leveling override
+ */
+ popts->wrlvl_override = 1;
+ popts->wrlvl_sample = 0xf;
+
+ /*
+ * Rtt and Rtt_WR override
+ */
+ popts->rtt_override = 0;
+
+ /* Enable ZQ calibration */
+ popts->zq_en = 1;
+
+ /* DHC_EN =1, ODT = 75 Ohm */
+ popts->ddr_cdr1 = DDR_CDR1_DHC_EN | DDR_CDR1_ODT(DDR_CDR_ODT_75ohm);
+ popts->ddr_cdr2 = DDR_CDR2_ODT(DDR_CDR_ODT_75ohm);
+
+ /* optimize cpo for erratum A-009942 */
+ popts->cpo_sample = 0x64;
+}
+
+int dram_init(void)
+{
+ phys_size_t dram_size;
+
+ puts("Initializing....using SPD\n");
+
+#if defined(CONFIG_SPL_BUILD) || !defined(CONFIG_RAMBOOT_PBL)
+ dram_size = fsl_ddr_sdram();
+#else
+ /* DDR has been initialised by first stage boot loader */
+ dram_size = fsl_ddr_sdram_size();
+#endif
+ dram_size = setup_ddr_tlbs(dram_size / 0x100000);
+ dram_size *= 0x100000;
+
+ gd->ram_size = dram_size;
+
+ return 0;
+}
diff --git a/board/freescale/t4rdb/ddr.h b/board/freescale/t4rdb/ddr.h
new file mode 100644
index 00000000000..74a27796114
--- /dev/null
+++ b/board/freescale/t4rdb/ddr.h
@@ -0,0 +1,77 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __DDR_H__
+#define __DDR_H__
+struct board_specific_parameters {
+ u32 n_ranks;
+ u32 datarate_mhz_high;
+ u32 rank_gb;
+ u32 clk_adjust;
+ u32 wrlvl_start;
+ u32 wrlvl_ctl_2;
+ u32 wrlvl_ctl_3;
+};
+
+/*
+ * These tables contain all valid speeds we want to override with board
+ * specific parameters. datarate_mhz_high values need to be in ascending order
+ * for each n_ranks group.
+ */
+static const struct board_specific_parameters udimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {2, 1350, 4, 8, 8, 0x0809090b, 0x0c0c0d0a},
+ {2, 1350, 0, 10, 7, 0x0709090b, 0x0c0c0d09},
+ {2, 1666, 4, 8, 8, 0x080a0a0d, 0x0d10100b},
+ {2, 1666, 0, 10, 7, 0x080a0a0c, 0x0d0d0e0a},
+ {2, 1900, 0, 8, 8, 0x090a0b0e, 0x0f11120c},
+ {2, 2140, 0, 8, 8, 0x090a0b0e, 0x0f11120c},
+ {1, 1350, 0, 10, 8, 0x0809090b, 0x0c0c0d0a},
+ {1, 1700, 0, 10, 8, 0x080a0a0c, 0x0c0d0e0a},
+ {1, 1900, 0, 8, 8, 0x080a0a0c, 0x0e0e0f0a},
+ {1, 2140, 0, 8, 8, 0x090a0b0c, 0x0e0f100b},
+ {}
+};
+
+static const struct board_specific_parameters rdimm0[] = {
+ /*
+ * memory controller 0
+ * num| hi| rank| clk| wrlvl | wrlvl | wrlvl
+ * ranks| mhz| GB |adjst| start | ctl2 | ctl3
+ */
+ {4, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {4, 1666, 0, 10, 11, 0x0a080706, 0x07090906},
+ {4, 2140, 0, 10, 12, 0x0b090807, 0x080a0b07},
+ {2, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {2, 1666, 0, 10, 11, 0x0a090806, 0x08090a06},
+ {2, 2140, 0, 10, 12, 0x0b090807, 0x080a0b07},
+ {1, 1350, 0, 10, 9, 0x08070605, 0x06070806},
+ {1, 1666, 0, 10, 11, 0x0a090806, 0x08090a06},
+ {1, 2140, 0, 8, 12, 0x0b090807, 0x080a0b07},
+ {}
+};
+
+/*
+ * The three slots have slightly different timing. The center values are good
+ * for all slots. We use identical speed tables for them. In future use, if
+ * DIMMs require separated tables, make more entries as needed.
+ */
+static const struct board_specific_parameters *udimms[] = {
+ udimm0,
+};
+
+/*
+ * The three slots have slightly different timing. See comments above.
+ */
+static const struct board_specific_parameters *rdimms[] = {
+ rdimm0,
+};
+
+
+#endif
diff --git a/board/freescale/t4rdb/eth.c b/board/freescale/t4rdb/eth.c
new file mode 100644
index 00000000000..e7646365d7d
--- /dev/null
+++ b/board/freescale/t4rdb/eth.c
@@ -0,0 +1,152 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ *
+ * Chunhe Lan <Chunhe.Lan@freescale.com>
+ */
+
+#include <config.h>
+#include <command.h>
+#include <fdt_support.h>
+#include <net.h>
+#include <netdev.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <fsl_ddr_sdram.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_portals.h>
+#include <asm/fsl_liodn.h>
+#include <malloc.h>
+#include <fm_eth.h>
+#include <fsl_mdio.h>
+#include <miiphy.h>
+#include <phy.h>
+#include <fsl_dtsec.h>
+#include <asm/fsl_serdes.h>
+#include <hwconfig.h>
+
+#include "../common/fman.h"
+#include "t4rdb.h"
+
+void fdt_fixup_board_enet(void *fdt)
+{
+ return;
+}
+
+int board_eth_init(struct bd_info *bis)
+{
+#if defined(CONFIG_FMAN_ENET)
+ int i, interface;
+ struct memac_mdio_info dtsec_mdio_info;
+ struct memac_mdio_info tgec_mdio_info;
+ struct mii_dev *dev;
+ ccsr_gur_t *gur = (void *)(CFG_SYS_MPC85xx_GUTS_ADDR);
+ u32 srds_prtcl_s1, srds_prtcl_s2;
+
+ srds_prtcl_s1 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS1_PRTCL;
+ srds_prtcl_s1 >>= FSL_CORENET2_RCWSR4_SRDS1_PRTCL_SHIFT;
+ srds_prtcl_s2 = in_be32(&gur->rcwsr[4]) &
+ FSL_CORENET2_RCWSR4_SRDS2_PRTCL;
+ srds_prtcl_s2 >>= FSL_CORENET2_RCWSR4_SRDS2_PRTCL_SHIFT;
+
+ dtsec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM2_DTSEC_MDIO_ADDR;
+
+ dtsec_mdio_info.name = DEFAULT_FM_MDIO_NAME;
+
+ /* Register the 1G MDIO bus */
+ fm_memac_mdio_init(bis, &dtsec_mdio_info);
+
+ tgec_mdio_info.regs =
+ (struct memac_mdio_controller *)CFG_SYS_FM2_TGEC_MDIO_ADDR;
+ tgec_mdio_info.name = DEFAULT_FM_TGEC_MDIO_NAME;
+
+ /* Register the 10G MDIO bus */
+ fm_memac_mdio_init(bis, &tgec_mdio_info);
+
+ if ((srds_prtcl_s1 == 28) || (srds_prtcl_s1 == 27)) {
+ /* SGMII */
+ fm_info_set_phy_address(FM1_DTSEC1, SGMII_PHY_ADDR1);
+ fm_info_set_phy_address(FM1_DTSEC2, SGMII_PHY_ADDR2);
+ fm_info_set_phy_address(FM1_DTSEC3, SGMII_PHY_ADDR3);
+ fm_info_set_phy_address(FM1_DTSEC4, SGMII_PHY_ADDR4);
+ } else {
+ puts("Invalid SerDes1 protocol for T4240RDB\n");
+ }
+
+ fm_disable_port(FM1_DTSEC5);
+ fm_disable_port(FM1_DTSEC6);
+
+ for (i = FM1_DTSEC1; i < FM1_DTSEC1 + CFG_SYS_NUM_FM1_DTSEC; i++) {
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_SGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+ for (i = FM1_10GEC1; i < FM1_10GEC1 + CFG_SYS_NUM_FM1_10GEC; i++) {
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_XGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+#if (CFG_SYS_NUM_FMAN == 2)
+ if ((srds_prtcl_s2 == 56) || (srds_prtcl_s2 == 55)) {
+ /* SGMII && 10GBase-R */
+ fm_info_set_phy_address(FM2_DTSEC1, SGMII_PHY_ADDR5);
+ fm_info_set_phy_address(FM2_DTSEC2, SGMII_PHY_ADDR6);
+ fm_info_set_phy_address(FM2_DTSEC3, SGMII_PHY_ADDR7);
+ fm_info_set_phy_address(FM2_DTSEC4, SGMII_PHY_ADDR8);
+ fm_info_set_phy_address(FM1_10GEC1, FM1_10GEC1_PHY_ADDR);
+ fm_info_set_phy_address(FM1_10GEC2, FM1_10GEC2_PHY_ADDR);
+ fm_info_set_phy_address(FM2_10GEC1, FM2_10GEC2_PHY_ADDR);
+ fm_info_set_phy_address(FM2_10GEC2, FM2_10GEC1_PHY_ADDR);
+ } else {
+ puts("Invalid SerDes2 protocol for T4240RDB\n");
+ }
+
+ fm_disable_port(FM2_DTSEC5);
+ fm_disable_port(FM2_DTSEC6);
+ for (i = FM2_DTSEC1; i < FM2_DTSEC1 + CFG_SYS_NUM_FM2_DTSEC; i++) {
+ interface = fm_info_get_enet_if(i);
+ switch (interface) {
+ case PHY_INTERFACE_MODE_SGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+
+ for (i = FM2_10GEC1; i < FM2_10GEC1 + CFG_SYS_NUM_FM2_10GEC; i++) {
+ switch (fm_info_get_enet_if(i)) {
+ case PHY_INTERFACE_MODE_XGMII:
+ dev = miiphy_get_dev_by_name(DEFAULT_FM_TGEC_MDIO_NAME);
+ fm_info_set_mdio(i, dev);
+ break;
+ default:
+ break;
+ }
+ }
+#endif /* CFG_SYS_NUM_FMAN */
+
+ cpu_eth_init(bis);
+#endif /* CONFIG_FMAN_ENET */
+
+ return pci_eth_init(bis);
+}
diff --git a/board/freescale/t4rdb/law.c b/board/freescale/t4rdb/law.c
new file mode 100644
index 00000000000..c43ac0f30d7
--- /dev/null
+++ b/board/freescale/t4rdb/law.c
@@ -0,0 +1,30 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/fsl_law.h>
+#include <asm/mmu.h>
+
+struct law_entry law_table[] = {
+ SET_LAW(CFG_SYS_FLASH_BASE_PHYS, LAW_SIZE_256M, LAW_TRGT_IF_IFC),
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_BMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_BMAN),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_LAW(CFG_SYS_QMAN_MEM_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_QMAN),
+#endif
+#ifdef CFG_SYS_CPLD_BASE_PHYS
+ SET_LAW(CFG_SYS_CPLD_BASE_PHYS, LAW_SIZE_4K, LAW_TRGT_IF_IFC),
+#endif
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ /* Limit DCSR to 32M to access NPC Trace Buffer */
+ SET_LAW(CFG_SYS_DCSRBAR_PHYS, LAW_SIZE_32M, LAW_TRGT_IF_DCSR),
+#endif
+#ifdef CFG_SYS_NAND_BASE_PHYS
+ SET_LAW(CFG_SYS_NAND_BASE_PHYS, LAW_SIZE_64K, LAW_TRGT_IF_IFC),
+#endif
+};
+
+int num_law_entries = ARRAY_SIZE(law_table);
diff --git a/board/freescale/t4rdb/spl.c b/board/freescale/t4rdb/spl.c
new file mode 100644
index 00000000000..9d2472dec25
--- /dev/null
+++ b/board/freescale/t4rdb/spl.c
@@ -0,0 +1,88 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2015 Freescale Semiconductor, Inc.
+ *
+ * Author: Chunhe Lan <Chunhe.Lan@freescale.com>
+ */
+
+#include <config.h>
+#include <clock_legacy.h>
+#include <console.h>
+#include <env_internal.h>
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/spl.h>
+#include <malloc.h>
+#include <ns16550.h>
+#include <nand.h>
+#include <mmc.h>
+#include <fsl_esdhc.h>
+#include <i2c.h>
+
+#include "t4rdb.h"
+
+#define FSL_CORENET_CCSR_PORSR1_RCW_MASK 0xFF800000
+
+DECLARE_GLOBAL_DATA_PTR;
+
+phys_size_t get_effective_memsize(void)
+{
+ return CONFIG_SYS_L3_SIZE;
+}
+
+void board_init_f(ulong bootflag)
+{
+ u32 plat_ratio, sys_clk, ccb_clk;
+ ccsr_gur_t *gur = (void *)CFG_SYS_MPC85xx_GUTS_ADDR;
+
+ /* Memcpy existing GD at CONFIG_SPL_GD_ADDR */
+ memcpy((void *)CONFIG_SPL_GD_ADDR, (void *)gd, sizeof(gd_t));
+
+ /* Update GD pointer */
+ gd = (gd_t *)(CONFIG_SPL_GD_ADDR);
+
+ /* compiler optimization barrier needed for GCC >= 3.4 */
+ __asm__ __volatile__("" : : : "memory");
+
+ console_init_f();
+
+ /* initialize selected port with appropriate baud rate */
+ sys_clk = get_board_sys_clk();
+ plat_ratio = (in_be32(&gur->rcwsr[0]) >> 25) & 0x1f;
+ ccb_clk = sys_clk * plat_ratio / 2;
+
+ ns16550_init((struct ns16550 *)CFG_SYS_NS16550_COM1,
+ ccb_clk / 16 / CONFIG_BAUDRATE);
+
+ puts("\nSD boot...\n");
+
+ relocate_code(CONFIG_SPL_RELOC_STACK, (gd_t *)CONFIG_SPL_GD_ADDR, 0x0);
+}
+
+void board_init_r(gd_t *gd, ulong dest_addr)
+{
+ struct bd_info *bd;
+
+ bd = (struct bd_info *)(gd + sizeof(gd_t));
+ memset(bd, 0, sizeof(struct bd_info));
+ gd->bd = bd;
+
+ arch_cpu_init();
+ get_clocks();
+ mem_malloc_init(CONFIG_SPL_RELOC_MALLOC_ADDR,
+ CONFIG_SPL_RELOC_MALLOC_SIZE);
+ gd->flags |= GD_FLG_FULL_MALLOC_INIT;
+
+ mmc_initialize(bd);
+ mmc_spl_load_image(CONFIG_ENV_OFFSET, CONFIG_ENV_SIZE,
+ (uchar *)SPL_ENV_ADDR);
+
+ gd->env_addr = (ulong)(SPL_ENV_ADDR);
+ gd->env_valid = ENV_VALID;
+
+ i2c_init_all();
+
+ dram_init();
+
+ mmc_boot();
+}
diff --git a/board/freescale/t4rdb/t4240rdb.c b/board/freescale/t4rdb/t4240rdb.c
new file mode 100644
index 00000000000..5cacfd27380
--- /dev/null
+++ b/board/freescale/t4rdb/t4240rdb.c
@@ -0,0 +1,183 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ * Copyright 2023 NXP
+ */
+
+#include <config.h>
+#include <command.h>
+#include <env.h>
+#include <fdt_support.h>
+#include <i2c.h>
+#include <image.h>
+#include <init.h>
+#include <netdev.h>
+#include <asm/global_data.h>
+#include <linux/compiler.h>
+#include <asm/mmu.h>
+#include <asm/processor.h>
+#include <asm/cache.h>
+#include <asm/immap_85xx.h>
+#include <asm/fsl_law.h>
+#include <asm/fsl_serdes.h>
+#include <asm/fsl_liodn.h>
+#include <clock_legacy.h>
+#include <fm_eth.h>
+
+#include "t4rdb.h"
+#include "cpld.h"
+#include "../common/vid.h"
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if CONFIG_IS_ENABLED(DM_SERIAL)
+int get_serial_clock(void)
+{
+ return get_bus_freq(0) / 2;
+}
+#endif
+
+int checkboard(void)
+{
+ struct cpu_type *cpu = gd->arch.cpu;
+ u8 sw;
+
+ printf("Board: %sRDB, ", cpu->name);
+ printf("Board rev: 0x%02x CPLD ver: 0x%02x%02x, ",
+ CPLD_READ(hw_ver), CPLD_READ(sw_maj_ver), CPLD_READ(sw_min_ver));
+
+ sw = CPLD_READ(vbank);
+ sw = sw & CPLD_BANK_SEL_MASK;
+
+ if (sw <= 7)
+ printf("vBank: %d\n", sw);
+ else
+ printf("Unsupported Bank=%x\n", sw);
+
+ puts("SERDES Reference Clocks:\n");
+ printf(" SERDES1=100MHz SERDES2=156.25MHz\n"
+ " SERDES3=100MHz SERDES4=100MHz\n");
+
+ return 0;
+}
+
+int board_early_init_r(void)
+{
+ const unsigned int flashbase = CFG_SYS_FLASH_BASE;
+ int flash_esel = find_tlb_idx((void *)flashbase, 1);
+
+ /*
+ * Remap Boot flash + PROMJET region to caching-inhibited
+ * so that flash can be erased properly.
+ */
+
+ /* Flush d-cache and invalidate i-cache of any FLASH data */
+ flush_dcache();
+ invalidate_icache();
+
+ if (flash_esel == -1) {
+ /* very unlikely unless something is messed up */
+ puts("Error: Could not find TLB for FLASH BASE\n");
+ flash_esel = 2; /* give our best effort to continue */
+ } else {
+ /* invalidate existing TLB entry for flash + promjet */
+ disable_tlb(flash_esel);
+ }
+
+ set_tlb(1, flashbase, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, flash_esel, BOOKE_PAGESZ_256M, 1);
+
+ /*
+ * Adjust core voltage according to voltage ID
+ * This function changes I2C mux to channel 2.
+ */
+ if (adjust_vdd(0))
+ printf("Warning: Adjusting core voltage failed.\n");
+
+ pci_init();
+
+ return 0;
+}
+
+int misc_init_r(void)
+{
+ return 0;
+}
+
+int ft_board_setup(void *blob, struct bd_info *bd)
+{
+ phys_addr_t base;
+ phys_size_t size;
+
+ ft_cpu_setup(blob, bd);
+
+ base = env_get_bootm_low();
+ size = env_get_bootm_size();
+
+ fdt_fixup_memory(blob, (u64)base, (u64)size);
+
+#ifdef CONFIG_PCI
+ pci_of_setup(blob, bd);
+#endif
+
+ fdt_fixup_liodn(blob);
+ fsl_fdt_fixup_dr_usb(blob, bd);
+
+#ifdef CONFIG_SYS_DPAA_FMAN
+#ifndef CONFIG_DM_ETH
+ fdt_fixup_fman_ethernet(blob);
+#endif
+ fdt_fixup_board_enet(blob);
+#endif
+
+ return 0;
+}
+
+/*
+ * This function is called by bdinfo to print detail board information.
+ * As an exmaple for future board, we organize the messages into
+ * several sections. If applicable, the message is in the format of
+ * <name> = <value>
+ * It should aligned with normal output of bdinfo command.
+ *
+ * Voltage: Core, DDR and another configurable voltages
+ * Clock : Critical clocks which are not printed already
+ * RCW : RCW source if not printed already
+ * Misc : Other important information not in above catagories
+ */
+void board_detail(void)
+{
+ int rcwsrc;
+
+ /* RCW section SW3[4] */
+ rcwsrc = 0x0;
+ puts("RCW source = ");
+ switch (rcwsrc & 0x1) {
+ case 0x1:
+ puts("SDHC/eMMC\n");
+ break;
+ default:
+ puts("I2C normal addressing\n");
+ break;
+ }
+}
+
+ulong *cs4340_get_fw_addr(void)
+{
+ ulong cortina_fw_addr = CONFIG_CORTINA_FW_ADDR;
+
+#ifdef CONFIG_SYS_CORTINA_FW_IN_NOR
+ u8 sw;
+
+ sw = CPLD_READ(vbank);
+ sw = sw & CPLD_BANK_SEL_MASK;
+
+ if (sw == 0)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR;
+ else if (sw == 4)
+ cortina_fw_addr = CORTINA_FW_ADDR_IFCNOR_ALTBANK;
+#endif
+
+ return (ulong *)cortina_fw_addr;
+}
diff --git a/board/freescale/t4rdb/t4_pbi.cfg b/board/freescale/t4rdb/t4_pbi.cfg
new file mode 100644
index 00000000000..0b326fa1635
--- /dev/null
+++ b/board/freescale/t4rdb/t4_pbi.cfg
@@ -0,0 +1,27 @@
+#
+# Copyright 2014 Freescale Semiconductor, Inc.
+#
+# SPDX-License-Identifier: GPL-2.0+
+#
+
+#PBI commands
+#Initialize CPC1
+09010000 00200400
+09138000 00000000
+091380c0 00000100
+#512KB SRAM
+09010100 00000000
+09010104 fff80009
+09010f00 08000000
+#enable CPC1
+09010000 80000000
+#Configure LAW for CPC1
+09000d00 00000000
+09000d04 fff80000
+09000d08 81000012
+#Configure alternate space
+09000010 00000000
+09000014 ff000000
+09000018 81000000
+#Flush PBL data
+091380c0 00100000
diff --git a/board/freescale/t4rdb/t4_sd_rcw.cfg b/board/freescale/t4rdb/t4_sd_rcw.cfg
new file mode 100644
index 00000000000..cc2bff68269
--- /dev/null
+++ b/board/freescale/t4rdb/t4_sd_rcw.cfg
@@ -0,0 +1,7 @@
+#PBL preamble and RCW header
+aa55aa55 010e0100
+#serdes protocol 27_55_1_9
+16070019 18101916 00000000 00000000
+6c6e0848 00448c00 6c020000 f5000000
+00000000 ee0000ee 00000000 000307fc
+00000000 00000000 00000000 00000028
diff --git a/board/freescale/t4rdb/t4rdb.h b/board/freescale/t4rdb/t4rdb.h
new file mode 100644
index 00000000000..bb3ce216d7d
--- /dev/null
+++ b/board/freescale/t4rdb/t4rdb.h
@@ -0,0 +1,20 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#ifndef __T4RDB_H__
+#define __T4RDB_H__
+
+#undef CFG_SYS_NUM_FM1_DTSEC
+#undef CFG_SYS_NUM_FM2_DTSEC
+#define CFG_SYS_NUM_FM1_DTSEC 4
+#define CFG_SYS_NUM_FM2_DTSEC 4
+
+#define CORTINA_FW_ADDR_IFCNOR 0xefe00000
+#define CORTINA_FW_ADDR_IFCNOR_ALTBANK 0xebf00000
+
+void fdt_fixup_board_enet(void *blob);
+void pci_of_setup(void *blob, struct bd_info *bd);
+
+#endif
diff --git a/board/freescale/t4rdb/tlb.c b/board/freescale/t4rdb/tlb.c
new file mode 100644
index 00000000000..1fb9d41d52b
--- /dev/null
+++ b/board/freescale/t4rdb/tlb.c
@@ -0,0 +1,124 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2014 Freescale Semiconductor, Inc.
+ */
+
+#include <config.h>
+#include <asm/mmu.h>
+#include <asm/ppc.h>
+
+struct fsl_e_tlb_entry tlb_table[] = {
+ /* TLB 0 - for temp stack in cache */
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR,
+ CFG_SYS_INIT_RAM_ADDR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 4 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 4 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 8 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 8 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+ SET_TLB_ENTRY(0, CFG_SYS_INIT_RAM_ADDR + 12 * 1024,
+ CFG_SYS_INIT_RAM_ADDR_PHYS + 12 * 1024,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 0, BOOKE_PAGESZ_4K, 0),
+
+ /* TLB 1 */
+ /* *I*** - Covers boot page */
+#if defined(CONFIG_SYS_RAMBOOT) && defined(CFG_SYS_INIT_L3_ADDR)
+ /*
+ * *I*G - L3SRAM. When L3 is used as 512K SRAM */
+ SET_TLB_ENTRY(1, CFG_SYS_INIT_L3_ADDR, CFG_SYS_INIT_L3_ADDR,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_512K, 1),
+#else
+ SET_TLB_ENTRY(1, 0xfffff000, 0xfffff000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 0, BOOKE_PAGESZ_4K, 1),
+#endif
+
+ /* *I*G* - CCSRBAR */
+ SET_TLB_ENTRY(1, CFG_SYS_CCSRBAR, CFG_SYS_CCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 1, BOOKE_PAGESZ_16M, 1),
+
+ /* *I*G* - Flash, localbus */
+ /* This will be changed to *I*G* after relocation to RAM. */
+ SET_TLB_ENTRY(1, CFG_SYS_FLASH_BASE, CFG_SYS_FLASH_BASE_PHYS,
+ MAS3_SX|MAS3_SR, MAS2_W|MAS2_G,
+ 0, 2, BOOKE_PAGESZ_256M, 1),
+
+#ifndef CONFIG_SPL_BUILD
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT, CFG_SYS_PCIE1_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 3, BOOKE_PAGESZ_1G, 1),
+
+ /* *I*G* - PCI */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT + 0x40000000,
+ CFG_SYS_PCIE1_MEM_PHYS + 0x40000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 4, BOOKE_PAGESZ_256M, 1),
+
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_MEM_VIRT + 0x50000000,
+ CFG_SYS_PCIE1_MEM_PHYS + 0x50000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 5, BOOKE_PAGESZ_256M, 1),
+
+ /* *I*G* - PCI I/O */
+ SET_TLB_ENTRY(1, CFG_SYS_PCIE1_IO_VIRT, CFG_SYS_PCIE1_IO_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 6, BOOKE_PAGESZ_256K, 1),
+
+ /* Bman/Qman */
+#ifdef CFG_SYS_BMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE, CFG_SYS_BMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 9, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_BMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_BMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 10, BOOKE_PAGESZ_16M, 1),
+#endif
+#ifdef CFG_SYS_QMAN_MEM_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE, CFG_SYS_QMAN_MEM_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, 0,
+ 0, 11, BOOKE_PAGESZ_16M, 1),
+ SET_TLB_ENTRY(1, CFG_SYS_QMAN_MEM_BASE + 0x01000000,
+ CFG_SYS_QMAN_MEM_PHYS + 0x01000000,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 12, BOOKE_PAGESZ_16M, 1),
+#endif
+#endif
+
+#ifdef CFG_SYS_DCSRBAR_PHYS
+ SET_TLB_ENTRY(1, CFG_SYS_DCSRBAR, CFG_SYS_DCSRBAR_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 13, BOOKE_PAGESZ_32M, 1),
+#endif
+#ifdef CFG_SYS_NAND_BASE
+ /*
+ * *I*G - NAND
+ * entry 14 and 15 has been used hard coded, they will be disabled
+ * in cpu_init_f, so we use entry 16 for nand.
+ */
+ SET_TLB_ENTRY(1, CFG_SYS_NAND_BASE, CFG_SYS_NAND_BASE_PHYS,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 16, BOOKE_PAGESZ_64K, 1),
+#endif
+#ifdef CFG_SYS_CPLD_BASE
+ SET_TLB_ENTRY(1, CFG_SYS_CPLD_BASE, CFG_SYS_CPLD_BASE_PHYS,
+ MAS3_SW|MAS3_SW|MAS3_SR, MAS2_I|MAS2_G,
+ 0, 17, BOOKE_PAGESZ_4K, 1),
+#endif
+#if defined(CONFIG_RAMBOOT_PBL) && !defined(CONFIG_SPL_BUILD)
+ SET_TLB_ENTRY(1, CFG_SYS_DDR_SDRAM_BASE, CFG_SYS_DDR_SDRAM_BASE,
+ MAS3_SX|MAS3_SW|MAS3_SR, MAS2_M,
+ 0, 18, BOOKE_PAGESZ_2G, 1)
+#endif
+};
+
+int num_tlb_entries = ARRAY_SIZE(tlb_table);
diff --git a/board/freescale/vf610twr/Kconfig b/board/freescale/vf610twr/Kconfig
new file mode 100644
index 00000000000..208c7ae2f42
--- /dev/null
+++ b/board/freescale/vf610twr/Kconfig
@@ -0,0 +1,15 @@
+if TARGET_VF610TWR
+
+config SYS_BOARD
+ default "vf610twr"
+
+config SYS_VENDOR
+ default "freescale"
+
+config SYS_CONFIG_NAME
+ default "vf610twr"
+
+config IMX_CONFIG
+ default "board/freescale/vf610twr/imximage.cfg"
+
+endif
diff --git a/board/freescale/vf610twr/MAINTAINERS b/board/freescale/vf610twr/MAINTAINERS
new file mode 100644
index 00000000000..b2eef8e24be
--- /dev/null
+++ b/board/freescale/vf610twr/MAINTAINERS
@@ -0,0 +1,7 @@
+VF610TWR BOARD
+M: Alison Wang <alison.wang@nxp.com>
+S: Maintained
+F: board/freescale/vf610twr/
+F: include/configs/vf610twr.h
+F: configs/vf610twr_defconfig
+F: configs/vf610twr_nand_defconfig
diff --git a/board/freescale/vf610twr/Makefile b/board/freescale/vf610twr/Makefile
new file mode 100644
index 00000000000..43934e8b2ae
--- /dev/null
+++ b/board/freescale/vf610twr/Makefile
@@ -0,0 +1,5 @@
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Copyright 2013 Freescale Semiconductor, Inc.
+
+obj-y := vf610twr.o
diff --git a/board/freescale/vf610twr/imximage.cfg b/board/freescale/vf610twr/imximage.cfg
new file mode 100644
index 00000000000..e2fa1a582d2
--- /dev/null
+++ b/board/freescale/vf610twr/imximage.cfg
@@ -0,0 +1,16 @@
+/* SPDX-License-Identifier: GPL-2.0+ */
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ *
+ * Refer doc/imx/mkimage/imximage.txt for more details about how-to configure
+ * and create imximage boot image
+ *
+ * The syntax is taken as close as possible with the kwbimage
+ */
+#include <asm/mach-imx/imximage.cfg>
+
+/* image version */
+IMAGE_VERSION 2
+
+/* Boot Offset 0x400, valid for both SD and NAND boot */
+BOOT_OFFSET FLASH_OFFSET_STANDARD
diff --git a/board/freescale/vf610twr/vf610twr.c b/board/freescale/vf610twr/vf610twr.c
new file mode 100644
index 00000000000..80a798af9cb
--- /dev/null
+++ b/board/freescale/vf610twr/vf610twr.c
@@ -0,0 +1,387 @@
+// SPDX-License-Identifier: GPL-2.0+
+/*
+ * Copyright 2013 Freescale Semiconductor, Inc.
+ */
+
+#include <init.h>
+#include <asm/global_data.h>
+#include <asm/io.h>
+#include <asm/arch/imx-regs.h>
+#include <asm/arch/iomux-vf610.h>
+#include <asm/arch/ddrmc-vf610.h>
+#include <asm/arch/crm_regs.h>
+#include <asm/arch/clock.h>
+#include <mmc.h>
+#include <fsl_esdhc_imx.h>
+#include <miiphy.h>
+#include <netdev.h>
+#include <i2c.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define UART_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_MED | \
+ PAD_CTL_DSE_25ohm | PAD_CTL_OBE_IBE_ENABLE)
+
+#define ESDHC_PAD_CTRL (PAD_CTL_PUS_100K_UP | PAD_CTL_SPEED_HIGH | \
+ PAD_CTL_DSE_20ohm | PAD_CTL_OBE_IBE_ENABLE)
+
+#define ENET_PAD_CTRL (PAD_CTL_PUS_47K_UP | PAD_CTL_SPEED_HIGH | \
+ PAD_CTL_DSE_50ohm | PAD_CTL_OBE_IBE_ENABLE)
+
+static struct ddrmc_cr_setting vf610twr_cr_settings[] = {
+ /* levelling */
+ { DDRMC_CR97_WRLVL_EN, 97 },
+ { DDRMC_CR98_WRLVL_DL_0(0), 98 },
+ { DDRMC_CR99_WRLVL_DL_1(0), 99 },
+ { DDRMC_CR102_RDLVL_REG_EN | DDRMC_CR102_RDLVL_GT_REGEN, 102 },
+ { DDRMC_CR105_RDLVL_DL_0(0), 105 },
+ { DDRMC_CR106_RDLVL_GTDL_0(4), 106 },
+ { DDRMC_CR110_RDLVL_DL_1(0) | DDRMC_CR110_RDLVL_GTDL_1(4), 110 },
+ /* AXI */
+ { DDRMC_CR117_AXI0_W_PRI(0) | DDRMC_CR117_AXI0_R_PRI(0), 117 },
+ { DDRMC_CR118_AXI1_W_PRI(1) | DDRMC_CR118_AXI1_R_PRI(1), 118 },
+ { DDRMC_CR120_AXI0_PRI1_RPRI(2) |
+ DDRMC_CR120_AXI0_PRI0_RPRI(2), 120 },
+ { DDRMC_CR121_AXI0_PRI3_RPRI(2) |
+ DDRMC_CR121_AXI0_PRI2_RPRI(2), 121 },
+ { DDRMC_CR122_AXI1_PRI1_RPRI(1) | DDRMC_CR122_AXI1_PRI0_RPRI(1) |
+ DDRMC_CR122_AXI0_PRIRLX(100), 122 },
+ { DDRMC_CR123_AXI1_P_ODR_EN | DDRMC_CR123_AXI1_PRI3_RPRI(1) |
+ DDRMC_CR123_AXI1_PRI2_RPRI(1), 123 },
+ { DDRMC_CR124_AXI1_PRIRLX(100), 124 },
+ { DDRMC_CR126_PHY_RDLAT(8), 126 },
+ { DDRMC_CR132_WRLAT_ADJ(5) |
+ DDRMC_CR132_RDLAT_ADJ(6), 132 },
+ { DDRMC_CR137_PHYCTL_DL(2), 137 },
+ { DDRMC_CR138_PHY_WRLV_MXDL(256) |
+ DDRMC_CR138_PHYDRAM_CK_EN(1), 138 },
+ { DDRMC_CR139_PHY_WRLV_RESPLAT(4) | DDRMC_CR139_PHY_WRLV_LOAD(7) |
+ DDRMC_CR139_PHY_WRLV_DLL(3) |
+ DDRMC_CR139_PHY_WRLV_EN(3), 139 },
+ { DDRMC_CR140_PHY_WRLV_WW(64), 140 },
+ { DDRMC_CR143_RDLV_GAT_MXDL(1536) |
+ DDRMC_CR143_RDLV_MXDL(128), 143 },
+ { DDRMC_CR144_PHY_RDLVL_RES(4) | DDRMC_CR144_PHY_RDLV_LOAD(7) |
+ DDRMC_CR144_PHY_RDLV_DLL(3) |
+ DDRMC_CR144_PHY_RDLV_EN(3), 144 },
+ { DDRMC_CR145_PHY_RDLV_RR(64), 145 },
+ { DDRMC_CR146_PHY_RDLVL_RESP(64), 146 },
+ { DDRMC_CR147_RDLV_RESP_MASK(983040), 147 },
+ { DDRMC_CR148_RDLV_GATE_RESP_MASK(983040), 148 },
+ { DDRMC_CR151_RDLV_GAT_DQ_ZERO_CNT(1) |
+ DDRMC_CR151_RDLVL_DQ_ZERO_CNT(1), 151 },
+
+ { DDRMC_CR154_PAD_ZQ_EARLY_CMP_EN_TIMER(13) |
+ DDRMC_CR154_PAD_ZQ_MODE(1) |
+ DDRMC_CR154_DDR_SEL_PAD_CONTR(3) |
+ DDRMC_CR154_PAD_ZQ_HW_FOR(1), 154 },
+ { DDRMC_CR155_PAD_ODT_BYTE1(1) | DDRMC_CR155_PAD_ODT_BYTE0(1), 155 },
+ { DDRMC_CR158_TWR(6), 158 },
+ { DDRMC_CR161_ODT_EN(1) | DDRMC_CR161_TODTH_RD(2) |
+ DDRMC_CR161_TODTH_WR(2), 161 },
+ /* end marker */
+ { 0, -1 }
+};
+
+int dram_init(void)
+{
+ static const struct ddr3_jedec_timings timings = {
+ .tinit = 5,
+ .trst_pwron = 80000,
+ .cke_inactive = 200000,
+ .wrlat = 5,
+ .caslat_lin = 12,
+ .trc = 21,
+ .trrd = 4,
+ .tccd = 4,
+ .tbst_int_interval = 0,
+ .tfaw = 20,
+ .trp = 6,
+ .twtr = 4,
+ .tras_min = 15,
+ .tmrd = 4,
+ .trtp = 4,
+ .tras_max = 28080,
+ .tmod = 12,
+ .tckesr = 4,
+ .tcke = 3,
+ .trcd_int = 6,
+ .tras_lockout = 0,
+ .tdal = 12,
+ .bstlen = 3,
+ .tdll = 512,
+ .trp_ab = 6,
+ .tref = 3120,
+ .trfc = 44,
+ .tref_int = 0,
+ .tpdex = 3,
+ .txpdll = 10,
+ .txsnr = 48,
+ .txsr = 468,
+ .cksrx = 5,
+ .cksre = 5,
+ .freq_chg_en = 0,
+ .zqcl = 256,
+ .zqinit = 512,
+ .zqcs = 64,
+ .ref_per_zq = 64,
+ .zqcs_rotate = 0,
+ .aprebit = 10,
+ .cmd_age_cnt = 64,
+ .age_cnt = 64,
+ .q_fullness = 7,
+ .odt_rd_mapcs0 = 0,
+ .odt_wr_mapcs0 = 1,
+ .wlmrd = 40,
+ .wldqsen = 25,
+ };
+
+ ddrmc_setup_iomux(NULL, 0);
+
+ ddrmc_ctrl_init_ddr3(&timings, vf610twr_cr_settings, NULL, 1, 3);
+ gd->ram_size = get_ram_size((void *)PHYS_SDRAM, PHYS_SDRAM_SIZE);
+
+ return 0;
+}
+
+static void setup_iomux_uart(void)
+{
+ static const iomux_v3_cfg_t uart1_pads[] = {
+ NEW_PAD_CTRL(VF610_PAD_PTB4__UART1_TX, UART_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTB5__UART1_RX, UART_PAD_CTRL),
+ };
+
+ imx_iomux_v3_setup_multiple_pads(uart1_pads, ARRAY_SIZE(uart1_pads));
+}
+
+static void setup_iomux_enet(void)
+{
+ static const iomux_v3_cfg_t enet0_pads[] = {
+ NEW_PAD_CTRL(VF610_PAD_PTA6__RMII0_CLKIN, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC1__RMII0_MDIO, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC0__RMII0_MDC, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC2__RMII0_CRS_DV, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC3__RMII0_RD1, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC4__RMII0_RD0, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC5__RMII0_RXER, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC6__RMII0_TD1, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC7__RMII0_TD0, ENET_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTC8__RMII0_TXEN, ENET_PAD_CTRL),
+ };
+
+ imx_iomux_v3_setup_multiple_pads(enet0_pads, ARRAY_SIZE(enet0_pads));
+}
+
+static void setup_iomux_i2c(void)
+{
+ static const iomux_v3_cfg_t i2c0_pads[] = {
+ VF610_PAD_PTB14__I2C0_SCL,
+ VF610_PAD_PTB15__I2C0_SDA,
+ };
+
+ imx_iomux_v3_setup_multiple_pads(i2c0_pads, ARRAY_SIZE(i2c0_pads));
+}
+
+#ifdef CONFIG_NAND_VF610_NFC
+static void setup_iomux_nfc(void)
+{
+ static const iomux_v3_cfg_t nfc_pads[] = {
+ VF610_PAD_PTD31__NF_IO15,
+ VF610_PAD_PTD30__NF_IO14,
+ VF610_PAD_PTD29__NF_IO13,
+ VF610_PAD_PTD28__NF_IO12,
+ VF610_PAD_PTD27__NF_IO11,
+ VF610_PAD_PTD26__NF_IO10,
+ VF610_PAD_PTD25__NF_IO9,
+ VF610_PAD_PTD24__NF_IO8,
+ VF610_PAD_PTD23__NF_IO7,
+ VF610_PAD_PTD22__NF_IO6,
+ VF610_PAD_PTD21__NF_IO5,
+ VF610_PAD_PTD20__NF_IO4,
+ VF610_PAD_PTD19__NF_IO3,
+ VF610_PAD_PTD18__NF_IO2,
+ VF610_PAD_PTD17__NF_IO1,
+ VF610_PAD_PTD16__NF_IO0,
+ VF610_PAD_PTB24__NF_WE_B,
+ VF610_PAD_PTB25__NF_CE0_B,
+ VF610_PAD_PTB27__NF_RE_B,
+ VF610_PAD_PTC26__NF_RB_B,
+ VF610_PAD_PTC27__NF_ALE,
+ VF610_PAD_PTC28__NF_CLE
+ };
+
+ imx_iomux_v3_setup_multiple_pads(nfc_pads, ARRAY_SIZE(nfc_pads));
+}
+#endif
+
+
+static void setup_iomux_qspi(void)
+{
+ static const iomux_v3_cfg_t qspi0_pads[] = {
+ VF610_PAD_PTD0__QSPI0_A_QSCK,
+ VF610_PAD_PTD1__QSPI0_A_CS0,
+ VF610_PAD_PTD2__QSPI0_A_DATA3,
+ VF610_PAD_PTD3__QSPI0_A_DATA2,
+ VF610_PAD_PTD4__QSPI0_A_DATA1,
+ VF610_PAD_PTD5__QSPI0_A_DATA0,
+ VF610_PAD_PTD7__QSPI0_B_QSCK,
+ VF610_PAD_PTD8__QSPI0_B_CS0,
+ VF610_PAD_PTD9__QSPI0_B_DATA3,
+ VF610_PAD_PTD10__QSPI0_B_DATA2,
+ VF610_PAD_PTD11__QSPI0_B_DATA1,
+ VF610_PAD_PTD12__QSPI0_B_DATA0,
+ };
+
+ imx_iomux_v3_setup_multiple_pads(qspi0_pads, ARRAY_SIZE(qspi0_pads));
+}
+
+#ifdef CONFIG_FSL_ESDHC_IMX
+struct fsl_esdhc_cfg esdhc_cfg[1] = {
+ {ESDHC1_BASE_ADDR},
+};
+
+int board_mmc_getcd(struct mmc *mmc)
+{
+ /* eSDHC1 is always present */
+ return 1;
+}
+
+int board_mmc_init(struct bd_info *bis)
+{
+ static const iomux_v3_cfg_t esdhc1_pads[] = {
+ NEW_PAD_CTRL(VF610_PAD_PTA24__ESDHC1_CLK, ESDHC_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTA25__ESDHC1_CMD, ESDHC_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTA26__ESDHC1_DAT0, ESDHC_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTA27__ESDHC1_DAT1, ESDHC_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTA28__ESDHC1_DAT2, ESDHC_PAD_CTRL),
+ NEW_PAD_CTRL(VF610_PAD_PTA29__ESDHC1_DAT3, ESDHC_PAD_CTRL),
+ };
+
+ esdhc_cfg[0].sdhc_clk = mxc_get_clock(MXC_ESDHC_CLK);
+
+ imx_iomux_v3_setup_multiple_pads(
+ esdhc1_pads, ARRAY_SIZE(esdhc1_pads));
+
+ return fsl_esdhc_initialize(bis, &esdhc_cfg[0]);
+}
+#endif
+
+static void clock_init(void)
+{
+ struct ccm_reg *ccm = (struct ccm_reg *)CCM_BASE_ADDR;
+ struct anadig_reg *anadig = (struct anadig_reg *)ANADIG_BASE_ADDR;
+
+ clrsetbits_le32(&ccm->ccgr0, CCM_REG_CTRL_MASK,
+ CCM_CCGR0_UART1_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr1, CCM_REG_CTRL_MASK,
+ CCM_CCGR1_PIT_CTRL_MASK | CCM_CCGR1_WDOGA5_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr2, CCM_REG_CTRL_MASK,
+ CCM_CCGR2_IOMUXC_CTRL_MASK | CCM_CCGR2_PORTA_CTRL_MASK |
+ CCM_CCGR2_PORTB_CTRL_MASK | CCM_CCGR2_PORTC_CTRL_MASK |
+ CCM_CCGR2_PORTD_CTRL_MASK | CCM_CCGR2_PORTE_CTRL_MASK |
+ CCM_CCGR2_QSPI0_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr3, CCM_REG_CTRL_MASK,
+ CCM_CCGR3_ANADIG_CTRL_MASK | CCM_CCGR3_SCSC_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr4, CCM_REG_CTRL_MASK,
+ CCM_CCGR4_WKUP_CTRL_MASK | CCM_CCGR4_CCM_CTRL_MASK |
+ CCM_CCGR4_GPC_CTRL_MASK | CCM_CCGR4_I2C0_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr6, CCM_REG_CTRL_MASK,
+ CCM_CCGR6_OCOTP_CTRL_MASK | CCM_CCGR6_DDRMC_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr7, CCM_REG_CTRL_MASK,
+ CCM_CCGR7_SDHC1_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr9, CCM_REG_CTRL_MASK,
+ CCM_CCGR9_FEC0_CTRL_MASK | CCM_CCGR9_FEC1_CTRL_MASK);
+ clrsetbits_le32(&ccm->ccgr10, CCM_REG_CTRL_MASK,
+ CCM_CCGR10_NFC_CTRL_MASK);
+
+ clrsetbits_le32(&anadig->pll2_ctrl, ANADIG_PLL2_CTRL_POWERDOWN,
+ ANADIG_PLL2_CTRL_ENABLE | ANADIG_PLL2_CTRL_DIV_SELECT);
+ clrsetbits_le32(&anadig->pll1_ctrl, ANADIG_PLL1_CTRL_POWERDOWN,
+ ANADIG_PLL1_CTRL_ENABLE | ANADIG_PLL1_CTRL_DIV_SELECT);
+
+ clrsetbits_le32(&ccm->ccr, CCM_CCR_OSCNT_MASK,
+ CCM_CCR_FIRC_EN | CCM_CCR_OSCNT(5));
+ clrsetbits_le32(&ccm->ccsr, CCM_REG_CTRL_MASK,
+ CCM_CCSR_PLL1_PFD_CLK_SEL(3) | CCM_CCSR_PLL2_PFD4_EN |
+ CCM_CCSR_PLL2_PFD3_EN | CCM_CCSR_PLL2_PFD2_EN |
+ CCM_CCSR_PLL2_PFD1_EN | CCM_CCSR_PLL1_PFD4_EN |
+ CCM_CCSR_PLL1_PFD3_EN | CCM_CCSR_PLL1_PFD2_EN |
+ CCM_CCSR_PLL1_PFD1_EN | CCM_CCSR_DDRC_CLK_SEL(1) |
+ CCM_CCSR_FAST_CLK_SEL(1) | CCM_CCSR_SYS_CLK_SEL(4));
+ clrsetbits_le32(&ccm->cacrr, CCM_REG_CTRL_MASK,
+ CCM_CACRR_IPG_CLK_DIV(1) | CCM_CACRR_BUS_CLK_DIV(2) |
+ CCM_CACRR_ARM_CLK_DIV(0));
+ clrsetbits_le32(&ccm->cscmr1, CCM_REG_CTRL_MASK,
+ CCM_CSCMR1_ESDHC1_CLK_SEL(3) | CCM_CSCMR1_QSPI0_CLK_SEL(3) |
+ CCM_CSCMR1_NFC_CLK_SEL(0));
+ clrsetbits_le32(&ccm->cscdr1, CCM_REG_CTRL_MASK,
+ CCM_CSCDR1_RMII_CLK_EN);
+ clrsetbits_le32(&ccm->cscdr2, CCM_REG_CTRL_MASK,
+ CCM_CSCDR2_ESDHC1_EN | CCM_CSCDR2_ESDHC1_CLK_DIV(0) |
+ CCM_CSCDR2_NFC_EN);
+ clrsetbits_le32(&ccm->cscdr3, CCM_REG_CTRL_MASK,
+ CCM_CSCDR3_QSPI0_EN | CCM_CSCDR3_QSPI0_DIV(1) |
+ CCM_CSCDR3_QSPI0_X2_DIV(1) | CCM_CSCDR3_QSPI0_X4_DIV(3) |
+ CCM_CSCDR3_NFC_PRE_DIV(5));
+ clrsetbits_le32(&ccm->cscmr2, CCM_REG_CTRL_MASK,
+ CCM_CSCMR2_RMII_CLK_SEL(0));
+}
+
+static void mscm_init(void)
+{
+ struct mscm_ir *mscmir = (struct mscm_ir *)MSCM_IR_BASE_ADDR;
+ int i;
+
+ for (i = 0; i < MSCM_IRSPRC_NUM; i++)
+ writew(MSCM_IRSPRC_CP0_EN, &mscmir->irsprc[i]);
+}
+
+int board_phy_config(struct phy_device *phydev)
+{
+ if (phydev->drv->config)
+ phydev->drv->config(phydev);
+
+ return 0;
+}
+
+int board_early_init_f(void)
+{
+ clock_init();
+ mscm_init();
+
+ setup_iomux_uart();
+ setup_iomux_enet();
+ setup_iomux_i2c();
+ setup_iomux_qspi();
+#ifdef CONFIG_NAND_VF610_NFC
+ setup_iomux_nfc();
+#endif
+
+ return 0;
+}
+
+int board_init(void)
+{
+ struct scsc_reg *scsc = (struct scsc_reg *)SCSC_BASE_ADDR;
+
+ /* address of boot parameters */
+ gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+ /*
+ * Enable external 32K Oscillator
+ *
+ * The internal clock experiences significant drift
+ * so we must use the external oscillator in order
+ * to maintain correct time in the hwclock
+ */
+ setbits_le32(&scsc->sosc_ctr, SCSC_SOSC_CTR_SOSC_EN);
+
+ return 0;
+}
+
+int checkboard(void)
+{
+ puts("Board: vf610twr\n");
+
+ return 0;
+}